CS212715B2 - Method of preparing 1-phenyl-2-amino ethanol derivatives - Google Patents
Method of preparing 1-phenyl-2-amino ethanol derivatives Download PDFInfo
- Publication number
- CS212715B2 CS212715B2 CS803430A CS343080A CS212715B2 CS 212715 B2 CS212715 B2 CS 212715B2 CS 803430 A CS803430 A CS 803430A CS 343080 A CS343080 A CS 343080A CS 212715 B2 CS212715 B2 CS 212715B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- group
- phenyl
- complex
- formula
- carbon atoms
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 20
- ULSIYEODSMZIPX-UHFFFAOYSA-N phenylethanolamine Chemical class NCC(O)C1=CC=CC=C1 ULSIYEODSMZIPX-UHFFFAOYSA-N 0.000 title claims description 4
- -1 3,5-dichloro-4-aminophenyl Chemical group 0.000 claims abstract description 98
- 150000001875 compounds Chemical class 0.000 claims abstract description 46
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 29
- 150000003839 salts Chemical class 0.000 claims abstract description 16
- 125000004423 acyloxy group Chemical group 0.000 claims abstract description 14
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 14
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 12
- 239000001257 hydrogen Substances 0.000 claims abstract description 10
- 125000001424 substituent group Chemical group 0.000 claims abstract description 9
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 claims abstract description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 7
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims abstract description 6
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 5
- 125000002947 alkylene group Chemical group 0.000 claims abstract description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 5
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims abstract description 5
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 claims abstract description 4
- 125000005843 halogen group Chemical group 0.000 claims abstract description 4
- 239000002253 acid Substances 0.000 claims description 28
- 125000004432 carbon atom Chemical group C* 0.000 claims description 26
- LEQAOMBKQFMDFZ-UHFFFAOYSA-N glyoxal Chemical compound O=CC=O LEQAOMBKQFMDFZ-UHFFFAOYSA-N 0.000 claims description 13
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 12
- 238000006243 chemical reaction Methods 0.000 claims description 9
- 239000007858 starting material Substances 0.000 claims description 8
- 125000001589 carboacyl group Chemical group 0.000 claims description 6
- 229940015043 glyoxal Drugs 0.000 claims description 6
- 229910052757 nitrogen Inorganic materials 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- 125000002252 acyl group Chemical group 0.000 claims description 4
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 3
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 239000012458 free base Substances 0.000 claims description 3
- 239000003701 inert diluent Substances 0.000 claims description 3
- 239000012442 inert solvent Substances 0.000 claims description 3
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 2
- 150000001450 anions Chemical class 0.000 claims 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 abstract description 3
- 238000004519 manufacturing process Methods 0.000 abstract description 3
- 239000002260 anti-inflammatory agent Substances 0.000 abstract description 2
- 239000008194 pharmaceutical composition Substances 0.000 abstract description 2
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 abstract description 2
- TUFSNHTWUFCSBL-PMCHYTPCSA-N [2-(2,2-dimethylpropanoyloxy)-4-[1-hydroxy-2-[[2-methyl-1-[[(2s)-1-(2-phenylacetyl)pyrrolidine-2-carbonyl]amino]propan-2-yl]amino]ethyl]phenyl] 2,2-dimethylpropanoate Chemical compound C([C@H]1C(=O)NCC(C)(C)NCC(O)C=2C=C(OC(=O)C(C)(C)C)C(OC(=O)C(C)(C)C)=CC=2)CCN1C(=O)CC1=CC=CC=C1 TUFSNHTWUFCSBL-PMCHYTPCSA-N 0.000 abstract 1
- 125000003118 aryl group Chemical group 0.000 description 44
- 125000006367 bivalent amino carbonyl group Chemical group [H]N([*:1])C([*:2])=O 0.000 description 37
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 33
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 29
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 26
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 22
- 239000000243 solution Substances 0.000 description 22
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 21
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 18
- 239000000203 mixture Substances 0.000 description 17
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 14
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 13
- 239000007787 solid Substances 0.000 description 13
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 238000002844 melting Methods 0.000 description 12
- 230000008018 melting Effects 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- OEZNULIHEQCKJR-UHFFFAOYSA-N ethanol;hydrobromide Chemical compound Br.CCO OEZNULIHEQCKJR-UHFFFAOYSA-N 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 230000003110 anti-inflammatory effect Effects 0.000 description 9
- LJCJRRKKAKAKRV-UHFFFAOYSA-N (2-amino-2-methylpropyl) 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate Chemical group CC(C)(N)COC(=O)CCC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 LJCJRRKKAKAKRV-UHFFFAOYSA-N 0.000 description 8
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 8
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- 229940024606 amino acid Drugs 0.000 description 7
- 235000001014 amino acid Nutrition 0.000 description 7
- 150000001413 amino acids Chemical class 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 7
- 239000006260 foam Substances 0.000 description 7
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 7
- 235000019341 magnesium sulphate Nutrition 0.000 description 7
- 239000003921 oil Substances 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 6
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- 150000007513 acids Chemical class 0.000 description 6
- OJUGVDODNPJEEC-UHFFFAOYSA-N phenylglyoxal Chemical compound O=CC(=O)C1=CC=CC=C1 OJUGVDODNPJEEC-UHFFFAOYSA-N 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- 206010061218 Inflammation Diseases 0.000 description 5
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 5
- 230000004054 inflammatory process Effects 0.000 description 5
- LIGACIXOYTUXAW-UHFFFAOYSA-N phenacyl bromide Chemical compound BrCC(=O)C1=CC=CC=C1 LIGACIXOYTUXAW-UHFFFAOYSA-N 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 4
- 230000003647 oxidation Effects 0.000 description 4
- 238000007254 oxidation reaction Methods 0.000 description 4
- 239000003208 petroleum Substances 0.000 description 4
- JPJALAQPGMAKDF-UHFFFAOYSA-N selenium dioxide Chemical compound O=[Se]=O JPJALAQPGMAKDF-UHFFFAOYSA-N 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- UBQCWSGRNIOFFC-NSHDSACASA-N (2s)-1-(2-phenylacetyl)pyrrolidine-2-carboxylic acid Chemical compound OC(=O)[C@@H]1CCCN1C(=O)CC1=CC=CC=C1 UBQCWSGRNIOFFC-NSHDSACASA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 230000031709 bromination Effects 0.000 description 3
- 238000005893 bromination reaction Methods 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 230000002757 inflammatory effect Effects 0.000 description 3
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- OTIZTAXUFMCICV-UHFFFAOYSA-N phenacyl 2,2-dimethylpropanoate Chemical compound CC(C)(C)C(=O)OCC(=O)C1=CC=CC=C1 OTIZTAXUFMCICV-UHFFFAOYSA-N 0.000 description 3
- 230000002829 reductive effect Effects 0.000 description 3
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- CHMYZARZMLDZTJ-NSHDSACASA-N (2s)-1-(2-phenoxyacetyl)pyrrolidine-2-carboxylic acid Chemical compound OC(=O)[C@@H]1CCCN1C(=O)COC1=CC=CC=C1 CHMYZARZMLDZTJ-NSHDSACASA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- UCQUAMAQHHEXGD-UHFFFAOYSA-N 3',4'-dihydroxyacetophenone Chemical compound CC(=O)C1=CC=C(O)C(O)=C1 UCQUAMAQHHEXGD-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- 239000004471 Glycine Substances 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- UAQVHNZEONHPQG-ZETCQYMHSA-N N-benzoyl-L-alanine Chemical compound OC(=O)[C@H](C)NC(=O)C1=CC=CC=C1 UAQVHNZEONHPQG-ZETCQYMHSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- VTCZJZGLUHXDLI-UHFFFAOYSA-N [2-(2,2-dimethylpropanoyloxy)-4-oxaldehydoylphenyl] 2,2-dimethylpropanoate Chemical compound CC(C)(C)C(=O)OC1=CC=C(C(=O)C=O)C=C1OC(=O)C(C)(C)C VTCZJZGLUHXDLI-UHFFFAOYSA-N 0.000 description 2
- 150000001263 acyl chlorides Chemical class 0.000 description 2
- 229960003767 alanine Drugs 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 150000004985 diamines Chemical class 0.000 description 2
- 125000004185 ester group Chemical group 0.000 description 2
- LIWAQLJGPBVORC-UHFFFAOYSA-N ethylmethylamine Chemical compound CCNC LIWAQLJGPBVORC-UHFFFAOYSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 208000027866 inflammatory disease Diseases 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical compound CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 2
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 230000006340 racemization Effects 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 238000012289 standard assay Methods 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 238000004809 thin layer chromatography Methods 0.000 description 2
- PWDBFVOKBGVYHY-JQWIXIFHSA-N (2S,3S)-2-[benzoyl(methyl)amino]-3-methylpentanoic acid Chemical compound CC[C@H](C)[C@@H](C(O)=O)N(C)C(=O)C1=CC=CC=C1 PWDBFVOKBGVYHY-JQWIXIFHSA-N 0.000 description 1
- MRFUSOYEXOWMJG-AWEZNQCLSA-N (2s)-1-(2-amino-2-methylpropyl)-n-(2-phenylacetyl)pyrrolidine-2-carboxamide Chemical compound CC(C)(N)CN1CCC[C@H]1C(=O)NC(=O)CC1=CC=CC=C1 MRFUSOYEXOWMJG-AWEZNQCLSA-N 0.000 description 1
- YVOKUDRBHYTONE-FQQMSVSDSA-N (2s)-1-benzoyl-n-[2-[[2-(2-chlorophenyl)-2-hydroxyethyl]amino]-2-methylpropyl]pyrrolidine-2-carboxamide;hydrobromide Chemical compound Br.C([C@H]1C(=O)NCC(C)(C)NCC(O)C=2C(=CC=CC=2)Cl)CCN1C(=O)C1=CC=CC=C1 YVOKUDRBHYTONE-FQQMSVSDSA-N 0.000 description 1
- RQYKQWFHJOBBAO-JTQLQIEISA-N (2s)-1-benzoylpyrrolidine-2-carboxylic acid Chemical compound OC(=O)[C@@H]1CCCN1C(=O)C1=CC=CC=C1 RQYKQWFHJOBBAO-JTQLQIEISA-N 0.000 description 1
- HJTVVCRZISNBLL-HNNXBMFYSA-N (2s)-2-[benzoyl(methyl)amino]-3-phenylpropanoic acid Chemical compound C([C@H](N(C)C(=O)C=1C=CC=CC=1)C(O)=O)C1=CC=CC=C1 HJTVVCRZISNBLL-HNNXBMFYSA-N 0.000 description 1
- MLLWNNCPLXFMTJ-QMMMGPOBSA-N (2s)-2-[benzoyl(methyl)amino]propanoic acid Chemical compound OC(=O)[C@H](C)N(C)C(=O)C1=CC=CC=C1 MLLWNNCPLXFMTJ-QMMMGPOBSA-N 0.000 description 1
- KCQBCDKSKWGCEK-ONGXEEELSA-N (2s,3s)-2-benzamido-3-methylpentanoic acid Chemical compound CC[C@H](C)[C@@H](C(O)=O)NC(=O)C1=CC=CC=C1 KCQBCDKSKWGCEK-ONGXEEELSA-N 0.000 description 1
- SJHPCNCNNSSLPL-CSKARUKUSA-N (4e)-4-(ethoxymethylidene)-2-phenyl-1,3-oxazol-5-one Chemical compound O1C(=O)C(=C/OCC)\N=C1C1=CC=CC=C1 SJHPCNCNNSSLPL-CSKARUKUSA-N 0.000 description 1
- FMKMEWWKBLDKST-UHFFFAOYSA-N (5-acetyl-2-acetyloxyphenyl)methyl acetate Chemical compound CC(=O)OCC1=CC(C(C)=O)=CC=C1OC(C)=O FMKMEWWKBLDKST-UHFFFAOYSA-N 0.000 description 1
- 125000004765 (C1-C4) haloalkyl group Chemical group 0.000 description 1
- OPCJOXGBLDJWRM-UHFFFAOYSA-N 1,2-diamino-2-methylpropane Chemical compound CC(C)(N)CN OPCJOXGBLDJWRM-UHFFFAOYSA-N 0.000 description 1
- SAIBTFQTLRUYEF-UHFFFAOYSA-N 1-(2-amino-2-methylpropyl)-n-benzoylazetidine-2-carboxamide Chemical compound CC(C)(N)CN1CCC1C(=O)NC(=O)C1=CC=CC=C1 SAIBTFQTLRUYEF-UHFFFAOYSA-N 0.000 description 1
- JLPKZJDZXIKSCP-UHFFFAOYSA-N 1-(4-amino-3,5-dichlorophenyl)ethanone Chemical compound CC(=O)C1=CC(Cl)=C(N)C(Cl)=C1 JLPKZJDZXIKSCP-UHFFFAOYSA-N 0.000 description 1
- JZEHWMUIAKALDN-UHFFFAOYSA-N 1-amino-3-phenoxypropan-2-ol Chemical group NCC(O)COC1=CC=CC=C1 JZEHWMUIAKALDN-UHFFFAOYSA-N 0.000 description 1
- COICQXZXKSHESO-UHFFFAOYSA-N 1-benzoyl-n-[2-[[2-(2-chlorophenyl)-2-hydroxyethyl]amino]-2-methylpropyl]piperidine-2-carboxamide;hydrobromide Chemical compound Br.C=1C=CC=C(Cl)C=1C(O)CNC(C)(C)CNC(=O)C1CCCCN1C(=O)C1=CC=CC=C1 COICQXZXKSHESO-UHFFFAOYSA-N 0.000 description 1
- UUFQTNFCRMXOAE-UHFFFAOYSA-N 1-methylmethylene Chemical compound C[CH] UUFQTNFCRMXOAE-UHFFFAOYSA-N 0.000 description 1
- JVSFQJZRHXAUGT-UHFFFAOYSA-N 2,2-dimethylpropanoyl chloride Chemical compound CC(C)(C)C(Cl)=O JVSFQJZRHXAUGT-UHFFFAOYSA-N 0.000 description 1
- RIZUCYSQUWMQLX-UHFFFAOYSA-N 2,3-dimethylbenzoic acid Chemical compound CC1=CC=CC(C(O)=O)=C1C RIZUCYSQUWMQLX-UHFFFAOYSA-N 0.000 description 1
- BCISXCSLXUAFMM-UHFFFAOYSA-N 2-(4-amino-3,5-dichlorophenyl)-2-oxoacetaldehyde Chemical compound NC1=C(Cl)C=C(C(=O)C=O)C=C1Cl BCISXCSLXUAFMM-UHFFFAOYSA-N 0.000 description 1
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 1
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 description 1
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 1
- VMZCDNSFRSVYKQ-UHFFFAOYSA-N 2-phenylacetyl chloride Chemical compound ClC(=O)CC1=CC=CC=C1 VMZCDNSFRSVYKQ-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 125000000242 4-chlorobenzoyl group Chemical group ClC1=CC=C(C(=O)*)C=C1 0.000 description 1
- DEXFNLNNUZKHNO-UHFFFAOYSA-N 6-[3-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperidin-1-yl]-3-oxopropyl]-3H-1,3-benzoxazol-2-one Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C1CCN(CC1)C(CCC1=CC2=C(NC(O2)=O)C=C1)=O DEXFNLNNUZKHNO-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- 101100167062 Caenorhabditis elegans chch-3 gene Proteins 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 101150065749 Churc1 gene Proteins 0.000 description 1
- 244000248349 Citrus limon Species 0.000 description 1
- 235000005979 Citrus limon Nutrition 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- ONIBWKKTOPOVIA-BYPYZUCNSA-N L-Proline Chemical compound OC(=O)[C@@H]1CCCN1 ONIBWKKTOPOVIA-BYPYZUCNSA-N 0.000 description 1
- 229930182821 L-proline Natural products 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- GBVCQLHVOSAXJE-OAQYLSRUSA-N N-[(2R)-1-[(2-amino-2-methylpropyl)amino]-1-oxo-2-phenylpropan-2-yl]-N-methylbenzamide Chemical compound CN([C@@](C)(C(=O)NCC(C)(C)N)C=1C=CC=CC=1)C(=O)C1=CC=CC=C1 GBVCQLHVOSAXJE-OAQYLSRUSA-N 0.000 description 1
- NPKISZUVEBESJI-AWEZNQCLSA-N N-benzoyl-L-phenylalanine Chemical compound C([C@@H](C(=O)O)NC(=O)C=1C=CC=CC=1)C1=CC=CC=C1 NPKISZUVEBESJI-AWEZNQCLSA-N 0.000 description 1
- PKCSYDDSNIJRIX-UHFFFAOYSA-N N-methylhippuric acid Chemical compound OC(=O)CN(C)C(=O)C1=CC=CC=C1 PKCSYDDSNIJRIX-UHFFFAOYSA-N 0.000 description 1
- 102100038239 Protein Churchill Human genes 0.000 description 1
- CZWCWEJLCCCFRC-UHFFFAOYSA-N [2-(2-methylpropanoyloxy)-5-oxaldehydoylphenyl]methyl 2-methylpropanoate Chemical compound CC(C)C(=O)OCC1=CC(C(=O)C=O)=CC=C1OC(=O)C(C)C CZWCWEJLCCCFRC-UHFFFAOYSA-N 0.000 description 1
- PJGNAPYOJDZXHK-BJSSTWLPSA-N [5-[1-hydroxy-2-[[2-methyl-1-[[(2S)-1-(2-phenylacetyl)pyrrolidine-2-carbonyl]amino]propan-2-yl]amino]ethyl]-2-(2-methylpropanoyloxy)cyclohexa-2,4-dien-1-ylidene]methyl 2-methylpropanoate hydrobromide Chemical compound CC(C)C(=O)OC=C1CC(=CC=C1OC(=O)C(C)C)C(CNC(C)(C)CNC(=O)[C@@H]2CCCN2C(=O)CC3=CC=CC=C3)O.Br PJGNAPYOJDZXHK-BJSSTWLPSA-N 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 230000001800 adrenalinergic effect Effects 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 150000001370 alpha-amino acid derivatives Chemical class 0.000 description 1
- 235000008206 alpha-amino acids Nutrition 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 238000005571 anion exchange chromatography Methods 0.000 description 1
- 229940121363 anti-inflammatory agent Drugs 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000012300 argon atmosphere Substances 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000000319 biphenyl-4-yl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- GHWVXCQZPNWFRO-UHFFFAOYSA-N butane-2,3-diamine Chemical compound CC(N)C(C)N GHWVXCQZPNWFRO-UHFFFAOYSA-N 0.000 description 1
- KMGBZBJJOKUPIA-UHFFFAOYSA-N butyl iodide Chemical compound CCCCI KMGBZBJJOKUPIA-UHFFFAOYSA-N 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000004803 chlorobenzyl group Chemical group 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- 208000010247 contact dermatitis Diseases 0.000 description 1
- 229940117173 croton oil Drugs 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 125000004005 formimidoyl group Chemical group [H]\N=C(/[H])* 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 230000004968 inflammatory condition Effects 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000000400 lauroyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- VACHIRYHOHLRKQ-VIFPVBQESA-N methyl (2s)-2-[benzoyl(methyl)amino]propanoate Chemical compound COC(=O)[C@H](C)N(C)C(=O)C1=CC=CC=C1 VACHIRYHOHLRKQ-VIFPVBQESA-N 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 235000013336 milk Nutrition 0.000 description 1
- 239000008267 milk Substances 0.000 description 1
- 210000004080 milk Anatomy 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- YOLMHAXXPZUZBH-ZFWWWQNUSA-N n-[(2s,3s)-1-[(2-amino-2-methylpropyl)amino]-3-methyl-1-oxopentan-2-yl]-n-methylbenzamide Chemical compound CC(N)(C)CNC(=O)[C@H]([C@@H](C)CC)N(C)C(=O)C1=CC=CC=C1 YOLMHAXXPZUZBH-ZFWWWQNUSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000007797 non-conventional method Methods 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 229960002429 proline Drugs 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 231100000161 signs of toxicity Toxicity 0.000 description 1
- 238000010898 silica gel chromatography Methods 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 150000003431 steroids Chemical class 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid group Chemical class S(O)(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- WMOVHXAZOJBABW-UHFFFAOYSA-N tert-butyl acetate Chemical compound CC(=O)OC(C)(C)C WMOVHXAZOJBABW-UHFFFAOYSA-N 0.000 description 1
- YBRBMKDOPFTVDT-UHFFFAOYSA-N tert-butylamine Chemical compound CC(C)(C)N YBRBMKDOPFTVDT-UHFFFAOYSA-N 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D205/00—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom
- C07D205/02—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D205/04—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/10—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/16—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/60—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J29/00—Details of cathode-ray tubes or of electron-beam tubes of the types covered by group H01J31/00
- H01J29/02—Electrodes; Screens; Mounting, supporting, spacing or insulating thereof
- H01J29/06—Screens for shielding; Masks interposed in the electron stream
- H01J29/07—Shadow masks for colour television tubes
- H01J29/073—Mounting arrangements associated with shadow masks
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J29/00—Details of cathode-ray tubes or of electron-beam tubes of the types covered by group H01J31/00
- H01J29/86—Vessels; Containers; Vacuum locks
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J31/00—Cathode ray tubes; Electron beam tubes
- H01J31/08—Cathode ray tubes; Electron beam tubes having a screen on or from which an image or pattern is formed, picked up, converted, or stored
- H01J31/10—Image or pattern display tubes, i.e. having electrical input and optical output; Flying-spot tubes for scanning purposes
- H01J31/12—Image or pattern display tubes, i.e. having electrical input and optical output; Flying-spot tubes for scanning purposes with luminescent screen
- H01J31/123—Flat display tubes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pain & Pain Management (AREA)
- Pharmacology & Pharmacy (AREA)
- Rheumatology (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Hydrogenated Pyridines (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB7917645 | 1979-05-21 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS212715B2 true CS212715B2 (en) | 1982-03-26 |
Family
ID=10505312
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS803430A CS212715B2 (en) | 1979-05-21 | 1980-05-16 | Method of preparing 1-phenyl-2-amino ethanol derivatives |
Country Status (24)
| Country | Link |
|---|---|
| US (1) | US4323575A (no) |
| EP (1) | EP0019411B1 (no) |
| JP (1) | JPS55154948A (no) |
| AT (1) | ATE2070T1 (no) |
| AU (1) | AU542577B2 (no) |
| CA (1) | CA1149804A (no) |
| CS (1) | CS212715B2 (no) |
| DD (1) | DD150892A5 (no) |
| DE (1) | DE3061410D1 (no) |
| DK (1) | DK221280A (no) |
| ES (1) | ES491643A0 (no) |
| FI (1) | FI801632A7 (no) |
| GR (1) | GR68464B (no) |
| HU (1) | HU180139B (no) |
| IE (1) | IE49772B1 (no) |
| IL (1) | IL60007A (no) |
| NO (1) | NO151237C (no) |
| NZ (1) | NZ193560A (no) |
| PH (1) | PH17143A (no) |
| PL (1) | PL128750B1 (no) |
| PT (1) | PT71283A (no) |
| SU (1) | SU1318151A3 (no) |
| ZA (1) | ZA802552B (no) |
| ZW (1) | ZW9580A1 (no) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IE54220B1 (en) * | 1981-12-23 | 1989-07-19 | Ici Plc | Phenol esters |
| US4540581A (en) * | 1984-01-31 | 1985-09-10 | Bristol-Myers Company | Topical nonsteroidal anti-inflammatory compositions and uses |
| US4574129A (en) * | 1984-01-31 | 1986-03-04 | Bristol-Myers Company | Topical nonsteroidal anti-inflammatory methods |
| JPS6137764A (ja) * | 1984-07-31 | 1986-02-22 | Suntory Ltd | 抗プロリルエンドペプチダ−ゼ活性を有する新規生理活性化合物 |
| AU5410786A (en) * | 1985-03-04 | 1986-09-11 | Fujisawa Pharmaceutical Co., Ltd. | Amino acid derivatives and processes for preparation thereof |
| JPH0623190B2 (ja) * | 1985-04-16 | 1994-03-30 | サントリー株式会社 | インヒビタ−活性を有するn−アシルピロリジン誘導体及びその製法並びに用途 |
| US4636405A (en) * | 1985-12-24 | 1987-01-13 | Corning Glass Works | Curing apparatus for coated fiber |
| EP1125925A1 (en) * | 2000-02-15 | 2001-08-22 | Applied Research Systems ARS Holding N.V. | Amine derivatives for the treatment of apoptosis |
| PL212489B1 (pl) * | 2008-01-22 | 2012-10-31 | Univ Jagiellonski | Pochodne fenoksyalkiloaminoalkanoli i ich zastosowania |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1178400A (en) * | 1966-12-13 | 1970-01-21 | Delalande Sa | Nitrogen Substituted Amines and their process of Preparation. |
| US3607859A (en) * | 1968-06-12 | 1971-09-21 | Monsanto Co | Furylacryloylgly-clycyl-l-leucinamide and relateo peptides and use thereof in spectrophotometric assay for neutral protease |
| GB1460593A (en) * | 1973-06-22 | 1977-01-06 | Ici Ltd | Ethanolamine derivatives |
| US3957870A (en) * | 1973-07-19 | 1976-05-18 | Imperial Chemical Industries Limited | Organic compounds |
| GB1468156A (en) * | 1973-07-19 | 1977-03-23 | Ici Ltd | Phenylethylamine derivatives |
| US4041075A (en) * | 1973-12-12 | 1977-08-09 | Imperial Chemical Industries Limited | Phenoxy-alkanolamine derivatives |
| DE2557657A1 (de) * | 1975-12-20 | 1977-06-30 | Knoll Ag | Neue spermin-derivate |
| GB1540463A (en) * | 1976-10-07 | 1979-02-14 | Ici Ltd | Alkanolamine derivatives |
-
1980
- 1980-04-28 ZA ZA00802552A patent/ZA802552B/xx unknown
- 1980-04-28 ZW ZW95/80A patent/ZW9580A1/xx unknown
- 1980-04-29 IE IE871/80A patent/IE49772B1/en unknown
- 1980-04-29 NZ NZ193560A patent/NZ193560A/xx unknown
- 1980-05-01 AU AU58000/80A patent/AU542577B2/en not_active Ceased
- 1980-05-06 IL IL60007A patent/IL60007A/xx unknown
- 1980-05-06 CA CA000351309A patent/CA1149804A/en not_active Expired
- 1980-05-06 US US06/147,074 patent/US4323575A/en not_active Expired - Lifetime
- 1980-05-07 EP EP80301483A patent/EP0019411B1/en not_active Expired
- 1980-05-07 DE DE8080301483T patent/DE3061410D1/de not_active Expired
- 1980-05-07 AT AT80301483T patent/ATE2070T1/de not_active IP Right Cessation
- 1980-05-12 PH PH24006A patent/PH17143A/en unknown
- 1980-05-16 CS CS803430A patent/CS212715B2/cs unknown
- 1980-05-19 HU HU801237A patent/HU180139B/hu unknown
- 1980-05-20 GR GR61999A patent/GR68464B/el unknown
- 1980-05-20 ES ES491643A patent/ES491643A0/es active Granted
- 1980-05-20 SU SU802922105A patent/SU1318151A3/ru active
- 1980-05-20 PL PL1980224366A patent/PL128750B1/pl unknown
- 1980-05-20 DD DD80221242A patent/DD150892A5/de unknown
- 1980-05-20 NO NO801491A patent/NO151237C/no unknown
- 1980-05-21 PT PT71283A patent/PT71283A/pt unknown
- 1980-05-21 FI FI801632A patent/FI801632A7/fi not_active Application Discontinuation
- 1980-05-21 DK DK221280A patent/DK221280A/da not_active Application Discontinuation
- 1980-05-21 JP JP6657580A patent/JPS55154948A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| ATE2070T1 (de) | 1983-01-15 |
| ZA802552B (en) | 1981-04-29 |
| JPS55154948A (en) | 1980-12-02 |
| DD150892A5 (de) | 1981-09-23 |
| IE800871L (en) | 1980-11-21 |
| PH17143A (en) | 1984-06-04 |
| IE49772B1 (en) | 1985-12-11 |
| PL128750B1 (en) | 1984-02-29 |
| NO151237B (no) | 1984-11-26 |
| DE3061410D1 (en) | 1983-01-27 |
| PT71283A (en) | 1980-06-01 |
| FI801632A7 (fi) | 1981-01-01 |
| AU542577B2 (en) | 1985-02-28 |
| IL60007A0 (en) | 1980-07-31 |
| HU180139B (en) | 1983-02-28 |
| NO801491L (no) | 1980-11-24 |
| EP0019411B1 (en) | 1982-12-22 |
| NZ193560A (en) | 1982-05-31 |
| ES8104187A1 (es) | 1981-04-16 |
| CA1149804A (en) | 1983-07-12 |
| AU5800080A (en) | 1980-12-11 |
| IL60007A (en) | 1984-06-29 |
| DK221280A (da) | 1980-11-22 |
| ZW9580A1 (en) | 1981-12-23 |
| SU1318151A3 (ru) | 1987-06-15 |
| NO151237C (no) | 1985-03-06 |
| GR68464B (no) | 1981-12-30 |
| US4323575A (en) | 1982-04-06 |
| ES491643A0 (es) | 1981-04-16 |
| PL224366A1 (no) | 1981-02-13 |
| EP0019411A1 (en) | 1980-11-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ES2300119T3 (es) | Compuestos de amina, su produccion y su uso como inhibidores de la produccion de beta-amiloide. | |
| US20040024057A1 (en) | Nitrosated nonsteroidal antiinflammatory compounds, compositions and methods of use related applications | |
| DE69507293T2 (de) | Benzamid-derivate als vasopressin-antagonisten | |
| HU187611B (en) | Process for production of substituaded amino-acetofenon derivates | |
| CA2223869A1 (en) | Benzamide derivatives and their use as vasopressin antagonists | |
| SE503081C2 (sv) | Förening med relaxationsaktivitet för kärls glatta muskulatur | |
| EP0403185A2 (en) | Compounds having one or more aminosulfonyloxy radicals useful as pharmaceuticals | |
| DK156825B (da) | Analogifremgangsmaade til fremstilling af en basisk ether eller et farmaceutisk acceptabelt syreadditionssalt eller kvaternaert salt deraf | |
| CS258149B2 (en) | Method of arylcyclobutylalkylamines production | |
| AU767002B2 (en) | Naphthalenecarboxamides as tachykinin receptor antagonists | |
| CS212715B2 (en) | Method of preparing 1-phenyl-2-amino ethanol derivatives | |
| US4048314A (en) | Morpholino containing 4-arylpiperidine derivatives | |
| HU209723B (en) | Process for producing of piperazine derivatives | |
| CS198297B2 (en) | Method of producing derivatives of urea | |
| EP3040329B1 (en) | Aromatic compound and use thereof in the treatment of disorders associated with bone metabolism | |
| JP2021526531A (ja) | リフィテグラストの製造方法 | |
| JP2009518379A (ja) | 光学的に活性なカルバメート、その製法及び医薬品成分としての使用 | |
| AU737994B2 (en) | Process for preparing o-(3-amino-2-hydroxy-propyl)-hydroxymic acid halides | |
| JPH0625191B2 (ja) | 1−[2−(フエニルメチル)フエニルピペラジン化合物、その製造方法および医薬組成物 | |
| US3709938A (en) | 2,6-dihalo-m-substituted-benzoic acid amides | |
| US4927970A (en) | Substituted 3-cyclobutene-1,2-dione intermediates | |
| KR930006777B1 (ko) | 피리도[1,2-a]인돌 화합물 및 그 제조방법 | |
| US4082801A (en) | 4-Aminomethyldibenzobicyclo[5.1.0]octanes | |
| EP0223124B1 (en) | Substituted aminosulfonyl 6-nitrobenzoic-esters or amides, processes for their preparation and pharmaceutical compositions containing them | |
| CS212331B2 (cs) | Způsob výroby derivátů 1-fenyl-2-[(acylamino)-alkanoylamino] alkylaminoethanolu |