DD146943A5 - Verfahren zur herstellung von acetaldehyd - Google Patents
Verfahren zur herstellung von acetaldehyd Download PDFInfo
- Publication number
- DD146943A5 DD146943A5 DD79216554A DD21655479A DD146943A5 DD 146943 A5 DD146943 A5 DD 146943A5 DD 79216554 A DD79216554 A DD 79216554A DD 21655479 A DD21655479 A DD 21655479A DD 146943 A5 DD146943 A5 DD 146943A5
- Authority
- DD
- German Democratic Republic
- Prior art keywords
- item
- cobalt
- halogen
- methanol
- iodide
- Prior art date
Links
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 title claims abstract description 50
- 238000000034 method Methods 0.000 title claims description 49
- 238000002360 preparation method Methods 0.000 title claims description 5
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims abstract description 117
- 229910017052 cobalt Inorganic materials 0.000 claims abstract description 49
- 239000010941 cobalt Substances 0.000 claims abstract description 49
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims abstract description 46
- 239000000203 mixture Substances 0.000 claims abstract description 34
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 27
- 239000001257 hydrogen Substances 0.000 claims abstract description 25
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 24
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 23
- 150000002367 halogens Chemical class 0.000 claims abstract description 21
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 claims abstract description 20
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 claims abstract description 7
- 229910002091 carbon monoxide Inorganic materials 0.000 claims abstract description 7
- 125000004429 atom Chemical group 0.000 claims description 16
- -1 quaternary ammonium ions Chemical class 0.000 claims description 14
- AVWLPUQJODERGA-UHFFFAOYSA-L cobalt(2+);diiodide Chemical compound [Co+2].[I-].[I-] AVWLPUQJODERGA-UHFFFAOYSA-L 0.000 claims description 4
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 3
- 239000003513 alkali Substances 0.000 claims description 3
- 150000001351 alkyl iodides Chemical class 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 229910052740 iodine Inorganic materials 0.000 claims description 3
- 239000011630 iodine Substances 0.000 claims description 3
- 239000007791 liquid phase Substances 0.000 claims description 3
- XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical compound [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 claims description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 2
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 2
- 150000001347 alkyl bromides Chemical class 0.000 claims description 2
- 150000001348 alkyl chlorides Chemical class 0.000 claims description 2
- 150000001768 cations Chemical class 0.000 claims description 2
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims 1
- 239000002253 acid Substances 0.000 claims 1
- 150000007513 acids Chemical class 0.000 claims 1
- BZRRQSJJPUGBAA-UHFFFAOYSA-L cobalt(ii) bromide Chemical compound Br[Co]Br BZRRQSJJPUGBAA-UHFFFAOYSA-L 0.000 claims 1
- 125000005843 halogen group Chemical group 0.000 claims 1
- 229910052753 mercury Inorganic materials 0.000 claims 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims 1
- 125000005496 phosphonium group Chemical group 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 abstract description 36
- 150000002431 hydrogen Chemical class 0.000 abstract 1
- 238000002474 experimental method Methods 0.000 description 19
- 150000001875 compounds Chemical class 0.000 description 17
- 239000007789 gas Substances 0.000 description 15
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 14
- 230000000052 comparative effect Effects 0.000 description 13
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 10
- 239000000047 product Substances 0.000 description 9
- 230000006315 carbonylation Effects 0.000 description 7
- 238000005810 carbonylation reaction Methods 0.000 description 7
- 150000004694 iodide salts Chemical class 0.000 description 6
- 238000004519 manufacturing process Methods 0.000 description 6
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 6
- IKHGUXGNUITLKF-XPULMUKRSA-N acetaldehyde Chemical compound [14CH]([14CH3])=O IKHGUXGNUITLKF-XPULMUKRSA-N 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical group COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N acetic acid anhydride Natural products CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 4
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 4
- 230000002045 lasting effect Effects 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- MQIKJSYMMJWAMP-UHFFFAOYSA-N dicobalt octacarbonyl Chemical group [Co+2].[Co+2].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-] MQIKJSYMMJWAMP-UHFFFAOYSA-N 0.000 description 3
- 229930195733 hydrocarbon Natural products 0.000 description 3
- 150000002430 hydrocarbons Chemical class 0.000 description 3
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 3
- 239000012429 reaction media Substances 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- SPEUIVXLLWOEMJ-UHFFFAOYSA-N 1,1-dimethoxyethane Chemical compound COC(C)OC SPEUIVXLLWOEMJ-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- ZTQSAGDEMFDKMZ-UHFFFAOYSA-N Butyraldehyde Chemical compound CCCC=O ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- GZUXJHMPEANEGY-UHFFFAOYSA-N bromomethane Chemical compound BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 150000001869 cobalt compounds Chemical class 0.000 description 2
- QAHREYKOYSIQPH-UHFFFAOYSA-L cobalt(II) acetate Chemical compound [Co+2].CC([O-])=O.CC([O-])=O QAHREYKOYSIQPH-UHFFFAOYSA-L 0.000 description 2
- MLUCVPSAIODCQM-NSCUHMNNSA-N crotonaldehyde Chemical compound C\C=C\C=O MLUCVPSAIODCQM-NSCUHMNNSA-N 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 229940071870 hydroiodic acid Drugs 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-M iodide Chemical compound [I-] XMBWDFGMSWQBCA-UHFFFAOYSA-M 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- XYFCBTPGUUZFHI-UHFFFAOYSA-N phosphine group Chemical group P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Inorganic materials [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 2
- 229910001220 stainless steel Inorganic materials 0.000 description 2
- 239000010935 stainless steel Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- UDHXJZHVNHGCEC-UHFFFAOYSA-N Chlorophacinone Chemical compound C1=CC(Cl)=CC=C1C(C=1C=CC=CC=1)C(=O)C1C(=O)C2=CC=CC=C2C1=O UDHXJZHVNHGCEC-UHFFFAOYSA-N 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241000063963 Jodia Species 0.000 description 1
- VKEQBMCRQDSRET-UHFFFAOYSA-N Methylone Chemical compound CNC(C)C(=O)C1=CC=C2OCOC2=C1 VKEQBMCRQDSRET-UHFFFAOYSA-N 0.000 description 1
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 229910052785 arsenic Inorganic materials 0.000 description 1
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 150000001622 bismuth compounds Chemical class 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 229940011182 cobalt acetate Drugs 0.000 description 1
- 229910021446 cobalt carbonate Inorganic materials 0.000 description 1
- ZOTKGJBKKKVBJZ-UHFFFAOYSA-L cobalt(2+);carbonate Chemical compound [Co+2].[O-]C([O-])=O ZOTKGJBKKKVBJZ-UHFFFAOYSA-L 0.000 description 1
- PFQLIVQUKOIJJD-UHFFFAOYSA-L cobalt(ii) formate Chemical compound [Co+2].[O-]C=O.[O-]C=O PFQLIVQUKOIJJD-UHFFFAOYSA-L 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- GPAYUJZHTULNBE-UHFFFAOYSA-N diphenylphosphine Chemical compound C=1C=CC=CC=1PC1=CC=CC=C1 GPAYUJZHTULNBE-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 238000011905 homologation Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229940102396 methyl bromide Drugs 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- LSMAIBOZUPTNBR-UHFFFAOYSA-N phosphanium;iodide Chemical group [PH4+].[I-] LSMAIBOZUPTNBR-UHFFFAOYSA-N 0.000 description 1
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 1
- 150000003053 piperidines Chemical class 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- ZUHZGEOKBKGPSW-UHFFFAOYSA-N tetraglyme Chemical compound COCCOCCOCCOCCOC ZUHZGEOKBKGPSW-UHFFFAOYSA-N 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
- WLPUWLXVBWGYMZ-UHFFFAOYSA-N tricyclohexylphosphine Chemical compound C1CCCCC1P(C1CCCCC1)C1CCCCC1 WLPUWLXVBWGYMZ-UHFFFAOYSA-N 0.000 description 1
- GIIXTFIYICRGMZ-UHFFFAOYSA-N tris(2,3-dimethylphenyl)phosphane Chemical compound CC1=CC=CC(P(C=2C(=C(C)C=CC=2)C)C=2C(=C(C)C=CC=2)C)=C1C GIIXTFIYICRGMZ-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/49—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reaction with carbon monoxide
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
- Saccharide Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7831634A FR2441603A1 (fr) | 1978-10-31 | 1978-10-31 | Procede de preparation de l'acetaldehyde |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DD146943A5 true DD146943A5 (de) | 1981-03-11 |
Family
ID=9214627
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DD79216554A DD146943A5 (de) | 1978-10-31 | 1979-10-30 | Verfahren zur herstellung von acetaldehyd |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4293718A (OSRAM) |
| EP (1) | EP0011042B2 (OSRAM) |
| JP (1) | JPS5564539A (OSRAM) |
| AT (1) | ATE199T1 (OSRAM) |
| BR (1) | BR7907034A (OSRAM) |
| CA (1) | CA1125311A (OSRAM) |
| DD (1) | DD146943A5 (OSRAM) |
| DE (1) | DE2960788D1 (OSRAM) |
| ES (1) | ES485527A1 (OSRAM) |
| FR (1) | FR2441603A1 (OSRAM) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2460284A1 (fr) * | 1979-07-04 | 1981-01-23 | Rhone Poulenc Ind | Procede de preparation de l'acetaldehyde |
| US4320230A (en) * | 1979-09-24 | 1982-03-16 | Exxon Research & Engineering Co. | Methanol homologation using iron-cobalt carbonyl cluster catalyst |
| CA1155458A (en) * | 1980-04-09 | 1983-10-18 | Union Carbide Corporation | Process for the selective hydroformylation of methanol to acetaldehyde |
| JPS579733A (en) * | 1980-06-18 | 1982-01-19 | Mitsubishi Gas Chem Co Inc | Preparation of acetaldehyde |
| DE3031558C2 (de) * | 1980-08-21 | 1984-04-26 | Union Rheinische Braunkohlen Kraftstoff AG, 5000 Köln | Verfahren zur Herstellung von Acetaldehyd und Ethanol |
| US4361707A (en) * | 1981-08-03 | 1982-11-30 | Gulf Research & Development Company | Process for producing aldehydes |
| US4361706A (en) * | 1981-08-03 | 1982-11-30 | Gulf Research & Development Company | Process for preparing aldehydes |
| DE3368406D1 (en) * | 1982-06-05 | 1987-01-29 | Bp Chem Int Ltd | Process for the production of monocarboxylic acid anhydrides |
| GB8326986D0 (en) * | 1983-10-08 | 1983-11-09 | British Petroleum Co Plc | Production of ethanol |
| JPS6084239A (ja) * | 1983-10-14 | 1985-05-13 | Agency Of Ind Science & Technol | アセトアルデヒドの製造法 |
| DE3343519A1 (de) * | 1983-12-01 | 1985-06-13 | Union Rheinische Braunkohlen Kraftstoff AG, 5000 Köln | Selektive herstellung von acetaldehyd |
| DE3506714A1 (de) * | 1985-02-26 | 1986-08-28 | Union Rheinische Braunkohlen Kraftstoff AG, 5000 Köln | Verfahren zur kontinuierlichen homologisierung von methanol |
| JPH0374007U (OSRAM) * | 1989-11-15 | 1991-07-25 | ||
| US20050154239A1 (en) * | 2004-01-08 | 2005-07-14 | Windhorst Kenneth A. | Methods for preparing 1,3 butylene glycol |
| US9266806B1 (en) | 2014-12-30 | 2016-02-23 | Eastman Chemical Company | Reductive carbonylation of methanol to acetaldehyde |
| US9238606B1 (en) | 2014-12-30 | 2016-01-19 | Eastman Chemical Company | Methyl-Iodide-free carbonylation of methanol to acetaldehyde |
| US9365479B1 (en) | 2014-12-30 | 2016-06-14 | Eastman Chemical Company | Methyl-iodide-free carbonylation of an alcohol to its homologous aldehyde and/or alcohol |
| US9714206B2 (en) | 2014-12-30 | 2017-07-25 | Eastman Chemical Company | Methyl-iodide-free carbonylation of an alcohol to its homologous aldehyde and/or alcohol |
| US9266807B1 (en) | 2014-12-30 | 2016-02-23 | Eastman Chemical Company | Conversion of alcohols to longer chain aldehydes or alcohols |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3248432A (en) * | 1961-12-12 | 1966-04-26 | Commercial Solvents Corp | Process for the production of ethyl alcohol |
| US3356734A (en) * | 1963-02-28 | 1967-12-05 | Kuraishi Michio | Process for the production of acetaldehyde |
| US3285948A (en) * | 1965-01-22 | 1966-11-15 | Commercial Solvents Corp | Halides of ruthenium and osmium in conjunction with cobalt and iodine in the production of ethanol from methanol |
| BE842430A (nl) * | 1975-06-09 | 1976-12-01 | Werkwijze ter bereiding van ethanol uit methanol koolmonoxyde en waterstof | |
| JPS52133914A (en) * | 1976-04-30 | 1977-11-09 | Mitsubishi Gas Chem Co Inc | Preparation of acetaldehyde |
| JPS52136111A (en) * | 1976-05-10 | 1977-11-14 | Mitsubishi Gas Chem Co Inc | Preparation of acetaldehyde |
| US4151208A (en) * | 1977-12-23 | 1979-04-24 | Gulf Research & Development Company | Process for the selective preparation of acetaldehyde from methanol and synthesis gas |
-
1978
- 1978-10-31 FR FR7831634A patent/FR2441603A1/fr active Granted
-
1979
- 1979-10-22 AT AT79420052T patent/ATE199T1/de active
- 1979-10-22 EP EP79420052A patent/EP0011042B2/fr not_active Expired
- 1979-10-22 DE DE7979420052T patent/DE2960788D1/de not_active Expired
- 1979-10-23 US US06/087,631 patent/US4293718A/en not_active Expired - Lifetime
- 1979-10-26 JP JP13863179A patent/JPS5564539A/ja active Granted
- 1979-10-30 CA CA338,764A patent/CA1125311A/fr not_active Expired
- 1979-10-30 BR BR7907034A patent/BR7907034A/pt unknown
- 1979-10-30 ES ES485527A patent/ES485527A1/es not_active Expired
- 1979-10-30 DD DD79216554A patent/DD146943A5/de unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FR2441603B1 (OSRAM) | 1981-05-29 |
| ES485527A1 (es) | 1980-05-16 |
| JPS6344135B2 (OSRAM) | 1988-09-02 |
| JPS5564539A (en) | 1980-05-15 |
| EP0011042B1 (fr) | 1981-09-09 |
| ATE199T1 (de) | 1981-09-15 |
| DE2960788D1 (en) | 1981-11-26 |
| US4293718A (en) | 1981-10-06 |
| CA1125311A (fr) | 1982-06-08 |
| EP0011042B2 (fr) | 1986-03-26 |
| BR7907034A (pt) | 1980-07-15 |
| FR2441603A1 (fr) | 1980-06-13 |
| EP0011042A1 (fr) | 1980-05-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DD146943A5 (de) | Verfahren zur herstellung von acetaldehyd | |
| DE2733663C2 (OSRAM) | ||
| DE68920933T2 (de) | Produktion von Formiat-Salzen von Stickstoffbasen. | |
| DD151743A5 (de) | Verfahren zur herstellung von acetaldehyd | |
| DE2658216A1 (de) | Verfahren zur herstellung von monocarbonsaeureanhydriden | |
| DE2462444A1 (de) | Verfahren zur herstellung von monocarbonsaeureestern | |
| DE2749955C2 (de) | Verfahren zur Herstellung niedrigmolekularer Alkanmonocarbonsäuren | |
| DE69507822T2 (de) | Herstellung der carbonsäuren oder ihrer ester durch carbonylierung in gegenwart von iridium | |
| DD151301A5 (de) | Verfahren zur herstellung von aethanol aus methanol | |
| DE69314388T2 (de) | Carbonylierung von conjugierten Dienen | |
| DE69201007T2 (de) | Verfahren zur Herstellung von Adipinsäure durch Hydrocarboxylierung der Pentensäuren. | |
| DE3151371A1 (de) | Verfahren zur herstellung von carbonsaeureanhydriden | |
| DE3335595C2 (OSRAM) | ||
| DD155319A5 (de) | Verfahren zur herstellung von carbonsaeurealkylestern | |
| DD146944A5 (de) | Verfahren zur herstellung von essigsaeure,gegebenenfalls im gemisch mit methylacetat | |
| DD150196A5 (de) | Verfahren zur herstellung von monocarbonsaeuren | |
| DE3049046A1 (de) | Verfahren zur herstellung von essigsaeureanhydrid | |
| DE3343519C2 (OSRAM) | ||
| DE3136815C2 (de) | Verfahren zur Herstellung von Acetaldehyd | |
| DE2630981A1 (de) | Lactone | |
| DE2310808C2 (de) | Verfahren zur Herstellung von Propionsäure und/oder Propionsäureanhydrid | |
| DE2324765C2 (de) | Verfahren zur Herstellung von Carbonsäureestern | |
| DD200466A5 (de) | Verfahren zur herstellung von estern mittels carbonylierung von monoolefinischen verbindungen | |
| DE3512246C2 (de) | Verfahren zur Herstellung von Essigsäure | |
| DE1941501C3 (de) | Verfahren zur Herstellung von Carbonsäuren durch Umsetzen von Olefinen mit Kohlenmonoxid |