CH571517A5 - - Google Patents
Info
- Publication number
- CH571517A5 CH571517A5 CH1567572A CH1567572A CH571517A5 CH 571517 A5 CH571517 A5 CH 571517A5 CH 1567572 A CH1567572 A CH 1567572A CH 1567572 A CH1567572 A CH 1567572A CH 571517 A5 CH571517 A5 CH 571517A5
- Authority
- CH
- Switzerland
- Prior art keywords
- formula
- methyl
- compounds
- dimethoxy
- phenyl
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 24
- 239000002253 acid Substances 0.000 claims description 9
- 150000003839 salts Chemical class 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 8
- -1 aminophenyl Chemical group 0.000 claims description 7
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- 125000005504 styryl group Chemical group 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 239000003795 chemical substances by application Substances 0.000 claims description 5
- 125000003884 phenylalkyl group Chemical group 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- FLBAYUMRQUHISI-UHFFFAOYSA-N 1,8-naphthyridine Chemical compound N1=CC=CC2=CC=CN=C21 FLBAYUMRQUHISI-UHFFFAOYSA-N 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- 125000000242 4-chlorobenzoyl group Chemical group ClC1=CC=C(C(=O)*)C=C1 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 description 5
- 239000012043 crude product Substances 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 208000010110 spontaneous platelet aggregation Diseases 0.000 description 2
- WOGITNXCNOTRLK-VOTSOKGWSA-N (e)-3-phenylprop-2-enoyl chloride Chemical compound ClC(=O)\C=C\C1=CC=CC=C1 WOGITNXCNOTRLK-VOTSOKGWSA-N 0.000 description 1
- ONIKNECPXCLUHT-UHFFFAOYSA-N 2-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1Cl ONIKNECPXCLUHT-UHFFFAOYSA-N 0.000 description 1
- GPZXFICWCMCQPF-UHFFFAOYSA-N 2-methylbenzoyl chloride Chemical compound CC1=CC=CC=C1C(Cl)=O GPZXFICWCMCQPF-UHFFFAOYSA-N 0.000 description 1
- VMZCDNSFRSVYKQ-UHFFFAOYSA-N 2-phenylacetyl chloride Chemical compound ClC(=O)CC1=CC=CC=C1 VMZCDNSFRSVYKQ-UHFFFAOYSA-N 0.000 description 1
- LJGHYPLBDBRCRZ-UHFFFAOYSA-N 3-(3-aminophenyl)sulfonylaniline Chemical group NC1=CC=CC(S(=O)(=O)C=2C=C(N)C=CC=2)=C1 LJGHYPLBDBRCRZ-UHFFFAOYSA-N 0.000 description 1
- APYAEEZOKBYDSX-UHFFFAOYSA-N 4-(8,9-dimethoxy-2-methyl-3,4,4a,10b-tetrahydro-1h-benzo[c][1,6]naphthyridin-6-yl)aniline Chemical compound C1=2C=C(OC)C(OC)=CC=2C2CN(C)CCC2N=C1C1=CC=C(N)C=C1 APYAEEZOKBYDSX-UHFFFAOYSA-N 0.000 description 1
- XTWYTFMLZFPYCI-KQYNXXCUSA-N 5'-adenylphosphoric acid Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](COP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O XTWYTFMLZFPYCI-KQYNXXCUSA-N 0.000 description 1
- XTWYTFMLZFPYCI-UHFFFAOYSA-N Adenosine diphosphate Natural products C1=NC=2C(N)=NC=NC=2N1C1OC(COP(O)(=O)OP(O)(O)=O)C(O)C1O XTWYTFMLZFPYCI-UHFFFAOYSA-N 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- MXMOTZIXVICDSD-UHFFFAOYSA-N anisoyl chloride Chemical compound COC1=CC=C(C(Cl)=O)C=C1 MXMOTZIXVICDSD-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- XMSZANIMCDLNKA-UHFFFAOYSA-N methyl hypofluorite Chemical group COF XMSZANIMCDLNKA-UHFFFAOYSA-N 0.000 description 1
- 230000004089 microcirculation Effects 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 230000003285 pharmacodynamic effect Effects 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000012730 sustained-release form Substances 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 230000009424 thromboembolic effect Effects 0.000 description 1
- 230000001960 triggered effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Priority Applications (12)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1567572A CH571517A5 (enExample) | 1972-10-26 | 1972-10-26 | |
| US407418A US3862153A (en) | 1972-10-26 | 1973-10-18 | Cis-6-(acylaminophenyl)-8,9-dimethoxy-2-methyl-1,2,3,4,4a, 10b-hexahydro-benzo {8 c{9 -{8 1,6{9 {0 naphthyridine |
| NL7314396A NL7314396A (enExample) | 1972-10-26 | 1973-10-19 | |
| US408053A US3899494A (en) | 1970-05-13 | 1973-10-19 | Substituted 6-phenyl benzo-naphthyridines |
| DE19732352909 DE2352909A1 (de) | 1972-10-26 | 1973-10-22 | Verfahren zur herstellung neuer heterocyclischer verbindungen |
| HUSA002548 HU166630B (enExample) | 1972-10-26 | 1973-10-24 | |
| JP48119082A JPS4976900A (enExample) | 1972-10-26 | 1973-10-24 | |
| AU61775/73A AU6177573A (en) | 1972-10-26 | 1973-10-24 | Organic compounds |
| DD174266*A DD107457A5 (enExample) | 1972-10-26 | 1973-10-24 | |
| BE137082A BE806532A (fr) | 1972-10-26 | 1973-10-25 | Nouveaux derives de la naphtyridine, leur preparation et leur application comme medicaments |
| FR7338197A FR2204418A1 (en) | 1972-10-26 | 1973-10-26 | 8,9-Dimethoxy-6-acylaminophenyl-2-methyl benzo(c) (1,6)-naphthyridines - used to inhibit aggregation of blood platelets |
| US05/575,523 US3966938A (en) | 1972-10-26 | 1975-05-08 | Treatment of thrombosis and the inhibition of blood platelet aggregation |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1567572A CH571517A5 (enExample) | 1972-10-26 | 1972-10-26 | |
| US407418A US3862153A (en) | 1972-10-26 | 1973-10-18 | Cis-6-(acylaminophenyl)-8,9-dimethoxy-2-methyl-1,2,3,4,4a, 10b-hexahydro-benzo {8 c{9 -{8 1,6{9 {0 naphthyridine |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH571517A5 true CH571517A5 (enExample) | 1976-01-15 |
Family
ID=25716838
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1567572A CH571517A5 (enExample) | 1970-05-13 | 1972-10-26 |
Country Status (3)
| Country | Link |
|---|---|
| US (1) | US3862153A (enExample) |
| BE (1) | BE806532A (enExample) |
| CH (1) | CH571517A5 (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4087530A (en) * | 1974-02-05 | 1978-05-02 | Sandoz Ltd. | Substituted 6-phenyl-octahydrobenzo [c] [1,6] naphthyridines |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3420818A (en) * | 1964-08-07 | 1969-01-07 | Sandoz Ag | Tetrahydroisoquinolines |
| US3682926A (en) * | 1971-04-19 | 1972-08-08 | Archer Sydney | Tetrahydroiso quinolinecarboxamides |
-
1972
- 1972-10-26 CH CH1567572A patent/CH571517A5/de not_active IP Right Cessation
-
1973
- 1973-10-18 US US407418A patent/US3862153A/en not_active Expired - Lifetime
- 1973-10-25 BE BE137082A patent/BE806532A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| BE806532A (fr) | 1974-04-25 |
| US3862153A (en) | 1975-01-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0528922B1 (de) | Neue sulfonylverbindungen | |
| DE69110685T2 (de) | Substituierte imidazobenzazepine und imidazopyridoazepine. | |
| DD263772A5 (de) | Verfahren zur herstellung neuer 1h, 3h-pyrrolo[1,2-c]thiazolderivate | |
| EP0089028B1 (de) | Neue Theophyllin-Derivate und Verfahren zu ihrer Herstellung | |
| DE69406425T2 (de) | Trizyklische heterozyklische verbindungen als 5-ht4 rezeptorantagonisten | |
| CH571517A5 (enExample) | ||
| DE69520876T2 (de) | Gamma-diketonverbindung mit thrombozytenaggregationshemmender wirkung | |
| CH625789A5 (enExample) | ||
| CH575413A5 (en) | 8,9-Dimethoxy-6-acylaminophenyl-2-methyl benzo(c) (1,6)-naphthyridines - used to inhibit aggregation of blood platelets | |
| DE3248094C1 (de) | 7H-Dibenzo(a,c)cyclohepten-5-on(7)-Derivate,Verfahren zu deren Herstellung und deren Verwendung bei der Bekaempfung psychischer Erkrankungen und von Magen-und/oder Darmgeschwueren | |
| DE3722134A1 (de) | 3-sulfonyl-3,7-diazabicyclo(3,3,1)nonan- verbindungen sowie verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| AT337182B (de) | Verfahren zur herstellung neuer 4-(4-piperidyliden)-4h-benzo(4,5)cyclohepta (1,2-b) thiophen-derivate und ihrer saureadditionssalze | |
| DE2352909A1 (de) | Verfahren zur herstellung neuer heterocyclischer verbindungen | |
| AT314537B (de) | Verfahren zur Herstellung von neuen 1,3,4,9b-Tetrahydro-2H-indeno[1,2-c]pyridinen und ihren Säureadditionssalzen | |
| AT360537B (de) | Verfahren zur herstellung neuer 1,4-dihydro- pyridinderivate | |
| AT367402B (de) | Verfahren zur herstellung von neuen 1,4dihydropyridinverbindungen | |
| AT338790B (de) | Verfahren zur herstellung von neuen chinolinessigsaurederivaten und ihren salzen | |
| CH572055A5 (en) | 8,9-Dimethoxy-6-acylaminophenyl-2-methyl benzo(c) (1,6)-naphthyridines - used to inhibit aggregation of blood platelets | |
| CH571521A5 (en) | 8,9-Dimethoxy-6-acylaminophenyl-2-methyl benzo(c) (1,6)-naphthyridines - used to inhibit aggregation of blood platelets | |
| AT211001B (de) | Verfahren zur Herstellung von neuen Scopin-äthern | |
| AT204551B (de) | Verfahren zur Herstellung von neuen Pyrazolon-Derivaten | |
| CH561207A5 (en) | 3-(Cyclo)alkylidenehydrazino-6-acyl-pyrido(4,3-c)pyridazines - with antihypertensive activity | |
| CH559748A5 (en) | Antihypertensive 3-hydrazinopyrido (4,3-c) py-ridazines - prepd. from corresp. 3-halopyrido(4,3-c)pyridazines and hydrazine hydrate | |
| CH532067A (de) | Verfahren zur Herstellung neuer Benzo (c) (1,6) naphthyridine | |
| DE2201994A1 (de) | Verfahren zur Herstellung neuer heterocyclischer Verbindungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |