CH500963A - Verfahren zur Herstellung von 2,3-Dihydro-2,2-dimethyl-7-benzofuranol - Google Patents
Verfahren zur Herstellung von 2,3-Dihydro-2,2-dimethyl-7-benzofuranolInfo
- Publication number
- CH500963A CH500963A CH257467A CH257467A CH500963A CH 500963 A CH500963 A CH 500963A CH 257467 A CH257467 A CH 257467A CH 257467 A CH257467 A CH 257467A CH 500963 A CH500963 A CH 500963A
- Authority
- CH
- Switzerland
- Prior art keywords
- dihydro
- dimethyl
- benzofuranol
- carried out
- rearrangement
- Prior art date
Links
- WJGPNUBJBMCRQH-UHFFFAOYSA-N 2,2-dimethyl-2,3-dihydro-1-benzofuran-7-ol Chemical compound C1=CC(O)=C2OC(C)(C)CC2=C1 WJGPNUBJBMCRQH-UHFFFAOYSA-N 0.000 title claims abstract description 13
- 238000002360 preparation method Methods 0.000 title claims abstract description 10
- 239000000543 intermediate Substances 0.000 title abstract description 3
- DUEPRVBVGDRKAG-UHFFFAOYSA-N carbofuran Chemical compound CNC(=O)OC1=CC=CC2=C1OC(C)(C)C2 DUEPRVBVGDRKAG-UHFFFAOYSA-N 0.000 title abstract 2
- VOQBBFRDEFSEKW-UHFFFAOYSA-N 1-(2,2-dimethyl-3h-1-benzofuran-7-yl)ethanone Chemical compound CC(=O)C1=CC=CC2=C1OC(C)(C)C2 VOQBBFRDEFSEKW-UHFFFAOYSA-N 0.000 claims abstract description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 19
- 238000000034 method Methods 0.000 claims description 17
- 238000006243 chemical reaction Methods 0.000 claims description 16
- 239000003054 catalyst Substances 0.000 claims description 11
- ZWVHTXAYIKBMEE-UHFFFAOYSA-N 2-hydroxyacetophenone Chemical compound OCC(=O)C1=CC=CC=C1 ZWVHTXAYIKBMEE-UHFFFAOYSA-N 0.000 claims description 7
- 150000001875 compounds Chemical class 0.000 claims description 7
- 230000008707 rearrangement Effects 0.000 claims description 7
- 238000007363 ring formation reaction Methods 0.000 claims description 7
- LKMZGTIBHBYUOW-UHFFFAOYSA-N (2,2-dimethyl-3h-1-benzofuran-7-yl) acetate Chemical compound CC(=O)OC1=CC=CC2=C1OC(C)(C)C2 LKMZGTIBHBYUOW-UHFFFAOYSA-N 0.000 claims description 6
- 238000010438 heat treatment Methods 0.000 claims description 5
- -1 methallyl halide Chemical class 0.000 claims description 5
- 230000002378 acidificating effect Effects 0.000 claims description 4
- 238000006462 rearrangement reaction Methods 0.000 claims description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 239000003513 alkali Substances 0.000 claims description 2
- 238000010992 reflux Methods 0.000 claims description 2
- 230000001419 dependent effect Effects 0.000 claims 4
- 230000015572 biosynthetic process Effects 0.000 claims 2
- AMJUWROQAOGQPZ-UHFFFAOYSA-N [O].CC(=O)OO Chemical compound [O].CC(=O)OO AMJUWROQAOGQPZ-UHFFFAOYSA-N 0.000 claims 1
- 230000003647 oxidation Effects 0.000 claims 1
- 238000007254 oxidation reaction Methods 0.000 claims 1
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 abstract description 18
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 abstract description 15
- 239000002904 solvent Substances 0.000 abstract description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 abstract description 6
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 abstract description 6
- 239000000203 mixture Substances 0.000 abstract description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 abstract description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 abstract description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical compound OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 description 6
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 5
- 238000004458 analytical method Methods 0.000 description 5
- 238000009835 boiling Methods 0.000 description 5
- 230000007062 hydrolysis Effects 0.000 description 5
- 238000006460 hydrolysis reaction Methods 0.000 description 5
- 239000000243 solution Substances 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- OHXAOPZTJOUYKM-UHFFFAOYSA-N 3-Chloro-2-methylpropene Chemical compound CC(=C)CCl OHXAOPZTJOUYKM-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 238000005481 NMR spectroscopy Methods 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 239000000370 acceptor Substances 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 2
- 229910001629 magnesium chloride Inorganic materials 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- AAXBKJXGVXNSHI-UHFFFAOYSA-N 2-(2-methylprop-2-enoxy)phenol Chemical compound CC(=C)COC1=CC=CC=C1O AAXBKJXGVXNSHI-UHFFFAOYSA-N 0.000 description 1
- YNJSNEKCXVFDKW-UHFFFAOYSA-N 3-(5-amino-1h-indol-3-yl)-2-azaniumylpropanoate Chemical compound C1=C(N)C=C2C(CC(N)C(O)=O)=CNC2=C1 YNJSNEKCXVFDKW-UHFFFAOYSA-N 0.000 description 1
- USEGQJLHQSTGHW-UHFFFAOYSA-N 3-bromo-2-methylprop-1-ene Chemical compound CC(=C)CBr USEGQJLHQSTGHW-UHFFFAOYSA-N 0.000 description 1
- ATVJXMYDOSMEPO-UHFFFAOYSA-N 3-prop-2-enoxyprop-1-ene Chemical compound C=CCOCC=C ATVJXMYDOSMEPO-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 230000000749 insecticidal effect Effects 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/79—Benzo [b] furans; Hydrogenated benzo [b] furans with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/68—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
- C07C45/70—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form
- C07C45/71—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form being hydroxy groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/86—Benzo [b] furans; Hydrogenated benzo [b] furans with an oxygen atom directly attached in position 7
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Furan Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US529268A US3419579A (en) | 1966-02-23 | 1966-02-23 | Synthesis of 2,3-dihydro-2,2-dimethyl-7-benzofuranol |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH500963A true CH500963A (de) | 1970-12-31 |
Family
ID=24109191
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH257467A CH500963A (de) | 1966-02-23 | 1967-02-22 | Verfahren zur Herstellung von 2,3-Dihydro-2,2-dimethyl-7-benzofuranol |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3419579A (en:Method) |
| BE (1) | BE694120A (en:Method) |
| CH (1) | CH500963A (en:Method) |
| DE (1) | DE1593855B1 (en:Method) |
| DK (1) | DK115632B (en:Method) |
| FR (1) | FR1511399A (en:Method) |
| GB (1) | GB1170333A (en:Method) |
| IL (1) | IL27333A (en:Method) |
| NL (1) | NL6702645A (en:Method) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4118400A (en) * | 1977-09-22 | 1978-10-03 | Fmc Corporation | Process for preparing 2,3-dihydro-7-benzofuranols and benzodioxole intermediate therefor |
| DE2932458A1 (de) * | 1979-08-10 | 1981-02-26 | Bayer Ag | Herstellung von monoalkylethern von hydroxyphenolen und deren umwandlung zu hydroxycumaranen |
| US4380654A (en) * | 1982-02-18 | 1983-04-19 | Fmc Corporation | Process for preparation of 2,3-dihydro-2,2-dimethyl-7-hydroxybenzofuran |
| US7174823B2 (en) | 2004-09-22 | 2007-02-13 | Irwin Industrial Tool Company | Saw blade having increased tooth stiffness and resistance to fatigue failure |
| WO2022207123A1 (de) * | 2021-04-03 | 2022-10-06 | Symrise Ag | Herstellungsverfahren für polycyclische riechstoffe |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2937188A (en) * | 1951-11-15 | 1960-05-17 | Gen Aniline & Film Corp | 2-methyl 2, 3-dihydrobenzofurancarboxylic acids and acid halides |
| NL131921C (en:Method) * | 1963-06-28 | |||
| US3474170A (en) * | 1964-01-23 | 1969-10-21 | Fmc Corp | Pesticidal carbamates of dihydrobenzofuranols |
| US3356690A (en) * | 1965-02-04 | 1967-12-05 | Fmc Corp | Synthesis of 2, 3-dihydro-2, 2-dimethyl-7-benzofuranyl nu-methylcarbamate |
-
1966
- 1966-02-23 US US529268A patent/US3419579A/en not_active Expired - Lifetime
-
1967
- 1967-01-26 IL IL27333A patent/IL27333A/xx unknown
- 1967-02-13 DK DK77867AA patent/DK115632B/da unknown
- 1967-02-14 FR FR94932A patent/FR1511399A/fr not_active Expired
- 1967-02-15 BE BE694120D patent/BE694120A/xx unknown
- 1967-02-16 GB GB7459/67A patent/GB1170333A/en not_active Expired
- 1967-02-21 NL NL6702645A patent/NL6702645A/xx unknown
- 1967-02-22 CH CH257467A patent/CH500963A/de not_active IP Right Cessation
- 1967-02-23 DE DE19671593855 patent/DE1593855B1/de active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| DK115632B (da) | 1969-10-27 |
| GB1170333A (en) | 1969-11-12 |
| BE694120A (en:Method) | 1967-08-16 |
| US3419579A (en) | 1968-12-31 |
| FR1511399A (fr) | 1968-01-26 |
| NL6702645A (en:Method) | 1967-08-24 |
| DE1593855B1 (de) | 1972-04-27 |
| IL27333A (en) | 1970-09-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH624102A5 (en:Method) | ||
| DE2533920C2 (de) | Verfahren zur Herstellung von Resorcinen | |
| CH500963A (de) | Verfahren zur Herstellung von 2,3-Dihydro-2,2-dimethyl-7-benzofuranol | |
| DD229126A5 (de) | Verfahren zur herstellung von tetronsaeure | |
| EP0001980B1 (de) | Verfahren zur Herstellung von Halogenvinyl-gamma-butyrolactonen, sowie Zwischenprodukte und ihre Herstellung | |
| DE2608932C2 (de) | Verfahren zur Herstellung von 3-Oxy-4H-pyran-4-on-Derivaten | |
| DE2404158C3 (de) | Verfahren zur Herstellung eines 2-(4-Alkylphenyl)-propion-aldehyds | |
| DE3122995C2 (en:Method) | ||
| DE1543569B1 (de) | Verfahren zur Herstellung von 2,3-Dihydro-2,2-dimethyl-7-benzofuranol | |
| DE1543573B1 (de) | Verfahren zur Herstellung von 2,3-Dihydro-2,2-dimethyl-7-benzofuranol | |
| DE2263527C3 (de) | 2,2-Disubstituierte Phenylacetonitril-Derivate, Verfahren zu ihrer Herstellung und deren Verwendung | |
| DE3338853C2 (de) | Verfahren zur Herstellung von 2-Cyclopentenonen | |
| DE2914166A1 (de) | Arylsubstituierte furane und verfahren zu ihrer herstellung | |
| CH500964A (de) | Verfahren zur Herstellung von 2,3-Dihydro-2,2,4-trimethyl-7-benzofuranol | |
| DE1593855C (de) | Verfahren zur Herstellung von 2,3-Dihydro-2,2-dimethyl-7-benzofuranol | |
| DE69229017T2 (de) | Glyceraldehyd-3-pentanid und Verfahren zu ihrer Herstellung | |
| DE69013773T2 (de) | Verfahren zur Herstellung von Polyalkyl-2-alkoxy-7-hydroxychromanderivate. | |
| US2526859A (en) | Catalytic hydrogenation of betanaphthol to produce beta-tetralone | |
| DE2254609A1 (de) | Verfahren zur herstellung von 2.3dihydro-2.2-dimethyl-7-benzofuranyl-n-methylcarbamat (carbofuran) | |
| DE2143989B2 (de) | Verfahren zur Herstellung von 2-Methyl-pyridin-3-ol-Derivaten | |
| DE2150146B2 (de) | Verfahren zur Herstellung von Flavon-7-oxyessigsäureäthylester | |
| DE1543569C (de) | Verfahren zur Herstellung von 2,3 Dihydro 2, dimethyl 7 benzofuranol | |
| AT381938B (de) | Verfahren zur herstellung von neuen spirobenzofuranonverbindungen | |
| DE3237632A1 (de) | Verfahren zur herstellung langkettiger linearer wachsalkohole | |
| DE2705927C2 (de) | Verfahren zur Herstellung von A-B-Ring aromatischen Steroiden |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |