CH624239A5 - Regenerierfaehiger elektrischer kondensator und verfahren zu einer herstellung - Google Patents
Regenerierfaehiger elektrischer kondensator und verfahren zu einer herstellung Download PDFInfo
- Publication number
- CH624239A5 CH624239A5 CH1445477A CH1445477A CH624239A5 CH 624239 A5 CH624239 A5 CH 624239A5 CH 1445477 A CH1445477 A CH 1445477A CH 1445477 A CH1445477 A CH 1445477A CH 624239 A5 CH624239 A5 CH 624239A5
- Authority
- CH
- Switzerland
- Prior art keywords
- metal
- capacitor according
- electrical capacitor
- aluminum
- alloy
- Prior art date
Links
- 239000003990 capacitor Substances 0.000 title claims description 29
- 238000004519 manufacturing process Methods 0.000 title claims description 3
- 229910052751 metal Inorganic materials 0.000 claims description 39
- 239000002184 metal Substances 0.000 claims description 39
- 229910052782 aluminium Inorganic materials 0.000 claims description 19
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 19
- 238000000576 coating method Methods 0.000 claims description 17
- 229910045601 alloy Inorganic materials 0.000 claims description 14
- 239000000956 alloy Substances 0.000 claims description 14
- 150000002739 metals Chemical class 0.000 claims description 10
- 239000002985 plastic film Substances 0.000 claims description 9
- 229920006255 plastic film Polymers 0.000 claims description 9
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 6
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 5
- -1 polypropylene Polymers 0.000 claims description 5
- 239000011701 zinc Substances 0.000 claims description 5
- 229910052725 zinc Inorganic materials 0.000 claims description 5
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 4
- 229910052802 copper Inorganic materials 0.000 claims description 4
- 239000010949 copper Substances 0.000 claims description 4
- 238000000034 method Methods 0.000 claims description 4
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 3
- 239000004743 Polypropylene Substances 0.000 claims description 3
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 claims description 3
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 3
- 229910002065 alloy metal Inorganic materials 0.000 claims description 3
- 229910052804 chromium Inorganic materials 0.000 claims description 3
- 239000011651 chromium Substances 0.000 claims description 3
- 229910052742 iron Inorganic materials 0.000 claims description 3
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 claims description 3
- 229920001155 polypropylene Polymers 0.000 claims description 3
- 229910052709 silver Inorganic materials 0.000 claims description 3
- 239000004332 silver Substances 0.000 claims description 3
- 239000011135 tin Substances 0.000 claims description 3
- 229910052718 tin Inorganic materials 0.000 claims description 3
- 229920002301 cellulose acetate Polymers 0.000 claims description 2
- 230000008020 evaporation Effects 0.000 claims description 2
- 238000001704 evaporation Methods 0.000 claims description 2
- 229920000515 polycarbonate Polymers 0.000 claims description 2
- 239000004417 polycarbonate Substances 0.000 claims description 2
- 229920000139 polyethylene terephthalate Polymers 0.000 claims description 2
- 239000005020 polyethylene terephthalate Substances 0.000 claims description 2
- 239000011133 lead Substances 0.000 claims 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 7
- 229910052760 oxygen Inorganic materials 0.000 description 7
- 239000001301 oxygen Substances 0.000 description 7
- 239000011248 coating agent Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- 230000015556 catabolic process Effects 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 238000006731 degradation reaction Methods 0.000 description 3
- 238000005260 corrosion Methods 0.000 description 2
- 230000007797 corrosion Effects 0.000 description 2
- 238000009434 installation Methods 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 239000011148 porous material Substances 0.000 description 2
- 229910000967 As alloy Inorganic materials 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- 239000010953 base metal Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 230000008929 regeneration Effects 0.000 description 1
- 238000011069 regeneration method Methods 0.000 description 1
- 238000007740 vapor deposition Methods 0.000 description 1
- 238000004804 winding Methods 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01G—CAPACITORS; CAPACITORS, RECTIFIERS, DETECTORS, SWITCHING DEVICES, LIGHT-SENSITIVE OR TEMPERATURE-SENSITIVE DEVICES OF THE ELECTROLYTIC TYPE
- H01G4/00—Fixed capacitors; Processes of their manufacture
- H01G4/002—Details
- H01G4/005—Electrodes
- H01G4/008—Selection of materials
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01G—CAPACITORS; CAPACITORS, RECTIFIERS, DETECTORS, SWITCHING DEVICES, LIGHT-SENSITIVE OR TEMPERATURE-SENSITIVE DEVICES OF THE ELECTROLYTIC TYPE
- H01G4/00—Fixed capacitors; Processes of their manufacture
- H01G4/002—Details
- H01G4/005—Electrodes
- H01G4/015—Special provisions for self-healing
Landscapes
- Engineering & Computer Science (AREA)
- Power Engineering (AREA)
- Manufacturing & Machinery (AREA)
- Microelectronics & Electronic Packaging (AREA)
- Chemical & Material Sciences (AREA)
- Materials Engineering (AREA)
- Fixed Capacitors And Capacitor Manufacturing Machines (AREA)
- Physical Vapour Deposition (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2703636A DE2703636C3 (de) | 1977-01-28 | 1977-01-28 | Regenerierfähiger elektrischer Kondensator und Verfahren zu seiner Herstellung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH624239A5 true CH624239A5 (de) | 1981-07-15 |
Family
ID=5999830
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1445477A CH624239A5 (de) | 1977-01-28 | 1977-11-25 | Regenerierfaehiger elektrischer kondensator und verfahren zu einer herstellung |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4215385A (enExample) |
| JP (1) | JPS5396466A (enExample) |
| BR (1) | BR7800505A (enExample) |
| CH (1) | CH624239A5 (enExample) |
| DE (1) | DE2703636C3 (enExample) |
| FR (1) | FR2379146A1 (enExample) |
| GB (1) | GB1546354A (enExample) |
| IT (1) | IT1092142B (enExample) |
| SE (1) | SE435559B (enExample) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2826481A1 (de) * | 1977-01-28 | 1980-01-03 | Siemens Ag | Regenerierfaehiger elektrischer kondensator |
| DE2902195C2 (de) * | 1979-01-20 | 1984-09-06 | Robert Bosch Gmbh, 7000 Stuttgart | Selbstheilender elektrischer Kondensator |
| JPS56101732A (en) | 1980-01-18 | 1981-08-14 | Matsushita Electric Industrial Co Ltd | Metallized film condenser |
| US4482931A (en) * | 1981-08-24 | 1984-11-13 | General Electric Company | Metallized capacitor with improved bilayer electrodes |
| DE3273861D1 (en) * | 1982-03-06 | 1986-11-20 | Steiner Kg | Self restoring electric capacitor |
| DE3231576A1 (de) * | 1982-08-25 | 1984-03-01 | Siemens AG, 1000 Berlin und 8000 München | Regenerierfaehiger elektrischer schichtkondensator |
| JPS59136918A (ja) * | 1983-01-26 | 1984-08-06 | マルコン電子株式会社 | 積層形フイルムコンデンサ |
| US5019418A (en) * | 1985-03-12 | 1991-05-28 | Sprague Electric Company | Metallized film capacitor process |
| CA1266518A (en) * | 1985-03-12 | 1990-03-06 | Raynor Linzey | Self-healing metallized film capacitor |
| JPS63318120A (ja) * | 1987-06-19 | 1988-12-27 | Matsushita Electric Ind Co Ltd | 金属化プラスチックフィルムコンデンサ |
| JPH0616459B2 (ja) * | 1987-07-23 | 1994-03-02 | 株式会社村田製作所 | 磁器コンデンサの製造方法 |
| JPH01158714A (ja) * | 1987-12-15 | 1989-06-21 | Mitsubishi Shindo Kk | コンデンサ用蒸着フイルム |
| US5442517A (en) * | 1993-05-28 | 1995-08-15 | The United States Of America As Represented By The Administrator Of The National Aeronautics And Space Administration | Cellulose triacetate, thin film dielectric capacitor |
| EP0650174A3 (en) * | 1993-10-21 | 1995-08-02 | Philips Electronics Nv | Multiple metal film capacitor with improved oxidation resistance. |
| US5615078A (en) * | 1994-12-16 | 1997-03-25 | Aerovox Incorporated | Metallized film for electrical capacitors having a semiconductive layer extending entirely across the unmetallized margin |
| US6896807B1 (en) * | 2003-02-27 | 2005-05-24 | Toxco Inc | Capacitor electrolyte recovery |
Family Cites Families (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2934687A (en) * | 1960-04-26 | Self-healing capacitor | ||
| US661250A (en) * | 1900-05-18 | 1900-11-06 | Luigi Lombardi | Process of manufacturing thin homogeneous plates. |
| BE407990A (enExample) * | 1934-03-15 | |||
| US2321587A (en) * | 1940-05-10 | 1943-06-15 | Davie | Electrical conductive coating |
| DE975973C (de) * | 1943-11-27 | 1962-12-27 | Siemens Ag | Gegen Korrosionen weitgehend bestaendige aufgedampfte oder aufgestaeubte Metallschicht |
| GB768366A (en) * | 1950-05-26 | 1957-02-13 | British Dielectric Res Ltd | Improvements in the manufacture of electric capacitors |
| US2740732A (en) * | 1951-07-16 | 1956-04-03 | Sprague Electric Co | Process of bonding a metal film to a thermoplastic sheet and resulting product |
| AT182462B (de) * | 1951-10-04 | 1955-07-11 | Bosch Gmbh Robert | Elektrischer Kondensator aus metallisierten Dielektrikumsbändern |
| US2797373A (en) | 1952-08-28 | 1957-06-25 | Sprague Electric Co | Metallized film capacitors |
| DE1006692B (de) * | 1953-10-29 | 1957-04-18 | Siemens Ag | Verfahren zur Herstellung festhaftender Metallbelegungen auf Unterlagen aller Art |
| GB822179A (en) * | 1956-02-15 | 1959-10-21 | Steyr Daimler Puch Ag | Improvements in or relating to four-wheeled tractors |
| DE1087277B (de) * | 1957-07-26 | 1960-08-18 | Asea Ab | Elektrischer Kondensator |
| GB882179A (en) * | 1957-07-26 | 1961-11-15 | Allmanna Svenska Elek Ska Axti | Electric condenser |
| US3086889A (en) * | 1960-03-21 | 1963-04-23 | Stokes F J Corp | Method and apparatus for coating a continuous sheet of material |
| US3891901A (en) * | 1970-02-24 | 1975-06-24 | Mallory & Co Inc P R | Capacitors with sprayed electrode terminals |
| DE2106833A1 (de) * | 1971-02-12 | 1972-08-17 | Steiner Ltd H | Elektrischer Kondensator mit metallisierter Folie und Verfahren zu seiner Herstellung |
| LU67831A1 (enExample) * | 1972-10-31 | 1973-08-28 | Siemens Ag | |
| DE2359431C2 (de) * | 1973-11-29 | 1983-02-24 | Licentia Patent-Verwaltungs-Gmbh, 6000 Frankfurt | Verfahren zur Herstellung eines mit einer Metallschicht versehenen, dielektrischen Bandes für elektrische Kondensatoren |
| DE2359432C3 (de) * | 1973-11-29 | 1984-08-09 | Licentia Patent-Verwaltungs-Gmbh, 6000 Frankfurt | Verfahren zur Herstellung von mit Aluminium beschichteten Folien für Kondensatoren und Vorrichtung zur Durchführung des Verfahrens |
| US3987348A (en) * | 1974-09-16 | 1976-10-19 | General Electric Company | Partially impregnated capacitor |
| JPS5188583A (en) * | 1975-02-03 | 1976-08-03 | Kinzokuhichakufuirumu |
-
1977
- 1977-01-28 DE DE2703636A patent/DE2703636C3/de not_active Expired
- 1977-11-25 CH CH1445477A patent/CH624239A5/de not_active IP Right Cessation
- 1977-12-23 US US05/863,794 patent/US4215385A/en not_active Expired - Lifetime
-
1978
- 1978-01-20 FR FR7801650A patent/FR2379146A1/fr active Granted
- 1978-01-26 SE SE7800984A patent/SE435559B/sv not_active IP Right Cessation
- 1978-01-26 JP JP783578A patent/JPS5396466A/ja active Granted
- 1978-01-26 IT IT19651/78A patent/IT1092142B/it active
- 1978-01-27 BR BR7800505A patent/BR7800505A/pt unknown
- 1978-01-27 GB GB3301/78A patent/GB1546354A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| US4215385A (en) | 1980-07-29 |
| IT7819651A0 (it) | 1978-01-26 |
| DE2703636B2 (de) | 1980-01-03 |
| BR7800505A (pt) | 1978-10-03 |
| GB1546354A (en) | 1979-05-23 |
| DE2703636C3 (de) | 1985-10-10 |
| FR2379146A1 (fr) | 1978-08-25 |
| JPS6249978B2 (enExample) | 1987-10-22 |
| DE2703636A1 (de) | 1978-08-03 |
| FR2379146B1 (enExample) | 1983-02-18 |
| JPS5396466A (en) | 1978-08-23 |
| SE435559B (sv) | 1984-10-01 |
| IT1092142B (it) | 1985-07-06 |
| SE7800984L (sv) | 1978-07-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH624239A5 (de) | Regenerierfaehiger elektrischer kondensator und verfahren zu einer herstellung | |
| DE69800198T2 (de) | Metallisierter Film, Herstellungsverfahren und ihn verwendender Kondensator | |
| DE19641249C2 (de) | Kondensator | |
| EP0088137B1 (de) | Selbstheilender elektrischer Kondensator | |
| DE2700013C2 (de) | Regenerierfähiger elektrischer Kondensator | |
| DE1214786B (de) | Elektrischer Kondenstator und Verfahren zu seiner Herstellung | |
| DE69504399T2 (de) | Metallisierte Filme und damit hergestellte Kondensatoren | |
| EP0162144B1 (de) | Verfahren zu Herstellung eines elektrischen Kondensators mit Polyethylenterephthalat als Dielektrikum insbesondere zur Verwendung als lötfähiges Chip-Bauelement | |
| EP0181555A1 (de) | Verfahren zum Herstellen elektrischer plasmapolymerer Vielschichtkondensatoren | |
| DE2759524C2 (de) | Regenerierfaehiger elektrischer kondensator und verfahren zu einer herstellung | |
| DE10044451C1 (de) | Elektrode und Kondensator mit der Elektrode | |
| DE2760196C3 (de) | Regenerierfaehiger elektrischer kondensator und verfahren zu einer herstellung | |
| EP0103762B1 (de) | Regenerierfähiger elektrischer Schichtkondensator | |
| DE1963865U (de) | Trockener elektrolytkondensator. | |
| DE2759519C2 (de) | Regenerierfähiger elektrischer Kondensator | |
| DE900723C (de) | Kondensator mit duennen, bei einem Durchschlag an der Durchschlagstelle wegbrennenden Belegungen | |
| DD151383A5 (de) | Bipolarer elektrolyt-kondensator | |
| AT247989B (de) | Elektrischer Kondensator | |
| EP0030689B1 (de) | Elektrischer Wickel- oder Stapelkondensator | |
| DE2106833A1 (de) | Elektrischer Kondensator mit metallisierter Folie und Verfahren zu seiner Herstellung | |
| DE931478C (de) | Elektrischer Kondensator mit ausbrennfaehigen Belegungen und verstaerkter Randanschlussschicht, insbesondere Wickelkondensator | |
| DE692974C (de) | Elektrolytischer Kondensator | |
| DE1564505A1 (de) | Elektrischer Kondensator fuer grosse Leistungen | |
| DE2516453C2 (de) | Elektrischer Durchführungskondensator | |
| DE814763C (de) | Elektronenroehre mit einer Abschirmung und einem Trimmerkondensator |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |