CH495397A - Verfahren zur Herstellung siliciumhaltiger Polymere - Google Patents
Verfahren zur Herstellung siliciumhaltiger PolymereInfo
- Publication number
- CH495397A CH495397A CH691665A CH691665A CH495397A CH 495397 A CH495397 A CH 495397A CH 691665 A CH691665 A CH 691665A CH 691665 A CH691665 A CH 691665A CH 495397 A CH495397 A CH 495397A
- Authority
- CH
- Switzerland
- Prior art keywords
- emulsion
- siloxane
- catalyst
- hydrocarbon radical
- emulsions
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 30
- 238000004519 manufacturing process Methods 0.000 title claims description 8
- 229920005573 silicon-containing polymer Polymers 0.000 title claims description 5
- 239000000839 emulsion Substances 0.000 claims description 52
- -1 alkyl hydrogen sulfate Chemical compound 0.000 claims description 36
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical class [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 claims description 27
- 239000003054 catalyst Substances 0.000 claims description 21
- 239000000945 filler Substances 0.000 claims description 12
- 239000004215 Carbon black (E152) Substances 0.000 claims description 9
- 229930195733 hydrocarbon Natural products 0.000 claims description 9
- 125000005375 organosiloxane group Chemical group 0.000 claims description 7
- 229920000642 polymer Polymers 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 239000006185 dispersion Substances 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- 239000012736 aqueous medium Substances 0.000 claims description 2
- 230000001419 dependent effect Effects 0.000 claims 3
- 125000004429 atom Chemical group 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 18
- 238000006116 polymerization reaction Methods 0.000 description 12
- 239000003995 emulsifying agent Substances 0.000 description 7
- 229920001296 polysiloxane Polymers 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- 125000004122 cyclic group Chemical group 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- QTUIJRIDZOSXHJ-UHFFFAOYSA-N tridecyl hydrogen sulfate Chemical compound CCCCCCCCCCCCCOS(O)(=O)=O QTUIJRIDZOSXHJ-UHFFFAOYSA-N 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 239000007859 condensation product Substances 0.000 description 4
- MOTZDAYCYVMXPC-UHFFFAOYSA-N dodecyl hydrogen sulfate Chemical compound CCCCCCCCCCCCOS(O)(=O)=O MOTZDAYCYVMXPC-UHFFFAOYSA-N 0.000 description 4
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical group O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical group [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 238000000576 coating method Methods 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 230000000379 polymerizing effect Effects 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 229910052710 silicon Inorganic materials 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 229920001971 elastomer Polymers 0.000 description 2
- 238000004945 emulsification Methods 0.000 description 2
- 230000001804 emulsifying effect Effects 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- WSFSSNUMVMOOMR-UHFFFAOYSA-N formaldehyde Natural products O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 125000001802 myricyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 150000004756 silanes Chemical class 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 1
- CMCBDXRRFKYBDG-UHFFFAOYSA-N 1-dodecoxydodecane Chemical compound CCCCCCCCCCCCOCCCCCCCCCCCC CMCBDXRRFKYBDG-UHFFFAOYSA-N 0.000 description 1
- NNAVBEAARXTLEG-UHFFFAOYSA-N 2-(10-methylundecyl)phenol Chemical class CC(C)CCCCCCCCCC1=CC=CC=C1O NNAVBEAARXTLEG-UHFFFAOYSA-N 0.000 description 1
- GXJQMKFJQFGQKV-KHPPLWFESA-N 2-[methyl-[(z)-octadec-9-enoyl]amino]ethanesulfonic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)N(C)CCS(O)(=O)=O GXJQMKFJQFGQKV-KHPPLWFESA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- UQRONKZLYKUEMO-UHFFFAOYSA-N 4-methyl-1-(2,4,6-trimethylphenyl)pent-4-en-2-one Chemical group CC(=C)CC(=O)Cc1c(C)cc(C)cc1C UQRONKZLYKUEMO-UHFFFAOYSA-N 0.000 description 1
- LIFHMKCDDVTICL-UHFFFAOYSA-N 6-(chloromethyl)phenanthridine Chemical compound C1=CC=C2C(CCl)=NC3=CC=CC=C3C2=C1 LIFHMKCDDVTICL-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- NOWKCMXCCJGMRR-UHFFFAOYSA-N Aziridine Chemical compound C1CN1 NOWKCMXCCJGMRR-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- 239000004908 Emulsion polymer Substances 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 229910017974 NH40H Inorganic materials 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 239000003082 abrasive agent Substances 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 238000004220 aggregation Methods 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 239000012874 anionic emulsifier Substances 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 1
- 230000015271 coagulation Effects 0.000 description 1
- 238000005345 coagulation Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 239000008199 coating composition Substances 0.000 description 1
- 230000001427 coherent effect Effects 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000003678 cyclohexadienyl group Chemical group C1(=CC=CCC1)* 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 1
- SMVRDGHCVNAOIN-UHFFFAOYSA-L disodium;1-dodecoxydodecane;sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O.CCCCCCCCCCCCOCCCCCCCCCCCC SMVRDGHCVNAOIN-UHFFFAOYSA-L 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000007720 emulsion polymerization reaction Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000011874 heated mixture Substances 0.000 description 1
- LPTIRUACFKQDHZ-UHFFFAOYSA-N hexadecyl sulfate;hydron Chemical compound CCCCCCCCCCCCCCCCOS(O)(=O)=O LPTIRUACFKQDHZ-UHFFFAOYSA-N 0.000 description 1
- 125000006038 hexenyl group Chemical group 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 150000002466 imines Chemical class 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000004816 latex Substances 0.000 description 1
- 229920000126 latex Polymers 0.000 description 1
- 229910000032 lithium hydrogen carbonate Inorganic materials 0.000 description 1
- HQRPHMAXFVUBJX-UHFFFAOYSA-M lithium;hydrogen carbonate Chemical compound [Li+].OC([O-])=O HQRPHMAXFVUBJX-UHFFFAOYSA-M 0.000 description 1
- 125000005394 methallyl group Chemical group 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 239000012875 nonionic emulsifier Substances 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001117 oleyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])/C([H])=C([H])\C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000003544 oxime group Chemical group 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 238000005498 polishing Methods 0.000 description 1
- 239000002685 polymerization catalyst Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 150000003138 primary alcohols Chemical class 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 229930182490 saponin Natural products 0.000 description 1
- 150000007949 saponins Chemical class 0.000 description 1
- 235000017709 saponins Nutrition 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- HQCFDOOSGDZRII-UHFFFAOYSA-M sodium;tridecyl sulfate Chemical compound [Na+].CCCCCCCCCCCCCOS([O-])(=O)=O HQCFDOOSGDZRII-UHFFFAOYSA-M 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid Chemical class NS(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 1
- 125000003639 thymyl group Chemical group C1(=CC(C)=CC=C1C(C)C)* 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G77/00—Macromolecular compounds obtained by reactions forming a linkage containing silicon with or without sulfur, nitrogen, oxygen or carbon in the main chain of the macromolecule
- C08G77/48—Macromolecular compounds obtained by reactions forming a linkage containing silicon with or without sulfur, nitrogen, oxygen or carbon in the main chain of the macromolecule in which at least two but not all the silicon atoms are connected by linkages other than oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G77/00—Macromolecular compounds obtained by reactions forming a linkage containing silicon with or without sulfur, nitrogen, oxygen or carbon in the main chain of the macromolecule
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G77/00—Macromolecular compounds obtained by reactions forming a linkage containing silicon with or without sulfur, nitrogen, oxygen or carbon in the main chain of the macromolecule
- C08G77/04—Polysiloxanes
- C08G77/06—Preparatory processes
- C08G77/08—Preparatory processes characterised by the catalysts used
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G77/00—Macromolecular compounds obtained by reactions forming a linkage containing silicon with or without sulfur, nitrogen, oxygen or carbon in the main chain of the macromolecule
- C08G77/48—Macromolecular compounds obtained by reactions forming a linkage containing silicon with or without sulfur, nitrogen, oxygen or carbon in the main chain of the macromolecule in which at least two but not all the silicon atoms are connected by linkages other than oxygen atoms
- C08G77/50—Macromolecular compounds obtained by reactions forming a linkage containing silicon with or without sulfur, nitrogen, oxygen or carbon in the main chain of the macromolecule in which at least two but not all the silicon atoms are connected by linkages other than oxygen atoms by carbon linkages
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Silicon Polymers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US368352A US3360491A (en) | 1964-05-18 | 1964-05-18 | Method of polymerizing siloxanes and silcarbanes in emulsion |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH495397A true CH495397A (de) | 1970-08-31 |
Family
ID=23450868
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH691665A CH495397A (de) | 1964-05-18 | 1965-05-18 | Verfahren zur Herstellung siliciumhaltiger Polymere |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3360491A (instruction) |
| AT (1) | AT258573B (instruction) |
| BE (1) | BE664014A (instruction) |
| CH (1) | CH495397A (instruction) |
| DE (1) | DE1570451B2 (instruction) |
| NL (2) | NL6506319A (instruction) |
| SE (1) | SE310265B (instruction) |
Families Citing this family (38)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH106968D (instruction) * | 1965-01-21 | 1900-01-01 | ||
| BE759286A (fr) * | 1969-11-24 | 1971-05-24 | Dow Corning | Emulsions de siloxanes a durcissement rapide utiles comme agents de separation |
| US4046930A (en) * | 1974-11-06 | 1977-09-06 | Union Carbide Corporation | Treatment of paper and textile fabrics with emulsified epoxy-silicones |
| US4008346A (en) * | 1974-12-18 | 1977-02-15 | General Electric Company | Process for preparing a polysiloxane |
| US4170581A (en) * | 1978-08-04 | 1979-10-09 | Dow Corning Corporation | Method and composition relating to emulsion-polymerized polydimethylsiloxanes in durable press resins |
| DE3216585C2 (de) * | 1982-05-04 | 1984-07-26 | Th. Goldschmidt Ag, 4300 Essen | Verfahren zur Herstellung von feinteiligen, stabilen O/W-Emulsionen von Organopolysiloxanen |
| US4568718A (en) * | 1984-06-26 | 1986-02-04 | Dow Corning Corporation | Polydiorganosiloxane latex |
| US4567231A (en) * | 1984-06-26 | 1986-01-28 | Dow Corning Corporation | Emulsions of reinforced polydiorganosiloxane latex |
| US4584341A (en) * | 1984-06-26 | 1986-04-22 | Dow Corning Corporation | Emulsions of crosslinked polydiorganosiloxanes |
| US4788001A (en) * | 1985-04-02 | 1988-11-29 | Dow Corning Corporation | Oil-in-water emulsion |
| US4874547A (en) * | 1985-04-02 | 1989-10-17 | Dow Corning Corporation | Bi-modal silicone emulsions, silicone emulsification process and emulsions therefrom |
| US4661556A (en) * | 1985-05-24 | 1987-04-28 | Dow Corning Corporation | Method of producing reinforced aqueous emulsion of polydiorganosiloxane |
| US4618645A (en) * | 1985-05-24 | 1986-10-21 | Dow Corning Corporation | Method of producing aqueous latex of crosslinked polydiorganosiloxane |
| FR2621921B1 (fr) * | 1987-10-20 | 1990-02-23 | Rhone Poulenc Chimie | Emulsion aqueuse de silicone pouvant reticuler en un elastomere par elimination de l'eau |
| JP2714674B2 (ja) * | 1988-11-30 | 1998-02-16 | 東芝シリコーン株式会社 | ポリオルガノシロキサンの製造方法 |
| FR2642765B1 (fr) * | 1989-02-03 | 1991-04-26 | Rhone Poulenc Chimie | Dispersion aqueuse de silicone a base d'aminosilane et/ou d'amidosilane reticulant en un elastomere par elimination de l'eau |
| FR2647798B1 (fr) * | 1989-05-31 | 1991-09-13 | Rhone Poulenc Chimie | Dispersion aqueuse a base d'huiles silicones fonctionnalisees pouvant reticuler en un elastomere par elimination de l'eau |
| GB9320556D0 (en) * | 1993-10-06 | 1993-11-24 | Unilever Plc | Hair conditioning composition |
| GB9404550D0 (en) | 1994-03-09 | 1994-04-20 | Unilever Plc | Hair conditioning composition |
| GB9507130D0 (en) * | 1995-04-06 | 1995-05-31 | Unilever Plc | Hair treatment composition |
| US5668203A (en) * | 1995-06-07 | 1997-09-16 | Xerox Corporation | Elastomeric articles containing haloceramer compositions |
| US5708070A (en) | 1995-12-20 | 1998-01-13 | Dow Corning Corporation | Silicone emulsions which crosslink by Michael addition reactions |
| US5777026A (en) | 1995-12-28 | 1998-07-07 | Dow Corning Corporation | Surface modified silicone elastomers from aqueous silicone emulsions |
| US5861451A (en) * | 1996-10-31 | 1999-01-19 | Dow Corning Corporation | Sprayable silicone emulsions which form elastomers having smoke and fire resistant properties |
| GB9804720D0 (en) | 1998-03-05 | 1998-04-29 | Unilever Plc | Shampoo compositions |
| JPH11335563A (ja) * | 1998-05-28 | 1999-12-07 | Shin Etsu Chem Co Ltd | カルボキシル基含有シリコーンエマルジョン及びその製造方法並びに毛髪化粧料 |
| DE19824188A1 (de) * | 1998-05-29 | 1999-12-02 | Bayer Ag | Wäßrige Zubereitung zur Behandlung mineralischer Baustoffe |
| KR100592008B1 (ko) * | 1998-08-12 | 2006-06-21 | 신에쓰 가가꾸 고교 가부시끼가이샤 | 오르가노폴리실록산 에멀젼의 제조 방법 |
| GB9913951D0 (en) | 1999-06-15 | 1999-08-18 | Unilever Plc | Mousse-forming shampoo compositions |
| EP1846478B2 (en) * | 2005-02-02 | 2021-09-08 | Wacker Chemie AG | Manufacture of stable low particle size organopolysiloxane emulsion |
| KR101235660B1 (ko) * | 2005-03-17 | 2013-02-22 | 다우 코닝 코포레이션 | 실리콘 에멀젼, 이의 제조방법 및 화장품 성분 |
| WO2009077389A1 (de) * | 2007-12-14 | 2009-06-25 | Henkel Ag & Co. Kgaa | Härtbare zusammensetzungen enthaltend wässrige dispersionen von organopolysiloxanen |
| DE102007060919A1 (de) | 2007-12-14 | 2009-06-18 | Henkel Ag & Co. Kgaa | Härtbare Zusammensetzungen enthaltend wässrige Dispersionen von Organopolysiloxanen |
| DE102008003155A1 (de) | 2008-01-03 | 2009-07-09 | Henkel Ag & Co. Kgaa | Härtbare Zusammensetzungen enthaltend wässrige Dispersionen von Organopolysiloxanen |
| WO2013033687A1 (en) | 2011-09-02 | 2013-03-07 | Rtetta Holdings, Llc | System for tracking and allocating renewable energy contributions to a modular renewable energy system |
| US11022343B2 (en) | 2011-09-02 | 2021-06-01 | Pv Solutions, Llc | Mounting system for photovoltaic arrays |
| US10008974B2 (en) | 2011-09-02 | 2018-06-26 | Pv Solutions, Llc | Mounting system for photovoltaic arrays |
| WO2016123357A2 (en) | 2015-01-28 | 2016-08-04 | Pv Solutions, Llc | Integrated electrical and mechanical photovoltaic array interconnection system |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2562000A (en) * | 1946-10-28 | 1951-07-24 | Du Pont | Polyarylene-siloxanes and processes for making same |
| US2891920A (en) * | 1955-01-26 | 1959-06-23 | Dow Corning | Polymerization of organopolysiloxanes in aqueous emulsion |
| US3133949A (en) * | 1960-07-01 | 1964-05-19 | Exxon Research Engineering Co | Novel preparation of organic sulfates |
| BE623601A (instruction) * | 1961-10-16 | 1900-01-01 | ||
| GB1024024A (en) * | 1963-04-08 | 1966-03-30 | Dow Corning | Improvements in or relating to polymerising or co-polymerising organosilicon compounds |
-
0
- NL NL124881D patent/NL124881C/xx active
-
1964
- 1964-05-18 US US368352A patent/US3360491A/en not_active Expired - Lifetime
-
1965
- 1965-03-15 SE SE3355/65A patent/SE310265B/xx unknown
- 1965-05-14 DE DE19651570451 patent/DE1570451B2/de not_active Withdrawn
- 1965-05-17 BE BE664014D patent/BE664014A/xx unknown
- 1965-05-17 AT AT445565A patent/AT258573B/de active
- 1965-05-18 CH CH691665A patent/CH495397A/de not_active IP Right Cessation
- 1965-05-18 NL NL6506319A patent/NL6506319A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NL6506319A (instruction) | 1965-11-19 |
| AT258573B (de) | 1967-12-11 |
| SE310265B (instruction) | 1969-04-21 |
| NL124881C (instruction) | |
| DE1570451B2 (de) | 1972-05-10 |
| DE1570451A1 (de) | 1969-07-31 |
| BE664014A (instruction) | 1965-11-17 |
| US3360491A (en) | 1967-12-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH495397A (de) | Verfahren zur Herstellung siliciumhaltiger Polymere | |
| DE1595535A1 (de) | Verfahren zur Herstellung stabiler Organopolysiloxanemulsionen (II) | |
| DE69124838T2 (de) | Verfahren zur Herstellung von Polysiloxanemulsionen | |
| EP0093310B1 (de) | Verfahren zur Herstellung von feinteiligen, stabilen O/W-Emulsionen von Organopolysiloxanen | |
| DE3689130T2 (de) | Verfahren zur Herstellung von wässrigem Latex aus vernetztem Polydiorganosiloxan. | |
| DE3687704T2 (de) | Verfahren zur herstellung von mikroemulsionen von polydiorganosiloxanen. | |
| DE2829261A1 (de) | Silicon-schaumverhuetungsmittel und verfahren zu seiner herstellung und anwendung | |
| DE1289989B (de) | Lagerbestaendige Organopolysiloxanlatices | |
| DE2455377A1 (de) | Trennmittelgemische | |
| EP2385077B1 (de) | Verfahren zur Herstellung von Siliconemulsionen | |
| DE2014174B2 (de) | Waessrige emulsionen von organopolysiloxanen | |
| DE60000469T2 (de) | Silikonemulsionen mit grösser Korngrössen | |
| DE671378C (de) | Verfahren zur Herstellung von Mischpolymerisaten | |
| DE3151957A1 (de) | Entschaeumerzubereitungen | |
| DE19629621A1 (de) | Mit kationischen, oberflächenaktiven Mitteln verträgliche, anionische emulsionspolymerisierte Silicon-Emulsion | |
| DE3883176T2 (de) | Verfahren zur Herstellung partiell gehärteten Silikonemulsion. | |
| DE68911164T2 (de) | Filmformende Polysiloxanmikroemulsion. | |
| DE3881797T2 (de) | Verfahren zum hydrophobieren von kieselerde. | |
| EP2885353B1 (de) | Verfahren zur herstellung von siliconemulsionen | |
| DE1570451C (de) | Verfahren zur Herstellung von stabi len Organopolysiloxanemulsionen | |
| EP0043985A2 (de) | Polysiloxan-Emulsionen mit verbesserter Kältestabilität | |
| AT263357B (de) | Verfahren zur Herstellung von stabilen Organopolysiloxanemulsionen | |
| EP3679086B1 (de) | Wässrige emulsionen aus oxamidoester-funktionalisierten organopolysiloxanen | |
| DE1037707B (de) | Verfahren zur Herstellung von Organopolysiloxanemulsionen | |
| DE1920467A1 (de) | Verfahren zur Herstellung stabiler Organopolysiloxan-Emulsionen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |