CH638493A5 - Verfahren zur herstellung von peroxycarbonsaeuren. - Google Patents
Verfahren zur herstellung von peroxycarbonsaeuren. Download PDFInfo
- Publication number
- CH638493A5 CH638493A5 CH329678A CH329678A CH638493A5 CH 638493 A5 CH638493 A5 CH 638493A5 CH 329678 A CH329678 A CH 329678A CH 329678 A CH329678 A CH 329678A CH 638493 A5 CH638493 A5 CH 638493A5
- Authority
- CH
- Switzerland
- Prior art keywords
- acid
- water
- peroxycarboxylic
- reaction
- solvent
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title description 15
- 150000004653 carbonic acids Chemical class 0.000 title 1
- 238000006243 chemical reaction Methods 0.000 claims description 50
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 48
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 48
- 239000002904 solvent Substances 0.000 claims description 48
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid group Chemical group S(O)(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 42
- 238000000034 method Methods 0.000 claims description 41
- 239000002253 acid Substances 0.000 claims description 35
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 23
- BDJRBEYXGGNYIS-UHFFFAOYSA-N nonanedioic acid Chemical compound OC(=O)CCCCCCCC(O)=O BDJRBEYXGGNYIS-UHFFFAOYSA-N 0.000 claims description 21
- 230000008569 process Effects 0.000 claims description 19
- SCKXCAADGDQQCS-UHFFFAOYSA-N Performic acid Chemical compound OOC=O SCKXCAADGDQQCS-UHFFFAOYSA-N 0.000 claims description 18
- 150000007513 acids Chemical class 0.000 claims description 16
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 claims description 14
- 239000008346 aqueous phase Substances 0.000 claims description 14
- 239000003054 catalyst Substances 0.000 claims description 14
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 12
- 230000002378 acidificating effect Effects 0.000 claims description 8
- 150000001735 carboxylic acids Chemical class 0.000 claims description 8
- 238000010992 reflux Methods 0.000 claims description 8
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical compound OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 claims description 8
- 229940098779 methanesulfonic acid Drugs 0.000 claims description 7
- IPCSVZSSVZVIGE-UHFFFAOYSA-N hexadecanoic acid Chemical compound CCCCCCCCCCCCCCCC(O)=O IPCSVZSSVZVIGE-UHFFFAOYSA-N 0.000 claims description 6
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 claims description 4
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 claims description 4
- 238000007254 oxidation reaction Methods 0.000 claims description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 claims description 4
- 235000021314 Palmitic acid Nutrition 0.000 claims description 3
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical group ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 claims description 3
- WQEPLUUGTLDZJY-UHFFFAOYSA-N n-Pentadecanoic acid Natural products CCCCCCCCCCCCCCC(O)=O WQEPLUUGTLDZJY-UHFFFAOYSA-N 0.000 claims description 3
- 230000003647 oxidation Effects 0.000 claims description 3
- HQHCYKULIHKCEB-UHFFFAOYSA-N tetradecanedioic acid Chemical compound OC(=O)CCCCCCCCCCCCC(O)=O HQHCYKULIHKCEB-UHFFFAOYSA-N 0.000 claims description 3
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical compound OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 claims description 3
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 claims description 2
- WMRCTEPOPAZMMN-UHFFFAOYSA-N 2-undecylpropanedioic acid Chemical compound CCCCCCCCCCCC(C(O)=O)C(O)=O WMRCTEPOPAZMMN-UHFFFAOYSA-N 0.000 claims description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 2
- BOSAWIQFTJIYIS-UHFFFAOYSA-N 1,1,1-trichloro-2,2,2-trifluoroethane Chemical compound FC(F)(F)C(Cl)(Cl)Cl BOSAWIQFTJIYIS-UHFFFAOYSA-N 0.000 claims 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims 1
