DE1012069B - Verfahren zur Herstellung von Silikonelastomeren unter Formgebung - Google Patents
Verfahren zur Herstellung von Silikonelastomeren unter FormgebungInfo
- Publication number
- DE1012069B DE1012069B DEU3616A DEU0003616A DE1012069B DE 1012069 B DE1012069 B DE 1012069B DE U3616 A DEU3616 A DE U3616A DE U0003616 A DEU0003616 A DE U0003616A DE 1012069 B DE1012069 B DE 1012069B
- Authority
- DE
- Germany
- Prior art keywords
- unsaturated
- tert
- linear
- peroxide
- diorganopolysiloxanes
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 21
- 238000004519 manufacturing process Methods 0.000 title claims description 8
- 229920002379 silicone rubber Polymers 0.000 title claims description 6
- 238000000465 moulding Methods 0.000 title description 5
- 229920001296 polysiloxane Polymers 0.000 claims description 46
- -1 Alkyl peroxides Chemical class 0.000 claims description 37
- 239000000203 mixture Substances 0.000 claims description 17
- 239000000945 filler Substances 0.000 claims description 15
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 11
- 239000006229 carbon black Substances 0.000 claims description 11
- LSXWFXONGKSEMY-UHFFFAOYSA-N di-tert-butyl peroxide Chemical group CC(C)(C)OOC(C)(C)C LSXWFXONGKSEMY-UHFFFAOYSA-N 0.000 claims description 10
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 9
- 229920006395 saturated elastomer Polymers 0.000 claims description 8
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 7
- 229920005645 diorganopolysiloxane polymer Polymers 0.000 claims description 6
- 150000002978 peroxides Chemical group 0.000 claims description 6
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical group [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 claims description 5
- 239000003054 catalyst Substances 0.000 claims description 5
- 238000010438 heat treatment Methods 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 229920002554 vinyl polymer Polymers 0.000 claims description 4
- 238000007493 shaping process Methods 0.000 claims description 3
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 claims description 2
- 125000000962 organic group Chemical group 0.000 claims description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims 1
- RNMGIGDVVSNURZ-UHFFFAOYSA-N 3-ethyl-3-(3-ethyl-4-methyloctan-3-yl)peroxy-4-methyloctane Chemical compound CCCCC(C)C(CC)(CC)OOC(CC)(CC)C(C)CCCC RNMGIGDVVSNURZ-UHFFFAOYSA-N 0.000 claims 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 claims 1
- 125000000217 alkyl group Chemical group 0.000 claims 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 1
- 229920001971 elastomer Polymers 0.000 description 27
- 239000000806 elastomer Substances 0.000 description 21
- 239000003795 chemical substances by application Substances 0.000 description 16
- 230000032683 aging Effects 0.000 description 13
- 125000001183 hydrocarbyl group Chemical group 0.000 description 12
- 238000002156 mixing Methods 0.000 description 12
- 125000001424 substituent group Chemical group 0.000 description 9
- 229910004298 SiO 2 Inorganic materials 0.000 description 7
- 229930195735 unsaturated hydrocarbon Natural products 0.000 description 7
- PAOHAQSLJSMLAT-UHFFFAOYSA-N 1-butylperoxybutane Chemical compound CCCCOOCCCC PAOHAQSLJSMLAT-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 229920001577 copolymer Polymers 0.000 description 5
- 125000005375 organosiloxane group Chemical group 0.000 description 5
- 230000000704 physical effect Effects 0.000 description 5
- 239000004848 polyfunctional curative Substances 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 229910052710 silicon Inorganic materials 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 4
- 125000004122 cyclic group Chemical group 0.000 description 4
- 229920000642 polymer Polymers 0.000 description 4
- 229930195734 saturated hydrocarbon Natural products 0.000 description 4
- 239000010703 silicon Substances 0.000 description 4
- 239000000377 silicon dioxide Substances 0.000 description 4
- 239000004071 soot Substances 0.000 description 4
- 239000004342 Benzoyl peroxide Substances 0.000 description 3
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- 235000019400 benzoyl peroxide Nutrition 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- 238000005299 abrasion Methods 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- UPIWXMRIPODGLE-UHFFFAOYSA-N butyl benzenecarboperoxoate Chemical compound CCCCOOC(=O)C1=CC=CC=C1 UPIWXMRIPODGLE-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- HMMGMWAXVFQUOA-UHFFFAOYSA-N octamethylcyclotetrasiloxane Chemical compound C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1 HMMGMWAXVFQUOA-UHFFFAOYSA-N 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- IALUUOKJPBOFJL-UHFFFAOYSA-N potassium oxidosilane Chemical compound [K+].[SiH3][O-] IALUUOKJPBOFJL-UHFFFAOYSA-N 0.000 description 2
- 235000012239 silicon dioxide Nutrition 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 239000005046 Chlorosilane Substances 0.000 description 1
- 229920001875 Ebonite Polymers 0.000 description 1
- 240000003085 Quassia amara Species 0.000 description 1
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 1
- YKTSYUJCYHOUJP-UHFFFAOYSA-N [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] Chemical compound [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] YKTSYUJCYHOUJP-UHFFFAOYSA-N 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- KOPOQZFJUQMUML-UHFFFAOYSA-N chlorosilane Chemical compound Cl[SiH3] KOPOQZFJUQMUML-UHFFFAOYSA-N 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- 229920005565 cyclic polymer Polymers 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- MAYIDWCWWMOISO-UHFFFAOYSA-N dichloro-bis(ethenyl)silane Chemical compound C=C[Si](Cl)(Cl)C=C MAYIDWCWWMOISO-UHFFFAOYSA-N 0.000 description 1
- YLJJAVFOBDSYAN-UHFFFAOYSA-N dichloro-ethenyl-methylsilane Chemical compound C[Si](Cl)(Cl)C=C YLJJAVFOBDSYAN-UHFFFAOYSA-N 0.000 description 1
- FUWTUGQLAYKVAD-UHFFFAOYSA-N diethoxy-methyl-trimethylsilyloxysilane Chemical compound CCO[Si](C)(OCC)O[Si](C)(C)C FUWTUGQLAYKVAD-UHFFFAOYSA-N 0.000 description 1
- SRXOCFMDUSFFAK-UHFFFAOYSA-N dimethyl peroxide Chemical compound COOC SRXOCFMDUSFFAK-UHFFFAOYSA-N 0.000 description 1
- LIKFHECYJZWXFJ-UHFFFAOYSA-N dimethyldichlorosilane Chemical compound C[Si](C)(Cl)Cl LIKFHECYJZWXFJ-UHFFFAOYSA-N 0.000 description 1
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical class [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 238000005304 joining Methods 0.000 description 1
- 238000004898 kneading Methods 0.000 description 1
- 235000021190 leftovers Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000012766 organic filler Substances 0.000 description 1
- 150000001282 organosilanes Chemical class 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 230000000379 polymerizing effect Effects 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- 238000002203 pretreatment Methods 0.000 description 1
- 238000005096 rolling process Methods 0.000 description 1
- 239000004945 silicone rubber Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- 230000004580 weight loss Effects 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
- GFQYVLUOOAAOGM-UHFFFAOYSA-N zirconium(iv) silicate Chemical compound [Zr+4].[O-][Si]([O-])([O-])[O-] GFQYVLUOOAAOGM-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/04—Oxygen-containing compounds
- C08K5/14—Peroxides
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US470834A US3183205A (en) | 1954-11-23 | 1954-11-23 | Alky peroxide heat-cured organopolysiloxane elastomers |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1012069B true DE1012069B (de) | 1957-07-11 |
Family
ID=23869243
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEU3616A Pending DE1012069B (de) | 1954-11-23 | 1955-11-23 | Verfahren zur Herstellung von Silikonelastomeren unter Formgebung |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US3183205A (enExample) |
| BE (1) | BE542995A (enExample) |
| DE (1) | DE1012069B (enExample) |
| FR (1) | FR1144641A (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL247360A (enExample) * | 1959-01-14 | |||
| US3271360A (en) * | 1963-04-29 | 1966-09-06 | Union Carbide Corp | Polymeric organosiloxanes |
| US3334065A (en) * | 1963-05-06 | 1967-08-01 | Owens Illinois Inc | Organopolysiloxane bead forming process and products |
| US3357940A (en) * | 1964-03-18 | 1967-12-12 | Purolator Products Inc | Silicone rubber containing antimony trisulfide and cured with peroxides |
| US3919161A (en) * | 1971-12-29 | 1975-11-11 | Gen Electric | Heat curable polysiloxane compositions containing fibers |
| US4011197A (en) * | 1975-09-18 | 1977-03-08 | Dow Corning Corporation | Method of curing organosiloxane compositions using microwaves |
| US4056561A (en) * | 1976-06-16 | 1977-11-01 | Argus Chemical Corporation | Thermally stable high molecular weight acyl peroxycarbonic esters in vulcanization of silicone rubber |
| US4188423A (en) * | 1977-04-06 | 1980-02-12 | Xerox Corporation | Solvent extracted heat fuser member |
| US4774281A (en) * | 1987-09-04 | 1988-09-27 | Dow Corning Corporation | Low compression set silicone rubber |
| CN107207859A (zh) * | 2014-12-26 | 2017-09-26 | 道康宁东丽株式会社 | 固化性有机聚硅氧烷组合物、由该组合物构成的半导体用密封剂和半导体装置 |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL66834C (enExample) * | 1943-03-29 | |||
| US2448756A (en) * | 1944-03-14 | 1948-09-07 | Gen Electric | Methyl siloxane elastomers |
| GB596668A (en) * | 1944-06-08 | 1948-01-08 | Shell Dev | Process for the production of polymeric di-alkenyl silicones |
| US2445794A (en) * | 1945-06-11 | 1948-07-27 | Gen Electric | Methyl silicone elastomers containing si-bonded vinyl radicals |
| NL67694C (enExample) * | 1945-06-11 | |||
| GB620692A (en) * | 1945-06-11 | 1949-03-29 | British Thomson Houston Co Ltd | Improvements in and relating to polymerizable polysiloxane compounds and copolymers thereof |
| US2420911A (en) * | 1945-06-11 | 1947-05-20 | Gen Electric | Methyl vinyl polysiloxane-methyl methacrylate copolymers |
| US2448530A (en) * | 1945-11-30 | 1948-09-07 | Gen Electric | Modified silicone compositions |
| US2557928A (en) * | 1945-12-15 | 1951-06-26 | Westinghouse Electric Corp | Electrical apparatus having silicone rubber insulation |
| US2521328A (en) * | 1948-10-14 | 1950-09-05 | Alrose Chemical Company | Stabilizing cellulosic textile materials against shrinkage employing glyoxal and a metal silicofluoride as a catalyst |
| US2714099A (en) * | 1954-01-11 | 1955-07-26 | Dow Corning | Vinyl containing organosiloxane fluids |
| US2803619A (en) * | 1954-12-23 | 1957-08-20 | Dow Corning | Low compression set siloxane elastomers containing a vinyl organosiloxane |
-
0
- BE BE542995D patent/BE542995A/xx unknown
-
1954
- 1954-11-23 US US470834A patent/US3183205A/en not_active Expired - Lifetime
-
1955
- 1955-11-22 FR FR1144641D patent/FR1144641A/fr not_active Expired
- 1955-11-23 DE DEU3616A patent/DE1012069B/de active Pending
Non-Patent Citations (1)
| Title |
|---|
| None * |
Also Published As
| Publication number | Publication date |
|---|---|
| US3183205A (en) | 1965-05-11 |
| BE542995A (enExample) | |
| FR1144641A (fr) | 1957-10-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2265619C2 (de) | Ohne Grundierung anwendbare hitzehärtbare Organopolysiloxanmasse | |
| DE2422846C3 (de) | Verfahren zur Herstellung von Organopolysiloxanmassen | |
| DE2523224C3 (de) | Verfahren zum Verstärken des Haftens von Organopolysiloxanelastomeren | |
| DE1795289C3 (de) | Verfahren zur Herstellung von Organopolysiloxanen mit aufgepfropften organischen Seitenketten, die in situ gebildete längliche Teilchen enthalten | |
| DE2358784A1 (de) | Kalt haertende silikon-kautschukzusammensetzungen | |
| DE2146863A1 (de) | Sihkongummi Zusammensetzung | |
| DD203064A5 (de) | Verfahren zur herstellung von silikonkautschuk | |
| DE1494065A1 (de) | Verfahren zur Haertung von Organopolysiloxan bei Zimmertemperatur | |
| DE1297335B (de) | Bei etwa 0íµ und darunter unbegrenzt lagerfaehige Platinkatalysatoren enthaltende Gemische von Vinylgruppen aufweisenden Organopolysiloxanen und siliciumgebundene Wasserstoffatome aufweisenden Organopolysiloxanen | |
| DE1101754B (de) | Verfahren zur Herstellung von Formkoerpern aus einer zum Strangpressen geeigneten, Polyaethylen, Fuellstoffe und gegebenenfalls Di-ª-cumylperoxyd enthaltenden Masse | |
| DE10259613A1 (de) | Organopolysiloxanzusammensetzungen und deren Einsatz in bei Raumtemperatur vernetzbaren niedermoduligen Massen | |
| DE2604755C3 (de) | Verfahren zur Herstellung von lagerbeständigen flüssigen, nach Zusatz eines Härtersystems härtenden Organopolysiloxanmassen | |
| DE3927362A1 (de) | Verfahren zur herstellung einer polyorganosiloxanmasse | |
| DE69119249T2 (de) | Schnell vulkanisierbare extrudierbare Organosiloxanmassen | |
| DE2702046A1 (de) | Zu einem elastomer haertbare siliconmasse und verfahren zu ihrer herstellung | |
| DE2702057A1 (de) | Zu einem siloxanelastomer haertbare masse | |
| DE1944367C2 (de) | Hitzehärtbare Organopolysiloxanmasse | |
| DE2702056C3 (de) | Verfahren zur Herstellung eines Polysiloxanelastomeren | |
| DE1012069B (de) | Verfahren zur Herstellung von Silikonelastomeren unter Formgebung | |
| CH529809A (de) | Verfahren zur Herstellung eines Siloxanblockcopolymerisats und dessen Verwendung | |
| DE2134437A1 (de) | Siliconelastomere mit hohem Füllstoffgehalt | |
| CH630658A5 (de) | Vernetzer und haertungskatalysatoren aufweisende pastoese massen als komponente fuer bei raumtemperatur vulkanisierbare polysiloxanelastomere. | |
| DE1802374B2 (de) | Nichthaftende, in der Hitze zu Elastomeren härtbare Formmassen auf Organopolysiloxangrundlage | |
| CH646987A5 (de) | Mit sauerstoff vernetzbare mischung auf basis von mercaptofunktionellen organosiloxanen. | |
| DE3789195T2 (de) | Silicon-Ausgangsmasse zum Extrudieren. |