CH621782A5 - - Google Patents
Download PDFInfo
- Publication number
- CH621782A5 CH621782A5 CH871476A CH871476A CH621782A5 CH 621782 A5 CH621782 A5 CH 621782A5 CH 871476 A CH871476 A CH 871476A CH 871476 A CH871476 A CH 871476A CH 621782 A5 CH621782 A5 CH 621782A5
- Authority
- CH
- Switzerland
- Prior art keywords
- carbon atoms
- radical
- dihydro
- group
- alkyl group
- Prior art date
Links
- -1 arylalkyl radical Chemical class 0.000 claims description 53
- 125000004432 carbon atom Chemical group C* 0.000 claims description 42
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 33
- 125000000217 alkyl group Chemical group 0.000 claims description 15
- 150000002780 morpholines Chemical class 0.000 claims description 15
- 150000001875 compounds Chemical class 0.000 claims description 14
- 150000003839 salts Chemical class 0.000 claims description 14
- 238000000034 method Methods 0.000 claims description 12
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 11
- 231100000252 nontoxic Toxicity 0.000 claims description 10
- 230000003000 nontoxic effect Effects 0.000 claims description 10
- 239000002253 acid Substances 0.000 claims description 8
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 7
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 claims description 4
- 150000003951 lactams Chemical class 0.000 claims description 4
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 3
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 claims description 3
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 claims description 2
- 239000000935 antidepressant agent Substances 0.000 claims description 2
- 150000005840 aryl radicals Chemical class 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 150000003254 radicals Chemical class 0.000 claims description 2
- 230000001430 anti-depressive effect Effects 0.000 claims 1
- 229940005513 antidepressants Drugs 0.000 claims 1
- 125000003118 aryl group Chemical group 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- 239000000126 substance Substances 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 54
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 42
- 238000002844 melting Methods 0.000 description 30
- 230000008018 melting Effects 0.000 description 30
- 239000000243 solution Substances 0.000 description 22
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 20
- 239000011541 reaction mixture Substances 0.000 description 20
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- 239000000203 mixture Substances 0.000 description 14
- 239000012280 lithium aluminium hydride Substances 0.000 description 12
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- LHHOBLDSZWYRBD-UHFFFAOYSA-N ctk2b4363 Chemical compound C12=CC=CC=C2C2(CC=C)C3=CC=CC=C3C1CC2 LHHOBLDSZWYRBD-UHFFFAOYSA-N 0.000 description 8
- 239000013078 crystal Substances 0.000 description 7
- 238000010992 reflux Methods 0.000 description 7
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 238000009835 boiling Methods 0.000 description 6
- KMQFIAHMFOCATJ-UHFFFAOYSA-N 1-aminotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaen-15-ol Chemical compound C12=CC=CC=C2C2(N)C3=CC=CC=C3C1CC2O KMQFIAHMFOCATJ-UHFFFAOYSA-N 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 239000003638 chemical reducing agent Substances 0.000 description 5
- ZAELYRWEXINIKF-UHFFFAOYSA-N ctk2f1535 Chemical compound C12=CC=CC=C2C2(C=O)C3=CC=CC=C3C1C2 ZAELYRWEXINIKF-UHFFFAOYSA-N 0.000 description 5
- 239000002585 base Substances 0.000 description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 4
- 239000010410 layer Substances 0.000 description 4
- 238000006722 reduction reaction Methods 0.000 description 4
- 239000012279 sodium borohydride Substances 0.000 description 4
- 229910000033 sodium borohydride Inorganic materials 0.000 description 4
- IFBJPYFKURISGC-UHFFFAOYSA-N β-(9,10-dihydro-9,10-methano-9-anthryl)propionic acid Chemical class C12=CC=CC=C2C2(CCC(=O)O)C3=CC=CC=C3C1C2 IFBJPYFKURISGC-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical class CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 3
- 239000004593 Epoxy Substances 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 3
- 210000003169 central nervous system Anatomy 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- ZCZTXPRRZOVHGJ-UHFFFAOYSA-N ctk2b4370 Chemical compound C1C(C=2C3=CC=CC=2)C2=CC=CC=C2C13CC1CNCCO1 ZCZTXPRRZOVHGJ-UHFFFAOYSA-N 0.000 description 3
- 239000006185 dispersion Substances 0.000 description 3
- 239000002024 ethyl acetate extract Substances 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 239000000825 pharmaceutical preparation Substances 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 239000012312 sodium hydride Substances 0.000 description 3
- 229910000104 sodium hydride Inorganic materials 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- LTMRRSWNXVJMBA-UHFFFAOYSA-L 2,2-diethylpropanedioate Chemical compound CCC(CC)(C([O-])=O)C([O-])=O LTMRRSWNXVJMBA-UHFFFAOYSA-L 0.000 description 2
- AIIBFOGKWCOTCW-UHFFFAOYSA-N 9-(4-benzyl-2-morpholinylmethyl)-9,10-dihydro-9,10-ethanoanthracene Chemical compound C1COC(CC23C4=CC=CC=C4C(CC2)C=2C3=CC=CC=2)CN1CC1=CC=CC=C1 AIIBFOGKWCOTCW-UHFFFAOYSA-N 0.000 description 2
- OHBFRJVWAIBCRC-UHFFFAOYSA-N 9-(4-ethoxycarbonyl-2-morpholinylmethyl)-9,10-dihydro-9,10-methanoanthracene Chemical compound C1N(C(=O)OCC)CCOC1CC1(C2=CC=CC=C22)C3=CC=CC=C3C2C1 OHBFRJVWAIBCRC-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- JEDZLBFUGJTJGQ-UHFFFAOYSA-N [Na].COCCO[AlH]OCCOC Chemical compound [Na].COCCO[AlH]OCCOC JEDZLBFUGJTJGQ-UHFFFAOYSA-N 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- VFFXSIUGTXVZEF-UHFFFAOYSA-N ctk2b4371 Chemical compound C1N(C)CCOC1CC1(C2=CC=CC=C22)C3=CC=CC=C3C2C1 VFFXSIUGTXVZEF-UHFFFAOYSA-N 0.000 description 2
- 230000008030 elimination Effects 0.000 description 2
- 238000003379 elimination reaction Methods 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 2
- MBHINSULENHCMF-UHFFFAOYSA-N n,n-dimethylpropanamide Chemical compound CCC(=O)N(C)C MBHINSULENHCMF-UHFFFAOYSA-N 0.000 description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- SSOLNOMRVKKSON-UHFFFAOYSA-N proguanil Chemical compound CC(C)\N=C(/N)N=C(N)NC1=CC=C(Cl)C=C1 SSOLNOMRVKKSON-UHFFFAOYSA-N 0.000 description 2
- 235000019260 propionic acid Nutrition 0.000 description 2
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical class O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 2
- 238000006462 rearrangement reaction Methods 0.000 description 2
- NDVLTYZPCACLMA-UHFFFAOYSA-N silver oxide Chemical compound [O-2].[Ag+].[Ag+] NDVLTYZPCACLMA-UHFFFAOYSA-N 0.000 description 2
- 239000012419 sodium bis(2-methoxyethoxy)aluminum hydride Substances 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- SFLSHLFXELFNJZ-QMMMGPOBSA-N (-)-norepinephrine Chemical compound NC[C@H](O)C1=CC=C(O)C(O)=C1 SFLSHLFXELFNJZ-QMMMGPOBSA-N 0.000 description 1
- MRXQGJKCSBGHHW-UHFFFAOYSA-N (1-isocyanato-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl) acetate Chemical compound C12=CC=CC=C2C2CC(OC(=O)C)C1(N=C=O)C1=CC=CC=C12 MRXQGJKCSBGHHW-UHFFFAOYSA-N 0.000 description 1
- FSJPQPQXDUGPFV-UHFFFAOYSA-N (2-ethoxy-2-oxoethyl)phosphonic acid Chemical compound CCOC(=O)CP(O)(O)=O FSJPQPQXDUGPFV-UHFFFAOYSA-N 0.000 description 1
- MKJIEFSOBYUXJB-HOCLYGCPSA-N (3S,11bS)-9,10-dimethoxy-3-isobutyl-1,3,4,6,7,11b-hexahydro-2H-pyrido[2,1-a]isoquinolin-2-one Chemical compound C1CN2C[C@H](CC(C)C)C(=O)C[C@H]2C2=C1C=C(OC)C(OC)=C2 MKJIEFSOBYUXJB-HOCLYGCPSA-N 0.000 description 1
- DNXIKVLOVZVMQF-UHFFFAOYSA-N (3beta,16beta,17alpha,18beta,20alpha)-17-hydroxy-11-methoxy-18-[(3,4,5-trimethoxybenzoyl)oxy]-yohimban-16-carboxylic acid, methyl ester Natural products C1C2CN3CCC(C4=CC=C(OC)C=C4N4)=C4C3CC2C(C(=O)OC)C(O)C1OC(=O)C1=CC(OC)=C(OC)C(OC)=C1 DNXIKVLOVZVMQF-UHFFFAOYSA-N 0.000 description 1
- DHBXNPKRAUYBTH-UHFFFAOYSA-N 1,1-ethanedithiol Chemical compound CC(S)S DHBXNPKRAUYBTH-UHFFFAOYSA-N 0.000 description 1
- ZKFWGWXNKDTHQE-UHFFFAOYSA-N 15-acetyloxytetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-1-carboxylic acid Chemical compound C12=CC=CC=C2C2CC(OC(=O)C)C1(C(O)=O)C1=CC=CC=C12 ZKFWGWXNKDTHQE-UHFFFAOYSA-N 0.000 description 1
- DFEOQTUWINHKPU-UHFFFAOYSA-N 15-hydroxytetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-1-carboxylic acid Chemical compound C12=CC=CC=C2C2CC(O)C1(C(O)=O)C1=CC=CC=C12 DFEOQTUWINHKPU-UHFFFAOYSA-N 0.000 description 1
- RLAWQNBRBDSSQS-UHFFFAOYSA-N 1h-cyclopropa[a]anthracene Chemical compound C1=CC=CC2=CC3=C4CC4=CC=C3C=C21 RLAWQNBRBDSSQS-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- XNIOWJUQPMKCIJ-UHFFFAOYSA-N 2-(benzylamino)ethanol Chemical compound OCCNCC1=CC=CC=C1 XNIOWJUQPMKCIJ-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- XZXYQEHISUMZAT-UHFFFAOYSA-N 2-[(2-hydroxy-5-methylphenyl)methyl]-4-methylphenol Chemical compound CC1=CC=C(O)C(CC=2C(=CC=C(C)C=2)O)=C1 XZXYQEHISUMZAT-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- SYZRZLUNWVNNNV-UHFFFAOYSA-N 2-bromoacetyl chloride Chemical compound ClC(=O)CBr SYZRZLUNWVNNNV-UHFFFAOYSA-N 0.000 description 1
- IJJJSNBMFDDFBC-UHFFFAOYSA-N 2-cyanoethyl acetate Chemical compound CC(=O)OCCC#N IJJJSNBMFDDFBC-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- BBTYYMBELCBPMW-UHFFFAOYSA-N 4-(cyclopropylmethyl)-2-(1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenylmethyl)morpholine hydrochloride Chemical compound Cl.C1COC(CC23C4=CC=CC=C4C(CC2)C=2C3=CC=CC=2)CN1CC1CC1 BBTYYMBELCBPMW-UHFFFAOYSA-N 0.000 description 1
- ZYBGPDIFXMFKGK-UHFFFAOYSA-N 4-benzyl-2-(1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenylmethyl)morpholin-3-one Chemical compound O=C1C(CC23C4=CC=CC=C4C(CC2)C=2C3=CC=CC=2)OCCN1CC1=CC=CC=C1 ZYBGPDIFXMFKGK-UHFFFAOYSA-N 0.000 description 1
- SLWFOZIYBLZIDS-UHFFFAOYSA-N 4-ethyl-2-(1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaenylmethyl)morpholine Chemical compound C1N(CC)CCOC1CC1(C2=CC=CC=C22)C3=CC=CC=C3C2C1 SLWFOZIYBLZIDS-UHFFFAOYSA-N 0.000 description 1
- HAWIGDXXCJILMT-UHFFFAOYSA-N 4-methyl-2-(1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenylmethyl)morpholine hydrochloride Chemical compound Cl.C1N(C)CCOC1CC1(C2=CC=CC=C22)C3=CC=CC=C3C2CC1 HAWIGDXXCJILMT-UHFFFAOYSA-N 0.000 description 1
- KSLFCIIXZZHFPI-UHFFFAOYSA-N 8-prop-2-enyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaen-15-one Chemical compound C12=CC=CC=C2C2(CC=C)C3=CC=CC=C3C1C(=O)C2 KSLFCIIXZZHFPI-UHFFFAOYSA-N 0.000 description 1
- LGOCLFDOAMUHHM-UHFFFAOYSA-N 9-(4-benzyl-2-morpholinylmethyl)-9,10-dihydro-9,10-methanoanthracene Chemical compound C1C(C=2C3=CC=CC=2)C2=CC=CC=C2C13CC(OCC1)CN1CC1=CC=CC=C1 LGOCLFDOAMUHHM-UHFFFAOYSA-N 0.000 description 1
- JMCHHRJOWYAVPB-UHFFFAOYSA-N 9-(4-benzyl-3-oxo-2-morpholinylmethyl)-9,10-dihydro-9,10-methanoanthracene Chemical compound O=C1C(CC23C4=CC=CC=C4C(C2)C=2C3=CC=CC=2)OCCN1CC1=CC=CC=C1 JMCHHRJOWYAVPB-UHFFFAOYSA-N 0.000 description 1
- YIRLOZAONOSZGK-UHFFFAOYSA-N 9-(4-benzyl-5-oxo-2-morpholinylmethyl)-9,10-dihydro-9,10-ethanoanthracene Chemical compound O=C1COC(CC23C4=CC=CC=C4C(CC2)C=2C3=CC=CC=2)CN1CC1=CC=CC=C1 YIRLOZAONOSZGK-UHFFFAOYSA-N 0.000 description 1
- XSXLXROQGCBLNK-UHFFFAOYSA-N 9-(4-cyclopropylmethyl-2-morpholinylmethyl)-9,10-dihydro-9,10-methanoanthracene Chemical compound C1COC(CC23C4=CC=CC=C4C(C2)C=2C3=CC=CC=2)CN1CC1CC1 XSXLXROQGCBLNK-UHFFFAOYSA-N 0.000 description 1
- USRRYCXZCVGSQG-UHFFFAOYSA-N 9-prop-2-enylanthracene Chemical compound C1=CC=C2C(CC=C)=C(C=CC=C3)C3=CC2=C1 USRRYCXZCVGSQG-UHFFFAOYSA-N 0.000 description 1
- RORZPMFTONYUBB-UHFFFAOYSA-N C12=CC=CC=C2C2CC(OC(=O)C)C1(C(Cl)=O)C1=CC=CC=C12 Chemical compound C12=CC=CC=C2C2CC(OC(=O)C)C1(C(Cl)=O)C1=CC=CC=C12 RORZPMFTONYUBB-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 238000006969 Curtius rearrangement reaction Methods 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- OPFTUNCRGUEPRZ-QLFBSQMISA-N Cyclohexane Natural products CC(=C)[C@@H]1CC[C@@](C)(C=C)[C@H](C(C)=C)C1 OPFTUNCRGUEPRZ-QLFBSQMISA-N 0.000 description 1
- 238000005698 Diels-Alder reaction Methods 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 238000006000 Knoevenagel condensation reaction Methods 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Natural products C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- LCQMZZCPPSWADO-UHFFFAOYSA-N Reserpilin Natural products COC(=O)C1COCC2CN3CCc4c([nH]c5cc(OC)c(OC)cc45)C3CC12 LCQMZZCPPSWADO-UHFFFAOYSA-N 0.000 description 1
- QEVHRUUCFGRFIF-SFWBKIHZSA-N Reserpine Natural products O=C(OC)[C@@H]1[C@H](OC)[C@H](OC(=O)c2cc(OC)c(OC)c(OC)c2)C[C@H]2[C@@H]1C[C@H]1N(C2)CCc2c3c([nH]c12)cc(OC)cc3 QEVHRUUCFGRFIF-SFWBKIHZSA-N 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- 238000005644 Wolff-Kishner reduction reaction Methods 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 238000010640 amide synthesis reaction Methods 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229940107816 ammonium iodide Drugs 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- HESUZVIPQUWTTD-UHFFFAOYSA-N ctk2b4364 Chemical compound C12=CC=CC=C2C2(CC=C)C3=CC=CC=C3C1C2 HESUZVIPQUWTTD-UHFFFAOYSA-N 0.000 description 1
- RNFNWXUUICUMGO-UHFFFAOYSA-N ctk2b4366 Chemical compound C1N(C(=O)C)CCOC1CC1(C2=CC=CC=C22)C3=CC=CC=C3C2C1 RNFNWXUUICUMGO-UHFFFAOYSA-N 0.000 description 1
- XSDSPNZDCGPBDV-UHFFFAOYSA-N ctk2b4369 Chemical compound Cl.C1CC(C=2C3=CC=CC=2)C2=CC=CC=C2C13CC1CNCCO1 XSDSPNZDCGPBDV-UHFFFAOYSA-N 0.000 description 1
- WXBZAVSJTILQFW-UHFFFAOYSA-N ctk2f1533 Chemical compound C12=CC=CC=C2C2(C=CC(=O)O)C3=CC=CC=C3C1C2 WXBZAVSJTILQFW-UHFFFAOYSA-N 0.000 description 1
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 230000003001 depressive effect Effects 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 125000004494 ethyl ester group Chemical class 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-L fumarate(2-) Chemical class [O-]C(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-L 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000003893 lactate salts Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- CQDGTJPVBWZJAZ-UHFFFAOYSA-N monoethyl carbonate Chemical compound CCOC(O)=O CQDGTJPVBWZJAZ-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 229960002748 norepinephrine Drugs 0.000 description 1
- SFLSHLFXELFNJZ-UHFFFAOYSA-N norepinephrine Natural products NCC(O)C1=CC=C(O)C(O)=C1 SFLSHLFXELFNJZ-UHFFFAOYSA-N 0.000 description 1
- 150000003891 oxalate salts Chemical class 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- BJOIZNZVOZKDIG-MDEJGZGSSA-N reserpine Chemical compound O([C@H]1[C@@H]([C@H]([C@H]2C[C@@H]3C4=C([C]5C=CC(OC)=CC5=N4)CCN3C[C@H]2C1)C(=O)OC)OC)C(=O)C1=CC(OC)=C(OC)C(OC)=C1 BJOIZNZVOZKDIG-MDEJGZGSSA-N 0.000 description 1
- 229960003147 reserpine Drugs 0.000 description 1
- MDMGHDFNKNZPAU-UHFFFAOYSA-N roserpine Natural products C1C2CN3CCC(C4=CC=C(OC)C=C4N4)=C4C3CC2C(OC(C)=O)C(OC)C1OC(=O)C1=CC(OC)=C(OC)C(OC)=C1 MDMGHDFNKNZPAU-UHFFFAOYSA-N 0.000 description 1
- 238000010898 silica gel chromatography Methods 0.000 description 1
- 229910001923 silver oxide Inorganic materials 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 150000003890 succinate salts Chemical class 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 229960005333 tetrabenazine Drugs 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- GGUBFICZYGKNTD-UHFFFAOYSA-N triethyl phosphonoacetate Chemical compound CCOC(=O)CP(=O)(OCC)OCC GGUBFICZYGKNTD-UHFFFAOYSA-N 0.000 description 1
- ZIBGPFATKBEMQZ-UHFFFAOYSA-N triethylene glycol Chemical compound OCCOCCOCCO ZIBGPFATKBEMQZ-UHFFFAOYSA-N 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D265/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom and one oxygen atom as the only ring hetero atoms
- C07D265/28—1,4-Oxazines; Hydrogenated 1,4-oxazines
- C07D265/30—1,4-Oxazines; Hydrogenated 1,4-oxazines not condensed with other rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C1/00—Preparation of hydrocarbons from one or more compounds, none of them being a hydrocarbon
- C07C1/20—Preparation of hydrocarbons from one or more compounds, none of them being a hydrocarbon starting from organic compounds containing only oxygen atoms as heteroatoms
- C07C1/22—Preparation of hydrocarbons from one or more compounds, none of them being a hydrocarbon starting from organic compounds containing only oxygen atoms as heteroatoms by reduction
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C47/00—Compounds having —CHO groups
- C07C47/38—Unsaturated compounds having —CHO groups bound to carbon atoms of rings other than six—membered aromatic rings
- C07C47/453—Unsaturated compounds having —CHO groups bound to carbon atoms of rings other than six—membered aromatic rings containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C57/00—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms
- C07C57/46—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms containing six-membered aromatic rings and other rings, e.g. cyclohexylphenylacetic acid
- C07C57/50—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms containing six-membered aromatic rings and other rings, e.g. cyclohexylphenylacetic acid containing condensed ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D265/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom and one oxygen atom as the only ring hetero atoms
- C07D265/28—1,4-Oxazines; Hydrogenated 1,4-oxazines
- C07D265/30—1,4-Oxazines; Hydrogenated 1,4-oxazines not condensed with other rings
- C07D265/32—1,4-Oxazines; Hydrogenated 1,4-oxazines not condensed with other rings with oxygen atoms directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D303/00—Compounds containing three-membered rings having one oxygen atom as the only ring hetero atom
- C07D303/02—Compounds containing oxirane rings
- C07D303/04—Compounds containing oxirane rings containing only hydrogen and carbon atoms in addition to the ring oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP50083870A JPS527972A (en) | 1975-07-07 | 1975-07-07 | Process for preparing novel morpholine derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH621782A5 true CH621782A5 (OSRAM) | 1981-02-27 |
Family
ID=13814686
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH871476A CH621782A5 (OSRAM) | 1975-07-07 | 1976-07-07 |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4045560A (OSRAM) |
| JP (1) | JPS527972A (OSRAM) |
| AT (1) | AT347472B (OSRAM) |
| BE (1) | BE843875A (OSRAM) |
| CA (1) | CA1060015A (OSRAM) |
| CH (1) | CH621782A5 (OSRAM) |
| DE (1) | DE2630587A1 (OSRAM) |
| DK (1) | DK307776A (OSRAM) |
| FR (1) | FR2316936A1 (OSRAM) |
| GB (1) | GB1517878A (OSRAM) |
| NL (1) | NL7607518A (OSRAM) |
| SE (1) | SE425394B (OSRAM) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB9216297D0 (en) * | 1991-08-15 | 1992-09-16 | Ici Plc | Therapeutic agents |
| US5512575A (en) * | 1991-08-15 | 1996-04-30 | Zeneca Limited | Methanoanthraceneyl methyl piperidinyl compounds |
| GB9216298D0 (en) * | 1991-08-15 | 1992-09-16 | Ici Plc | Piperidine derivatives |
| TWI435729B (zh) | 2005-11-09 | 2014-05-01 | Combinatorx Inc | 治療病症之方法,組合物及套組 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE674185A (OSRAM) * | 1961-10-10 | |||
| US3489799A (en) * | 1967-09-26 | 1970-01-13 | Ciba Geigy Corp | Ethano-anthracenes |
| ES367292A1 (es) * | 1968-05-16 | 1971-05-01 | Ciba Geigy | Procedimiento para la obtencion de 9-(aminoalquilo)-9,10- dihidro - 9,10-etanoantracenos sustituidos. |
-
1975
- 1975-07-07 JP JP50083870A patent/JPS527972A/ja active Pending
-
1976
- 1976-07-06 FR FR7620617A patent/FR2316936A1/fr active Granted
- 1976-07-06 SE SE7607729A patent/SE425394B/xx unknown
- 1976-07-06 CA CA256,337A patent/CA1060015A/en not_active Expired
- 1976-07-06 GB GB28066/76A patent/GB1517878A/en not_active Expired
- 1976-07-07 CH CH871476A patent/CH621782A5/de not_active IP Right Cessation
- 1976-07-07 NL NL7607518A patent/NL7607518A/xx not_active Application Discontinuation
- 1976-07-07 AT AT495476A patent/AT347472B/de not_active IP Right Cessation
- 1976-07-07 US US05/703,128 patent/US4045560A/en not_active Expired - Lifetime
- 1976-07-07 DE DE19762630587 patent/DE2630587A1/de not_active Withdrawn
- 1976-07-07 DK DK307776A patent/DK307776A/da not_active Application Discontinuation
- 1976-07-07 BE BE168709A patent/BE843875A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| BE843875A (fr) | 1977-01-07 |
| NL7607518A (nl) | 1977-01-11 |
| SE425394B (sv) | 1982-09-27 |
| AT347472B (de) | 1978-12-27 |
| SE7607729L (sv) | 1977-01-08 |
| GB1517878A (en) | 1978-07-12 |
| JPS527972A (en) | 1977-01-21 |
| FR2316936A1 (fr) | 1977-02-04 |
| FR2316936B1 (OSRAM) | 1978-11-17 |
| ATA495476A (de) | 1978-05-15 |
| DE2630587A1 (de) | 1977-01-27 |
| CA1060015A (en) | 1979-08-07 |
| US4045560A (en) | 1977-08-30 |
| DK307776A (da) | 1977-01-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH621115A5 (OSRAM) | ||
| DE1963182A1 (de) | Neue N-Phenylindolin-Derivate und deren Verwendung als Arzneimittel | |
| DE2314636A1 (de) | Pharmakodynamisch aktive, basisch substituierte indanderivate | |
| DE2413102A1 (de) | Verfahren zur herstellung von 1-(3,5dihydroxyphenyl)-1-hydroxy-2- eckige klammer auf 1-methyl-2-(4-hydroxyphenyl)-aethyl eckige klammer zu -amino-aethan | |
| AT390054B (de) | Verfahren zur herstellung von neuen benzoylderivaten von aliphatischen carbonsaeuren | |
| CH621782A5 (OSRAM) | ||
| DE3119796A1 (de) | Substituierte tryptaminderivate von thienyloxpropanolaminen, verfahren zu ihrer herstellung, pharmazeutische praeparate auf basis dieser verbindungen sowie ihre verwendung | |
| DE2933636A1 (de) | Neue n-phenylindolinderivate, ihre herstellung und pharmazeutische praeparate, welche diese verbindungen enthalten | |
| CH615412A5 (OSRAM) | ||
| DE1294961B (de) | Verfahren zur Herstellung von 22-Azacholestanderivaten und deren Saeureadditionssalzen | |
| DE1568762A1 (de) | Verfahren zur Herstellung von substituierten Cyclohexylaminen | |
| CH653996A5 (de) | Tryptaminderivate und verfahren zu deren herstellung. | |
| DE2806909A1 (de) | Verfahren zur herstellung von mefloquin | |
| DE1543777B2 (de) | Verfahren zur Herstellung von alpha niedrig Alkyl beta (4 hydroxy phenyl) alaninen | |
| CH635834A5 (de) | Dibenzo(d,g)(1,3,6)dioxazocin-derivate, verfahren zu ihrer herstellung und die diese verbindungen enthaltenden arzneimittelpraeparate. | |
| DE1214688B (de) | Verfahren zur Herstellung von N-substituierten 1-Phenyl-2-aminopropanen sowie deren nicht-toxischen Saeureadditionssalzen | |
| AT250338B (de) | Verfahren zur Herstellung neuer, basischer Derivate von substituierten Benzofuran-2-carbonsäuren und deren Salzen | |
| AT350580B (de) | Verfahren zur herstellung von neuen morpholin- derivaten und deren salzen | |
| DE1445800C (de) | Verfahren zur Herstellung von Diben zoazepinen | |
| AT337682B (de) | Verfahren zur herstellung von neuen benzocycloalkencarbonsauren sowie ihren estern und salzen | |
| DE1620206C (de) | N-Cyclopropylmethyl-6,14-endo-äthanotetrahydronororipavine und ihre Salze, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende pharmazeutische Zubereitungen | |
| AT238180B (de) | Verfahren zur Herstellung neuer Pyrrolidinverbindungen | |
| AT356665B (de) | Verfahren zum herstellen neuer chinuclidin- derivate, ihren stereoisomeren, optischen isomeren und salzen | |
| AT231425B (de) | Verfahren zur Herstellung von neuen basischen Verbindungen und deren Salzen | |
| AT321289B (de) | Verfahren zur Herstellung von neuen Diphenyläthanalkylaminen und deren Säureadditionssalzen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |