JPS5392743A - Cyclopropane derivative and its preparation - Google Patents
Cyclopropane derivative and its preparationInfo
- Publication number
- JPS5392743A JPS5392743A JP588578A JP588578A JPS5392743A JP S5392743 A JPS5392743 A JP S5392743A JP 588578 A JP588578 A JP 588578A JP 588578 A JP588578 A JP 588578A JP S5392743 A JPS5392743 A JP S5392743A
- Authority
- JP
- Japan
- Prior art keywords
- preparation
- cyclopropane derivative
- cyclopropane
- derivative
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 125000001559 cyclopropyl group Chemical class [H]C1([H])C([H])([H])C1([H])* 0.000 title 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB3164/77A GB1594224A (en) | 1977-01-26 | 1977-01-26 | Preparation of cyclopropane derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| JPS5392743A true JPS5392743A (en) | 1978-08-15 |
Family
ID=9753142
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP588578A Pending JPS5392743A (en) | 1977-01-26 | 1978-01-24 | Cyclopropane derivative and its preparation |
Country Status (11)
| Country | Link |
|---|---|
| JP (1) | JPS5392743A (enExample) |
| BE (1) | BE863272A (enExample) |
| BR (1) | BR7800411A (enExample) |
| CA (1) | CA1121831A (enExample) |
| CH (1) | CH634035A5 (enExample) |
| DE (1) | DE2802967A1 (enExample) |
| FR (1) | FR2378740A1 (enExample) |
| GB (1) | GB1594224A (enExample) |
| IT (1) | IT7819574A0 (enExample) |
| MX (1) | MX4672E (enExample) |
| NL (1) | NL7800811A (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3026093C2 (de) * | 1980-07-10 | 1983-02-10 | Degussa Ag, 6000 Frankfurt | 1-Methyl-2-chlorcyclopropancarbonsäure und deren verzweigte und unverzweigte C↓1↓ bis C↓6↓-Alkylester, sowie Verfahren zu deren Herstellung |
| JP4413864B2 (ja) * | 2003-01-07 | 2010-02-10 | 第一三共株式会社 | 還元的脱ハロゲン化方法 |
-
1977
- 1977-01-26 GB GB3164/77A patent/GB1594224A/en not_active Expired
-
1978
- 1978-01-04 CA CA000294304A patent/CA1121831A/en not_active Expired
- 1978-01-24 FR FR7801895A patent/FR2378740A1/fr active Granted
- 1978-01-24 IT IT7819574A patent/IT7819574A0/it unknown
- 1978-01-24 CH CH75178A patent/CH634035A5/de not_active IP Right Cessation
- 1978-01-24 BE BE184604A patent/BE863272A/xx not_active IP Right Cessation
- 1978-01-24 MX MX678678U patent/MX4672E/es unknown
- 1978-01-24 JP JP588578A patent/JPS5392743A/ja active Pending
- 1978-01-24 DE DE19782802967 patent/DE2802967A1/de not_active Withdrawn
- 1978-01-24 BR BR7800411A patent/BR7800411A/pt unknown
- 1978-01-24 NL NL7800811A patent/NL7800811A/xx not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| GB1594224A (en) | 1981-07-30 |
| BE863272A (fr) | 1978-07-24 |
| CA1121831A (en) | 1982-04-13 |
| CH634035A5 (en) | 1983-01-14 |
| FR2378740A1 (fr) | 1978-08-25 |
| MX4672E (es) | 1982-07-23 |
| BR7800411A (pt) | 1978-08-22 |
| NL7800811A (nl) | 1978-07-28 |
| FR2378740B1 (enExample) | 1981-08-21 |
| IT7819574A0 (it) | 1978-01-24 |
| DE2802967A1 (de) | 1978-07-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NZ187452A (en) | N- substituted-aminocarbonylpropoxy-carbostyrils and their preparation | |
| JPS549296A (en) | Cephem derivative and its preparation | |
| IL59567A0 (en) | Oxiranylmethyltetrahydropyran derivative and its preparation | |
| JPS5439090A (en) | Betaalactam compound and its preparation | |
| JPS545999A (en) | Novel benzoquinolidine derivative and its preparation | |
| JPS5446781A (en) | Cycloaminal and its preparation | |
| JPS5312861A (en) | Benzimdazole derivative and its preparation | |
| GB2001630B (en) | Inosadiamine derivatives and their preparation | |
| JPS5498758A (en) | Thiazolidinee2*44dione derivative and its manufacture | |
| JPS5436298A (en) | Vincaminol ester derivative and its preparation | |
| JPS53127435A (en) | 44alkylthioo22triflormethylalkan sulfonanilid and those derivative | |
| IL54252A0 (en) | Novel -aryl-acetamide derivatives and their preparation | |
| GB2004542B (en) | Beta-substituted-diketones and preparation thereof | |
| JPS5416486A (en) | Novel pyridazinylhydrazones and its preparation | |
| JPS5395942A (en) | New perfumous compound * its preparation and its perfumous compound | |
| IL57817A (en) | Cyclopropane derivatives and their preparation | |
| IL56031A0 (en) | Novel dichlorovinylcyclobutanones and their preparation | |
| ZA78808B (en) | Everninomicin derivatives and their preparation | |
| JPS5392743A (en) | Cyclopropane derivative and its preparation | |
| JPS53132543A (en) | Derivative of cyclohexen and its preparation | |
| GB2000776B (en) | Tunicamine derivatives and their preparation | |
| JPS5481280A (en) | Naphthalene derivative and manufacture | |
| JPS5444686A (en) | Sstriazine derivative and its manufacture | |
| JPS5473800A (en) | Eburnamenine derivative and its manufacture | |
| JPS5436297A (en) | Vincinic acid derivative and its preparation |