CH622543A5 - - Google Patents
Download PDFInfo
- Publication number
- CH622543A5 CH622543A5 CH890376A CH890376A CH622543A5 CH 622543 A5 CH622543 A5 CH 622543A5 CH 890376 A CH890376 A CH 890376A CH 890376 A CH890376 A CH 890376A CH 622543 A5 CH622543 A5 CH 622543A5
- Authority
- CH
- Switzerland
- Prior art keywords
- compounds
- formula
- mixture
- cobalt
- mixtures
- Prior art date
Links
- 239000000203 mixture Substances 0.000 claims description 31
- 150000001875 compounds Chemical class 0.000 claims description 17
- 238000004043 dyeing Methods 0.000 claims description 13
- 229910052739 hydrogen Inorganic materials 0.000 claims description 11
- 239000001257 hydrogen Substances 0.000 claims description 11
- 238000002360 preparation method Methods 0.000 claims description 11
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 7
- 238000000034 method Methods 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 4
- 150000001768 cations Chemical class 0.000 claims description 4
- 150000004700 cobalt complex Chemical class 0.000 claims description 4
- 150000002431 hydrogen Chemical class 0.000 claims description 4
- 150000003839 salts Chemical group 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 150000001450 anions Chemical class 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 230000002378 acidificating effect Effects 0.000 claims description 2
- 239000010985 leather Substances 0.000 claims description 2
- 239000012429 reaction media Substances 0.000 claims description 2
- 239000000975 dye Substances 0.000 description 18
- 239000000460 chlorine Chemical group 0.000 description 14
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 13
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 10
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 10
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 229910052801 chlorine Inorganic materials 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- 230000008878 coupling Effects 0.000 description 8
- 238000010168 coupling process Methods 0.000 description 8
- 238000005859 coupling reaction Methods 0.000 description 8
- 150000001868 cobalt Chemical class 0.000 description 7
- 239000004952 Polyamide Substances 0.000 description 6
- -1 monoazo compound Chemical class 0.000 description 6
- 229920002647 polyamide Polymers 0.000 description 6
- 239000000835 fiber Substances 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 229910017052 cobalt Inorganic materials 0.000 description 3
- 239000010941 cobalt Substances 0.000 description 3
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 3
- 238000004040 coloring Methods 0.000 description 3
- 238000001465 metallisation Methods 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 239000004677 Nylon Substances 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- DYRDKSSFIWVSNM-UHFFFAOYSA-N acetoacetanilide Chemical compound CC(=O)CC(=O)NC1=CC=CC=C1 DYRDKSSFIWVSNM-UHFFFAOYSA-N 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 125000002843 carboxylic acid group Chemical group 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- KTVIXTQDYHMGHF-UHFFFAOYSA-L cobalt(2+) sulfate Chemical compound [Co+2].[O-]S([O-])(=O)=O KTVIXTQDYHMGHF-UHFFFAOYSA-L 0.000 description 2
- 229910000335 cobalt(II) sulfate Inorganic materials 0.000 description 2
- 230000009918 complex formation Effects 0.000 description 2
- 150000004696 coordination complex Chemical class 0.000 description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 229920001778 nylon Polymers 0.000 description 2
- 229910001415 sodium ion Inorganic materials 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000011550 stock solution Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 210000002268 wool Anatomy 0.000 description 2
- ULUIMLJNTCECJU-UHFFFAOYSA-N 3-amino-4-hydroxybenzenesulfonate;hydron Chemical compound NC1=CC(S(O)(=O)=O)=CC=C1O ULUIMLJNTCECJU-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- DRSHXJFUUPIBHX-UHFFFAOYSA-N COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 Chemical compound COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 DRSHXJFUUPIBHX-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 241000009328 Perro Species 0.000 description 1
- NPYPAHLBTDXSSS-UHFFFAOYSA-N Potassium ion Chemical compound [K+] NPYPAHLBTDXSSS-UHFFFAOYSA-N 0.000 description 1
- FKNQFGJONOIPTF-UHFFFAOYSA-N Sodium cation Chemical compound [Na+] FKNQFGJONOIPTF-UHFFFAOYSA-N 0.000 description 1
- 235000011941 Tilia x europaea Nutrition 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 229910001413 alkali metal ion Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Chemical group 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 238000003763 carbonization Methods 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 238000010409 ironing Methods 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000004571 lime Substances 0.000 description 1
- 229910001416 lithium ion Inorganic materials 0.000 description 1
- 239000000434 metal complex dye Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 125000001477 organic nitrogen group Chemical group 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 229910001414 potassium ion Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 229940066769 systemic antihistamines substituted alkylamines Drugs 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical compound C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-O triethanolammonium Chemical compound OCC[NH+](CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-O 0.000 description 1
- ZMANZCXQSJIPKH-UHFFFAOYSA-O triethylammonium ion Chemical compound CC[NH+](CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-O 0.000 description 1
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B45/00—Complex metal compounds of azo dyes
- C09B45/02—Preparation from dyes containing in o-position a hydroxy group and in o'-position hydroxy, alkoxy, carboxyl, amino or keto groups
- C09B45/14—Monoazo compounds
- C09B45/20—Monoazo compounds containing cobalt
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Electrochemical Coating By Surface Reaction (AREA)
Priority Applications (9)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH890376A CH622543A5 (OSRAM) | 1976-07-12 | 1976-07-12 | |
| DE2729915A DE2729915C2 (de) | 1976-07-12 | 1977-07-02 | Gemische von 1 zu 2-Kobaltkomplexazoverbindungen, deren Herstellung und Verwendung |
| US05/812,826 US4165314A (en) | 1976-07-12 | 1977-07-05 | Mixtures of 1:2 cobalt complexes of monoazo compounds having an acetoacetanilide coupling component radical |
| GB28518/77A GB1578988A (en) | 1976-07-12 | 1977-07-07 | Mixtures of 1:2 cobalt complexes of azo dyes |
| JP52082078A JPS6047309B2 (ja) | 1976-07-12 | 1977-07-11 | 含金属錯化合物染料混合物,その製法およびその使用方法 |
| IT50218/77A IT1079277B (it) | 1976-07-12 | 1977-07-11 | Miscele di complessi cobaltiferi simmetrici e asimmetrici 1/2 loro preparazione e loro impiego quali coloranti |
| FR7721425A FR2358448A1 (fr) | 1976-07-12 | 1977-07-12 | Nouveaux complexes cobaltiferes 1 : 2, leur preparation et leur application comme colorants |
| BE0/198791A BE880912Q (fr) | 1976-07-12 | 1979-12-27 | Nouveaux complexes cobaltiferes 1,2, leur preparation et leur application comme colorants |
| HK257/81A HK25781A (en) | 1976-07-12 | 1981-06-11 | Mixtures of 1:2 cobalt complexes of azo dyes |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH890376A CH622543A5 (OSRAM) | 1976-07-12 | 1976-07-12 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH622543A5 true CH622543A5 (OSRAM) | 1981-04-15 |
Family
ID=4346082
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH890376A CH622543A5 (OSRAM) | 1976-07-12 | 1976-07-12 |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4165314A (OSRAM) |
| JP (1) | JPS6047309B2 (OSRAM) |
| BE (1) | BE880912Q (OSRAM) |
| CH (1) | CH622543A5 (OSRAM) |
| DE (1) | DE2729915C2 (OSRAM) |
| FR (1) | FR2358448A1 (OSRAM) |
| GB (1) | GB1578988A (OSRAM) |
| HK (1) | HK25781A (OSRAM) |
| IT (1) | IT1079277B (OSRAM) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1096377B (it) * | 1978-06-06 | 1985-08-26 | Acna | Coloranti azoici cobaltati e materiali tinti con essi |
| DE2918633A1 (de) * | 1979-05-09 | 1980-11-20 | Bayer Ag | Kobalt-komplexfarbstoffe |
| FR2508472A1 (fr) * | 1981-06-25 | 1982-12-31 | Sandoz Sa | Melanges de complexes metalliferes, leur preparation et leur application comme colorants |
| US4457783A (en) * | 1981-10-31 | 1984-07-03 | Ciba-Geigy Corporation | Stabilized opaque form of C.I. Pigment Yellow 74 |
| DE3363057D1 (en) * | 1982-07-12 | 1986-05-22 | Ciba Geigy Ag | 1:2 cobalt complexes of azo dyestuffs |
| DE10032683A1 (de) | 2000-07-05 | 2002-01-17 | Clariant Gmbh | Farbmittelmischung |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2734895A (en) * | 1956-02-14 | Cochj | ||
| US2897189A (en) * | 1951-12-21 | 1959-07-28 | Ciba Ltd | Metalliferous azo-dyestuffs |
| DE934905C (de) * | 1951-12-21 | 1955-11-10 | Ciba Geigy | Verfahren zur Herstellung neuer metallhaltiger Azofarbstoffe |
| BE629818A (OSRAM) * | 1963-03-19 |
-
1976
- 1976-07-12 CH CH890376A patent/CH622543A5/de not_active IP Right Cessation
-
1977
- 1977-07-02 DE DE2729915A patent/DE2729915C2/de not_active Expired
- 1977-07-05 US US05/812,826 patent/US4165314A/en not_active Expired - Lifetime
- 1977-07-07 GB GB28518/77A patent/GB1578988A/en not_active Expired
- 1977-07-11 IT IT50218/77A patent/IT1079277B/it active
- 1977-07-11 JP JP52082078A patent/JPS6047309B2/ja not_active Expired
- 1977-07-12 FR FR7721425A patent/FR2358448A1/fr active Granted
-
1979
- 1979-12-27 BE BE0/198791A patent/BE880912Q/fr not_active IP Right Cessation
-
1981
- 1981-06-11 HK HK257/81A patent/HK25781A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| US4165314A (en) | 1979-08-21 |
| FR2358448A1 (fr) | 1978-02-10 |
| JPS6047309B2 (ja) | 1985-10-21 |
| IT1079277B (it) | 1985-05-08 |
| HK25781A (en) | 1981-06-19 |
| JPS538623A (en) | 1978-01-26 |
| DE2729915C2 (de) | 1986-03-06 |
| GB1578988A (en) | 1980-11-12 |
| BE880912Q (fr) | 1980-06-27 |
| FR2358448B1 (OSRAM) | 1982-03-05 |
| DE2729915A1 (de) | 1978-01-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2748966B2 (de) | Wasserlösliche Farbstoffe, Verfahren zu deren Herstellung, ihre Verwendung als faserreaktive Farbstoffe zum Färben und Bedrucken von Cellulose- und Polyamid-Fasermaterialien | |
| DE2704364C2 (OSRAM) | ||
| CH622543A5 (OSRAM) | ||
| EP0718374B1 (de) | 1:2-Chromkomplexfarbstoffe enthaltende Farbstoffmischungen und 1:2 Chromkomplexfarbstoffe | |
| DE2636798C2 (de) | Asymmetrische 1:2-Chromkomplex-azoverbindungen, deren Herstellung und Verwendung | |
| EP0532994B1 (de) | Unsymmetrische 1:2-chrom-komplexfarbstoffe | |
| EP0016975B1 (de) | Polyazofarbstoffe sowie ihre Verwendung zum Färben von amino- und hydroxygruppenhaltigen Fasermaterialien und Leder | |
| CH372974A (de) | Ausdrückbarer Behälter für Flüssigkeiten und pastenförmige Massen | |
| EP0095441B1 (de) | Asymmetrische 1:2-Chromkomplexfarbstoffe | |
| DE2608535C2 (de) | Neue Chromkomplexfarbstoffe, ihre Herstellung und Verwendung | |
| DE963898C (de) | Verfahren zur Herstellung von metallhaltigen Azofarbstoffen | |
| EP0037377B1 (de) | Metallkomplexfarbstoffe, deren Herstellung und Verwendung | |
| DE2408907C3 (de) | Wasserlösliche Tetrakisazofarbstoffe, Verfahren zu deren Herstellung und ihre Verwendung zum Färben von Leder | |
| DE2541007A1 (de) | Wasserloesliche trisazofarbstoffe, ihre herstellung und verwendung | |
| EP0047427A1 (de) | Sulfonsäuregruppenhaltige 1:2-Chromkomplexfarbstoffe | |
| CH643580A5 (de) | Anionische disazoverbindungen, deren herstellung und verwendung als farbstoffe. | |
| DE853188C (de) | Verfahren zur Herstellung von Mono-, Dis- oder Polyazofarbstoffen | |
| DE3022928A1 (de) | Anionische disazoverbindungen | |
| CH640556A5 (de) | Metallisierbare und metallisierte azoverbindungen, deren herstellung und verwendung. | |
| DE2805306A1 (de) | Gemische von 1 zu 2-kobaltkomplexazoverbindungen, deren herstellung und verwendung | |
| DE2732356A1 (de) | Anionische disazoverbindungen, verfahren zur herstellung und verwendung | |
| EP0073951A1 (de) | Asymmetrische 1:2-Chromkomplexfarbstoffe und Verfahren zu ihrer Herstellung und zum Färben | |
| DE951526C (de) | Verfahren zur Herstellung von schwermetallhaltigen Azofarbstoffen | |
| CH654845A5 (de) | Anionische monoazoverbindungen, verfahren zur herstellung und ihre verwendung bei faerbe- und druckverfahren. | |
| DE2637883A1 (de) | Organische verbindungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |