CH627201A5 - - Google Patents
Download PDFInfo
- Publication number
- CH627201A5 CH627201A5 CH315877A CH315877A CH627201A5 CH 627201 A5 CH627201 A5 CH 627201A5 CH 315877 A CH315877 A CH 315877A CH 315877 A CH315877 A CH 315877A CH 627201 A5 CH627201 A5 CH 627201A5
- Authority
- CH
- Switzerland
- Prior art keywords
- formula
- parts
- acid
- dye
- paper
- Prior art date
Links
- 239000000975 dye Substances 0.000 description 36
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 34
- -1 alkyl radical Chemical class 0.000 description 32
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 21
- 229910052739 hydrogen Inorganic materials 0.000 description 21
- 239000001257 hydrogen Substances 0.000 description 20
- 238000004043 dyeing Methods 0.000 description 19
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 19
- 230000008878 coupling Effects 0.000 description 15
- 238000010168 coupling process Methods 0.000 description 15
- 238000005859 coupling reaction Methods 0.000 description 15
- 238000000034 method Methods 0.000 description 14
- 150000001875 compounds Chemical class 0.000 description 12
- 150000002431 hydrogen Chemical group 0.000 description 11
- 150000001735 carboxylic acids Chemical class 0.000 description 10
- 238000002360 preparation method Methods 0.000 description 10
- 150000003254 radicals Chemical class 0.000 description 9
- 150000001450 anions Chemical class 0.000 description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 7
- 235000011054 acetic acid Nutrition 0.000 description 7
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000000460 chlorine Substances 0.000 description 6
- 229910052801 chlorine Inorganic materials 0.000 description 6
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 6
- 229910052736 halogen Inorganic materials 0.000 description 6
- 150000002367 halogens Chemical class 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 6
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 150000007656 barbituric acids Chemical class 0.000 description 5
- 239000008187 granular material Substances 0.000 description 5
- 239000004753 textile Substances 0.000 description 5
- JWAZRIHNYRIHIV-UHFFFAOYSA-N 2-naphthol Chemical compound C1=CC=CC2=CC(O)=CC=C21 JWAZRIHNYRIHIV-UHFFFAOYSA-N 0.000 description 4
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 4
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 3
- 239000004952 Polyamide Substances 0.000 description 3
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 125000000129 anionic group Chemical group 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 239000001913 cellulose Substances 0.000 description 3
- 229920002678 cellulose Polymers 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 235000019253 formic acid Nutrition 0.000 description 3
- 150000007524 organic acids Chemical class 0.000 description 3
- 229920002647 polyamide Polymers 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- JVVRJMXHNUAPHW-UHFFFAOYSA-N 1h-pyrazol-5-amine Chemical compound NC=1C=CNN=1 JVVRJMXHNUAPHW-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- 239000004677 Nylon Substances 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 239000002250 absorbent Substances 0.000 description 2
- 230000002745 absorbent Effects 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 150000004985 diamines Chemical class 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- BJEPYKJPYRNKOW-UHFFFAOYSA-N malic acid Chemical compound OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000002609 medium Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 229920001778 nylon Polymers 0.000 description 2
- 239000010893 paper waste Substances 0.000 description 2
- 235000019260 propionic acid Nutrition 0.000 description 2
- JEXVQSWXXUJEMA-UHFFFAOYSA-N pyrazol-3-one Chemical compound O=C1C=CN=N1 JEXVQSWXXUJEMA-UHFFFAOYSA-N 0.000 description 2
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000010186 staining Methods 0.000 description 2
- 125000000547 substituted alkyl group Chemical group 0.000 description 2
- 239000002351 wastewater Substances 0.000 description 2
- 239000002023 wood Substances 0.000 description 2
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- KJUGUADJHNHALS-UHFFFAOYSA-N 1H-tetrazole Chemical compound C=1N=NNN=1 KJUGUADJHNHALS-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 1
- KWIUHFFTVRNATP-UHFFFAOYSA-N Betaine Natural products C[N+](C)(C)CC([O-])=O KWIUHFFTVRNATP-UHFFFAOYSA-N 0.000 description 1
- 235000018185 Betula X alpestris Nutrition 0.000 description 1
- 235000018212 Betula X uliginosa Nutrition 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 239000004135 Bone phosphate Substances 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 229920001353 Dextrin Polymers 0.000 description 1
- 239000004375 Dextrin Substances 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- QEVGZEDELICMKH-UHFFFAOYSA-N Diglycolic acid Chemical compound OC(=O)COCC(O)=O QEVGZEDELICMKH-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 229930091371 Fructose Natural products 0.000 description 1
- 239000005715 Fructose Substances 0.000 description 1
- RFSUNEUAIZKAJO-ARQDHWQXSA-N Fructose Chemical compound OC[C@H]1O[C@](O)(CO)[C@@H](O)[C@@H]1O RFSUNEUAIZKAJO-ARQDHWQXSA-N 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- KWIUHFFTVRNATP-UHFFFAOYSA-O N,N,N-trimethylglycinium Chemical compound C[N+](C)(C)CC(O)=O KWIUHFFTVRNATP-UHFFFAOYSA-O 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 229920001131 Pulp (paper) Polymers 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- ZXYNGLRGFYLTQZ-UHFFFAOYSA-M [Zn]Cl Chemical compound [Zn]Cl ZXYNGLRGFYLTQZ-UHFFFAOYSA-M 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 235000013334 alcoholic beverage Nutrition 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 229960003237 betaine Drugs 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- KYPOHTVBFVELTG-UHFFFAOYSA-N but-2-enedinitrile Chemical group N#CC=CC#N KYPOHTVBFVELTG-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001767 cationic compounds Chemical class 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 235000019425 dextrin Nutrition 0.000 description 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 1
- BADXJIPKFRBFOT-UHFFFAOYSA-N dimedone Chemical compound CC1(C)CC(=O)CC(=O)C1 BADXJIPKFRBFOT-UHFFFAOYSA-N 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 235000015203 fruit juice Nutrition 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 229910001410 inorganic ion Inorganic materials 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- 229940049920 malate Drugs 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 1
- 235000013336 milk Nutrition 0.000 description 1
- 239000008267 milk Substances 0.000 description 1
- 210000004080 milk Anatomy 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229920002239 polyacrylonitrile Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920006149 polyester-amide block copolymer Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000004513 sizing Methods 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 238000004544 sputter deposition Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 238000010025 steaming Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 229940086735 succinate Drugs 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid Chemical compound NS(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 238000004383 yellowing Methods 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D21—PAPER-MAKING; PRODUCTION OF CELLULOSE
- D21H—PULP COMPOSITIONS; PREPARATION THEREOF NOT COVERED BY SUBCLASSES D21C OR D21D; IMPREGNATING OR COATING OF PAPER; TREATMENT OF FINISHED PAPER NOT COVERED BY CLASS B31 OR SUBCLASS D21G; PAPER NOT OTHERWISE PROVIDED FOR
- D21H21/00—Non-fibrous material added to the pulp, characterised by its function, form or properties; Paper-impregnating or coating material, characterised by its function, form or properties
- D21H21/14—Non-fibrous material added to the pulp, characterised by its function, form or properties; Paper-impregnating or coating material, characterised by its function, form or properties characterised by function or properties in or on the paper
- D21H21/28—Colorants ; Pigments or opacifying agents
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B44/00—Azo dyes containing onium groups
- C09B44/02—Azo dyes containing onium groups containing ammonium groups not directly attached to an azo group
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Paper (AREA)
- Plural Heterocyclic Compounds (AREA)
- Coloring (AREA)
Priority Applications (10)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH315877A CH627201A5 (pm) | 1977-03-14 | 1977-03-14 | |
| SE7802513A SE428699B (sv) | 1977-03-14 | 1978-03-06 | Basiska fran sulfogrupper fria dis- och trisazofergemnen innehallande en pyridinium-pyridonrest |
| DE2809601A DE2809601C2 (de) | 1977-03-14 | 1978-03-06 | Organische Verbindungen, deren Herstellung und Verwendung |
| US05/884,413 US4213897A (en) | 1977-03-14 | 1978-03-08 | Disazo and trisazo compounds having a 3-pyridinium or substituted pyridinium-4-methyl-6-hydroxypyridone-2 coupling component radical |
| GB9542/78A GB1591004A (en) | 1977-03-14 | 1978-03-10 | Polyazo basic compounds and their use in dyeing |
| FR7806921A FR2383997A1 (fr) | 1977-03-14 | 1978-03-10 | Nouveaux colorants polyazoiques et leur preparation |
| IT48375/78A IT1155873B (it) | 1977-03-14 | 1978-03-10 | Coloranti poliazoici e loro preparazione |
| BR7801497A BR7801497A (pt) | 1977-03-14 | 1978-03-13 | Processo para a producao de um composto basico poliazoico livre de grupo sulfo,e processos de tingimento ou estampagem aplicando o mesmo como corante |
| ES467815A ES467815A1 (es) | 1977-03-14 | 1978-03-13 | Un procedimiento para la preparacion de colorantes dis y tris-azoicos basicos |
| JP2783578A JPS53112927A (en) | 1977-03-14 | 1978-03-13 | Basic polyazo compound |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH315877A CH627201A5 (pm) | 1977-03-14 | 1977-03-14 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH627201A5 true CH627201A5 (pm) | 1981-12-31 |
Family
ID=4249866
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH315877A CH627201A5 (pm) | 1977-03-14 | 1977-03-14 |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4213897A (pm) |
| JP (1) | JPS53112927A (pm) |
| BR (1) | BR7801497A (pm) |
| CH (1) | CH627201A5 (pm) |
| DE (1) | DE2809601C2 (pm) |
| ES (1) | ES467815A1 (pm) |
| FR (1) | FR2383997A1 (pm) |
| GB (1) | GB1591004A (pm) |
| IT (1) | IT1155873B (pm) |
| SE (1) | SE428699B (pm) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AR207988A1 (es) | 1974-07-16 | 1976-11-22 | Ciba Geigy Ag | Complejos de cobre niquel cromo y cobalto de colorantes azoicos y azometinicos y procedimiento para su obtencion |
| DE3213826A1 (de) * | 1982-04-15 | 1983-10-27 | Sandoz-Patent-GmbH, 7850 Lörrach | Basische und/oder kationische pyridonhaltige dis- oder polyazoverbindungen, ihre herstellung und verwendung |
| EP0092520B1 (de) * | 1982-04-15 | 1986-11-12 | Sandoz Ag | Basische Verbindungen, deren Herstellung und Verwendung |
| CH656880A5 (de) * | 1982-11-22 | 1986-07-31 | Sandoz Ag | Basische verbindungen, ihre herstellung und verwendung. |
| CH667464A5 (de) * | 1985-03-30 | 1988-10-14 | Sandoz Ag | Sulfonsaeuregruppenfreie basische azoverbindungen. |
| US5352334A (en) * | 1985-03-30 | 1994-10-04 | Sandoz Ltd. | The use of metal-free sulfo group free basic disazo compounds containing two identical 6-hydroxypyrid-2-one coupling component radicals for producing colored paper |
| CH672496A5 (pm) * | 1986-05-14 | 1989-11-30 | Sandoz Ag | |
| DE3801945A1 (de) * | 1988-01-23 | 1989-07-27 | Basf Ag | Aufzeichnungsfluessigkeit fuer das ink-jet-verfahren |
| DE3815481A1 (de) * | 1988-05-06 | 1989-11-16 | Sandoz Ag | Sulfonsaeuregruppenfreie basische verbindung |
| DE4034060A1 (de) * | 1990-10-26 | 1992-04-30 | Basf Ag | Biskationische azofarbstoffe |
| EP0696619B1 (de) * | 1994-07-15 | 2001-11-14 | Ciba SC Holding AG | Verfahren zum Färben von Papier |
| CN100343338C (zh) * | 2002-06-06 | 2007-10-17 | 西巴特殊化学品控股有限公司 | 黄色阴离子双偶氮染料 |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH480422A (de) | 1967-07-13 | 1969-10-31 | Sandoz Ag | Konzentrierte,flüssige Zubereitung |
| CH482000A (de) | 1967-09-22 | 1969-11-30 | Sandoz Ag | Festes Farbstoffpräparat |
| US3567707A (en) * | 1968-04-04 | 1971-03-02 | Sterling Drug Inc | Disazo coupling procedure |
| CH503781A (de) * | 1968-05-15 | 1971-02-28 | Sandoz Ag | Verfahren zur Herstellung von basischen Farbstoffen |
| CH525936A (de) * | 1968-08-13 | 1972-07-31 | Sandoz Ag | Verfahren zur Herstellung von basischen Verbindungen der Azoreihe |
| GB1297116A (pm) * | 1968-12-09 | 1972-11-22 | ||
| CH185570A4 (pm) | 1969-01-20 | 1972-09-15 | ||
| GB1332477A (en) * | 1969-11-07 | 1973-10-03 | Sandoz Ltd | Basic azo dyes free from sulphonic acid groups their production and use |
| GB1377612A (en) * | 1971-01-04 | 1974-12-18 | Ici Ltd | Water-soluble cationic azo pyridone dyestuffs |
| DE2627680C2 (de) * | 1975-06-30 | 1986-02-06 | Sandoz-Patent-GmbH, 7850 Lörrach | Organische Verbindungen, ihre Herstellung und Verwendung |
| GB1550830A (en) * | 1975-12-17 | 1979-08-22 | Ici Ltd | Water soluble azo dyestuffs |
-
1977
- 1977-03-14 CH CH315877A patent/CH627201A5/de not_active IP Right Cessation
-
1978
- 1978-03-06 DE DE2809601A patent/DE2809601C2/de not_active Expired
- 1978-03-06 SE SE7802513A patent/SE428699B/sv not_active IP Right Cessation
- 1978-03-08 US US05/884,413 patent/US4213897A/en not_active Expired - Lifetime
- 1978-03-10 FR FR7806921A patent/FR2383997A1/fr active Granted
- 1978-03-10 IT IT48375/78A patent/IT1155873B/it active
- 1978-03-10 GB GB9542/78A patent/GB1591004A/en not_active Expired
- 1978-03-13 BR BR7801497A patent/BR7801497A/pt unknown
- 1978-03-13 ES ES467815A patent/ES467815A1/es not_active Expired
- 1978-03-13 JP JP2783578A patent/JPS53112927A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| DE2809601A1 (de) | 1978-09-21 |
| JPS6143388B2 (pm) | 1986-09-27 |
| GB1591004A (en) | 1981-06-10 |
| IT1155873B (it) | 1987-01-28 |
| IT7848375A0 (it) | 1978-03-10 |
| FR2383997A1 (fr) | 1978-10-13 |
| SE428699B (sv) | 1983-07-18 |
| SE7802513L (sv) | 1978-09-15 |
| US4213897A (en) | 1980-07-22 |
| FR2383997B1 (pm) | 1982-11-26 |
| ES467815A1 (es) | 1979-12-01 |
| DE2809601C2 (de) | 1987-04-09 |
| BR7801497A (pt) | 1978-10-10 |
| JPS53112927A (en) | 1978-10-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2915323C2 (pm) | ||
| EP0357560B1 (de) | Anionische Triazinylamino-Disazofarbstoffe | |
| DE3440777C2 (de) | Neue sulfonsäuregruppenhaltige, basische Azoverbindungen, deren Herstellung und Verwendung als Farbstoffe | |
| CH667464A5 (de) | Sulfonsaeuregruppenfreie basische azoverbindungen. | |
| CH627201A5 (pm) | ||
| EP0176472B1 (de) | Methinazoverbindungen | |
| CH672923A5 (pm) | ||
| CH663417A5 (de) | Basische verbindungen, deren herstellung und verwendung. | |
| EP0092520B1 (de) | Basische Verbindungen, deren Herstellung und Verwendung | |
| DE19629238B4 (de) | Basische Azoverbindungen, deren Herstellung und Verwendung | |
| DE2555533C2 (de) | Verfahren zum Färben von Papier | |
| DE2733107A1 (de) | Hexakisazoverbindungen, verfahren zur herstellung und verwendung | |
| EP0051559B1 (de) | Basische bzw. kationische, sulfonsäuregruppenfreie Azoverbindungen | |
| EP0306452B1 (de) | Kationische Stilben-disazofarbstoffe | |
| CH653697A5 (de) | Polykationische azoverbindung, ihre herstellung und verwendung. | |
| CH656630A5 (de) | Sulfonsaeuregruppenfreie basische azoverbindungen, ihre herstellung und verwendung. | |
| DE3609590C2 (pm) | ||
| DE3815481A1 (de) | Sulfonsaeuregruppenfreie basische verbindung | |
| DE69707122T2 (de) | Basische monoazoverbindungen | |
| DE3313965A1 (de) | Polykationische azoverbindung, ihre herstellung und verwendung | |
| EP0263073A2 (de) | Kationische Disazofarbstoffe | |
| DE19500203A1 (de) | Kationisch verbrückte Tetrakisazofarbstoffe mit unterschiedlichen Kupplern, ihre Herstellung und Verwendung | |
| WO2000027929A1 (de) | Kationische azofarbstoffe | |
| CH656880A5 (de) | Basische verbindungen, ihre herstellung und verwendung. | |
| DE3340483C2 (pm) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |