CH630596A5 - Verfahren zur herstellung von 4-phenoxy-phenolen. - Google Patents
Verfahren zur herstellung von 4-phenoxy-phenolen. Download PDFInfo
- Publication number
- CH630596A5 CH630596A5 CH1291677A CH1291677A CH630596A5 CH 630596 A5 CH630596 A5 CH 630596A5 CH 1291677 A CH1291677 A CH 1291677A CH 1291677 A CH1291677 A CH 1291677A CH 630596 A5 CH630596 A5 CH 630596A5
- Authority
- CH
- Switzerland
- Prior art keywords
- sulfuric acid
- diazotization
- mixture
- phenoxy
- boiling
- Prior art date
Links
- ZSBDGXGICLIJGD-UHFFFAOYSA-N 4-phenoxyphenol Chemical class C1=CC(O)=CC=C1OC1=CC=CC=C1 ZSBDGXGICLIJGD-UHFFFAOYSA-N 0.000 title description 5
- 238000004519 manufacturing process Methods 0.000 title description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 52
- 238000000034 method Methods 0.000 description 16
- 238000006193 diazotization reaction Methods 0.000 description 14
- 238000009835 boiling Methods 0.000 description 11
- 239000000203 mixture Substances 0.000 description 11
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 10
- 239000008096 xylene Substances 0.000 description 10
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- 239000001257 hydrogen Substances 0.000 description 8
- 229910052739 hydrogen Inorganic materials 0.000 description 8
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 8
- 239000012954 diazonium Substances 0.000 description 7
- -1 methylthio, cyclopentyl Chemical group 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 6
- 125000000217 alkyl group Chemical group 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- 210000003298 dental enamel Anatomy 0.000 description 6
- 239000007789 gas Substances 0.000 description 6
- 229910052736 halogen Inorganic materials 0.000 description 6
- 150000002367 halogens Chemical class 0.000 description 6
- 150000002431 hydrogen Chemical group 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 5
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 5
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 5
- 229910000831 Steel Inorganic materials 0.000 description 5
- 239000010959 steel Substances 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 4
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 4
- 150000001989 diazonium salts Chemical class 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical compound [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 235000002639 sodium chloride Nutrition 0.000 description 4
- 235000010288 sodium nitrite Nutrition 0.000 description 4
- RWDOREOERSVIRK-UHFFFAOYSA-N 4-(2,4-dichlorophenoxy)aniline Chemical compound C1=CC(N)=CC=C1OC1=CC=C(Cl)C=C1Cl RWDOREOERSVIRK-UHFFFAOYSA-N 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 229910001514 alkali metal chloride Inorganic materials 0.000 description 3
- 150000001448 anilines Chemical class 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- YTISFYMPVILQRL-UHFFFAOYSA-N 4-(4-chlorophenoxy)aniline Chemical compound C1=CC(N)=CC=C1OC1=CC=C(Cl)C=C1 YTISFYMPVILQRL-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- XQMRZWSYBUCVAX-UHFFFAOYSA-N 4-(4-chlorophenoxy)phenol Chemical compound C1=CC(O)=CC=C1OC1=CC=C(Cl)C=C1 XQMRZWSYBUCVAX-UHFFFAOYSA-N 0.000 description 1
- WOYZXEVUWXQVNV-UHFFFAOYSA-N 4-phenoxyaniline Chemical class C1=CC(N)=CC=C1OC1=CC=CC=C1 WOYZXEVUWXQVNV-UHFFFAOYSA-N 0.000 description 1
- RXQNKKRGJJRMKD-UHFFFAOYSA-N 5-bromo-2-methylaniline Chemical compound CC1=CC=C(Br)C=C1N RXQNKKRGJJRMKD-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 1
- RPJKYODNJDVOOO-UHFFFAOYSA-N [B].F Chemical compound [B].F RPJKYODNJDVOOO-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- CTEPZBOSYJBGFK-UHFFFAOYSA-N aniline;sulfuric acid Chemical compound OS(O)(=O)=O.OS(O)(=O)=O.NC1=CC=CC=C1 CTEPZBOSYJBGFK-UHFFFAOYSA-N 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 150000001804 chlorine Chemical class 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 150000002632 lipids Chemical class 0.000 description 1
- GYNAVKULVOETAD-UHFFFAOYSA-N n-phenoxyaniline Chemical class C=1C=CC=CC=1NOC1=CC=CC=C1 GYNAVKULVOETAD-UHFFFAOYSA-N 0.000 description 1
- 229930195143 oxyphenol Natural products 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 210000002966 serum Anatomy 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- WBHQBSYUUJJSRZ-UHFFFAOYSA-M sodium bisulfate Chemical compound [Na+].OS([O-])(=O)=O WBHQBSYUUJJSRZ-UHFFFAOYSA-M 0.000 description 1
- 229910000342 sodium bisulfate Inorganic materials 0.000 description 1
- IOGUBQAGAJDPBC-UHFFFAOYSA-N sulfuric acid;1,2-xylene Chemical group OS(O)(=O)=O.CC1=CC=CC=C1C IOGUBQAGAJDPBC-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C41/00—Preparation of ethers; Preparation of compounds having groups, groups or groups
- C07C41/01—Preparation of ethers
- C07C41/18—Preparation of ethers by reactions not forming ether-oxygen bonds
- C07C41/26—Preparation of ethers by reactions not forming ether-oxygen bonds by introduction of hydroxy or O-metal groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2648644A DE2648644C3 (de) | 1976-10-27 | 1976-10-27 | Verfahren zur Herstellung von 4-Phenoxy-phenolen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH630596A5 true CH630596A5 (de) | 1982-06-30 |
Family
ID=5991539
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1291677A CH630596A5 (de) | 1976-10-27 | 1977-10-24 | Verfahren zur herstellung von 4-phenoxy-phenolen. |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4316993A (enExample) |
| JP (1) | JPS5356630A (enExample) |
| CH (1) | CH630596A5 (enExample) |
| DE (1) | DE2648644C3 (enExample) |
| FR (1) | FR2369237A1 (enExample) |
| GB (1) | GB1549547A (enExample) |
| IT (1) | IT1087095B (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3004610A1 (de) * | 1980-02-08 | 1981-08-13 | Hoechst Ag, 6000 Frankfurt | Verfahren zur herstellung von 4-phenoxyphenolen |
| US4355186A (en) * | 1980-06-27 | 1982-10-19 | Hoechst Aktiengesellschaft | Process for the preparation of 4-phenoxy-phenols |
| US6887692B2 (en) * | 2002-12-17 | 2005-05-03 | Gas Technology Institute | Method and apparatus for hydrogen production from organic wastes and manure |
| CN102126935A (zh) * | 2011-01-19 | 2011-07-20 | 浙江一帆化工有限公司 | 一种4-(2,4-二氯苯氧基)苯酚的制备方法 |
| JP2015051964A (ja) * | 2013-08-06 | 2015-03-19 | Jfeケミカル株式会社 | フェノール類の製造方法 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA735967A (en) * | 1966-06-07 | Bindler Jakob | Process for the production of new substituted diphenyl ethers | |
| US2565300A (en) * | 1950-06-13 | 1951-08-21 | Allied Lab Inc | Unsymmetrical dichloro-dihydroxybenzophenones and a method for their production |
| DE1231251B (de) * | 1963-11-28 | 1966-12-29 | Basf Ag | Verfahren zur kontinuierlichen Herstellung von Diazoverbindungen |
| BE786644A (fr) * | 1971-07-23 | 1973-01-24 | Hoechst Ag | Derives d'acides phenoxy-4 phenoxy-alcane-carboxyliques leur preparation et les medicaments qui en contiennent |
| US3914325A (en) * | 1973-06-21 | 1975-10-21 | Olin Corp | Method for preparing phenol compounds using mixed acid system |
| US3998642A (en) * | 1975-07-11 | 1976-12-21 | Eastman Kodak Company | Silver halide emulsions with incorporated 4,6-difluorophenolic couplers |
-
1976
- 1976-10-27 DE DE2648644A patent/DE2648644C3/de not_active Expired
-
1977
- 1977-10-24 CH CH1291677A patent/CH630596A5/de not_active IP Right Cessation
- 1977-10-25 IT IT28988/77A patent/IT1087095B/it active
- 1977-10-26 JP JP12768177A patent/JPS5356630A/ja active Granted
- 1977-10-27 GB GB44769/77A patent/GB1549547A/en not_active Expired
- 1977-10-27 FR FR7732388A patent/FR2369237A1/fr active Granted
-
1980
- 1980-02-28 US US06/125,443 patent/US4316993A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| GB1549547A (en) | 1979-08-08 |
| DE2648644C3 (de) | 1980-09-11 |
| DE2648644A1 (de) | 1978-05-03 |
| US4316993A (en) | 1982-02-23 |
| FR2369237A1 (fr) | 1978-05-26 |
| FR2369237B1 (enExample) | 1983-11-04 |
| JPS5356630A (en) | 1978-05-23 |
| IT1087095B (it) | 1985-05-31 |
| DE2648644B2 (de) | 1980-01-17 |
| JPS6111209B2 (enExample) | 1986-04-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2900266A1 (de) | Verbessertes verfahren zur herstellung eines ameisensaeureamids | |
| EP0496306A1 (de) | Verfahren zur Herstellung von 3-Amino-9,13b-dihydro-1H-dibenz-[c,f]imidazol[1,5-a]azepin-hydrochlorid | |
| CH630596A5 (de) | Verfahren zur herstellung von 4-phenoxy-phenolen. | |
| EP0026291B1 (de) | Verfahren zur Herstellung von Terephthalaldehyd bzw. Isophthalaldehyd | |
| DE1518307B1 (de) | Verfahren zur Herstellung von Nitrodiarylaminen | |
| DE2216804A1 (de) | Verfahren zur Herstellung von 2 Nitro-4,6 dichlor 5 methylphenol | |
| DE2945170A1 (de) | Verfahren zur herstellung von diaryl-p- phenylendiaminen | |
| DE2501899B1 (de) | Verfahren zur herstellung von 2- nitro-4,6-dichlor-5-methylphenol | |
| EP0057889B1 (de) | Verfahren zur Herstellung von 1-Alkyl-2-chlor-5-nitro-4-benzol-sulfonsäuren | |
| DE3104310A1 (de) | Verfahren zur herstellung von 5-chlor-2-nitroanilin | |
| DE3873983T2 (de) | Verfahren zur herstellung von halogenierten imiden. | |
| DE2931777A1 (de) | Verfahren zur herstellung von alkylchloriden | |
| DE69511827T2 (de) | Verfahren zur Herstellung von Aminoacetamid Derivaten | |
| EP0022959B1 (de) | Verfahren zur Herstellung von Diazoniumtetrafluoroboraten in verdünnter wässriger Lösung | |
| DE2513952C2 (de) | Verfahren zur herstellung von monochlorbenzoesaeuren | |
| DE2800537C2 (de) | Verfahren zur Herstellung von 1-Amino-2-alkoxy-5-brom-benzolen | |
| DE3504073A1 (de) | Verfahren zur herstellung von 2-arylamino-4,6-dichlor-s-triazinen | |
| EP0369420A1 (de) | Verfahren zur Herstellung von 4,4'-Dinitrodiphenylamin | |
| DE1518818C3 (de) | Verfahren zur Herstellung von Guanidinderivaten | |
| EP0063298A1 (de) | Verfahren zur Herstellung von 1-Alkylaminoanthrachinonen | |
| DE2714255A1 (de) | Verfahren zur herstellung von m-aminophenolen und deren verwendung | |
| DE854521C (de) | Verfahren zur Herstellung von Phenanthridin-Verbindungen | |
| AT242679B (de) | Verfahren zur Herstellung von Diacetonitril | |
| DE736024C (de) | Verfahren zur Herstellung sauerstoffhaltiger Anthracenabkoemmlinge | |
| DE2925041A1 (de) | Verfahren zur synthese einer phenylessigsaeure |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |