CH644394A5 - Koernige wasch- und reinigungsmittelzusammensetzung. - Google Patents
Koernige wasch- und reinigungsmittelzusammensetzung. Download PDFInfo
- Publication number
- CH644394A5 CH644394A5 CH338780A CH338780A CH644394A5 CH 644394 A5 CH644394 A5 CH 644394A5 CH 338780 A CH338780 A CH 338780A CH 338780 A CH338780 A CH 338780A CH 644394 A5 CH644394 A5 CH 644394A5
- Authority
- CH
- Switzerland
- Prior art keywords
- surfactant
- alkyl
- weight
- cationic
- anionic
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims description 113
- 239000003599 detergent Substances 0.000 title claims description 68
- 239000003093 cationic surfactant Substances 0.000 claims description 41
- 125000004432 carbon atom Chemical group C* 0.000 claims description 40
- 239000002736 nonionic surfactant Substances 0.000 claims description 29
- 239000003945 anionic surfactant Substances 0.000 claims description 27
- 125000000217 alkyl group Chemical group 0.000 claims description 25
- 125000000129 anionic group Chemical group 0.000 claims description 24
- 125000003342 alkenyl group Chemical group 0.000 claims description 10
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 9
- 238000004140 cleaning Methods 0.000 claims description 9
- 150000001450 anions Chemical class 0.000 claims description 4
- 125000002947 alkylene group Chemical group 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 239000007864 aqueous solution Substances 0.000 claims description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 28
- 150000003839 salts Chemical class 0.000 description 28
- 239000004094 surface-active agent Substances 0.000 description 26
- 125000002091 cationic group Chemical group 0.000 description 24
- -1 dodecylbenzylhydroxyammonium ethylhydroxyammonium ethyl xyl ammonium ammonium ammonium ammonium ammonium ammonium salts Chemical class 0.000 description 18
- 229910052708 sodium Inorganic materials 0.000 description 17
- 239000011734 sodium Substances 0.000 description 17
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 16
- 239000000047 product Substances 0.000 description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 15
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 14
- 239000003925 fat Substances 0.000 description 12
- 235000019197 fats Nutrition 0.000 description 12
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 11
- 235000013162 Cocos nucifera Nutrition 0.000 description 10
- 244000060011 Cocos nucifera Species 0.000 description 10
- 239000000344 soap Substances 0.000 description 10
- 239000003760 tallow Substances 0.000 description 10
- 239000006260 foam Substances 0.000 description 9
- 239000003921 oil Substances 0.000 description 9
- 235000019198 oils Nutrition 0.000 description 9
- 238000001694 spray drying Methods 0.000 description 9
- 239000004753 textile Substances 0.000 description 9
- 238000005406 washing Methods 0.000 description 9
- 230000008901 benefit Effects 0.000 description 8
- 150000001875 compounds Chemical class 0.000 description 8
- 239000000463 material Substances 0.000 description 8
- 239000000178 monomer Substances 0.000 description 8
- 235000019832 sodium triphosphate Nutrition 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- 239000002253 acid Substances 0.000 description 7
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 7
- 229920001577 copolymer Polymers 0.000 description 7
- 235000014113 dietary fatty acids Nutrition 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 239000000194 fatty acid Substances 0.000 description 7
- 229930195729 fatty acid Natural products 0.000 description 7
- 150000004665 fatty acids Chemical class 0.000 description 7
- 239000007788 liquid Substances 0.000 description 7
- 229910052700 potassium Inorganic materials 0.000 description 7
- 239000011591 potassium Substances 0.000 description 7
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000002585 base Substances 0.000 description 6
- 229920001296 polysiloxane Polymers 0.000 description 6
- 102000004190 Enzymes Human genes 0.000 description 5
- 108090000790 Enzymes Proteins 0.000 description 5
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 5
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 5
- 125000003545 alkoxy group Chemical group 0.000 description 5
- 150000002500 ions Chemical class 0.000 description 5
- 239000011976 maleic acid Substances 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- GAEXIJRVTSSOBA-UHFFFAOYSA-N 2,2-dihydroxyethyl-dodecyl-methylazanium;chloride Chemical compound [Cl-].CCCCCCCCCCCC[NH+](C)CC(O)O GAEXIJRVTSSOBA-UHFFFAOYSA-N 0.000 description 4
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical class OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 230000009471 action Effects 0.000 description 4
- 239000000654 additive Substances 0.000 description 4
- 150000001298 alcohols Chemical class 0.000 description 4
- 229910052783 alkali metal Inorganic materials 0.000 description 4
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 4
- 235000019864 coconut oil Nutrition 0.000 description 4
- 239000003240 coconut oil Substances 0.000 description 4
- 239000007859 condensation product Substances 0.000 description 4
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 4
- UPBDXRPQPOWRKR-UHFFFAOYSA-N furan-2,5-dione;methoxyethene Chemical compound COC=C.O=C1OC(=O)C=C1 UPBDXRPQPOWRKR-UHFFFAOYSA-N 0.000 description 4
- 239000004519 grease Substances 0.000 description 4
- 230000002209 hydrophobic effect Effects 0.000 description 4
- 229920001983 poloxamer Polymers 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 239000000377 silicon dioxide Substances 0.000 description 4
- 239000007921 spray Substances 0.000 description 4
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 239000004115 Sodium Silicate Substances 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- 239000004480 active ingredient Substances 0.000 description 3
- 125000002252 acyl group Chemical group 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- 229910000323 aluminium silicate Inorganic materials 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- 150000001768 cations Chemical class 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- GVGUFUZHNYFZLC-UHFFFAOYSA-N dodecyl benzenesulfonate;sodium Chemical compound [Na].CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 GVGUFUZHNYFZLC-UHFFFAOYSA-N 0.000 description 3
- NFDRPXJGHKJRLJ-UHFFFAOYSA-N edtmp Chemical compound OP(O)(=O)CN(CP(O)(O)=O)CCN(CP(O)(O)=O)CP(O)(O)=O NFDRPXJGHKJRLJ-UHFFFAOYSA-N 0.000 description 3
- 239000007850 fluorescent dye Substances 0.000 description 3
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 239000000693 micelle Substances 0.000 description 3
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- 150000003138 primary alcohols Chemical class 0.000 description 3
- 239000002002 slurry Substances 0.000 description 3
- 229940080264 sodium dodecylbenzenesulfonate Drugs 0.000 description 3
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 3
- 229910052911 sodium silicate Inorganic materials 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 150000003871 sulfonates Chemical class 0.000 description 3
- 229960005486 vaccine Drugs 0.000 description 3
- 239000001124 (E)-prop-1-ene-1,2,3-tricarboxylic acid Substances 0.000 description 2
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical class OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- IGFHQQFPSIBGKE-UHFFFAOYSA-N Nonylphenol Natural products CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- 229910021536 Zeolite Inorganic materials 0.000 description 2
- 229940091181 aconitic acid Drugs 0.000 description 2
- 230000000996 additive effect Effects 0.000 description 2
- 150000003863 ammonium salts Chemical group 0.000 description 2
- 239000007844 bleaching agent Substances 0.000 description 2
- 150000001642 boronic acid derivatives Chemical class 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 2
- 150000007942 carboxylates Chemical class 0.000 description 2
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 2
- GTZCVFVGUGFEME-IWQZZHSRSA-N cis-aconitic acid Chemical compound OC(=O)C\C(C(O)=O)=C\C(O)=O GTZCVFVGUGFEME-IWQZZHSRSA-N 0.000 description 2
- HNEGQIOMVPPMNR-IHWYPQMZSA-N citraconic acid Chemical compound OC(=O)C(/C)=C\C(O)=O HNEGQIOMVPPMNR-IHWYPQMZSA-N 0.000 description 2
- 229940018557 citraconic acid Drugs 0.000 description 2
- 239000013065 commercial product Substances 0.000 description 2
- 230000001236 detergent effect Effects 0.000 description 2
- IDROXUWVODOXTL-UHFFFAOYSA-N dodecyl-(2-hydroxyethyl)-dimethylazanium Chemical class CCCCCCCCCCCC[N+](C)(C)CCO IDROXUWVODOXTL-UHFFFAOYSA-N 0.000 description 2
- OQKFOMLUQPERBK-UHFFFAOYSA-N dodecyl-(3-hydroxypropyl)-dimethylazanium Chemical class CCCCCCCCCCCC[N+](C)(C)CCCO OQKFOMLUQPERBK-UHFFFAOYSA-N 0.000 description 2
- DUYCTCQXNHFCSJ-UHFFFAOYSA-N dtpmp Chemical compound OP(=O)(O)CN(CP(O)(O)=O)CCN(CP(O)(=O)O)CCN(CP(O)(O)=O)CP(O)(O)=O DUYCTCQXNHFCSJ-UHFFFAOYSA-N 0.000 description 2
- 238000007046 ethoxylation reaction Methods 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 239000001530 fumaric acid Substances 0.000 description 2
- 230000002070 germicidal effect Effects 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- ROBFUDYVXSDBQM-UHFFFAOYSA-N hydroxymalonic acid Chemical compound OC(=O)C(O)C(O)=O ROBFUDYVXSDBQM-UHFFFAOYSA-N 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical class CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 229910003002 lithium salt Inorganic materials 0.000 description 2
- 159000000002 lithium salts Chemical class 0.000 description 2
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 2
- YDSWCNNOKPMOTP-UHFFFAOYSA-N mellitic acid Chemical compound OC(=O)C1=C(C(O)=O)C(C(O)=O)=C(C(O)=O)C(C(O)=O)=C1C(O)=O YDSWCNNOKPMOTP-UHFFFAOYSA-N 0.000 description 2
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Chemical compound CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 description 2
- GLDOVTGHNKAZLK-UHFFFAOYSA-N octadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCO GLDOVTGHNKAZLK-UHFFFAOYSA-N 0.000 description 2
- 239000012188 paraffin wax Substances 0.000 description 2
- OSBMVGFXROCQIZ-UHFFFAOYSA-I pentasodium;[bis(phosphonatomethyl)amino]methyl-hydroxyphosphinate Chemical compound [Na+].[Na+].[Na+].[Na+].[Na+].OP([O-])(=O)CN(CP([O-])([O-])=O)CP([O-])([O-])=O OSBMVGFXROCQIZ-UHFFFAOYSA-I 0.000 description 2
- 239000002304 perfume Substances 0.000 description 2
- 235000002949 phytic acid Nutrition 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 159000000001 potassium salts Chemical class 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- CYIDZMCFTVVTJO-UHFFFAOYSA-N pyromellitic acid Chemical compound OC(=O)C1=CC(C(O)=O)=C(C(O)=O)C=C1C(O)=O CYIDZMCFTVVTJO-UHFFFAOYSA-N 0.000 description 2
- 238000007127 saponification reaction Methods 0.000 description 2
- 229960001922 sodium perborate Drugs 0.000 description 2
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 2
- 239000000271 synthetic detergent Substances 0.000 description 2
- GTZCVFVGUGFEME-UHFFFAOYSA-N trans-aconitic acid Natural products OC(=O)CC(C(O)=O)=CC(O)=O GTZCVFVGUGFEME-UHFFFAOYSA-N 0.000 description 2
- 239000001993 wax Substances 0.000 description 2
- 239000010457 zeolite Substances 0.000 description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- CIOXZGOUEYHNBF-UHFFFAOYSA-N (carboxymethoxy)succinic acid Chemical compound OC(=O)COC(C(O)=O)CC(O)=O CIOXZGOUEYHNBF-UHFFFAOYSA-N 0.000 description 1
- PGHYAIXOPQQRJA-CLFYSBASSA-N (z)-2-benzylbut-2-enedioic acid Chemical compound OC(=O)\C=C(C(O)=O)\CC1=CC=CC=C1 PGHYAIXOPQQRJA-CLFYSBASSA-N 0.000 description 1
- CQNPSIAJXGEDQS-VURMDHGXSA-N (z)-2-phenylbut-2-enedioic acid Chemical compound OC(=O)\C=C(/C(O)=O)C1=CC=CC=C1 CQNPSIAJXGEDQS-VURMDHGXSA-N 0.000 description 1
- KWKAKUADMBZCLK-UHFFFAOYSA-N 1-octene Chemical compound CCCCCCC=C KWKAKUADMBZCLK-UHFFFAOYSA-N 0.000 description 1
- AQFLVLHRZFLDDV-UHFFFAOYSA-N 1-phenylpropan-1-amine Chemical class CCC(N)C1=CC=CC=C1 AQFLVLHRZFLDDV-UHFFFAOYSA-N 0.000 description 1
- FNRRHKQTVNDRSJ-UHFFFAOYSA-N 2,3-bis(6-methylheptyl)phenol Chemical compound CC(C)CCCCCC1=CC=CC(O)=C1CCCCCC(C)C FNRRHKQTVNDRSJ-UHFFFAOYSA-N 0.000 description 1
- JKTAIYGNOFSMCE-UHFFFAOYSA-N 2,3-di(nonyl)phenol Chemical compound CCCCCCCCCC1=CC=CC(O)=C1CCCCCCCCC JKTAIYGNOFSMCE-UHFFFAOYSA-N 0.000 description 1
- FXNDIJDIPNCZQJ-UHFFFAOYSA-N 2,4,4-trimethylpent-1-ene Chemical group CC(=C)CC(C)(C)C FXNDIJDIPNCZQJ-UHFFFAOYSA-N 0.000 description 1
- CFPOJWPDQWJEMO-UHFFFAOYSA-N 2-(1,2-dicarboxyethoxy)butanedioic acid Chemical compound OC(=O)CC(C(O)=O)OC(C(O)=O)CC(O)=O CFPOJWPDQWJEMO-UHFFFAOYSA-N 0.000 description 1
- UURYKQHCLJWXEU-UHFFFAOYSA-N 2-(2-hydroxypropanoyloxy)butanedioic acid Chemical compound CC(O)C(=O)OC(C(O)=O)CC(O)=O UURYKQHCLJWXEU-UHFFFAOYSA-N 0.000 description 1
- JAHNSTQSQJOJLO-UHFFFAOYSA-N 2-(3-fluorophenyl)-1h-imidazole Chemical compound FC1=CC=CC(C=2NC=CN=2)=C1 JAHNSTQSQJOJLO-UHFFFAOYSA-N 0.000 description 1
- LFZBMEPDHVRMHO-UHFFFAOYSA-N 2-[2-(carboxymethoxy)ethoxy]acetic acid;propanedioic acid Chemical compound OC(=O)CC(O)=O.OC(=O)COCCOCC(O)=O LFZBMEPDHVRMHO-UHFFFAOYSA-N 0.000 description 1
- PCZBCZQLEWMBQT-UHFFFAOYSA-N 2-[dodecyl(3-hydroxypropyl)amino]ethane-1,1-diol Chemical class CCCCCCCCCCCCN(CC(O)O)CCCO PCZBCZQLEWMBQT-UHFFFAOYSA-N 0.000 description 1
- FAEIVMXWKPDFTP-UHFFFAOYSA-N 2-[dodecyl(methyl)amino]ethane-1,1-diol Chemical class CCCCCCCCCCCCN(C)CC(O)O FAEIVMXWKPDFTP-UHFFFAOYSA-N 0.000 description 1
- CYEJMVLDXAUOPN-UHFFFAOYSA-N 2-dodecylphenol Chemical compound CCCCCCCCCCCCC1=CC=CC=C1O CYEJMVLDXAUOPN-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- WYWPHTQMLPHMKP-UHFFFAOYSA-N 2-hydroxyethyl-dimethyl-tetradecylazanium Chemical class CCCCCCCCCCCCCC[N+](C)(C)CCO WYWPHTQMLPHMKP-UHFFFAOYSA-N 0.000 description 1
- PSZAEHPBBUYICS-UHFFFAOYSA-N 2-methylidenepropanedioic acid Chemical compound OC(=O)C(=C)C(O)=O PSZAEHPBBUYICS-UHFFFAOYSA-N 0.000 description 1
- VBBBJZGJBRFXCH-UHFFFAOYSA-N 3-(dodecylamino)propane-1,1,1-triol Chemical class CCCCCCCCCCCCNCCC(O)(O)O VBBBJZGJBRFXCH-UHFFFAOYSA-N 0.000 description 1
- PYDIHFBPOQSSDD-UHFFFAOYSA-N 3-[dodecyl(2-hydroxyethyl)amino]propane-1,1-diol Chemical class CCCCCCCCCCCCN(CCO)CCC(O)O PYDIHFBPOQSSDD-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- 241000251468 Actinopterygii Species 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- VCCWZAQTNBYODU-UHFFFAOYSA-N CC(=C)CC(C)CCC(C)=C Chemical group CC(=C)CC(C)CCC(C)=C VCCWZAQTNBYODU-UHFFFAOYSA-N 0.000 description 1
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical compound [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- QEVGZEDELICMKH-UHFFFAOYSA-N Diglycolic acid Chemical compound OC(=O)COCC(O)=O QEVGZEDELICMKH-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- 239000001692 EU approved anti-caking agent Substances 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- IMQLKJBTEOYOSI-GPIVLXJGSA-N Inositol-hexakisphosphate Chemical class OP(O)(=O)O[C@H]1[C@H](OP(O)(O)=O)[C@@H](OP(O)(O)=O)[C@H](OP(O)(O)=O)[C@H](OP(O)(O)=O)[C@@H]1OP(O)(O)=O IMQLKJBTEOYOSI-GPIVLXJGSA-N 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical group CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical class NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 1
- UEEJHVSXFDXPFK-UHFFFAOYSA-N N-dimethylaminoethanol Chemical class CN(C)CCO UEEJHVSXFDXPFK-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 108091005804 Peptidases Proteins 0.000 description 1
- IMQLKJBTEOYOSI-UHFFFAOYSA-N Phytic acid Natural products OP(O)(=O)OC1C(OP(O)(O)=O)C(OP(O)(O)=O)C(OP(O)(O)=O)C(OP(O)(O)=O)C1OP(O)(O)=O IMQLKJBTEOYOSI-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 229920000388 Polyphosphate Polymers 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- 102100037486 Reverse transcriptase/ribonuclease H Human genes 0.000 description 1
- 102000005158 Subtilisins Human genes 0.000 description 1
- 108010056079 Subtilisins Proteins 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- QYKIQEUNHZKYBP-UHFFFAOYSA-N Vinyl ether Chemical class C=COC=C QYKIQEUNHZKYBP-UHFFFAOYSA-N 0.000 description 1
- KDQHFXVSTXHORK-UHFFFAOYSA-H [Na+].C([O-])([O-])=O.[Na+].C([O-])([O-])=O.[Na+].C([O-])([O-])=O.[Na+].C(O)(O)=O.[Na+].C(O)(O)=O.[Na+] Chemical compound [Na+].C([O-])([O-])=O.[Na+].C([O-])([O-])=O.[Na+].C([O-])([O-])=O.[Na+].C(O)(O)=O.[Na+].C(O)(O)=O.[Na+] KDQHFXVSTXHORK-UHFFFAOYSA-H 0.000 description 1
- ZQSXSZIFPCDQQN-UHFFFAOYSA-N [Na].[Cl-].C(CCCCCCCCCCC)[NH+](C)CC(O)O Chemical compound [Na].[Cl-].C(CCCCCCCCCCC)[NH+](C)CC(O)O ZQSXSZIFPCDQQN-UHFFFAOYSA-N 0.000 description 1
- YDONNITUKPKTIG-UHFFFAOYSA-N [Nitrilotris(methylene)]trisphosphonic acid Chemical compound OP(O)(=O)CN(CP(O)(O)=O)CP(O)(O)=O YDONNITUKPKTIG-UHFFFAOYSA-N 0.000 description 1
- YKTSYUJCYHOUJP-UHFFFAOYSA-N [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] Chemical compound [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] YKTSYUJCYHOUJP-UHFFFAOYSA-N 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 239000011149 active material Substances 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 150000004996 alkyl benzenes Chemical class 0.000 description 1
- 125000006177 alkyl benzyl group Chemical group 0.000 description 1
- 150000005215 alkyl ethers Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000002280 amphoteric surfactant Substances 0.000 description 1
- 230000002421 anti-septic effect Effects 0.000 description 1
- 229940064004 antiseptic throat preparations Drugs 0.000 description 1
- 239000002216 antistatic agent Substances 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- ZXVOCOLRQJZVBW-UHFFFAOYSA-N azane;ethanol Chemical compound N.CCO ZXVOCOLRQJZVBW-UHFFFAOYSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- FJXFHUROXYODHL-UHFFFAOYSA-N benzyl-(2,2-dihydroxyethyl)-dodecyl-methylazanium Chemical class CCCCCCCCCCCC[N+](C)(CC(O)O)CC1=CC=CC=C1 FJXFHUROXYODHL-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 229910001424 calcium ion Inorganic materials 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 238000005341 cation exchange Methods 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 229960001231 choline Drugs 0.000 description 1
- 229960004106 citric acid Drugs 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000012459 cleaning agent Substances 0.000 description 1
- 229940096386 coconut alcohol Drugs 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- LWXKHHXHDYZZFK-UHFFFAOYSA-N cyclopenta-3,4-diene-1,1,2,2,3-pentacarboxylic acid Chemical compound OC(=O)C1=C=CC(C(O)=O)(C(O)=O)C1(C(O)=O)C(O)=O LWXKHHXHDYZZFK-UHFFFAOYSA-N 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 239000007857 degradation product Substances 0.000 description 1
- IQDGSYLLQPDQDV-UHFFFAOYSA-N dimethylazanium;chloride Chemical compound Cl.CNC IQDGSYLLQPDQDV-UHFFFAOYSA-N 0.000 description 1
- 238000004851 dishwashing Methods 0.000 description 1
- JMGZBMRVDHKMKB-UHFFFAOYSA-L disodium;2-sulfobutanedioate Chemical compound [Na+].[Na+].OS(=O)(=O)C(C([O-])=O)CC([O-])=O JMGZBMRVDHKMKB-UHFFFAOYSA-L 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- LQZZUXJYWNFBMV-UHFFFAOYSA-N dodecan-1-ol Chemical compound CCCCCCCCCCCCO LQZZUXJYWNFBMV-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 239000003792 electrolyte Substances 0.000 description 1
- 239000003623 enhancer Substances 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000005313 fatty acid group Chemical group 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 235000021588 free fatty acids Nutrition 0.000 description 1
- 229960002598 fumaric acid Drugs 0.000 description 1
- 229940083124 ganglion-blocking antiadrenergic secondary and tertiary amines Drugs 0.000 description 1
- 125000005456 glyceride group Chemical group 0.000 description 1
- 239000008233 hard water Substances 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- HKZVDXUEAWCPIQ-UHFFFAOYSA-N hexane-1,2,3,4,5,6-hexacarboxylic acid Chemical compound OC(=O)CC(C(O)=O)C(C(O)=O)C(C(O)=O)C(C(O)=O)CC(O)=O HKZVDXUEAWCPIQ-UHFFFAOYSA-N 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 1
- 125000001165 hydrophobic group Chemical group 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 239000002563 ionic surfactant Substances 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 230000001050 lubricating effect Effects 0.000 description 1
- 229940098895 maleic acid Drugs 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- MBKDYNNUVRNNRF-UHFFFAOYSA-N medronic acid Chemical class OP(O)(=O)CP(O)(O)=O MBKDYNNUVRNNRF-UHFFFAOYSA-N 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- XJRBAMWJDBPFIM-UHFFFAOYSA-N methyl vinyl ether Chemical compound COC=C XJRBAMWJDBPFIM-UHFFFAOYSA-N 0.000 description 1
- LVHBHZANLOWSRM-UHFFFAOYSA-N methylenebutanedioic acid Natural products OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 description 1
- 239000004200 microcrystalline wax Substances 0.000 description 1
- 235000019808 microcrystalline wax Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- 239000010705 motor oil Substances 0.000 description 1
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- GOQYKNQRPGWPLP-UHFFFAOYSA-N n-heptadecyl alcohol Natural products CCCCCCCCCCCCCCCCCO GOQYKNQRPGWPLP-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical compound OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000013618 particulate matter Substances 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical compound [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 150000003021 phthalic acid derivatives Chemical class 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 229940068041 phytic acid Drugs 0.000 description 1
- 239000000467 phytic acid Substances 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920005646 polycarboxylate Polymers 0.000 description 1
- 229940068917 polyethylene glycols Drugs 0.000 description 1
- 239000001205 polyphosphate Substances 0.000 description 1
- 235000011176 polyphosphates Nutrition 0.000 description 1
- NJKRDXUWFBJCDI-UHFFFAOYSA-N propane-1,1,2,3-tetracarboxylic acid Chemical compound OC(=O)CC(C(O)=O)C(C(O)=O)C(O)=O NJKRDXUWFBJCDI-UHFFFAOYSA-N 0.000 description 1
- NJEVMKZODGWUQT-UHFFFAOYSA-N propane-1,1,3,3-tetracarboxylic acid Chemical compound OC(=O)C(C(O)=O)CC(C(O)=O)C(O)=O NJEVMKZODGWUQT-UHFFFAOYSA-N 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 239000002453 shampoo Substances 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- WXMKPNITSTVMEF-UHFFFAOYSA-M sodium benzoate Chemical compound [Na+].[O-]C(=O)C1=CC=CC=C1 WXMKPNITSTVMEF-UHFFFAOYSA-M 0.000 description 1
- 239000004299 sodium benzoate Substances 0.000 description 1
- 235000010234 sodium benzoate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- 235000019795 sodium metasilicate Nutrition 0.000 description 1
- DZCAZXAJPZCSCU-UHFFFAOYSA-K sodium nitrilotriacetate Chemical compound [Na+].[Na+].[Na+].[O-]C(=O)CN(CC([O-])=O)CC([O-])=O DZCAZXAJPZCSCU-UHFFFAOYSA-K 0.000 description 1
- 229940048842 sodium xylenesulfonate Drugs 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000008247 solid mixture Substances 0.000 description 1
- 239000002195 soluble material Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 150000003440 styrenes Chemical class 0.000 description 1
- 230000001180 sulfating effect Effects 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- HLZKNKRTKFSKGZ-UHFFFAOYSA-N tetradecan-1-ol Chemical compound CCCCCCCCCCCCCCO HLZKNKRTKFSKGZ-UHFFFAOYSA-N 0.000 description 1
- JZBRFIUYUGTUGG-UHFFFAOYSA-J tetrapotassium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate Chemical compound [K+].[K+].[K+].[K+].[O-]C(=O)CN(CC([O-])=O)CCN(CC([O-])=O)CC([O-])=O JZBRFIUYUGTUGG-UHFFFAOYSA-J 0.000 description 1
- KQTIIICEAUMSDG-UHFFFAOYSA-N tricarballylic acid Chemical compound OC(=O)CC(C(O)=O)CC(O)=O KQTIIICEAUMSDG-UHFFFAOYSA-N 0.000 description 1
- SOBHUZYZLFQYFK-UHFFFAOYSA-K trisodium;hydroxy-[[phosphonatomethyl(phosphonomethyl)amino]methyl]phosphinate Chemical compound [Na+].[Na+].[Na+].OP(O)(=O)CN(CP(O)([O-])=O)CP([O-])([O-])=O SOBHUZYZLFQYFK-UHFFFAOYSA-K 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000002888 zwitterionic surfactant Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D1/00—Detergent compositions based essentially on surface-active compounds; Use of these compounds as a detergent
- C11D1/86—Mixtures of anionic, cationic, and non-ionic compounds
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D1/00—Detergent compositions based essentially on surface-active compounds; Use of these compounds as a detergent
- C11D1/38—Cationic compounds
- C11D1/62—Quaternary ammonium compounds
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D1/00—Detergent compositions based essentially on surface-active compounds; Use of these compounds as a detergent
- C11D1/66—Non-ionic compounds
- C11D1/72—Ethers of polyoxyalkylene glycols
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D1/00—Detergent compositions based essentially on surface-active compounds; Use of these compounds as a detergent
- C11D1/02—Anionic compounds
- C11D1/12—Sulfonic acids or sulfuric acid esters; Salts thereof
- C11D1/22—Sulfonic acids or sulfuric acid esters; Salts thereof derived from aromatic compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB4798177 | 1977-11-17 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH644394A5 true CH644394A5 (de) | 1984-07-31 |
Family
ID=10446947
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH338780A CH644394A5 (de) | 1977-11-17 | 1978-11-06 | Koernige wasch- und reinigungsmittelzusammensetzung. |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4347168A (OSRAM) |
| EP (1) | EP0002084A1 (OSRAM) |
| JP (1) | JPS54108814A (OSRAM) |
| AT (1) | AT377283B (OSRAM) |
| BE (1) | BE40T1 (OSRAM) |
| BR (1) | BR7807523A (OSRAM) |
| CA (1) | CA1102202A (OSRAM) |
| CH (1) | CH644394A5 (OSRAM) |
| DE (1) | DE2857300A1 (OSRAM) |
| FR (1) | FR2436179A1 (OSRAM) |
| GB (1) | GB2040990B (OSRAM) |
| IT (1) | IT1109258B (OSRAM) |
| NL (1) | NL7815052A (OSRAM) |
| PH (1) | PH15555A (OSRAM) |
Families Citing this family (59)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH636123A5 (de) * | 1978-06-07 | 1983-05-13 | Ciba Geigy Ag | Verfahren zur herstellung schaumregulierter waschmittel. |
| IT1124027B (it) * | 1979-03-23 | 1986-05-07 | Mira Lanza Spa | Composizione detersiva a basso o nullo tenore di fosforo |
| US4395342A (en) * | 1980-06-06 | 1983-07-26 | The Procter & Gamble Company | Granular fabric softening composition |
| EP0051986B1 (en) * | 1980-11-06 | 1985-05-29 | THE PROCTER & GAMBLE COMPANY | Detergent compositions |
| DE3366958D1 (en) * | 1982-05-24 | 1986-11-20 | Procter & Gamble | Fatty acid containing detergent compositions |
| JPS596299A (ja) * | 1982-07-05 | 1984-01-13 | ライオン株式会社 | 粒状洗剤用添加剤の製造方法 |
| US4891160A (en) * | 1982-12-23 | 1990-01-02 | The Proctor & Gamble Company | Detergent compositions containing ethoxylated amines having clay soil removal/anti-redeposition properties |
| US4597898A (en) * | 1982-12-23 | 1986-07-01 | The Proctor & Gamble Company | Detergent compositions containing ethoxylated amines having clay soil removal/anti-redeposition properties |
| US4537708A (en) * | 1983-08-30 | 1985-08-27 | Fmc Corporation | Homogeneous laundry detergent slurries containing nonionic surface-active agents |
| US4564463A (en) * | 1984-06-15 | 1986-01-14 | Lever Brothers Company | Liquid laundry detergents with improved soil release properties |
| US4622173A (en) * | 1984-12-31 | 1986-11-11 | Colgate-Palmolive Co. | Non-aqueous liquid laundry detergents containing three surfactants including a polycarboxylic acid ester of a non-ionic |
| GB8525269D0 (en) * | 1985-10-14 | 1985-11-20 | Unilever Plc | Detergent composition |
| GB8526998D0 (en) * | 1985-11-01 | 1985-12-04 | Unilever Plc | Detergent powder |
| GB8727659D0 (en) * | 1987-11-26 | 1987-12-31 | Unilever Plc | Machine dishwashing compositions |
| GB8821035D0 (en) * | 1988-09-07 | 1988-10-05 | Unilever Plc | Detergent compositions |
| US5232622A (en) * | 1990-06-20 | 1993-08-03 | Rohm And Haas Company | Chlorine-free machine dishwashing |
| EP0544944A1 (en) * | 1991-12-03 | 1993-06-09 | The Procter & Gamble Company | Rinse-active foam control particles |
| US5591705A (en) * | 1991-12-03 | 1997-01-07 | The Procter & Gamble Company | Rinse-active foam control particles |
| DE4234376A1 (de) * | 1992-10-12 | 1994-04-14 | Henkel Kgaa | Wertstoffe und Wertstoffgemische für Netz-, Wasch- und/oder Reinigungsmittel in neuer Zubereitungsform |
| CA2121792A1 (en) * | 1992-08-27 | 1994-03-17 | Gene D. Rose | An improved cleaning composition which includes a sulfonated alkylated aromatic surfactant and a nonionic surfactant |
| US5898025A (en) * | 1992-09-25 | 1999-04-27 | Henkel Kommanditgesellschaft Auf Aktien | Mildly alkaline dishwashing detergents |
| US5496486A (en) * | 1994-06-30 | 1996-03-05 | Amway Corporation | Process for increasing liquid surfactant loading in free flowing powder detergents |
| DE69424551T3 (de) * | 1994-12-02 | 2005-12-29 | The Procter & Gamble Company, Cincinnati | Kationisches Tensid enthaltende Waschmittelzusammensetzungen sowie deren Herstellung |
| US6034048A (en) * | 1995-03-01 | 2000-03-07 | Charvid Limited Liability Co. | Non-caustic cleaning composition using an alkali salt |
| US5898024A (en) * | 1995-03-01 | 1999-04-27 | Charvid Limited Liability | Non-caustic cleaning composition comprising peroxygen compound and specific silicate, and method of making the same in free-flowing, particulate form |
| US5663132A (en) * | 1995-03-01 | 1997-09-02 | Charvid Limited Liability Company | Non-caustic composition comprising peroxygen compound and metasilicate and cleaning methods for using same |
| US6194367B1 (en) * | 1995-03-01 | 2001-02-27 | Charvid Limited Liability Co. | Non-caustic cleaning composition comprising peroxygen compound and specific silicate and method of making the same in free-flowing, particulate form |
| EP0753571A1 (en) | 1995-07-10 | 1997-01-15 | The Procter & Gamble Company | Process for making granular detergent composition |
| EG22088A (en) † | 1996-04-16 | 2002-07-31 | Procter & Gamble | Alkoxylated sulfates |
| AU729480B2 (en) * | 1996-05-03 | 2001-02-01 | Procter & Gamble Company, The | Laundry detergent compositions comprising cationic surfactants and modified polyamine soil dispersents |
| ZA974226B (en) * | 1996-05-17 | 1998-12-28 | Procter & Gamble | Detergent composition |
| MA25183A1 (fr) * | 1996-05-17 | 2001-07-02 | Arthur Jacques Kami Christiaan | Compositions detergentes |
| GB2313603A (en) * | 1996-05-31 | 1997-12-03 | Procter & Gamble | Detergent compositions |
| US6207632B1 (en) | 1996-05-31 | 2001-03-27 | The Procter & Gamble Company | Detergent composition comprising a cationic surfactant and a hydrophobic peroxyacid bleaching system |
| WO1997048927A1 (en) * | 1996-06-19 | 1997-12-24 | Armor All Products Corporation | Cleaning composition, method and apparatus for cleaning exterior windows |
| GB2323378A (en) * | 1997-03-20 | 1998-09-23 | Procter & Gamble | Detergent compositions |
| GB2323375A (en) * | 1997-03-20 | 1998-09-23 | Procter & Gamble | Detergent compositions |
| GB2323373A (en) * | 1997-03-20 | 1998-09-23 | Procter & Gamble | Detergent compositions |
| GB2323377A (en) * | 1997-03-20 | 1998-09-23 | Procter & Gamble | Detergent compositions |
| EP0934378B1 (en) * | 1996-10-18 | 2003-06-11 | The Procter & Gamble Company | Detergent compositions comprising a mixture of cationic, anionic and nonionic surfactants |
| GB2323379A (en) * | 1997-03-20 | 1998-09-23 | Procter & Gamble | Detergent compositions |
| GB2323376A (en) * | 1997-03-20 | 1998-09-23 | Procter & Gamble | Detergent compositions |
| GB2323370A (en) * | 1997-03-20 | 1998-09-23 | Procter & Gamble | Detergent compositions |
| GB2323381A (en) * | 1997-03-20 | 1998-09-23 | Procter & Gamble | Detergent compositions |
| EP0879876A1 (en) * | 1997-05-21 | 1998-11-25 | The Procter & Gamble Company | Process for preparation of granular detergent composition or component comprising a water-soluble cationic surfactant |
| US6127329A (en) * | 1997-10-02 | 2000-10-03 | The Procter & Gamble Company | Detergent compositions |
| GB2338242A (en) * | 1998-06-10 | 1999-12-15 | Reckitt & Colman Inc | Germicidal laundry detergent |
| US6627596B1 (en) * | 1999-02-01 | 2003-09-30 | The Procter & Gamble Company | Cationic particle and a process for making thereof |
| US6462014B1 (en) * | 2001-04-09 | 2002-10-08 | Akzo Nobel N.V. | Low foaming/defoaming compositions containing alkoxylated quaternary ammonium compounds |
| USD519382S1 (en) * | 2004-02-19 | 2006-04-25 | Saint-Gobain Containers, Inc. | Bottle |
| JP2008523225A (ja) * | 2004-12-17 | 2008-07-03 | ザ プロクター アンド ギャンブル カンパニー | 改良された疎水性汚れ洗浄のための疎水変性ポリオール |
| WO2006066060A1 (en) * | 2004-12-17 | 2006-06-22 | The Procter & Gamble Company | Hydrophilically modified polyols for improved hydrophobic soil cleaning |
| US20070049732A1 (en) * | 2005-09-01 | 2007-03-01 | Zurlo Eugene J | Ultra-high yield intravenous immune globulin preparation |
| DE102005047833A1 (de) * | 2005-10-05 | 2007-04-19 | Basf Ag | Verfahren zur Herstellung von granulären oder pulverförmigen Waschmittelzusammensetzungen |
| WO2010025452A1 (en) * | 2008-08-29 | 2010-03-04 | Micro Pure Solutions, Llc | Method for treating hydrogen sulfide-containing fluids |
| CN106701351A (zh) | 2015-11-12 | 2017-05-24 | 艺康美国股份有限公司 | 低起泡器皿清洗清洁剂,含增强含油污垢除去的混合的阳离子/非离子表面活性剂体系 |
| US10442732B2 (en) | 2016-05-20 | 2019-10-15 | United States Gypsum Company | Gypsum slurries with linear polycarboxylate dispersants |
| EP3707230B1 (en) | 2017-11-07 | 2025-06-18 | Ecolab USA Inc. | Alkaline cleaning composition and methods for removing lipstick |
| US10954475B2 (en) | 2017-12-07 | 2021-03-23 | Ecolab Usa Inc. | Compositions and methods of removing lipstick using branched polyamines |
Family Cites Families (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA818419A (en) | 1969-07-22 | A.E. Staley Manufacturing Company | Fabric softener-detergent composition | |
| NL232749A (OSRAM) * | 1957-10-31 | |||
| GB873214A (en) | 1958-08-20 | 1961-07-19 | British Nylon Spinners Ltd | Non-ionic detergent compositions |
| NL135441C (OSRAM) * | 1961-10-25 | |||
| US3325414A (en) * | 1963-10-01 | 1967-06-13 | Colgate Palmolive Co | Heavy duty detergent composition containing a quaternary ammonium salt |
| US3539520A (en) * | 1967-07-12 | 1970-11-10 | West Laboratories Inc | Compositions comprising quaternary ammonium germicides and nonionic surfactants |
| US3726815A (en) * | 1970-11-16 | 1973-04-10 | Colgate Palmolive Co | Compositions containing amino-polyureylene resin |
| US3729432A (en) * | 1971-08-06 | 1973-04-24 | Milchem Inc | Detergent builder composition |
| US3993573A (en) * | 1973-02-16 | 1976-11-23 | The Procter & Gamble Company | Softening additive and detergent composition |
| DE2433079A1 (de) * | 1973-07-13 | 1975-02-06 | Colgate Palmolive Co | Kombiniertes wasch- und weichmachmittel |
| US3951879A (en) * | 1973-12-14 | 1976-04-20 | Colgate-Palmolive Company | Detergent that reduces electrostatic cling of synthetic fabrics |
| SE415031B (sv) * | 1974-05-20 | 1980-09-01 | Modokemi Ab | Tvettmedel med mjukgorande och/eller antistatisk verkan |
| US4125370A (en) * | 1976-06-24 | 1978-11-14 | The Procter & Gamble Company | Laundry method imparting soil release properties to laundered fabrics |
| JPS5352799A (en) * | 1976-10-19 | 1978-05-13 | Kao Corp | Fabric softening agent composition |
| US4259217A (en) * | 1978-03-07 | 1981-03-31 | The Procter & Gamble Company | Laundry detergent compositions having enhanced greasy and oily soil removal performance |
| US4228044A (en) * | 1978-06-26 | 1980-10-14 | The Procter & Gamble Company | Laundry detergent compositions having enhanced particulate soil removal and antiredeposition performance |
| DE2967237D1 (en) * | 1978-08-10 | 1984-10-31 | Procter & Gamble Europ | Liquid detergent composition containing ternary surfactant system |
-
1978
- 1978-11-06 CH CH338780A patent/CH644394A5/de not_active IP Right Cessation
- 1978-11-06 EP EP78200290A patent/EP0002084A1/en not_active Withdrawn
- 1978-11-06 NL NL7815052A patent/NL7815052A/nl unknown
- 1978-11-06 GB GB8001752A patent/GB2040990B/en not_active Expired
- 1978-11-06 DE DE19782857300 patent/DE2857300A1/de active Granted
- 1978-11-06 BE BEBTR40A patent/BE40T1/xx not_active IP Right Cessation
- 1978-11-16 CA CA316,318A patent/CA1102202A/en not_active Expired
- 1978-11-16 AT AT0818878A patent/AT377283B/de active
- 1978-11-16 BR BR7807523A patent/BR7807523A/pt unknown
- 1978-11-16 IT IT51924/78A patent/IT1109258B/it active
- 1978-11-17 PH PH21819A patent/PH15555A/en unknown
- 1978-11-17 JP JP14212878A patent/JPS54108814A/ja active Pending
-
1979
- 1979-11-02 FR FR7927199A patent/FR2436179A1/fr active Granted
-
1980
- 1980-08-01 US US06/174,486 patent/US4347168A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| BE40T1 (fr) | 1980-01-11 |
| DE2857300C2 (OSRAM) | 1989-01-05 |
| EP0002084A1 (en) | 1979-05-30 |
| ATA818878A (de) | 1984-07-15 |
| JPS54108814A (en) | 1979-08-25 |
| DE2857300A1 (de) | 1980-06-26 |
| FR2436179B1 (OSRAM) | 1984-04-13 |
| AT377283B (de) | 1985-02-25 |
| FR2436179A1 (fr) | 1980-04-11 |
| US4347168A (en) | 1982-08-31 |
| GB2040990A (en) | 1980-09-03 |
| IT7851924A0 (it) | 1978-11-16 |
| NL7815052A (nl) | 1980-01-31 |
| GB2040990B (en) | 1982-10-06 |
| CA1102202A (en) | 1981-06-02 |
| PH15555A (en) | 1983-02-11 |
| IT1109258B (it) | 1985-12-16 |
| BR7807523A (pt) | 1979-07-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH644394A5 (de) | Koernige wasch- und reinigungsmittelzusammensetzung. | |
| EP1148868B1 (de) | Detergensgemische | |
| DE2857163C2 (OSRAM) | ||
| DE68926228T2 (de) | Waschmittelzusammensetzung | |
| DE2548242C3 (de) | Mit Detergentien verträgliche, Gewebe weichmachende und antistatisch ausrüstende Mittel | |
| DE2857161A1 (de) | Wasch- und reinigungsmittel | |
| DE69018676T2 (de) | Flüssige Detergensprodukte. | |
| DE2422655A1 (de) | Waschmittelzusammensetzung | |
| CH672498A5 (OSRAM) | ||
| DE69730654T2 (de) | Zitronensäuremonohydrat enthaltende Persäuregranulate zwecks verbesserter Auflösbarkeit | |
| DE3832589A1 (de) | Waschmittel fuer niedrige temperaturen | |
| DE2857294C2 (OSRAM) | ||
| DE69723677T2 (de) | Pulverformige waschmittelzusammensetzung mit hohem schuttgewicht | |
| DE10303130A1 (de) | Wässrige Flüssigwaschmittel-Dispersionen | |
| CH626396A5 (OSRAM) | ||
| DE2857154A1 (de) | Detergensgemische | |
| DE2646127A1 (de) | Wasch- und reinigungsmittelzusammensetzungen | |
| EP1879990B1 (de) | Wasch- und reinigungsmittel enthaltend alkohol-ethoxylat-propoxylate | |
| DE2816770C2 (de) | Gerüststoffhaltiges Textilwaschmittel | |
| DE2538755A1 (de) | Zeolith-molekularsieb enthaltendes waescheweichmachmittel | |
| EP1217064B1 (de) | Nichtionische Tenside | |
| DE2514675C2 (de) | Waschmittel | |
| DE2645881A1 (de) | Waschmittel und ihre herstellung | |
| AT394376B (de) | Teilchenfoermige waschmittel-weichmacher-zusammen- setzung sowie weichmacher-zusammensetzung | |
| DE2511677C2 (de) | Fett und Öl entfernendes Mittel sowie Waschmittel, die dieses Fett und Öl entfernende Mittel enthalten |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |