DD146178A5 - Verfahren zur herstellung von n-alkylarylaminen - Google Patents
Verfahren zur herstellung von n-alkylarylaminen Download PDFInfo
- Publication number
- DD146178A5 DD146178A5 DD213900A DD21390079A DD146178A5 DD 146178 A5 DD146178 A5 DD 146178A5 DD 213900 A DD213900 A DD 213900A DD 21390079 A DD21390079 A DD 21390079A DD 146178 A5 DD146178 A5 DD 146178A5
- Authority
- DD
- German Democratic Republic
- Prior art keywords
- carbon atoms
- radical
- catalyst
- hydrogen atom
- alkyl
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 11
- 239000003054 catalyst Substances 0.000 claims abstract description 22
- 150000004982 aromatic amines Chemical class 0.000 claims abstract description 11
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims abstract description 6
- 229910052802 copper Inorganic materials 0.000 claims abstract description 6
- 239000010949 copper Substances 0.000 claims abstract description 6
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 claims abstract description 4
- QPLDLSVMHZLSFG-UHFFFAOYSA-N Copper oxide Chemical compound [Cu]=O QPLDLSVMHZLSFG-UHFFFAOYSA-N 0.000 claims description 2
- 239000005751 Copper oxide Substances 0.000 claims description 2
- 229910000431 copper oxide Inorganic materials 0.000 claims description 2
- 239000005995 Aluminium silicate Substances 0.000 claims 1
- 235000012211 aluminium silicate Nutrition 0.000 claims 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 claims 1
- 235000019353 potassium silicate Nutrition 0.000 claims 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 claims 1
- 125000004432 carbon atom Chemical group C* 0.000 abstract description 12
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract description 6
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 abstract description 2
- 125000000217 alkyl group Chemical group 0.000 abstract description 2
- 125000002947 alkylene group Chemical group 0.000 abstract description 2
- 125000004093 cyano group Chemical group *C#N 0.000 abstract description 2
- 238000004519 manufacturing process Methods 0.000 abstract description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 abstract description 2
- 125000003545 alkoxy group Chemical group 0.000 abstract 1
- 239000007792 gaseous phase Substances 0.000 abstract 1
- 125000005843 halogen group Chemical group 0.000 abstract 1
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 12
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 8
- -1 alkyl phosphates Chemical class 0.000 description 7
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 6
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methyl-N-phenylamine Natural products CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- 239000012044 organic layer Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 3
- CDULGHZNHURECF-UHFFFAOYSA-N 2,3-dimethylaniline 2,4-dimethylaniline 2,5-dimethylaniline 2,6-dimethylaniline 3,4-dimethylaniline 3,5-dimethylaniline Chemical class CC1=CC=C(N)C(C)=C1.CC1=CC=C(C)C(N)=C1.CC1=CC(C)=CC(N)=C1.CC1=CC=C(N)C=C1C.CC1=CC=CC(N)=C1C.CC1=CC=CC(C)=C1N CDULGHZNHURECF-UHFFFAOYSA-N 0.000 description 2
- JJYPMNFTHPTTDI-UHFFFAOYSA-N 3-methylaniline Chemical compound CC1=CC=CC(N)=C1 JJYPMNFTHPTTDI-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical class CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 241000607479 Yersinia pestis Species 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- RNVCVTLRINQCPJ-UHFFFAOYSA-N o-toluidine Chemical compound CC1=CC=CC=C1N RNVCVTLRINQCPJ-UHFFFAOYSA-N 0.000 description 2
- RZXMPPFPUUCRFN-UHFFFAOYSA-N p-toluidine Chemical compound CC1=CC=C(N)C=C1 RZXMPPFPUUCRFN-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- TUONOWHEGIZLGU-UHFFFAOYSA-N 2,3-dimethylaniline;methanol Chemical compound OC.CC1=CC=CC(N)=C1C TUONOWHEGIZLGU-UHFFFAOYSA-N 0.000 description 1
- YBRVSVVVWCFQMG-UHFFFAOYSA-N 4,4'-diaminodiphenylmethane Chemical compound C1=CC(N)=CC=C1CC1=CC=C(N)C=C1 YBRVSVVVWCFQMG-UHFFFAOYSA-N 0.000 description 1
- TYMLOMAKGOJONV-UHFFFAOYSA-N 4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1 TYMLOMAKGOJONV-UHFFFAOYSA-N 0.000 description 1
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical class CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 206010035148 Plague Diseases 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- KSQVSZVMPSQMMH-UHFFFAOYSA-N aniline;propan-1-ol Chemical compound CCCO.NC1=CC=CC=C1 KSQVSZVMPSQMMH-UHFFFAOYSA-N 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000012159 carrier gas Substances 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- CSSLPRYGJIPGGN-UHFFFAOYSA-N ethanol;3-methylaniline Chemical compound CCO.CC1=CC=CC(N)=C1 CSSLPRYGJIPGGN-UHFFFAOYSA-N 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 150000004994 m-toluidines Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 150000002926 oxygen Chemical class 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 150000004992 toluidines Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C209/00—Preparation of compounds containing amino groups bound to a carbon skeleton
- C07C209/68—Preparation of compounds containing amino groups bound to a carbon skeleton from amines, by reactions not involving amino groups, e.g. reduction of unsaturated amines, aromatisation, or substitution of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C209/00—Preparation of compounds containing amino groups bound to a carbon skeleton
- C07C209/04—Preparation of compounds containing amino groups bound to a carbon skeleton by substitution of functional groups by amino groups
- C07C209/14—Preparation of compounds containing amino groups bound to a carbon skeleton by substitution of functional groups by amino groups by substitution of hydroxy groups or of etherified or esterified hydroxy groups
- C07C209/18—Preparation of compounds containing amino groups bound to a carbon skeleton by substitution of functional groups by amino groups by substitution of hydroxy groups or of etherified or esterified hydroxy groups with formation of amino groups bound to carbon atoms of six-membered aromatic rings or from amines having nitrogen atoms bound to carbon atoms of six-membered aromatic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH715778A CH633520A5 (de) | 1978-06-30 | 1978-06-30 | Verfahren zur herstellung von n-alkylarylaminen. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DD146178A5 true DD146178A5 (de) | 1981-01-28 |
Family
ID=4320802
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DD213900A DD146178A5 (de) | 1978-06-30 | 1979-06-26 | Verfahren zur herstellung von n-alkylarylaminen |
Country Status (18)
| Country | Link |
|---|---|
| EP (1) | EP0006590B1 (enExample) |
| JP (1) | JPS559063A (enExample) |
| KR (1) | KR810001701B1 (enExample) |
| AT (1) | ATE288T1 (enExample) |
| BR (1) | BR7904142A (enExample) |
| CA (1) | CA1118447A (enExample) |
| CH (1) | CH633520A5 (enExample) |
| CS (1) | CS208783B2 (enExample) |
| DD (1) | DD146178A5 (enExample) |
| DE (1) | DE2960991D1 (enExample) |
| ES (1) | ES481637A1 (enExample) |
| HU (1) | HU180833B (enExample) |
| IL (1) | IL57631A (enExample) |
| IN (1) | IN153564B (enExample) |
| PL (1) | PL116521B1 (enExample) |
| RO (1) | RO77273A (enExample) |
| SU (1) | SU955856A3 (enExample) |
| ZA (1) | ZA792863B (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2919741A1 (de) * | 1979-05-16 | 1980-11-27 | Basf Ag | Verfahren zur herstellung von m-substituierten n-methylanilinen |
| EP0190101B1 (de) * | 1985-01-29 | 1992-07-22 | Ciba-Geigy Ag | Verfahren zur Herstellung von N-Alkylanilinen |
| CN100408179C (zh) * | 2005-05-20 | 2008-08-06 | 中国科学院大连化学物理研究所 | 用于苯胺与醇气相合成n-烷基苯胺的过渡金属催化剂 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3732311A (en) * | 1970-02-24 | 1973-05-08 | Fine Organics Inc | Production of n-alkylated amines |
| US3819709A (en) * | 1970-12-09 | 1974-06-25 | New Japan Chem Co Ltd | Synthesis of n-methylaniline |
| DE2324855A1 (de) * | 1973-05-17 | 1974-12-05 | Hoechst Ag | Verfahren zur n-methylierung von aliphatischen aminen |
| DE2335906C3 (de) * | 1973-07-14 | 1978-06-15 | Basf Ag, 6700 Ludwigshafen | Verfahren zur kontinuierlichen Herstellung von N-Alkylarylaminen |
| DE2646379C3 (de) * | 1976-10-14 | 1982-04-08 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Herstellung von N-Alkylanilinen |
-
1978
- 1978-06-30 CH CH715778A patent/CH633520A5/de not_active IP Right Cessation
-
1979
- 1979-06-08 ZA ZA792863A patent/ZA792863B/xx unknown
- 1979-06-13 IN IN613/CAL/79A patent/IN153564B/en unknown
- 1979-06-18 ES ES481637A patent/ES481637A1/es not_active Expired
- 1979-06-21 JP JP7865079A patent/JPS559063A/ja active Pending
- 1979-06-22 EP EP79102070A patent/EP0006590B1/de not_active Expired
- 1979-06-22 AT AT79102070T patent/ATE288T1/de active
- 1979-06-22 DE DE7979102070T patent/DE2960991D1/de not_active Expired
- 1979-06-22 IL IL57631A patent/IL57631A/xx unknown
- 1979-06-26 DD DD213900A patent/DD146178A5/de unknown
- 1979-06-28 PL PL1979216679A patent/PL116521B1/pl unknown
- 1979-06-28 CS CS794489A patent/CS208783B2/cs unknown
- 1979-06-28 HU HU79LO433A patent/HU180833B/hu unknown
- 1979-06-28 SU SU792784304A patent/SU955856A3/ru active
- 1979-06-29 CA CA000330851A patent/CA1118447A/en not_active Expired
- 1979-06-30 RO RO7998006A patent/RO77273A/ro unknown
- 1979-06-30 KR KR7902163A patent/KR810001701B1/ko not_active Expired
- 1979-07-29 BR BR7904142A patent/BR7904142A/pt unknown
Also Published As
| Publication number | Publication date |
|---|---|
| EP0006590B1 (de) | 1981-10-14 |
| ATE288T1 (de) | 1981-10-15 |
| ES481637A1 (es) | 1980-06-16 |
| JPS559063A (en) | 1980-01-22 |
| PL216679A1 (enExample) | 1980-02-25 |
| HU180833B (en) | 1983-04-29 |
| EP0006590A1 (de) | 1980-01-09 |
| BR7904142A (pt) | 1980-03-25 |
| IL57631A0 (en) | 1979-10-31 |
| RO77273A (ro) | 1981-08-17 |
| SU955856A3 (ru) | 1982-08-30 |
| ZA792863B (en) | 1980-06-25 |
| KR810001701B1 (ko) | 1981-10-27 |
| CS208783B2 (en) | 1981-09-15 |
| IN153564B (enExample) | 1984-07-28 |
| DE2960991D1 (en) | 1981-12-24 |
| CH633520A5 (de) | 1982-12-15 |
| PL116521B1 (en) | 1981-06-30 |
| CA1118447A (en) | 1982-02-16 |
| IL57631A (en) | 1983-02-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2633811C2 (de) | Verfahren zur Herstellung von Nitrodiphenylaminen | |
| DE2503187C3 (de) | Verfahren zur Herstellung durch Chlor meta-substituierte Aniline | |
| DE69006911T2 (de) | Verfahren zur Herstellung von 3,4-Dichloranilin. | |
| IE46944B1 (en) | Denitrosation of organic nitrosamines | |
| DE2155495A1 (de) | Verfahren zur herstellung von benzylidenverbindungen | |
| US3957874A (en) | Continuous production of n-alkylarylamines | |
| DD146178A5 (de) | Verfahren zur herstellung von n-alkylarylaminen | |
| DE69003935T2 (de) | Herstellung eines N-substituierten Phenylendiamins. | |
| EP0135833B1 (de) | Verfahren zur Herstellung von 2-Amino-alkylpyridinen | |
| DE2348738A1 (de) | N-alkylierung aromatischer amine | |
| CH507193A (de) | Verfahren zur Herstellung halogenierter primärer aromatischer Amine | |
| EP0004623A1 (de) | Verfahren zur Herstellung von aromatischen Aminen | |
| EP0173202B1 (de) | Verfahren zur Herstellung von Chlor-o-nitroanilinen | |
| EP0018576B1 (de) | Verfahren zur Herstellung von N-alkylierten aromatischen Aminen | |
| EP0481316B1 (de) | Verfahren zur Herstellung von 2,2-Bis-(aminophenyl)-propan | |
| DE671785C (de) | Verfahren zur Herstellung von Trichloracetamidin und dessen Derivaten | |
| DE2810666B2 (de) | Verfahren zur Herstellung von p-Amino-diphenylamin | |
| DE3317875A1 (de) | 1-alkyl-2-isocyanatomethyl-isocyanato-cyclohexane und/oder 1-alkyl-4-isocyanatomethyl-isocyanato-cyclohexane sowie die entsprechenden diamine, verfahren zu deren herstellung und verwendung | |
| DD210030A5 (de) | Verfahren zur herstellung gegebenenfalls halogenierter aniline | |
| DE2136616A1 (de) | 2,4 Dinitro 1,3 phenylendiamine und ihre Verwendung | |
| EP0513640B1 (de) | Verfahren zur Herstellung von Dicyclohexylaminen | |
| DE2714255A1 (de) | Verfahren zur herstellung von m-aminophenolen und deren verwendung | |
| DE2544504C2 (de) | Verfahren zur Herstellung von Diarylaminen | |
| DE2405370A1 (de) | Verfahren zur herstellung von propargylamin | |
| DE745560C (de) | Verfahren zur Herstellung sekundaerer und tertiaerer aromatischer Amine |