CS219305B2 - Method of making the halogenacetanilide - Google Patents
Method of making the halogenacetanilide Download PDFInfo
- Publication number
- CS219305B2 CS219305B2 CS811977A CS197781A CS219305B2 CS 219305 B2 CS219305 B2 CS 219305B2 CS 811977 A CS811977 A CS 811977A CS 197781 A CS197781 A CS 197781A CS 219305 B2 CS219305 B2 CS 219305B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- alkoxy
- alkyl
- ether
- group
- reaction
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title description 3
- 238000000034 method Methods 0.000 claims abstract description 20
- 238000006243 chemical reaction Methods 0.000 claims abstract description 17
- 239000002904 solvent Substances 0.000 claims abstract description 12
- 239000003444 phase transfer catalyst Substances 0.000 claims abstract description 9
- 239000002253 acid Substances 0.000 claims abstract description 7
- 150000004820 halides Chemical class 0.000 claims abstract description 7
- 238000002360 preparation method Methods 0.000 claims abstract description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims abstract description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 24
- 125000004432 carbon atom Chemical group C* 0.000 claims description 20
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 17
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 15
- 125000000217 alkyl group Chemical group 0.000 claims description 12
- 229910052799 carbon Inorganic materials 0.000 claims description 12
- 150000001875 compounds Chemical class 0.000 claims description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 10
- 125000003545 alkoxy group Chemical group 0.000 claims description 9
- 229910052801 chlorine Inorganic materials 0.000 claims description 7
- 239000000460 chlorine Substances 0.000 claims description 7
- 125000003342 alkenyl group Chemical group 0.000 claims description 6
- FXXACINHVKSMDR-UHFFFAOYSA-N acetyl bromide Chemical compound CC(Br)=O FXXACINHVKSMDR-UHFFFAOYSA-N 0.000 claims description 4
- 125000000304 alkynyl group Chemical group 0.000 claims description 4
- HTZCNXWZYVXIMZ-UHFFFAOYSA-M benzyl(triethyl)azanium;chloride Chemical compound [Cl-].CC[N+](CC)(CC)CC1=CC=CC=C1 HTZCNXWZYVXIMZ-UHFFFAOYSA-M 0.000 claims description 4
- SNOOUWRIMMFWNE-UHFFFAOYSA-M sodium;6-[(3,4,5-trimethoxybenzoyl)amino]hexanoate Chemical compound [Na+].COC1=CC(C(=O)NCCCCCC([O-])=O)=CC(OC)=C1OC SNOOUWRIMMFWNE-UHFFFAOYSA-M 0.000 claims description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 3
- CHQVQXZFZHACQQ-UHFFFAOYSA-M benzyl(triethyl)azanium;bromide Chemical compound [Br-].CC[N+](CC)(CC)CC1=CC=CC=C1 CHQVQXZFZHACQQ-UHFFFAOYSA-M 0.000 claims description 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 claims description 2
- 239000012346 acetyl chloride Substances 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Chemical group 0.000 claims description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 2
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 claims 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 claims 1
- 229910000043 hydrogen iodide Inorganic materials 0.000 claims 1
- -1 haloalkyl ether Chemical compound 0.000 abstract description 16
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 abstract description 11
- 238000011065 in-situ storage Methods 0.000 abstract description 6
- HRQGCQVOJVTVLU-UHFFFAOYSA-N bis(chloromethyl) ether Chemical compound ClCOCCl HRQGCQVOJVTVLU-UHFFFAOYSA-N 0.000 abstract description 2
- 239000006227 byproduct Substances 0.000 abstract description 2
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 abstract description 2
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 abstract 3
- 230000003247 decreasing effect Effects 0.000 abstract 1
- 239000000203 mixture Substances 0.000 description 14
- 239000002585 base Substances 0.000 description 13
- 229910052739 hydrogen Inorganic materials 0.000 description 7
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 229930040373 Paraformaldehyde Natural products 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 4
- 239000010410 layer Substances 0.000 description 4
- 229920002866 paraformaldehyde Polymers 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- HYGWNUKOUCZBND-UHFFFAOYSA-N azanide Chemical compound [NH2-] HYGWNUKOUCZBND-UHFFFAOYSA-N 0.000 description 3
- 235000019441 ethanol Nutrition 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- NKCXALLPUHSJIO-UHFFFAOYSA-N 2-chloro-n-(2-methoxy-6-methylphenyl)-n-propan-2-yloxypropanamide Chemical compound COC1=CC=CC(C)=C1N(OC(C)C)C(=O)C(C)Cl NKCXALLPUHSJIO-UHFFFAOYSA-N 0.000 description 2
- HHRZBYFCNZFYAB-UHFFFAOYSA-N 2-chloro-n-(2-methoxy-6-methylphenyl)acetamide Chemical compound COC1=CC=CC(C)=C1NC(=O)CCl HHRZBYFCNZFYAB-UHFFFAOYSA-N 0.000 description 2
- QPRQEDXDYOZYLA-UHFFFAOYSA-N 2-methylbutan-1-ol Chemical compound CCC(C)CO QPRQEDXDYOZYLA-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 150000003334 secondary amides Chemical class 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 231100000925 very toxic Toxicity 0.000 description 2
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- XEZNGIUYQVAUSS-UHFFFAOYSA-N 18-crown-6 Chemical compound C1COCCOCCOCCOCCOCCO1 XEZNGIUYQVAUSS-UHFFFAOYSA-N 0.000 description 1
- VONWPEXRCLHKRJ-UHFFFAOYSA-N 2-chloro-n-phenylacetamide Chemical class ClCC(=O)NC1=CC=CC=C1 VONWPEXRCLHKRJ-UHFFFAOYSA-N 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- MREBHKVJKWXYMM-UHFFFAOYSA-N CCOCCOC1=C(N(C(C(Cl)C)=O)OCC)C(=CC=C1)C(C)C Chemical compound CCOCCOC1=C(N(C(C(Cl)C)=O)OCC)C(=CC=C1)C(C)C MREBHKVJKWXYMM-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- XJUZRXYOEPSWMB-UHFFFAOYSA-N Chloromethyl methyl ether Chemical compound COCCl XJUZRXYOEPSWMB-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- LBJVHMAYBNQJBK-UHFFFAOYSA-N N-(2,6-diethylphenyl)-2-chloroacetamide Chemical compound CCC1=CC=CC(CC)=C1NC(=O)CCl LBJVHMAYBNQJBK-UHFFFAOYSA-N 0.000 description 1
- 125000002015 acyclic group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910000318 alkali metal phosphate Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 150000003931 anilides Chemical group 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 description 1
- 239000000292 calcium oxide Substances 0.000 description 1
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 1
- 230000000711 cancerogenic effect Effects 0.000 description 1
- 231100000315 carcinogenic Toxicity 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229920005556 chlorobutyl Polymers 0.000 description 1
- 125000002603 chloroethyl group Chemical group [H]C([*])([H])C([H])([H])Cl 0.000 description 1
- 229940061627 chloromethyl methyl ether Drugs 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical compound [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229910001467 sodium calcium phosphate Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C209/00—Preparation of compounds containing amino groups bound to a carbon skeleton
- C07C209/04—Preparation of compounds containing amino groups bound to a carbon skeleton by substitution of functional groups by amino groups
- C07C209/06—Preparation of compounds containing amino groups bound to a carbon skeleton by substitution of functional groups by amino groups by substitution of halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D309/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings
- C07D309/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D309/04—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D309/06—Radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C211/00—Compounds containing amino groups bound to a carbon skeleton
- C07C211/01—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms
- C07C211/02—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton
- C07C211/15—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton the carbon skeleton being further substituted by halogen atoms or by nitro or nitroso groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
- Furan Compounds (AREA)
- Epoxy Compounds (AREA)
- Pyrane Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/133,720 US4284564A (en) | 1980-03-25 | 1980-03-25 | Process for the in-solvent, in-situ generation of haloalkyl alkyl ethers useful to produce N-substituted-2-haloacetanilides |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS219305B2 true CS219305B2 (en) | 1983-03-25 |
Family
ID=22459995
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS811977A CS219305B2 (en) | 1980-03-25 | 1981-03-18 | Method of making the halogenacetanilide |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US4284564A (enExample) |
| EP (1) | EP0037656B1 (enExample) |
| JP (1) | JPS56150032A (enExample) |
| KR (1) | KR840000238B1 (enExample) |
| AR (1) | AR229509A1 (enExample) |
| AT (1) | ATE7291T1 (enExample) |
| AU (1) | AU536552B2 (enExample) |
| BG (1) | BG35895A3 (enExample) |
| BR (1) | BR8101607A (enExample) |
| CA (1) | CA1165325A (enExample) |
| CS (1) | CS219305B2 (enExample) |
| DE (1) | DE3163356D1 (enExample) |
| ES (2) | ES500464A0 (enExample) |
| HU (1) | HU188545B (enExample) |
| IL (1) | IL62408A (enExample) |
| MX (1) | MX157884A (enExample) |
| MY (1) | MY8600462A (enExample) |
| NZ (1) | NZ196539A (enExample) |
| PL (1) | PL129317B1 (enExample) |
| YU (1) | YU42388B (enExample) |
| ZA (1) | ZA811810B (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| HU177876B (en) * | 1979-04-24 | 1982-01-28 | Nitrokemia Ipartelepek | Process for preparing 2,6-dialkyl-n-/alkoxy-methyl/-chloro-acetanilide derivatives |
| US4798618A (en) * | 1981-12-10 | 1989-01-17 | Agro-Kanesho Co., Ltd. | Novel chloroacetanilide derivatives and herbicides containing the same for use in paddy field |
| HU190681B (en) * | 1982-01-15 | 1986-10-28 | Eszakmagyar Vegyimuevek | Process for production of n-alcoxi-alkyl-2,6-dialkylchlor-acetanilids |
| JPH042552U (enExample) * | 1990-04-24 | 1992-01-10 | ||
| JPH05228796A (ja) * | 1992-02-13 | 1993-09-07 | Nippon Avionics Co Ltd | 位置決め制御装置 |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2863752A (en) * | 1953-10-30 | 1958-12-09 | Monsanto Chemicals | Herbicides |
| NL282569A (enExample) * | 1961-08-28 | |||
| US3442945A (en) * | 1967-05-22 | 1969-05-06 | Monsanto Co | Phytotoxic alpha-halo-acetanilides |
| US3547620A (en) * | 1969-01-23 | 1970-12-15 | Monsanto Co | N-(oxamethyl)alpha-halo-acetanilide herbicides |
| US3952056A (en) * | 1972-02-07 | 1976-04-20 | Ciba-Geigy Corporation | Plant growth regulating agent |
| US4160660A (en) * | 1972-02-07 | 1979-07-10 | Ciba-Geigy Corporation | Acetanilide plant growth regulating agent |
| US4168965A (en) * | 1972-06-06 | 1979-09-25 | Ciba-Geigy Corporation | 2,6-Diethyl-n-(2'-N-propoxyethyl)-chloroacetanilide for selectively combating weeds |
| US4200451A (en) * | 1972-06-06 | 1980-04-29 | Ciba-Geigy Corporation | Plant growth regulating agent |
| US3937730A (en) * | 1972-06-06 | 1976-02-10 | Ciba-Geigy Corporation | Plant growth regulating agent |
| US4070179A (en) * | 1973-02-07 | 1978-01-24 | Ciba-Geigy Corporation | Plant growth regulation with N-(2-alkoxy-ethyl)-N-chloroacetyl-2,3,6-trimethyl-anilines |
| SU643488A1 (ru) * | 1976-08-04 | 1979-01-25 | Предприятие П/Я Р-6462 | Способ получени -хлорэтиловых эфиров замещенных спиртов |
-
1980
- 1980-03-18 ZA ZA00811810A patent/ZA811810B/xx unknown
- 1980-03-25 US US06/133,720 patent/US4284564A/en not_active Expired - Lifetime
-
1981
- 1981-03-18 BR BR8101607A patent/BR8101607A/pt not_active IP Right Cessation
- 1981-03-18 AR AR284656A patent/AR229509A1/es active
- 1981-03-18 PL PL1981230203A patent/PL129317B1/pl unknown
- 1981-03-18 AT AT81301135T patent/ATE7291T1/de not_active IP Right Cessation
- 1981-03-18 CA CA000373352A patent/CA1165325A/en not_active Expired
- 1981-03-18 ES ES500464A patent/ES500464A0/es active Granted
- 1981-03-18 MX MX186439A patent/MX157884A/es unknown
- 1981-03-18 EP EP81301135A patent/EP0037656B1/en not_active Expired
- 1981-03-18 YU YU707/81A patent/YU42388B/xx unknown
- 1981-03-18 ES ES500463A patent/ES500463A0/es active Granted
- 1981-03-18 AU AU68492/81A patent/AU536552B2/en not_active Ceased
- 1981-03-18 BG BG051260A patent/BG35895A3/xx unknown
- 1981-03-18 CS CS811977A patent/CS219305B2/cs unknown
- 1981-03-18 JP JP3807381A patent/JPS56150032A/ja active Granted
- 1981-03-18 IL IL62408A patent/IL62408A/xx unknown
- 1981-03-18 DE DE8181301135T patent/DE3163356D1/de not_active Expired
- 1981-03-18 KR KR1019810000880A patent/KR840000238B1/ko not_active Expired
- 1981-03-18 HU HU81686A patent/HU188545B/hu not_active IP Right Cessation
- 1981-03-19 NZ NZ196539A patent/NZ196539A/xx unknown
-
1986
- 1986-12-30 MY MY462/86A patent/MY8600462A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| ES8202531A1 (es) | 1982-02-01 |
| AR229509A1 (es) | 1983-09-15 |
| IL62408A0 (en) | 1981-05-20 |
| ES8202536A1 (es) | 1982-02-01 |
| BG35895A3 (en) | 1984-07-16 |
| ZA811810B (en) | 1982-04-28 |
| KR830005097A (ko) | 1983-07-23 |
| ES500464A0 (es) | 1982-02-01 |
| JPH027940B2 (enExample) | 1990-02-21 |
| ES500463A0 (es) | 1982-02-01 |
| EP0037656A1 (en) | 1981-10-14 |
| YU42388B (en) | 1988-08-31 |
| NZ196539A (en) | 1983-06-17 |
| AU536552B2 (en) | 1984-05-10 |
| KR840000238B1 (ko) | 1984-03-07 |
| US4284564A (en) | 1981-08-18 |
| EP0037656B1 (en) | 1984-05-02 |
| YU70781A (en) | 1983-09-30 |
| MY8600462A (en) | 1986-12-31 |
| IL62408A (en) | 1985-10-31 |
| JPS56150032A (en) | 1981-11-20 |
| AU6849281A (en) | 1981-10-01 |
| BR8101607A (pt) | 1981-09-29 |
| MX157884A (es) | 1988-12-19 |
| HU188545B (en) | 1986-04-28 |
| ATE7291T1 (de) | 1984-05-15 |
| PL129317B1 (en) | 1984-04-30 |
| CA1165325A (en) | 1984-04-10 |
| PL230203A1 (enExample) | 1981-11-13 |
| DE3163356D1 (en) | 1984-06-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP6676038B2 (ja) | ヘキサフルオロプロペンから出発する5−フルオロ−1h−ピラゾール類の調製のための方法 | |
| KR100975520B1 (ko) | 마이코페놀레이트 모페틸의 개선된 제조방법 | |
| CS219305B2 (en) | Method of making the halogenacetanilide | |
| EP1414786B1 (en) | Process for obtaining n-monosubstituted amides | |
| US7847117B2 (en) | Process for preparing alkyl(methoxymethyl)trimethylsilanylmethylamines | |
| DK2931703T3 (en) | METHOD FOR PREPARING BIS (3-AMINOPHENYL) -DISULPHIDES AND 3-AMINOTHIOLS | |
| US6060623A (en) | Process for producing amine borane compound | |
| SU1072800A3 (ru) | Способ получени гидрогалогенидов 2-меркаптоэтиламина и его вариант | |
| EP0147472A1 (en) | 4-chloro-4-methyl-5-methylene-1,3-dioxolan-2-one | |
| US4327040A (en) | Preparation of phosphoric acid propargyl esters | |
| WO2017044043A1 (en) | Process for direct amidation of amines via rh(i)-catalyzed addition of boroxines | |
| JP3855570B2 (ja) | 4−アセチルテトラヒドロピランの製法 | |
| US20050203287A1 (en) | Process for the preparation of sulfamate derivatives | |
| EP0053400B1 (en) | Process for preparing malononitrile | |
| JP5068642B2 (ja) | ピロール−2−カルボニトリルの合成 | |
| WO2012172893A1 (ja) | ヘキサフルオロアセトンまたはその水和物の製造法 | |
| EP0183797B1 (en) | 5-halo-4h-1,3-dioxin-4-one compounds, process for their preparation and their use in the preparation of alpha-halo-acetoacetic esters | |
| KR100449310B1 (ko) | 2-데옥시-l-리보스의 제조방법 | |
| KR20230060027A (ko) | 비대칭형 포스페이트계 화합물의 제조방법 | |
| SU1657503A1 (ru) | Способ получени @ , @ -дихлортетрагидрофурилового эфира этиленгликол | |
| KR890002977B1 (ko) | 시스, 트랜스-2-(β,β-디클로로비닐)-3,3-디메틸 싸이클로 프로판 카르복실염의 제조방법 | |
| ZA200608135B (en) | Synthesis of pyrrole-2-carbonitriles | |
| KR100388432B1 (ko) | 디알킬(4-히드록시-3,5-디(t-부틸)벤질)포스포네이트의제조 방법 | |
| KR100454090B1 (ko) | 3-클로로-2-(4-클로로-2-플루오로-5-히드록시페닐)-4,5,6,7-테트라히드로-2h-인다졸의 제조방법 | |
| JP2003183245A (ja) | アリールスルホンの製造方法 |