DE10229519A1 - Reaktive Polyurethane mit einem geringen Gehalt an monomeren Diisocyanaten - Google Patents
Reaktive Polyurethane mit einem geringen Gehalt an monomeren DiisocyanatenInfo
- Publication number
- DE10229519A1 DE10229519A1 DE10229519A DE10229519A DE10229519A1 DE 10229519 A1 DE10229519 A1 DE 10229519A1 DE 10229519 A DE10229519 A DE 10229519A DE 10229519 A DE10229519 A DE 10229519A DE 10229519 A1 DE10229519 A1 DE 10229519A1
- Authority
- DE
- Germany
- Prior art keywords
- reactive
- diisocyanate
- mol
- mdi
- acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000004814 polyurethane Substances 0.000 title claims abstract description 88
- 229920002635 polyurethane Polymers 0.000 title claims abstract description 84
- 125000005442 diisocyanate group Chemical group 0.000 title claims abstract description 72
- 150000002009 diols Chemical class 0.000 title claims abstract description 30
- 238000004519 manufacturing process Methods 0.000 title claims description 17
- 239000000178 monomer Substances 0.000 title abstract description 22
- 239000013466 adhesive and sealant Substances 0.000 title description 2
- 239000003054 catalyst Substances 0.000 claims abstract description 20
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 18
- 239000000010 aprotic solvent Substances 0.000 claims abstract description 10
- 239000000203 mixture Substances 0.000 claims description 47
- -1 B. tin-II-acetate Chemical class 0.000 claims description 31
- 238000006243 chemical reaction Methods 0.000 claims description 28
- 150000001875 compounds Chemical class 0.000 claims description 23
- 239000000853 adhesive Substances 0.000 claims description 22
- 230000001070 adhesive effect Effects 0.000 claims description 22
- UPMLOUAZCHDJJD-UHFFFAOYSA-N 4,4'-Diphenylmethane Diisocyanate Chemical compound C1=CC(N=C=O)=CC=C1CC1=CC=C(N=C=O)C=C1 UPMLOUAZCHDJJD-UHFFFAOYSA-N 0.000 claims description 18
- 239000000565 sealant Substances 0.000 claims description 16
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 claims description 15
- 239000006260 foam Substances 0.000 claims description 14
- NIMLQBUJDJZYEJ-UHFFFAOYSA-N isophorone diisocyanate Chemical compound CC1(C)CC(N=C=O)CC(C)(CN=C=O)C1 NIMLQBUJDJZYEJ-UHFFFAOYSA-N 0.000 claims description 10
- 239000004831 Hot glue Substances 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 9
- 239000002904 solvent Substances 0.000 claims description 9
- 239000005058 Isophorone diisocyanate Substances 0.000 claims description 7
- DVKJHBMWWAPEIU-UHFFFAOYSA-N toluene 2,4-diisocyanate Chemical compound CC1=CC=C(N=C=O)C=C1N=C=O DVKJHBMWWAPEIU-UHFFFAOYSA-N 0.000 claims description 7
- SBJCUZQNHOLYMD-UHFFFAOYSA-N 1,5-Naphthalene diisocyanate Chemical compound C1=CC=C2C(N=C=O)=CC=CC2=C1N=C=O SBJCUZQNHOLYMD-UHFFFAOYSA-N 0.000 claims description 6
- 125000003118 aryl group Chemical group 0.000 claims description 6
- 150000001735 carboxylic acids Chemical class 0.000 claims description 6
- 238000004140 cleaning Methods 0.000 claims description 6
- 125000001931 aliphatic group Chemical group 0.000 claims description 5
- 238000005266 casting Methods 0.000 claims description 5
- 230000008569 process Effects 0.000 claims description 5
- 239000011135 tin Substances 0.000 claims description 5
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 4
- 229910052797 bismuth Inorganic materials 0.000 claims description 4
- 239000012939 laminating adhesive Substances 0.000 claims description 4
- 239000011133 lead Substances 0.000 claims description 4
- 150000002902 organometallic compounds Chemical class 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 238000009419 refurbishment Methods 0.000 claims description 4
- LFSYUSUFCBOHGU-UHFFFAOYSA-N 1-isocyanato-2-[(4-isocyanatophenyl)methyl]benzene Chemical compound C1=CC(N=C=O)=CC=C1CC1=CC=CC=C1N=C=O LFSYUSUFCBOHGU-UHFFFAOYSA-N 0.000 claims description 3
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 3
- VXUYXOFXAQZZMF-UHFFFAOYSA-N titanium(IV) isopropoxide Chemical compound CC(C)O[Ti](OC(C)C)(OC(C)C)OC(C)C VXUYXOFXAQZZMF-UHFFFAOYSA-N 0.000 claims description 3
- SIZPGZFVROGOIR-UHFFFAOYSA-N 1,4-diisocyanatonaphthalene Chemical compound C1=CC=C2C(N=C=O)=CC=C(N=C=O)C2=C1 SIZPGZFVROGOIR-UHFFFAOYSA-N 0.000 claims description 2
- ATOUXIOKEJWULN-UHFFFAOYSA-N 1,6-diisocyanato-2,2,4-trimethylhexane Chemical compound O=C=NCCC(C)CC(C)(C)CN=C=O ATOUXIOKEJWULN-UHFFFAOYSA-N 0.000 claims description 2
- QGLRLXLDMZCFBP-UHFFFAOYSA-N 1,6-diisocyanato-2,4,4-trimethylhexane Chemical compound O=C=NCC(C)CC(C)(C)CCN=C=O QGLRLXLDMZCFBP-UHFFFAOYSA-N 0.000 claims description 2
- VZDIRINETBAVAV-UHFFFAOYSA-N 2,4-diisocyanato-1-methylcyclohexane Chemical compound CC1CCC(N=C=O)CC1N=C=O VZDIRINETBAVAV-UHFFFAOYSA-N 0.000 claims description 2
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 2
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 claims description 2
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 claims description 2
- SHZIWNPUGXLXDT-UHFFFAOYSA-N ethyl hexanoate Chemical class CCCCCC(=O)OCC SHZIWNPUGXLXDT-UHFFFAOYSA-N 0.000 claims description 2
- 229910052742 iron Inorganic materials 0.000 claims description 2
- AYLRODJJLADBOB-QMMMGPOBSA-N methyl (2s)-2,6-diisocyanatohexanoate Chemical compound COC(=O)[C@@H](N=C=O)CCCCN=C=O AYLRODJJLADBOB-QMMMGPOBSA-N 0.000 claims description 2
- IUTCEZPPWBHGIX-UHFFFAOYSA-N tin(2+) Chemical class [Sn+2] IUTCEZPPWBHGIX-UHFFFAOYSA-N 0.000 claims description 2
- 239000010936 titanium Substances 0.000 claims description 2
- 229910052719 titanium Inorganic materials 0.000 claims description 2
- 229910052726 zirconium Inorganic materials 0.000 claims description 2
- VGHSXKTVMPXHNG-UHFFFAOYSA-N 1,3-diisocyanatobenzene Chemical compound O=C=NC1=CC=CC(N=C=O)=C1 VGHSXKTVMPXHNG-UHFFFAOYSA-N 0.000 claims 1
- 239000012948 isocyanate Substances 0.000 abstract description 11
- 150000002513 isocyanates Chemical class 0.000 abstract description 10
- 238000012545 processing Methods 0.000 abstract description 8
- 238000000746 purification Methods 0.000 abstract 1
- 229920005862 polyol Polymers 0.000 description 36
- 150000003077 polyols Chemical class 0.000 description 35
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 16
- 150000001412 amines Chemical class 0.000 description 13
- 239000000047 product Substances 0.000 description 12
- 125000004432 carbon atom Chemical group C* 0.000 description 10
- DNIAPMSPPWPWGF-UHFFFAOYSA-N monopropylene glycol Natural products CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 10
- 229910052757 nitrogen Inorganic materials 0.000 description 10
- 239000005056 polyisocyanate Substances 0.000 description 10
- 229920001228 polyisocyanate Polymers 0.000 description 10
- 239000007983 Tris buffer Substances 0.000 description 9
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 9
- 239000004823 Reactive adhesive Substances 0.000 description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 8
- 229920000728 polyester Polymers 0.000 description 8
- 229920000570 polyether Polymers 0.000 description 8
- CWERGRDVMFNCDR-UHFFFAOYSA-N thioglycolic acid Chemical compound OC(=O)CS CWERGRDVMFNCDR-UHFFFAOYSA-N 0.000 description 8
- 230000002378 acidificating effect Effects 0.000 description 7
- 239000007788 liquid Substances 0.000 description 7
- 239000003381 stabilizer Substances 0.000 description 7
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 6
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 6
- 239000004848 polyfunctional curative Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 5
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 5
- HGQSXVKHVMGQRG-UHFFFAOYSA-N dioctyltin Chemical compound CCCCCCCC[Sn]CCCCCCCC HGQSXVKHVMGQRG-UHFFFAOYSA-N 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 229920000642 polymer Polymers 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- JOYRKODLDBILNP-UHFFFAOYSA-N urethane group Chemical group NC(=O)OCC JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 5
- WWZKQHOCKIZLMA-UHFFFAOYSA-N Caprylic acid Natural products CCCCCCCC(O)=O WWZKQHOCKIZLMA-UHFFFAOYSA-N 0.000 description 4
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 4
- GHVNFZFCNZKVNT-UHFFFAOYSA-N Decanoic acid Natural products CCCCCCCCCC(O)=O GHVNFZFCNZKVNT-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 4
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 4
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 4
- 150000001298 alcohols Chemical class 0.000 description 4
- 230000008901 benefit Effects 0.000 description 4
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 4
- 125000000524 functional group Chemical group 0.000 description 4
- 239000012943 hotmelt Substances 0.000 description 4
- POULHZVOKOAJMA-UHFFFAOYSA-N methyl undecanoic acid Natural products CCCCCCCCCCCC(O)=O POULHZVOKOAJMA-UHFFFAOYSA-N 0.000 description 4
- IPCSVZSSVZVIGE-UHFFFAOYSA-N n-hexadecanoic acid Natural products CCCCCCCCCCCCCCCC(O)=O IPCSVZSSVZVIGE-UHFFFAOYSA-N 0.000 description 4
- 229920000058 polyacrylate Polymers 0.000 description 4
- 235000013772 propylene glycol Nutrition 0.000 description 4
- 230000009257 reactivity Effects 0.000 description 4
- 238000007789 sealing Methods 0.000 description 4
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 4
- DGVVWUTYPXICAM-UHFFFAOYSA-N β‐Mercaptoethanol Chemical compound OCCS DGVVWUTYPXICAM-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 229920001730 Moisture cure polyurethane Polymers 0.000 description 3
- 239000004721 Polyphenylene oxide Substances 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- ZJCCRDAZUWHFQH-UHFFFAOYSA-N Trimethylolpropane Chemical compound CCC(CO)(CO)CO ZJCCRDAZUWHFQH-UHFFFAOYSA-N 0.000 description 3
- 230000004913 activation Effects 0.000 description 3
- 125000002947 alkylene group Chemical group 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- AUJDNBNEWGSLMQ-UHFFFAOYSA-N bis(3-methoxy-3-oxopropyl)tin Chemical compound COC(=O)CC[Sn]CCC(=O)OC AUJDNBNEWGSLMQ-UHFFFAOYSA-N 0.000 description 3
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 238000004132 cross linking Methods 0.000 description 3
- 235000014113 dietary fatty acids Nutrition 0.000 description 3
- 239000000539 dimer Substances 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 238000010894 electron beam technology Methods 0.000 description 3
- 239000000194 fatty acid Substances 0.000 description 3
- 229930195729 fatty acid Natural products 0.000 description 3
- 150000004665 fatty acids Chemical class 0.000 description 3
- 239000010408 film Substances 0.000 description 3
- 235000013305 food Nutrition 0.000 description 3
- 235000011187 glycerol Nutrition 0.000 description 3
- XXMIOPMDWAUFGU-UHFFFAOYSA-N hexane-1,6-diol Chemical compound OCCCCCCO XXMIOPMDWAUFGU-UHFFFAOYSA-N 0.000 description 3
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 3
- 230000005012 migration Effects 0.000 description 3
- 238000013508 migration Methods 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 238000004806 packaging method and process Methods 0.000 description 3
- 229920000515 polycarbonate Polymers 0.000 description 3
- 239000004417 polycarbonate Substances 0.000 description 3
- 229920001451 polypropylene glycol Polymers 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 229920005989 resin Polymers 0.000 description 3
- 239000011347 resin Substances 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000010409 thin film Substances 0.000 description 3
- 238000005829 trimerization reaction Methods 0.000 description 3
- OBETXYAYXDNJHR-SSDOTTSWSA-M (2r)-2-ethylhexanoate Chemical compound CCCC[C@@H](CC)C([O-])=O OBETXYAYXDNJHR-SSDOTTSWSA-M 0.000 description 2
- NFDXQGNDWIPXQL-UHFFFAOYSA-N 1-cyclooctyldiazocane Chemical compound C1CCCCCCC1N1NCCCCCC1 NFDXQGNDWIPXQL-UHFFFAOYSA-N 0.000 description 2
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 2
- BTXXTMOWISPQSJ-UHFFFAOYSA-N 4,4,4-trifluorobutan-2-one Chemical compound CC(=O)CC(F)(F)F BTXXTMOWISPQSJ-UHFFFAOYSA-N 0.000 description 2
- ZMSQJSMSLXVTKN-UHFFFAOYSA-N 4-[2-(2-morpholin-4-ylethoxy)ethyl]morpholine Chemical compound C1COCCN1CCOCCN1CCOCC1 ZMSQJSMSLXVTKN-UHFFFAOYSA-N 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 2
- 235000021314 Palmitic acid Nutrition 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 2
- 235000021355 Stearic acid Nutrition 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 239000001361 adipic acid Substances 0.000 description 2
- 235000011037 adipic acid Nutrition 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- OBETXYAYXDNJHR-UHFFFAOYSA-N alpha-ethylcaproic acid Natural products CCCCC(CC)C(O)=O OBETXYAYXDNJHR-UHFFFAOYSA-N 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- MMCPOSDMTGQNKG-UHFFFAOYSA-N anilinium chloride Chemical compound Cl.NC1=CC=CC=C1 MMCPOSDMTGQNKG-UHFFFAOYSA-N 0.000 description 2
- 239000003963 antioxidant agent Substances 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- PXKLMJQFEQBVLD-UHFFFAOYSA-N bisphenol F Chemical compound C1=CC(O)=CC=C1CC1=CC=C(O)C=C1 PXKLMJQFEQBVLD-UHFFFAOYSA-N 0.000 description 2
- 229920001400 block copolymer Polymers 0.000 description 2
- 239000002981 blocking agent Substances 0.000 description 2
- 230000000903 blocking effect Effects 0.000 description 2
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L calcium carbonate Substances [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 239000001569 carbon dioxide Substances 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 150000007942 carboxylates Chemical class 0.000 description 2
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical compound OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- 230000018109 developmental process Effects 0.000 description 2
- 239000012973 diazabicyclooctane Substances 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- SZXQTJUDPRGNJN-UHFFFAOYSA-N dipropylene glycol Chemical compound OCCCOCCCO SZXQTJUDPRGNJN-UHFFFAOYSA-N 0.000 description 2
- GHLKSLMMWAKNBM-UHFFFAOYSA-N dodecane-1,12-diol Chemical compound OCCCCCCCCCCCCO GHLKSLMMWAKNBM-UHFFFAOYSA-N 0.000 description 2
- TVIDDXQYHWJXFK-UHFFFAOYSA-N dodecanedioic acid Chemical compound OC(=O)CCCCCCCCCCC(O)=O TVIDDXQYHWJXFK-UHFFFAOYSA-N 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 238000005227 gel permeation chromatography Methods 0.000 description 2
- 150000002334 glycols Chemical class 0.000 description 2
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 2
- 238000004128 high performance liquid chromatography Methods 0.000 description 2
- 229920001519 homopolymer Polymers 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 2
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical compound CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 2
- 238000002372 labelling Methods 0.000 description 2
- 239000002651 laminated plastic film Substances 0.000 description 2
- IVSZLXZYQVIEFR-UHFFFAOYSA-N m-xylene Chemical group CC1=CC=CC(C)=C1 IVSZLXZYQVIEFR-UHFFFAOYSA-N 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 150000002780 morpholines Chemical class 0.000 description 2
- AOHAPDDBNAPPIN-UHFFFAOYSA-N myristicinic acid Natural products COC1=CC(C(O)=O)=CC2=C1OCO2 AOHAPDDBNAPPIN-UHFFFAOYSA-N 0.000 description 2
- WQEPLUUGTLDZJY-UHFFFAOYSA-N n-Pentadecanoic acid Natural products CCCCCCCCCCCCCCC(O)=O WQEPLUUGTLDZJY-UHFFFAOYSA-N 0.000 description 2
- BDJRBEYXGGNYIS-UHFFFAOYSA-N nonanedioic acid Chemical compound OC(=O)CCCCCCCC(O)=O BDJRBEYXGGNYIS-UHFFFAOYSA-N 0.000 description 2
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 2
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 2
- ZMHZSHHZIKJFIR-UHFFFAOYSA-N octyltin Chemical compound CCCCCCCC[Sn] ZMHZSHHZIKJFIR-UHFFFAOYSA-N 0.000 description 2
- 235000011837 pasties Nutrition 0.000 description 2
- 229920001568 phenolic resin Polymers 0.000 description 2
- 239000005011 phenolic resin Substances 0.000 description 2
- 239000000049 pigment Substances 0.000 description 2
- WLJVNTCWHIRURA-UHFFFAOYSA-N pimelic acid Chemical compound OC(=O)CCCCCC(O)=O WLJVNTCWHIRURA-UHFFFAOYSA-N 0.000 description 2
- 239000004014 plasticizer Substances 0.000 description 2
- 229920002857 polybutadiene Polymers 0.000 description 2
- 229920005906 polyester polyol Polymers 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- 229920006324 polyoxymethylene Polymers 0.000 description 2
- 238000004382 potting Methods 0.000 description 2
- 150000003142 primary aromatic amines Chemical class 0.000 description 2
- 230000004224 protection Effects 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical compound OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 2
- 239000008117 stearic acid Substances 0.000 description 2
- TYFQFVWCELRYAO-UHFFFAOYSA-N suberic acid Chemical compound OC(=O)CCCCCCC(O)=O TYFQFVWCELRYAO-UHFFFAOYSA-N 0.000 description 2
- 150000005846 sugar alcohols Polymers 0.000 description 2
- 150000003505 terpenes Chemical class 0.000 description 2
- 235000007586 terpenes Nutrition 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- 150000003568 thioethers Chemical class 0.000 description 2
- 150000003626 triacylglycerols Chemical class 0.000 description 2
- ZIBGPFATKBEMQZ-UHFFFAOYSA-N triethylene glycol Chemical compound OCCOCCOCCO ZIBGPFATKBEMQZ-UHFFFAOYSA-N 0.000 description 2
- 150000004072 triols Chemical class 0.000 description 2
- LWBHHRRTOZQPDM-UHFFFAOYSA-N undecanedioic acid Chemical compound OC(=O)CCCCCCCCCC(O)=O LWBHHRRTOZQPDM-UHFFFAOYSA-N 0.000 description 2
- 150000003672 ureas Chemical class 0.000 description 2
- DNIAPMSPPWPWGF-VKHMYHEASA-N (+)-propylene glycol Chemical compound C[C@H](O)CO DNIAPMSPPWPWGF-VKHMYHEASA-N 0.000 description 1
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 1
- WHIVNJATOVLWBW-PLNGDYQASA-N (nz)-n-butan-2-ylidenehydroxylamine Chemical compound CC\C(C)=N/O WHIVNJATOVLWBW-PLNGDYQASA-N 0.000 description 1
- KYVBNYUBXIEUFW-UHFFFAOYSA-N 1,1,3,3-tetramethylguanidine Chemical compound CN(C)C(=N)N(C)C KYVBNYUBXIEUFW-UHFFFAOYSA-N 0.000 description 1
- KLCNDZKZXMQNBO-UHFFFAOYSA-N 1,2-bis[(4-isocyanatophenyl)methyl]benzene Chemical compound C1=CC(N=C=O)=CC=C1CC1=CC=CC=C1CC1=CC=C(N=C=O)C=C1 KLCNDZKZXMQNBO-UHFFFAOYSA-N 0.000 description 1
- 125000001989 1,3-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([H])C([*:2])=C1[H] 0.000 description 1
- YPFDHNVEDLHUCE-UHFFFAOYSA-N 1,3-propanediol Substances OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 1
- RXYPXQSKLGGKOL-UHFFFAOYSA-N 1,4-dimethylpiperazine Chemical compound CN1CCN(C)CC1 RXYPXQSKLGGKOL-UHFFFAOYSA-N 0.000 description 1
- NPXAFGGRWMOHLM-UHFFFAOYSA-N 1-(3-morpholin-4-ylpropyl)pyrrolidin-2-one Chemical compound O=C1CCCN1CCCN1CCOCC1 NPXAFGGRWMOHLM-UHFFFAOYSA-N 0.000 description 1
- BFIAIMMAHAIVFT-UHFFFAOYSA-N 1-[bis(2-hydroxybutyl)amino]butan-2-ol Chemical compound CCC(O)CN(CC(O)CC)CC(O)CC BFIAIMMAHAIVFT-UHFFFAOYSA-N 0.000 description 1
- LHYVEOGDJNQNEW-UHFFFAOYSA-N 1-amino-2-methylbutan-2-ol Chemical compound CCC(C)(O)CN LHYVEOGDJNQNEW-UHFFFAOYSA-N 0.000 description 1
- MONBXKAJLMCVCS-UHFFFAOYSA-N 1-isocyanato-2,3-bis[(2-isocyanatophenyl)methyl]benzene Chemical compound O=C=NC1=CC=CC=C1CC1=CC=CC(N=C=O)=C1CC1=CC=CC=C1N=C=O MONBXKAJLMCVCS-UHFFFAOYSA-N 0.000 description 1
- MHKMRJFLSKEYCI-UHFFFAOYSA-N 1-isocyanato-4-[(2-isocyanatophenyl)methyl]-2-[(3-isocyanatophenyl)methyl]benzene Chemical compound O=C=NC1=CC=CC(CC=2C(=CC=C(CC=3C(=CC=CC=3)N=C=O)C=2)N=C=O)=C1 MHKMRJFLSKEYCI-UHFFFAOYSA-N 0.000 description 1
- RTBFRGCFXZNCOE-UHFFFAOYSA-N 1-methylsulfonylpiperidin-4-one Chemical compound CS(=O)(=O)N1CCC(=O)CC1 RTBFRGCFXZNCOE-UHFFFAOYSA-N 0.000 description 1
- SPWDQSXYMZXSIV-UHFFFAOYSA-N 11,12-dimethyldocosane Chemical group CCCCCCCCCCC(C)C(C)CCCCCCCCCC SPWDQSXYMZXSIV-UHFFFAOYSA-N 0.000 description 1
- QFGCFKJIPBRJGM-UHFFFAOYSA-N 12-[(2-methylpropan-2-yl)oxy]-12-oxododecanoic acid Chemical compound CC(C)(C)OC(=O)CCCCCCCCCCC(O)=O QFGCFKJIPBRJGM-UHFFFAOYSA-N 0.000 description 1
- RKZRLJNRLHTFPT-UHFFFAOYSA-N 2-(4-isocyanatophenyl)-1,3-dimethylbenzene Chemical group CC1=CC=CC(C)=C1C1=CC=C(N=C=O)C=C1 RKZRLJNRLHTFPT-UHFFFAOYSA-N 0.000 description 1
- LCZVSXRMYJUNFX-UHFFFAOYSA-N 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol Chemical compound CC(O)COC(C)COC(C)CO LCZVSXRMYJUNFX-UHFFFAOYSA-N 0.000 description 1
- XHCXVEOOEJMFIP-UHFFFAOYSA-N 2-[2-(3-azabicyclo[2.2.1]heptan-3-yl)ethoxy]ethanol Chemical compound C1CC2N(CCOCCO)CC1C2 XHCXVEOOEJMFIP-UHFFFAOYSA-N 0.000 description 1
- GTEXIOINCJRBIO-UHFFFAOYSA-N 2-[2-(dimethylamino)ethoxy]-n,n-dimethylethanamine Chemical compound CN(C)CCOCCN(C)C GTEXIOINCJRBIO-UHFFFAOYSA-N 0.000 description 1
- YSAANLSYLSUVHB-UHFFFAOYSA-N 2-[2-(dimethylamino)ethoxy]ethanol Chemical compound CN(C)CCOCCO YSAANLSYLSUVHB-UHFFFAOYSA-N 0.000 description 1
- HHPDFYDITNAMAM-UHFFFAOYSA-N 2-[cyclohexyl(2-hydroxyethyl)amino]ethanol Chemical compound OCCN(CCO)C1CCCCC1 HHPDFYDITNAMAM-UHFFFAOYSA-N 0.000 description 1
- OJPDDQSCZGTACX-UHFFFAOYSA-N 2-[n-(2-hydroxyethyl)anilino]ethanol Chemical compound OCCN(CCO)C1=CC=CC=C1 OJPDDQSCZGTACX-UHFFFAOYSA-N 0.000 description 1
- ONIKNECPXCLUHT-UHFFFAOYSA-N 2-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1Cl ONIKNECPXCLUHT-UHFFFAOYSA-N 0.000 description 1
- BFSVOASYOCHEOV-UHFFFAOYSA-N 2-diethylaminoethanol Chemical compound CCN(CC)CCO BFSVOASYOCHEOV-UHFFFAOYSA-N 0.000 description 1
- 229940095095 2-hydroxyethyl acrylate Drugs 0.000 description 1
- OMIGHNLMNHATMP-UHFFFAOYSA-N 2-hydroxyethyl prop-2-enoate Chemical compound OCCOC(=O)C=C OMIGHNLMNHATMP-UHFFFAOYSA-N 0.000 description 1
- VHSHLMUCYSAUQU-UHFFFAOYSA-N 2-hydroxypropyl methacrylate Chemical compound CC(O)COC(=O)C(C)=C VHSHLMUCYSAUQU-UHFFFAOYSA-N 0.000 description 1
- GWZMWHWAWHPNHN-UHFFFAOYSA-N 2-hydroxypropyl prop-2-enoate Chemical compound CC(O)COC(=O)C=C GWZMWHWAWHPNHN-UHFFFAOYSA-N 0.000 description 1
- BNOSAGKHYAMZGF-UHFFFAOYSA-N 2-isocyanato-1,3-bis[(2-isocyanatophenyl)methyl]benzene Chemical compound O=C=NC1=CC=CC=C1CC1=CC=CC(CC=2C(=CC=CC=2)N=C=O)=C1N=C=O BNOSAGKHYAMZGF-UHFFFAOYSA-N 0.000 description 1
- KIBAANMHKKFBLT-UHFFFAOYSA-N 2-isocyanato-1,4-bis[(4-isocyanatophenyl)methyl]benzene Chemical compound C1=CC(N=C=O)=CC=C1CC(C=C1N=C=O)=CC=C1CC1=CC=C(N=C=O)C=C1 KIBAANMHKKFBLT-UHFFFAOYSA-N 0.000 description 1
- HEBTZZBBPUFAFE-UHFFFAOYSA-N 2-methyl-n-(oxomethylidene)benzenesulfonamide Chemical compound CC1=CC=CC=C1S(=O)(=O)N=C=O HEBTZZBBPUFAFE-UHFFFAOYSA-N 0.000 description 1
- QOFLTGDAZLWRMJ-UHFFFAOYSA-N 2-methylpropane-1,1-diol Chemical compound CC(C)C(O)O QOFLTGDAZLWRMJ-UHFFFAOYSA-N 0.000 description 1
- WLJVXDMOQOGPHL-PPJXEINESA-N 2-phenylacetic acid Chemical compound O[14C](=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-PPJXEINESA-N 0.000 description 1
- DUHQIGLHYXLKAE-UHFFFAOYSA-N 3,3-dimethylglutaric acid Chemical compound OC(=O)CC(C)(C)CC(O)=O DUHQIGLHYXLKAE-UHFFFAOYSA-N 0.000 description 1
- SDXAWLJRERMRKF-UHFFFAOYSA-N 3,5-dimethyl-1h-pyrazole Chemical compound CC=1C=C(C)NN=1 SDXAWLJRERMRKF-UHFFFAOYSA-N 0.000 description 1
- WADSJYLPJPTMLN-UHFFFAOYSA-N 3-(cycloundecen-1-yl)-1,2-diazacycloundec-2-ene Chemical compound C1CCCCCCCCC=C1C1=NNCCCCCCCC1 WADSJYLPJPTMLN-UHFFFAOYSA-N 0.000 description 1
- QEOGKTCJGDHZDW-UHFFFAOYSA-N 3-[2-(dimethylamino)ethoxy]-n,n-dimethylpropan-1-amine Chemical compound CN(C)CCCOCCN(C)C QEOGKTCJGDHZDW-UHFFFAOYSA-N 0.000 description 1
- FZQMJOOSLXFQSU-UHFFFAOYSA-N 3-[3,5-bis[3-(dimethylamino)propyl]-1,3,5-triazinan-1-yl]-n,n-dimethylpropan-1-amine Chemical compound CN(C)CCCN1CN(CCCN(C)C)CN(CCCN(C)C)C1 FZQMJOOSLXFQSU-UHFFFAOYSA-N 0.000 description 1
- GNSFRPWPOGYVLO-UHFFFAOYSA-N 3-hydroxypropyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCCO GNSFRPWPOGYVLO-UHFFFAOYSA-N 0.000 description 1
- QZPSOSOOLFHYRR-UHFFFAOYSA-N 3-hydroxypropyl prop-2-enoate Chemical compound OCCCOC(=O)C=C QZPSOSOOLFHYRR-UHFFFAOYSA-N 0.000 description 1
- ONQHXPPAIRRMCO-UHFFFAOYSA-N 3-morpholin-4-yl-n-(3-morpholin-4-ylpropyl)-n-propylpropan-1-amine Chemical compound C1COCCN1CCCN(CCC)CCCN1CCOCC1 ONQHXPPAIRRMCO-UHFFFAOYSA-N 0.000 description 1
- XAJMBOZDPXFSDS-UHFFFAOYSA-N 4-[3-(4-methylpiperazin-1-yl)propyl]morpholine Chemical compound C1CN(C)CCN1CCCN1CCOCC1 XAJMBOZDPXFSDS-UHFFFAOYSA-N 0.000 description 1
- QYDIWKPIGAEUEG-UHFFFAOYSA-N 4-isocyanato-1,2-bis[(4-isocyanatophenyl)methyl]benzene Chemical compound C1=CC(N=C=O)=CC=C1CC1=CC=C(N=C=O)C=C1CC1=CC=C(N=C=O)C=C1 QYDIWKPIGAEUEG-UHFFFAOYSA-N 0.000 description 1
- VLJQDHDVZJXNQL-UHFFFAOYSA-N 4-methyl-n-(oxomethylidene)benzenesulfonamide Chemical compound CC1=CC=C(S(=O)(=O)N=C=O)C=C1 VLJQDHDVZJXNQL-UHFFFAOYSA-N 0.000 description 1
- PCFMUWBCZZUMRX-UHFFFAOYSA-N 9,10-Dihydroxyanthracene Chemical class C1=CC=C2C(O)=C(C=CC=C3)C3=C(O)C2=C1 PCFMUWBCZZUMRX-UHFFFAOYSA-N 0.000 description 1
- BQACOLQNOUYJCE-FYZZASKESA-N Abietic acid Natural products CC(C)C1=CC2=CC[C@]3(C)[C@](C)(CCC[C@@]3(C)C(=O)O)[C@H]2CC1 BQACOLQNOUYJCE-FYZZASKESA-N 0.000 description 1
- RSWGJHLUYNHPMX-UHFFFAOYSA-N Abietic-Saeure Natural products C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- 239000005632 Capric acid (CAS 334-48-5) Substances 0.000 description 1
- 239000005635 Caprylic acid (CAS 124-07-2) Substances 0.000 description 1
- 229920001634 Copolyester Polymers 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- IYXGSMUGOJNHAZ-UHFFFAOYSA-N Ethyl malonate Chemical compound CCOC(=O)CC(=O)OCC IYXGSMUGOJNHAZ-UHFFFAOYSA-N 0.000 description 1
- 239000013032 Hydrocarbon resin Substances 0.000 description 1
- WOBHKFSMXKNTIM-UHFFFAOYSA-N Hydroxyethyl methacrylate Chemical compound CC(=C)C(=O)OCCO WOBHKFSMXKNTIM-UHFFFAOYSA-N 0.000 description 1
- 239000005639 Lauric acid Substances 0.000 description 1
- 229920000877 Melamine resin Polymers 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- UEEJHVSXFDXPFK-UHFFFAOYSA-N N-dimethylaminoethanol Chemical compound CN(C)CCO UEEJHVSXFDXPFK-UHFFFAOYSA-N 0.000 description 1
- AKNUHUCEWALCOI-UHFFFAOYSA-N N-ethyldiethanolamine Chemical compound OCCN(CC)CCO AKNUHUCEWALCOI-UHFFFAOYSA-N 0.000 description 1
- QVHMSMOUDQXMRS-UHFFFAOYSA-N PPG n4 Chemical compound CC(O)COC(C)COC(C)COC(C)CO QVHMSMOUDQXMRS-UHFFFAOYSA-N 0.000 description 1
- 239000005062 Polybutadiene Substances 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 229920002873 Polyethylenimine Polymers 0.000 description 1
- 229920005830 Polyurethane Foam Polymers 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- UWHCKJMYHZGTIT-UHFFFAOYSA-N Tetraethylene glycol, Natural products OCCOCCOCCOCCO UWHCKJMYHZGTIT-UHFFFAOYSA-N 0.000 description 1
- APQHKWPGGHMYKJ-UHFFFAOYSA-N Tributyltin oxide Chemical compound CCCC[Sn](CCCC)(CCCC)O[Sn](CCCC)(CCCC)CCCC APQHKWPGGHMYKJ-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 230000006750 UV protection Effects 0.000 description 1
- ISKQADXMHQSTHK-UHFFFAOYSA-N [4-(aminomethyl)phenyl]methanamine Chemical group NCC1=CC=C(CN)C=C1 ISKQADXMHQSTHK-UHFFFAOYSA-N 0.000 description 1
- YIMQCDZDWXUDCA-UHFFFAOYSA-N [4-(hydroxymethyl)cyclohexyl]methanol Chemical compound OCC1CCC(CO)CC1 YIMQCDZDWXUDCA-UHFFFAOYSA-N 0.000 description 1
- CQQXCSFSYHAZOO-UHFFFAOYSA-L [acetyloxy(dioctyl)stannyl] acetate Chemical compound CCCCCCCC[Sn](OC(C)=O)(OC(C)=O)CCCCCCCC CQQXCSFSYHAZOO-UHFFFAOYSA-L 0.000 description 1
- ITBPIKUGMIZTJR-UHFFFAOYSA-N [bis(hydroxymethyl)amino]methanol Chemical compound OCN(CO)CO ITBPIKUGMIZTJR-UHFFFAOYSA-N 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 125000005396 acrylic acid ester group Chemical group 0.000 description 1
- 230000002730 additional effect Effects 0.000 description 1
- 238000004026 adhesive bonding Methods 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000008064 anhydrides Chemical group 0.000 description 1
- JFCQEDHGNNZCLN-UHFFFAOYSA-N anhydrous glutaric acid Natural products OC(=O)CCCC(O)=O JFCQEDHGNNZCLN-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 125000003354 benzotriazolyl group Chemical class N1N=NC2=C1C=CC=C2* 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- HIFVAOIJYDXIJG-UHFFFAOYSA-N benzylbenzene;isocyanic acid Chemical class N=C=O.N=C=O.C=1C=CC=CC=1CC1=CC=CC=C1 HIFVAOIJYDXIJG-UHFFFAOYSA-N 0.000 description 1
- DSLKTDKZDUTITA-UHFFFAOYSA-L bis(3-methoxy-3-oxopropyl)tin(2+);dodecanoate Chemical compound COC(=O)CC[Sn+2]CCC(=O)OC.CCCCCCCCCCCC([O-])=O.CCCCCCCCCCCC([O-])=O DSLKTDKZDUTITA-UHFFFAOYSA-L 0.000 description 1
- MICYUZKCWYGVCQ-UHFFFAOYSA-L bis(3-oxobutyl)tin(2+);dodecanoate Chemical compound CC(=O)CC[Sn+2]CCC(C)=O.CCCCCCCCCCCC([O-])=O.CCCCCCCCCCCC([O-])=O MICYUZKCWYGVCQ-UHFFFAOYSA-L 0.000 description 1
- 150000001622 bismuth compounds Chemical class 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- MTAZNLWOLGHBHU-UHFFFAOYSA-N butadiene-styrene rubber Chemical compound C=CC=C.C=CC1=CC=CC=C1 MTAZNLWOLGHBHU-UHFFFAOYSA-N 0.000 description 1
- CDQSJQSWAWPGKG-UHFFFAOYSA-N butane-1,1-diol Chemical class CCCC(O)O CDQSJQSWAWPGKG-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 235000010216 calcium carbonate Nutrition 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 239000004359 castor oil Substances 0.000 description 1
- 235000019438 castor oil Nutrition 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000005253 cladding Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 238000007334 copolymerization reaction Methods 0.000 description 1
- LDHQCZJRKDOVOX-NSCUHMNNSA-N crotonic acid Chemical compound C\C=C\C(O)=O LDHQCZJRKDOVOX-NSCUHMNNSA-N 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- QSAWQNUELGIYBC-UHFFFAOYSA-N cyclohexane-1,2-dicarboxylic acid Chemical compound OC(=O)C1CCCCC1C(O)=O QSAWQNUELGIYBC-UHFFFAOYSA-N 0.000 description 1
- FOTKYAAJKYLFFN-UHFFFAOYSA-N decane-1,10-diol Chemical compound OCCCCCCCCCCO FOTKYAAJKYLFFN-UHFFFAOYSA-N 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- WCRDXYSYPCEIAK-UHFFFAOYSA-N dibutylstannane Chemical group CCCC[SnH2]CCCC WCRDXYSYPCEIAK-UHFFFAOYSA-N 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- KORSJDCBLAPZEQ-UHFFFAOYSA-N dicyclohexylmethane-4,4'-diisocyanate Chemical compound C1CC(N=C=O)CCC1CC1CCC(N=C=O)CC1 KORSJDCBLAPZEQ-UHFFFAOYSA-N 0.000 description 1
- XXBDWLFCJWSEKW-UHFFFAOYSA-N dimethylbenzylamine Chemical compound CN(C)CC1=CC=CC=C1 XXBDWLFCJWSEKW-UHFFFAOYSA-N 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 239000003822 epoxy resin Substances 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 238000007046 ethoxylation reaction Methods 0.000 description 1
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 1
- 239000000383 hazardous chemical Substances 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- RRAMGCGOFNQTLD-UHFFFAOYSA-N hexamethylene diisocyanate Chemical class O=C=NCCCCCCN=C=O RRAMGCGOFNQTLD-UHFFFAOYSA-N 0.000 description 1
- ACCCMOQWYVYDOT-UHFFFAOYSA-N hexane-1,1-diol Chemical class CCCCCC(O)O ACCCMOQWYVYDOT-UHFFFAOYSA-N 0.000 description 1
- 229920006270 hydrocarbon resin Polymers 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- VKOBVWXKNCXXDE-UHFFFAOYSA-N icosanoic acid Chemical compound CCCCCCCCCCCCCCCCCCCC(O)=O VKOBVWXKNCXXDE-UHFFFAOYSA-N 0.000 description 1
- 239000002085 irritant Substances 0.000 description 1
- 231100000021 irritant Toxicity 0.000 description 1
- 230000000622 irritating effect Effects 0.000 description 1
- 238000003475 lamination Methods 0.000 description 1
- 239000004611 light stabiliser Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000002207 metabolite Substances 0.000 description 1
- 125000005397 methacrylic acid ester group Chemical group 0.000 description 1
- CRVGTESFCCXCTH-UHFFFAOYSA-N methyl diethanolamine Chemical compound OCCN(C)CCO CRVGTESFCCXCTH-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 230000001617 migratory effect Effects 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- SIKLBQUNDVFDSP-UHFFFAOYSA-N n,n-diethyl-3-morpholin-4-ylpropan-1-amine Chemical compound CCN(CC)CCCN1CCOCC1 SIKLBQUNDVFDSP-UHFFFAOYSA-N 0.000 description 1
- WOVGPTWDVHNCLE-UHFFFAOYSA-N n,n-dimethyl-3-morpholin-4-ylpropan-1-amine Chemical compound CN(C)CCCN1CCOCC1 WOVGPTWDVHNCLE-UHFFFAOYSA-N 0.000 description 1
- BPJSFKWPIOFKPW-UHFFFAOYSA-N n-ethyl-3-morpholin-4-yl-n-(3-morpholin-4-ylpropyl)propan-1-amine Chemical compound C1COCCN1CCCN(CC)CCCN1CCOCC1 BPJSFKWPIOFKPW-UHFFFAOYSA-N 0.000 description 1
- UZSBXLQQPOUQKT-UHFFFAOYSA-N n-methyl-3-morpholin-4-yl-n-(3-morpholin-4-ylpropyl)propan-1-amine Chemical compound C1COCCN1CCCN(C)CCCN1CCOCC1 UZSBXLQQPOUQKT-UHFFFAOYSA-N 0.000 description 1
- NXPPAOGUKPJVDI-UHFFFAOYSA-N naphthalene-1,2-diol Chemical class C1=CC=CC2=C(O)C(O)=CC=C21 NXPPAOGUKPJVDI-UHFFFAOYSA-N 0.000 description 1
- SLCVBVWXLSEKPL-UHFFFAOYSA-N neopentyl glycol Chemical compound OCC(C)(C)CO SLCVBVWXLSEKPL-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 230000009972 noncorrosive effect Effects 0.000 description 1
- 229920003986 novolac Polymers 0.000 description 1
- OEIJHBUUFURJLI-UHFFFAOYSA-N octane-1,8-diol Chemical compound OCCCCCCCCO OEIJHBUUFURJLI-UHFFFAOYSA-N 0.000 description 1
- 229960002446 octanoic acid Drugs 0.000 description 1
- 125000002524 organometallic group Chemical group 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 239000005022 packaging material Substances 0.000 description 1
- 238000012856 packing Methods 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 1
- 150000004707 phenolate Chemical class 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005498 phthalate group Chemical class 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 239000002985 plastic film Substances 0.000 description 1
- 229920006255 plastic film Polymers 0.000 description 1
- 229920001610 polycaprolactone Polymers 0.000 description 1
- 239000004632 polycaprolactone Substances 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920005903 polyol mixture Polymers 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- 229920000166 polytrimethylene carbonate Polymers 0.000 description 1
- 239000011496 polyurethane foam Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- RLJWTAURUFQFJP-UHFFFAOYSA-N propan-2-ol;titanium Chemical compound [Ti].CC(C)O.CC(C)O.CC(C)O.CC(C)O RLJWTAURUFQFJP-UHFFFAOYSA-N 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 239000011814 protection agent Substances 0.000 description 1
- 230000001698 pyrogenic effect Effects 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 229920005604 random copolymer Polymers 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000029058 respiratory gaseous exchange Effects 0.000 description 1
- 238000007142 ring opening reaction Methods 0.000 description 1
- 239000005060 rubber Substances 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 230000001235 sensitizing effect Effects 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 150000003377 silicon compounds Chemical class 0.000 description 1
- 238000007711 solidification Methods 0.000 description 1
- 230000008023 solidification Effects 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000004071 soot Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 229920006301 statistical copolymer Polymers 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- ISIJQEHRDSCQIU-UHFFFAOYSA-N tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC11CNCC1 ISIJQEHRDSCQIU-UHFFFAOYSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- TUNFSRHWOTWDNC-HKGQFRNVSA-N tetradecanoic acid Chemical compound CCCCCCCCCCCCC[14C](O)=O TUNFSRHWOTWDNC-HKGQFRNVSA-N 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- 150000007944 thiolates Chemical class 0.000 description 1
- 239000013008 thixotropic agent Substances 0.000 description 1
- 229910001887 tin oxide Inorganic materials 0.000 description 1
- SYRHIZPPCHMRIT-UHFFFAOYSA-N tin(4+) Chemical class [Sn+4] SYRHIZPPCHMRIT-UHFFFAOYSA-N 0.000 description 1
- QHGNHLZPVBIIPX-UHFFFAOYSA-N tin(ii) oxide Chemical class [Sn]=O QHGNHLZPVBIIPX-UHFFFAOYSA-N 0.000 description 1
- RUELTTOHQODFPA-UHFFFAOYSA-N toluene 2,6-diisocyanate Chemical compound CC1=C(N=C=O)C=CC=C1N=C=O RUELTTOHQODFPA-UHFFFAOYSA-N 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- LDHQCZJRKDOVOX-UHFFFAOYSA-N trans-crotonic acid Natural products CC=CC(O)=O LDHQCZJRKDOVOX-UHFFFAOYSA-N 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
- DBGVGMSCBYYSLD-UHFFFAOYSA-N tributylstannane Chemical group CCCC[SnH](CCCC)CCCC DBGVGMSCBYYSLD-UHFFFAOYSA-N 0.000 description 1
- PWBHRVGYSMBMIO-UHFFFAOYSA-M tributylstannanylium;acetate Chemical compound CCCC[Sn](CCCC)(CCCC)OC(C)=O PWBHRVGYSMBMIO-UHFFFAOYSA-M 0.000 description 1
- 150000003628 tricarboxylic acids Chemical class 0.000 description 1
- QXJQHYBHAIHNGG-UHFFFAOYSA-N trimethylolethane Chemical compound OCC(C)(CO)CO QXJQHYBHAIHNGG-UHFFFAOYSA-N 0.000 description 1
- XATCWUIVPWOLDP-UHFFFAOYSA-N trioctyl(trioctylstannyloxy)stannane Chemical compound CCCCCCCC[Sn](CCCCCCCC)(CCCCCCCC)O[Sn](CCCCCCCC)(CCCCCCCC)CCCCCCCC XATCWUIVPWOLDP-UHFFFAOYSA-N 0.000 description 1
- XMHKTINRBAKEDS-UHFFFAOYSA-N trioctyltin Chemical compound CCCCCCCC[Sn](CCCCCCCC)CCCCCCCC XMHKTINRBAKEDS-UHFFFAOYSA-N 0.000 description 1
- KGLSETWPYVUTQX-UHFFFAOYSA-N tris(4-isocyanatophenoxy)-sulfanylidene-$l^{5}-phosphane Chemical compound C1=CC(N=C=O)=CC=C1OP(=S)(OC=1C=CC(=CC=1)N=C=O)OC1=CC=C(N=C=O)C=C1 KGLSETWPYVUTQX-UHFFFAOYSA-N 0.000 description 1
- 150000004670 unsaturated fatty acids Chemical class 0.000 description 1
- 235000021122 unsaturated fatty acids Nutrition 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- PAPBSGBWRJIAAV-UHFFFAOYSA-N ε-Caprolactone Chemical compound O=C1CCCCCO1 PAPBSGBWRJIAAV-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G18/00—Polymeric products of isocyanates or isothiocyanates
- C08G18/06—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen
- C08G18/08—Processes
- C08G18/10—Prepolymer processes involving reaction of isocyanates or isothiocyanates with compounds having active hydrogen in a first reaction step
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyurethanes Or Polyureas (AREA)
- Sealing Material Composition (AREA)
- Adhesives Or Adhesive Processes (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE10229519A DE10229519A1 (de) | 2001-07-10 | 2002-07-02 | Reaktive Polyurethane mit einem geringen Gehalt an monomeren Diisocyanaten |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE10132571 | 2001-07-10 | ||
| DE10229519A DE10229519A1 (de) | 2001-07-10 | 2002-07-02 | Reaktive Polyurethane mit einem geringen Gehalt an monomeren Diisocyanaten |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE10229519A1 true DE10229519A1 (de) | 2003-01-30 |
Family
ID=7690688
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE10229519A Withdrawn DE10229519A1 (de) | 2001-07-10 | 2002-07-02 | Reaktive Polyurethane mit einem geringen Gehalt an monomeren Diisocyanaten |
| DE50214182T Expired - Lifetime DE50214182D1 (de) | 2001-07-10 | 2002-07-03 | Reaktive polyurethane mit einem geringen gehalt an monomeren diisocyanaten |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE50214182T Expired - Lifetime DE50214182D1 (de) | 2001-07-10 | 2002-07-03 | Reaktive polyurethane mit einem geringen gehalt an monomeren diisocyanaten |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US20040162385A1 (https=) |
| EP (1) | EP1404733B1 (https=) |
| JP (2) | JP4317446B2 (https=) |
| AT (1) | ATE455810T1 (https=) |
| CA (1) | CA2453511C (https=) |
| DE (2) | DE10229519A1 (https=) |
| WO (1) | WO2003006521A1 (https=) |
Cited By (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE10260974A1 (de) * | 2002-12-24 | 2004-07-15 | Fischerwerke Artur Fischer Gmbh & Co. Kg | Spezialmörtel für Mehrkomponentensysteme |
| DE10358667A1 (de) * | 2003-12-12 | 2005-07-14 | Votteler Lackfabrik Gmbh & Co. Kg | Mittel zur Isoliergrundierung von Holz und Holzwerkstoffen und dessen Verwendung |
| DE102004018048A1 (de) * | 2004-04-08 | 2005-11-10 | Henkel Kgaa | Verfahren zur Herstellung von Polyurethan-Prepolymeren |
| DE102004057292A1 (de) * | 2004-11-26 | 2006-06-01 | Klebchemie, M.G. Becker Gmbh & Co Kg | Verfahren zur Herstellung von reaktiven Polyurethanzusammensetzungen |
| DE102008025793A1 (de) * | 2008-05-29 | 2009-12-03 | Henkel Ag & Co. Kgaa | Reaktive Klebstoffe mit sehr geringem Gehalt an monomeren Diisocyanaten |
| DE102008027914A1 (de) * | 2008-06-12 | 2009-12-17 | Henkel Ag & Co. Kgaa | Vernetzende 2K-Isocyanat-Zusammensetzungen |
| DE102009033637A1 (de) | 2009-07-17 | 2011-01-20 | Bayer Materialscience Ag | Prepolymere |
| US9637667B2 (en) | 2001-10-13 | 2017-05-02 | Henkel Ag & Co. Kgaa | Reactive polyurethane compositions with a low residual monomer content |
| EP3450476A1 (de) | 2017-08-31 | 2019-03-06 | Evonik Degussa GmbH | Reaktivklebstoffe mit niedrigem gehalt an monomerem diisocyanat |
Families Citing this family (70)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE10163857A1 (de) * | 2001-12-22 | 2003-07-10 | Henkel Kgaa | Reaktive Polyurethane mit einem geringen Gehalt an monomeren Diisocyanaten |
| EP1338635B2 (de) † | 2002-02-22 | 2020-10-14 | Jowat AG | Polyurethan-Zusammensetzungen mit geringem Anteil an Diisocyanatmonomer(en) |
| DE10343750A1 (de) * | 2003-09-22 | 2005-04-28 | Henkel Kgaa | Polyurethan-Schmelzklebstoffe mit langer Reaktivierbarkeit |
| DE10351530A1 (de) * | 2003-11-03 | 2005-06-16 | Basf Ag | Verfahren zur Herstellung von Isocyanatgruppen enthaltenden Prepolymeren |
| DE10353663A1 (de) * | 2003-11-17 | 2005-06-16 | Henkel Kgaa | Polyurethanzusammensetzungen mit NCO- und Silylreaktivität |
| EP1602676A1 (en) * | 2004-06-01 | 2005-12-07 | SOLVAY (Société Anonyme) | Catalytic compositions |
| DE102004035764A1 (de) * | 2004-07-23 | 2006-03-16 | Bayer Materialscience Ag | Niedrigviskose Polyurethan-Prepolymere auf Basis von 2,4'-MDI |
| DE102004060284A1 (de) * | 2004-12-15 | 2006-06-29 | Bayer Materialscience Ag | Reaktive Polyurethan-Prepolymere mit einem geringen Gehalt an monomeren Diisocyanaten |
| DE102005012794A1 (de) * | 2005-03-19 | 2006-09-21 | Bayer Materialscience Ag | Poly(etherester)polyole und Verfahren zu ihrer Herstellung |
| DE102005030500A1 (de) * | 2005-06-28 | 2007-01-04 | Basf Ag | Beschichtungsmassen enthaltend 2,4'-Diisocyanatodiphenylmethan |
| US20100105797A1 (en) * | 2005-07-22 | 2010-04-29 | Bridgestone Corporation | Sealing material, process for production of the material, and gasket using the material |
| DE102005035000A1 (de) | 2005-07-22 | 2007-01-25 | Basf Ag | Isocyanatgruppen enthaltende Prepolymere |
| JP4976768B2 (ja) * | 2005-07-22 | 2012-07-18 | 株式会社ブリヂストン | シール用材料及びガスケット |
| EP1918314A1 (de) | 2006-10-31 | 2008-05-07 | Sika Technology AG | Polyurethanzusammensetzung mit guter Anfangsfestigkeit |
| EP2091883B1 (en) | 2006-12-14 | 2011-02-16 | DSM IP Assets B.V. | D1364 bt secondary coating on optical fiber |
| US20080226915A1 (en) * | 2006-12-14 | 2008-09-18 | Xiaosong Wu | D1379 p radiation curable primary coating on optical fiber |
| WO2008076298A1 (en) | 2006-12-14 | 2008-06-26 | Dsm Ip Assets B.V. | D1381 supercoatings for optical fiber |
| WO2008076303A1 (en) * | 2006-12-14 | 2008-06-26 | Dsm Ip Assets B.V. | D1365 bj radiation curable primary coating for optical fiber |
| EP2089333B1 (en) * | 2006-12-14 | 2011-02-16 | DSM IP Assets B.V. | D1363 bt radiation curable primary coatings on optical fiber |
| ATE498594T1 (de) * | 2006-12-14 | 2011-03-15 | Dsm Ip Assets Bv | Strahlungshärtbare d1378 ca-grundierbeschichtung für optische fasern |
| EP1975189A1 (de) | 2007-03-27 | 2008-10-01 | Sika Technology AG | Polyurethanzusammensetzung enthaltend asymmetrisches Dialdimin |
| EP1975186A1 (de) | 2007-03-27 | 2008-10-01 | Sika Technology AG | Isocyanat- und Aldiminogruppen aufweisende Zusammensetzung mit niedrigem Isocyanat-Monomergehalt |
| EP1975187A1 (de) | 2007-03-28 | 2008-10-01 | Sika Technology AG | Verfahren zur Herstellung von Polyurethanzusammensetzungen mit niedrigem Isocyanat-Monomergehalt |
| CN101679575B (zh) * | 2007-11-28 | 2013-09-18 | 奎克化学(中国)有限公司 | 单组分、湿固化聚氨酯粘合剂 |
| DE102008009407A1 (de) * | 2008-02-15 | 2009-08-20 | Bayer Materialscience Ag | Klebstoff |
| DK2262842T3 (en) | 2008-03-28 | 2018-03-05 | Polytex Sportbelaege Produktions Gmbh | 2,2'-MDI-BASED ISOCYANATE MIXTURES AND THE PREPARATION AND APPLICATION OF THEREOF |
| JP2009286941A (ja) * | 2008-05-30 | 2009-12-10 | Henkel Japan Ltd | 湿気硬化型ホットメルト接着剤 |
| US8901187B1 (en) | 2008-12-19 | 2014-12-02 | Hickory Springs Manufacturing Company | High resilience flexible polyurethane foam using MDI |
| US20100160470A1 (en) * | 2008-12-23 | 2010-06-24 | Smiecinski Theodore M | Flexible Polyurethane Foam |
| US8906975B1 (en) | 2009-02-09 | 2014-12-09 | Hickory Springs Manufacturing Company | Conventional flexible polyurethane foam using MDI |
| US20130025784A1 (en) * | 2010-04-01 | 2013-01-31 | Henkel Corporation | Methods for making aqueous polyurethane dispersions of aromatic polyisocyanate mixtures and compositions |
| DE102010028269A1 (de) * | 2010-04-27 | 2011-10-27 | Henkel Ag & Co. Kgaa | PU-Klebstoff mit Fließgrenze |
| JP6161866B2 (ja) * | 2010-12-21 | 2017-07-12 | ローム アンド ハース カンパニーRohm And Haas Company | 接着剤組成物 |
| PL2780384T5 (pl) | 2011-11-16 | 2020-11-02 | Soudal | Ulepszona kompozycja pianki poliuretanowej |
| DE102011089783A1 (de) | 2011-12-23 | 2013-06-27 | Bayer Materialscience Aktiengesellschaft | Niedrigviskose reaktive Polyurethan-Zusammensetzungen |
| DE102012200018A1 (de) * | 2012-01-02 | 2013-07-04 | Bayer Materialscience Ag | Reaktive Polyurethan-Zubereitungen |
| EP2800834B1 (en) | 2012-01-04 | 2018-05-30 | Soudal | Filling of cavities in road construction and repair |
| TWI486367B (zh) | 2012-05-30 | 2015-06-01 | Nippon Soda Co | 聚胺甲酸酯 |
| RU2636015C2 (ru) | 2012-08-29 | 2017-11-17 | Судаль | Улучшенная оконная изоляция |
| EP2740750B1 (en) | 2012-12-05 | 2017-09-06 | 3M Innovative Properties Company | Polyurethane-based adhesives |
| US10138373B2 (en) | 2013-09-04 | 2018-11-27 | Virfex, LLC | Flexible polyurethane and polyurethane/polyorganosiloxane foam materials that absorb impact energy |
| PL405383A1 (pl) | 2013-09-18 | 2015-03-30 | Wrocławskie Centrum Badań Eit + Spółka Z Ograniczoną Odpowiedzialnością | Jednoskładnikowa kompozycja do wytwarzania pianki poliuretanowej w tym o zmniejszonej zawartości MDI i o obniżonej gęstości oraz jej zastosowanie |
| FR3014441B1 (fr) * | 2013-12-05 | 2016-01-08 | Merylithe | Procede de preparation de prepolymeres a terminaison isocyanate pour la preparation de polyurethanes |
| ES2680469T3 (es) | 2014-03-11 | 2018-09-07 | Sika Technology Ag | Pegamento termofusible de poliuretano con bajo contenido en diisocianatos monoméricos y buena velocidad de reticulación |
| FR3021658B1 (fr) | 2014-05-28 | 2017-12-08 | Bostik Sa | Composition de polyurethane a terminaisons nco a base mdi non thermofusible et a faible teneur en monomere mdi, comprenant au moins un compose isocyanate de volume molaire particulier. |
| JP6110827B2 (ja) | 2014-09-29 | 2017-04-05 | 富士フイルム株式会社 | 内視鏡用可撓管、内視鏡用接着剤、内視鏡型医療機器、ならびに内視鏡用可撓管および内視鏡型医療機器の製造方法 |
| EP3088435A1 (de) | 2015-04-28 | 2016-11-02 | Sika Technology AG | Zweistufiges verfahren zur herstellung eines polyurethan-heissschmelzklebstoffs mit niedrigem gehalt an monomeren diisocyanaten und hoher anfangsfestigkeit |
| DE102015207792A1 (de) * | 2015-04-28 | 2016-11-03 | Henkel Ag & Co. Kgaa | Polyurethan-basiertes Bindemittel-System |
| JP6165204B2 (ja) * | 2015-08-27 | 2017-07-19 | Dic株式会社 | 電子機器用封止材、及び、電子機器 |
| WO2017108829A1 (de) | 2015-12-21 | 2017-06-29 | Sika Technology Ag | Hydroxyaldimin und härtbare polyurethanzusammensetzung mit niedrigem gehalt an monomeren isocyanaten |
| US11214706B2 (en) | 2015-12-21 | 2022-01-04 | Sika Technology Ag | Polyurethane composition with low plasticiser migration |
| CA3008034A1 (en) * | 2016-01-19 | 2017-07-27 | H.B. Fuller Company | One-part polyurethane adhesive composition, method of making a laminate, and laminate |
| ES2852199T3 (es) | 2016-03-23 | 2021-09-13 | Fuller H B Co | Composición adhesiva termofusible reactiva |
| WO2017207609A1 (de) * | 2016-05-31 | 2017-12-07 | Covestro Deutschland Ag | Reaktionssystem für einen 1-k polyurethanschaum |
| BR112019000382B1 (pt) * | 2016-07-11 | 2022-10-11 | Dow Global Technologies Llc | Composição adesiva de dois componentes, método para produzir uma estrutura de laminado e laminado |
| PL3315527T3 (pl) | 2016-11-01 | 2021-11-02 | Sika Technology Ag | Utwardzane wilgocią kleje termotopliwe o niskiej zawartości monomerów diizocyjanianowych, zmniejszonej kleistości resztkowej i wysokiej stabilności termicznej |
| PL3315528T3 (pl) | 2016-11-01 | 2022-03-07 | Sika Technology Ag | Sposób zmniejszania kleistości spoczynkowej termotopliwych klejów poliuretanowych utwardzanych wilgocią |
| PL3592818T3 (pl) * | 2017-03-09 | 2023-04-11 | H. B. Fuller Company | Reaktywny termotopliwy klej poliuretanowy o małej zawartości diizocyjanianu monomerycznego |
| JP6620964B2 (ja) * | 2017-12-12 | 2019-12-18 | Dic株式会社 | 無溶剤型ラミネート接着剤、その硬化物、積層体及び包装体 |
| EP3947506A1 (en) * | 2019-03-28 | 2022-02-09 | Basf Se | Process for producing polyurethane-polyisocyanurate elastomers, sealing materials and adhesives having a long pot life |
| PL3990510T3 (pl) | 2019-06-25 | 2025-02-10 | H.B. Fuller Company | Utwardzalna wilgocią kompozycja poliuretanowego kleju topliwego o niskim poziomie monomeru diizocyjanianu |
| DE102020111278A1 (de) | 2020-04-24 | 2021-10-28 | Klebchemie M.G. Becker Gmbh & Co. Kg | Reaktive Heißschmelzklebstoffzusammensetzungen basierend auf alpha-Silan-terminierten organischen Polymeren |
| EP3919535A1 (en) | 2020-06-03 | 2021-12-08 | Henkel AG & Co. KGaA | Polyurethane composition having low monomeric content of diisocyanate |
| JP2022011881A (ja) * | 2020-06-30 | 2022-01-17 | 東洋インキScホールディングス株式会社 | ポリイソシアネート組成物の製造方法 |
| KR102390345B1 (ko) * | 2020-11-10 | 2022-04-22 | 테사 소시에타스 유로파에아 | 잠재 반응성 접착 화합물을 제조하기 위한 제제 |
| DE102021127517A1 (de) | 2021-10-22 | 2023-04-27 | Klebchemie M.G. Becker GmbH & Co KG | Reaktive Heißschmelzklebstoffzusammensetzungen basierend auf alpha-Silan-terminierten organischen Polymeren |
| BE1032362B1 (nl) | 2024-01-31 | 2025-09-01 | Soudal N V | Reactieve polyurethaanformulering met een laag monomeer gehalte |
| BE1032463B1 (nl) * | 2024-03-11 | 2025-10-06 | Soudal N V | Polyurethaanlijm met een lage vrije monomere isocyanaat inhoud |
| DE102024114875A1 (de) | 2024-05-28 | 2025-12-04 | Kleiberit Se & Co. Kg | Reaktive Heißschmelzklebstoffzusammensetzungen basierend auf alpha-Silan-terminierten organischen Polymeren |
| BE1032688B1 (nl) | 2024-06-11 | 2026-01-22 | Soudal | Reactieve polyurethaan formuleringen met een laag monomeer gehalte |
Family Cites Families (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3401129A1 (de) * | 1984-01-14 | 1985-07-18 | Henkel KGaA, 4000 Düsseldorf | Verfahren zur herstellung gemischter polyurethan-prepolymerer |
| DE3610729A1 (de) * | 1986-03-29 | 1987-10-01 | Bayer Ag | Verfahren zur herstellung von thixotropen bindemitteln, die nach diesem verfahren erhaeltlichen bindemittel und ihre verwendung zur herstellung von beschichtungs- und abdichtungsmitteln |
| DE3739261A1 (de) * | 1987-11-18 | 1989-06-01 | Bayer Ag | Verfahren zur herstellung von urethangruppen aufweisenden polyisocyanaten und ihre verwendung |
| DE3815237A1 (de) * | 1988-05-05 | 1989-11-16 | Bayer Ag | Verfahren zur herstellung von modifizierten polyisocyanaten, die nach diesem verfahren erhaeltlichen polyisocyanate und ihre verwendung als bindemittel oder bindemittelkomponente |
| DE4136490C2 (de) * | 1991-11-06 | 2003-04-30 | Bayer Ag | Lösungsmittelfreie Beschichtungssysteme |
| DE4232015A1 (de) * | 1992-09-24 | 1994-03-31 | Bayer Ag | Lösungsmittelfreie Zweikomponentenpolyurethanklebstoffsysteme |
| DE4419449A1 (de) * | 1994-06-03 | 1995-12-07 | Henkel Kgaa | Schnell abbindender Polyurethan-Schmelzklebstoff |
| MX9605802A (es) * | 1994-05-25 | 1997-12-31 | Henkel Kgaa | Pegamento por fusion de poliuretano endurecible por medio de la humedad. |
| US5525663A (en) * | 1994-08-18 | 1996-06-11 | Minnesota Mining And Manufacturing Company | Reactive hot-melt adhesive and/or sealing composition and method of using same |
| MX9701338A (es) * | 1994-08-22 | 1997-05-31 | Henkel Kgaa | Composiciones de poliuretano con bajo contenido endiisocianatos monomeros. |
| DE4446027A1 (de) * | 1994-12-23 | 1996-07-04 | Henkel Kgaa | Formteile aus PU-Schmelzklebstoffen |
| JPH09235540A (ja) * | 1996-03-01 | 1997-09-09 | Sekisui Chem Co Ltd | 湿気硬化型ウレタン系接着剤 |
| DE19700014A1 (de) * | 1997-01-02 | 1998-07-09 | Henkel Kgaa | Monomerenarmes PU-Prepolymer |
| JPH10237153A (ja) * | 1997-02-28 | 1998-09-08 | Asahi Glass Co Ltd | 二液型硬化性組成物 |
| US6465104B1 (en) * | 1997-12-01 | 2002-10-15 | Henkel Kommanditgesellschaft Auf Aktien | Modified polyurethane hotmelt adhesive |
| JP2000103830A (ja) * | 1998-09-28 | 2000-04-11 | Sekisui Chem Co Ltd | ウレタン系プレポリマー組成物 |
| JP2000129115A (ja) * | 1998-10-27 | 2000-05-09 | Konishi Co Ltd | 1液湿気硬化型ウレタン系樹脂組成物及び接着剤 |
| JP2000211295A (ja) * | 1999-01-26 | 2000-08-02 | Sekisui Chem Co Ltd | 化粧シ―ト被覆材の製造方法 |
| ATE258943T1 (de) * | 1999-07-02 | 2004-02-15 | Henkel Kgaa | Verwendung von polyurethanzusammensetzungen mit niedrigen monomergehalt als haftklebstoff |
| KR100830384B1 (ko) * | 1999-11-29 | 2008-05-20 | 헨켈 코만디트게젤샤프트 아우프 악티엔 | 단량체가 없는 반응성 폴리우레탄을 위한 접착 촉진제 |
| DE10157488A1 (de) * | 2000-12-15 | 2002-06-20 | Henkel Kgaa | Polyurethan-Prepolymere mit NCO-Gruppen und niedrigem Gehalt an monomeren Polyisocyanat |
| DE10149142A1 (de) * | 2001-10-05 | 2003-04-24 | Henkel Kgaa | Modifizierter reaktiver Schmelzklebstoff und dessen Verwendung |
| DE10150722A1 (de) * | 2001-10-13 | 2003-04-30 | Henkel Kgaa | Reaktive Polyurethan-Zusammensetzungen mit niedrigem Restmonomergehalt |
| CA2471252A1 (en) * | 2001-12-18 | 2003-06-26 | Henkel Kommanditgesellschaft Auf Aktien | Method for producing polyurethane prepolymers having a low content of monomers |
| DE10162642A1 (de) * | 2001-12-20 | 2003-07-10 | Henkel Kgaa | Haftvermittler für reaktive Polyurethane |
| DE10163857A1 (de) * | 2001-12-22 | 2003-07-10 | Henkel Kgaa | Reaktive Polyurethane mit einem geringen Gehalt an monomeren Diisocyanaten |
-
2002
- 2002-07-02 DE DE10229519A patent/DE10229519A1/de not_active Withdrawn
- 2002-07-03 JP JP2003512288A patent/JP4317446B2/ja not_active Expired - Fee Related
- 2002-07-03 AT AT02764621T patent/ATE455810T1/de not_active IP Right Cessation
- 2002-07-03 EP EP02764621A patent/EP1404733B1/de not_active Revoked
- 2002-07-03 WO PCT/EP2002/007344 patent/WO2003006521A1/de not_active Ceased
- 2002-07-03 DE DE50214182T patent/DE50214182D1/de not_active Expired - Lifetime
- 2002-07-03 CA CA2453511A patent/CA2453511C/en not_active Expired - Fee Related
-
2004
- 2004-01-12 US US10/755,702 patent/US20040162385A1/en not_active Abandoned
-
2008
- 2008-09-04 JP JP2008227295A patent/JP5015098B2/ja not_active Expired - Fee Related
Cited By (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US9637667B2 (en) | 2001-10-13 | 2017-05-02 | Henkel Ag & Co. Kgaa | Reactive polyurethane compositions with a low residual monomer content |
| DE10260974A1 (de) * | 2002-12-24 | 2004-07-15 | Fischerwerke Artur Fischer Gmbh & Co. Kg | Spezialmörtel für Mehrkomponentensysteme |
| DE10358667A1 (de) * | 2003-12-12 | 2005-07-14 | Votteler Lackfabrik Gmbh & Co. Kg | Mittel zur Isoliergrundierung von Holz und Holzwerkstoffen und dessen Verwendung |
| DE102004018048A1 (de) * | 2004-04-08 | 2005-11-10 | Henkel Kgaa | Verfahren zur Herstellung von Polyurethan-Prepolymeren |
| DE102004057292A1 (de) * | 2004-11-26 | 2006-06-01 | Klebchemie, M.G. Becker Gmbh & Co Kg | Verfahren zur Herstellung von reaktiven Polyurethanzusammensetzungen |
| DE102008025793A1 (de) * | 2008-05-29 | 2009-12-03 | Henkel Ag & Co. Kgaa | Reaktive Klebstoffe mit sehr geringem Gehalt an monomeren Diisocyanaten |
| DE102008027914A1 (de) * | 2008-06-12 | 2009-12-17 | Henkel Ag & Co. Kgaa | Vernetzende 2K-Isocyanat-Zusammensetzungen |
| DE102009033637A1 (de) | 2009-07-17 | 2011-01-20 | Bayer Materialscience Ag | Prepolymere |
| US8729210B2 (en) | 2009-07-17 | 2014-05-20 | Bayer Materialscience Ag | Prepolymers based on di- or polyisocyanates and formamide-terminated low molecular weight compounds, processes for preparing the same and uses thereof |
| EP3450476A1 (de) | 2017-08-31 | 2019-03-06 | Evonik Degussa GmbH | Reaktivklebstoffe mit niedrigem gehalt an monomerem diisocyanat |
| WO2019043054A1 (de) | 2017-08-31 | 2019-03-07 | Evonik Degussa Gmbh | Reaktivklebstoffe mit niedrigem gehalt an monomerem diisocyanat |
| CN111295404A (zh) * | 2017-08-31 | 2020-06-16 | 赢创运营有限公司 | 具有低含量的单体二异氰酸酯的反应性粘合剂 |
| CN111295404B (zh) * | 2017-08-31 | 2022-02-01 | 赢创运营有限公司 | 具有低含量的单体二异氰酸酯的反应性粘合剂 |
Also Published As
| Publication number | Publication date |
|---|---|
| ATE455810T1 (de) | 2010-02-15 |
| EP1404733A1 (de) | 2004-04-07 |
| JP4317446B2 (ja) | 2009-08-19 |
| JP2004534132A (ja) | 2004-11-11 |
| CA2453511C (en) | 2010-12-21 |
| CA2453511A1 (en) | 2003-01-23 |
| JP5015098B2 (ja) | 2012-08-29 |
| JP2009019211A (ja) | 2009-01-29 |
| DE50214182D1 (de) | 2010-03-11 |
| EP1404733B1 (de) | 2010-01-20 |
| WO2003006521A1 (de) | 2003-01-23 |
| US20040162385A1 (en) | 2004-08-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP1404733B1 (de) | Reaktive polyurethane mit einem geringen gehalt an monomeren diisocyanaten | |
| EP1456266B1 (de) | Reaktive polyurethane mit einem geringen gehalt an monomeren diisocyanaten | |
| EP2794707B1 (de) | Niedrigviskose reaktive polyurethan-zusammensetzungen | |
| EP1237971B1 (de) | Haftungsverstärker für monomerfreie reaktive polyurethane | |
| DE10259248A1 (de) | Verfahren zur Herstellung von Polyurethan-Prepolymeren | |
| EP0777695B1 (de) | Polyurethan-zusammensetzungen mit niedrigem gehalt an monomeren diisocyanaten | |
| EP1674546B1 (de) | Feuchthärtende Zusammensetzung und Schmelzklebstoff | |
| EP3402834B1 (de) | Reaktive polyurethan-schmelzklebstoffe enthaltend füllstoffe | |
| DE10150722A1 (de) | Reaktive Polyurethan-Zusammensetzungen mit niedrigem Restmonomergehalt | |
| DE102008025793A1 (de) | Reaktive Klebstoffe mit sehr geringem Gehalt an monomeren Diisocyanaten | |
| DE19851182A1 (de) | Polyurethanbindemittel mit einem niedrigen Gehalt an leichtflüchtigen Monomeren | |
| DE102004035764A1 (de) | Niedrigviskose Polyurethan-Prepolymere auf Basis von 2,4'-MDI | |
| EP2208743A1 (de) | Reaktive Polyurethan Zusammensetzungen | |
| EP1685175A1 (de) | Polyurethanzusammensetzungen mit nco- und silylreaktivität | |
| DE3220865A1 (de) | Haftkleber auf der basis von hydroxylgruppenhaltigen polymermischungen | |
| DE19957351A1 (de) | Polyurethan-Zusammensetzungen mit niedrigem Gehalt an Isocyanatmonomeren | |
| EP2016109B1 (de) | Feuchtigkeitshärtende kleb- und dichtstoffe | |
| EP1964868A1 (de) | Migrationsarme Polyurethane | |
| EP0746577B1 (de) | einkomponenten-polyurethanklebstoffe | |
| DE10055786A1 (de) | Haftungsverstärker für monomerfreie reaktive Polyurethane | |
| EP2386586B1 (de) | PU-Klebstoff mit Fließgrenze | |
| DE2415467A1 (de) | Fluessiger klebstoff |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8127 | New person/name/address of the applicant |
Owner name: HENKEL AG & CO. KGAA, 40589 DUESSELDORF, DE |
|
| 8141 | Disposal/no request for examination |