CS238611B2 - Preparation method of sulphone-amides - Google Patents
Preparation method of sulphone-amides Download PDFInfo
- Publication number
- CS238611B2 CS238611B2 CS809599A CS959980A CS238611B2 CS 238611 B2 CS238611 B2 CS 238611B2 CS 809599 A CS809599 A CS 809599A CS 959980 A CS959980 A CS 959980A CS 238611 B2 CS238611 B2 CS 238611B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- ethyl
- acid
- yield
- carbon atoms
- theory
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims description 6
- 150000001875 compounds Chemical class 0.000 claims abstract description 21
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 9
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 9
- 150000002148 esters Chemical class 0.000 claims abstract description 8
- 150000003839 salts Chemical class 0.000 claims abstract description 7
- 150000003456 sulfonamides Chemical class 0.000 claims abstract description 6
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 5
- 150000002367 halogens Chemical class 0.000 claims abstract description 5
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims abstract description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims abstract description 3
- 125000003545 alkoxy group Chemical group 0.000 claims abstract 2
- -1 alkenyl radical Chemical class 0.000 claims description 44
- 125000004432 carbon atom Chemical group C* 0.000 claims description 22
- 239000002253 acid Substances 0.000 claims description 15
- 229910052739 hydrogen Inorganic materials 0.000 claims description 13
- 239000001257 hydrogen Substances 0.000 claims description 13
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 claims description 8
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 8
- 150000005840 aryl radicals Chemical class 0.000 claims description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 5
- 239000011230 binding agent Substances 0.000 claims description 5
- 150000007529 inorganic bases Chemical class 0.000 claims description 5
- 238000000034 method Methods 0.000 claims description 5
- 150000007530 organic bases Chemical class 0.000 claims description 5
- 239000011734 sodium Substances 0.000 claims description 5
- 229910052708 sodium Inorganic materials 0.000 claims description 5
- 229940124530 sulfonamide Drugs 0.000 claims description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 4
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 150000007513 acids Chemical class 0.000 claims description 4
- 239000011575 calcium Substances 0.000 claims description 4
- 229910052791 calcium Inorganic materials 0.000 claims description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 3
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 claims description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 3
- 125000003342 alkenyl group Chemical group 0.000 claims description 3
- 150000001768 cations Chemical class 0.000 claims description 3
- 239000011591 potassium Substances 0.000 claims description 3
- 229910052700 potassium Inorganic materials 0.000 claims description 3
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims description 2
- 150000001412 amines Chemical class 0.000 claims description 2
- 238000009833 condensation Methods 0.000 claims description 2
- 230000005494 condensation Effects 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 125000006527 (C1-C5) alkyl group Chemical group 0.000 claims 2
- 125000005915 C6-C14 aryl group Chemical group 0.000 claims 2
- 150000002431 hydrogen Chemical group 0.000 claims 1
- 239000012442 inert solvent Substances 0.000 claims 1
- 238000004220 aggregation Methods 0.000 abstract description 9
- 230000002776 aggregation Effects 0.000 abstract description 9
- 210000001772 blood platelet Anatomy 0.000 abstract description 4
- 125000003118 aryl group Chemical group 0.000 abstract description 3
- 150000002632 lipids Chemical class 0.000 abstract description 3
- 125000002252 acyl group Chemical group 0.000 abstract description 2
- 125000003710 aryl alkyl group Chemical group 0.000 abstract description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 abstract 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 abstract 1
- 150000001408 amides Chemical class 0.000 abstract 1
- 230000000881 depressing effect Effects 0.000 abstract 1
- 230000000144 pharmacologic effect Effects 0.000 abstract 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 136
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 60
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 44
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 33
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 32
- 230000007062 hydrolysis Effects 0.000 description 26
- 238000006460 hydrolysis reaction Methods 0.000 description 26
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 25
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 24
- 239000000203 mixture Substances 0.000 description 23
- WLJVXDMOQOGPHL-UHFFFAOYSA-N benzyl-alpha-carboxylic acid Natural products OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 19
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 18
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- WBYWAXJHAXSJNI-VOTSOKGWSA-M .beta-Phenylacrylic acid Natural products [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 14
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 14
- 229930016911 cinnamic acid Natural products 0.000 description 14
- 235000013985 cinnamic acid Nutrition 0.000 description 14
- WBYWAXJHAXSJNI-UHFFFAOYSA-N methyl p-hydroxycinnamate Natural products OC(=O)C=CC1=CC=CC=C1 WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 description 14
- 239000000243 solution Substances 0.000 description 14
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 13
- FKRCODPIKNYEAC-UHFFFAOYSA-N ethyl propionate Chemical compound CCOC(=O)CC FKRCODPIKNYEAC-UHFFFAOYSA-N 0.000 description 12
- 239000012071 phase Substances 0.000 description 12
- 229960003424 phenylacetic acid Drugs 0.000 description 12
- 239000003279 phenylacetic acid Substances 0.000 description 12
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 11
- WBYWAXJHAXSJNI-SREVYHEPSA-N Cinnamic acid Chemical compound OC(=O)\C=C/C1=CC=CC=C1 WBYWAXJHAXSJNI-SREVYHEPSA-N 0.000 description 11
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 10
- UCTWMZQNUQWSLP-UHFFFAOYSA-N adrenaline Chemical compound CNCC(O)C1=CC=C(O)C(O)=C1 UCTWMZQNUQWSLP-UHFFFAOYSA-N 0.000 description 10
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 10
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 10
- 229910052938 sodium sulfate Inorganic materials 0.000 description 10
- 235000011152 sodium sulphate Nutrition 0.000 description 10
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical class OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 8
- 239000012230 colorless oil Substances 0.000 description 8
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 7
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical group OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 7
- LATLQSMOBLIWQV-UHFFFAOYSA-N ethyl 2-[4-(2-aminoethyl)phenyl]acetate;hydrochloride Chemical compound Cl.CCOC(=O)CC1=CC=C(CCN)C=C1 LATLQSMOBLIWQV-UHFFFAOYSA-N 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- VRQYIFVLYBGWNB-UHFFFAOYSA-N Cl.C(C)OC(C=CC1=CC=CC=C1)=O Chemical compound Cl.C(C)OC(C=CC1=CC=CC=C1)=O VRQYIFVLYBGWNB-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- 239000008346 aqueous phase Substances 0.000 description 5
- 150000001735 carboxylic acids Chemical class 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 5
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- RZEAUNQAWCZAHC-UHFFFAOYSA-N 2-[4-(2-aminoethyl)phenyl]acetic acid;hydrochloride Chemical compound Cl.NCCC1=CC=C(CC(O)=O)C=C1 RZEAUNQAWCZAHC-UHFFFAOYSA-N 0.000 description 4
- OVWSNDOUOHKMOM-UHFFFAOYSA-N 3-phenylprop-2-enoic acid;hydrochloride Chemical compound Cl.OC(=O)C=CC1=CC=CC=C1 OVWSNDOUOHKMOM-UHFFFAOYSA-N 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- KBEBGUQPQBELIU-UHFFFAOYSA-N cinnamic acid ethyl ester Natural products CCOC(=O)C=CC1=CC=CC=C1 KBEBGUQPQBELIU-UHFFFAOYSA-N 0.000 description 4
- 238000005886 esterification reaction Methods 0.000 description 4
- GVTGITXWTNFZMS-UHFFFAOYSA-N ethyl 3-[4-(2-aminoethyl)phenyl]propanoate;hydrochloride Chemical compound Cl.CCOC(=O)CCC1=CC=C(CCN)C=C1 GVTGITXWTNFZMS-UHFFFAOYSA-N 0.000 description 4
- 125000004494 ethyl ester group Chemical group 0.000 description 4
- 239000005457 ice water Substances 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- 239000012074 organic phase Substances 0.000 description 4
- 235000019260 propionic acid Nutrition 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 208000010110 spontaneous platelet aggregation Diseases 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- WLJVXDMOQOGPHL-PPJXEINESA-N 2-phenylacetic acid Chemical compound O[14C](=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-PPJXEINESA-N 0.000 description 3
- 239000005711 Benzoic acid Substances 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- KBEBGUQPQBELIU-CMDGGOBGSA-N Ethyl cinnamate Chemical compound CCOC(=O)\C=C\C1=CC=CC=C1 KBEBGUQPQBELIU-CMDGGOBGSA-N 0.000 description 3
- 229920002472 Starch Polymers 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 235000010233 benzoic acid Nutrition 0.000 description 3
- 235000001465 calcium Nutrition 0.000 description 3
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 3
- 230000032050 esterification Effects 0.000 description 3
- YFLWCZIVJVCWNQ-UHFFFAOYSA-N ethyl 4-(2-aminoethyl)benzoate;hydrochloride Chemical compound Cl.CCOC(=O)C1=CC=C(CCN)C=C1 YFLWCZIVJVCWNQ-UHFFFAOYSA-N 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 3
- 239000008107 starch Substances 0.000 description 3
- 235000019698 starch Nutrition 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- PMYKZTUJQKUULR-UHFFFAOYSA-N 2-[4-[2-(benzenesulfonamido)ethyl]phenyl]acetic acid Chemical compound C1=CC(CC(=O)O)=CC=C1CCNS(=O)(=O)C1=CC=CC=C1 PMYKZTUJQKUULR-UHFFFAOYSA-N 0.000 description 2
- CWDUZRJDZSSNLL-UHFFFAOYSA-N 2-[4-[2-(benzenesulfonamido)ethyl]phenyl]propanoic acid Chemical compound C1=CC(C(C(O)=O)C)=CC=C1CCNS(=O)(=O)C1=CC=CC=C1 CWDUZRJDZSSNLL-UHFFFAOYSA-N 0.000 description 2
- OOFVDXDWBUSDHF-UHFFFAOYSA-N 2-[4-[2-[(4-methylphenyl)sulfonylamino]ethyl]phenyl]acetic acid Chemical compound C1=CC(C)=CC=C1S(=O)(=O)NCCC1=CC=C(CC(O)=O)C=C1 OOFVDXDWBUSDHF-UHFFFAOYSA-N 0.000 description 2
- PYXYLLBBIRNRJT-UHFFFAOYSA-N 2-chlorosulfonyloxynaphthalene Chemical compound C1=CC=CC2=CC(OS(=O)(=O)Cl)=CC=C21 PYXYLLBBIRNRJT-UHFFFAOYSA-N 0.000 description 2
- WYIOCTBMAODUCE-UHFFFAOYSA-N 4-[2-(methanesulfonamido)ethyl]benzoic acid Chemical compound CS(=O)(=O)NCCC1=CC=C(C(O)=O)C=C1 WYIOCTBMAODUCE-UHFFFAOYSA-N 0.000 description 2
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 2
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- DULCUDSUACXJJC-UHFFFAOYSA-N Ethyl phenylacetate Chemical compound CCOC(=O)CC1=CC=CC=C1 DULCUDSUACXJJC-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 230000005540 biological transmission Effects 0.000 description 2
- 210000004369 blood Anatomy 0.000 description 2
- 239000008280 blood Substances 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- JESCPVSKEGXYSC-UHFFFAOYSA-N chlorobenzene;sulfurochloridic acid Chemical compound OS(Cl)(=O)=O.ClC1=CC=CC=C1 JESCPVSKEGXYSC-UHFFFAOYSA-N 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- MTZQAGJQAFMTAQ-UHFFFAOYSA-N ethyl benzoate Chemical compound CCOC(=O)C1=CC=CC=C1 MTZQAGJQAFMTAQ-UHFFFAOYSA-N 0.000 description 2
- 239000000796 flavoring agent Substances 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 230000004060 metabolic process Effects 0.000 description 2
- 229920000609 methyl cellulose Polymers 0.000 description 2
- 239000001923 methylcellulose Substances 0.000 description 2
- WIVNTNLDTMNDNO-UHFFFAOYSA-N octane-1-sulfonyl chloride Chemical compound CCCCCCCCS(Cl)(=O)=O WIVNTNLDTMNDNO-UHFFFAOYSA-N 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- YYFIGOPUHPDIBO-UHFFFAOYSA-N propanoic acid;hydrochloride Chemical compound Cl.CCC(O)=O YYFIGOPUHPDIBO-UHFFFAOYSA-N 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- UFTFJSFQGQCHQW-UHFFFAOYSA-N triformin Chemical compound O=COCC(OC=O)COC=O UFTFJSFQGQCHQW-UHFFFAOYSA-N 0.000 description 2
- 125000006833 (C1-C5) alkylene group Chemical group 0.000 description 1
- ZTHYKETWAFFOKO-UHFFFAOYSA-N 1-(4-methylpiperazin-1-yl)-2-phenylethanone;hydrochloride Chemical compound Cl.C1CN(C)CCN1C(=O)CC1=CC=CC=C1 ZTHYKETWAFFOKO-UHFFFAOYSA-N 0.000 description 1
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 1
- MROCYLWEFRCECF-UHFFFAOYSA-N 2-(2-phenylethyl)benzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1CCC1=CC=CC=C1 MROCYLWEFRCECF-UHFFFAOYSA-N 0.000 description 1
- HVBRPCXLQIUQLT-UHFFFAOYSA-N 2-(4-chlorophenyl)ethenesulfonyl chloride Chemical compound ClC1=CC=C(C=CS(Cl)(=O)=O)C=C1 HVBRPCXLQIUQLT-UHFFFAOYSA-N 0.000 description 1
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 1
- XEMOWUGWPSAERG-UHFFFAOYSA-N 2-[4-(2-aminoethyl)phenyl]propanoic acid;hydrochloride Chemical compound Cl.OC(=O)C(C)C1=CC=C(CCN)C=C1 XEMOWUGWPSAERG-UHFFFAOYSA-N 0.000 description 1
- OFPBMGOGAFUKOD-UHFFFAOYSA-N 2-[4-(3-aminopropyl)phenyl]acetic acid;hydrochloride Chemical compound Cl.NCCCC1=CC=C(CC(O)=O)C=C1 OFPBMGOGAFUKOD-UHFFFAOYSA-N 0.000 description 1
- UKAVOYLGNMTMID-UHFFFAOYSA-N 2-[4-(benzenesulfonamidomethyl)phenyl]acetic acid Chemical compound C1=CC(CC(=O)O)=CC=C1CNS(=O)(=O)C1=CC=CC=C1 UKAVOYLGNMTMID-UHFFFAOYSA-N 0.000 description 1
- QYNZTLQOBVEAHN-UHFFFAOYSA-N 2-[4-[2-(2-phenylethylsulfonylamino)ethyl]phenyl]acetic acid Chemical compound C1=CC(CC(=O)O)=CC=C1CCNS(=O)(=O)CCC1=CC=CC=C1 QYNZTLQOBVEAHN-UHFFFAOYSA-N 0.000 description 1
- UDEHYPXDTCKDKA-UHFFFAOYSA-N 2-[4-[2-(benzenesulfonamido)ethyl]phenyl]-2-methylpropanoic acid Chemical compound C1=CC(C(C)(C(O)=O)C)=CC=C1CCNS(=O)(=O)C1=CC=CC=C1 UDEHYPXDTCKDKA-UHFFFAOYSA-N 0.000 description 1
- SZJZIMSQKBQKKW-UHFFFAOYSA-N 2-[4-[2-(benzenesulfonamido)ethyl]phenyl]acetamide Chemical compound C1=CC(CC(=O)N)=CC=C1CCNS(=O)(=O)C1=CC=CC=C1 SZJZIMSQKBQKKW-UHFFFAOYSA-N 0.000 description 1
- RCMFIKLPTGCHAZ-UHFFFAOYSA-N 2-[4-[2-(methanesulfonamido)ethyl]phenyl]acetic acid Chemical compound CS(=O)(=O)NCCC1=CC=C(CC(O)=O)C=C1 RCMFIKLPTGCHAZ-UHFFFAOYSA-N 0.000 description 1
- CFGYJSCFPPWLFX-UHFFFAOYSA-N 2-[4-[2-[(2,5-dichlorophenyl)sulfonylamino]ethyl]phenyl]acetic acid Chemical compound C1=CC(CC(=O)O)=CC=C1CCNS(=O)(=O)C1=CC(Cl)=CC=C1Cl CFGYJSCFPPWLFX-UHFFFAOYSA-N 0.000 description 1
- IULOBWFWYDMECP-UHFFFAOYSA-N 2-[4-[2-[(4-chlorophenyl)sulfonylamino]ethyl]phenyl]acetic acid Chemical compound C1=CC(CC(=O)O)=CC=C1CCNS(=O)(=O)C1=CC=C(Cl)C=C1 IULOBWFWYDMECP-UHFFFAOYSA-N 0.000 description 1
- FKHBYBWCBWOACA-UHFFFAOYSA-N 2-[4-[2-[(4-fluorophenyl)sulfonylamino]ethyl]phenyl]acetic acid Chemical compound C1=CC(CC(=O)O)=CC=C1CCNS(=O)(=O)C1=CC=C(F)C=C1 FKHBYBWCBWOACA-UHFFFAOYSA-N 0.000 description 1
- LEMIXPRJDRMQDO-UHFFFAOYSA-N 2-[4-[3-(benzenesulfonamido)propyl]phenyl]acetic acid Chemical compound C1=CC(CC(=O)O)=CC=C1CCCNS(=O)(=O)C1=CC=CC=C1 LEMIXPRJDRMQDO-UHFFFAOYSA-N 0.000 description 1
- VMZCDNSFRSVYKQ-UHFFFAOYSA-N 2-phenylacetyl chloride Chemical compound ClC(=O)CC1=CC=CC=C1 VMZCDNSFRSVYKQ-UHFFFAOYSA-N 0.000 description 1
- OFJWFSNDPCAWDK-UHFFFAOYSA-N 2-phenylbutyric acid Chemical compound CCC(C(O)=O)C1=CC=CC=C1 OFJWFSNDPCAWDK-UHFFFAOYSA-N 0.000 description 1
- LKFNLHZZPHHFEC-UHFFFAOYSA-N 2-phenylethanesulfonyl chloride Chemical compound ClS(=O)(=O)CCC1=CC=CC=C1 LKFNLHZZPHHFEC-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- ONCAZCNPWWQQMW-UHFFFAOYSA-N 3-(trifluoromethyl)benzenesulfonyl chloride Chemical compound FC(F)(F)C1=CC=CC(S(Cl)(=O)=O)=C1 ONCAZCNPWWQQMW-UHFFFAOYSA-N 0.000 description 1
- SJHVRMXXMYVJFU-UHFFFAOYSA-N 3-[4-(2-aminoethyl)phenyl]-2-methylpropanoic acid;hydrochloride Chemical compound Cl.OC(=O)C(C)CC1=CC=C(CCN)C=C1 SJHVRMXXMYVJFU-UHFFFAOYSA-N 0.000 description 1
- YEXJVOCZRVTRFB-UHFFFAOYSA-N 3-[4-[2-(benzenesulfonamido)ethyl]phenyl]propanoic acid Chemical compound C1=CC(CCC(=O)O)=CC=C1CCNS(=O)(=O)C1=CC=CC=C1 YEXJVOCZRVTRFB-UHFFFAOYSA-N 0.000 description 1
- WXQKZICWZYUUPT-UHFFFAOYSA-N 3-[4-[2-(octylsulfonylamino)ethyl]phenyl]propanoic acid Chemical compound CCCCCCCCS(=O)(=O)NCCC1=CC=C(CCC(O)=O)C=C1 WXQKZICWZYUUPT-UHFFFAOYSA-N 0.000 description 1
- SWDNVPSDMLMQPP-UHFFFAOYSA-N 3-[4-[2-[(2-chlorophenyl)sulfonylamino]ethyl]phenyl]propanoic acid Chemical compound C1=CC(CCC(=O)O)=CC=C1CCNS(=O)(=O)C1=CC=CC=C1Cl SWDNVPSDMLMQPP-UHFFFAOYSA-N 0.000 description 1
- NJQDLDWOJVDETM-UHFFFAOYSA-N 3-[4-[2-[(4-chlorophenyl)sulfonylamino]ethyl]phenyl]propanoic acid Chemical compound C1=CC(CCC(=O)O)=CC=C1CCNS(=O)(=O)C1=CC=C(Cl)C=C1 NJQDLDWOJVDETM-UHFFFAOYSA-N 0.000 description 1
- NKLGEAGHHCZSEM-UHFFFAOYSA-N 4-(2-aminoethyl)-2-ethylbenzoic acid Chemical compound CCC1=CC(CCN)=CC=C1C(O)=O NKLGEAGHHCZSEM-UHFFFAOYSA-N 0.000 description 1
- GRQLJCQMQXXDTR-UHFFFAOYSA-N 4-(2-aminoethyl)benzoic acid;hydrochloride Chemical compound Cl.NCCC1=CC=C(C(O)=O)C=C1 GRQLJCQMQXXDTR-UHFFFAOYSA-N 0.000 description 1
- ORWDDKSOGFICQP-UHFFFAOYSA-N 4-(3-aminopropyl)benzoic acid;hydrochloride Chemical compound Cl.NCCCC1=CC=C(C(O)=O)C=C1 ORWDDKSOGFICQP-UHFFFAOYSA-N 0.000 description 1
- QXCQYOUWERBWFE-UHFFFAOYSA-N 4-[2-(2-phenylethenylsulfonylamino)ethyl]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1CCNS(=O)(=O)C=CC1=CC=CC=C1 QXCQYOUWERBWFE-UHFFFAOYSA-N 0.000 description 1
- DLRDACDWEUGXPM-UHFFFAOYSA-N 4-[2-(2-phenylethylsulfonylamino)ethyl]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1CCNS(=O)(=O)CCC1=CC=CC=C1 DLRDACDWEUGXPM-UHFFFAOYSA-N 0.000 description 1
- VGZACKZNXXITSD-UHFFFAOYSA-N 4-[2-(benzenesulfonamido)ethyl]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1CCNS(=O)(=O)C1=CC=CC=C1 VGZACKZNXXITSD-UHFFFAOYSA-N 0.000 description 1
- YUYHDAZMHAOVHN-UHFFFAOYSA-N 4-[2-(hexadecylsulfonylamino)ethyl]benzoic acid Chemical compound CCCCCCCCCCCCCCCCS(=O)(=O)NCCC1=CC=C(C(O)=O)C=C1 YUYHDAZMHAOVHN-UHFFFAOYSA-N 0.000 description 1
- DRZWGLYRMIPBMY-UHFFFAOYSA-N 4-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]benzoic acid Chemical compound C1=CC(OC)=CC=C1S(=O)(=O)NCCC1=CC=C(C(O)=O)C=C1 DRZWGLYRMIPBMY-UHFFFAOYSA-N 0.000 description 1
- LECIZSDAKARZOQ-UHFFFAOYSA-N 4-[3-(benzenesulfonamido)propyl]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1CCCNS(=O)(=O)C1=CC=CC=C1 LECIZSDAKARZOQ-UHFFFAOYSA-N 0.000 description 1
- OHQSXJACVTUTFB-UHFFFAOYSA-N 4-[4-[2-(benzenesulfonamido)ethyl]phenyl]butanoic acid Chemical compound C1=CC(CCCC(=O)O)=CC=C1CCNS(=O)(=O)C1=CC=CC=C1 OHQSXJACVTUTFB-UHFFFAOYSA-N 0.000 description 1
- RJWBTWIBUIGANW-UHFFFAOYSA-M 4-chlorobenzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=C(Cl)C=C1 RJWBTWIBUIGANW-UHFFFAOYSA-M 0.000 description 1
- ZLYBFBAHAQEEQQ-UHFFFAOYSA-N 4-chlorobenzenesulfonyl chloride Chemical compound ClC1=CC=C(S(Cl)(=O)=O)C=C1 ZLYBFBAHAQEEQQ-UHFFFAOYSA-N 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- 235000019737 Animal fat Nutrition 0.000 description 1
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- LDOXTQYWWYXYSQ-UHFFFAOYSA-N Butyl phenylacetate Chemical compound CCCCOC(=O)CC1=CC=CC=C1 LDOXTQYWWYXYSQ-UHFFFAOYSA-N 0.000 description 1
- QLRMGQPRAOXQSV-UHFFFAOYSA-N C(C)OC(CC1=CC=C(C=C1)CCNS(=O)(=O)C1=CC=C(C=C1)OC(=O)OCC)=O Chemical compound C(C)OC(CC1=CC=C(C=C1)CCNS(=O)(=O)C1=CC=C(C=C1)OC(=O)OCC)=O QLRMGQPRAOXQSV-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 241000206672 Gelidium Species 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 240000007817 Olea europaea Species 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 229960001138 acetylsalicylic acid Drugs 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 125000004450 alkenylene group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 125000004419 alkynylene group Chemical group 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000003524 antilipemic agent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N carbonic acid monoamide Natural products NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- 125000005392 carboxamide group Chemical group NC(=O)* 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- 235000012000 cholesterol Nutrition 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 210000003743 erythrocyte Anatomy 0.000 description 1
- 238000010931 ester hydrolysis Methods 0.000 description 1
- LJQKCYFTNDAAPC-UHFFFAOYSA-N ethanol;ethyl acetate Chemical compound CCO.CCOC(C)=O LJQKCYFTNDAAPC-UHFFFAOYSA-N 0.000 description 1
- ABPWRDTYSVAUHK-UHFFFAOYSA-N ethyl 2-[4-(2-aminoethyl)phenyl]-2-methylpropanoate;hydrochloride Chemical compound Cl.CCOC(=O)C(C)(C)C1=CC=C(CCN)C=C1 ABPWRDTYSVAUHK-UHFFFAOYSA-N 0.000 description 1
- XKCZVOWGVYXSAQ-UHFFFAOYSA-N ethyl 2-[4-(2-aminoethyl)phenyl]propanoate;hydrochloride Chemical compound Cl.CCOC(=O)C(C)C1=CC=C(CCN)C=C1 XKCZVOWGVYXSAQ-UHFFFAOYSA-N 0.000 description 1
- KELKHZBRWRYNIV-UHFFFAOYSA-N ethyl 2-[4-[2-(2-phenylethylsulfonylamino)ethyl]phenyl]acetate Chemical compound C1=CC(CC(=O)OCC)=CC=C1CCNS(=O)(=O)CCC1=CC=CC=C1 KELKHZBRWRYNIV-UHFFFAOYSA-N 0.000 description 1
- VTFVXJMQBHNJAC-UHFFFAOYSA-N ethyl 2-[4-[2-(2-phenylethylsulfonylamino)ethyl]phenyl]propanoate Chemical compound C1=CC(C(C)C(=O)OCC)=CC=C1CCNS(=O)(=O)CCC1=CC=CC=C1 VTFVXJMQBHNJAC-UHFFFAOYSA-N 0.000 description 1
- QPFRTPBZISEROZ-UHFFFAOYSA-N ethyl 2-[4-[2-(methanesulfonamido)ethyl]phenyl]acetate Chemical compound CCOC(=O)CC1=CC=C(CCNS(C)(=O)=O)C=C1 QPFRTPBZISEROZ-UHFFFAOYSA-N 0.000 description 1
- XHCUBLGRLNAGIK-UHFFFAOYSA-N ethyl 2-[4-[2-[(4-chlorophenyl)sulfonylamino]ethyl]phenyl]acetate Chemical compound C1=CC(CC(=O)OCC)=CC=C1CCNS(=O)(=O)C1=CC=C(Cl)C=C1 XHCUBLGRLNAGIK-UHFFFAOYSA-N 0.000 description 1
- DYWSVRKDKVQEDP-UHFFFAOYSA-N ethyl 2-[4-[2-[(4-methylphenyl)sulfonylamino]ethyl]phenyl]acetate Chemical compound C1=CC(CC(=O)OCC)=CC=C1CCNS(=O)(=O)C1=CC=C(C)C=C1 DYWSVRKDKVQEDP-UHFFFAOYSA-N 0.000 description 1
- CLLUFLLBRNCOLB-UHFFFAOYSA-N ethyl 2-phenylbutanoate Chemical compound CCOC(=O)C(CC)C1=CC=CC=C1 CLLUFLLBRNCOLB-UHFFFAOYSA-N 0.000 description 1
- KJUWLDVZMOZSPC-UHFFFAOYSA-N ethyl 3-[4-(2-aminoethyl)phenyl]propanoate Chemical compound CCOC(=O)CCC1=CC=C(CCN)C=C1 KJUWLDVZMOZSPC-UHFFFAOYSA-N 0.000 description 1
- IIBWZYXEYAKDEW-UHFFFAOYSA-N ethyl 3-[4-[2-[(4-chlorophenyl)sulfonylamino]ethyl]phenyl]propanoate Chemical compound C1=CC(CCC(=O)OCC)=CC=C1CCNS(=O)(=O)C1=CC=C(Cl)C=C1 IIBWZYXEYAKDEW-UHFFFAOYSA-N 0.000 description 1
- RBLUWLZGAZETKS-UHFFFAOYSA-N ethyl 4-(2-aminoethyl)benzoate Chemical compound CCOC(=O)C1=CC=C(CCN)C=C1 RBLUWLZGAZETKS-UHFFFAOYSA-N 0.000 description 1
- FYSOVENRNJWNGE-UHFFFAOYSA-N ethyl 4-[2-(2-phenylethenylsulfonylamino)ethyl]benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1CCNS(=O)(=O)C=CC1=CC=CC=C1 FYSOVENRNJWNGE-UHFFFAOYSA-N 0.000 description 1
- SDUIVORKQXJKNJ-UHFFFAOYSA-N ethyl 4-[2-(methanesulfonamido)ethyl]benzoate Chemical compound CCOC(=O)C1=CC=C(CCNS(C)(=O)=O)C=C1 SDUIVORKQXJKNJ-UHFFFAOYSA-N 0.000 description 1
- SNCPJOAPRHIDNC-UHFFFAOYSA-N ethyl 4-[2-[(4-chlorophenyl)sulfonylamino]ethyl]benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1CCNS(=O)(=O)C1=CC=C(Cl)C=C1 SNCPJOAPRHIDNC-UHFFFAOYSA-N 0.000 description 1
- 229960003750 ethyl chloride Drugs 0.000 description 1
- YJJCBPAEWVURMJ-UHFFFAOYSA-N ethyl propanoate;hydrochloride Chemical compound Cl.CCOC(=O)CC YJJCBPAEWVURMJ-UHFFFAOYSA-N 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- YOSVFFVBSPQTTP-UHFFFAOYSA-N hexadecane-1-sulfonyl chloride Chemical compound CCCCCCCCCCCCCCCCS(Cl)(=O)=O YOSVFFVBSPQTTP-UHFFFAOYSA-N 0.000 description 1
- 229920006158 high molecular weight polymer Polymers 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000004922 lacquer Substances 0.000 description 1
- 230000001418 larval effect Effects 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- YCVLNLXLOPCQCX-UHFFFAOYSA-N n-(4-chlorophenyl)ethanesulfonamide Chemical compound CCS(=O)(=O)NC1=CC=C(Cl)C=C1 YCVLNLXLOPCQCX-UHFFFAOYSA-N 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000033764 rhythmic process Effects 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 239000003352 sequestering agent Substances 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 230000002269 spontaneous effect Effects 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 125000005504 styryl group Chemical group 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- 125000000565 sulfonamide group Chemical group 0.000 description 1
- 150000003458 sulfonic acid derivatives Chemical class 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- KJAMZCVTJDTESW-UHFFFAOYSA-N tiracizine Chemical compound C1CC2=CC=CC=C2N(C(=O)CN(C)C)C2=CC(NC(=O)OCC)=CC=C21 KJAMZCVTJDTESW-UHFFFAOYSA-N 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 210000002700 urine Anatomy 0.000 description 1
- 235000019871 vegetable fat Nutrition 0.000 description 1
- 210000003462 vein Anatomy 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/06—Antihyperlipidemics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P7/00—Drugs for disorders of the blood or the extracellular fluid
- A61P7/02—Antithrombotic agents; Anticoagulants; Platelet aggregation inhibitors
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/10—Drugs for disorders of the cardiovascular system for treating ischaemic or atherosclerotic diseases, e.g. antianginal drugs, coronary vasodilators, drugs for myocardial infarction, retinopathy, cerebrovascula insufficiency, renal arteriosclerosis
Landscapes
- Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Veterinary Medicine (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Animal Behavior & Ethology (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Diabetes (AREA)
- Hematology (AREA)
- Vascular Medicine (AREA)
- Heart & Thoracic Surgery (AREA)
- Cardiology (AREA)
- Urology & Nephrology (AREA)
- Obesity (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Steroid Compounds (AREA)
- Devices That Are Associated With Refrigeration Equipment (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19803000377 DE3000377A1 (de) | 1980-01-07 | 1980-01-07 | Neue sulfonamide, verfahren zu deren herstellung sowie diese verbindungen enthaltende arzneimittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS238611B2 true CS238611B2 (en) | 1985-12-16 |
Family
ID=6091629
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS809599A CS238611B2 (en) | 1980-01-07 | 1980-12-31 | Preparation method of sulphone-amides |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US4443477A (es) |
| EP (1) | EP0031954B1 (es) |
| JP (1) | JPS56100757A (es) |
| AT (1) | ATE6641T1 (es) |
| AU (1) | AU538993B2 (es) |
| CA (1) | CA1241341A (es) |
| CS (1) | CS238611B2 (es) |
| DD (1) | DD157190A5 (es) |
| DE (2) | DE3000377A1 (es) |
| ES (1) | ES8200655A1 (es) |
| FI (1) | FI73667C (es) |
| GR (1) | GR72486B (es) |
| HK (1) | HK68887A (es) |
| IE (1) | IE50657B1 (es) |
| IL (1) | IL61834A (es) |
| PH (1) | PH18739A (es) |
| PL (1) | PL127050B1 (es) |
| PT (1) | PT72305B (es) |
| SG (1) | SG2387G (es) |
| SU (1) | SU1088664A3 (es) |
| YU (1) | YU42995B (es) |
| ZA (1) | ZA8132B (es) |
Families Citing this family (63)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4401663A (en) * | 1981-06-30 | 1983-08-30 | The Procter & Gamble Company | Novel sulfonamide derivatives |
| AU567140B2 (en) * | 1984-01-06 | 1987-11-12 | Shionogi & Co., Ltd. | Sulphonamido-benzamide derivatives |
| EP0194548A3 (de) * | 1985-03-12 | 1988-08-17 | Dr. Karl Thomae GmbH | Neue Sulfonylaminoäthylverbindungen, diese Verbindungen enthaltende Arzneimittel und Verfahren zu ihrer Herstellung |
| DE3535167A1 (de) * | 1985-10-02 | 1987-04-09 | Boehringer Mannheim Gmbh | Neue sulfonyl-phenyl(alkyl)amine, verfahren zu ihrer herstellung sowie arzneimittel |
| US4689182A (en) * | 1985-12-20 | 1987-08-25 | Warner-Lambert Company | Benzoic acid and benzoic acid ester derivatives having anti-inflammatory and analgesic activity |
| FR2598412B1 (fr) * | 1986-03-12 | 1988-10-21 | Sanofi Sa | Nouveaux derives de diarylcetones et leurs procedes de preparation et les compositions pharmaceutiques les contenant |
| IL83230A (en) * | 1986-08-06 | 1992-06-21 | Tanabe Seiyaku Co | Phenoxyacetic acid derivatives,their preparation and pharmaceutical compositions containing them |
| DE3629929A1 (de) * | 1986-09-03 | 1988-03-10 | Thomae Gmbh Dr K | Neue sulfonamido-aethylverbindungen, diese verbindungen enthaltende arzneimittel und verfahren zu ihrer herstellung |
| EP0266949B1 (en) * | 1986-10-28 | 1990-11-28 | Smith Kline & French Laboratories Limited | Tetrahydroisoquinolin-2-yl derivatives of carboxylic acids as thromboxane a2 antagonists |
| GB8708233D0 (en) * | 1987-04-07 | 1987-05-13 | Smith Kline French Lab | Pharmaceutically active compounds |
| KR880012221A (ko) * | 1987-04-13 | 1988-11-26 | 사노 가즈오 | 에스테르 또는 아미드를 활성성분으로 함유하는 약제 조성물 |
| CA1294974C (en) * | 1987-05-08 | 1992-01-28 | Sanji Hagishita | Bicyclic sulfonamide derivatives and process therefor |
| US4752616A (en) * | 1987-06-29 | 1988-06-21 | E. R. Squibb & Sons, Inc. | Arylthioalkylphenyl carboxylic acids, compositions containing same and method of use |
| GB8717374D0 (en) * | 1987-07-22 | 1987-08-26 | Smith Kline French Lab | Pharmaceutically active compounds |
| US4752613A (en) * | 1987-08-03 | 1988-06-21 | E. R. Squibb & Sons, Inc. | Sulphonamidothienylcarboxylic acid compounds |
| US4783473A (en) * | 1987-09-02 | 1988-11-08 | E. R. Squibb & Sons, Inc. | Geminally substituted cyclic ether carboxylic acids, derivatives thereof, compositions containing same and method of use |
| US4931460A (en) * | 1987-09-17 | 1990-06-05 | E. R. Squibb & Sons, Inc. | Post-ischemic myocardial dysfunction using thromboxane A2 antagonists |
| JPH01175962A (ja) * | 1987-12-28 | 1989-07-12 | Tanabe Seiyaku Co Ltd | フェニル酢酸誘導体 |
| DE68909958D1 (de) * | 1988-01-19 | 1993-11-25 | Tanabe Seiyaku Co | Phenoxyessigsäure-Derivate, ihre Herstellung, pharmazeutische Zusammensetzungen, die sie enthalten, und deren Verwendung. |
| US5066480A (en) * | 1988-04-11 | 1991-11-19 | E. R. Squibb & Sons, Inc. | Method of preventing or reducing adverse reactions to protamine using a thromboxane a2 receptor antagonist |
| DE3819052A1 (de) * | 1988-06-04 | 1989-12-07 | Basf Ag | Neue sulfonamid-derivate, ihre herstellung und verwendung |
| DE3829455A1 (de) * | 1988-08-31 | 1990-03-15 | Boehringer Mannheim Gmbh | Sulfonamidoalkyl-cyclohexan-verbindungen, verfahren zu ihrer herstellung sowie arzneimittel |
| US4925873A (en) * | 1988-09-01 | 1990-05-15 | E. R. Squibb & Sons, Inc. | Method of treating skin injuries using thromboxane A2 receptor antagonists |
| GB8823731D0 (en) * | 1988-10-10 | 1988-11-16 | Smith Kline French Lab | Biologically active compounds |
| US5280043A (en) * | 1988-10-10 | 1994-01-18 | Smith Kline & French Laboratories Ltd. | Sulphonamido containing phenylalkanoic acids as thromboxane A2 antagonists |
| US5070099A (en) * | 1988-10-31 | 1991-12-03 | E. R. Squibb & Sons, Inc. | Arylthioalkylphenyl carboxylic acids, derivatives thereof, compositions containing same method of use |
| US5006542A (en) * | 1988-10-31 | 1991-04-09 | E. R. Squibb & Sons, Inc. | Arylthioalkylphenyl carboxylic acids, derivatives thereof, compositions containing same and method of use |
| US4959383A (en) * | 1988-10-31 | 1990-09-25 | E. R. Squibb & Sons, Inc. | Phenylsulfone alkenoic acids, derivatives thereof, compositions containing same and method of use |
| US4975452A (en) * | 1989-06-02 | 1990-12-04 | E. R. Squibb & Sons, Inc. | Geminally substituted thiaheterocyclic carboxylic acids and derivatives thereof |
| US5106991A (en) * | 1989-06-02 | 1992-04-21 | E. R. Squibb & Sons, Inc. | Geminally substituted thiaheterocyclic carboxylic acids and derivatives thereof |
| US5153214A (en) * | 1989-06-28 | 1992-10-06 | Ciba-Geigy Corporation | Certain (arylsulfonamido- and imidazolyl-)-substituted carboxylic acids and derivatives thereof and use for suppressing thromboxane activity |
| US5025025A (en) * | 1989-06-28 | 1991-06-18 | Ciba-Geigy Corporation | (Arylsulfonamido- and pyridyl-)-substituted carboxylic acids and derivatives thereof and use for suppressing thromboxane activity |
| DE4010536A1 (de) * | 1990-04-02 | 1991-10-10 | Boehringer Mannheim Gmbh | Pharmazeutische waessrige loesung von 4-(2-(benzolsulfonylamino)-ethyl)-phenoxyessigsaeure |
| FR2665440B1 (fr) * | 1990-07-31 | 1994-02-04 | Lipha | Nouveaux cycloalkylsulfonamides substitues, procedes de preparation et medicaments les contenant. |
| US5189211A (en) * | 1990-08-01 | 1993-02-23 | Taisho Pharmaceutical Co., Ltd. | Sulfonamide derivatives |
| US5409959A (en) * | 1991-01-29 | 1995-04-25 | Genelabs Incorporated | Antithrombotic treatment with calix(n)arene compounds |
| DE4109735A1 (de) * | 1991-03-25 | 1992-10-01 | Boehringer Mannheim Gmbh | Neue sulfonamide, verfahren zu ihrer herstellung und arzneimittel, die diese verbindungen enthalten |
| US5280034A (en) * | 1991-08-23 | 1994-01-18 | E. R. Squibb & Sons, Inc. | Bis-heterocyclic prostaglandin analogs |
| US5827868A (en) * | 1991-10-07 | 1998-10-27 | E. R. Squibb & Sons, Inc. | Prostaglandin analogs |
| TW219358B (es) * | 1991-12-20 | 1994-01-21 | Hokuriku Pharmaceutical | |
| GB9220137D0 (en) * | 1992-09-23 | 1992-11-04 | Pfizer Ltd | Therapeutic agents |
| JPH0753505A (ja) * | 1992-10-01 | 1995-02-28 | Hokuriku Seiyaku Co Ltd | ベンゼンスルホンアミド誘導体及びその用途 |
| EP0896533B1 (en) * | 1996-02-22 | 2003-09-10 | Tularik, Inc. | Pentafluorobenzenesulfonamides and analogs |
| CN1147294C (zh) * | 1996-07-19 | 2004-04-28 | 图拉列克股份有限公司 | 五氟苯磺酰胺及其类似物 |
| GB9702194D0 (en) | 1997-02-04 | 1997-03-26 | Lilly Co Eli | Sulphonide derivatives |
| FR2760235B1 (fr) * | 1997-02-28 | 1999-04-09 | Adir | Nouveaux derives de benzenesulfonylamine, leur procede de preparation et les compositions pharmaceutiques qui les contiennent |
| UA67754C2 (uk) | 1997-10-10 | 2004-07-15 | Пфайзер, Інк. | Агоністи простагландину, фармацевтична композиція на їх основі (варіанти), спосіб нарощення та збереження кісткової маси у хребетних та спосіб лікування (варіанти) |
| US6693137B1 (en) * | 1998-07-31 | 2004-02-17 | Eli Lilly And Company | Sulphonamide derivatives |
| AP2002002555A0 (en) | 1999-12-22 | 2002-06-30 | Pfizer Prod Inc | EP4 Receptor selective agonists in the treatment of osteoporosis. |
| US20050250854A1 (en) * | 2000-11-03 | 2005-11-10 | Amgen Inc. | Combination therapy using pentafluorobenzenesulfonamides and antineoplastic agents |
| US6822001B2 (en) | 2000-11-03 | 2004-11-23 | Tularik Inc. | Combination therapy using pentafluorobenzenesulfonamides and antineoplastic agents |
| AU2005300150A1 (en) * | 2004-10-29 | 2006-05-04 | Astrazeneca Ab | Novel sulphonamide derivatives as glucocorticoid receptor modulators for the treatment of inflammatory diseases |
| TW200829578A (en) | 2006-11-23 | 2008-07-16 | Astrazeneca Ab | Chemical compounds 537 |
| JO2754B1 (en) | 2006-12-21 | 2014-03-15 | استرازينكا ايه بي | Amylendazoleil derivatives for the treatment of glucocorticoid-mediated disorders |
| WO2008132154A1 (en) * | 2007-04-27 | 2008-11-06 | Tibotec Pharmaceuticals Ltd. | Methods for the preparation of n-isobutyl-n-(2-hydroxy-3-amino-4-phenylbutyl)-p-nitrobenzenesulfonylamide derivatives |
| UY31831A (es) | 2008-05-20 | 2010-01-05 | Astrazeneca Ab | Derivados de indazoles sustituidos con fenilo o piridinilo |
| WO2010005922A1 (en) * | 2008-07-07 | 2010-01-14 | Fasgen, Inc. | Novel compounds, pharmaceutical compositions containing same, methods of use for same, and methods for preparing same |
| US10207989B2 (en) | 2012-09-20 | 2019-02-19 | Temple University—Of the Commonwealth System of Higher Education | Substituted alkyl diaryl derivatives, methods of preparation and uses |
| US12161632B2 (en) | 2014-05-16 | 2024-12-10 | Cumberland Pharmaceuticals Inc. | Compositions and methods of treating cardiac fibrosis with ifetroban |
| US9693998B2 (en) | 2014-05-16 | 2017-07-04 | Cumberland Pharmaceuticals, Inc. | Compositions and methods of treating cardiac fibrosis with ifetroban |
| KR20220137141A (ko) | 2015-06-30 | 2022-10-11 | 큠버랜드 파마슈티컬즈 인코포레이티드 | Aerd/천식에서 트롬복산 수용체 길항제 |
| US10383831B2 (en) | 2015-08-03 | 2019-08-20 | Temple University—Of the Commonwealth System of Higher Education | 2,4,6-trialkoxystryl aryl sulfones, sulfonamides and carboxamides, and methods of preparation and use |
| AU2017263462B2 (en) | 2016-05-11 | 2021-05-13 | Cumberland Pharmaceuticals, Inc. | Compositions and methods of treating muscular dystrophy with thromboxane-A2 receptor antagonists |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE542184A (es) * | 1954-10-21 | |||
| US3027405A (en) * | 1959-07-29 | 1962-03-27 | Geigy Chem Corp | Nu-(alkylarylsulfonyl)-amino acids and salts thereof |
| US3991106A (en) * | 1974-09-13 | 1976-11-09 | Merck & Co., Inc. | 16-Ethers of 8-aza-9-dioxothia-11,12-seco-prostaglandins |
| DK148576A (da) * | 1975-04-18 | 1976-10-19 | Boehringer Mannheim Gmbh | Fenylalkankarbonsyrederivater og fremgangsmade til deres fremstilling |
| US4112236A (en) * | 1977-04-04 | 1978-09-05 | Merck & Co., Inc. | Interphenylene 8-aza-9-dioxothia-11,12-secoprostaglandins |
| GB1572201A (en) * | 1977-04-05 | 1980-07-23 | Bristol Myers Co | Cephalosporins |
| DE2809377A1 (de) * | 1978-03-04 | 1979-09-13 | Boehringer Mannheim Gmbh | Phenoxyalkylcarbonsaeure-derivate, verfahren zu deren herstellung sowie diese verbindungen enthaltende arzneimittel |
| DE3000519A1 (de) * | 1979-02-01 | 1980-08-14 | Byk Gulden Lomberg Chem Fab | Sulfonamido-alkansaeuren, ihre verwendung und herstellung sowie sie enthaltende arzneimittel |
-
1980
- 1980-01-07 DE DE19803000377 patent/DE3000377A1/de not_active Withdrawn
- 1980-12-17 CA CA000366994A patent/CA1241341A/en not_active Expired
- 1980-12-24 AT AT80108207T patent/ATE6641T1/de not_active IP Right Cessation
- 1980-12-24 DE DE8080108207T patent/DE3067068D1/de not_active Expired
- 1980-12-24 EP EP80108207A patent/EP0031954B1/de not_active Expired
- 1980-12-29 GR GR63765A patent/GR72486B/el unknown
- 1980-12-31 CS CS809599A patent/CS238611B2/cs unknown
- 1980-12-31 IL IL61834A patent/IL61834A/xx not_active IP Right Cessation
- 1980-12-31 FI FI804085A patent/FI73667C/fi not_active IP Right Cessation
-
1981
- 1981-01-02 ZA ZA00810032A patent/ZA8132B/xx unknown
- 1981-01-02 PT PT72305A patent/PT72305B/pt not_active IP Right Cessation
- 1981-01-03 ES ES498308A patent/ES8200655A1/es not_active Expired
- 1981-01-04 SU SU813223600A patent/SU1088664A3/ru active
- 1981-01-05 PH PH25051A patent/PH18739A/en unknown
- 1981-01-05 AU AU65974/81A patent/AU538993B2/en not_active Ceased
- 1981-01-05 IE IE6/81A patent/IE50657B1/en not_active IP Right Cessation
- 1981-01-06 PL PL1981229072A patent/PL127050B1/pl unknown
- 1981-01-06 YU YU8/81A patent/YU42995B/xx unknown
- 1981-01-06 DD DD81226847A patent/DD157190A5/de unknown
- 1981-01-07 JP JP54081A patent/JPS56100757A/ja active Granted
-
1982
- 1982-07-07 US US06/395,882 patent/US4443477A/en not_active Expired - Lifetime
-
1987
- 1987-01-15 SG SG23/87A patent/SG2387G/en unknown
- 1987-09-24 HK HK688/87A patent/HK68887A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FI73667B (fi) | 1987-07-31 |
| IE50657B1 (en) | 1986-06-11 |
| EP0031954A3 (en) | 1981-11-11 |
| ZA8132B (en) | 1982-02-24 |
| ES498308A0 (es) | 1981-12-01 |
| ATE6641T1 (de) | 1984-03-15 |
| YU881A (en) | 1983-10-31 |
| GR72486B (es) | 1983-11-14 |
| DD157190A5 (de) | 1982-10-20 |
| SU1088664A3 (ru) | 1984-04-23 |
| DE3000377A1 (de) | 1981-07-09 |
| JPS56100757A (en) | 1981-08-12 |
| PL127050B1 (en) | 1983-09-30 |
| JPS6352625B2 (es) | 1988-10-19 |
| SG2387G (en) | 1987-11-13 |
| CA1241341A (en) | 1988-08-30 |
| AU6597481A (en) | 1981-07-16 |
| IE810006L (en) | 1981-07-07 |
| IL61834A0 (en) | 1981-01-30 |
| HK68887A (en) | 1987-10-02 |
| FI804085L (fi) | 1981-07-08 |
| PL229072A1 (es) | 1982-04-26 |
| EP0031954B1 (de) | 1984-03-14 |
| ES8200655A1 (es) | 1981-12-01 |
| PT72305B (de) | 1981-12-17 |
| DE3067068D1 (en) | 1984-04-19 |
| EP0031954A2 (de) | 1981-07-15 |
| IL61834A (en) | 1984-06-29 |
| YU42995B (en) | 1989-02-28 |
| PT72305A (de) | 1981-02-01 |
| AU538993B2 (en) | 1984-09-06 |
| PH18739A (en) | 1985-09-16 |
| FI73667C (fi) | 1987-11-09 |
| US4443477A (en) | 1984-04-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CS238611B2 (en) | Preparation method of sulphone-amides | |
| US4258058A (en) | Phenoxyalkylcarboxylic acid compounds and thrombocyte-aggregation inhibition | |
| EP0901466B1 (en) | Biphenylsulfonamide matrix metalloproteinase inhibitors | |
| JP5450105B2 (ja) | ビフェニル−4−イル−スルホン酸アリールアミド及びその治療剤としての使用 | |
| EP0223593B1 (en) | Phenoxyalkylcarboxylic acids and esters and their preparation and pharmaceutical formulation | |
| HU204029B (en) | Process for producing sulfonamide derivatives and pharmaceutical compositions comprising same | |
| JPH0395154A (ja) | [ジ―tert―ブチル(ヒドロキシ)フェニルチオ]置換ヒドロキサム酸誘導体 | |
| US5756545A (en) | Biphenysulfonamide matrix metal alloproteinase inhibitors | |
| EP0239907B1 (de) | Neue Phenoxyalkylcarbonsäure-Derivate, Verfahren zu ihrer Herstellung, sowie diese Verbindungen enthaltende Arzneimittel | |
| RU2345063C2 (ru) | Сульфоновые кислоты, производные указанных кислот и содержащие их фармацевтические композиции | |
| SU664561A3 (ru) | Способ получени производных 2-/4(ациламиноалкил)-фенокси/-алкилкарбоновой кислоты или их солей | |
| CA1043806A (en) | Phenoxy-alkyl-carboxylic acid derivatives | |
| RU2208610C2 (ru) | Пиперазиновые производные, способ их получения и содержащая их композиция | |
| US5534533A (en) | Carboxylate derivatives exhibiting phospholipase A2 inhibitory activity | |
| CA2030004A1 (en) | Tetrahydronaphthalene derivatives and preparation thereof | |
| US3954763A (en) | N-Metatrifluoromethylthiophenyl-piperazine | |
| KR840001855B1 (ko) | 술폰아미드류의 제조방법 | |
| HU185854B (en) | Process for preparing new sulphonamide derivatives | |
| US4031094A (en) | N-meta-trifluoromethylpiperazines | |
| IE914044A1 (en) | Pharmaceutical compositions containing sulfonamides, novel¹sulfonamides and process for their production | |
| IE904648A1 (en) | New phenoxyalkylcarboxylic acid amides, processes for the¹preparation thereof and pharmaceutical compositions¹containing them | |
| IE47972B1 (en) | Phenoxyalkylcarboxylic acid derivatives | |
| EP0375557A1 (en) | Glycine derivative process for preparation thereof, and pharmaceutical composition containing it |