CH562852A5 - Perylene tetracarboxylic diimide dyes - contg n-substd pyrazole groups,for mass-colouring of plastics - Google Patents
Perylene tetracarboxylic diimide dyes - contg n-substd pyrazole groups,for mass-colouring of plasticsInfo
- Publication number
- CH562852A5 CH562852A5 CH1208872A CH1208872A CH562852A5 CH 562852 A5 CH562852 A5 CH 562852A5 CH 1208872 A CH1208872 A CH 1208872A CH 1208872 A CH1208872 A CH 1208872A CH 562852 A5 CH562852 A5 CH 562852A5
- Authority
- CH
- Switzerland
- Prior art keywords
- parts
- sep
- dye
- paste
- orange
- Prior art date
Links
- 239000000975 dye Substances 0.000 title claims abstract description 46
- 239000004033 plastic Substances 0.000 title claims abstract description 12
- 229920003023 plastic Polymers 0.000 title claims abstract description 12
- 238000004040 coloring Methods 0.000 title claims abstract description 6
- NAZODJSYHDYJGP-UHFFFAOYSA-N 7,18-bis[2,6-di(propan-2-yl)phenyl]-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone Chemical compound CC(C)C1=CC=CC(C(C)C)=C1N(C(=O)C=1C2=C3C4=CC=1)C(=O)C2=CC=C3C(C=C1)=C2C4=CC=C3C(=O)N(C=4C(=CC=CC=4C(C)C)C(C)C)C(=O)C1=C23 NAZODJSYHDYJGP-UHFFFAOYSA-N 0.000 title 1
- 125000003226 pyrazolyl group Chemical group 0.000 title 1
- JVVRJMXHNUAPHW-UHFFFAOYSA-N 1h-pyrazol-5-amine Chemical compound NC=1C=CNN=1 JVVRJMXHNUAPHW-UHFFFAOYSA-N 0.000 claims abstract description 12
- FVDOBFPYBSDRKH-UHFFFAOYSA-N perylene-3,4,9,10-tetracarboxylic acid Chemical compound C=12C3=CC=C(C(O)=O)C2=C(C(O)=O)C=CC=1C1=CC=C(C(O)=O)C2=C1C3=CC=C2C(=O)O FVDOBFPYBSDRKH-UHFFFAOYSA-N 0.000 claims abstract description 12
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 10
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 9
- 229910052794 bromium Inorganic materials 0.000 claims abstract description 7
- 238000004043 dyeing Methods 0.000 claims abstract description 7
- 239000003973 paint Substances 0.000 claims abstract description 6
- 125000003710 aryl alkyl group Chemical group 0.000 claims abstract description 5
- 125000004404 heteroalkyl group Chemical group 0.000 claims abstract description 5
- 239000000049 pigment Substances 0.000 claims abstract description 3
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 claims description 22
- -1 monochloroperylene-3,4,9,10-tetracarboxylic anhydride Chemical class 0.000 claims description 21
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 12
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 12
- 239000000460 chlorine Substances 0.000 claims description 9
- 239000000203 mixture Substances 0.000 claims description 9
- 239000004408 titanium dioxide Substances 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 8
- 238000002156 mixing Methods 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 7
- 229920000180 alkyd Polymers 0.000 claims description 7
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 7
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 6
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 6
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 6
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 5
- 238000009833 condensation Methods 0.000 claims description 5
- 230000005494 condensation Effects 0.000 claims description 5
- 239000000463 material Substances 0.000 claims description 5
- 239000008188 pellet Substances 0.000 claims description 5
- 229920000915 polyvinyl chloride Polymers 0.000 claims description 5
- 239000004800 polyvinyl chloride Substances 0.000 claims description 5
- 239000000725 suspension Substances 0.000 claims description 5
- IOPYVZVNUXHZCP-UHFFFAOYSA-N 2-(3-ethyloctan-3-yloxycarbonyl)benzoic acid Chemical compound CCCCCC(CC)(CC)OC(=O)C1=CC=CC=C1C(O)=O IOPYVZVNUXHZCP-UHFFFAOYSA-N 0.000 claims description 4
- PONZBUKBFVIXOD-UHFFFAOYSA-N 9,10-dicarbamoylperylene-3,4-dicarboxylic acid Chemical compound C=12C3=CC=C(C(O)=O)C2=C(C(O)=O)C=CC=1C1=CC=C(C(O)=N)C2=C1C3=CC=C2C(=N)O PONZBUKBFVIXOD-UHFFFAOYSA-N 0.000 claims description 4
- 239000004640 Melamine resin Substances 0.000 claims description 4
- 229920000877 Melamine resin Polymers 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 239000011230 binding agent Substances 0.000 claims description 4
- 238000001816 cooling Methods 0.000 claims description 4
- QCHIESZMDORMPC-UHFFFAOYSA-N dibutyltin;hexyl 2-hydroxyethanedithioate Chemical compound CCCC[Sn]CCCC.CCCCCCSC(=S)CO QCHIESZMDORMPC-UHFFFAOYSA-N 0.000 claims description 4
- 239000000839 emulsion Substances 0.000 claims description 4
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 claims description 4
- 239000000843 powder Substances 0.000 claims description 4
- 150000003141 primary amines Chemical class 0.000 claims description 4
- 235000012424 soybean oil Nutrition 0.000 claims description 4
- 239000003549 soybean oil Substances 0.000 claims description 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 3
- 238000001914 filtration Methods 0.000 claims description 3
- 230000007935 neutral effect Effects 0.000 claims description 3
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- VDJIKRJAJCIMPK-UHFFFAOYSA-N 1-chloroperylene-3,4,9,10-tetracarboxylic acid Chemical compound ClC1=CC(=C2C(=CC=C3C4=CC=C(C=5C(=CC=C(C1=C23)C4=5)C(=O)O)C(=O)O)C(=O)O)C(=O)O VDJIKRJAJCIMPK-UHFFFAOYSA-N 0.000 claims description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 2
- 235000010469 Glycine max Nutrition 0.000 claims description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 2
- GTDPSWPPOUPBNX-UHFFFAOYSA-N ac1mqpva Chemical compound CC12C(=O)OC(=O)C1(C)C1(C)C2(C)C(=O)OC1=O GTDPSWPPOUPBNX-UHFFFAOYSA-N 0.000 claims description 2
- POJOORKDYOPQLS-UHFFFAOYSA-L barium(2+) 5-chloro-2-[(2-hydroxynaphthalen-1-yl)diazenyl]-4-methylbenzenesulfonate Chemical compound [Ba+2].C1=C(Cl)C(C)=CC(N=NC=2C3=CC=CC=C3C=CC=2O)=C1S([O-])(=O)=O.C1=C(Cl)C(C)=CC(N=NC=2C3=CC=CC=C3C=CC=2O)=C1S([O-])(=O)=O POJOORKDYOPQLS-UHFFFAOYSA-L 0.000 claims description 2
- 229940075614 colloidal silicon dioxide Drugs 0.000 claims description 2
- 238000011010 flushing procedure Methods 0.000 claims description 2
- 229910052740 iodine Inorganic materials 0.000 claims description 2
- 239000011630 iodine Substances 0.000 claims description 2
- 239000003921 oil Substances 0.000 claims description 2
- 235000019198 oils Nutrition 0.000 claims description 2
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 claims description 2
- 238000005406 washing Methods 0.000 claims description 2
- 239000004753 textile Substances 0.000 claims 1
- 229920001169 thermoplastic Polymers 0.000 abstract description 5
- 239000003086 colorant Substances 0.000 abstract description 4
- 239000004416 thermosoftening plastic Substances 0.000 abstract description 4
- 150000008064 anhydrides Chemical class 0.000 abstract description 2
- 239000000976 ink Substances 0.000 abstract description 2
- 239000006185 dispersion Substances 0.000 abstract 1
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical compound [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 abstract 1
- 239000004793 Polystyrene Substances 0.000 description 6
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 6
- 229920002223 polystyrene Polymers 0.000 description 6
- 229920000642 polymer Polymers 0.000 description 5
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- ZOIORXHNWRGPMV-UHFFFAOYSA-N acetic acid;zinc Chemical compound [Zn].CC(O)=O.CC(O)=O ZOIORXHNWRGPMV-UHFFFAOYSA-N 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 229920001187 thermosetting polymer Polymers 0.000 description 2
- 239000004246 zinc acetate Substances 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- RELMFMZEBKVZJC-UHFFFAOYSA-N 1,2,3-trichlorobenzene Chemical compound ClC1=CC=CC(Cl)=C1Cl RELMFMZEBKVZJC-UHFFFAOYSA-N 0.000 description 1
- RABLNFZVSVWKEB-UHFFFAOYSA-N 1h-pyrazol-5-amine;hydrochloride Chemical compound Cl.NC=1C=CNN=1 RABLNFZVSVWKEB-UHFFFAOYSA-N 0.000 description 1
- IYXYXQGSWRTPHX-UHFFFAOYSA-N 2-(4-chlorophenyl)pyrazol-3-amine Chemical compound NC1=CC=NN1C1=CC=C(Cl)C=C1 IYXYXQGSWRTPHX-UHFFFAOYSA-N 0.000 description 1
- IQMRCZGRXUSTNT-UHFFFAOYSA-N 2-butylpyrazol-3-amine Chemical compound CCCCN1N=CC=C1N IQMRCZGRXUSTNT-UHFFFAOYSA-N 0.000 description 1
- 125000006282 2-chlorobenzyl group Chemical group [H]C1=C([H])C(Cl)=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000002927 2-methoxybenzyl group Chemical group [H]C1=C([H])C([H])=C(C(OC([H])([H])[H])=C1[H])C([H])([H])* 0.000 description 1
- 125000005916 2-methylpentyl group Chemical group 0.000 description 1
- ZVNYYNAAEVZNDW-UHFFFAOYSA-N 2-phenylpyrazol-3-amine Chemical compound NC1=CC=NN1C1=CC=CC=C1 ZVNYYNAAEVZNDW-UHFFFAOYSA-N 0.000 description 1
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 1
- 125000006181 4-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])C([H])([H])* 0.000 description 1
- FMKMKBLHMONXJM-UHFFFAOYSA-N 5-methyl-2-phenylpyrazol-3-amine Chemical compound N1=C(C)C=C(N)N1C1=CC=CC=C1 FMKMKBLHMONXJM-UHFFFAOYSA-N 0.000 description 1
- 239000004908 Emulsion polymer Substances 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 150000003857 carboxamides Chemical class 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000003292 glue Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000001048 orange dye Substances 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- WSRHMJYUEZHUCM-UHFFFAOYSA-N perylene-1,2,3,4-tetracarboxylic acid Chemical compound C=12C3=CC=CC2=CC=CC=1C1=C(C(O)=O)C(C(O)=O)=C(C(O)=O)C2=C1C3=CC=C2C(=O)O WSRHMJYUEZHUCM-UHFFFAOYSA-N 0.000 description 1
- 229920000058 polyacrylate Polymers 0.000 description 1
- 229920002239 polyacrylonitrile Polymers 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 229920001225 polyester resin Polymers 0.000 description 1
- 239000004645 polyester resin Substances 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000001226 reprecipitation Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
- XDWXRAYGALQIFG-UHFFFAOYSA-L zinc;propanoate Chemical compound [Zn+2].CCC([O-])=O.CCC([O-])=O XDWXRAYGALQIFG-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B5/00—Dyes with an anthracene nucleus condensed with one or more heterocyclic rings with or without carbocyclic rings
- C09B5/62—Cyclic imides or amidines of peri-dicarboxylic acids of the anthracene, benzanthrene, or perylene series
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Processes Of Treating Macromolecular Substances (AREA)
- Packages (AREA)
Priority Applications (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1208872A CH562852A5 (en) | 1972-08-15 | 1972-08-15 | Perylene tetracarboxylic diimide dyes - contg n-substd pyrazole groups,for mass-colouring of plastics |
| JP9100473A JPS4952090A (enrdf_load_stackoverflow) | 1972-08-15 | 1973-08-15 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1208872A CH562852A5 (en) | 1972-08-15 | 1972-08-15 | Perylene tetracarboxylic diimide dyes - contg n-substd pyrazole groups,for mass-colouring of plastics |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH562852A5 true CH562852A5 (en) | 1975-06-13 |
Family
ID=4379743
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1208872A CH562852A5 (en) | 1972-08-15 | 1972-08-15 | Perylene tetracarboxylic diimide dyes - contg n-substd pyrazole groups,for mass-colouring of plastics |
Country Status (2)
| Country | Link |
|---|---|
| JP (1) | JPS4952090A (enrdf_load_stackoverflow) |
| CH (1) | CH562852A5 (enrdf_load_stackoverflow) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4379934A (en) | 1980-01-19 | 1983-04-12 | Basf Aktiengesellschaft | Process for two-dimensionally concentrating light, and novel perylene-3,4,9,10-tetracarboxylic acid diimides |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5166009U (enrdf_load_stackoverflow) * | 1974-10-31 | 1976-05-25 | ||
| JPS5529413A (en) * | 1978-08-07 | 1980-03-01 | Nippon Porisero Kogyo Kk | Caffee packing method |
| DE102017202685A1 (de) * | 2017-02-20 | 2018-08-23 | Wmf Group Gmbh | Filterkapsel zur Nachfiltration von Kaffee und Verwendung hiervon |
-
1972
- 1972-08-15 CH CH1208872A patent/CH562852A5/de not_active IP Right Cessation
-
1973
- 1973-08-15 JP JP9100473A patent/JPS4952090A/ja active Pending
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4379934A (en) | 1980-01-19 | 1983-04-12 | Basf Aktiengesellschaft | Process for two-dimensionally concentrating light, and novel perylene-3,4,9,10-tetracarboxylic acid diimides |
| EP0033079B1 (de) * | 1980-01-19 | 1984-10-24 | BASF Aktiengesellschaft | Neue Perylen-3,4,9,10-tetracarbonsäurediimide und deren Verwendung |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS4952090A (enrdf_load_stackoverflow) | 1974-05-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2814526A1 (de) | Isoindolinpigmente, verfahren zu deren herstellung und verwendung | |
| DE2139688A1 (de) | Farbstoffe zum faerben von kunststoffen | |
| DE2243999A1 (de) | Neue disazopigmente, verfahren zu deren herstellung und verwendung | |
| DE2244035C3 (de) | Disazopigmente, Verfahren zu deren Herstellung und ihre Verwendung zum Pigmentieren von hochmolekularem organischen Material | |
| CH562852A5 (en) | Perylene tetracarboxylic diimide dyes - contg n-substd pyrazole groups,for mass-colouring of plastics | |
| DE2157547C3 (enrdf_load_stackoverflow) | ||
| DE2146027A1 (de) | Farbstoffe der perylentetracarbonsaeurediimidreihe | |
| EP0190692B1 (de) | Bis-isoindolinpigmente und ihre Verwendung | |
| DE2532540A1 (de) | Neue disazopigmente und verfahren zu deren herstellung | |
| DE2147024A1 (de) | Farbstoffe der perylentetracarbonsaeurediimidreihe | |
| DE2145422C3 (de) | Neue Disazopigmente | |
| DE2429286C2 (de) | Neue Disazopigmente, Verfahren zu deren Herstellung und deren Verwendung | |
| DE2616486A1 (de) | Farbstoffe der perylentetracarbonsaeurediimidreihe | |
| DE2728864A1 (de) | Metallkomplexpigmente | |
| DE2210170A1 (de) | Farbstoff der perylentetracarbonsaeurediimidreihe | |
| DE2420941A1 (de) | Neue monoazopigmente, verfahren zu deren herstellung und verwendung | |
| DE2441924C3 (de) | Disazopigmentfarbstoffe | |
| DE2739041A1 (de) | Verfahren zum pigmentieren von hochmolekularem organischem material | |
| DE3049215A1 (de) | Perylentetracarbonsaeurediimid und dessen verwendung | |
| EP0006154B1 (de) | Monoazopigmente und deren Verwendung zum Pigmentieren von hochmolekularem organischem Material | |
| DE3007329A1 (de) | Isoindolinfarbstoffe | |
| DE2447228A1 (de) | Perinon-verbindungen, verfahren zu deren herstellung und ihre verwendung als farbmittel | |
| DE2451784A1 (de) | Farbstoffe der perylen-3,4,9-10- tetracarbonsaeurediimid-reihe | |
| DE1569710C (de) | Disazomethin Pigmente , Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE2451782C3 (de) | Perylen^&lO-tetracarbonsäurediimidfarbstoffe und ihre Verwendung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |