HU188545B - Process for producing in situ halogeno-alkyl-alkyl-ethers for producing n-substituted 2-halogeno-acetanilides - Google Patents
Process for producing in situ halogeno-alkyl-alkyl-ethers for producing n-substituted 2-halogeno-acetanilides Download PDFInfo
- Publication number
- HU188545B HU188545B HU81686A HU68681A HU188545B HU 188545 B HU188545 B HU 188545B HU 81686 A HU81686 A HU 81686A HU 68681 A HU68681 A HU 68681A HU 188545 B HU188545 B HU 188545B
- Authority
- HU
- Hungary
- Prior art keywords
- formula
- alkoxy
- alkyl
- preparation
- haloacetanilide
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 23
- 238000011065 in-situ storage Methods 0.000 title abstract description 4
- -1 haloalkyl ether Chemical compound 0.000 claims abstract description 19
- 238000006243 chemical reaction Methods 0.000 claims abstract description 16
- 239000003444 phase transfer catalyst Substances 0.000 claims abstract description 11
- 238000002360 preparation method Methods 0.000 claims abstract description 10
- 239000002904 solvent Substances 0.000 claims abstract description 7
- 239000002253 acid Substances 0.000 claims abstract description 6
- 150000004820 halides Chemical class 0.000 claims abstract description 5
- 239000000460 chlorine Substances 0.000 claims description 21
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 18
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 15
- 125000003545 alkoxy group Chemical group 0.000 claims description 15
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 150000001875 compounds Chemical class 0.000 claims description 8
- 239000011541 reaction mixture Substances 0.000 claims description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 6
- 125000000304 alkynyl group Chemical group 0.000 claims description 6
- 229910052799 carbon Inorganic materials 0.000 claims description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 5
- FXXACINHVKSMDR-UHFFFAOYSA-N acetyl bromide Chemical compound CC(Br)=O FXXACINHVKSMDR-UHFFFAOYSA-N 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- CHQVQXZFZHACQQ-UHFFFAOYSA-M benzyl(triethyl)azanium;bromide Chemical compound [Br-].CC[N+](CC)(CC)CC1=CC=CC=C1 CHQVQXZFZHACQQ-UHFFFAOYSA-M 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 claims description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 claims description 2
- 239000012346 acetyl chloride Substances 0.000 claims description 2
- KXHPPCXNWTUNSB-UHFFFAOYSA-M benzyl(trimethyl)azanium;chloride Chemical compound [Cl-].C[N+](C)(C)CC1=CC=CC=C1 KXHPPCXNWTUNSB-UHFFFAOYSA-M 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Chemical group 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 claims description 2
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- 125000003158 alcohol group Chemical group 0.000 claims 3
- 125000004432 carbon atom Chemical group C* 0.000 claims 3
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims 1
- 125000006274 (C1-C3)alkoxy group Chemical group 0.000 claims 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- 150000001298 alcohols Chemical class 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- 229940071870 hydroiodic acid Drugs 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 abstract description 9
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 abstract description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 abstract description 5
- 239000006227 byproduct Substances 0.000 abstract description 3
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 abstract description 2
- HRQGCQVOJVTVLU-UHFFFAOYSA-N bis(chloromethyl) ether Chemical compound ClCOCCl HRQGCQVOJVTVLU-UHFFFAOYSA-N 0.000 abstract 1
- 230000003247 decreasing effect Effects 0.000 abstract 1
- 239000000203 mixture Substances 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 238000004458 analytical method Methods 0.000 description 7
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- 239000012074 organic phase Substances 0.000 description 5
- 229930040373 Paraformaldehyde Natural products 0.000 description 4
- 239000003153 chemical reaction reagent Substances 0.000 description 4
- 229920002866 paraformaldehyde Polymers 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- 235000019441 ethanol Nutrition 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- HHRZBYFCNZFYAB-UHFFFAOYSA-N 2-chloro-n-(2-methoxy-6-methylphenyl)acetamide Chemical compound COC1=CC=CC(C)=C1NC(=O)CCl HHRZBYFCNZFYAB-UHFFFAOYSA-N 0.000 description 2
- QPRQEDXDYOZYLA-UHFFFAOYSA-N 2-methylbutan-1-ol Chemical compound CCC(C)CO QPRQEDXDYOZYLA-UHFFFAOYSA-N 0.000 description 2
- FZERHIULMFGESH-UHFFFAOYSA-N N-phenylacetamide Chemical compound CC(=O)NC1=CC=CC=C1 FZERHIULMFGESH-UHFFFAOYSA-N 0.000 description 2
- 150000001450 anions Chemical class 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000006531 (C2-C5) alkyl group Chemical group 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- LJQZZLGKEVOCIU-UHFFFAOYSA-N 2-chloro-2-(2-ethoxyethoxy)-n-(2-propan-2-ylphenyl)acetamide Chemical compound CCOCCOC(Cl)C(=O)NC1=CC=CC=C1C(C)C LJQZZLGKEVOCIU-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- 229960001413 acetanilide Drugs 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 125000002015 acyclic group Chemical group 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 150000003931 anilides Chemical group 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- HYGWNUKOUCZBND-UHFFFAOYSA-N azanide Chemical compound [NH2-] HYGWNUKOUCZBND-UHFFFAOYSA-N 0.000 description 1
- 229940088623 biologically active substance Drugs 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000005868 electrolysis reaction Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 125000004970 halomethyl group Chemical group 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 239000006166 lysate Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910001512 metal fluoride Inorganic materials 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical compound [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 239000011698 potassium fluoride Substances 0.000 description 1
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Inorganic materials [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 description 1
- 235000003270 potassium fluoride Nutrition 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C209/00—Preparation of compounds containing amino groups bound to a carbon skeleton
- C07C209/04—Preparation of compounds containing amino groups bound to a carbon skeleton by substitution of functional groups by amino groups
- C07C209/06—Preparation of compounds containing amino groups bound to a carbon skeleton by substitution of functional groups by amino groups by substitution of halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D309/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings
- C07D309/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D309/04—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D309/06—Radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C211/00—Compounds containing amino groups bound to a carbon skeleton
- C07C211/01—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms
- C07C211/02—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton
- C07C211/15—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton the carbon skeleton being further substituted by halogen atoms or by nitro or nitroso groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
- Furan Compounds (AREA)
- Epoxy Compounds (AREA)
- Pyrane Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/133,720 US4284564A (en) | 1980-03-25 | 1980-03-25 | Process for the in-solvent, in-situ generation of haloalkyl alkyl ethers useful to produce N-substituted-2-haloacetanilides |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU188545B true HU188545B (en) | 1986-04-28 |
Family
ID=22459995
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU81686A HU188545B (en) | 1980-03-25 | 1981-03-18 | Process for producing in situ halogeno-alkyl-alkyl-ethers for producing n-substituted 2-halogeno-acetanilides |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US4284564A (enExample) |
| EP (1) | EP0037656B1 (enExample) |
| JP (1) | JPS56150032A (enExample) |
| KR (1) | KR840000238B1 (enExample) |
| AR (1) | AR229509A1 (enExample) |
| AT (1) | ATE7291T1 (enExample) |
| AU (1) | AU536552B2 (enExample) |
| BG (1) | BG35895A3 (enExample) |
| BR (1) | BR8101607A (enExample) |
| CA (1) | CA1165325A (enExample) |
| CS (1) | CS219305B2 (enExample) |
| DE (1) | DE3163356D1 (enExample) |
| ES (2) | ES500464A0 (enExample) |
| HU (1) | HU188545B (enExample) |
| IL (1) | IL62408A (enExample) |
| MX (1) | MX157884A (enExample) |
| MY (1) | MY8600462A (enExample) |
| NZ (1) | NZ196539A (enExample) |
| PL (1) | PL129317B1 (enExample) |
| YU (1) | YU42388B (enExample) |
| ZA (1) | ZA811810B (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| HU177876B (en) * | 1979-04-24 | 1982-01-28 | Nitrokemia Ipartelepek | Process for preparing 2,6-dialkyl-n-/alkoxy-methyl/-chloro-acetanilide derivatives |
| US4798618A (en) * | 1981-12-10 | 1989-01-17 | Agro-Kanesho Co., Ltd. | Novel chloroacetanilide derivatives and herbicides containing the same for use in paddy field |
| HU190681B (en) * | 1982-01-15 | 1986-10-28 | Eszakmagyar Vegyimuevek | Process for production of n-alcoxi-alkyl-2,6-dialkylchlor-acetanilids |
| JPH042552U (enExample) * | 1990-04-24 | 1992-01-10 | ||
| JPH05228796A (ja) * | 1992-02-13 | 1993-09-07 | Nippon Avionics Co Ltd | 位置決め制御装置 |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2863752A (en) * | 1953-10-30 | 1958-12-09 | Monsanto Chemicals | Herbicides |
| NL282569A (enExample) * | 1961-08-28 | |||
| US3442945A (en) * | 1967-05-22 | 1969-05-06 | Monsanto Co | Phytotoxic alpha-halo-acetanilides |
| US3547620A (en) * | 1969-01-23 | 1970-12-15 | Monsanto Co | N-(oxamethyl)alpha-halo-acetanilide herbicides |
| US3952056A (en) * | 1972-02-07 | 1976-04-20 | Ciba-Geigy Corporation | Plant growth regulating agent |
| US4160660A (en) * | 1972-02-07 | 1979-07-10 | Ciba-Geigy Corporation | Acetanilide plant growth regulating agent |
| US4168965A (en) * | 1972-06-06 | 1979-09-25 | Ciba-Geigy Corporation | 2,6-Diethyl-n-(2'-N-propoxyethyl)-chloroacetanilide for selectively combating weeds |
| US4200451A (en) * | 1972-06-06 | 1980-04-29 | Ciba-Geigy Corporation | Plant growth regulating agent |
| US3937730A (en) * | 1972-06-06 | 1976-02-10 | Ciba-Geigy Corporation | Plant growth regulating agent |
| US4070179A (en) * | 1973-02-07 | 1978-01-24 | Ciba-Geigy Corporation | Plant growth regulation with N-(2-alkoxy-ethyl)-N-chloroacetyl-2,3,6-trimethyl-anilines |
| SU643488A1 (ru) * | 1976-08-04 | 1979-01-25 | Предприятие П/Я Р-6462 | Способ получени -хлорэтиловых эфиров замещенных спиртов |
-
1980
- 1980-03-18 ZA ZA00811810A patent/ZA811810B/xx unknown
- 1980-03-25 US US06/133,720 patent/US4284564A/en not_active Expired - Lifetime
-
1981
- 1981-03-18 BR BR8101607A patent/BR8101607A/pt not_active IP Right Cessation
- 1981-03-18 AR AR284656A patent/AR229509A1/es active
- 1981-03-18 PL PL1981230203A patent/PL129317B1/pl unknown
- 1981-03-18 AT AT81301135T patent/ATE7291T1/de not_active IP Right Cessation
- 1981-03-18 CA CA000373352A patent/CA1165325A/en not_active Expired
- 1981-03-18 ES ES500464A patent/ES500464A0/es active Granted
- 1981-03-18 MX MX186439A patent/MX157884A/es unknown
- 1981-03-18 EP EP81301135A patent/EP0037656B1/en not_active Expired
- 1981-03-18 YU YU707/81A patent/YU42388B/xx unknown
- 1981-03-18 ES ES500463A patent/ES500463A0/es active Granted
- 1981-03-18 AU AU68492/81A patent/AU536552B2/en not_active Ceased
- 1981-03-18 BG BG051260A patent/BG35895A3/xx unknown
- 1981-03-18 CS CS811977A patent/CS219305B2/cs unknown
- 1981-03-18 JP JP3807381A patent/JPS56150032A/ja active Granted
- 1981-03-18 IL IL62408A patent/IL62408A/xx unknown
- 1981-03-18 DE DE8181301135T patent/DE3163356D1/de not_active Expired
- 1981-03-18 KR KR1019810000880A patent/KR840000238B1/ko not_active Expired
- 1981-03-18 HU HU81686A patent/HU188545B/hu not_active IP Right Cessation
- 1981-03-19 NZ NZ196539A patent/NZ196539A/xx unknown
-
1986
- 1986-12-30 MY MY462/86A patent/MY8600462A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| ES8202531A1 (es) | 1982-02-01 |
| AR229509A1 (es) | 1983-09-15 |
| IL62408A0 (en) | 1981-05-20 |
| ES8202536A1 (es) | 1982-02-01 |
| BG35895A3 (en) | 1984-07-16 |
| ZA811810B (en) | 1982-04-28 |
| KR830005097A (ko) | 1983-07-23 |
| ES500464A0 (es) | 1982-02-01 |
| JPH027940B2 (enExample) | 1990-02-21 |
| ES500463A0 (es) | 1982-02-01 |
| EP0037656A1 (en) | 1981-10-14 |
| YU42388B (en) | 1988-08-31 |
| NZ196539A (en) | 1983-06-17 |
| AU536552B2 (en) | 1984-05-10 |
| KR840000238B1 (ko) | 1984-03-07 |
| US4284564A (en) | 1981-08-18 |
| EP0037656B1 (en) | 1984-05-02 |
| YU70781A (en) | 1983-09-30 |
| MY8600462A (en) | 1986-12-31 |
| IL62408A (en) | 1985-10-31 |
| JPS56150032A (en) | 1981-11-20 |
| AU6849281A (en) | 1981-10-01 |
| BR8101607A (pt) | 1981-09-29 |
| MX157884A (es) | 1988-12-19 |
| ATE7291T1 (de) | 1984-05-15 |
| PL129317B1 (en) | 1984-04-30 |
| CA1165325A (en) | 1984-04-10 |
| PL230203A1 (enExample) | 1981-11-13 |
| CS219305B2 (en) | 1983-03-25 |
| DE3163356D1 (en) | 1984-06-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA2277928C (en) | Method of preparing monofluoromethyl ethers | |
| CN103748077B (zh) | 用于制备4-取代咪唑类的方法 | |
| SK283757B6 (sk) | Spôsob prípravy zmesových éterov | |
| HU185789B (en) | Process for preparing new 3-phenoxy-4-fluoro-benzaldehyde-acetal derivatives | |
| EP0057588B1 (en) | Process for producing n-(halomethyl)acylamides | |
| HU188545B (en) | Process for producing in situ halogeno-alkyl-alkyl-ethers for producing n-substituted 2-halogeno-acetanilides | |
| US4965362A (en) | Joint preparation of 3-dialkylaminopropionitriles, bis-(2-cyanoethyl) ether and, if desired, ethylene-cyanohydrin | |
| CN107428648B (zh) | 用于制备可用于合成美托咪定的诸如3-芳基丁醛的化合物的方法 | |
| US7847117B2 (en) | Process for preparing alkyl(methoxymethyl)trimethylsilanylmethylamines | |
| JPS5840932B2 (ja) | アリ−ルエ−テルの製造法 | |
| KR100908570B1 (ko) | 3-플루오로-1,3-프로판설톤의 제조방법 | |
| EP0507417B1 (en) | Process for the selective reduction of the 4-halogen in 2,4-dihaloanilines | |
| JP4828862B2 (ja) | 5−ブロモ−2,2−ジフルオロベンゾ−[1,3]−ジオキソールの製造方法 | |
| US4996377A (en) | Preparation of aliphatically substituted fluorobenzenes | |
| EP1951677B1 (en) | Process for the production of carboxanilides | |
| HU199101B (en) | Process for producing fluoro-formiate derivatives | |
| EP1002788B1 (en) | Process for preparing halogenated phenylmalonates | |
| US4293702A (en) | Method for preparing 4-substituted-N-methylbenzothiazolone derivatives | |
| US6894197B2 (en) | Process for producing fluorinated alcohol | |
| EP1896397B1 (en) | Process for producing ethers | |
| JP2001114756A (ja) | β−カロチンの製造方法 | |
| US4594467A (en) | Preparation of 3,5-dichloro-α-methylstyrene | |
| JPH0153654B2 (enExample) | ||
| JPH0332536B2 (enExample) | ||
| US6956132B2 (en) | Process for producing 2-phenylacetophenone derivatives and precursors therefor |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 | ||
| HMM4 | Cancellation of final prot. due to non-payment of fee |