CH634035A5 - Derivatives of cyclopropane and processes for preparing them - Google Patents
Derivatives of cyclopropane and processes for preparing them Download PDFInfo
- Publication number
- CH634035A5 CH634035A5 CH75178A CH75178A CH634035A5 CH 634035 A5 CH634035 A5 CH 634035A5 CH 75178 A CH75178 A CH 75178A CH 75178 A CH75178 A CH 75178A CH 634035 A5 CH634035 A5 CH 634035A5
- Authority
- CH
- Switzerland
- Prior art keywords
- acid
- zinc
- formula
- compounds
- ppm
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 15
- 125000001559 cyclopropyl group Chemical class [H]C1([H])C([H])([H])C1([H])* 0.000 title 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 53
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 44
- 239000011701 zinc Substances 0.000 claims description 31
- 229910052725 zinc Inorganic materials 0.000 claims description 31
- 239000002253 acid Substances 0.000 claims description 28
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 19
- 150000001875 compounds Chemical class 0.000 claims description 17
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 15
- 150000002148 esters Chemical class 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- 125000005907 alkyl ester group Chemical group 0.000 claims description 9
- 150000003863 ammonium salts Chemical class 0.000 claims description 8
- 125000005843 halogen group Chemical group 0.000 claims description 8
- 229910052740 iodine Inorganic materials 0.000 claims description 8
- 150000003839 salts Chemical class 0.000 claims description 8
- 150000008064 anhydrides Chemical class 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- 150000003857 carboxamides Chemical class 0.000 claims description 7
- 239000003795 chemical substances by application Substances 0.000 claims description 7
- 229910052801 chlorine Inorganic materials 0.000 claims description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 7
- 239000000460 chlorine Substances 0.000 claims description 5
- YMGUBTXCNDTFJI-UHFFFAOYSA-N cyclopropanecarboxylic acid Chemical compound OC(=O)C1CC1 YMGUBTXCNDTFJI-UHFFFAOYSA-N 0.000 claims description 5
- 125000002947 alkylene group Chemical group 0.000 claims description 4
- 238000005695 dehalogenation reaction Methods 0.000 claims description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- 150000007513 acids Chemical class 0.000 claims description 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 3
- 125000001183 hydrocarbyl group Chemical group 0.000 claims description 2
- 235000019260 propionic acid Nutrition 0.000 claims description 2
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 claims description 2
- KXCAEQNNTZANTK-UHFFFAOYSA-N stannane Chemical compound [SnH4] KXCAEQNNTZANTK-UHFFFAOYSA-N 0.000 claims description 2
- 229910000083 tin tetrahydride Inorganic materials 0.000 claims description 2
- 229960000583 acetic acid Drugs 0.000 claims 2
- 239000003513 alkali Substances 0.000 claims 1
- 239000012362 glacial acetic acid Substances 0.000 claims 1
- 229910052736 halogen Inorganic materials 0.000 claims 1
- 150000002367 halogens Chemical class 0.000 claims 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 16
- 238000006243 chemical reaction Methods 0.000 description 13
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- YUBCVMNXGPVXID-UHFFFAOYSA-N 2,2-dichloro-3,3-dimethylcyclopropane-1-carboxylic acid Chemical compound CC1(C)C(C(O)=O)C1(Cl)Cl YUBCVMNXGPVXID-UHFFFAOYSA-N 0.000 description 11
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- 235000019270 ammonium chloride Nutrition 0.000 description 8
- 238000010992 reflux Methods 0.000 description 8
- GHXJAGHRKSJMPQ-UHFFFAOYSA-N 3-chloro-2,2-dimethylcyclopropane-1-carboxylic acid Chemical compound CC1(C)C(Cl)C1C(O)=O GHXJAGHRKSJMPQ-UHFFFAOYSA-N 0.000 description 6
- 101000716807 Arabidopsis thaliana Protein SCO1 homolog 1, mitochondrial Proteins 0.000 description 6
- 101001076715 Homo sapiens RNA-binding protein 39 Proteins 0.000 description 6
- 102100023361 SAP domain-containing ribonucleoprotein Human genes 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 238000006298 dechlorination reaction Methods 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 4
- 230000035484 reaction time Effects 0.000 description 4
- 230000009102 absorption Effects 0.000 description 3
- 238000010521 absorption reaction Methods 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- 150000001942 cyclopropanes Chemical class 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- LNEFGAYKTMMXDW-UHFFFAOYSA-N tert-butyl 2,2-dichloro-3,3-dimethylcyclopropane-1-carboxylate Chemical compound CC(C)(C)OC(=O)C1C(C)(C)C1(Cl)Cl LNEFGAYKTMMXDW-UHFFFAOYSA-N 0.000 description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical class [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- YMGUBTXCNDTFJI-UHFFFAOYSA-M cyclopropanecarboxylate Chemical compound [O-]C(=O)C1CC1 YMGUBTXCNDTFJI-UHFFFAOYSA-M 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- ZJAJKMDQAODLNY-UHFFFAOYSA-N methyl 2,2-dichloro-3,3-dimethylcyclopropane-1-carboxylate Chemical compound COC(=O)C1C(C)(C)C1(Cl)Cl ZJAJKMDQAODLNY-UHFFFAOYSA-N 0.000 description 2
- VPQWGHHXCIHSCW-UHFFFAOYSA-N methyl 3-chloro-2,2-dimethylcyclopropane-1-carboxylate Chemical compound COC(=O)C1C(Cl)C1(C)C VPQWGHHXCIHSCW-UHFFFAOYSA-N 0.000 description 2
- 150000004702 methyl esters Chemical class 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- QCRGTFXKYABKHU-UHFFFAOYSA-N tert-butyl 3-chloro-2,2-dimethylcyclopropane-1-carboxylate Chemical compound ClC1C(C1C(=O)OC(C)(C)C)(C)C QCRGTFXKYABKHU-UHFFFAOYSA-N 0.000 description 2
- DBGVGMSCBYYSLD-UHFFFAOYSA-N tributylstannane Chemical compound CCCC[SnH](CCCC)CCCC DBGVGMSCBYYSLD-UHFFFAOYSA-N 0.000 description 2
- HTSGKJQDMSTCGS-UHFFFAOYSA-N 1,4-bis(4-chlorophenyl)-2-(4-methylphenyl)sulfonylbutane-1,4-dione Chemical compound C1=CC(C)=CC=C1S(=O)(=O)C(C(=O)C=1C=CC(Cl)=CC=1)CC(=O)C1=CC=C(Cl)C=C1 HTSGKJQDMSTCGS-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- LVZWSLJZHVFIQJ-UHFFFAOYSA-N Cyclopropane Chemical compound C1CC1 LVZWSLJZHVFIQJ-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 1
- ZLIUAIJHSXKIDP-UHFFFAOYSA-N acetic acid;zinc Chemical compound [Zn].[Zn].CC(O)=O ZLIUAIJHSXKIDP-UHFFFAOYSA-N 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- VEMKTZHHVJILDY-UXHICEINSA-N bioresmethrin Chemical compound CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)OCC1=COC(CC=2C=CC=CC=2)=C1 VEMKTZHHVJILDY-UXHICEINSA-N 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 229910001873 dinitrogen Inorganic materials 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 238000011010 flushing procedure Methods 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 229910052756 noble gas Inorganic materials 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910000077 silane Inorganic materials 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- -1 tetramethylene silane Chemical compound 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB3164/77A GB1594224A (en) | 1977-01-26 | 1977-01-26 | Preparation of cyclopropane derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH634035A5 true CH634035A5 (en) | 1983-01-14 |
Family
ID=9753142
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH75178A CH634035A5 (en) | 1977-01-26 | 1978-01-24 | Derivatives of cyclopropane and processes for preparing them |
Country Status (11)
| Country | Link |
|---|---|
| JP (1) | JPS5392743A (enExample) |
| BE (1) | BE863272A (enExample) |
| BR (1) | BR7800411A (enExample) |
| CA (1) | CA1121831A (enExample) |
| CH (1) | CH634035A5 (enExample) |
| DE (1) | DE2802967A1 (enExample) |
| FR (1) | FR2378740A1 (enExample) |
| GB (1) | GB1594224A (enExample) |
| IT (1) | IT7819574A0 (enExample) |
| MX (1) | MX4672E (enExample) |
| NL (1) | NL7800811A (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3026093C2 (de) * | 1980-07-10 | 1983-02-10 | Degussa Ag, 6000 Frankfurt | 1-Methyl-2-chlorcyclopropancarbonsäure und deren verzweigte und unverzweigte C↓1↓ bis C↓6↓-Alkylester, sowie Verfahren zu deren Herstellung |
| JP4413864B2 (ja) * | 2003-01-07 | 2010-02-10 | 第一三共株式会社 | 還元的脱ハロゲン化方法 |
-
1977
- 1977-01-26 GB GB3164/77A patent/GB1594224A/en not_active Expired
-
1978
- 1978-01-04 CA CA000294304A patent/CA1121831A/en not_active Expired
- 1978-01-24 FR FR7801895A patent/FR2378740A1/fr active Granted
- 1978-01-24 IT IT7819574A patent/IT7819574A0/it unknown
- 1978-01-24 CH CH75178A patent/CH634035A5/de not_active IP Right Cessation
- 1978-01-24 BE BE184604A patent/BE863272A/xx not_active IP Right Cessation
- 1978-01-24 MX MX678678U patent/MX4672E/es unknown
- 1978-01-24 JP JP588578A patent/JPS5392743A/ja active Pending
- 1978-01-24 DE DE19782802967 patent/DE2802967A1/de not_active Withdrawn
- 1978-01-24 BR BR7800411A patent/BR7800411A/pt unknown
- 1978-01-24 NL NL7800811A patent/NL7800811A/xx not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| GB1594224A (en) | 1981-07-30 |
| JPS5392743A (en) | 1978-08-15 |
| BE863272A (fr) | 1978-07-24 |
| CA1121831A (en) | 1982-04-13 |
| FR2378740A1 (fr) | 1978-08-25 |
| MX4672E (es) | 1982-07-23 |
| BR7800411A (pt) | 1978-08-22 |
| NL7800811A (nl) | 1978-07-28 |
| FR2378740B1 (enExample) | 1981-08-21 |
| IT7819574A0 (it) | 1978-01-24 |
| DE2802967A1 (de) | 1978-07-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2540210C3 (de) | Verfahren zur Herstellung von Organozinntrihalogeniden | |
| DE2539048C2 (enExample) | ||
| DE2212604C3 (de) | Verfahren zur Herstellung von 2-Halogenäthylphosphonsauren | |
| DE2630268C2 (de) | Verfahren zur Herstellung von Methacrylsäure oder niedermolekularen Methacrylsäurealkylestern | |
| DE2616681A1 (de) | Verfahren zur reduktiven dehydrohalogenierung von alpha-halogenalkoholen | |
| CH622759A5 (enExample) | ||
| DE2437882B2 (de) | Verfahren zur herstellung von estern des 3-phenoxybenzylalkohols | |
| CH634035A5 (en) | Derivatives of cyclopropane and processes for preparing them | |
| DE1668516A1 (de) | Bifunktionelle Cyclohexenylverbindungen und deren Herstellung | |
| DE2920591C2 (enExample) | ||
| DE852851C (de) | Verfahren zur Herstellung von Alkylestern ª‡, ª‰-ungesaettigter Monocarbonsaeuren | |
| EP0136566B1 (de) | Verfahren zur Herstellung von 3,4-Dichlorbenzotrihalogeniden | |
| EP0048370B1 (de) | Verfahren zur Herstellung von trans-3-(Z-2-Chlor-2-aryl-vinyl)-2,2-dimethyl-cyclopropan-1-carbon-säure-derivaten, neue Zwischenprodukte hierfür, Verfahren zu deren Herstellung und Verwendung von Zwischenprodukten in Schädlingsbekämpfungsmitteln | |
| DD202427A5 (de) | Verfahren zur herstellung von alpha-halogenalkylamiden | |
| DE2716772A1 (de) | Verfahren zur herstellung von estern von m-phenoxybenzylalkohol und seiner alpha-cyano- und alpha-aethinylderivate mit carbonsaeuren | |
| DE2542377A1 (de) | 1,1,1-trihalogen-4-methyl-3-penten- 2-ole sowie verfahren zu ihrer herstellung | |
| EP0002206A1 (de) | Halogenierte Buttersäurechloride, Verfahren zu deren Herstellung und ihre Verwendung als Zwischenprodukte zur Herstellung von Schädlingsbekämpfungsmitteln | |
| DE3217029A1 (de) | Verfahren zur herstellung von n-(m-halogenphenyl)-(alpha)-aminosaeureestern | |
| DE2442883A1 (de) | Verfahren zur herstellung von carbonsaeurefluoriden | |
| DE3340141C2 (de) | Verfahren zur Herstellung eines Perfluoracrylsäureesters | |
| DE2231438B2 (de) | Verfahren zur Herstellung von 2-Alkyl-2-formyl-1,3-dithiacyclopentanen bzw. 1,3-dithiacyclohexanen | |
| DE69023246T2 (de) | Verfahren zur herstellung von optisch aktiven oder racemischen cyclopropancarbonsäurechloriden. | |
| DE2008115C3 (de) | Verfahren zur Herstellung von Naralkylsubstituierten N-Acylcarbamidsäurehalogeniden | |
| DE1468142C (enExample) | ||
| EP0051791A1 (de) | 2,2-Dimethylcyclobutanone und Verfahren zu ihrer Herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |