CZ280524B6 - Částicové detergenční směsi - Google Patents
Částicové detergenční směsi Download PDFInfo
- Publication number
- CZ280524B6 CZ280524B6 CS924071A CS407192A CZ280524B6 CZ 280524 B6 CZ280524 B6 CZ 280524B6 CS 924071 A CS924071 A CS 924071A CS 407192 A CS407192 A CS 407192A CZ 280524 B6 CZ280524 B6 CZ 280524B6
- Authority
- CZ
- Czechia
- Prior art keywords
- zeolite
- detergent
- zeolite map
- detergent composition
- weight
- Prior art date
Links
- 239000010457 zeolite Substances 0.000 title claims abstract description 62
- 229910021536 Zeolite Inorganic materials 0.000 title claims abstract description 58
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 title claims abstract description 58
- 239000003599 detergent Substances 0.000 title claims abstract description 43
- 239000000203 mixture Substances 0.000 title claims abstract description 40
- 238000004061 bleaching Methods 0.000 title claims abstract description 13
- 239000007844 bleaching agent Substances 0.000 claims abstract description 25
- XSVSPKKXQGNHMD-UHFFFAOYSA-N 5-bromo-3-methyl-1,2-thiazole Chemical compound CC=1C=C(Br)SN=1 XSVSPKKXQGNHMD-UHFFFAOYSA-N 0.000 claims abstract description 19
- 150000001875 compounds Chemical class 0.000 claims abstract description 14
- 229910052782 aluminium Inorganic materials 0.000 claims abstract description 13
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims abstract description 13
- -1 alkali metal aluminum silicate Chemical class 0.000 claims description 19
- 239000002243 precursor Substances 0.000 claims description 15
- 239000004615 ingredient Substances 0.000 claims description 9
- 229910052710 silicon Inorganic materials 0.000 claims description 9
- 239000010703 silicon Substances 0.000 claims description 9
- 229910052783 alkali metal Inorganic materials 0.000 claims description 8
- 239000002245 particle Substances 0.000 claims description 8
- 238000003860 storage Methods 0.000 abstract description 5
- 229910052910 alkali metal silicate Inorganic materials 0.000 abstract description 2
- 239000000843 powder Substances 0.000 description 13
- 238000000034 method Methods 0.000 description 9
- 239000002585 base Substances 0.000 description 6
- 239000002736 nonionic surfactant Substances 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 239000000344 soap Substances 0.000 description 5
- 239000004094 surface-active agent Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 150000004965 peroxy acids Chemical class 0.000 description 4
- 229920000642 polymer Polymers 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- BGRWYDHXPHLNKA-UHFFFAOYSA-N Tetraacetylethylenediamine Chemical compound CC(=O)N(C(C)=O)CCN(C(C)=O)C(C)=O BGRWYDHXPHLNKA-UHFFFAOYSA-N 0.000 description 3
- 125000000129 anionic group Chemical group 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical class OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 229920005646 polycarboxylate Polymers 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- 238000001694 spray drying Methods 0.000 description 3
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical compound [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 description 2
- 102000005701 Calcium-Binding Proteins Human genes 0.000 description 2
- 108010045403 Calcium-Binding Proteins Proteins 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 150000008051 alkyl sulfates Chemical group 0.000 description 2
- 239000003945 anionic surfactant Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 229910001424 calcium ion Inorganic materials 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 230000036571 hydration Effects 0.000 description 2
- 238000006703 hydration reaction Methods 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229920005996 polystyrene-poly(ethylene-butylene)-polystyrene Polymers 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- QSKQNALVHFTOQX-UHFFFAOYSA-M sodium nonanoyloxybenzenesulfonate Chemical compound [Na+].CCCCCCCCC(=O)OC1=CC=CC=C1S([O-])(=O)=O QSKQNALVHFTOQX-UHFFFAOYSA-M 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- CIOXZGOUEYHNBF-UHFFFAOYSA-N (carboxymethoxy)succinic acid Chemical class OC(=O)COC(C(O)=O)CC(O)=O CIOXZGOUEYHNBF-UHFFFAOYSA-N 0.000 description 1
- CFPOJWPDQWJEMO-UHFFFAOYSA-N 2-(1,2-dicarboxyethoxy)butanedioic acid Chemical class OC(=O)CC(C(O)=O)OC(C(O)=O)CC(O)=O CFPOJWPDQWJEMO-UHFFFAOYSA-N 0.000 description 1
- LVVZBNKWTVZSIU-UHFFFAOYSA-N 2-(carboxymethoxy)propanedioic acid Chemical class OC(=O)COC(C(O)=O)C(O)=O LVVZBNKWTVZSIU-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- OCUCCJIRFHNWBP-IYEMJOQQSA-L Copper gluconate Chemical class [Cu+2].OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O OCUCCJIRFHNWBP-IYEMJOQQSA-L 0.000 description 1
- JYXGIOKAKDAARW-UHFFFAOYSA-N N-(2-hydroxyethyl)iminodiacetic acid Chemical class OCCN(CC(O)=O)CC(O)=O JYXGIOKAKDAARW-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- SCKXCAADGDQQCS-UHFFFAOYSA-N Performic acid Chemical compound OOC=O SCKXCAADGDQQCS-UHFFFAOYSA-N 0.000 description 1
- GBFLZEXEOZUWRN-VKHMYHEASA-N S-carboxymethyl-L-cysteine Chemical compound OC(=O)[C@@H](N)CSCC(O)=O GBFLZEXEOZUWRN-VKHMYHEASA-N 0.000 description 1
- 239000004115 Sodium Silicate Substances 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- ULUAUXLGCMPNKK-UHFFFAOYSA-N Sulfobutanedioic acid Chemical class OC(=O)CC(C(O)=O)S(O)(=O)=O ULUAUXLGCMPNKK-UHFFFAOYSA-N 0.000 description 1
- 229920006243 acrylic copolymer Polymers 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical group [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- MMCOUVMKNAHQOY-UHFFFAOYSA-N carbonoperoxoic acid Chemical compound OOC(O)=O MMCOUVMKNAHQOY-UHFFFAOYSA-N 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 235000019864 coconut oil Nutrition 0.000 description 1
- 239000003240 coconut oil Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000000280 densification Methods 0.000 description 1
- RUYJNKYXOHIGPH-UHFFFAOYSA-N dialuminum;trioxido(trioxidosilyloxy)silane Chemical compound [Al+3].[Al+3].[O-][Si]([O-])([O-])O[Si]([O-])([O-])[O-] RUYJNKYXOHIGPH-UHFFFAOYSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 229930182478 glucoside Natural products 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229910017053 inorganic salt Inorganic materials 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- XCRBXWCUXJNEFX-UHFFFAOYSA-N peroxybenzoic acid Chemical compound OOC(=O)C1=CC=CC=C1 XCRBXWCUXJNEFX-UHFFFAOYSA-N 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 125000005496 phosphonium group Chemical group 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920001983 poloxamer Polymers 0.000 description 1
- 229920000058 polyacrylate Polymers 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- 150000003138 primary alcohols Chemical class 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 150000003333 secondary alcohols Chemical class 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- 229910052911 sodium silicate Inorganic materials 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- YDLQSTFHBCVEJV-UHFFFAOYSA-M sodium;2-(3,5,5-trimethylhexanoyloxy)benzenesulfonate Chemical compound [Na+].CC(C)(C)CC(C)CC(=O)OC1=CC=CC=C1S([O-])(=O)=O YDLQSTFHBCVEJV-UHFFFAOYSA-M 0.000 description 1
- GHKCMSLSUYMTNI-UHFFFAOYSA-M sodium;3-benzoyloxy-4-methylbenzenesulfonate Chemical compound [Na+].CC1=CC=C(S([O-])(=O)=O)C=C1OC(=O)C1=CC=CC=C1 GHKCMSLSUYMTNI-UHFFFAOYSA-M 0.000 description 1
- XVESOXRSUKAXRD-UHFFFAOYSA-M sodium;3-benzoyloxy-4-methylbenzoate Chemical compound [Na+].CC1=CC=C(C([O-])=O)C=C1OC(=O)C1=CC=CC=C1 XVESOXRSUKAXRD-UHFFFAOYSA-M 0.000 description 1
- OVONNAXAHAIEDF-UHFFFAOYSA-M sodium;4-benzoyloxybenzenesulfonate Chemical compound [Na+].C1=CC(S(=O)(=O)[O-])=CC=C1OC(=O)C1=CC=CC=C1 OVONNAXAHAIEDF-UHFFFAOYSA-M 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 150000003890 succinate salts Chemical class 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 1
- 230000004580 weight loss Effects 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/02—Inorganic compounds ; Elemental compounds
- C11D3/12—Water-insoluble compounds
- C11D3/124—Silicon containing, e.g. silica, silex, quartz or glass beads
- C11D3/1246—Silicates, e.g. diatomaceous earth
- C11D3/1253—Layer silicates, e.g. talcum, kaolin, clay, bentonite, smectite, montmorillonite, hectorite or attapulgite
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D1/00—Detergent compositions based essentially on surface-active compounds; Use of these compounds as a detergent
- C11D1/66—Non-ionic compounds
- C11D1/83—Mixtures of non-ionic with anionic compounds
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D11/00—Special methods for preparing compositions containing mixtures of detergents
- C11D11/0082—Special methods for preparing compositions containing mixtures of detergents one or more of the detergent ingredients being in a liquefied state, e.g. slurry, paste or melt, and the process resulting in solid detergent particles such as granules, powders or beads
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D17/00—Detergent materials or soaps characterised by their shape or physical properties
- C11D17/06—Powder; Flakes; Free-flowing mixtures; Sheets
- C11D17/065—High-density particulate detergent compositions
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/02—Inorganic compounds ; Elemental compounds
- C11D3/12—Water-insoluble compounds
- C11D3/124—Silicon containing, e.g. silica, silex, quartz or glass beads
- C11D3/1246—Silicates, e.g. diatomaceous earth
- C11D3/128—Aluminium silicates, e.g. zeolites
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/39—Organic or inorganic per-compounds
- C11D3/3942—Inorganic per-compounds
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D1/00—Detergent compositions based essentially on surface-active compounds; Use of these compounds as a detergent
- C11D1/02—Anionic compounds
- C11D1/12—Sulfonic acids or sulfuric acid esters; Salts thereof
- C11D1/14—Sulfonic acids or sulfuric acid esters; Salts thereof derived from aliphatic hydrocarbons or mono-alcohols
- C11D1/146—Sulfuric acid esters
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D1/00—Detergent compositions based essentially on surface-active compounds; Use of these compounds as a detergent
- C11D1/66—Non-ionic compounds
- C11D1/72—Ethers of polyoxyalkylene glycols
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB929201059A GB9201059D0 (en) | 1991-11-26 | 1992-01-17 | Detergent compositions |
| GB929225610A GB9225610D0 (en) | 1992-01-17 | 1992-12-08 | Detergent composition |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| CZ407192A3 CZ407192A3 (en) | 1994-01-19 |
| CZ280524B6 true CZ280524B6 (cs) | 1996-02-14 |
Family
ID=26300177
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS924071A CZ280524B6 (cs) | 1992-01-17 | 1992-12-31 | Částicové detergenční směsi |
| CS924072A CZ280593B6 (cs) | 1992-01-17 | 1992-12-31 | Částicové detergenční směsi |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS924072A CZ280593B6 (cs) | 1992-01-17 | 1992-12-31 | Částicové detergenční směsi |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US5259982A (enEXAMPLES) |
| EP (1) | EP0552053B1 (enEXAMPLES) |
| JP (1) | JPH0680988A (enEXAMPLES) |
| CN (1) | CN1045310C (enEXAMPLES) |
| AU (1) | AU662586B2 (enEXAMPLES) |
| BR (1) | BR9300205A (enEXAMPLES) |
| CA (1) | CA2087307C (enEXAMPLES) |
| CZ (2) | CZ280524B6 (enEXAMPLES) |
| DE (1) | DE69300873T2 (enEXAMPLES) |
| ES (1) | ES2081173T3 (enEXAMPLES) |
| HK (1) | HK29596A (enEXAMPLES) |
| HU (1) | HU213246B (enEXAMPLES) |
| ID (1) | ID1052B (enEXAMPLES) |
| IN (2) | IN176921B (enEXAMPLES) |
| MY (2) | MY108857A (enEXAMPLES) |
| PL (1) | PL170757B1 (enEXAMPLES) |
| SK (1) | SK278833B6 (enEXAMPLES) |
| TW (1) | TW260706B (enEXAMPLES) |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB8825783D0 (en) * | 1988-11-03 | 1988-12-07 | Unilever Plc | Novel aluminosilicates & detergent compositions containing them |
| GB9113675D0 (en) * | 1991-06-25 | 1991-08-14 | Unilever Plc | Particulate detergent composition or component |
| SK278834B6 (sk) * | 1992-01-17 | 1998-03-04 | Unilever Nv | Časticová bieliaca detergentná zmes |
| GB9216386D0 (en) * | 1992-07-31 | 1992-09-16 | Unilever Plc | Use of aluminosilicates of the zeolite p type as low temperature calcium binders |
| TR27586A (tr) * | 1992-09-01 | 1995-06-13 | Procter & Gamble | Yüksek yogunlukla zerre deterjanin yapilmasi icin islem ve islem ile yapilan bilesimler. |
| GB9225609D0 (en) * | 1992-12-08 | 1993-01-27 | Unilever Plc | Detergent composition |
| GB9305599D0 (en) * | 1993-03-18 | 1993-05-05 | Unilever Plc | Detergent compositions |
| DE4319935A1 (de) * | 1993-06-16 | 1994-12-22 | Basf Ag | Verwendung von Glycin-N,N-diessigsäure-Derivaten als Komplexbildner für Erdalkali- und Schwermetallionen |
| US5389277A (en) * | 1993-09-30 | 1995-02-14 | Shell Oil Company | Secondary alkyl sulfate-containing powdered laundry detergent compositions |
| GB2288187A (en) * | 1994-03-31 | 1995-10-11 | Procter & Gamble | Detergent composition |
| GB2288813A (en) * | 1994-04-28 | 1995-11-01 | Procter & Gamble | Granular Detergent Composition |
| DE69510074T2 (de) * | 1994-09-29 | 1999-10-21 | Unilever N.V., Rotterdam | Körnige hochaktive waschmittelzusammensetzungen und verfahren zu ihrer herstellung |
| GB9500738D0 (en) * | 1995-01-14 | 1995-03-08 | Procter & Gamble | Detergent composition |
| US6440922B1 (en) | 1995-01-14 | 2002-08-27 | The Procter & Gamble Company | Detergent composition comprising zeolite and amylase enzyme |
| GB9500737D0 (en) * | 1995-01-14 | 1995-03-08 | Procter & Gamble | Detergent composition |
| US5958871A (en) * | 1995-09-26 | 1999-09-28 | The Procter & Gamble Company | Detergent composition based on zeolite-bicarbonate builder mixture |
| GB9519587D0 (en) * | 1995-09-26 | 1995-11-29 | Procter & Gamble | Detergent compositions |
| GB9519606D0 (en) * | 1995-09-26 | 1995-11-29 | Procter & Gamble | Detergent composition |
| EP0934380A4 (en) * | 1996-10-18 | 1999-12-22 | Procter & Gamble | DETERGENT COMPOSITION |
| GB9716139D0 (en) | 1997-08-01 | 1997-10-08 | Solvay Interox Ltd | Process for stabilishing particulate alkali metal percarbonate |
| MY133398A (en) * | 1999-07-09 | 2007-11-30 | Colgate Palmolive Co | Fabric cleaning composition containing zeolite |
| US6204239B1 (en) * | 1999-11-24 | 2001-03-20 | Colgate-Palmolive, Inc. | Fabric cleaning composition containing zeolite |
Family Cites Families (29)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL113890C (enEXAMPLES) * | 1955-07-27 | |||
| GB864798A (en) * | 1958-03-20 | 1961-04-06 | Unilever Ltd | Bleaching processes and compositions |
| BE591624A (enEXAMPLES) * | 1959-06-19 | |||
| GB1003310A (en) * | 1963-01-15 | 1965-09-02 | Unilever Ltd | Bleaching processes and compositions |
| US3332882A (en) * | 1964-12-18 | 1967-07-25 | Fmc Corp | Peroxygen compositions |
| GB1519351A (en) * | 1975-01-29 | 1978-07-26 | Unilever Ltd | Preparation of acetoxy arylene sulphonates |
| US4128494A (en) * | 1976-09-01 | 1978-12-05 | Produits Chimiques Ugine Kuhlmann | Activators for percompounds |
| US4397757A (en) * | 1979-11-16 | 1983-08-09 | Lever Brothers Company | Bleaching compositions having quarternary ammonium activators |
| EP0091159B1 (en) * | 1982-04-02 | 1985-09-11 | Unilever N.V. | Process for preparing sugar acetates |
| CA1202854A (en) * | 1982-06-10 | 1986-04-08 | Muthumi Kuroda | Bleaching detergent composition |
| US4412934A (en) * | 1982-06-30 | 1983-11-01 | The Procter & Gamble Company | Bleaching compositions |
| GB8304990D0 (en) * | 1983-02-23 | 1983-03-30 | Procter & Gamble | Detergent ingredients |
| DE3337921A1 (de) * | 1983-10-19 | 1985-05-02 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von alkali- und erdalkalisalzen von acyloxibenzolfulfonsaeuren |
| GB8422158D0 (en) * | 1984-09-01 | 1984-10-03 | Procter & Gamble Ltd | Bleach compositions |
| TR22733A (tr) * | 1984-12-14 | 1988-05-24 | Clorox Co | Fenilen mono-ve diester perasit iptidai maddeler |
| US4751015A (en) * | 1987-03-17 | 1988-06-14 | Lever Brothers Company | Quaternary ammonium or phosphonium substituted peroxy carbonic acid precursors and their use in detergent bleach compositions |
| US4933103A (en) * | 1987-03-23 | 1990-06-12 | Kao Corporation | Bleaching composition |
| US4915863A (en) * | 1987-08-14 | 1990-04-10 | Kao Corporation | Bleaching composition |
| EP0331229B1 (en) * | 1988-03-01 | 1993-08-18 | Unilever N.V. | Quaternary ammonium compounds for use in bleaching systems |
| CA2001927C (en) * | 1988-11-03 | 1999-12-21 | Graham Thomas Brown | Aluminosilicates and detergent compositions |
| GB8924294D0 (en) * | 1989-10-27 | 1989-12-13 | Unilever Plc | Detergent compositions |
| GB9006171D0 (en) * | 1990-03-19 | 1990-05-16 | Unilever Plc | Detergent compositions |
| EP0448297A1 (en) * | 1990-03-19 | 1991-09-25 | Unilever Plc | Detergent compositions |
| GB9011618D0 (en) * | 1990-05-24 | 1990-07-11 | Unilever Plc | Bleaching composition |
| GB9012001D0 (en) * | 1990-05-30 | 1990-07-18 | Unilever Plc | Bleaching composition |
| GB9104547D0 (en) * | 1991-03-05 | 1991-04-17 | Unilever Plc | Detergent compositions |
| GB9113674D0 (en) * | 1991-06-25 | 1991-08-14 | Unilever Plc | Detergent compositions |
| JPH054799A (ja) * | 1991-06-27 | 1993-01-14 | Toyota Autom Loom Works Ltd | フオークリフトのバーコード読み取り装置 |
| SK278834B6 (sk) * | 1992-01-17 | 1998-03-04 | Unilever Nv | Časticová bieliaca detergentná zmes |
-
1992
- 1992-12-31 SK SK4071-92A patent/SK278833B6/sk not_active IP Right Cessation
- 1992-12-31 CZ CS924071A patent/CZ280524B6/cs not_active IP Right Cessation
- 1992-12-31 CZ CS924072A patent/CZ280593B6/cs not_active IP Right Cessation
-
1993
- 1993-01-14 MY MYPI93000064A patent/MY108857A/en unknown
- 1993-01-14 CA CA002087307A patent/CA2087307C/en not_active Expired - Lifetime
- 1993-01-14 JP JP5004631A patent/JPH0680988A/ja active Pending
- 1993-01-14 MY MYPI93000063A patent/MY109046A/en unknown
- 1993-01-15 US US08/006,012 patent/US5259982A/en not_active Expired - Lifetime
- 1993-01-15 AU AU31812/93A patent/AU662586B2/en not_active Expired
- 1993-01-15 EP EP93300260A patent/EP0552053B1/en not_active Expired - Lifetime
- 1993-01-15 HU HU9300101A patent/HU213246B/hu unknown
- 1993-01-15 PL PL93297437A patent/PL170757B1/pl unknown
- 1993-01-15 BR BR9300205A patent/BR9300205A/pt not_active IP Right Cessation
- 1993-01-15 DE DE69300873T patent/DE69300873T2/de not_active Expired - Lifetime
- 1993-01-15 ES ES93300260T patent/ES2081173T3/es not_active Expired - Lifetime
- 1993-01-16 ID IDP537293A patent/ID1052B/id unknown
- 1993-01-16 CN CN93101070A patent/CN1045310C/zh not_active Expired - Lifetime
- 1993-01-18 IN IN15BO1993 patent/IN176921B/en unknown
- 1993-01-18 IN IN16BO1993 patent/IN176922B/en unknown
- 1993-02-25 TW TW082101379A patent/TW260706B/zh not_active IP Right Cessation
-
1996
- 1996-02-15 HK HK29596A patent/HK29596A/en not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| US5259982A (en) | 1993-11-09 |
| EP0552053A1 (en) | 1993-07-21 |
| CN1045310C (zh) | 1999-09-29 |
| SK407192A3 (en) | 1994-08-10 |
| CN1074705A (zh) | 1993-07-28 |
| JPH0680988A (ja) | 1994-03-22 |
| CA2087307A1 (en) | 1993-07-18 |
| CZ407292A3 (en) | 1994-01-19 |
| HUT63453A (en) | 1993-08-30 |
| IN176921B (enEXAMPLES) | 1996-10-05 |
| MY108857A (en) | 1996-11-30 |
| TW260706B (enEXAMPLES) | 1995-10-21 |
| EP0552053B1 (en) | 1995-11-29 |
| HK29596A (en) | 1996-02-23 |
| HU213246B (en) | 1997-04-28 |
| CA2087307C (en) | 1999-03-23 |
| HU9300101D0 (en) | 1993-04-28 |
| CZ407192A3 (en) | 1994-01-19 |
| IN176922B (enEXAMPLES) | 1996-10-05 |
| ES2081173T3 (es) | 1996-02-16 |
| AU3181293A (en) | 1993-07-29 |
| DE69300873D1 (de) | 1996-01-11 |
| PL170757B1 (pl) | 1997-01-31 |
| BR9300205A (pt) | 1993-07-20 |
| PL297437A1 (en) | 1993-09-20 |
| CZ280593B6 (cs) | 1996-02-14 |
| DE69300873T2 (de) | 1996-04-18 |
| AU662586B2 (en) | 1995-09-07 |
| SK278833B6 (sk) | 1998-03-04 |
| ID1052B (id) | 1996-10-30 |
| MY109046A (en) | 1996-11-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CZ280524B6 (cs) | Částicové detergenční směsi | |
| EP0552054B1 (en) | Detergent compositions | |
| US5238594A (en) | Detergent compositions | |
| KR960001018B1 (ko) | 세제 조성물 | |
| EP0730637B2 (en) | Detergent compositions and process for preparing them | |
| CA2153312C (en) | Detergent composition and process for producing it | |
| US5498342A (en) | Detergent composition containing zeolite map and organic peroxyacid | |
| JPH07504696A (ja) | 顆粒状洗剤組成物 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| IF00 | In force as of 2000-06-30 in czech republic | ||
| MK4A | Patent expired |
Effective date: 20121231 |