CS214675B2 - Method of making the 1,2,3-thiadizol-5-yl-ureas - Google Patents
Method of making the 1,2,3-thiadizol-5-yl-ureas Download PDFInfo
- Publication number
- CS214675B2 CS214675B2 CS797477A CS747779A CS214675B2 CS 214675 B2 CS214675 B2 CS 214675B2 CS 797477 A CS797477 A CS 797477A CS 747779 A CS747779 A CS 747779A CS 214675 B2 CS214675 B2 CS 214675B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- formula
- acid
- methyl
- pyridyl
- theory
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title description 7
- 239000002253 acid Substances 0.000 claims abstract description 41
- -1 1,2,3-thiadiazol-5-yl ureas Chemical class 0.000 claims abstract description 39
- 238000000034 method Methods 0.000 claims abstract description 21
- 150000001412 amines Chemical class 0.000 claims abstract description 16
- 150000004820 halides Chemical class 0.000 claims abstract description 11
- 238000002360 preparation method Methods 0.000 claims abstract description 11
- 239000003960 organic solvent Substances 0.000 claims abstract description 3
- 238000006243 chemical reaction Methods 0.000 claims description 12
- NEAQRZUHTPSBBM-UHFFFAOYSA-N 2-hydroxy-3,3-dimethyl-7-nitro-4h-isoquinolin-1-one Chemical compound C1=C([N+]([O-])=O)C=C2C(=O)N(O)C(C)(C)CC2=C1 NEAQRZUHTPSBBM-UHFFFAOYSA-N 0.000 claims description 9
- 239000011230 binding agent Substances 0.000 claims description 9
- LVAISXKBPDTJGC-UHFFFAOYSA-N N-hydroxythiadiazole-5-carboxamide Chemical compound ONC(=O)C1=CN=NS1 LVAISXKBPDTJGC-UHFFFAOYSA-N 0.000 claims description 8
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 4
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 claims description 3
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 claims description 3
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 claims description 3
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims description 3
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 claims description 3
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical group [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 claims description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 2
- 229910052751 metal Inorganic materials 0.000 claims description 2
- 239000002184 metal Substances 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 claims description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 125000004076 pyridyl group Chemical group 0.000 claims description 2
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 2
- 125000000719 pyrrolidinyl group Chemical group 0.000 claims description 2
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims 1
- 235000013877 carbamide Nutrition 0.000 abstract description 31
- 239000004202 carbamide Substances 0.000 description 42
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 27
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 12
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- 239000000203 mixture Substances 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 8
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 7
- 238000000354 decomposition reaction Methods 0.000 description 7
- 238000002844 melting Methods 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- 150000003839 salts Chemical class 0.000 description 7
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical group CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 6
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 6
- 239000000243 solution Substances 0.000 description 5
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 4
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 230000015556 catabolic process Effects 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 238000006731 degradation reaction Methods 0.000 description 3
- 239000012442 inert solvent Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- UGUHFDPGDQDVGX-UHFFFAOYSA-N 1,2,3-thiadiazole Chemical compound C1=CSN=N1 UGUHFDPGDQDVGX-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- HFCYZXMHUIHAQI-UHFFFAOYSA-N Thidiazuron Chemical compound C=1C=CC=CC=1NC(=O)NC1=CN=NS1 HFCYZXMHUIHAQI-UHFFFAOYSA-N 0.000 description 2
- 229910000287 alkaline earth metal oxide Inorganic materials 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 239000012045 crude solution Substances 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 150000004679 hydroxides Chemical class 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- HJOVHMDZYOCNQW-UHFFFAOYSA-N isophorone Chemical compound CC1=CC(=O)CC(C)(C)C1 HJOVHMDZYOCNQW-UHFFFAOYSA-N 0.000 description 2
- 230000008635 plant growth Effects 0.000 description 2
- 239000001103 potassium chloride Substances 0.000 description 2
- 235000011164 potassium chloride Nutrition 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- BXCZJWHJYRELHY-UHFFFAOYSA-N thiadiazole-5-carboxylic acid Chemical compound OC(=O)C1=CN=NS1 BXCZJWHJYRELHY-UHFFFAOYSA-N 0.000 description 2
- 125000003944 tolyl group Chemical group 0.000 description 2
- 150000003672 ureas Chemical class 0.000 description 2
- ODIGIKRIUKFKHP-UHFFFAOYSA-N (n-propan-2-yloxycarbonylanilino) acetate Chemical compound CC(C)OC(=O)N(OC(C)=O)C1=CC=CC=C1 ODIGIKRIUKFKHP-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 1
- CQQKDILFHPKTLK-UHFFFAOYSA-N 4-ethylthiadiazole Chemical compound CCC1=CSN=N1 CQQKDILFHPKTLK-UHFFFAOYSA-N 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- HKROJPSXWYDUBU-UHFFFAOYSA-N 5-isocyanato-1h-pyrazole Chemical compound O=C=NC1=CC=NN1 HKROJPSXWYDUBU-UHFFFAOYSA-N 0.000 description 1
- HXABWNOBBYCXLG-UHFFFAOYSA-N 5-isocyanatothiadiazole Chemical compound O=C=NC1=CN=NS1 HXABWNOBBYCXLG-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical class CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- AEMNHJKFGDOYCD-UHFFFAOYSA-N [K+].S1N=NC=C1C(=O)N[O-] Chemical compound [K+].S1N=NC=C1C(=O)N[O-] AEMNHJKFGDOYCD-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 239000002837 defoliant Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000003495 polar organic solvent Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 239000011814 protection agent Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 238000003892 spreading Methods 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- PVGHNTXQMCYYGF-UHFFFAOYSA-N thiadiazol-5-amine Chemical compound NC1=CN=NS1 PVGHNTXQMCYYGF-UHFFFAOYSA-N 0.000 description 1
- GDPRTNRLCIICFQ-UHFFFAOYSA-N thiadiazole-5-carbonyl chloride Chemical compound ClC(=O)C1=CN=NS1 GDPRTNRLCIICFQ-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D285/00—Heterocyclic compounds containing rings having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by groups C07D275/00 - C07D283/00
- C07D285/01—Five-membered rings
- C07D285/02—Thiadiazoles; Hydrogenated thiadiazoles
- C07D285/04—Thiadiazoles; Hydrogenated thiadiazoles not condensed with other rings
- C07D285/06—1,2,3-Thiadiazoles; Hydrogenated 1,2,3-thiadiazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen- Or Sulfur-Containing Heterocyclic Ring Compounds With Rings Of Six Or More Members (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782848330 DE2848330A1 (de) | 1978-11-03 | 1978-11-03 | Verfahren zur herstellung von 1,2, 3-thiadiazol-5-yl-harnstoffen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS214675B2 true CS214675B2 (en) | 1982-05-28 |
Family
ID=6054085
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS797477A CS214675B2 (en) | 1978-11-03 | 1979-11-02 | Method of making the 1,2,3-thiadizol-5-yl-ureas |
Country Status (37)
| Country | Link |
|---|---|
| US (1) | US4358596A (ro) |
| JP (1) | JPS5826913B2 (ro) |
| AR (1) | AR224253A1 (ro) |
| AT (1) | AT373885B (ro) |
| AU (1) | AU528407B2 (ro) |
| BE (1) | BE879830A (ro) |
| BG (1) | BG35046A3 (ro) |
| BR (1) | BR7907117A (ro) |
| CA (1) | CA1131639A (ro) |
| CH (1) | CH641793A5 (ro) |
| CS (1) | CS214675B2 (ro) |
| DD (1) | DD147109A5 (ro) |
| DE (1) | DE2848330A1 (ro) |
| DK (1) | DK459579A (ro) |
| EG (1) | EG14043A (ro) |
| ES (1) | ES485650A1 (ro) |
| FI (1) | FI793367A7 (ro) |
| FR (1) | FR2440947A1 (ro) |
| GB (1) | GB2039889B (ro) |
| GR (1) | GR74077B (ro) |
| HU (1) | HU183104B (ro) |
| IE (1) | IE49107B1 (ro) |
| IL (1) | IL58572A (ro) |
| IT (1) | IT1165334B (ro) |
| LU (1) | LU81834A1 (ro) |
| MX (1) | MX5790E (ro) |
| NL (1) | NL7907673A (ro) |
| NZ (1) | NZ191933A (ro) |
| PH (1) | PH15680A (ro) |
| PL (1) | PL130308B1 (ro) |
| PT (1) | PT70398A (ro) |
| RO (1) | RO78090A (ro) |
| SE (1) | SE7909017L (ro) |
| SU (1) | SU927114A3 (ro) |
| TR (1) | TR20548A (ro) |
| YU (1) | YU251479A (ro) |
| ZA (1) | ZA795893B (ro) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2920939A1 (de) * | 1979-05-21 | 1980-11-27 | Schering Ag | Verfahren zur herstellung von 5-mercapto-1,2,3-triazolen |
| DE3139505A1 (de) * | 1981-10-01 | 1983-04-21 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | 1,2,3,-thiadiazol-5-yl-harnstoff-derivate, verfahren zur herstellung dieser verbindungen sowie diese enthaltende mittel mit wuchsregulatorischer und entblaetternder wirkung |
| DE3139506A1 (de) * | 1981-10-01 | 1983-04-21 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | 1,2,3-thiadiazol-5-yl-harnstoff-derivate, verfahren zur herstellung dieser verbindungen sowie diese enthaltende mittel mit wuchsregulatorischer und entblaetternder wirkung |
| DE3319008A1 (de) * | 1983-05-20 | 1984-11-22 | Schering AG, 1000 Berlin und 4709 Bergkamen | 1,2,3-thiadiazol-3-in-5-yliden-harnstoffderivate, verfahren zur herstellung dieser verbindungen sowie diese enthaltende mittel mit wuchsregulatorischer und entblaetternder wirkung |
| US6166054A (en) * | 1995-03-31 | 2000-12-26 | Nihon Nohyaku Co., Ltd. | Agricultural and horticultural disease controller and a method for controlling the diseases |
| US8124630B2 (en) | 1999-01-13 | 2012-02-28 | Bayer Healthcare Llc | ω-carboxyaryl substituted diphenyl ureas as raf kinase inhibitors |
| EP2298311B1 (en) | 1999-01-13 | 2012-05-09 | Bayer HealthCare LLC | w-Carboxy aryl substituted diphenyl ureas as p38 kinase inhibitors |
| ES2425739T3 (es) | 2002-02-11 | 2013-10-17 | Bayer Healthcare Llc | Sorafenib-tosilato para el tratamiento de enfermedades caracterizadas por angiogénesis anormal |
| US7557129B2 (en) | 2003-02-28 | 2009-07-07 | Bayer Healthcare Llc | Cyanopyridine derivatives useful in the treatment of cancer and other disorders |
| CA2526636C (en) * | 2003-05-20 | 2012-10-02 | Bayer Pharmaceuticals Corporation | Diaryl ureas for diseases mediated by pdgfr |
| BR122016015715B8 (pt) | 2003-07-23 | 2021-05-25 | Bayer Healthcare Llc | composições farmacêuticas de metilamida de ácido 4[4-[3-(4-cloro-3-trifluorometilfenil)-ureido]-3-fluorofenóxi)-piridina-2-carboxílico |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DD103124A5 (ro) | 1972-03-23 | 1974-01-12 | ||
| DE2636994C2 (de) | 1976-08-13 | 1984-10-18 | Schering AG, 1000 Berlin und 4709 Bergkamen | Verfahren zur Herstellung von 5-Amino-1,2,3-thiadiazol |
-
1978
- 1978-11-03 DE DE19782848330 patent/DE2848330A1/de not_active Withdrawn
-
1979
- 1979-10-16 YU YU02514/79A patent/YU251479A/xx unknown
- 1979-10-17 NL NL7907673A patent/NL7907673A/nl not_active Application Discontinuation
- 1979-10-23 TR TR20548A patent/TR20548A/xx unknown
- 1979-10-24 BG BG045274A patent/BG35046A3/xx unknown
- 1979-10-26 NZ NZ191933A patent/NZ191933A/xx unknown
- 1979-10-26 FI FI793367A patent/FI793367A7/fi not_active Application Discontinuation
- 1979-10-29 EG EG659/79A patent/EG14043A/xx active
- 1979-10-29 IL IL58572A patent/IL58572A/xx unknown
- 1979-10-29 LU LU81834A patent/LU81834A1/de unknown
- 1979-10-29 GB GB7937421A patent/GB2039889B/en not_active Expired
- 1979-10-30 IT IT26898/79A patent/IT1165334B/it active
- 1979-10-30 MX MX798464U patent/MX5790E/es unknown
- 1979-10-31 DK DK459579A patent/DK459579A/da not_active Application Discontinuation
- 1979-10-31 PT PT70398A patent/PT70398A/pt unknown
- 1979-10-31 AT AT0703179A patent/AT373885B/de active
- 1979-10-31 SE SE7909017A patent/SE7909017L/xx not_active Application Discontinuation
- 1979-11-01 GR GR60384A patent/GR74077B/el unknown
- 1979-11-01 DD DD79216618A patent/DD147109A5/de unknown
- 1979-11-01 BR BR7907117A patent/BR7907117A/pt unknown
- 1979-11-01 CA CA338,949A patent/CA1131639A/en not_active Expired
- 1979-11-02 JP JP54141441A patent/JPS5826913B2/ja not_active Expired
- 1979-11-02 AR AR278768A patent/AR224253A1/es active
- 1979-11-02 ZA ZA00795893A patent/ZA795893B/xx unknown
- 1979-11-02 SU SU792842379A patent/SU927114A3/ru active
- 1979-11-02 RO RO7999125A patent/RO78090A/ro unknown
- 1979-11-02 ES ES485650A patent/ES485650A1/es not_active Expired
- 1979-11-02 CH CH987979A patent/CH641793A5/de not_active IP Right Cessation
- 1979-11-02 HU HU79SCHE702A patent/HU183104B/hu unknown
- 1979-11-02 CS CS797477A patent/CS214675B2/cs unknown
- 1979-11-02 PL PL1979219405A patent/PL130308B1/pl unknown
- 1979-11-05 PH PH23243A patent/PH15680A/en unknown
- 1979-11-05 AU AU52489/79A patent/AU528407B2/en not_active Ceased
- 1979-11-05 FR FR7927192A patent/FR2440947A1/fr active Granted
- 1979-11-05 BE BE0/197972A patent/BE879830A/fr not_active IP Right Cessation
- 1979-11-05 IE IE2112/79A patent/IE49107B1/en unknown
-
1981
- 1981-01-21 US US06/226,899 patent/US4358596A/en not_active Expired - Fee Related
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| RU1836362C (ru) | Способ получени 5-[2-(4-аминофенил)этенил]-5,6-дигидро-1,3,4-тиадиазин-2-(3н)-онов | |
| CS214675B2 (en) | Method of making the 1,2,3-thiadizol-5-yl-ureas | |
| NL8203807A (nl) | Dioximino-cefalosporine-antibiotica. | |
| CA1097614A (en) | Process for the production of novel antibacterial amide compounds | |
| HU226428B1 (en) | Process for producing guanidine derivatives, intermediates therefor and their production | |
| US4025622A (en) | Novel sugar ureide and thioureide derivatives | |
| CA1108620A (en) | Imidazolines | |
| US4496737A (en) | Process for preparing sulfamylamidine antisecretory agents | |
| US4797482A (en) | Process for the preparation of oxazinobenzothiazine 6,6-dioxide derivatives | |
| IE62527B1 (en) | Process for preparing ureas | |
| CS219279B2 (en) | Method of making the 5-mercapto-6,2,3-triazole | |
| US3415840A (en) | Pyrazole-1-ethanol derivatives | |
| AU720862B2 (en) | Process for producing imidazole derivatives | |
| US2790808A (en) | Novel chemical compounds | |
| KR880001105B1 (ko) | 1-벤질-4-[4-(2-피리미디닐아미노)벤질]-2,3-디옥소피페라진 유도체의 제조방법 | |
| HU182999B (en) | Process for producing 1,2,3-thiadiazol-5-yl-urea derivatives | |
| US4650893A (en) | Bis-imido carbonate sulphones | |
| KR830000271B1 (ko) | 1,2,3-티아디아졸-5-일 우레아의 제조방법 | |
| DE2724819A1 (de) | Bis-phenyl-triazolone und verfahren zu ihrer herstellung | |
| DK148771B (da) | Fremgangsmaade til fremstilling af pyridinkarboxylsyre-piperazider eller syreadditionssalte deraf | |
| JPS6169765A (ja) | 1‐(2‐オキシアミノスルホニル‐フエニルスルホニル)‐尿素の製造法 | |
| US4658025A (en) | Hydrazine-thiocarboxylic acid O-carbamoylmethyl esters | |
| US4066661A (en) | Process for the preparation of substituted trichloroacetamidine derivatives | |
| US4459415A (en) | Process for the preparation of 1-(4-chlorobenzoyl)-5-methoxy-2-methyl-3-indoleacetoxyacetic acid | |
| JPS5869873A (ja) | 1,2,3−チアジアゾル−5−イル−尿素誘導体、その製法並びに該誘導体を含有する、植物成長調節および落葉作用を有する薬剤 |