CH635583A5 - Verfahren zur herstellung von gegebenenfalls substituierten thioxanthonen. - Google Patents
Verfahren zur herstellung von gegebenenfalls substituierten thioxanthonen. Download PDFInfo
- Publication number
- CH635583A5 CH635583A5 CH377378A CH377378A CH635583A5 CH 635583 A5 CH635583 A5 CH 635583A5 CH 377378 A CH377378 A CH 377378A CH 377378 A CH377378 A CH 377378A CH 635583 A5 CH635583 A5 CH 635583A5
- Authority
- CH
- Switzerland
- Prior art keywords
- compounds
- formula
- compound
- alkyl
- independently
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 35
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 12
- 229910052717 sulfur Inorganic materials 0.000 claims description 12
- 239000011593 sulfur Substances 0.000 claims description 12
- 229910052736 halogen Inorganic materials 0.000 claims description 11
- 150000002367 halogens Chemical class 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 10
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- 150000002431 hydrogen Chemical class 0.000 claims description 3
- 239000000203 mixture Substances 0.000 description 19
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 11
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 8
- 241000251730 Chondrichthyes Species 0.000 description 7
- 125000004432 carbon atom Chemical group C* 0.000 description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 6
- 239000000178 monomer Substances 0.000 description 6
- -1 alkoxy alcohols Chemical class 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 3
- ZCDADJXRUCOCJE-UHFFFAOYSA-N 2-chlorothioxanthen-9-one Chemical compound C1=CC=C2C(=O)C3=CC(Cl)=CC=C3SC2=C1 ZCDADJXRUCOCJE-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 238000004132 cross linking Methods 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 239000000976 ink Substances 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 description 3
- 229920000570 polyether Polymers 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- YRHRIQCWCFGUEQ-UHFFFAOYSA-N thioxanthen-9-one Chemical class C1=CC=C2C(=O)C3=CC=CC=C3SC2=C1 YRHRIQCWCFGUEQ-UHFFFAOYSA-N 0.000 description 3
- MKLXVYRSKJSNGW-UHFFFAOYSA-N (2-chlorophenyl)-(2,5-dichlorophenyl)methanone Chemical compound ClC1=CC=C(Cl)C(C(=O)C=2C(=CC=CC=2)Cl)=C1 MKLXVYRSKJSNGW-UHFFFAOYSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 150000001341 alkaline earth metal compounds Chemical class 0.000 description 2
- UCMIRNVEIXFBKS-UHFFFAOYSA-N beta-alanine Chemical class NCCC(O)=O UCMIRNVEIXFBKS-UHFFFAOYSA-N 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 235000021388 linseed oil Nutrition 0.000 description 2
- 239000000944 linseed oil Substances 0.000 description 2
- 229920000728 polyester Polymers 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- MYWOJODOMFBVCB-UHFFFAOYSA-N 1,2,6-trimethylphenanthrene Chemical compound CC1=CC=C2C3=CC(C)=CC=C3C=CC2=C1C MYWOJODOMFBVCB-UHFFFAOYSA-N 0.000 description 1
- YNSNJGRCQCDRDM-UHFFFAOYSA-N 1-chlorothioxanthen-9-one Chemical compound S1C2=CC=CC=C2C(=O)C2=C1C=CC=C2Cl YNSNJGRCQCDRDM-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- SBASXUCJHJRPEV-UHFFFAOYSA-N 2-(2-methoxyethoxy)ethanol Chemical compound COCCOCCO SBASXUCJHJRPEV-UHFFFAOYSA-N 0.000 description 1
- IWSZDQRGNFLMJS-UHFFFAOYSA-N 2-(dibutylamino)ethanol Chemical compound CCCCN(CCO)CCCC IWSZDQRGNFLMJS-UHFFFAOYSA-N 0.000 description 1
- QCDWFXQBSFUVSP-UHFFFAOYSA-N 2-phenoxyethanol Chemical compound OCCOC1=CC=CC=C1 QCDWFXQBSFUVSP-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- 239000004641 Diallyl-phthalate Substances 0.000 description 1
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical group CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 1
- 239000012965 benzophenone Substances 0.000 description 1
- JQRRFDWXQOQICD-UHFFFAOYSA-N biphenylen-1-ylboronic acid Chemical compound C12=CC=CC=C2C2=C1C=CC=C2B(O)O JQRRFDWXQOQICD-UHFFFAOYSA-N 0.000 description 1
- DRDRZHJTTDSOPK-UHFFFAOYSA-N bis(2-chlorophenyl)methanone Chemical compound ClC1=CC=CC=C1C(=O)C1=CC=CC=C1Cl DRDRZHJTTDSOPK-UHFFFAOYSA-N 0.000 description 1
- ZPOLOEWJWXZUSP-WAYWQWQTSA-N bis(prop-2-enyl) (z)-but-2-enedioate Chemical compound C=CCOC(=O)\C=C/C(=O)OCC=C ZPOLOEWJWXZUSP-WAYWQWQTSA-N 0.000 description 1
- QUDWYFHPNIMBFC-UHFFFAOYSA-N bis(prop-2-enyl) benzene-1,2-dicarboxylate Chemical compound C=CCOC(=O)C1=CC=CC=C1C(=O)OCC=C QUDWYFHPNIMBFC-UHFFFAOYSA-N 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229940045348 brown mixture Drugs 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- XXJWXESWEXIICW-UHFFFAOYSA-N diethylene glycol monoethyl ether Chemical compound CCOCCOCCO XXJWXESWEXIICW-UHFFFAOYSA-N 0.000 description 1
- 229940075557 diethylene glycol monoethyl ether Drugs 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000003822 epoxy resin Chemical class 0.000 description 1
- BLCTWBJQROOONQ-UHFFFAOYSA-N ethenyl prop-2-enoate Chemical compound C=COC(=O)C=C BLCTWBJQROOONQ-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical class C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 125000005397 methacrylic acid ester group Chemical group 0.000 description 1
- SLCVBVWXLSEKPL-UHFFFAOYSA-N neopentyl glycol Chemical compound OCC(C)(C)CO SLCVBVWXLSEKPL-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 239000012454 non-polar solvent Substances 0.000 description 1
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 1
- 229960005323 phenoxyethanol Drugs 0.000 description 1
- 230000002165 photosensitisation Effects 0.000 description 1
- 239000003504 photosensitizing agent Substances 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920000647 polyepoxide Chemical class 0.000 description 1
- 229920000151 polyglycol Polymers 0.000 description 1
- 239000010695 polyglycol Substances 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 230000000379 polymerizing effect Effects 0.000 description 1
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 1
- 150000003112 potassium compounds Chemical class 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 235000021122 unsaturated fatty acids Nutrition 0.000 description 1
- 150000004670 unsaturated fatty acids Chemical class 0.000 description 1
- 150000003673 urethanes Chemical class 0.000 description 1
- 150000007934 α,β-unsaturated carboxylic acids Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D335/00—Heterocyclic compounds containing six-membered rings having one sulfur atom as the only ring hetero atom
- C07D335/04—Heterocyclic compounds containing six-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D335/10—Dibenzothiopyrans; Hydrogenated dibenzothiopyrans
- C07D335/12—Thioxanthenes
- C07D335/14—Thioxanthenes with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 9
- C07D335/16—Oxygen atoms, e.g. thioxanthones
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Plural Heterocyclic Compounds (AREA)
Priority Applications (9)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH377378A CH635583A5 (de) | 1978-04-07 | 1978-04-07 | Verfahren zur herstellung von gegebenenfalls substituierten thioxanthonen. |
| IT4850879A IT1115089B (it) | 1978-04-07 | 1979-03-27 | Perfezionamento al procedimento per la preparazione di tioxantoni |
| DE19792912197 DE2912197A1 (de) | 1978-04-07 | 1979-03-28 | Verfahren zur herstellung von thioxanthonen |
| GB7911402A GB2018243B (en) | 1978-04-07 | 1979-04-02 | Process for the production of thioxanthones |
| NL7902588A NL7902588A (nl) | 1978-04-07 | 1979-04-03 | Werkwijze voor het bereiden van thioxanthonen. |
| FR7908377A FR2421898B2 (fr) | 1978-04-07 | 1979-04-03 | Procede de preparation de thioxanthones |
| JP4042179A JPS54148791A (en) | 1978-04-07 | 1979-04-05 | Manufacture of thioxanthones |
| BE0/194437A BE875359R (fr) | 1978-04-07 | 1979-04-05 | Procede de preparation de thioxanthones eventuellement substituees |
| ES479408A ES479408A1 (es) | 1978-04-07 | 1979-04-06 | Un procedimiento para la produccion de una tioxantona. |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH377378A CH635583A5 (de) | 1978-04-07 | 1978-04-07 | Verfahren zur herstellung von gegebenenfalls substituierten thioxanthonen. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH635583A5 true CH635583A5 (de) | 1983-04-15 |
Family
ID=4263176
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH377378A CH635583A5 (de) | 1978-04-07 | 1978-04-07 | Verfahren zur herstellung von gegebenenfalls substituierten thioxanthonen. |
Country Status (8)
| Country | Link |
|---|---|
| JP (1) | JPS54148791A (enrdf_load_stackoverflow) |
| BE (1) | BE875359R (enrdf_load_stackoverflow) |
| CH (1) | CH635583A5 (enrdf_load_stackoverflow) |
| DE (1) | DE2912197A1 (enrdf_load_stackoverflow) |
| ES (1) | ES479408A1 (enrdf_load_stackoverflow) |
| FR (1) | FR2421898B2 (enrdf_load_stackoverflow) |
| GB (1) | GB2018243B (enrdf_load_stackoverflow) |
| NL (1) | NL7902588A (enrdf_load_stackoverflow) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH644362A5 (de) | 1980-05-06 | 1984-07-31 | Ciba Geigy Ag | 3,5-disubstituierte phthalsaeureimide. |
| IT1200085B (it) * | 1984-07-12 | 1989-01-05 | Sandoz Ag | Procedimento per la preparazione di xantoni e di tioxantoni |
| CN102863422B (zh) * | 2012-09-07 | 2014-06-11 | 浙江工业大学 | 一种2-异丙基硫杂蒽酮的制备方法 |
| CN108218831B (zh) * | 2018-04-17 | 2020-07-07 | 吉林大学 | 具有室温磷光性质的噻吨酮化合物晶体及其制备方法和用途 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3767674A (en) * | 1971-10-01 | 1973-10-23 | Ostra Lakemedel Ab | Cyclohexeno thioxanthones |
| CH628343A5 (en) * | 1977-03-24 | 1982-02-26 | Sandoz Ag | Process for preparing thioxanthones |
-
1978
- 1978-04-07 CH CH377378A patent/CH635583A5/de not_active IP Right Cessation
-
1979
- 1979-03-28 DE DE19792912197 patent/DE2912197A1/de active Granted
- 1979-04-02 GB GB7911402A patent/GB2018243B/en not_active Expired
- 1979-04-03 FR FR7908377A patent/FR2421898B2/fr not_active Expired
- 1979-04-03 NL NL7902588A patent/NL7902588A/xx not_active Application Discontinuation
- 1979-04-05 BE BE0/194437A patent/BE875359R/xx active
- 1979-04-05 JP JP4042179A patent/JPS54148791A/ja active Granted
- 1979-04-06 ES ES479408A patent/ES479408A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| JPS54148791A (en) | 1979-11-21 |
| JPH0134993B2 (enrdf_load_stackoverflow) | 1989-07-21 |
| ES479408A1 (es) | 1979-12-01 |
| GB2018243A (en) | 1979-10-17 |
| DE2912197C2 (enrdf_load_stackoverflow) | 1988-12-29 |
| BE875359R (fr) | 1979-10-05 |
| NL7902588A (nl) | 1979-10-09 |
| FR2421898A2 (fr) | 1979-11-02 |
| FR2421898B2 (fr) | 1987-12-24 |
| GB2018243B (en) | 1982-10-20 |
| DE2912197A1 (de) | 1979-10-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0216884B1 (de) | Fotoinitiatoren für die fotopolymerisation von ungesättigten systemen | |
| DE19964382B4 (de) | Verwendung einer Beschichtungszusammensetzung zur Herstellung einer nicht reflektierenden Beschichtung und Verfahren zur Herstellung der Beschichtungszusammensetzung | |
| EP0141110B1 (de) | Photopolymerisierbare Mischungen, enthaltend tertiäre Amine als Photaktivatoren | |
| EP0281941B1 (de) | Coreaktive Fotoinitiatoren | |
| DE3782750T2 (de) | Instante klebstoffzusammensetzung mit calixarenen mit gemischter funktionalitaet als beschleuniger. | |
| EP0033720A1 (de) | Thioxanthoncarbonsäureester, -thioester und -amide, deren Verwendung als Sensibilisatoren oder Photoinitiatoren und Polymere | |
| CH640849A5 (de) | Thioxanthoncarbonsaeureester, -thioester und -amide. | |
| EP0354458A2 (de) | Fotoinitiatoren kombinierter Struktur | |
| DE2346424A1 (de) | Strahlungshaertbare, nicht gelierte michael-additionsprodukte | |
| EP0073413A2 (de) | Acylphosphinoxidverbindungen und ihre Verwendung | |
| DE3534645A1 (de) | Copolymerisierbare fotoinitiatoren | |
| EP0755949B1 (de) | Strahlungshärtbare Massen mit kovalent gebundenen Photoinitiatoren | |
| DE2811755A1 (de) | Verfahren zur herstellung von gegebenenfalls substituierten thioxanthonen | |
| DE112018007592T5 (de) | Makromolekularer polyacrylat-photoinitiator, syntheseverfahren dafür und verwendung davon | |
| DE69911050T2 (de) | Für die photopolymerisation geeignete bifunktionelle photoinitiatoren und diese enthaltende photopolymerisierbare systeme | |
| DE112020002202T5 (de) | Neuartige Diaroylcarbazolverbindung und Verwendung derselben als Sensibilisierungsmittel | |
| EP0080975B1 (de) | Lichtempfindliche Polymere | |
| DE3117568A1 (de) | "thioxanthoncarbonsaeuren und thioxanthoncarbonsaeurederivate" | |
| DE10063263A1 (de) | Organisches nicht reflektierendes Beschichtungspolymer und dessen Herstellungsverfahren | |
| EP0894798B1 (de) | Polymerisierbare Diketopyrrolopyrrole | |
| DE602004008602T2 (de) | Neue strahlenhärtbare Zusammensetzungen | |
| CH635583A5 (de) | Verfahren zur herstellung von gegebenenfalls substituierten thioxanthonen. | |
| DE2550572A1 (de) | Verfahren zur herstellung fluessiger harzmassen | |
| DE4014489A1 (de) | Copolymerisierbare benzilketal-fotoinitiatoren | |
| DE3632615C2 (de) | Wäßrige Beschichtungsmasse, die als Harzträger eine Harzzusammensetzung auf Basis einer wäßrigen Dispersion und ein wasserlösliches Harz enthält |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |