CS465690A3 - Benzanilide derivatives - Google Patents
Benzanilide derivatives Download PDFInfo
- Publication number
- CS465690A3 CS465690A3 CS904656A CS465690A CS465690A3 CS 465690 A3 CS465690 A3 CS 465690A3 CS 904656 A CS904656 A CS 904656A CS 465690 A CS465690 A CS 465690A CS 465690 A3 CS465690 A3 CS 465690A3
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- formula
- benzamide
- methylthio
- compound
- methoxy
- Prior art date
Links
- ZVSKZLHKADLHSD-UHFFFAOYSA-N benzanilide Chemical class C=1C=CC=CC=1C(=O)NC1=CC=CC=C1 ZVSKZLHKADLHSD-UHFFFAOYSA-N 0.000 title claims abstract description 6
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 21
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 20
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims abstract description 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 9
- 239000001257 hydrogen Substances 0.000 claims abstract description 8
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 7
- 125000002252 acyl group Chemical group 0.000 claims abstract description 6
- 125000005236 alkanoylamino group Chemical group 0.000 claims abstract description 6
- 239000001301 oxygen Substances 0.000 claims abstract description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 5
- 125000005842 heteroatom Chemical group 0.000 claims abstract description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims abstract description 4
- 229910052736 halogen Inorganic materials 0.000 claims abstract 3
- 150000002367 halogens Chemical class 0.000 claims abstract 3
- -1 2-methylthioethylaminocarbonyl Chemical group 0.000 claims description 94
- 150000001875 compounds Chemical class 0.000 claims description 43
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 claims description 40
- 125000004432 carbon atom Chemical group C* 0.000 claims description 24
- 229910052717 sulfur Inorganic materials 0.000 claims description 18
- 238000000034 method Methods 0.000 claims description 12
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 10
- 229910052757 nitrogen Inorganic materials 0.000 claims description 10
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 8
- 239000000460 chlorine Substances 0.000 claims description 5
- 125000005843 halogen group Chemical group 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 4
- 239000011203 carbon fibre reinforced carbon Substances 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 239000008194 pharmaceutical composition Substances 0.000 claims description 4
- 239000011593 sulfur Substances 0.000 claims description 4
- CREMABGTGYGIQB-UHFFFAOYSA-N carbon carbon Chemical compound C.C CREMABGTGYGIQB-UHFFFAOYSA-N 0.000 claims description 3
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 claims description 3
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 3
- 125000006527 (C1-C5) alkyl group Chemical group 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical group FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 150000008064 anhydrides Chemical class 0.000 claims description 2
- 239000003085 diluting agent Substances 0.000 claims description 2
- 239000011737 fluorine Chemical group 0.000 claims description 2
- 229910052731 fluorine Chemical group 0.000 claims description 2
- 125000002541 furyl group Chemical group 0.000 claims description 2
- 125000003386 piperidinyl group Chemical group 0.000 claims description 2
- 125000004076 pyridyl group Chemical group 0.000 claims description 2
- 125000000719 pyrrolidinyl group Chemical group 0.000 claims description 2
- 229910052727 yttrium Inorganic materials 0.000 claims description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims 3
- MZWDTNUNKXARGK-UHFFFAOYSA-N 3-[[4-(decylamino)benzoyl]amino]-4-methoxy-n-(2-methylsulfanylethyl)benzamide Chemical compound C1=CC(NCCCCCCCCCC)=CC=C1C(=O)NC1=CC(C(=O)NCCSC)=CC=C1OC MZWDTNUNKXARGK-UHFFFAOYSA-N 0.000 claims 1
- 125000005194 alkoxycarbonyloxy group Chemical group 0.000 claims 1
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- 239000003814 drug Substances 0.000 claims 1
- 125000002757 morpholinyl group Chemical group 0.000 claims 1
- 230000001681 protective effect Effects 0.000 claims 1
- 125000004434 sulfur atom Chemical group 0.000 claims 1
- 125000001113 thiadiazolyl group Chemical group 0.000 claims 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 abstract description 4
- 230000000879 anti-atherosclerotic effect Effects 0.000 abstract description 2
- 239000003795 chemical substances by application Substances 0.000 abstract description 2
- 150000002431 hydrogen Chemical class 0.000 abstract 3
- 125000000623 heterocyclic group Chemical group 0.000 abstract 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 141
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 108
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 66
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 51
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 46
- 239000000203 mixture Substances 0.000 description 31
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 27
- 238000000921 elemental analysis Methods 0.000 description 21
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 18
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 17
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 15
- 239000003208 petroleum Substances 0.000 description 12
- 229910052799 carbon Inorganic materials 0.000 description 10
- 239000007787 solid Substances 0.000 description 10
- 238000002844 melting Methods 0.000 description 9
- 230000008018 melting Effects 0.000 description 9
- 238000001953 recrystallisation Methods 0.000 description 9
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 8
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 8
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 6
- 239000013078 crystal Substances 0.000 description 6
- 229960004132 diethyl ether Drugs 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 6
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 5
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- 238000001665 trituration Methods 0.000 description 5
- YAMRKMLTCHKZJD-UHFFFAOYSA-N 3-amino-n-(2-methoxyethyl)-4-methylsulfanylbenzamide Chemical compound COCCNC(=O)C1=CC=C(SC)C(N)=C1 YAMRKMLTCHKZJD-UHFFFAOYSA-N 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 230000002950 deficient Effects 0.000 description 4
- 239000003480 eluent Substances 0.000 description 4
- 238000003818 flash chromatography Methods 0.000 description 4
- 239000003701 inert diluent Substances 0.000 description 4
- 230000005764 inhibitory process Effects 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 4
- 235000019341 magnesium sulphate Nutrition 0.000 description 4
- ASUDFOJKTJLAIK-UHFFFAOYSA-N 2-methoxyethanamine Chemical compound COCCN ASUDFOJKTJLAIK-UHFFFAOYSA-N 0.000 description 3
- HROAZOWBCJDYFT-UHFFFAOYSA-N 4-decoxybenzamide Chemical compound CCCCCCCCCCOC1=CC=C(C(N)=O)C=C1 HROAZOWBCJDYFT-UHFFFAOYSA-N 0.000 description 3
- NZNICZRIRMGOFG-UHFFFAOYSA-N 4-decoxybenzoic acid Chemical compound CCCCCCCCCCOC1=CC=C(C(O)=O)C=C1 NZNICZRIRMGOFG-UHFFFAOYSA-N 0.000 description 3
- BPZVSOOQLVSCDF-UHFFFAOYSA-N 4-methylsulfanyl-3-nitrobenzoic acid Chemical compound CSC1=CC=C(C(O)=O)C=C1[N+]([O-])=O BPZVSOOQLVSCDF-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 235000012000 cholesterol Nutrition 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- UQLQARPYHKDGAI-UHFFFAOYSA-N n-(2-methoxyethyl)-4-methylsulfanyl-3-nitrobenzamide Chemical compound COCCNC(=O)C1=CC=C(SC)C([N+]([O-])=O)=C1 UQLQARPYHKDGAI-UHFFFAOYSA-N 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- CYSGHNMQYZDMIA-UHFFFAOYSA-N 1,3-Dimethyl-2-imidazolidinon Chemical compound CN1CCN(C)C1=O CYSGHNMQYZDMIA-UHFFFAOYSA-N 0.000 description 2
- CYWGSFFHHMQKET-UHFFFAOYSA-N 2-methylsulfanylethanamine Chemical compound CSCCN CYWGSFFHHMQKET-UHFFFAOYSA-N 0.000 description 2
- ALNGFXNHCQVYOE-UHFFFAOYSA-N 4-decylsulfanylbenzoic acid Chemical compound CCCCCCCCCCSC1=CC=C(C(O)=O)C=C1 ALNGFXNHCQVYOE-UHFFFAOYSA-N 0.000 description 2
- DIFYZPFWWWWNBX-UHFFFAOYSA-N 4-methoxy-n-(2-methylsulfanylethyl)-3-nitrobenzamide Chemical compound COC1=CC=C(C(=O)NCCSC)C=C1[N+]([O-])=O DIFYZPFWWWWNBX-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 229940072049 amyl acetate Drugs 0.000 description 2
- PGMYKACGEOXYJE-UHFFFAOYSA-N anhydrous amyl acetate Natural products CCCCCOC(C)=O PGMYKACGEOXYJE-UHFFFAOYSA-N 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- MNWFXJYAOYHMED-UHFFFAOYSA-M heptanoate Chemical compound CCCCCCC([O-])=O MNWFXJYAOYHMED-UHFFFAOYSA-M 0.000 description 2
- 238000001727 in vivo Methods 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- CNJJSTPBUHAEFH-UHFFFAOYSA-N methyl 4-fluoro-3-nitrobenzoate Chemical compound COC(=O)C1=CC=C(F)C([N+]([O-])=O)=C1 CNJJSTPBUHAEFH-UHFFFAOYSA-N 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 235000019198 oils Nutrition 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000003755 preservative agent Substances 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000008247 solid mixture Substances 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 2
- 239000000375 suspending agent Substances 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 238000009736 wetting Methods 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- BHQCQFFYRZLCQQ-UHFFFAOYSA-N (3alpha,5alpha,7alpha,12alpha)-3,7,12-trihydroxy-cholan-24-oic acid Natural products OC1CC2CC(O)CCC2(C)C2C1C1CCC(C(CCC(O)=O)C)C1(C)C(O)C2 BHQCQFFYRZLCQQ-UHFFFAOYSA-N 0.000 description 1
- HCOITUYQNKEZQH-UHFFFAOYSA-N 1-bromo-4-decylsulfanylbenzene Chemical compound CCCCCCCCCCSC1=CC=C(Br)C=C1 HCOITUYQNKEZQH-UHFFFAOYSA-N 0.000 description 1
- LDKSCZJUIURGMW-UHFFFAOYSA-N 1-isothiocyanato-3-methylsulfanylpropane Chemical group CSCCCN=C=S LDKSCZJUIURGMW-UHFFFAOYSA-N 0.000 description 1
- CXBDYQVECUFKRK-UHFFFAOYSA-N 1-methoxybutane Chemical compound CCCCOC CXBDYQVECUFKRK-UHFFFAOYSA-N 0.000 description 1
- NRKYWOKHZRQRJR-UHFFFAOYSA-N 2,2,2-trifluoroacetamide Chemical compound NC(=O)C(F)(F)F NRKYWOKHZRQRJR-UHFFFAOYSA-N 0.000 description 1
- GMZUWNQJOIWBHS-UHFFFAOYSA-N 2-(2-methylsulfanylethyl)benzamide Chemical compound CSCCC1=CC=CC=C1C(N)=O GMZUWNQJOIWBHS-UHFFFAOYSA-N 0.000 description 1
- PXBFMLJZNCDSMP-UHFFFAOYSA-N 2-Aminobenzamide Chemical compound NC(=O)C1=CC=CC=C1N PXBFMLJZNCDSMP-UHFFFAOYSA-N 0.000 description 1
- 125000003006 2-dimethylaminoethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- VCFGDHUCAOASTJ-UHFFFAOYSA-N 3-[(4-decoxybenzoyl)amino]-4-ethoxy-n-ethylbenzamide Chemical compound C1=CC(OCCCCCCCCCC)=CC=C1C(=O)NC1=CC(C(=O)NCC)=CC=C1OCC VCFGDHUCAOASTJ-UHFFFAOYSA-N 0.000 description 1
- DYBVMVMELCPFHK-UHFFFAOYSA-N 3-[(4-decoxybenzoyl)amino]-4-methoxy-n-(2-methoxyethyl)benzamide Chemical compound C1=CC(OCCCCCCCCCC)=CC=C1C(=O)NC1=CC(C(=O)NCCOC)=CC=C1OC DYBVMVMELCPFHK-UHFFFAOYSA-N 0.000 description 1
- HNNOWAPRFGFTJT-UHFFFAOYSA-N 3-[(4-decoxybenzoyl)amino]-4-methoxy-n-propylbenzamide Chemical compound C1=CC(OCCCCCCCCCC)=CC=C1C(=O)NC1=CC(C(=O)NCCC)=CC=C1OC HNNOWAPRFGFTJT-UHFFFAOYSA-N 0.000 description 1
- SXOGYRGHEYCBGR-UHFFFAOYSA-N 3-[(4-decoxybenzoyl)amino]-n-(2-methoxyethyl)-4-methylbenzamide Chemical compound C1=CC(OCCCCCCCCCC)=CC=C1C(=O)NC1=CC(C(=O)NCCOC)=CC=C1C SXOGYRGHEYCBGR-UHFFFAOYSA-N 0.000 description 1
- PFPVHAFZIQZYEI-UHFFFAOYSA-N 3-[(4-decoxybenzoyl)amino]-n-(2-methoxyethyl)-4-propylbenzamide Chemical compound C1=CC(OCCCCCCCCCC)=CC=C1C(=O)NC1=CC(C(=O)NCCOC)=CC=C1CCC PFPVHAFZIQZYEI-UHFFFAOYSA-N 0.000 description 1
- QVJDYLXQKIXPAY-UHFFFAOYSA-N 3-[(4-decoxybenzoyl)amino]-n-(2-methylsulfanylethyl)-4-propoxybenzamide Chemical compound C1=CC(OCCCCCCCCCC)=CC=C1C(=O)NC1=CC(C(=O)NCCSC)=CC=C1OCCC QVJDYLXQKIXPAY-UHFFFAOYSA-N 0.000 description 1
- UXLCHODFGRUZLR-UHFFFAOYSA-N 3-[(4-decoxybenzoyl)amino]-n-(2-methylsulfanylethyl)-4-propylbenzamide Chemical compound C1=CC(OCCCCCCCCCC)=CC=C1C(=O)NC1=CC(C(=O)NCCSC)=CC=C1CCC UXLCHODFGRUZLR-UHFFFAOYSA-N 0.000 description 1
- ULNAEWXZESPJPG-UHFFFAOYSA-N 3-[(4-decoxybenzoyl)amino]-n-[2-(dimethylamino)ethyl]-4-ethoxybenzamide Chemical compound C1=CC(OCCCCCCCCCC)=CC=C1C(=O)NC1=CC(C(=O)NCCN(C)C)=CC=C1OCC ULNAEWXZESPJPG-UHFFFAOYSA-N 0.000 description 1
- CBMXZFLURLPSIJ-UHFFFAOYSA-N 3-[(4-decylsulfanylbenzoyl)amino]-n-(2-methylsulfanylethyl)-4-propylbenzamide Chemical compound C1=CC(SCCCCCCCCCC)=CC=C1C(=O)NC1=CC(C(=O)NCCSC)=CC=C1CCC CBMXZFLURLPSIJ-UHFFFAOYSA-N 0.000 description 1
- ZXDMRCPTEZSTNV-UHFFFAOYSA-N 3-[(4-dodecoxybenzoyl)amino]-4-methoxy-n-(2-methoxyethyl)benzamide Chemical compound C1=CC(OCCCCCCCCCCCC)=CC=C1C(=O)NC1=CC(C(=O)NCCOC)=CC=C1OC ZXDMRCPTEZSTNV-UHFFFAOYSA-N 0.000 description 1
- NYQAFLMFJZTLEY-UHFFFAOYSA-N 3-[(4-hexadecoxybenzoyl)amino]-n-(2-methoxyethyl)-4-methylbenzamide Chemical compound C1=CC(OCCCCCCCCCCCCCCCC)=CC=C1C(=O)NC1=CC(C(=O)NCCOC)=CC=C1C NYQAFLMFJZTLEY-UHFFFAOYSA-N 0.000 description 1
- JIMREUKKAQBFMO-UHFFFAOYSA-N 3-amino-4-methoxy-n-(2-methylsulfanylethyl)benzamide Chemical compound COC1=CC=C(C(=O)NCCSC)C=C1N JIMREUKKAQBFMO-UHFFFAOYSA-N 0.000 description 1
- RKKQCEOCMJCQIW-UHFFFAOYSA-N 3-amino-n-butyl-4-methoxybenzamide Chemical compound CCCCNC(=O)C1=CC=C(OC)C(N)=C1 RKKQCEOCMJCQIW-UHFFFAOYSA-N 0.000 description 1
- SSJJFMOFUPDGNG-UHFFFAOYSA-N 3-amino-n-butyl-4-methylbenzamide Chemical compound CCCCNC(=O)C1=CC=C(C)C(N)=C1 SSJJFMOFUPDGNG-UHFFFAOYSA-N 0.000 description 1
- GSCPDZHWVNUUFI-UHFFFAOYSA-N 3-aminobenzamide Chemical compound NC(=O)C1=CC=CC(N)=C1 GSCPDZHWVNUUFI-UHFFFAOYSA-N 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- GTPVFAULXKRNRR-UHFFFAOYSA-N 4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]benzoic acid Chemical compound COCCOCCOCCOC1=CC=C(C(O)=O)C=C1 GTPVFAULXKRNRR-UHFFFAOYSA-N 0.000 description 1
- FTBCOQFMQSTCQQ-UHFFFAOYSA-N 4-bromobenzenethiol Chemical compound SC1=CC=C(Br)C=C1 FTBCOQFMQSTCQQ-UHFFFAOYSA-N 0.000 description 1
- WFJLZWLCGSDPLW-UHFFFAOYSA-N 4-decoxy-2-phenylbenzamide Chemical compound C1(=CC=CC=C1)C1=C(C(=O)N)C=CC(=C1)OCCCCCCCCCC WFJLZWLCGSDPLW-UHFFFAOYSA-N 0.000 description 1
- QFPMTKPMXXKCNW-UHFFFAOYSA-N 4-decoxybenzoyl chloride Chemical compound CCCCCCCCCCOC1=CC=C(C(Cl)=O)C=C1 QFPMTKPMXXKCNW-UHFFFAOYSA-N 0.000 description 1
- ANXBDAFDZSXOPQ-UHFFFAOYSA-N 4-methoxy-3-nitrobenzoic acid Chemical compound COC1=CC=C(C(O)=O)C=C1[N+]([O-])=O ANXBDAFDZSXOPQ-UHFFFAOYSA-N 0.000 description 1
- SUGHWWAVYCGJGH-UHFFFAOYSA-N 4-methylsulfanyl-n-(2-methylsulfanylethyl)-3-nitrobenzamide Chemical compound CSCCNC(=O)C1=CC=C(SC)C([N+]([O-])=O)=C1 SUGHWWAVYCGJGH-UHFFFAOYSA-N 0.000 description 1
- BOZLUAUKDKKZHJ-UHFFFAOYSA-N 4-nonoxybenzoic acid Chemical compound CCCCCCCCCOC1=CC=C(C(O)=O)C=C1 BOZLUAUKDKKZHJ-UHFFFAOYSA-N 0.000 description 1
- GSYPSPBOERIZHM-UHFFFAOYSA-N 4-pentoxybenzamide Chemical compound CCCCCOC1=CC=C(C(N)=O)C=C1 GSYPSPBOERIZHM-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 206010003210 Arteriosclerosis Diseases 0.000 description 1
- 201000001320 Atherosclerosis Diseases 0.000 description 1
- 208000037260 Atherosclerotic Plaque Diseases 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- ZOVCNTWSELXBAH-UHFFFAOYSA-N CCC1=C(C=CC=C1N2CCCCC2)C(=O)N Chemical compound CCC1=C(C=CC=C1N2CCCCC2)C(=O)N ZOVCNTWSELXBAH-UHFFFAOYSA-N 0.000 description 1
- 239000004380 Cholic acid Substances 0.000 description 1
- 239000004375 Dextrin Substances 0.000 description 1
- 229920001353 Dextrin Polymers 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 208000031226 Hyperlipidaemia Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 238000012404 In vitro experiment Methods 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- OIZXRZCQJDXPFO-UHFFFAOYSA-N Octadecyl acetate Chemical compound CCCCCCCCCCCCCCCCCCOC(C)=O OIZXRZCQJDXPFO-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000008186 active pharmaceutical agent Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 150000003939 benzylamines Chemical class 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- AHZOHFYNIDGBKN-UHFFFAOYSA-N chloro(ethoxy)phosphinic acid Chemical compound CCOP(O)(Cl)=O AHZOHFYNIDGBKN-UHFFFAOYSA-N 0.000 description 1
- 230000000251 cholesterol ester accumulation Effects 0.000 description 1
- 235000019416 cholic acid Nutrition 0.000 description 1
- BHQCQFFYRZLCQQ-OELDTZBJSA-N cholic acid Chemical compound C([C@H]1C[C@H]2O)[C@H](O)CC[C@]1(C)[C@@H]1[C@@H]2[C@@H]2CC[C@H]([C@@H](CCC(O)=O)C)[C@@]2(C)[C@@H](O)C1 BHQCQFFYRZLCQQ-OELDTZBJSA-N 0.000 description 1
- 229960002471 cholic acid Drugs 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000007891 compressed tablet Substances 0.000 description 1
- 235000009508 confectionery Nutrition 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- KXGVEGMKQFWNSR-UHFFFAOYSA-N deoxycholic acid Natural products C1CC2CC(O)CCC2(C)C2C1C1CCC(C(CCC(O)=O)C)C1(C)C(O)C2 KXGVEGMKQFWNSR-UHFFFAOYSA-N 0.000 description 1
- 235000019425 dextrin Nutrition 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 230000000378 dietary effect Effects 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 229940088679 drug related substance Drugs 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- 210000004185 liver Anatomy 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- NBTOZLQBSIZIKS-UHFFFAOYSA-N methoxide Chemical compound [O-]C NBTOZLQBSIZIKS-UHFFFAOYSA-N 0.000 description 1
- XRTKWPWDSUNLHS-UHFFFAOYSA-N methyl 4-chloro-3-nitrobenzoate Chemical compound COC(=O)C1=CC=C(Cl)C([N+]([O-])=O)=C1 XRTKWPWDSUNLHS-UHFFFAOYSA-N 0.000 description 1
- MLFKUEQFNLAOQT-UHFFFAOYSA-N methyl 4-methylsulfanyl-3-nitrobenzoate Chemical compound COC(=O)C1=CC=C(SC)C([N+]([O-])=O)=C1 MLFKUEQFNLAOQT-UHFFFAOYSA-N 0.000 description 1
- 210000001589 microsome Anatomy 0.000 description 1
- 150000002780 morpholines Chemical class 0.000 description 1
- VMXOIQXFRRXZLA-UHFFFAOYSA-N n-butyl-3-[(4-decoxybenzoyl)-methylamino]-4-methoxy-n-methylbenzamide Chemical compound C1=CC(OCCCCCCCCCC)=CC=C1C(=O)N(C)C1=CC(C(=O)N(C)CCCC)=CC=C1OC VMXOIQXFRRXZLA-UHFFFAOYSA-N 0.000 description 1
- GOVXHMYCFFQNRR-UHFFFAOYSA-N n-butyl-3-[(4-decoxybenzoyl)amino]-4-fluorobenzamide Chemical compound C1=CC(OCCCCCCCCCC)=CC=C1C(=O)NC1=CC(C(=O)NCCCC)=CC=C1F GOVXHMYCFFQNRR-UHFFFAOYSA-N 0.000 description 1
- IKKQQHCKUDYTSO-UHFFFAOYSA-N n-butyl-3-[(4-decoxybenzoyl)amino]-4-methoxy-n-methylbenzamide Chemical compound C1=CC(OCCCCCCCCCC)=CC=C1C(=O)NC1=CC(C(=O)N(C)CCCC)=CC=C1OC IKKQQHCKUDYTSO-UHFFFAOYSA-N 0.000 description 1
- UPFWOFWXRWDAHX-UHFFFAOYSA-N n-butyl-3-[(4-decoxybenzoyl)amino]-4-methylbenzamide Chemical compound C1=CC(OCCCCCCCCCC)=CC=C1C(=O)NC1=CC(C(=O)NCCCC)=CC=C1C UPFWOFWXRWDAHX-UHFFFAOYSA-N 0.000 description 1
- HKNIZLBYOQOUNX-UHFFFAOYSA-N n-butyl-3-[(4-decoxybenzoyl)amino]-4-methylsulfinylbenzamide Chemical compound C1=CC(OCCCCCCCCCC)=CC=C1C(=O)NC1=CC(C(=O)NCCCC)=CC=C1S(C)=O HKNIZLBYOQOUNX-UHFFFAOYSA-N 0.000 description 1
- QQWMWZNMCFBLJX-UHFFFAOYSA-N n-butyl-3-[(4-decoxybenzoyl)amino]-4-methylsulfonylbenzamide Chemical compound C1=CC(OCCCCCCCCCC)=CC=C1C(=O)NC1=CC(C(=O)NCCCC)=CC=C1S(C)(=O)=O QQWMWZNMCFBLJX-UHFFFAOYSA-N 0.000 description 1
- AYIAFHYAURTJTE-UHFFFAOYSA-N n-butyl-3-[(4-dodecoxybenzoyl)amino]-4-methoxybenzamide Chemical compound C1=CC(OCCCCCCCCCCCC)=CC=C1C(=O)NC1=CC(C(=O)NCCCC)=CC=C1OC AYIAFHYAURTJTE-UHFFFAOYSA-N 0.000 description 1
- SDIDYFBTIZOPLA-UHFFFAOYSA-N n-ethylbenzamide Chemical compound CCNC(=O)C1=CC=CC=C1 SDIDYFBTIZOPLA-UHFFFAOYSA-N 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 235000016709 nutrition Nutrition 0.000 description 1
- 230000035764 nutrition Effects 0.000 description 1
- 125000002811 oleoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])/C([H])=C([H])\C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 150000002895 organic esters Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 239000003444 phase transfer catalyst Substances 0.000 description 1
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 125000006413 ring segment Chemical group 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 229960001922 sodium perborate Drugs 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 239000008223 sterile water Substances 0.000 description 1
- 230000001954 sterilising effect Effects 0.000 description 1
- 238000004659 sterilization and disinfection Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- DZLFLBLQUQXARW-UHFFFAOYSA-N tetrabutylammonium Chemical class CCCC[N+](CCCC)(CCCC)CCCC DZLFLBLQUQXARW-UHFFFAOYSA-N 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- 150000003573 thiols Chemical class 0.000 description 1
- 238000001890 transfection Methods 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C235/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms
- C07C235/42—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/36—Radicals substituted by singly-bound nitrogen atoms
- C07D213/40—Acylated substituent nitrogen atom
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/10—Drugs for disorders of the cardiovascular system for treating ischaemic or atherosclerotic diseases, e.g. antianginal drugs, coronary vasodilators, drugs for myocardial infarction, retinopathy, cerebrovascula insufficiency, renal arteriosclerosis
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C237/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups
- C07C237/28—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atom of at least one of the carboxamide groups bound to a carbon atom of a non-condensed six-membered aromatic ring of the carbon skeleton
- C07C237/42—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atom of at least one of the carboxamide groups bound to a carbon atom of a non-condensed six-membered aromatic ring of the carbon skeleton having nitrogen atoms of amino groups bound to the carbon skeleton of the acid part, further acylated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/23—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C323/39—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton at least one of the nitrogen atoms being part of any of the groups, X being a hetero atom, Y being any atom
- C07C323/40—Y being a hydrogen or a carbon atom
- C07C323/41—Y being a hydrogen or an acyclic carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/50—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton
- C07C323/62—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton having the sulfur atom of at least one of the thio groups bound to a carbon atom of a six-membered aromatic ring of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/50—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton
- C07C323/62—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton having the sulfur atom of at least one of the thio groups bound to a carbon atom of a six-membered aromatic ring of the carbon skeleton
- C07C323/63—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton having the sulfur atom of at least one of the thio groups bound to a carbon atom of a six-membered aromatic ring of the carbon skeleton the carbon skeleton being further substituted by nitrogen atoms, not being part of nitro or nitroso groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/08—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon radicals, substituted by hetero atoms, attached to ring carbon atoms
- C07D207/09—Radicals substituted by nitrogen atoms, not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D275/00—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings
- C07D275/02—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings not condensed with other rings
- C07D275/03—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings not condensed with other rings with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D285/00—Heterocyclic compounds containing rings having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by groups C07D275/00 - C07D283/00
- C07D285/01—Five-membered rings
- C07D285/02—Thiadiazoles; Hydrogenated thiadiazoles
- C07D285/04—Thiadiazoles; Hydrogenated thiadiazoles not condensed with other rings
- C07D285/12—1,3,4-Thiadiazoles; Hydrogenated 1,3,4-thiadiazoles
- C07D285/125—1,3,4-Thiadiazoles; Hydrogenated 1,3,4-thiadiazoles with oxygen, sulfur or nitrogen atoms, directly attached to ring carbon atoms, the nitrogen atoms not forming part of a nitro radical
- C07D285/135—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/18—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carboxylic acids, or sulfur or nitrogen analogues thereof
- C07D295/182—Radicals derived from carboxylic acids
- C07D295/192—Radicals derived from carboxylic acids from aromatic carboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/52—Radicals substituted by nitrogen atoms not forming part of a nitro radical
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Heart & Thoracic Surgery (AREA)
- Life Sciences & Earth Sciences (AREA)
- Vascular Medicine (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Urology & Nephrology (AREA)
- Pharmacology & Pharmacy (AREA)
- Cardiology (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB898921792A GB8921792D0 (en) | 1989-09-27 | 1989-09-27 | New compositions of matter |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS465690A3 true CS465690A3 (en) | 1992-04-15 |
Family
ID=10663679
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS904656A CS465690A3 (en) | 1989-09-27 | 1990-09-25 | Benzanilide derivatives |
Country Status (24)
| Country | Link |
|---|---|
| US (1) | US5159114A (de) |
| EP (1) | EP0424194B1 (de) |
| JP (1) | JPH03178954A (de) |
| KR (1) | KR910006219A (de) |
| AT (1) | ATE110715T1 (de) |
| AU (1) | AU641686B2 (de) |
| CA (1) | CA2026273A1 (de) |
| CS (1) | CS465690A3 (de) |
| DD (1) | DD295344A5 (de) |
| DE (1) | DE69012040T2 (de) |
| DK (1) | DK0424194T3 (de) |
| ES (1) | ES2058849T3 (de) |
| FI (1) | FI904728A7 (de) |
| GB (1) | GB8921792D0 (de) |
| HU (1) | HU207839B (de) |
| IE (1) | IE903448A1 (de) |
| IL (1) | IL95762A0 (de) |
| MX (1) | MX9203712A (de) |
| NO (1) | NO173057C (de) |
| NZ (1) | NZ235454A (de) |
| PL (1) | PL163034B1 (de) |
| PT (1) | PT95439A (de) |
| RU (1) | RU2007389C1 (de) |
| ZA (1) | ZA907639B (de) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB9016581D0 (en) * | 1990-07-27 | 1990-09-12 | Ici Plc | Fungicides |
| GB9017710D0 (en) * | 1990-08-13 | 1990-09-26 | May & Baker Ltd | New compositions of matter |
| DE4200259A1 (de) * | 1992-01-08 | 1993-07-15 | Asta Medica Ag | Neue 1,2,4-triaminobenzol-derivate und verfahren zu deren herstellung |
| AU672699B2 (en) * | 1993-06-30 | 1996-10-10 | Sankyo Company Limited | Amide and urea derivatives having anti-hypercholesteremic activity, their preparation and their therapeutic uses |
| GB9408185D0 (en) * | 1994-04-25 | 1994-06-15 | Fujisawa Pharmaceutical Co | New benzamide derivatives, processes for the preparation thereof and pharmaceutical composition comprising the same |
| DE19701694A1 (de) * | 1997-01-20 | 1998-07-23 | Asta Medica Ag | Neue Modifikationen des 2-Amino-4-(4-fluorbenzylamino)-l-ethoxycarbonyl-aminobenzen sowie Verfahren zu ihrer Herstellung |
| FR2946340B1 (fr) | 2009-06-05 | 2011-06-24 | Galderma Res & Dev | Nouveaux n-phenyl acetamie, inhibiteurs de l'enzyme soat-1, compositions pharmaceutiques et cosmetiques les contenant. |
| FR2946342B1 (fr) | 2009-06-05 | 2011-06-24 | Galderma Res & Dev | Nouveaux derives de dioxo-imidazolidine, inhibiteurs de l'enzyme soat-1, compositions pharmaceutiques et cosmetiques les contenant. |
| FR2946345B1 (fr) | 2009-06-05 | 2011-05-20 | Galderma Res & Dev | Nouveaux derives dioxo-imidazolidine, inhibiteurs de l'enzyme soat-1, compositions pharmaceutiques et cosmetiques les contenant. |
| FR2946346B1 (fr) | 2009-06-05 | 2011-05-20 | Galderma Res & Dev | Nouveaux derives dioxo-imidazolidine, inhibiteurs de l'enzyme soat-1, compositions pharmaceutiques et cosmetiques les contenant. |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1438612A (en) * | 1974-02-08 | 1976-06-09 | Biorex Laboratories Ltd | Glycyrrhetinic acid derivatives |
| AU547405B2 (en) * | 1981-07-08 | 1985-10-17 | Sanofi | Amidobenzamides |
| US4500714A (en) * | 1981-10-15 | 1985-02-19 | Chugai Seiyaku Kabushiki Kaisha | 3-Substituted-ureido-N-pyridyl benzamides |
| AU567140B2 (en) * | 1984-01-06 | 1987-11-12 | Shionogi & Co., Ltd. | Sulphonamido-benzamide derivatives |
| LU86258A1 (fr) * | 1986-01-21 | 1987-09-03 | Rech Dermatologiques C I R D S | Composes benzamido aromatique,leur procede de preparation et leur utilisation en medecine humaine ou veterinaire et en cosmetique |
| US4835181A (en) * | 1987-02-18 | 1989-05-30 | Eli Lilly And Company | Anticonvulsant agents using cyano dimethylphenyl benzamides |
-
1989
- 1989-09-27 GB GB898921792A patent/GB8921792D0/en active Pending
-
1990
- 1990-09-24 IL IL95762A patent/IL95762A0/xx unknown
- 1990-09-25 ZA ZA907639A patent/ZA907639B/xx unknown
- 1990-09-25 KR KR1019900015212A patent/KR910006219A/ko not_active Withdrawn
- 1990-09-25 NZ NZ235454A patent/NZ235454A/en unknown
- 1990-09-25 AT AT90402635T patent/ATE110715T1/de not_active IP Right Cessation
- 1990-09-25 EP EP90402635A patent/EP0424194B1/de not_active Expired - Lifetime
- 1990-09-25 ES ES90402635T patent/ES2058849T3/es not_active Expired - Lifetime
- 1990-09-25 IE IE344890A patent/IE903448A1/en unknown
- 1990-09-25 DE DE69012040T patent/DE69012040T2/de not_active Expired - Fee Related
- 1990-09-25 DK DK90402635.8T patent/DK0424194T3/da active
- 1990-09-25 AU AU63133/90A patent/AU641686B2/en not_active Ceased
- 1990-09-25 CS CS904656A patent/CS465690A3/cs unknown
- 1990-09-25 JP JP2252053A patent/JPH03178954A/ja active Pending
- 1990-09-26 FI FI904728A patent/FI904728A7/fi not_active Application Discontinuation
- 1990-09-26 HU HU906230A patent/HU207839B/hu not_active IP Right Cessation
- 1990-09-26 RU SU904831109A patent/RU2007389C1/ru active
- 1990-09-26 NO NO904187A patent/NO173057C/no unknown
- 1990-09-26 CA CA002026273A patent/CA2026273A1/en not_active Abandoned
- 1990-09-27 PL PL90287073A patent/PL163034B1/pl unknown
- 1990-09-27 DD DD90344265A patent/DD295344A5/de not_active IP Right Cessation
- 1990-09-27 PT PT95439A patent/PT95439A/pt not_active Application Discontinuation
-
1991
- 1991-08-05 US US07/742,493 patent/US5159114A/en not_active Expired - Fee Related
-
1992
- 1992-06-29 MX MX9203712A patent/MX9203712A/es unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IL95762A0 (en) | 1991-06-30 |
| FI904728A0 (fi) | 1990-09-26 |
| JPH03178954A (ja) | 1991-08-02 |
| KR910006219A (ko) | 1991-04-27 |
| ES2058849T3 (es) | 1994-11-01 |
| EP0424194A3 (en) | 1991-09-25 |
| PL163034B1 (pl) | 1994-02-28 |
| HU207839B (en) | 1993-06-28 |
| AU641686B2 (en) | 1993-09-30 |
| DE69012040T2 (de) | 1995-01-05 |
| PL287073A1 (en) | 1991-11-04 |
| PT95439A (pt) | 1991-05-22 |
| FI904728A7 (fi) | 1991-03-28 |
| NO904187L (no) | 1991-04-02 |
| HU906230D0 (en) | 1991-03-28 |
| AU6313390A (en) | 1991-04-11 |
| NZ235454A (en) | 1992-04-28 |
| DE69012040D1 (de) | 1994-10-06 |
| NO904187D0 (no) | 1990-09-26 |
| RU2007389C1 (ru) | 1994-02-15 |
| DD295344A5 (de) | 1991-10-31 |
| HUT55349A (en) | 1991-05-28 |
| ATE110715T1 (de) | 1994-09-15 |
| GB8921792D0 (en) | 1989-11-08 |
| NO173057B (no) | 1993-07-12 |
| ZA907639B (en) | 1991-07-31 |
| NO173057C (no) | 1993-10-20 |
| DK0424194T3 (da) | 1994-10-03 |
| EP0424194A2 (de) | 1991-04-24 |
| EP0424194B1 (de) | 1994-08-31 |
| MX9203712A (es) | 1992-07-01 |
| IE903448A1 (en) | 1991-04-10 |
| US5159114A (en) | 1992-10-27 |
| CA2026273A1 (en) | 1991-03-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US5776951A (en) | Anti-atherosclerotic diaryl compounds | |
| CA1302424C (en) | Phenolic thioethers as inhibitors of 5-lipoxygenase | |
| EP1149063B1 (de) | Ureido-thiobuttersäurederivate als ppar-agonisten | |
| US4711903A (en) | Phenolic thioethers as inhibitors of 5-lipoxygenase | |
| HUT66319A (en) | Benzanilide derivatives and pharmaceutical compositions containing them | |
| HUP0201654A2 (en) | Substituted phenylpropionic acid derivatives as agonists to human peroxisome proliferator-activated receptor (ppar) alpha, their preparation and pharmaceutical composition containing the same | |
| CS399991A3 (en) | Amide derivatives | |
| HU213605B (en) | Process for producing amide composition and pharmaceutical compositions comprising same as active ingredient | |
| JPWO2009072581A1 (ja) | ラクタム化合物又はその塩及びppar活性化剤 | |
| WO2005012221A1 (ja) | ジフェニルエーテル化合物、その製造方法および用途 | |
| JPWO2004007439A1 (ja) | ビアリール誘導体 | |
| JPH0395154A (ja) | [ジ―tert―ブチル(ヒドロキシ)フェニルチオ]置換ヒドロキサム酸誘導体 | |
| US5476944A (en) | Derivatives of cyclic phenolic thioethers | |
| US5391552A (en) | Diphenylpiperazine derivative and drug for circulatory organ containing the same | |
| CN100357280C (zh) | 二氢化萘衍生物及包含该衍生物作为活性成分的药物 | |
| EP0424194B1 (de) | Benzanilidederivate und Ihre Verwendung als anti-atherosclerosis Wirkstoffe | |
| JPH01106839A (ja) | アルカジエン誘導体類、それらの製造、およびそれらを含有している薬学的組成物 | |
| HU204030B (en) | Process for producing phenoxyalkylcarboxylic acid derivatives and pharmaceutical compositions comprising same as active ingredient | |
| JPS609716B2 (ja) | 1,2―ベンズインチアゾリン―3―オン類、それらの製造法および医薬としての使用 | |
| JP2003104971A (ja) | 新規アニリド誘導体又はその塩及びこれを含有する医薬 | |
| EP0398179A1 (de) | Rhodanin-Derivate und pharmazeutische Zusammensetzungen | |
| IE912889A1 (en) | Diphenylurea derivatives | |
| US5232941A (en) | Caffeic acid derivatives and pharmaceutical compositions containing the same | |
| JPH08301841A (ja) | スクアレン・エポキシダーゼ活性阻害剤 | |
| US5041440A (en) | Dithiolane derivatives |