- 238000000354 decomposition reaction Methods 0.000 claims 1
- 239000011541 reaction mixture Substances 0.000 description 26
- SXLLDUPXUVRMEE-UHFFFAOYSA-N nonanediperoxoic acid Chemical compound OOC(=O)CCCCCCCC(=O)OO SXLLDUPXUVRMEE-UHFFFAOYSA-N 0.000 description 23
- JHUXOSATQXGREM-UHFFFAOYSA-N dodecanediperoxoic acid Chemical compound OOC(=O)CCCCCCCCCCC(=O)OO JHUXOSATQXGREM-UHFFFAOYSA-N 0.000 description 20
- 239000013078 crystal Substances 0.000 description 16
- 230000015572 biosynthetic process Effects 0.000 description 11
- 150000004965 peroxy acids Chemical class 0.000 description 11
- TVIDDXQYHWJXFK-UHFFFAOYSA-N dodecanedioic acid Chemical compound OC(=O)CCCCCCCCCCC(O)=O TVIDDXQYHWJXFK-UHFFFAOYSA-N 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- -1 aliphatic peracids Chemical class 0.000 description 9
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 8
- 239000003377 acid catalyst Substances 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 7
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 239000012071 phase Substances 0.000 description 7
- 150000007524 organic acids Chemical class 0.000 description 6
- 238000013459 approach Methods 0.000 description 5
- 239000010410 layer Substances 0.000 description 5
- 125000003118 aryl group Chemical group 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 230000006872 improvement Effects 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 239000002002 slurry Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- DCQJDRNKCUQEMA-UHFFFAOYSA-N tetradecanediperoxoic acid Chemical compound OOC(=O)CCCCCCCCCCCCC(=O)OO DCQJDRNKCUQEMA-UHFFFAOYSA-N 0.000 description 3
- AJDIZQLSFPQPEY-UHFFFAOYSA-N 1,1,2-Trichlorotrifluoroethane Chemical compound FC(F)(Cl)C(F)(Cl)Cl AJDIZQLSFPQPEY-UHFFFAOYSA-N 0.000 description 2
- LULAYUGMBFYYEX-UHFFFAOYSA-N 3-chlorobenzoic acid Chemical compound OC(=O)C1=CC=CC(Cl)=C1 LULAYUGMBFYYEX-UHFFFAOYSA-N 0.000 description 2
- 239000004809 Teflon Substances 0.000 description 2
- 229920006362 Teflon® Polymers 0.000 description 2
- 238000002441 X-ray diffraction Methods 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- CZPZWMPYEINMCF-UHFFFAOYSA-N propaneperoxoic acid Chemical compound CCC(=O)OO CZPZWMPYEINMCF-UHFFFAOYSA-N 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- LJGHYPLBDBRCRZ-UHFFFAOYSA-N 3-(3-aminophenyl)sulfonylaniline Chemical compound NC1=CC=CC(S(=O)(=O)C=2C=C(N)C=CC=2)=C1 LJGHYPLBDBRCRZ-UHFFFAOYSA-N 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 238000004061 bleaching Methods 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- LBAYFEDWGHXMSM-UHFFFAOYSA-N butaneperoxoic acid Chemical compound CCCC(=O)OO LBAYFEDWGHXMSM-UHFFFAOYSA-N 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- UNWDCFHEVIWFCW-UHFFFAOYSA-N decanediperoxoic acid Chemical compound OOC(=O)CCCCCCCCC(=O)OO UNWDCFHEVIWFCW-UHFFFAOYSA-N 0.000 description 1
- 239000000645 desinfectant Substances 0.000 description 1
- 229960003750 ethyl chloride Drugs 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000004880 explosion Methods 0.000 description 1
- 239000002360 explosive Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 230000002070 germicidal effect Effects 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- QSGDGGWTDYSGCY-UHFFFAOYSA-N hexadecaneperoxoic acid Chemical compound CCCCCCCCCCCCCCCC(=O)OO QSGDGGWTDYSGCY-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 150000002762 monocarboxylic acid derivatives Chemical class 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 150000003022 phthalic acids Chemical class 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- 230000000171 quenching effect Effects 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 150000003330 sebacic acids Chemical class 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C409/00—Peroxy compounds
