CH497437A - Verfahren zur Herstellung von Benzotriazolen - Google Patents
Verfahren zur Herstellung von BenzotriazolenInfo
- Publication number
- CH497437A CH497437A CH478968A CH478968A CH497437A CH 497437 A CH497437 A CH 497437A CH 478968 A CH478968 A CH 478968A CH 478968 A CH478968 A CH 478968A CH 497437 A CH497437 A CH 497437A
- Authority
- CH
- Switzerland
- Prior art keywords
- sep
- benzotriazole
- acetic acid
- formula
- alkyl
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 10
- 238000002360 preparation method Methods 0.000 title claims description 4
- 150000001565 benzotriazoles Chemical class 0.000 title description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 36
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 12
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzenecarboxaldehyde Natural products O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 claims description 10
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical compound C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 claims description 6
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 239000012964 benzotriazole Substances 0.000 claims description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 4
- -1 NO .. Chemical group 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- 150000003935 benzaldehydes Chemical class 0.000 claims description 3
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 229910006069 SO3H Inorganic materials 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 125000005842 heteroatom Chemical group 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 239000011593 sulfur Substances 0.000 claims description 2
- 125000003354 benzotriazolyl group Chemical class N1N=NC2=C1C=CC=C2* 0.000 claims 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- BQCIJWPKDPZNHD-UHFFFAOYSA-N 5-bromo-2h-benzotriazole Chemical compound C1=C(Br)C=CC2=NNN=C21 BQCIJWPKDPZNHD-UHFFFAOYSA-N 0.000 description 8
- 239000013078 crystal Substances 0.000 description 8
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 7
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 7
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- 238000003756 stirring Methods 0.000 description 5
- XLLIQLLCWZCATF-UHFFFAOYSA-N 2-methoxyethyl acetate Chemical compound COCCOC(C)=O XLLIQLLCWZCATF-UHFFFAOYSA-N 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- PBKONEOXTCPAFI-UHFFFAOYSA-N 1,2,4-trichlorobenzene Chemical compound ClC1=CC=C(Cl)C(Cl)=C1 PBKONEOXTCPAFI-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- LRUDIIUSNGCQKF-UHFFFAOYSA-N 5-methyl-1H-benzotriazole Chemical compound C1=C(C)C=CC2=NNN=C21 LRUDIIUSNGCQKF-UHFFFAOYSA-N 0.000 description 2
- SWGKVHBMCWCGHR-UHFFFAOYSA-N 5-nitro-2-(2-phenylethenyl)benzotriazole Chemical compound N1=C2C=C([N+](=O)[O-])C=CC2=NN1C=CC1=CC=CC=C1 SWGKVHBMCWCGHR-UHFFFAOYSA-N 0.000 description 2
- 235000005811 Viola adunca Nutrition 0.000 description 2
- 240000009038 Viola odorata Species 0.000 description 2
- 235000013487 Viola odorata Nutrition 0.000 description 2
- 235000002254 Viola papilionacea Nutrition 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- ATACSYDDCNWCLV-UHFFFAOYSA-N 2-chloroacetic acid;sodium Chemical compound [Na].OC(=O)CCl ATACSYDDCNWCLV-UHFFFAOYSA-N 0.000 description 1
- SKLUWKYNZNXSLX-UHFFFAOYSA-N 4-Acetamidobenzaldehyde Chemical compound CC(=O)NC1=CC=C(C=O)C=C1 SKLUWKYNZNXSLX-UHFFFAOYSA-N 0.000 description 1
- AOCDQWRMYHJTMY-UHFFFAOYSA-N 5-nitro-2h-benzotriazole Chemical compound C1=C([N+](=O)[O-])C=CC2=NNN=C21 AOCDQWRMYHJTMY-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- JCXJVPUVTGWSNB-UHFFFAOYSA-N Nitrogen dioxide Chemical group O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 1
- 229940106681 chloroacetic acid Drugs 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- UIIMBOGNXHQVGW-UHFFFAOYSA-N sodium;hydron;carbonate Chemical compound [Na+].OC(O)=O UIIMBOGNXHQVGW-UHFFFAOYSA-N 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/16—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms condensed with carbocyclic rings or ring systems
- C07D249/18—Benzotriazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Lubricants (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF0051999 | 1967-04-01 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH497437A true CH497437A (de) | 1970-10-15 |
Family
ID=7105091
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH478968A CH497437A (de) | 1967-04-01 | 1968-04-01 | Verfahren zur Herstellung von Benzotriazolen |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3505318A (enExample) |
| JP (1) | JPS4817452B1 (enExample) |
| AT (1) | AT273114B (enExample) |
| BE (1) | BE712988A (enExample) |
| CH (1) | CH497437A (enExample) |
| FR (1) | FR1560056A (enExample) |
| GB (1) | GB1174365A (enExample) |
| NL (1) | NL6803958A (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2601469A1 (de) * | 1976-01-16 | 1977-07-21 | Bayer Ag | Weisstoener, deren herstellung und verwendung |
| IL91997A0 (en) * | 1988-11-03 | 1990-07-12 | American Cyanamid Co | Aryloxy benzotriazole herbicidal agents and methods for the preparation thereof |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3101333A (en) * | 1963-08-20 | Stilbyl-acenaphthenotriazole | ||
| US2784184A (en) * | 1957-03-05 | - methyl - | ||
| BE442515A (enExample) * | 1940-07-30 |
-
1968
- 1968-03-20 NL NL6803958A patent/NL6803958A/xx unknown
- 1968-03-25 GB GB04177/68A patent/GB1174365A/en not_active Expired
- 1968-03-29 FR FR1560056D patent/FR1560056A/fr not_active Expired
- 1968-03-29 BE BE712988D patent/BE712988A/xx unknown
- 1968-03-29 US US717397A patent/US3505318A/en not_active Expired - Lifetime
- 1968-04-01 JP JP43021175A patent/JPS4817452B1/ja active Pending
- 1968-04-01 CH CH478968A patent/CH497437A/de not_active IP Right Cessation
- 1968-04-01 AT AT315868A patent/AT273114B/de active
Also Published As
| Publication number | Publication date |
|---|---|
| NL6803958A (enExample) | 1968-10-02 |
| JPS4817452B1 (enExample) | 1973-05-29 |
| GB1174365A (en) | 1969-12-17 |
| US3505318A (en) | 1970-04-07 |
| AT273114B (de) | 1969-08-11 |
| DE1670841A1 (de) | 1971-03-11 |
| BE712988A (enExample) | 1968-07-31 |
| DE1670841B2 (de) | 1975-06-19 |
| FR1560056A (enExample) | 1969-03-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0380712B1 (de) | Verfahren zur Herstellung von 2,6-Dichlordiphenylaminessigsäurederivaten | |
| CH497437A (de) | Verfahren zur Herstellung von Benzotriazolen | |
| DE1670841C3 (de) | Verfahren zur Herstellung von 2-Styryl-benzotriazolen | |
| DE2528698C3 (de) | 7-Sulfonylacetylamino-substituierte Cumarinverbindungen und ein Verfahren zu deren Herstellung sowie die Verwendung dieser Verbindungen zur Herstellung von optischer Cumarin-Aufhellern | |
| DE2242784C3 (de) | Verfahren zur Herstellung von 2-Aryl-v-triazolen | |
| DE2501859A1 (de) | Verfahren zur herstellung von cyclopentandionen | |
| DE2353580C2 (de) | Verfahren zur Herstellung von o-Acylamino-diarylverbindungen | |
| EP0019182B1 (de) | Benzofuranverbindungen sowie deren Verwendung als optische Aufheller | |
| DE939151C (de) | Verfahren zur Herstellung von Aminocarbonsaeure-N, N-alkylenimiden | |
| DE1077222B (de) | Verfahren zur Herstellung von Benzimidazolylidenverbindungen | |
| DE1011887B (de) | Verfahren zur Herstellung von in 10-Stellung basisch substituierten Phenthiazinabkoemmlingen | |
| DE2329817A1 (de) | Gamma-halogen-beta-ketoester und verfahren zur herstellung von gammahalogen-beta-ketoestern | |
| DE1445719C (de) | Verfahren zur Herstellung von 4-Chlor- und 4-Brom-pyrazolo- eckige Klammer auf 3,4b eckige Klammer zu chinolinen. Ausscheidung aus: 1152421 | |
| AT274802B (de) | Verfahren zur Herstellung von Indolderivaten | |
| DE621455C (de) | Verfahren zur Herstellung von Verbindungen der Bz-2-Azabenzanthronreihe | |
| DE2706701A1 (de) | Verfahren zur herstellung von 3- chlor-5-halogenpyridazinen | |
| DE3620825A1 (de) | Heterocyclische verbindungen der 1,4-divinylenbenzol-reihe | |
| DE1213841B (de) | Verfahren zur Herstellung von 3-Aryl-4-halogen-pyridazonen-(6) | |
| DE700554C (de) | Verfahren zur Herstellung von halogenierten Carbazolen | |
| DE1793262C3 (de) | Verfahren zur Herstellung von 3-substituierten 7-Amino-cumarinen | |
| DE923192C (de) | Verfahren zur Herstellung von N-Aryl-pseudothiohydantoinen | |
| DE964861C (de) | Verfahren zur Herstellung von (Bz)-Oxy-chinolonen-(4) | |
| DE2131788B2 (de) | Verfahren zur Herstellung von 7-Pyrazolylcumarinen | |
| DE1095833B (de) | Verfahren zur Herstellung von Azlactonen | |
| DE1137024B (de) | Verfahren zur Herstellung von substituierten 2-Aminothiazol-(5)-aldehyden |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |