DE1024709B - Verfahren zum Haerten von Glycidylpolyaethern mehrwertiger Phenole oder Alkohole oder von polymeren Alkenylglycidylaethern - Google Patents
Verfahren zum Haerten von Glycidylpolyaethern mehrwertiger Phenole oder Alkohole oder von polymeren AlkenylglycidylaethernInfo
- Publication number
- DE1024709B DE1024709B DEN11879A DEN0011879A DE1024709B DE 1024709 B DE1024709 B DE 1024709B DE N11879 A DEN11879 A DE N11879A DE N0011879 A DEN0011879 A DE N0011879A DE 1024709 B DE1024709 B DE 1024709B
- Authority
- DE
- Germany
- Prior art keywords
- hardening
- anhydride
- parts
- glycidyl
- polyether
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 229920000570 polyether Polymers 0.000 title claims description 37
- -1 alkenyl glycidyl ethers Chemical class 0.000 title claims description 19
- 238000000034 method Methods 0.000 title claims description 12
- 125000003055 glycidyl group Chemical group C(C1CO1)* 0.000 title claims description 10
- 150000002989 phenols Chemical class 0.000 title claims description 5
- 150000001298 alcohols Chemical class 0.000 title claims description 4
- 150000008064 anhydrides Chemical class 0.000 claims description 22
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 claims description 7
- 239000003795 chemical substances by application Substances 0.000 claims description 7
- 239000004593 Epoxy Substances 0.000 claims description 6
- 229910000074 antimony hydride Inorganic materials 0.000 claims description 6
- RBFQJDQYXXHULB-UHFFFAOYSA-N arsane Chemical compound [AsH3] RBFQJDQYXXHULB-UHFFFAOYSA-N 0.000 claims description 6
- 229920000647 polyepoxide Polymers 0.000 claims description 6
- OUULRIDHGPHMNQ-UHFFFAOYSA-N stibane Chemical compound [SbH3] OUULRIDHGPHMNQ-UHFFFAOYSA-N 0.000 claims description 6
- 229920000642 polymer Polymers 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 229910000073 phosphorus hydride Inorganic materials 0.000 claims description 4
- 239000004215 Carbon black (E152) Substances 0.000 claims description 3
- 229910000072 bismuth hydride Inorganic materials 0.000 claims description 3
- BPBOBPIKWGUSQG-UHFFFAOYSA-N bismuthane Chemical compound [BiH3] BPBOBPIKWGUSQG-UHFFFAOYSA-N 0.000 claims description 3
- 150000001735 carboxylic acids Chemical class 0.000 claims description 3
- 229930195733 hydrocarbon Natural products 0.000 claims description 3
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 claims description 2
- 150000003003 phosphines Chemical class 0.000 claims 1
- 239000000203 mixture Substances 0.000 description 30
- 239000004721 Polyphenylene oxide Substances 0.000 description 26
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 12
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 9
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 9
- 239000007788 liquid Substances 0.000 description 8
- MUTGBJKUEZFXGO-OLQVQODUSA-N (3as,7ar)-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione Chemical compound C1CCC[C@@H]2C(=O)OC(=O)[C@@H]21 MUTGBJKUEZFXGO-OLQVQODUSA-N 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 6
- GYZLOYUZLJXAJU-UHFFFAOYSA-N diglycidyl ether Chemical compound C1OC1COCC1CO1 GYZLOYUZLJXAJU-UHFFFAOYSA-N 0.000 description 6
- 238000004519 manufacturing process Methods 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 4
- 125000001931 aliphatic group Chemical group 0.000 description 4
- 125000003118 aryl group Chemical group 0.000 description 4
- PEDCQBHIVMGVHV-UHFFFAOYSA-N glycerol group Chemical group OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 150000008065 acid anhydrides Chemical class 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 229920005989 resin Polymers 0.000 description 3
- 239000011347 resin Substances 0.000 description 3
- CXJAFLQWMOMYOW-UHFFFAOYSA-N 3-chlorofuran-2,5-dione Chemical compound ClC1=CC(=O)OC1=O CXJAFLQWMOMYOW-UHFFFAOYSA-N 0.000 description 2
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- DOIRQSBPFJWKBE-UHFFFAOYSA-N dibutyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC DOIRQSBPFJWKBE-UHFFFAOYSA-N 0.000 description 2
- GPAYUJZHTULNBE-UHFFFAOYSA-N diphenylphosphine Chemical compound C=1C=CC=CC=1PC1=CC=CC=C1 GPAYUJZHTULNBE-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 125000003700 epoxy group Chemical group 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- ANSXAPJVJOKRDJ-UHFFFAOYSA-N furo[3,4-f][2]benzofuran-1,3,5,7-tetrone Chemical compound C1=C2C(=O)OC(=O)C2=CC2=C1C(=O)OC2=O ANSXAPJVJOKRDJ-UHFFFAOYSA-N 0.000 description 2
- 235000011187 glycerol Nutrition 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 239000003973 paint Substances 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- BPLUKJNHPBNVQL-UHFFFAOYSA-N triphenylarsine Chemical compound C1=CC=CC=C1[As](C=1C=CC=CC=1)C1=CC=CC=C1 BPLUKJNHPBNVQL-UHFFFAOYSA-N 0.000 description 2
- HVYVMSPIJIWUNA-UHFFFAOYSA-N triphenylstibine Chemical compound C1=CC=CC=C1[Sb](C=1C=CC=CC=1)C1=CC=CC=C1 HVYVMSPIJIWUNA-UHFFFAOYSA-N 0.000 description 2
- ZJFCVUTYZHUNSW-UHFFFAOYSA-N 3-octadecyloxolane-2,5-dione Chemical compound CCCCCCCCCCCCCCCCCCC1CC(=O)OC1=O ZJFCVUTYZHUNSW-UHFFFAOYSA-N 0.000 description 1
- 229930185605 Bisphenol Natural products 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- 230000006978 adaptation Effects 0.000 description 1
- 125000005119 alkyl cycloalkyl group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- 229910052785 arsenic Inorganic materials 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 229910052797 bismuth Inorganic materials 0.000 description 1
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- ZXKWUYWWVSKKQZ-UHFFFAOYSA-N cyclohexyl(diphenyl)phosphane Chemical compound C1CCCCC1P(C=1C=CC=CC=1)C1=CC=CC=C1 ZXKWUYWWVSKKQZ-UHFFFAOYSA-N 0.000 description 1
- ZBCKWHYWPLHBOK-UHFFFAOYSA-N cyclohexylphosphane Chemical compound PC1CCCCC1 ZBCKWHYWPLHBOK-UHFFFAOYSA-N 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- LSXWFXONGKSEMY-UHFFFAOYSA-N di-tert-butyl peroxide Chemical compound CC(C)(C)OOC(C)(C)C LSXWFXONGKSEMY-UHFFFAOYSA-N 0.000 description 1
- 125000006159 dianhydride group Chemical group 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000002657 fibrous material Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 230000017525 heat dissipation Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- CUMGVDYAGVCGAW-UHFFFAOYSA-N hexylstibane Chemical compound CCCCCC[SbH2] CUMGVDYAGVCGAW-UHFFFAOYSA-N 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- RPGWZZNNEUHDAQ-UHFFFAOYSA-N phenylphosphine Chemical compound PC1=CC=CC=C1 RPGWZZNNEUHDAQ-UHFFFAOYSA-N 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 239000004848 polyfunctional curative Substances 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- MTWZZHCSSCNQBI-UHFFFAOYSA-N tributylbismuthane Chemical compound CCCC[Bi](CCCC)CCCC MTWZZHCSSCNQBI-UHFFFAOYSA-N 0.000 description 1
- BXJWDOYMROEHEN-UHFFFAOYSA-N tributylstibane Chemical compound CCCC[Sb](CCCC)CCCC BXJWDOYMROEHEN-UHFFFAOYSA-N 0.000 description 1
- XHMCWWCILGGBHL-UHFFFAOYSA-N tridecylarsane Chemical compound C(CCCCCCCCCCCC)[AsH2] XHMCWWCILGGBHL-UHFFFAOYSA-N 0.000 description 1
- MOSFSEPBWRXKJZ-UHFFFAOYSA-N tridecylphosphane Chemical compound CCCCCCCCCCCCCP MOSFSEPBWRXKJZ-UHFFFAOYSA-N 0.000 description 1
- KHHCPEOLGZWDNP-UHFFFAOYSA-N tridodecylarsane Chemical compound C(CCCCCCCCCCC)[As](CCCCCCCCCCCC)CCCCCCCCCCCC KHHCPEOLGZWDNP-UHFFFAOYSA-N 0.000 description 1
- GRAKJTASWCEOQI-UHFFFAOYSA-N tridodecylphosphane Chemical compound CCCCCCCCCCCCP(CCCCCCCCCCCC)CCCCCCCCCCCC GRAKJTASWCEOQI-UHFFFAOYSA-N 0.000 description 1
- RXJKFRMDXUJTEX-UHFFFAOYSA-N triethylphosphine Chemical compound CCP(CC)CC RXJKFRMDXUJTEX-UHFFFAOYSA-N 0.000 description 1
- RMZAYIKUYWXQPB-UHFFFAOYSA-N trioctylphosphane Chemical compound CCCCCCCCP(CCCCCCCC)CCCCCCCC RMZAYIKUYWXQPB-UHFFFAOYSA-N 0.000 description 1
- ZHXAZZQXWJJBHA-UHFFFAOYSA-N triphenylbismuthane Chemical compound C1=CC=CC=C1[Bi](C=1C=CC=CC=1)C1=CC=CC=C1 ZHXAZZQXWJJBHA-UHFFFAOYSA-N 0.000 description 1
- GIIXTFIYICRGMZ-UHFFFAOYSA-N tris(2,3-dimethylphenyl)phosphane Chemical compound CC1=CC=CC(P(C=2C(=C(C)C=CC=2)C)C=2C(=C(C)C=CC=2)C)=C1C GIIXTFIYICRGMZ-UHFFFAOYSA-N 0.000 description 1
- JDGZTQPBNKMAFX-UHFFFAOYSA-N tris(2-ethylhexyl)stibane Chemical compound C(C)C(C[Sb](CC(CCCC)CC)CC(CCCC)CC)CCCC JDGZTQPBNKMAFX-UHFFFAOYSA-N 0.000 description 1
- MXNPOBJBOPEUBB-UHFFFAOYSA-N tris(3,3,5-trimethylcyclohexyl)phosphane Chemical compound CC1(CC(CC(C1)C)P(C1CC(CC(C1)C)(C)C)C1CC(CC(C1)C)(C)C)C MXNPOBJBOPEUBB-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G59/00—Polycondensates containing more than one epoxy group per molecule; Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups
- C08G59/18—Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups ; e.g. general methods of curing
- C08G59/68—Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups ; e.g. general methods of curing characterised by the catalysts used
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G59/00—Polycondensates containing more than one epoxy group per molecule; Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups
- C08G59/18—Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups ; e.g. general methods of curing
- C08G59/68—Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups ; e.g. general methods of curing characterised by the catalysts used
- C08G59/688—Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups ; e.g. general methods of curing characterised by the catalysts used containing phosphorus
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Epoxy Resins (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US490420A US2768153A (en) | 1955-02-24 | 1955-02-24 | Process for curing polyepoxides and resulting products |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1024709B true DE1024709B (de) | 1958-02-20 |
Family
ID=23947960
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEN11879A Pending DE1024709B (de) | 1955-02-24 | 1956-02-22 | Verfahren zum Haerten von Glycidylpolyaethern mehrwertiger Phenole oder Alkohole oder von polymeren Alkenylglycidylaethern |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US2768153A (enExample) |
| CH (1) | CH344845A (enExample) |
| DE (1) | DE1024709B (enExample) |
| FR (1) | FR1146205A (enExample) |
| GB (1) | GB781416A (enExample) |
| NL (2) | NL204817A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3328319A (en) * | 1963-12-21 | 1967-06-27 | Henkel & Cie Gmbh | Process for the hardening of epoxide resins |
Families Citing this family (73)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3127357A (en) * | 1964-03-31 | Novel phospho nyl polymers | ||
| BE523503A (enExample) * | 1952-11-03 | |||
| NL190358A (enExample) * | 1953-08-28 | |||
| US2934520A (en) * | 1954-10-04 | 1960-04-26 | Aries Lab Inc | Epoxy resin compositions |
| NL109055C (enExample) * | 1955-06-28 | |||
| US3023178A (en) * | 1955-06-30 | 1962-02-27 | Johnson & Son Inc S C | Epoxide conversion of unsaturated acids |
| BE552679A (enExample) * | 1955-11-17 | |||
| US2935492A (en) * | 1956-04-30 | 1960-05-03 | Shell Oil Co | Process for curing material having internal epoxy groups and resulting products |
| US2890194A (en) * | 1956-05-24 | 1959-06-09 | Union Carbide Corp | Compositions of epoxides and polycarboxylic acid compounds |
| US2890210A (en) * | 1956-05-24 | 1959-06-09 | Union Carbide Corp | Compositions comprising epoxides and acid anhydrides |
| BE557991A (enExample) * | 1956-06-01 | |||
| US2933471A (en) * | 1956-06-04 | 1960-04-19 | Johnson & Son Inc S C | Epoxide acids |
| US2934506A (en) * | 1956-06-11 | 1960-04-26 | Devoe & Raynolds Co | Modified epoxide resins |
| US2978463A (en) * | 1956-08-27 | 1961-04-04 | Swift & Co | Complex epoxy fatty esters |
| US2967843A (en) * | 1956-11-19 | 1961-01-10 | Furane Plastics | Epoxy resin composition having high heat stability |
| US3006936A (en) * | 1956-11-30 | 1961-10-31 | Swift & Co | Polyesters from epoxy-containing oleaginous materials and process of making same |
| DE1069870B (de) * | 1957-05-16 | 1959-11-26 | Ciba Aktiengesellschaft, Basel (Schweiz) | Verfahren zum Härten von Epoxyharzen |
| BE569095A (enExample) * | 1957-07-09 | |||
| US2934508A (en) * | 1957-07-31 | 1960-04-26 | Union Carbide Corp | Polymerizable compositions and resins made therefrom |
| US2962469A (en) * | 1957-07-31 | 1960-11-29 | Union Carbide Corp | Polymerizable compositions containing dicyclopentadiene dioxide and plycarboxylic acid and resins prepared therefrom |
| US3025263A (en) * | 1957-07-31 | 1962-03-13 | Jr Henry L Lee | Epoxy carboxylic acid dianhydride compositions |
| US2918444A (en) * | 1957-08-08 | 1959-12-22 | Union Carbide Corp | Polyepoxide compositions |
| US2971946A (en) * | 1957-08-22 | 1961-02-14 | Firestone Tire & Rubber Co | Rubbery copolymers containing minor amounts of a monomethacrylate ester of an alkylene glycol |
| US3038886A (en) * | 1957-08-22 | 1962-06-12 | Firestone Tire & Rubber Co | Curing rubbery acrylate polymers containing ethylene glycol monoacrylate or monomethacrylate |
| US3028370A (en) * | 1957-09-09 | 1962-04-03 | Phillips Petroleum Co | Thermosetting resins |
| US2938014A (en) * | 1957-10-04 | 1960-05-24 | Pfizer & Co C | Resin compositions |
| US3102043A (en) * | 1958-01-30 | 1963-08-27 | Fluidized bed coating method | |
| FR1209921A (fr) * | 1958-02-28 | 1960-03-04 | Inst Textile De France | Procédé d'apprêt du verre textile destiné à la fabrication de matériaux plastiques armés |
| US3016580A (en) * | 1958-03-24 | 1962-01-16 | Eaton Mfg Co | Methods for forming rigid composite structures |
| US2995688A (en) * | 1958-04-10 | 1961-08-08 | Gen Electric | Electrical device and dielectric material therefor |
| US2992196A (en) * | 1958-04-30 | 1961-07-11 | Hooker Chemical Corp | Polyepoxide-dicarboxylic anhydride compositions |
| US2951778A (en) * | 1958-06-05 | 1960-09-06 | Grace W R & Co | High temperature adhesive containing polyepoxide resin mixture |
| US3015577A (en) * | 1958-08-04 | 1962-01-02 | Standard Insulation Company In | Plastic impregnated paper and method and apparatus for making same |
| US3098051A (en) * | 1958-08-13 | 1963-07-16 | Reichhold Chemicals Inc | Adduct of an anhydride of an aromatic polybasic acid and a fatty acid ester |
| US2969334A (en) * | 1958-09-03 | 1961-01-24 | Fmc Corp | Composition comprising dichloromaleic anhydride and an epoxy resin and method of using same |
| US2993920A (en) * | 1958-09-23 | 1961-07-25 | Archer Daniels Midland Co | Resins and method of making the same |
| US3043813A (en) * | 1958-10-03 | 1962-07-10 | Union Carbide Corp | Polymer of alkenyl epoxycyclopentyl ethers |
| BE588068A (enExample) * | 1959-02-26 | |||
| BE592221A (enExample) * | 1959-06-24 | |||
| US3073793A (en) * | 1959-06-30 | 1963-01-15 | Fmc Corp | Thermoset epoxy resin plasticized with a glycol ether-ester |
| US3207718A (en) * | 1961-03-23 | 1965-09-21 | Dow Chemical Co | Epoxy modified vinyl copolymers of alpha, beta-unsaturated dicarboxylic acid partialesters |
| US3428612A (en) * | 1960-10-05 | 1969-02-18 | Union Carbide Corp | Diepoxide compositions |
| US3272843A (en) * | 1961-02-01 | 1966-09-13 | Allied Chem | Phenylene-bis |
| US3334057A (en) * | 1961-04-17 | 1967-08-01 | Continental Can Co | Adhesive compositions comprising carboxyl polymers and polyepoxides |
| US3275599A (en) * | 1961-06-28 | 1966-09-27 | American Cyanamid Co | Resinous composition and process for preparing the same |
| US3265646A (en) * | 1961-07-18 | 1966-08-09 | Tenneco Chem | Resinous compositions comprising an epoxidized ester of a neopentyl polyhydric alcohol and method of producing same |
| GB977341A (en) * | 1961-11-29 | 1964-12-09 | Ciba Ltd | Improvements relating to epoxy resins |
| US3236863A (en) * | 1962-01-11 | 1966-02-22 | Union Carbide Corp | Organophosphorus compounds and resins employing same |
| BE632074A (enExample) * | 1962-05-11 | |||
| NL130162C (enExample) * | 1962-08-06 | |||
| US3294749A (en) * | 1963-05-21 | 1966-12-27 | Allis Chalmers Mfg Co | Latent catalysts for curing epoxy resins |
| US3317465A (en) * | 1963-06-26 | 1967-05-02 | Robertson Co H H | Combination catalyst-inhibitor for betahydroxy carboxylic esters |
| US3433753A (en) * | 1963-08-01 | 1969-03-18 | Ici Ltd | Paint composition including a dispersant having a solvatable chain-like component |
| NL299937A (enExample) * | 1963-10-30 | |||
| US3489695A (en) * | 1964-06-17 | 1970-01-13 | Air Prod & Chem | Substituted imidazoles for curing epoxy resins |
| US3412046A (en) * | 1965-07-01 | 1968-11-19 | Dexter Corp | Catalyzed polyepoxide-anhydride resin systems |
| NL137295C (enExample) * | 1965-11-03 | |||
| NL128836C (enExample) * | 1966-02-22 | |||
| US3444111A (en) * | 1967-04-12 | 1969-05-13 | Dow Chemical Co | Thermoset resins from an epoxy alcohol,a polyepoxide and cyclic anhydrides |
| US3852236A (en) * | 1970-12-21 | 1974-12-03 | Gulf Research Development Co | Homogeneous thermosettable composition of a polyanhydride and a polyepoxide |
| US3868613A (en) * | 1971-10-14 | 1975-02-25 | Westinghouse Electric Corp | Solventless epoxy resin composition and an electrical member impregnated therewith |
| US3977996A (en) * | 1972-02-18 | 1976-08-31 | Aerojet-General Corporation | Catalysts for the oxirane-anhydride reaction |
| US4273914A (en) * | 1980-03-06 | 1981-06-16 | Westinghouse Electric Corp. | Pre-reacted carboxylic acid anhydride complexes as low temperature curing agents for epoxy resins |
| JPS5933125B2 (ja) * | 1980-03-17 | 1984-08-14 | 信越化学工業株式会社 | 半導体装置封止用エポキシ樹脂組成物 |
| US4572853A (en) * | 1980-06-05 | 1986-02-25 | Tokyo Shibaura Denki Kabushiki Kaisha | Resin encapsulation type semiconductor device |
| DE3151540A1 (de) * | 1980-12-29 | 1982-08-19 | Ciba-Geigy GmbH, 7867 Wehr | "verwendung von transparenten anhydridhaertbaren epoxidgiessharzen" |
| US4426243A (en) | 1981-12-01 | 1984-01-17 | Illinois Tool Works Inc. | Room-temperature-curable, quick-setting acrylic/epoxy adhesives and methods of bonding |
| US4401775A (en) * | 1982-06-24 | 1983-08-30 | Rca Corporation | Epoxy encapsulating formulation |
| US4638038A (en) * | 1985-04-22 | 1987-01-20 | Union Carbide Corporation | Carboxylic acid-grafted phenoxy resins |
| US4755582A (en) * | 1986-08-21 | 1988-07-05 | Ppg Industries, Inc. | Thermosetting high solids coating composition of hydroxy-functional epoxies and anhydrides |
| US6911109B2 (en) * | 2000-12-11 | 2005-06-28 | Henkel Corporation | Two-part, room temperature curable epoxy resin/ (meth)acrylate compositions and process for using same to bond substrates |
| EP1426394A4 (en) | 2001-09-14 | 2010-11-03 | Sumitomo Chemical Co | Resin composition for optical-semiconductor encapsulation |
| EP2854260A1 (de) * | 2013-09-27 | 2015-04-01 | Siemens Aktiengesellschaft | Nutverschlussmasse, Nutverschluss und Verfahren zum Herstellen eines Nutverschlusses |
Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2585115A (en) * | 1945-09-18 | 1952-02-12 | Devoe & Raynolds Co | Amine-epoxide compositions |
| AT171730B (de) * | 1949-08-12 | 1952-06-25 | Ciba Geigy | Verfahren zur Herstellung elastischer Kunststoffe |
| DE910335C (de) * | 1951-05-31 | 1954-04-29 | Albert Ag Chem Werke | Verfahren zur Haertung von AEthoxylinharzen |
| DE910727C (de) * | 1951-10-25 | 1954-05-06 | Albert Ag Chem Werke | Verfahren zur Haertung von AEthoxylinharzen |
| DE931729C (de) * | 1952-03-27 | 1955-08-16 | Albert Ag Chem Werke | Verfahren zur Haertung von oelfreien AEthoxylinharzen |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL52346C (enExample) * | 1938-08-23 |
-
0
- NL NL90245D patent/NL90245C/xx active
- NL NL204817D patent/NL204817A/xx unknown
-
1955
- 1955-02-24 US US490420A patent/US2768153A/en not_active Expired - Lifetime
-
1956
- 1956-02-22 DE DEN11879A patent/DE1024709B/de active Pending
- 1956-02-22 CH CH344845D patent/CH344845A/de unknown
- 1956-02-22 FR FR1146205D patent/FR1146205A/fr not_active Expired
- 1956-02-22 GB GB5492/56A patent/GB781416A/en not_active Expired
Patent Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2585115A (en) * | 1945-09-18 | 1952-02-12 | Devoe & Raynolds Co | Amine-epoxide compositions |
| AT171730B (de) * | 1949-08-12 | 1952-06-25 | Ciba Geigy | Verfahren zur Herstellung elastischer Kunststoffe |
| DE910335C (de) * | 1951-05-31 | 1954-04-29 | Albert Ag Chem Werke | Verfahren zur Haertung von AEthoxylinharzen |
| DE910727C (de) * | 1951-10-25 | 1954-05-06 | Albert Ag Chem Werke | Verfahren zur Haertung von AEthoxylinharzen |
| DE931729C (de) * | 1952-03-27 | 1955-08-16 | Albert Ag Chem Werke | Verfahren zur Haertung von oelfreien AEthoxylinharzen |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3328319A (en) * | 1963-12-21 | 1967-06-27 | Henkel & Cie Gmbh | Process for the hardening of epoxide resins |
| DE1300695B (de) * | 1963-12-21 | 1969-08-07 | Henkel & Cie Gmbh | Verfahren zur Herstellung von Formkoerpern, UEberzuegen und Verklebungen auf der Basis von Epoxydpolyaddukten |
Also Published As
| Publication number | Publication date |
|---|---|
| FR1146205A (fr) | 1957-11-07 |
| US2768153A (en) | 1956-10-23 |
| GB781416A (en) | 1957-08-21 |
| NL204817A (enExample) | |
| NL90245C (enExample) | |
| CH344845A (de) | 1960-02-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1024709B (de) | Verfahren zum Haerten von Glycidylpolyaethern mehrwertiger Phenole oder Alkohole oder von polymeren Alkenylglycidylaethern | |
| DE1096600B (de) | Verfahren zur Herstellung ausgehaerteter Kunstharze durch Umsetzung von Epoxydgruppen aufweisenden Kunstharzen | |
| DE1520862B2 (de) | Verfahren zur herstellung von formkoerpern | |
| DE1046876B (de) | Verfahren zum Haerten von Verbindungen mit mehreren mittelstaendigen Epoxydgruppen in der Molekuelkette | |
| DE1009808B (de) | Verfahren zur Herstellung von Lack- und Giessharzen aus Polyglycidylaethern | |
| DE1041687B (de) | In der Waerme, in Gegenwart eines Haertungsmittels haertbare UEberzugsmassen und Giessharze auf Grundlage von Glycidylpolyaethern | |
| DE1096037B (de) | Verfahren zur Herstellung von Formkoerpern und UEberzuegen aus Diepoxydverbindungen | |
| DE1914004A1 (de) | Verfahren zum Haerten eines Polyepoxyds | |
| DE1120688B (de) | Verfahren zum Haerten von Epoxyharzen | |
| CH501690A (de) | Verfahren zur Herstellung eines Epoxydgemischpulvers | |
| DE1495021A1 (de) | Haertbares,biegsames Polyesterharz | |
| DE1142698B (de) | Verfahren zum Herstellen von Formteilen aus Formmassen, die epoxydierte Polybutadiene und reaktions-faehige Verduennungsmittel enthalten | |
| DE1161017B (de) | Herstellung von Formteilen aus Formmassen, die polymere Verbindungen mit Epoxydgruppen enthalten | |
| DE1192827B (de) | Verfahren zur Herstellung von Formteilen auf der Basis von Diepoxyden | |
| DE2229907A1 (de) | Fluessige haertungsmittel fuer epoxid harze | |
| DE1242869B (de) | Verfahren zur Herstellung von Formkoerpern auf der Basis von Polyaddukten | |
| DE1520780A1 (de) | Verfahren zur Herstellung von flammfesten Harzen auf Epoxybasis | |
| EP0086744A1 (de) | Heisshärtbare Massen aus einem Epoxidharz, einem latenten Härter und einem organischen Oxydationsmittel | |
| DE1130598B (de) | Verfahren zur Herstellung von UEberzugsmitteln | |
| DE69605511T2 (de) | Durch Fasern verstärkter Verbundwerkstoff und durch Polymerisation von Acrylmonomeren erthaltene Matrize und seine Herstellung | |
| DE1520862C (de) | Verfahren zur Herstellung von Formkörpern | |
| DE2446697C3 (enExample) | ||
| DE1049092B (de) | Verfahren zur Beschleunigung der Haertung von harzartigen Polyepoxydverbindungen | |
| AT261222B (de) | Warmhärtbare Kunstharzmasse | |
| DE1091746B (de) | Verfahren zum Haerten von Polyepoxyden |