- C07C409/24—Peroxy compounds the —O—O— group being bound between a >C=O group and hydrogen, i.e. peroxy acids
- C07C409/30—Peroxy compounds the —O—O— group being bound between a >C=O group and hydrogen, i.e. peroxy acids a >C=O group being bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C407/00—Preparation of peroxy compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C407/00—Preparation of peroxy compounds
- C07C407/003—Separation; Purification; Stabilisation; Use of additives
- C07C407/006—Stabilisation; Use of additives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C409/00—Peroxy compounds
- C07C409/24—Peroxy compounds the —O—O— group being bound between a >C=O group and hydrogen, i.e. peroxy acids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/782,204 US4172086A (en) | 1977-03-28 | 1977-03-28 | Process for the manufacture of peroxycarboxylic acids |
| NL7804587A NL7804587A (nl) | 1977-03-28 | 1978-04-28 | Werkwijze voor de bereiding van kristallijne peroxy- carbonzuren. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH638493A5 true CH638493A5 (de) | 1983-09-30 |
Family
ID=26645411
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH329678A CH638493A5 (de) | 1977-03-28 | 1978-03-28 | Verfahren zur herstellung von peroxycarbonsaeuren. |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4172086A (enExample) |
| JP (1) | JPS53119813A (enExample) |
| AT (1) | AT367400B (enExample) |
| AU (1) | AU519166B2 (enExample) |
| BE (1) | BE865205A (enExample) |
| CA (1) | CA1105050A (enExample) |
| CH (1) | CH638493A5 (enExample) |
| DE (1) | DE2812573A1 (enExample) |
| FR (1) | FR2385697A1 (enExample) |
| GB (1) | GB1580614A (enExample) |
| LU (1) | LU79327A1 (enExample) |
| NL (1) | NL7804587A (enExample) |
| SE (1) | SE429859B (enExample) |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2930546A1 (de) * | 1978-10-25 | 1980-05-08 | Degussa | Verfahren zur phlegmatisierung von wasserunloeslichen peroxycarbonsaeuren |
| US4233235A (en) * | 1979-02-26 | 1980-11-11 | The Procter & Gamble Company | Method for making diperoxyacids |
| US4370251A (en) * | 1980-07-25 | 1983-01-25 | Fmc Corporation | Continuous process for the production of peroxycarboxylic acid compositions |
| US4607052A (en) * | 1983-04-15 | 1986-08-19 | Roussel-Uclaf | Triglycerides, dietetic and therapeutical applications and compositions containing them |
| US4701469A (en) * | 1983-04-15 | 1987-10-20 | Roussel Uclaf | Triglycerides, process for therapeutical applications and compositions containing them |
| DE3320497A1 (de) * | 1983-06-07 | 1984-12-13 | Degussa Ag, 6000 Frankfurt | Verfahren zur herstellung von wasserunloeslichen peroxycarbonsaeuren |
| US4659519A (en) * | 1984-07-02 | 1987-04-21 | The Clorox Company | Process for synthesizing alkyl monoperoxysuccinic acid bleaching compositions |
| US4655781A (en) * | 1984-07-02 | 1987-04-07 | The Clorox Company | Stable bleaching compositions |
| US4680145A (en) * | 1984-09-04 | 1987-07-14 | Monsanto Company | Process for producing diperoxoic acids |
| ES2015044B3 (es) * | 1986-05-28 | 1990-08-01 | Akzo Nv | Proceso para la preparacion de aglomerados que contienen acido diperoxido-decanodioico y su uso en composiciones de blanqueo. |
| DE3628263A1 (de) * | 1986-08-25 | 1988-03-03 | Degussa | Verfahren zur phlegmatisierung von wasserunloeslichen peroxycarbonsaeuren |
| US4735740A (en) * | 1986-10-03 | 1988-04-05 | The Clorox Company | Diperoxyacid precursors and method |
| DE3822798A1 (de) * | 1988-07-06 | 1990-01-11 | Huels Chemische Werke Ag | Verfahren zur herstellung von phlegmatisierten aliphatischen diperoxidicarbonsaeuren |
| IT1245308B (it) | 1990-12-13 | 1994-09-19 | Ausimont Spa | Processo per la produzione di un acido aril-immido-per-alcanoico |
| GB9027975D0 (en) * | 1990-12-22 | 1991-02-13 | Interox Chemicals Ltd | Peroxycarboxylic acid |
| IT1254619B (it) * | 1992-02-21 | 1995-09-28 | Ausimont Spa | Procedimento per la purificazione di acido ftalimmido-perossicaproico (pap) da impurezze di solventi clorurati |
| IT1254240B (it) * | 1992-03-10 | 1995-09-14 | Ausimont Spa | Procedimento per la separazione dell'acido ftalimmido perossicaproico da soluzioni di solventi organici |
| US5487818A (en) * | 1992-03-10 | 1996-01-30 | Ausimont S.P.A. | Process for separating phthalimido-peroxycaproic acid from solutions in organic solvents |
| US5380928A (en) * | 1993-08-18 | 1995-01-10 | Synergistics Industries, Inc. | Two step oxidation process for the production of carboxylic acids such as azelaic acid from unsaturated substrates |
| US6010729A (en) | 1998-08-20 | 2000-01-04 | Ecolab Inc. | Treatment of animal carcasses |
| US20110274766A1 (en) | 2010-05-05 | 2011-11-10 | Allen Randall R | Synergy of Strong Acids and Peroxy Compounds |
| US9573893B2 (en) * | 2012-11-08 | 2017-02-21 | Evonik Degussa Gmbh | Method for producing equilibrium peracetic acid and equilibrium peracetic acid obtainable by the method |
| CN111039776A (zh) * | 2019-12-31 | 2020-04-21 | 淄博广通化工有限责任公司 | 高纯度的混合长碳链二元羧酸及其制备方法 |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2377038A (en) * | 1941-09-15 | 1945-05-29 | Du Pont | Manufacture of peracids |
| US2813896A (en) * | 1952-12-12 | 1957-11-19 | Bayer Ag | Process for preparing organic peracids |
| US2813885A (en) * | 1954-09-02 | 1957-11-19 | Swern Daniel | Process for making fatty peracids |
| GB803159A (en) * | 1956-07-31 | 1958-10-22 | Union Carbide Corp | Process for producing peracids from aliphatic carboxylic acids |
| US2814641A (en) * | 1956-07-31 | 1957-11-26 | Union Carbide Corp | Process for producing peracids from aliphatic carboxylic acids |
| US2877266A (en) * | 1957-06-04 | 1959-03-10 | Columbia Southern Chem Corp | Preparation of peracids |
| FR1317328A (fr) * | 1961-12-28 | 1963-02-08 | Air Liquide | Procédé de fabrication et de purification de peracides organiques |
| FR1390068A (fr) * | 1963-07-05 | 1965-02-19 | Pittsburgh Plate Glass Co | Procédé perfectionné de préparation d'acides percarboxyliques |
| US3284491A (en) * | 1963-07-05 | 1966-11-08 | Pittsburgh Plate Glass Co | Preparation of a peracid in a single liquid phase |
| US3367951A (en) * | 1964-04-10 | 1968-02-06 | U S Peroxygen Corp | Process for purifying solid peroxides |
| US3494898A (en) * | 1969-04-10 | 1970-02-10 | Heinz W Meyer | Polymerization of olefinic compounds and polymerization catalyst |
| DE2038318C3 (de) * | 1970-08-01 | 1978-08-17 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von Percarbonsänrelösungen oder Percarbonsäuren |
| DE2125160C3 (de) * | 1971-05-21 | 1980-05-22 | Deutsche Gold- Und Silber-Scheideanstalt Vormals Roessler, 6000 Frankfurt | Verfahren zur Herstellung von aliphatischen Percarbonsäuren mit 2 bis 5 Kohlenstoffatomen |
| GB1535313A (en) * | 1975-02-04 | 1978-12-13 | Interox Chemicals Ltd | Production of peracids and of epoxides |
| DE2519295C3 (de) * | 1975-04-30 | 1979-02-15 | Bayer Ag, 5090 Leverkusen | Verfahren zur kontinuierlichen Herstellung von organischen Lösungen von 1 bis 4 Kohlenstoffatome enthaltenden Percarbonsäuren |
| US4085133A (en) * | 1976-11-24 | 1978-04-18 | Ppg Industries, Inc. | Preparation of monoperoxyphthalic acid |
-
1977
- 1977-03-28 US US05/782,204 patent/US4172086A/en not_active Expired - Lifetime
-
1978
- 1978-03-08 CA CA298,467A patent/CA1105050A/en not_active Expired
- 1978-03-22 DE DE19782812573 patent/DE2812573A1/de active Granted
- 1978-03-22 BE BE186196A patent/BE865205A/xx not_active IP Right Cessation
- 1978-03-23 FR FR7808499A patent/FR2385697A1/fr active Granted
- 1978-03-23 GB GB11556/78A patent/GB1580614A/en not_active Expired
- 1978-03-23 AU AU34467/78A patent/AU519166B2/en not_active Expired
- 1978-03-23 AT AT0208678A patent/AT367400B/de not_active IP Right Cessation
- 1978-03-28 CH CH329678A patent/CH638493A5/de not_active IP Right Cessation
- 1978-03-28 SE SE7803503A patent/SE429859B/sv not_active IP Right Cessation
- 1978-03-28 JP JP3491678A patent/JPS53119813A/ja active Pending
- 1978-03-28 LU LU79327A patent/LU79327A1/xx unknown
- 1978-04-28 NL NL7804587A patent/NL7804587A/xx not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| BE865205A (fr) | 1978-09-22 |
| JPS53119813A (en) | 1978-10-19 |
| AU3446778A (en) | 1979-09-27 |
| SE7803503L (sv) | 1978-09-29 |
| AT367400B (de) | 1982-06-25 |
| DE2812573C2 (enExample) | 1988-11-03 |
| US4172086A (en) | 1979-10-23 |
| AU519166B2 (en) | 1981-11-12 |
| SE429859B (sv) | 1983-10-03 |
| FR2385697A1 (fr) | 1978-10-27 |
| GB1580614A (en) | 1980-12-03 |
| CA1105050A (en) | 1981-07-14 |
| ATA208678A (de) | 1981-11-15 |
| LU79327A1 (fr) | 1978-11-03 |
| DE2812573A1 (de) | 1978-10-05 |
| FR2385697B1 (enExample) | 1983-07-29 |
| NL7804587A (nl) | 1979-10-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH638493A5 (de) | Verfahren zur herstellung von peroxycarbonsaeuren. | |
| DE4003309A1 (de) | Verfahren zur kontinuierlichen herstellung von imidoperoxicarbonsaeuren | |
| DE3834239C2 (de) | Verfahren zur Herstellung von p-Benzochinon | |
| DE2504235B2 (de) | Verfahren zur Herstellung von Alkylsulfonsäuren | |
| US4294776A (en) | Process for the purification of organic solutions of percarboxylic acids | |
| DE2601681A1 (de) | Verfahren zur herstellung von 4,4'- isopropyliden-bis(2,6-dibromphenol) | |
| DE2756169C2 (de) | Verfahren zur Herstellung von Perfluorcarbonsäuren oder Perfluoralkansulfonylchloriden | |
| US4147720A (en) | Process for preparing aliphatic diperoxydicarboxylic acids | |
| DE3211305A1 (de) | Verfahren zur herstellung von 2,2-dicyclohexenylpropandiepoxid | |
| US3231605A (en) | Method for distilling and recovering organic peroxy acids | |
| EP0023545B1 (de) | Verfahren zur Herstellung aromatischer Peroxycarbonsäuren | |
| DE2916572A1 (de) | Verfahren zur destillativen trennung von tert.-alkylhydroperoxiden und di- tert.-alkylperoxiden | |
| DE1129471B (de) | Verfahren zur Herstellung von 3, 5-Dinitro-o-toluylsaeure | |
| EP0008112B1 (de) | Verfahren zur Herstellung von Glycidylestern aromatischer Polycarbonsäuren | |
| DE2141156A1 (de) | Verfahren zur herstellung organischer percarbonsaeureloesungen | |
| DE1155113B (de) | Verfahren zur Herstellung von Peroxybenzolcarbonsaeuren | |
| DE3101459A1 (de) | Verfahren zur herstellung neuer peroxyester und neue peroxyester | |
| DE2603269B2 (de) | Verfahren zur Herstellung von Cyclohexanon und methylsubstituiertem oder unsubstituiertem Phenol | |
| DE2125160C3 (de) | Verfahren zur Herstellung von aliphatischen Percarbonsäuren mit 2 bis 5 Kohlenstoffatomen | |
| DE3320496A1 (de) | Verfahren zum phlegmatisieren von wasserunloeslichen peroxycarbonsaeuren | |
| AT214644B (de) | Verfahren zur Polymerisation organischer, ungesättigter Verbindungen | |
| AT232981B (de) | Verfahren zur Herstellung von aliphatischen oder aromatischen Diacylperoxyden | |
| DE2262970C3 (de) | Verfahren zur Herstellung von Percarbonsäurelösungen in organischen Lösungsmitteln | |
| DE2257084C3 (de) | Verfahren zur Herstellung von 1,1, 2-Triacetoxyäthan | |
| AT212328B (de) | Verfahren zur Herstellung von neuen Harnstoff-Inklusionsverbindungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |