DD244552A5 - Verfahren zur herstellung von azetidin-derivaten - Google Patents
Verfahren zur herstellung von azetidin-derivaten Download PDFInfo
- Publication number
- DD244552A5 DD244552A5 DD86289076A DD28907686A DD244552A5 DD 244552 A5 DD244552 A5 DD 244552A5 DD 86289076 A DD86289076 A DD 86289076A DD 28907686 A DD28907686 A DD 28907686A DD 244552 A5 DD244552 A5 DD 244552A5
- Authority
- DD
- German Democratic Republic
- Prior art keywords
- nickel
- azetidine
- formula
- salt
- water
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 34
- 230000008569 process Effects 0.000 title claims abstract description 16
- 238000004519 manufacturing process Methods 0.000 title description 3
- HONIICLYMWZJFZ-UHFFFAOYSA-N azetidine Chemical class C1CNC1 HONIICLYMWZJFZ-UHFFFAOYSA-N 0.000 title description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims abstract description 71
- 229910052759 nickel Inorganic materials 0.000 claims abstract description 42
- 230000003647 oxidation Effects 0.000 claims abstract description 20
- 238000007254 oxidation reaction Methods 0.000 claims abstract description 20
- 150000003839 salts Chemical class 0.000 claims abstract description 19
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 17
- 150000001875 compounds Chemical class 0.000 claims abstract description 16
- 238000002360 preparation method Methods 0.000 claims abstract description 10
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 6
- GNVWVYIAQBJHGV-UHFFFAOYSA-N azetidin-3-ylmethanol Chemical class OCC1CNC1 GNVWVYIAQBJHGV-UHFFFAOYSA-N 0.000 claims abstract description 3
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims abstract 2
- -1 N-substituted azetidine carboxylate Chemical class 0.000 abstract description 29
- 238000006114 decarboxylation reaction Methods 0.000 abstract description 10
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract description 7
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 abstract description 6
- 229910052783 alkali metal Inorganic materials 0.000 abstract description 5
- 150000001340 alkali metals Chemical class 0.000 abstract description 5
- 229910052739 hydrogen Inorganic materials 0.000 abstract description 5
- 239000001257 hydrogen Substances 0.000 abstract description 5
- 125000004433 nitrogen atom Chemical group N* 0.000 abstract description 5
- 229910052784 alkaline earth metal Inorganic materials 0.000 abstract description 3
- 150000001342 alkaline earth metals Chemical group 0.000 abstract description 3
- 239000003513 alkali Substances 0.000 abstract description 2
- 125000000217 alkyl group Chemical group 0.000 abstract description 2
- 238000010511 deprotection reaction Methods 0.000 abstract description 2
- 239000013067 intermediate product Substances 0.000 abstract description 2
- CBOIHMRHGLHBPB-UHFFFAOYSA-N hydroxymethyl Chemical compound O[CH2] CBOIHMRHGLHBPB-UHFFFAOYSA-N 0.000 abstract 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 abstract 1
- 125000003944 tolyl group Chemical group 0.000 abstract 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 60
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 42
- 239000000243 solution Substances 0.000 description 35
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 27
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 20
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 19
- 239000007787 solid Substances 0.000 description 19
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 18
- 238000006243 chemical reaction Methods 0.000 description 18
- 239000000047 product Substances 0.000 description 17
- 238000003756 stirring Methods 0.000 description 17
- 239000000203 mixture Substances 0.000 description 16
- CWDWGQLVRSTJCN-UHFFFAOYSA-N 1-benzylazetidine-3,3-dicarboxylic acid Chemical compound C1C(C(=O)O)(C(O)=O)CN1CC1=CC=CC=C1 CWDWGQLVRSTJCN-UHFFFAOYSA-N 0.000 description 13
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical compound [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 13
- 239000002244 precipitate Substances 0.000 description 13
- AOFFCJVJVZRCBL-UHFFFAOYSA-N [1-benzyl-3-(hydroxymethyl)azetidin-3-yl]methanol Chemical compound C1C(CO)(CO)CN1CC1=CC=CC=C1 AOFFCJVJVZRCBL-UHFFFAOYSA-N 0.000 description 12
- GFZWHAAOIVMHOI-UHFFFAOYSA-N azetidine-3-carboxylic acid Chemical class OC(=O)C1CNC1 GFZWHAAOIVMHOI-UHFFFAOYSA-N 0.000 description 12
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 11
- 239000000706 filtrate Substances 0.000 description 11
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 10
- 238000005868 electrolysis reaction Methods 0.000 description 10
- 239000003792 electrolyte Substances 0.000 description 10
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 10
- IFGBBXJGLBGHJN-UHFFFAOYSA-N 1-(4-methylphenyl)sulfonylazetidine-3-carboxylic acid Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CC(C(O)=O)C1 IFGBBXJGLBGHJN-UHFFFAOYSA-N 0.000 description 9
- XVFKOLZJNKMHNL-UHFFFAOYSA-N 1-benzylazetidine-3-carboxylic acid Chemical compound C1C(C(=O)O)CN1CC1=CC=CC=C1 XVFKOLZJNKMHNL-UHFFFAOYSA-N 0.000 description 9
- 238000006056 electrooxidation reaction Methods 0.000 description 9
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 8
- 239000007788 liquid Substances 0.000 description 8
- 239000000376 reactant Substances 0.000 description 8
- 230000004913 activation Effects 0.000 description 7
- 238000011065 in-situ storage Methods 0.000 description 7
- 238000002329 infrared spectrum Methods 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 6
- 229910052794 bromium Inorganic materials 0.000 description 6
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 6
- 239000000543 intermediate Substances 0.000 description 6
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 6
- 159000000000 sodium salts Chemical class 0.000 description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 5
- 101100352919 Caenorhabditis elegans ppm-2 gene Proteins 0.000 description 5
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 5
- 229910021586 Nickel(II) chloride Inorganic materials 0.000 description 5
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 5
- 239000004743 Polypropylene Substances 0.000 description 5
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 5
- 239000007864 aqueous solution Substances 0.000 description 5
- 239000003054 catalyst Substances 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 238000001914 filtration Methods 0.000 description 5
- 238000004128 high performance liquid chromatography Methods 0.000 description 5
- QMMRZOWCJAIUJA-UHFFFAOYSA-L nickel dichloride Chemical compound Cl[Ni]Cl QMMRZOWCJAIUJA-UHFFFAOYSA-L 0.000 description 5
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 5
- 229910052697 platinum Inorganic materials 0.000 description 5
- 229920001155 polypropylene Polymers 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 229910000029 sodium carbonate Inorganic materials 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- 239000008096 xylene Substances 0.000 description 5
- ZDTSHVGCSDAFJH-UHFFFAOYSA-N (1-benzylazetidin-3-yl)methanol Chemical compound C1C(CO)CN1CC1=CC=CC=C1 ZDTSHVGCSDAFJH-UHFFFAOYSA-N 0.000 description 4
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 4
- 238000005481 NMR spectroscopy Methods 0.000 description 4
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 4
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 4
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 229960000583 acetic acid Drugs 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- BFDHFSHZJLFAMC-UHFFFAOYSA-L nickel(ii) hydroxide Chemical compound [OH-].[OH-].[Ni+2] BFDHFSHZJLFAMC-UHFFFAOYSA-L 0.000 description 4
- KBJMLQFLOWQJNF-UHFFFAOYSA-N nickel(ii) nitrate Chemical compound [Ni+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O KBJMLQFLOWQJNF-UHFFFAOYSA-N 0.000 description 4
- 229910017604 nitric acid Inorganic materials 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 4
- MBIJMMNQEXUYCL-UHFFFAOYSA-N 1-(4-methylphenyl)sulfonylazetidine-3,3-dicarboxylic acid Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CC(C(O)=O)(C(O)=O)C1 MBIJMMNQEXUYCL-UHFFFAOYSA-N 0.000 description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 3
- 239000011575 calcium Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 235000019253 formic acid Nutrition 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 3
- 229910052753 mercury Inorganic materials 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- BFLVHFJMYNKSEK-UHFFFAOYSA-N 1-nitroazetidine-3-carboxylic acid Chemical compound OC(=O)C1CN([N+]([O-])=O)C1 BFLVHFJMYNKSEK-UHFFFAOYSA-N 0.000 description 2
- LCPVQAHEFVXVKT-UHFFFAOYSA-N 2-(2,4-difluorophenoxy)pyridin-3-amine Chemical compound NC1=CC=CN=C1OC1=CC=C(F)C=C1F LCPVQAHEFVXVKT-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 239000005708 Sodium hypochlorite Substances 0.000 description 2
- 229910000831 Steel Inorganic materials 0.000 description 2
- IISOMQJAPNZTPN-UHFFFAOYSA-N [3-(hydroxymethyl)-1-(4-methylphenyl)sulfonylazetidin-3-yl]methanol Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CC(CO)(CO)C1 IISOMQJAPNZTPN-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- MHYMJKUZMUYNOJ-UHFFFAOYSA-N azetidin-1-ylmethanol Chemical compound OCN1CCC1 MHYMJKUZMUYNOJ-UHFFFAOYSA-N 0.000 description 2
- GETUVALQSXUKQD-UHFFFAOYSA-N azetidine-3,3-dicarboxylic acid Chemical class OC(=O)C1(C(O)=O)CNC1 GETUVALQSXUKQD-UHFFFAOYSA-N 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 239000001569 carbon dioxide Substances 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- HGCIXCUEYOPUTN-UHFFFAOYSA-N cyclohexene Chemical compound C1CCC=CC1 HGCIXCUEYOPUTN-UHFFFAOYSA-N 0.000 description 2
- 150000002009 diols Chemical class 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000012530 fluid Substances 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- JGJLWPGRMCADHB-UHFFFAOYSA-N hypobromite Chemical compound Br[O-] JGJLWPGRMCADHB-UHFFFAOYSA-N 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 159000000003 magnesium salts Chemical class 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- AOPCKOPZYFFEDA-UHFFFAOYSA-N nickel(2+);dinitrate;hexahydrate Chemical compound O.O.O.O.O.O.[Ni+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O AOPCKOPZYFFEDA-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- 238000012545 processing Methods 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 2
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 2
- CHQMHPLRPQMAMX-UHFFFAOYSA-L sodium persulfate Substances [Na+].[Na+].[O-]S(=O)(=O)OOS([O-])(=O)=O CHQMHPLRPQMAMX-UHFFFAOYSA-L 0.000 description 2
- 235000010265 sodium sulphite Nutrition 0.000 description 2
- 239000010959 steel Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 238000004804 winding Methods 0.000 description 2
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- VYCUOOZEPUQLNF-UHFFFAOYSA-N 1-(1-phenylethyl)azetidine-3,3-dicarboxylic acid Chemical compound C=1C=CC=CC=1C(C)N1CC(C(O)=O)(C(O)=O)C1 VYCUOOZEPUQLNF-UHFFFAOYSA-N 0.000 description 1
- VKCBXONEZGIOSP-UHFFFAOYSA-N 1-(4-methylphenyl)sulfonylazetidine Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CCC1 VKCBXONEZGIOSP-UHFFFAOYSA-N 0.000 description 1
- XVIVTATXHQQFFW-UHFFFAOYSA-N 1-benzhydrylazetidine-3,3-dicarboxylic acid Chemical compound C1C(C(=O)O)(C(O)=O)CN1C(C=1C=CC=CC=1)C1=CC=CC=C1 XVIVTATXHQQFFW-UHFFFAOYSA-N 0.000 description 1
- IXMOEAHDRKNAAG-UHFFFAOYSA-N 1-benzhydrylazetidine-3-carbonitrile Chemical compound C1C(C#N)CN1C(C=1C=CC=CC=1)C1=CC=CC=C1 IXMOEAHDRKNAAG-UHFFFAOYSA-N 0.000 description 1
- UNEKSSHIQHZUFD-UHFFFAOYSA-N 1-benzyl-3-(hydroxymethyl)azetidine-3-carboxylic acid Chemical compound C1C(CO)(C(O)=O)CN1CC1=CC=CC=C1 UNEKSSHIQHZUFD-UHFFFAOYSA-N 0.000 description 1
- SNKTZBNDUVWOAZ-UHFFFAOYSA-N 1-nitrosoazetidine Chemical compound O=NN1CCC1 SNKTZBNDUVWOAZ-UHFFFAOYSA-N 0.000 description 1
- RQEUFEKYXDPUSK-UHFFFAOYSA-N 1-phenylethylamine Chemical compound CC(N)C1=CC=CC=C1 RQEUFEKYXDPUSK-UHFFFAOYSA-N 0.000 description 1
- CHUGKEQJSLOLHL-UHFFFAOYSA-N 2,2-Bis(bromomethyl)propane-1,3-diol Chemical compound OCC(CO)(CBr)CBr CHUGKEQJSLOLHL-UHFFFAOYSA-N 0.000 description 1
- RZWGTXHSYZGXKF-UHFFFAOYSA-N 2-(2-methylphenyl)acetic acid Chemical compound CC1=CC=CC=C1CC(O)=O RZWGTXHSYZGXKF-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 206010021929 Infertility male Diseases 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- JLVVSXFLKOJNIY-UHFFFAOYSA-N Magnesium ion Chemical compound [Mg+2] JLVVSXFLKOJNIY-UHFFFAOYSA-N 0.000 description 1
- 208000007466 Male Infertility Diseases 0.000 description 1
- OKIZCWYLBDKLSU-UHFFFAOYSA-M N,N,N-Trimethylmethanaminium chloride Chemical compound [Cl-].C[N+](C)(C)C OKIZCWYLBDKLSU-UHFFFAOYSA-M 0.000 description 1
- VEQPNABPJHWNSG-UHFFFAOYSA-N Nickel(2+) Chemical class [Ni+2] VEQPNABPJHWNSG-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241000220317 Rosa Species 0.000 description 1
- 239000004809 Teflon Substances 0.000 description 1
- 229920006362 Teflon® Polymers 0.000 description 1
- JAXQPBINKGFTPK-UHFFFAOYSA-N [3-(hydroxymethyl)azetidin-3-yl]methanol Chemical compound OCC1(CO)CNC1 JAXQPBINKGFTPK-UHFFFAOYSA-N 0.000 description 1
- XAXXTYXMWOFKLW-UHFFFAOYSA-N [C-]1=CC=[NH+]1 Chemical class [C-]1=CC=[NH+]1 XAXXTYXMWOFKLW-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- PQLVXDKIJBQVDF-UHFFFAOYSA-N acetic acid;hydrate Chemical compound O.CC(O)=O PQLVXDKIJBQVDF-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical class [H]C([H])([H])C(*)=O 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- VDFLYDCPHUPMAO-UHFFFAOYSA-N azetidine-3-carboxylic acid Chemical compound OC(=O)C1CNC1.OC(=O)C1CNC1 VDFLYDCPHUPMAO-UHFFFAOYSA-N 0.000 description 1
- 150000001539 azetidines Chemical class 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 229910001424 calcium ion Inorganic materials 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 150000001925 cycloalkenes Chemical class 0.000 description 1
- UVJHQYIOXKWHFD-UHFFFAOYSA-N cyclohexa-1,4-diene Chemical compound C1C=CCC=C1 UVJHQYIOXKWHFD-UHFFFAOYSA-N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- ZOMNIUBKTOKEHS-UHFFFAOYSA-L dimercury dichloride Chemical class Cl[Hg][Hg]Cl ZOMNIUBKTOKEHS-UHFFFAOYSA-L 0.000 description 1
- MGHPNCMVUAKAIE-UHFFFAOYSA-N diphenylmethanamine Chemical compound C=1C=CC=CC=1C(N)C1=CC=CC=C1 MGHPNCMVUAKAIE-UHFFFAOYSA-N 0.000 description 1
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- KCIDZIIHRGYJAE-YGFYJFDDSA-L dipotassium;[(2r,3r,4s,5r,6r)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate Chemical class [K+].[K+].OC[C@H]1O[C@H](OP([O-])([O-])=O)[C@H](O)[C@@H](O)[C@H]1O KCIDZIIHRGYJAE-YGFYJFDDSA-L 0.000 description 1
- OCCIDTXLZAHUSF-UHFFFAOYSA-L disodium;1-benzylazetidine-3,3-dicarboxylate Chemical compound [Na+].[Na+].C1C(C(=O)[O-])(C([O-])=O)CN1CC1=CC=CC=C1 OCCIDTXLZAHUSF-UHFFFAOYSA-L 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000003487 electrochemical reaction Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 239000000852 hydrogen donor Substances 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910001425 magnesium ion Inorganic materials 0.000 description 1
- 238000003760 magnetic stirring Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 150000002815 nickel Chemical class 0.000 description 1
- LGQLOGILCSXPEA-UHFFFAOYSA-L nickel sulfate Chemical compound [Ni+2].[O-]S([O-])(=O)=O LGQLOGILCSXPEA-UHFFFAOYSA-L 0.000 description 1
- 229910000363 nickel(II) sulfate Inorganic materials 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 229920001467 poly(styrenesulfonates) Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 238000004611 spectroscopical analysis Methods 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 150000005621 tetraalkylammonium salts Chemical class 0.000 description 1
- DZLFLBLQUQXARW-UHFFFAOYSA-N tetrabutylammonium Chemical compound CCCC[N+](CCCC)(CCCC)CCCC DZLFLBLQUQXARW-UHFFFAOYSA-N 0.000 description 1
- KBLZDCFTQSIIOH-UHFFFAOYSA-M tetrabutylazanium;perchlorate Chemical compound [O-]Cl(=O)(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC KBLZDCFTQSIIOH-UHFFFAOYSA-M 0.000 description 1
- 229940073455 tetraethylammonium hydroxide Drugs 0.000 description 1
- LRGJRHZIDJQFCL-UHFFFAOYSA-M tetraethylazanium;hydroxide Chemical compound [OH-].CC[N+](CC)(CC)CC LRGJRHZIDJQFCL-UHFFFAOYSA-M 0.000 description 1
- DDFYFBUWEBINLX-UHFFFAOYSA-M tetramethylammonium bromide Chemical compound [Br-].C[N+](C)(C)C DDFYFBUWEBINLX-UHFFFAOYSA-M 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D205/00—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom
- C07D205/02—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D205/04—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Electrolytic Production Of Non-Metals, Compounds, Apparatuses Therefor (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Electrochromic Elements, Electrophoresis, Or Variable Reflection Or Absorption Elements (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB858509746A GB8509746D0 (en) | 1985-04-16 | 1985-04-16 | Preparing azetidine derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DD244552A5 true DD244552A5 (de) | 1987-04-08 |
Family
ID=10577742
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DD86289076A DD244552A5 (de) | 1985-04-16 | 1986-04-14 | Verfahren zur herstellung von azetidin-derivaten |
Country Status (21)
| Country | Link |
|---|---|
| US (2) | US4778577A (da) |
| EP (1) | EP0199413A3 (da) |
| JP (1) | JPS61238991A (da) |
| KR (1) | KR860008134A (da) |
| CN (1) | CN86102422A (da) |
| AU (1) | AU584412B2 (da) |
| BR (1) | BR8601677A (da) |
| DD (1) | DD244552A5 (da) |
| DK (1) | DK169386A (da) |
| ES (1) | ES8707494A1 (da) |
| GB (1) | GB8509746D0 (da) |
| GR (1) | GR860978B (da) |
| HU (1) | HU201303B (da) |
| IL (1) | IL78491A (da) |
| NO (1) | NO861447L (da) |
| NZ (1) | NZ215815A (da) |
| OA (1) | OA08276A (da) |
| PH (1) | PH22393A (da) |
| SU (1) | SU1586512A3 (da) |
| TN (1) | TNSN86056A1 (da) |
| ZA (1) | ZA862766B (da) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB8524024D0 (en) * | 1985-09-30 | 1985-11-06 | Shell Int Research | Preparation of azetidine-3-carboxylic acid |
| DE69722538T2 (de) * | 1996-09-06 | 2004-04-29 | Sumitomo Chemical Co., Ltd. | Verfahren zur Herstellung von optisch aktiver Azetidin-2-Carbonsäure |
| DE69811893T2 (de) * | 1997-04-24 | 2003-11-27 | Kaneka Corp | Verfahren zur herstellung von azetidin-2-carbonsäure und zwischenprodukten davon |
| DE10117222B4 (de) | 2001-04-06 | 2004-12-30 | Goldschmidt Ag | Verfahren zur Herstellung von Glycinderivaten |
| WO2002088298A1 (en) * | 2001-04-27 | 2002-11-07 | The Procter & Gamble Company | Compounds, compositions, and methods for controlling biofilms |
| PT1663966E (pt) * | 2003-09-15 | 2007-09-26 | Novartis Ag | Derivados de azetidina 1,3-di-substituídos para utilização como antagonistas do receptor ccr-3 no tratamento de doenças inflamatórias e alérgicas |
| JP5211318B2 (ja) * | 2007-03-28 | 2013-06-12 | 国立大学法人 長崎大学 | α，α−ジ置換環状含窒素化合物の製造方法 |
| CA2686517A1 (en) * | 2007-05-10 | 2008-11-20 | Pfizer Limited | Azetidine derivatives and their use as prostaglandin e2 antagonists |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1169027A (en) * | 1966-11-19 | 1969-10-29 | Beecham Group Ltd | Azetidine Derivatives |
| GB8300860D0 (en) * | 1983-01-13 | 1983-02-16 | Shell Int Research | Azetidine compounds |
| US4496440A (en) * | 1984-06-04 | 1985-01-29 | The Dow Chemical Company | Oxidation of hydrophobic --CH2 OH compounds at oxidized nickel anodes |
| DE3571811D1 (en) * | 1984-06-19 | 1989-08-31 | Shell Int Research | Azetidine derivatives and their preparation |
| GB8415614D0 (en) * | 1984-06-19 | 1984-07-25 | Shell Int Research | Azetidine derivatives |
| GB8415615D0 (en) * | 1984-06-19 | 1984-07-25 | Shell Int Research | Preparing azetidine derivatives |
-
1985
- 1985-04-16 GB GB858509746A patent/GB8509746D0/en active Pending
-
1986
- 1986-04-12 CN CN198686102422A patent/CN86102422A/zh active Pending
- 1986-04-14 HU HU861559A patent/HU201303B/hu not_active IP Right Cessation
- 1986-04-14 PH PH33647A patent/PH22393A/en unknown
- 1986-04-14 ES ES553949A patent/ES8707494A1/es not_active Expired
- 1986-04-14 KR KR1019860002829A patent/KR860008134A/ko not_active Application Discontinuation
- 1986-04-14 IL IL78491A patent/IL78491A/xx unknown
- 1986-04-14 DD DD86289076A patent/DD244552A5/de not_active IP Right Cessation
- 1986-04-14 SU SU864027253A patent/SU1586512A3/ru active
- 1986-04-14 OA OA58831A patent/OA08276A/xx unknown
- 1986-04-14 DK DK169386A patent/DK169386A/da not_active IP Right Cessation
- 1986-04-14 GR GR860978A patent/GR860978B/el unknown
- 1986-04-14 AU AU56064/86A patent/AU584412B2/en not_active Ceased
- 1986-04-14 NZ NZ215815A patent/NZ215815A/xx unknown
- 1986-04-14 JP JP61084413A patent/JPS61238991A/ja active Pending
- 1986-04-14 NO NO861447A patent/NO861447L/no unknown
- 1986-04-14 ZA ZA862766A patent/ZA862766B/xx unknown
- 1986-04-14 BR BR8601677A patent/BR8601677A/pt unknown
- 1986-04-15 EP EP86200639A patent/EP0199413A3/en not_active Withdrawn
- 1986-04-16 TN TNTNSN86056A patent/TNSN86056A1/fr unknown
- 1986-04-16 US US06/852,857 patent/US4778577A/en not_active Expired - Lifetime
-
1988
- 1988-06-09 US US07/204,479 patent/US4855452A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| AU5606486A (en) | 1986-10-23 |
| US4778577A (en) | 1988-10-18 |
| DK169386D0 (da) | 1986-04-14 |
| HUT42755A (en) | 1987-08-28 |
| ES553949A0 (es) | 1987-08-01 |
| ZA862766B (en) | 1986-11-26 |
| ES8707494A1 (es) | 1987-08-01 |
| KR860008134A (ko) | 1986-11-12 |
| SU1586512A3 (ru) | 1990-08-15 |
| CN86102422A (zh) | 1987-01-28 |
| IL78491A0 (en) | 1986-08-31 |
| PH22393A (en) | 1988-08-12 |
| HU201303B (en) | 1990-10-28 |
| JPS61238991A (ja) | 1986-10-24 |
| EP0199413A2 (en) | 1986-10-29 |
| AU584412B2 (en) | 1989-05-25 |
| IL78491A (en) | 1989-03-31 |
| NZ215815A (en) | 1989-07-27 |
| GB8509746D0 (en) | 1985-05-22 |
| GR860978B (en) | 1986-08-06 |
| US4855452A (en) | 1989-08-08 |
| NO861447L (no) | 1986-10-17 |
| DK169386A (da) | 1986-10-17 |
| BR8601677A (pt) | 1986-12-16 |
| EP0199413A3 (en) | 1987-05-06 |
| OA08276A (en) | 1987-10-30 |
| TNSN86056A1 (fr) | 1990-01-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE60100620T2 (de) | Gezielte elektrochemische reduktion von halogenierten 4-amino-picolinsäuren | |
| EP0780371B1 (de) | 2-Alkylmerkapto-4-(trifluormethyl)-benzoesäureester sowie ein Verfahren zu ihrer Herstellung | |
| DD244552A5 (de) | Verfahren zur herstellung von azetidin-derivaten | |
| DE1593865A1 (de) | Verfahren zur Isolierung von 4,4'-Diaminodiphenylmethan aus Polyphenylmethylenpolyamingemischen | |
| EP0064154A1 (de) | Verfahren zur Herstellung von blauen Eisenhexacyanoferrat-III-Pigmenten | |
| DE3725481C2 (da) | ||
| DE3443303A1 (de) | Verfahren zur herstellung von 3-hydroxy-3-methylglutarsaeure | |
| DE3420333A1 (de) | Verfahren zur herstellung von quadratsaeure, ihren komplexen und/oder salzen | |
| EP0533132B1 (de) | Verfahren zur Oxidation von Hydroxymethylpyridinderivaten zu Pyridincarbonsäurederivaten | |
| DE3152459C2 (da) | ||
| DE2414681B2 (de) | Verfahren zur Herstellung von Phthalazine [2,3-b] phthalazin-5-(14H), 12(7H)- dion | |
| DD249909A5 (de) | Verfahren zur herstellung von carbocyclischen acetidin-3-saeuren und deren salzen | |
| DE2331712A1 (de) | Verfahren zur herstellung von 2methoxy-3,6-dichlorbenzoesaeure | |
| DE2460156C2 (de) | Verfahren zur Herstellung von Diaceton-2-ketogulonsäure | |
| EP0415189A2 (de) | Verfahren zur Herstellung von Aminobenzylalkoholen | |
| DE2363634C3 (de) | Verfahren zur Herstellung von N-Phosphonmethylglycin | |
| EP0100498B1 (de) | Verfahren zur Herstellung von Dichlormilchsäure oder dem Nitril oder Amid der Dichlormilchsäure | |
| DE1643558C3 (de) | Verfahren zur Herstellung von Hydrochinon oder p-Benzochinon | |
| DE2503114C3 (de) | Verfahren zur Herstellung von N-(α-Alkoxyäthyl)-carbonsäureamiden | |
| DE2723121C2 (de) | Verfahren zur Herstellung von Alkylthiosemicarbaziden | |
| DE857501C (de) | Verfahren zur Herstellung von Disulfiden | |
| AT375343B (de) | Verfahren zur herstellung der neuen 1-methyl-5(p-toluoyl)-3-carboxypyrrol-2-essigsaeure | |
| DE1147950B (de) | Verfahren zur Herstellung von Hexahydropyrimidin-4, 6-dion-Derivaten | |
| DE2459233C2 (de) | Verfahren zur Herstellung von Hydrochinon | |
| DE2601216C3 (de) | Verfahren zur Herstellung von Hydrochinon aus Nitrobenzol |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ENJ | Ceased due to non-payment of renewal fee |