CH649775A5 - Wasserloesliche, anionische chromkomplexe, deren herstellung und verwendung. - Google Patents
Wasserloesliche, anionische chromkomplexe, deren herstellung und verwendung. Download PDFInfo
- Publication number
- CH649775A5 CH649775A5 CH8638/79A CH863879A CH649775A5 CH 649775 A5 CH649775 A5 CH 649775A5 CH 8638/79 A CH8638/79 A CH 8638/79A CH 863879 A CH863879 A CH 863879A CH 649775 A5 CH649775 A5 CH 649775A5
- Authority
- CH
- Switzerland
- Prior art keywords
- formula
- hydrogen
- group
- cooh
- chromium
- Prior art date
Links
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical class [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 title claims description 15
- 238000004519 manufacturing process Methods 0.000 title description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 49
- 239000001257 hydrogen Substances 0.000 claims description 49
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 36
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 claims description 34
- 150000001844 chromium Chemical class 0.000 claims description 31
- 239000000975 dye Substances 0.000 claims description 25
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 23
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 21
- 239000002253 acid Substances 0.000 claims description 21
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 20
- 150000002431 hydrogen Chemical group 0.000 claims description 19
- 239000010985 leather Substances 0.000 claims description 17
- -1 anionic chromium complexes Chemical class 0.000 claims description 15
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 claims description 15
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 claims description 15
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 15
- 125000001424 substituent group Chemical group 0.000 claims description 15
- 238000004043 dyeing Methods 0.000 claims description 14
- 239000008139 complexing agent Substances 0.000 claims description 13
- 150000001875 compounds Chemical class 0.000 claims description 13
- 229910052804 chromium Inorganic materials 0.000 claims description 12
- 239000011651 chromium Substances 0.000 claims description 12
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 11
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 10
- 239000000460 chlorine Substances 0.000 claims description 10
- 229910052801 chlorine Inorganic materials 0.000 claims description 10
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 239000000203 mixture Substances 0.000 claims description 9
- 150000002790 naphthalenes Chemical class 0.000 claims description 9
- 125000000129 anionic group Chemical group 0.000 claims description 8
- 150000008049 diazo compounds Chemical class 0.000 claims description 8
- 239000000758 substrate Substances 0.000 claims description 7
- 239000004753 textile Substances 0.000 claims description 6
- 229910006069 SO3H Inorganic materials 0.000 claims description 5
- 229910052751 metal Inorganic materials 0.000 claims description 5
- 239000002184 metal Substances 0.000 claims description 5
- 238000000034 method Methods 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 150000001412 amines Chemical class 0.000 claims description 4
- 230000009918 complex formation Effects 0.000 claims description 3
- 150000004696 coordination complex Chemical class 0.000 claims description 3
- 125000000542 sulfonic acid group Chemical group 0.000 claims description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N Resorcinol Natural products OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 11
- 150000003254 radicals Chemical class 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical compound NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- 238000005859 coupling reaction Methods 0.000 description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 6
- 230000008878 coupling Effects 0.000 description 5
- 238000010168 coupling process Methods 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- 229910052736 halogen Inorganic materials 0.000 description 4
- 150000002367 halogens Chemical class 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- 125000003277 amino group Chemical group 0.000 description 3
- 150000001555 benzenes Chemical class 0.000 description 3
- 150000001845 chromium compounds Chemical class 0.000 description 3
- 239000003086 colorant Substances 0.000 description 3
- 238000004040 coloring Methods 0.000 description 3
- 238000009792 diffusion process Methods 0.000 description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- ZFORMMHRWNVVQQ-UHFFFAOYSA-N 2-[(2,4-dihydroxyphenyl)diazenyl]benzoic acid Chemical compound OC1=C(C=CC(=C1)O)N=NC1=C(C=CC=C1)C(=O)O ZFORMMHRWNVVQQ-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 235000011114 ammonium hydroxide Nutrition 0.000 description 2
- 239000012736 aqueous medium Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- LTPSRQRIPCVMKQ-UHFFFAOYSA-N 2-amino-5-methylbenzenesulfonic acid Chemical compound CC1=CC=C(N)C(S(O)(=O)=O)=C1 LTPSRQRIPCVMKQ-UHFFFAOYSA-N 0.000 description 1
- MJNYPLCGWXFYPD-UHFFFAOYSA-N 2-amino-5-sulfobenzoic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1C(O)=O MJNYPLCGWXFYPD-UHFFFAOYSA-N 0.000 description 1
- GPNNOCMCNFXRAO-UHFFFAOYSA-N 2-aminoterephthalic acid Chemical compound NC1=CC(C(O)=O)=CC=C1C(O)=O GPNNOCMCNFXRAO-UHFFFAOYSA-N 0.000 description 1
- WQTCZINVPXJNEL-UHFFFAOYSA-N 4-amino-3-methylbenzenesulfonic acid Chemical compound CC1=CC(S(O)(=O)=O)=CC=C1N WQTCZINVPXJNEL-UHFFFAOYSA-N 0.000 description 1
- SEMRCUIXRUXGJX-UHFFFAOYSA-N 6-aminonaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=CC2=CC(N)=CC=C21 SEMRCUIXRUXGJX-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 235000000536 Brassica rapa subsp pekinensis Nutrition 0.000 description 1
- 241000499436 Brassica rapa subsp. pekinensis Species 0.000 description 1
- 229920001353 Dextrin Polymers 0.000 description 1
- 239000004375 Dextrin Substances 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 241001494479 Pecora Species 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- DMLAVOWQYNRWNQ-UHFFFAOYSA-N azobenzene Chemical compound C1=CC=CC=C1N=NC1=CC=CC=C1 DMLAVOWQYNRWNQ-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 229910052797 bismuth Inorganic materials 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000004532 chromating Methods 0.000 description 1
- 235000019425 dextrin Nutrition 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 1
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000004627 regenerated cellulose Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 235000002639 sodium chloride Nutrition 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B45/00—Complex metal compounds of azo dyes
- C09B45/02—Preparation from dyes containing in o-position a hydroxy group and in o'-position hydroxy, alkoxy, carboxyl, amino or keto groups
- C09B45/24—Disazo or polyazo compounds
- C09B45/26—Disazo or polyazo compounds containing chromium
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
Priority Applications (15)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH8638/79A CH649775A5 (de) | 1979-09-25 | 1979-09-25 | Wasserloesliche, anionische chromkomplexe, deren herstellung und verwendung. |
| DE3034686A DE3034686C2 (de) | 1979-09-25 | 1980-09-13 | Wasserlösliche 1:2-Chromkomplexe von Disazoverbindungen, deren Herstellung und Verwendung |
| GB8030515A GB2059986B (en) | 1979-09-25 | 1980-09-22 | Water-soluble chromium complexes of diazo compounds |
| SU802984001A SU1187726A3 (ru) | 1979-09-25 | 1980-09-23 | "cпocoб kpaшehия дублehoй hatуpaльhoй koжи" |
| SE8006638A SE449871B (sv) | 1979-09-25 | 1980-09-23 | Kromkomplex av disazoforeningar, deras framstellning och anvendning |
| HU802324A HU184830B (en) | 1979-09-25 | 1980-09-23 | Process for producing chromocomplexes of diazo-compounds |
| AR282639A AR227034A1 (es) | 1979-09-25 | 1980-09-24 | Un colorante anionico complejo hidrosoluble de cromo(1,2)de diazo compuestos |
| ES495317A ES495317A0 (es) | 1979-09-25 | 1980-09-24 | Procedimiento para la produccion de colorantes. complejos cromiferos anionicos hidrosolubles,de compuestos disazoicos. |
| BR8006113A BR8006113A (pt) | 1979-09-25 | 1980-09-24 | Processo para a producao de um complexo de cromo corante, hidrossoluvel, anionico, de compostos disazoicos, e processo para tingimento de substratos anionicos tingiveis |
| JP13178080A JPS5659871A (en) | 1979-09-25 | 1980-09-24 | Anionic waterrsoluble chromium complex |
| KR1019800003720A KR840001579B1 (ko) | 1979-09-25 | 1980-09-24 | 수용성 크롬착화합물 음이온성 염료의 제조방법 |
| FR8020576A FR2465769B1 (fr) | 1979-09-25 | 1980-09-25 | Nouveaux complexes chromiferes anioniques solubles dans l'eau, leur preparation et leur application comme colorants |
| IT49743/80A IT1128568B (it) | 1979-09-25 | 1980-09-25 | Complessi cromiferi di composti di sazoici loro preparazione e loro impiego come coloranti |
| HK377/86A HK37786A (en) | 1979-09-25 | 1986-05-22 | Anionic water-soluble chromium complexes of disazo compounds |
| US07/114,901 US5008379A (en) | 1979-09-25 | 1987-10-29 | Chromium complexes of sulfo group containing disazo compounds having a resorcinol biscoupling component radical |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH8638/79A CH649775A5 (de) | 1979-09-25 | 1979-09-25 | Wasserloesliche, anionische chromkomplexe, deren herstellung und verwendung. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH649775A5 true CH649775A5 (de) | 1985-06-14 |
Family
ID=4342939
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH8638/79A CH649775A5 (de) | 1979-09-25 | 1979-09-25 | Wasserloesliche, anionische chromkomplexe, deren herstellung und verwendung. |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US5008379A (enExample) |
| JP (1) | JPS5659871A (enExample) |
| KR (1) | KR840001579B1 (enExample) |
| AR (1) | AR227034A1 (enExample) |
| BR (1) | BR8006113A (enExample) |
| CH (1) | CH649775A5 (enExample) |
| DE (1) | DE3034686C2 (enExample) |
| ES (1) | ES495317A0 (enExample) |
| FR (1) | FR2465769B1 (enExample) |
| GB (1) | GB2059986B (enExample) |
| HK (1) | HK37786A (enExample) |
| HU (1) | HU184830B (enExample) |
| IT (1) | IT1128568B (enExample) |
| SE (1) | SE449871B (enExample) |
| SU (1) | SU1187726A3 (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3263035D1 (en) * | 1981-12-15 | 1985-05-15 | Ciba Geigy Ag | Chromium complexes of polyazo dyestuffs |
| US4502860A (en) * | 1982-07-02 | 1985-03-05 | Ciba-Geigy Corporation | Bis-1:2-chromium complexes of disazo dyes, and their preparation and use |
| CH676500A5 (enExample) * | 1990-05-18 | 1991-01-31 | Werner Kunz | |
| US5674248A (en) * | 1995-01-23 | 1997-10-07 | Angeion Corporation | Staged energy concentration for an implantable biomedical device |
| US6096870A (en) * | 1994-01-05 | 2000-08-01 | Sepragen Corporation | Sequential separation of whey |
| WO2000009615A1 (en) | 1998-08-14 | 2000-02-24 | Clariant Finance (Bvi) Limited | 1:2 chromium complex dyes, their production and use |
| US7131136B2 (en) * | 2002-07-10 | 2006-10-31 | E-Watch, Inc. | Comprehensive multi-media surveillance and response system for aircraft, operations centers, airports and other commercial transports, centers and terminals |
| GB0123150D0 (en) * | 2001-09-27 | 2001-11-21 | Clariant Int Ltd | Organic compounds |
| DE60214747T2 (de) | 2001-10-17 | 2007-09-13 | Clariant Finance (Bvi) Ltd., Road Town | 1:2 metallkomplexfarbstoffe, deren zusammensetzungen, deren herstellung und deren verwendung |
| MX2008000783A (es) * | 2005-07-21 | 2008-02-21 | Clariant Finance Bvi Ltd | Colorantes de complejos de cromo. |
Family Cites Families (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2950274A (en) * | 1960-08-23 | Azo-dyestuffs insoluble in water | ||
| DE595187C (de) * | 1932-12-21 | 1934-04-10 | Chem Ind Basel | Verfahren zum Faerben von Leder |
| US2136650A (en) * | 1933-06-17 | 1938-11-15 | Calco Chemical Co Inc | Metallized acid polyazo dyes |
| US2111559A (en) * | 1933-11-25 | 1938-03-22 | Gen Aniline Works Inc | Azo dyestuffs containing a heavy metal in a complex form |
| DE707225C (de) * | 1933-11-26 | 1941-06-16 | I G Farbenindustrie Akt Ges | Verfahren zur Herstellung von komplexen Chromverbindungen von Polyazofarbstoffen |
| DE670935C (de) * | 1933-11-26 | 1939-01-28 | I G Farbenindustrie Akt Ges | Verfahren zur Herstellung von komplexen Kupferverbindungen von Polyazofarbstoffen |
| FR783595A (fr) * | 1934-08-11 | 1935-07-16 | Ste Ind Chim Bale | Colorant contenant des métaux liés sous forme de complexes métallifères |
| US2216164A (en) * | 1936-03-13 | 1940-10-01 | Autogiro Co Of America | Rotary-wing aircraft |
| FR906366A (fr) * | 1941-08-28 | 1946-01-04 | Ig Farbenindustrie Ag | Composés complexes chromifères de colorants disazoïques et procédé pour leur production |
| CH427097A (de) * | 1960-03-04 | 1966-12-31 | Sandoz Ag | Verfahren zur Herstellung wasserlöslicher reaktiver Disazofarbstoffe |
| US3134760A (en) * | 1960-03-04 | 1964-05-26 | Sandoz Ltd | Water-soluble reactive disazo dyestuffs |
| US3185676A (en) * | 1960-08-12 | 1965-05-25 | Gen Aniline & Film Corp | Method of azo dye chromation |
| CH571559A5 (en) * | 1973-11-15 | 1976-01-15 | Sandoz Ag | Soluble metal complex dyes for leather - made by coupling diazotised 4-amino diphenylamine derivs. with 1,2 metal complexes |
| US3975369A (en) * | 1969-08-07 | 1976-08-17 | Sandoz Ltd. | 2:1 Metal complexes of 2,2',4'-trihydroxy-3,5-dinitroazobenzene bound to a diphenylamine through an azo bridge |
| CH529200A (de) * | 1969-08-21 | 1972-10-15 | Sandoz Ag | Verfahren zur Herstellung von Polyazoverbindungen |
| DE2037256A1 (de) * | 1970-07-28 | 1972-02-03 | Farbwerke Hoechst AG, vorm. Meister Lucius & Brüning, 6000 Frankfurt | Wasserlösliche Metallkomplex-disazofarbstoffe und Verfahren zu ihrer Herstellung |
| GB1503707A (en) * | 1976-04-08 | 1978-03-15 | Ici Ltd | Copper azo dyes containing phosphonic acid groups |
| DE3029271A1 (de) * | 1980-08-01 | 1982-03-18 | Bayer Ag, 5090 Leverkusen | Metallkomplexfarbstoffe, verfahren zu ihrer herstellung und ihre verwendung zum faerben stickstoffhaltiger materialien |
-
1979
- 1979-09-25 CH CH8638/79A patent/CH649775A5/de not_active IP Right Cessation
-
1980
- 1980-09-13 DE DE3034686A patent/DE3034686C2/de not_active Expired
- 1980-09-22 GB GB8030515A patent/GB2059986B/en not_active Expired
- 1980-09-23 SU SU802984001A patent/SU1187726A3/ru active
- 1980-09-23 SE SE8006638A patent/SE449871B/sv not_active IP Right Cessation
- 1980-09-23 HU HU802324A patent/HU184830B/hu not_active IP Right Cessation
- 1980-09-24 ES ES495317A patent/ES495317A0/es active Granted
- 1980-09-24 JP JP13178080A patent/JPS5659871A/ja active Granted
- 1980-09-24 BR BR8006113A patent/BR8006113A/pt unknown
- 1980-09-24 KR KR1019800003720A patent/KR840001579B1/ko not_active Expired
- 1980-09-24 AR AR282639A patent/AR227034A1/es active
- 1980-09-25 IT IT49743/80A patent/IT1128568B/it active
- 1980-09-25 FR FR8020576A patent/FR2465769B1/fr not_active Expired
-
1986
- 1986-05-22 HK HK377/86A patent/HK37786A/xx not_active IP Right Cessation
-
1987
- 1987-10-29 US US07/114,901 patent/US5008379A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| IT1128568B (it) | 1986-05-28 |
| FR2465769B1 (fr) | 1986-07-18 |
| SU1187726A3 (ru) | 1985-10-23 |
| DE3034686A1 (de) | 1981-04-02 |
| HK37786A (en) | 1986-05-30 |
| ES8107282A1 (es) | 1981-10-01 |
| IT8049743A0 (it) | 1980-09-25 |
| JPS5659871A (en) | 1981-05-23 |
| DE3034686C2 (de) | 1987-01-15 |
| BR8006113A (pt) | 1981-04-07 |
| ES495317A0 (es) | 1981-10-01 |
| KR840001579B1 (ko) | 1984-10-08 |
| SE449871B (sv) | 1987-05-25 |
| AR227034A1 (es) | 1982-09-15 |
| FR2465769A1 (fr) | 1981-03-27 |
| HU184830B (en) | 1984-10-29 |
| US5008379A (en) | 1991-04-16 |
| JPH0220661B2 (enExample) | 1990-05-10 |
| GB2059986A (en) | 1981-04-29 |
| SE8006638L (sv) | 1981-03-26 |
| GB2059986B (en) | 1983-06-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH649775A5 (de) | Wasserloesliche, anionische chromkomplexe, deren herstellung und verwendung. | |
| DE2722855C2 (enExample) | ||
| DE3018761A1 (de) | 1 zu 2 metallkomplexverbindungen, deren herstellung und verwendung | |
| CH619977A5 (enExample) | ||
| DE1644366B1 (de) | Verfahren zur Herstellung von metallhaltigen wasserloeslichen Pyrimidinreaktiv-Azofarbstoffen | |
| EP0113643B1 (de) | 1:2-Kobaltkomplexe von Disazofarbstoffen | |
| DE2832756A1 (de) | 1 zu 2-chromkomplexe von disazofarbstoffen, deren herstellung und verwendung | |
| CH622543A5 (enExample) | ||
| EP0061998B1 (de) | Verwendung von 1:2-Chrom- oder -Kobaltkomplexfarbstoffen zum Färben von Leder oder Pelzen | |
| DE3008086C2 (enExample) | ||
| EP0316278B1 (de) | Polyazofarbstoffe | |
| DE2608535C2 (de) | Neue Chromkomplexfarbstoffe, ihre Herstellung und Verwendung | |
| DE2501039C2 (de) | Neue Chromkomplexfarbstoffe, deren Herstellung und Verwendung | |
| DE19511830C2 (de) | Polyazometallkomplexfarbstoffe, deren Herstellung und Verwendung | |
| EP0037377B1 (de) | Metallkomplexfarbstoffe, deren Herstellung und Verwendung | |
| EP0322357B1 (de) | Verfahren zur Herstellung von Polyazofarbstoffen | |
| EP0095441A1 (de) | Asymmetrische 1:2-Chromkomplexfarbstoffe | |
| EP0099857B1 (de) | Metallkomplexe von Azofarbstoffen | |
| DE2501449A1 (de) | Neue chromkomplexfarbstoffe, deren herstellung und verwendung | |
| DE853188C (de) | Verfahren zur Herstellung von Mono-, Dis- oder Polyazofarbstoffen | |
| EP0423071B1 (de) | Polyazofarbstoffe | |
| EP0166687B1 (de) | Eisenkomplexe von Azofarbstoffen aus Naphthylaminsulfonsäure, Resorcin und Nitroaminophenol | |
| DE956794C (de) | Verfahren zur Herstellung von metallisierbaren Polyazofarbstoffen bzw. deren Metallkomplexverbindungen | |
| DE2540588C2 (de) | Neue Lederfarbstoffe, deren Herstellung und Verwendung | |
| DE2805243A1 (de) | 1 zu 2-metallkomplexe, deren herstellung und verwendung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |