CH619724A5 - - Google Patents
Download PDFInfo
- Publication number
- CH619724A5 CH619724A5 CH1577174A CH1577174A CH619724A5 CH 619724 A5 CH619724 A5 CH 619724A5 CH 1577174 A CH1577174 A CH 1577174A CH 1577174 A CH1577174 A CH 1577174A CH 619724 A5 CH619724 A5 CH 619724A5
- Authority
- CH
- Switzerland
- Prior art keywords
- group
- formula
- ring
- groups
- substituted
- Prior art date
Links
- 125000004432 carbon atom Chemical group C* 0.000 claims description 23
- 229920000642 polymer Polymers 0.000 claims description 19
- 239000000049 pigment Substances 0.000 claims description 16
- 125000000217 alkyl group Chemical group 0.000 claims description 15
- 239000000203 mixture Substances 0.000 claims description 15
- -1 N-substituted carbamoyl Chemical group 0.000 claims description 14
- 239000006096 absorbing agent Substances 0.000 claims description 12
- IZMJMCDDWKSTTK-UHFFFAOYSA-N quinoline yellow Chemical compound C1=CC=CC2=NC(C3C(C4=CC=CC=C4C3=O)=O)=CC=C21 IZMJMCDDWKSTTK-UHFFFAOYSA-N 0.000 claims description 11
- 125000003118 aryl group Chemical group 0.000 claims description 10
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- 125000001624 naphthyl group Chemical group 0.000 claims description 6
- 125000002947 alkylene group Chemical group 0.000 claims description 5
- 229910052799 carbon Inorganic materials 0.000 claims description 5
- 150000003053 piperidines Chemical class 0.000 claims description 5
- 229920000098 polyolefin Polymers 0.000 claims description 5
- 239000004793 Polystyrene Substances 0.000 claims description 4
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 4
- 125000000732 arylene group Chemical group 0.000 claims description 4
- 150000001875 compounds Chemical class 0.000 claims description 4
- 229920002223 polystyrene Polymers 0.000 claims description 4
- 229920006395 saturated elastomer Polymers 0.000 claims description 4
- WRYCSMQKUKOKBP-UHFFFAOYSA-N Imidazolidine Chemical compound C1CNCN1 WRYCSMQKUKOKBP-UHFFFAOYSA-N 0.000 claims description 3
- 229920000122 acrylonitrile butadiene styrene Polymers 0.000 claims description 3
- 125000002252 acyl group Chemical group 0.000 claims description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 3
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 3
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- 125000004434 sulfur atom Chemical group 0.000 claims description 3
- 229920000178 Acrylic resin Polymers 0.000 claims description 2
- 239000004925 Acrylic resin Substances 0.000 claims description 2
- 229930182556 Polyacetal Natural products 0.000 claims description 2
- 239000004952 Polyamide Substances 0.000 claims description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 2
- 125000003277 amino group Chemical group 0.000 claims description 2
- 125000001769 aryl amino group Chemical group 0.000 claims description 2
- 125000002993 cycloalkylene group Chemical group 0.000 claims description 2
- 239000003822 epoxy resin Substances 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 229920002285 poly(styrene-co-acrylonitrile) Polymers 0.000 claims description 2
- 229920002239 polyacrylonitrile Polymers 0.000 claims description 2
- 229920002647 polyamide Polymers 0.000 claims description 2
- 229920000515 polycarbonate Polymers 0.000 claims description 2
- 239000004417 polycarbonate Substances 0.000 claims description 2
- 229920000647 polyepoxide Polymers 0.000 claims description 2
- 229920006324 polyoxymethylene Polymers 0.000 claims description 2
- 229920000915 polyvinyl chloride Polymers 0.000 claims description 2
- 239000004800 polyvinyl chloride Substances 0.000 claims description 2
- 125000002723 alicyclic group Chemical group 0.000 claims 4
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims 4
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 claims 3
- 150000007524 organic acids Chemical class 0.000 claims 3
- 150000003839 salts Chemical class 0.000 claims 3
- 229910052736 halogen Inorganic materials 0.000 claims 2
- 150000002367 halogens Chemical group 0.000 claims 2
- 125000002813 thiocarbonyl group Chemical group *C(*)=S 0.000 claims 2
- DHGUMNJVFYRSIG-UHFFFAOYSA-N 2,3,4,5-tetrahydropyridin-6-amine Chemical class NC1=NCCCC1 DHGUMNJVFYRSIG-UHFFFAOYSA-N 0.000 claims 1
- HRSWSISJJJDBOQ-UHFFFAOYSA-N 2-oxo-1,3-diaza-8-azoniaspiro[4.5]dec-3-en-4-olate Chemical class N1C(=O)NC(=O)C11CCNCC1 HRSWSISJJJDBOQ-UHFFFAOYSA-N 0.000 claims 1
- NZNQMPZXPUKVSQ-UHFFFAOYSA-N [O].C1CO1 Chemical group [O].C1CO1 NZNQMPZXPUKVSQ-UHFFFAOYSA-N 0.000 claims 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims 1
- 125000001951 carbamoylamino group Chemical group C(N)(=O)N* 0.000 claims 1
- 125000004093 cyano group Chemical group *C#N 0.000 claims 1
- 239000000113 methacrylic resin Substances 0.000 claims 1
- 125000005843 halogen group Chemical group 0.000 description 8
- 239000002253 acid Substances 0.000 description 6
- 238000005562 fading Methods 0.000 description 5
- 239000008187 granular material Substances 0.000 description 5
- 125000001424 substituent group Chemical group 0.000 description 5
- 125000004433 nitrogen atom Chemical group N* 0.000 description 4
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 4
- 230000005855 radiation Effects 0.000 description 4
- YEYCMBWKTZNPDH-UHFFFAOYSA-N (2,2,6,6-tetramethylpiperidin-4-yl) benzoate Chemical compound C1C(C)(C)NC(C)(C)CC1OC(=O)C1=CC=CC=C1 YEYCMBWKTZNPDH-UHFFFAOYSA-N 0.000 description 3
- RKMGAJGJIURJSJ-UHFFFAOYSA-N 2,2,6,6-Tetramethylpiperidine Substances CC1(C)CCCC(C)(C)N1 RKMGAJGJIURJSJ-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- UJMDYLWCYJJYMO-UHFFFAOYSA-N benzene-1,2,3-tricarboxylic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1C(O)=O UJMDYLWCYJJYMO-UHFFFAOYSA-N 0.000 description 2
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 2
- 239000012965 benzophenone Substances 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- DIOQZVSQGTUSAI-UHFFFAOYSA-N decane Chemical compound CCCCCCCCCC DIOQZVSQGTUSAI-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- ROBFUDYVXSDBQM-UHFFFAOYSA-N hydroxymalonic acid Chemical compound OC(=O)C(O)C(O)=O ROBFUDYVXSDBQM-UHFFFAOYSA-N 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 239000006097 ultraviolet radiation absorber Substances 0.000 description 2
- 239000001052 yellow pigment Substances 0.000 description 2
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- YAXWOADCWUUUNX-UHFFFAOYSA-N 1,2,2,3-tetramethylpiperidine Chemical compound CC1CCCN(C)C1(C)C YAXWOADCWUUUNX-UHFFFAOYSA-N 0.000 description 1
- RTBFRGCFXZNCOE-UHFFFAOYSA-N 1-methylsulfonylpiperidin-4-one Chemical compound CS(=O)(=O)N1CCC(=O)CC1 RTBFRGCFXZNCOE-UHFFFAOYSA-N 0.000 description 1
- UWSMKYBKUPAEJQ-UHFFFAOYSA-N 5-Chloro-2-(3,5-di-tert-butyl-2-hydroxyphenyl)-2H-benzotriazole Chemical compound CC(C)(C)C1=CC(C(C)(C)C)=CC(N2N=C3C=C(Cl)C=CC3=N2)=C1O UWSMKYBKUPAEJQ-UHFFFAOYSA-N 0.000 description 1
- YDIBXNDCNQIVFJ-UHFFFAOYSA-N 7,7,8,9,9-pentamethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione Chemical compound C1C(C)(C)N(C)C(C)(C)CC21C(=O)NC(=O)N2 YDIBXNDCNQIVFJ-UHFFFAOYSA-N 0.000 description 1
- PNJCQCUNRRANAF-UHFFFAOYSA-N 7,7,9,9-tetramethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione Chemical compound C1C(C)(C)NC(C)(C)CC21C(=O)NC(=O)N2 PNJCQCUNRRANAF-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- WBDYFYYVULBFHX-UHFFFAOYSA-N 8-benzyl-7,7,9,9-tetramethyl-3-octyl-1,3,8-triazaspiro[4.5]decane-2,4-dione Chemical compound O=C1N(CCCCCCCC)C(=O)NC11CC(C)(C)N(CC=2C=CC=CC=2)C(C)(C)C1 WBDYFYYVULBFHX-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 229920003355 Novatec® Polymers 0.000 description 1
- 239000005062 Polybutadiene Substances 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 229920001893 acrylonitrile styrene Polymers 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- JFCQEDHGNNZCLN-UHFFFAOYSA-N anhydrous glutaric acid Natural products OC(=O)CCCC(O)=O JFCQEDHGNNZCLN-UHFFFAOYSA-N 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 229920005601 base polymer Polymers 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical compound C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 description 1
- 239000012964 benzotriazole Substances 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 238000004061 bleaching Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- QHIWVLPBUQWDMQ-UHFFFAOYSA-N butyl prop-2-enoate;methyl 2-methylprop-2-enoate;prop-2-enoic acid Chemical compound OC(=O)C=C.COC(=O)C(C)=C.CCCCOC(=O)C=C QHIWVLPBUQWDMQ-UHFFFAOYSA-N 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- QYQADNCHXSEGJT-UHFFFAOYSA-N cyclohexane-1,1-dicarboxylate;hydron Chemical compound OC(=O)C1(C(O)=O)CCCCC1 QYQADNCHXSEGJT-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229920001903 high density polyethylene Polymers 0.000 description 1
- 239000004700 high-density polyethylene Substances 0.000 description 1
- GVONPBONFIJAHJ-UHFFFAOYSA-N imidazolidin-4-one Chemical compound O=C1CNCN1 GVONPBONFIJAHJ-UHFFFAOYSA-N 0.000 description 1
- 150000002461 imidazolidines Chemical class 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000004611 light stabiliser Substances 0.000 description 1
- RLAWWYSOJDYHDC-BZSNNMDCSA-N lisinopril Chemical compound C([C@H](N[C@@H](CCCCN)C(=O)N1[C@@H](CCC1)C(O)=O)C(O)=O)CC1=CC=CC=C1 RLAWWYSOJDYHDC-BZSNNMDCSA-N 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 125000005395 methacrylic acid group Chemical group 0.000 description 1
- ULLMLEBBNFHESK-UHFFFAOYSA-N n-butyl-2,2,6,6-tetramethylpiperidin-4-imine Chemical compound CCCCN=C1CC(C)(C)NC(C)(C)C1 ULLMLEBBNFHESK-UHFFFAOYSA-N 0.000 description 1
- KHARCSTZAGNHOT-UHFFFAOYSA-N naphthalene-2,3-dicarboxylic acid Chemical compound C1=CC=C2C=C(C(O)=O)C(C(=O)O)=CC2=C1 KHARCSTZAGNHOT-UHFFFAOYSA-N 0.000 description 1
- 125000004957 naphthylene group Chemical group 0.000 description 1
- QUAMTGJKVDWJEQ-UHFFFAOYSA-N octabenzone Chemical compound OC1=CC(OCCCCCCCC)=CC=C1C(=O)C1=CC=CC=C1 QUAMTGJKVDWJEQ-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 229920001200 poly(ethylene-vinyl acetate) Polymers 0.000 description 1
- 229920002857 polybutadiene Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001195 polyisoprene Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- SCUZVMOVTVSBLE-UHFFFAOYSA-N prop-2-enenitrile;styrene Chemical compound C=CC#N.C=CC1=CC=CC=C1 SCUZVMOVTVSBLE-UHFFFAOYSA-N 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000003248 quinolines Chemical class 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/16—Nitrogen-containing compounds
- C08K5/34—Heterocyclic compounds having nitrogen in the ring
- C08K5/3412—Heterocyclic compounds having nitrogen in the ring having one nitrogen atom in the ring
- C08K5/3432—Six-membered rings
- C08K5/3437—Six-membered rings condensed with carbocyclic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP48132912A JPS5147738B2 (cs) | 1973-11-27 | 1973-11-27 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH619724A5 true CH619724A5 (cs) | 1980-10-15 |
Family
ID=15092415
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1577174A CH619724A5 (cs) | 1973-11-27 | 1974-11-26 |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3970632A (cs) |
| JP (1) | JPS5147738B2 (cs) |
| CH (1) | CH619724A5 (cs) |
| DE (1) | DE2456125C2 (cs) |
| FR (1) | FR2252372B1 (cs) |
| GB (1) | GB1457702A (cs) |
| NL (1) | NL176953C (cs) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0002753B1 (de) * | 1977-12-30 | 1983-10-05 | Ciba-Geigy Ag | Stabilisierung von Metalleffekteinbrennlacken gegen die Einwirkung von Licht, Feuchtigkeit und Sauerstoff durch den Zusatz von Polyalkylpiperidinderivaten |
| NL8204181A (nl) * | 1982-10-29 | 1984-05-16 | Gen Electric | Polymeer-mengsel, daaruit gevormde voorwerpen. |
| DE3785881D1 (de) * | 1986-04-10 | 1993-06-24 | Sandoz Ag | Piperidylgruppen enthaltende pigmente. |
| DE59309870D1 (de) * | 1992-03-05 | 1999-12-23 | Ciba Sc Holding Ag | Stabilisierung von Pyrrolopyrrolpigmenten |
| EP0559613B1 (de) * | 1992-03-05 | 1999-12-15 | Ciba SC Holding AG | Stabilisierung von organischen Pigmenten |
| TW237471B (cs) * | 1992-09-03 | 1995-01-01 | Ciba Geigy | |
| DE59404910D1 (de) * | 1993-02-23 | 1998-02-12 | Ciba Geigy Ag | Nitroxylgruppen enthaltende Diketopyrrolopyrrole |
| US5816238A (en) * | 1994-11-28 | 1998-10-06 | Minnesota Mining And Manufacturing Company | Durable fluorescent solar collectors |
| DE69515062T2 (de) * | 1994-11-28 | 2000-09-14 | Minnesota Mining And Mfg. Co., St. Paul | Gegenstände mit dauerhaften farb- und/oder fluoreszenzeigenschaften |
| US5700077A (en) * | 1995-03-23 | 1997-12-23 | Minnesota Mining And Manufacturing Company | Line light source including fluorescent colorant |
| DE602006001583D1 (de) * | 2006-04-26 | 2008-08-07 | Borealis Tech Oy | Vernetzbare Polyolefinzusammensetzung enthaltend hochmolekuaren Silanolkondensationskatalysator |
| CN106433063A (zh) * | 2015-08-12 | 2017-02-22 | 普立万聚合体(上海)有限公司 | 含有蓝光阻隔添加剂的混合物 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE665978A (cs) * | 1964-06-26 | |||
| BE759101A (fr) * | 1969-11-19 | 1971-04-30 | Bayer Ag | Colorants de 3'-hydroxy-quinophtalone |
| DE2035728A1 (de) * | 1970-07-18 | 1972-01-27 | Farbenfabriken Bayer Ag, 5090 Leverkusen | Verfahren zum Färben von synthetischen Fasermaterialien mit Chinophthalonfarbstoffen aus organischen Lösungsmitteln |
| NL154241C (cs) * | 1971-01-29 | 1900-01-01 | ||
| JPS5437175B2 (cs) * | 1971-08-21 | 1979-11-13 | ||
| US3859293A (en) * | 1971-11-13 | 1975-01-07 | Sankyo Co | N-substituted spiro piperidine derivatives |
| US3790525A (en) * | 1972-01-21 | 1974-02-05 | Sankyo Co | 4-piperidone ketal derivatives,their preparation and their use as stabilizers |
-
1973
- 1973-11-27 JP JP48132912A patent/JPS5147738B2/ja not_active Expired
-
1974
- 1974-11-06 NL NLAANVRAGE7414452,A patent/NL176953C/xx not_active IP Right Cessation
- 1974-11-20 GB GB5036474A patent/GB1457702A/en not_active Expired
- 1974-11-26 CH CH1577174A patent/CH619724A5/de not_active IP Right Cessation
- 1974-11-27 US US05/527,651 patent/US3970632A/en not_active Expired - Lifetime
- 1974-11-27 FR FR7438925A patent/FR2252372B1/fr not_active Expired
- 1974-11-27 DE DE2456125A patent/DE2456125C2/de not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB1457702A (en) | 1976-12-08 |
| NL176953B (nl) | 1985-02-01 |
| DE2456125C2 (de) | 1982-09-02 |
| JPS50100136A (cs) | 1975-08-08 |
| NL7414452A (nl) | 1975-05-29 |
| US3970632A (en) | 1976-07-20 |
| FR2252372A1 (cs) | 1975-06-20 |
| FR2252372B1 (cs) | 1978-02-24 |
| DE2456125A1 (de) | 1975-05-28 |
| NL176953C (nl) | 1985-07-01 |
| JPS5147738B2 (cs) | 1976-12-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH619724A5 (cs) | ||
| DE1769646C3 (de) | Stabilisierung von synthetischen Polymeren | |
| DE2844782C2 (cs) | ||
| DE3031591A1 (de) | Polypropylenzusammensetzung | |
| DE3517798A1 (de) | Polymere, sterisch gehinderte amine | |
| EP0001840A2 (de) | Stabilisatorgemische, Verfahren zum Stabilisieren von Kunststoffen gegen Licht mit diesen Gemischen und so stabilisierte Kunststoffe | |
| DE2851448C2 (cs) | ||
| DE2926897A1 (de) | Neue stabilisatoren | |
| EP0044499A1 (de) | Triazinylaminotriazine, ihre Herstellung, ihre Verwendung zum Stabilisieren von synthetischen Polymeren sowie die mit ihnen stabilisierten Produkte | |
| EP0019578B1 (de) | Piperidinverbindungen, Verfahren zu deren Herstellung und diese enthaltende polymere Zusammensetzungen | |
| DE2265271A1 (de) | Piperidin-spiro-hydantoin-derivate und ihre verwendung als stabilisatoren | |
| DE2030908B2 (de) | Gegen Photo- und Thermozersetzung stabilisierte synthetische Polymere | |
| EP0000487A1 (de) | Enolgruppen enthaltende Verbindungen, deren Metallchelate, deren Herstellung und Verwendung als Lichtschutzmittel insbesondere in hochmolekularen Verbindungen. | |
| CH676242A5 (cs) | ||
| EP1263856B1 (de) | Stabilisatorzusammensetzung | |
| EP0208264A1 (de) | 1-Oxa-3-oxo-4,8-diaza-spiro-[4,5]decan-Verbindungen | |
| DE19738615A1 (de) | Neue Lichtschutzmittel auf Basis von sterisch gehinderten Aminen | |
| DE2456735A1 (de) | Verbindungen zum stabilisieren von organischen materialien | |
| EP0008084A1 (de) | Neue Harnstoffderivate, ihre Herstellung und ihre Verwendung als Lichtschutzmittel für Polymere | |
| DE2500314A1 (de) | Stabilisierung von polyolefinen, die anorganische pigmente enthalten, gegen lichtabbau | |
| DE2625967C2 (de) | Neue Lichtschutzmittel, ihre Herstellung und Verwendung | |
| DE2203447A1 (de) | Diazepinon als Stabilisator | |
| EP0094605A2 (de) | Polyalkyldiazaspirodecanderivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Stabilisatoren | |
| EP1458802A1 (de) | Stabilisatorzusammensetzung i | |
| EP0638106B1 (de) | Aminoverbindungen als verarbeitungsstabilisatoren für thermoplastische kunststoffe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |