CA2071677A1 - 7-isoindolinyl-quinolone- and -naphthyridonecarboxylic acid derivatives - Google Patents
7-isoindolinyl-quinolone- and -naphthyridonecarboxylic acid derivativesInfo
- Publication number
- CA2071677A1 CA2071677A1 CA002071677A CA2071677A CA2071677A1 CA 2071677 A1 CA2071677 A1 CA 2071677A1 CA 002071677 A CA002071677 A CA 002071677A CA 2071677 A CA2071677 A CA 2071677A CA 2071677 A1 CA2071677 A1 CA 2071677A1
- Authority
- CA
- Canada
- Prior art keywords
- oxo
- dihydro
- cyclopropyl
- methyl
- hexahydro
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- 239000002253 acid Substances 0.000 title claims abstract description 34
- 150000001875 compounds Chemical class 0.000 claims abstract description 53
- 238000000034 method Methods 0.000 claims abstract description 24
- 238000002360 preparation method Methods 0.000 claims abstract description 7
- 239000000203 mixture Substances 0.000 claims description 58
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 49
- 239000001257 hydrogen Substances 0.000 claims description 43
- 229910052739 hydrogen Inorganic materials 0.000 claims description 43
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 33
- 125000004432 carbon atom Chemical group C* 0.000 claims description 30
- -1 methoxy, amino, methylamino, ethylamino, dimethylamino Chemical group 0.000 claims description 28
- 150000002431 hydrogen Chemical class 0.000 claims description 24
- 239000000460 chlorine Substances 0.000 claims description 21
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 19
- 125000000217 alkyl group Chemical group 0.000 claims description 14
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 14
- 150000003839 salts Chemical class 0.000 claims description 14
- 229910052731 fluorine Inorganic materials 0.000 claims description 11
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 10
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 10
- 229910052801 chlorine Inorganic materials 0.000 claims description 10
- 239000011737 fluorine Substances 0.000 claims description 10
- 229910052757 nitrogen Inorganic materials 0.000 claims description 10
- 229910052783 alkali metal Inorganic materials 0.000 claims description 9
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 8
- 125000003545 alkoxy group Chemical group 0.000 claims description 8
- 150000001340 alkali metals Chemical class 0.000 claims description 7
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 7
- 229910052736 halogen Inorganic materials 0.000 claims description 7
- 150000002367 halogens Chemical class 0.000 claims description 7
- 241000894006 Bacteria Species 0.000 claims description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 6
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical class NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 claims description 6
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 claims description 6
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 6
- 125000004453 alkoxycarbonyl group Chemical class 0.000 claims description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 6
- 229910052794 bromium Inorganic materials 0.000 claims description 6
- 239000003085 diluting agent Substances 0.000 claims description 6
- 150000004677 hydrates Chemical class 0.000 claims description 6
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- 239000004332 silver Substances 0.000 claims description 6
- 229910052709 silver Inorganic materials 0.000 claims description 6
- 125000001153 fluoro group Chemical group F* 0.000 claims description 5
- RGXXUXYBLRPAGO-UHFFFAOYSA-N 5,8-dichloro-1-cyclopropyl-6,7-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C12=C(Cl)C(F)=C(F)C(Cl)=C2C(=O)C(C(=O)O)=CN1C1CC1 RGXXUXYBLRPAGO-UHFFFAOYSA-N 0.000 claims description 4
- MNHCXQXOGBPNEB-UHFFFAOYSA-N 7-(4-amino-1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-8-chloro-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1C2C(N)C=CCC2CN1C(C=1Cl)=C(F)C=C(C(C(C(O)=O)=C2)=O)C=1N2C1CC1 MNHCXQXOGBPNEB-UHFFFAOYSA-N 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims description 4
- 125000006273 (C1-C3) alkyl group Chemical class 0.000 claims description 3
- 125000004777 2-fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 claims description 3
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 claims description 3
- ZCSJKPWCNHYNNO-UHFFFAOYSA-N 5-bromo-1-(2,4-difluorophenyl)-6,7,8-trifluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C12=C(F)C(F)=C(F)C(Br)=C2C(=O)C(C(=O)O)=CN1C1=CC=C(F)C=C1F ZCSJKPWCNHYNNO-UHFFFAOYSA-N 0.000 claims description 3
- 230000000844 anti-bacterial effect Effects 0.000 claims description 3
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 3
- 239000003826 tablet Substances 0.000 claims description 3
- RKUZWTUIYROZSO-UHFFFAOYSA-N 5,8-dichloro-1-(2,4-difluorophenyl)-6,7-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C12=C(Cl)C(F)=C(F)C(Cl)=C2C(=O)C(C(=O)O)=CN1C1=CC=C(F)C=C1F RKUZWTUIYROZSO-UHFFFAOYSA-N 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 125000003282 alkyl amino group Chemical group 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- 125000005110 aryl thio group Chemical group 0.000 claims description 2
- 239000002775 capsule Substances 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 2
- MDQRDWAGHRLBPA-UHFFFAOYSA-N fluoroamine Chemical compound FN MDQRDWAGHRLBPA-UHFFFAOYSA-N 0.000 claims description 2
- XMSZANIMCDLNKA-UHFFFAOYSA-N methyl hypofluorite Chemical compound COF XMSZANIMCDLNKA-UHFFFAOYSA-N 0.000 claims description 2
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 claims description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 2
- 229920002554 vinyl polymer Polymers 0.000 claims description 2
- 150000001447 alkali salts Chemical class 0.000 claims 2
- 230000001737 promoting effect Effects 0.000 claims 2
- SQSRQTPCRMVTJJ-UHFFFAOYSA-N 5-bromo-1-cyclopropyl-6,7,8-trifluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C12=C(F)C(F)=C(F)C(Br)=C2C(=O)C(C(=O)O)=CN1C1CC1 SQSRQTPCRMVTJJ-UHFFFAOYSA-N 0.000 claims 1
- ITGGODXXBNJXSR-UHFFFAOYSA-N 7-(4-amino-1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-1-cyclopropyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1C2C(N)C=CCC2CN1C(C=1F)=C(F)C=C(C(C(C(O)=O)=C2)=O)C=1N2C1CC1 ITGGODXXBNJXSR-UHFFFAOYSA-N 0.000 claims 1
- XHWYUYNINDZORQ-UHFFFAOYSA-N 7-(4-amino-1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1C2C(N)C=CCC2CN1C(C(=CC=1C(=O)C(C(O)=O)=C2)F)=CC=1N2C1CC1 XHWYUYNINDZORQ-UHFFFAOYSA-N 0.000 claims 1
- FINYMVFJPWNBRL-UHFFFAOYSA-N 8-chloro-1-cyclopropyl-6-fluoro-7-[4-(methylamino)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-4-oxoquinoline-3-carboxylic acid Chemical compound C1C2C(NC)C=CCC2CN1C(C=1Cl)=C(F)C=C(C(C(C(O)=O)=C2)=O)C=1N2C1CC1 FINYMVFJPWNBRL-UHFFFAOYSA-N 0.000 claims 1
- YCDNDCHDXDHBDR-UHFFFAOYSA-N 8-chloro-1-cyclopropyl-6-fluoro-7-[4-methyl-7-(methylamino)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-4-oxoquinoline-3-carboxylic acid Chemical compound C1C2C(NC)C=CC(C)C2CN1C(C=1Cl)=C(F)C=C(C(C(C(O)=O)=C2)=O)C=1N2C1CC1 YCDNDCHDXDHBDR-UHFFFAOYSA-N 0.000 claims 1
- 239000003708 ampul Substances 0.000 claims 1
- 239000003242 anti bacterial agent Substances 0.000 abstract description 3
- 239000003674 animal food additive Substances 0.000 abstract description 2
- 125000004594 isoindolinyl group Chemical group C1(NCC2=CC=CC=C12)* 0.000 abstract description 2
- 238000002844 melting Methods 0.000 description 63
- 230000008018 melting Effects 0.000 description 63
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 50
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 45
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 37
- 238000000354 decomposition reaction Methods 0.000 description 34
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 33
- 238000006243 chemical reaction Methods 0.000 description 33
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 32
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 24
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 24
- 239000000243 solution Substances 0.000 description 19
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- 238000010992 reflux Methods 0.000 description 18
- 238000001816 cooling Methods 0.000 description 16
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 15
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 15
- 239000000047 product Substances 0.000 description 15
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 13
- 239000002244 precipitate Substances 0.000 description 13
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- 238000009835 boiling Methods 0.000 description 12
- 235000011167 hydrochloric acid Nutrition 0.000 description 11
- 229960000443 hydrochloric acid Drugs 0.000 description 11
- 239000012280 lithium aluminium hydride Substances 0.000 description 10
- 239000000126 substance Substances 0.000 description 10
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 9
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 8
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 8
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- NRKAHECMMVDYGU-UHFFFAOYSA-N n-methyl-2,3,3a,4,7,7a-hexahydro-1h-isoindol-4-amine Chemical compound CNC1C=CCC2CNCC12 NRKAHECMMVDYGU-UHFFFAOYSA-N 0.000 description 8
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 7
- 239000000706 filtrate Substances 0.000 description 7
- 125000006239 protecting group Chemical group 0.000 description 7
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 6
- 239000012043 crude product Substances 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 239000001117 sulphuric acid Substances 0.000 description 6
- 235000011149 sulphuric acid Nutrition 0.000 description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 6
- KWIUHFFTVRNATP-UHFFFAOYSA-N Betaine Natural products C[N+](C)(C)CC([O-])=O KWIUHFFTVRNATP-UHFFFAOYSA-N 0.000 description 5
- PEEHTFAAVSWFBL-UHFFFAOYSA-N Maleimide Chemical compound O=C1NC(=O)C=C1 PEEHTFAAVSWFBL-UHFFFAOYSA-N 0.000 description 5
- KWIUHFFTVRNATP-UHFFFAOYSA-O N,N,N-trimethylglycinium Chemical compound C[N+](C)(C)CC(O)=O KWIUHFFTVRNATP-UHFFFAOYSA-O 0.000 description 5
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 5
- 229960003237 betaine Drugs 0.000 description 5
- 230000009467 reduction Effects 0.000 description 5
- 229920001817 Agar Polymers 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 238000005698 Diels-Alder reaction Methods 0.000 description 4
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 4
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 4
- 239000008272 agar Substances 0.000 description 4
- 150000001735 carboxylic acids Chemical class 0.000 description 4
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 150000004678 hydrides Chemical class 0.000 description 4
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 4
- 150000002500 ions Chemical class 0.000 description 4
- UAEPNZWRGJTJPN-UHFFFAOYSA-N methylcyclohexane Chemical compound CC1CCCCC1 UAEPNZWRGJTJPN-UHFFFAOYSA-N 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- PUZPDOWCWNUUKD-UHFFFAOYSA-M sodium fluoride Chemical compound [F-].[Na+] PUZPDOWCWNUUKD-UHFFFAOYSA-M 0.000 description 4
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 4
- 238000005160 1H NMR spectroscopy Methods 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 238000001819 mass spectrum Methods 0.000 description 3
- 244000052769 pathogen Species 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- DJXNJVFEFSWHLY-UHFFFAOYSA-N quinoline-3-carboxylic acid Chemical compound C1=CC=CC2=CC(C(=O)O)=CN=C21 DJXNJVFEFSWHLY-UHFFFAOYSA-N 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 230000002829 reductive effect Effects 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- KARNZIBTRGPSBA-UHFFFAOYSA-N 1-(2,3,3a,4,7,7a-hexahydro-1h-isoindol-4-yl)-n-methylmethanamine Chemical compound CNCC1C=CCC2CNCC12 KARNZIBTRGPSBA-UHFFFAOYSA-N 0.000 description 2
- NMASXYCNDJMMFR-UHFFFAOYSA-N 1-cyclopropyl-6,7,8-trifluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C12=C(F)C(F)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 NMASXYCNDJMMFR-UHFFFAOYSA-N 0.000 description 2
- QMNBWOHIZQXHJZ-UHFFFAOYSA-N 2,3,3a,4,7,7a-hexahydro-1h-isoindol-4-amine Chemical compound NC1C=CCC2CNCC12 QMNBWOHIZQXHJZ-UHFFFAOYSA-N 0.000 description 2
- HWZHYUCYEYJQTE-UHFFFAOYSA-N 2,3,3a,4,7,7a-hexahydro-1h-isoindole Chemical class C1C=CCC2CNCC21 HWZHYUCYEYJQTE-UHFFFAOYSA-N 0.000 description 2
- CEPCPXLLFXPZGW-UHFFFAOYSA-N 2,4-difluoroaniline Chemical compound NC1=CC=C(F)C=C1F CEPCPXLLFXPZGW-UHFFFAOYSA-N 0.000 description 2
- WVXDJMXXQMDEIZ-UHFFFAOYSA-N 2,5-dichloro-3,4,6-trifluorobenzoyl chloride Chemical compound FC1=C(F)C(Cl)=C(C(Cl)=O)C(F)=C1Cl WVXDJMXXQMDEIZ-UHFFFAOYSA-N 0.000 description 2
- AQXKNIXHFPOZFL-UHFFFAOYSA-N 3-chloro-2,4,5-trifluoro-6-nitrobenzoic acid Chemical compound OC(=O)C1=C(F)C(Cl)=C(F)C(F)=C1[N+]([O-])=O AQXKNIXHFPOZFL-UHFFFAOYSA-N 0.000 description 2
- ZHFGWIOLVRSZNQ-UHFFFAOYSA-N 8-chloro-1-cyclopropyl-6,7-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C12=C(Cl)C(F)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 ZHFGWIOLVRSZNQ-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 2
- HTJDQJBWANPRPF-UHFFFAOYSA-N Cyclopropylamine Chemical compound NC1CC1 HTJDQJBWANPRPF-UHFFFAOYSA-N 0.000 description 2
- RGHNJXZEOKUKBD-SQOUGZDYSA-N D-gluconic acid Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O RGHNJXZEOKUKBD-SQOUGZDYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 241000194032 Enterococcus faecalis Species 0.000 description 2
- 241000588724 Escherichia coli Species 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 241000589517 Pseudomonas aeruginosa Species 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 241000191967 Staphylococcus aureus Species 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 244000052616 bacterial pathogen Species 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 229960001701 chloroform Drugs 0.000 description 2
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 2
- FAEZVIMSZVCUOP-UHFFFAOYSA-N diethyl 2-(2-bromo-3,4,5,6-tetrafluorobenzoyl)propanedioate Chemical compound CCOC(=O)C(C(=O)OCC)C(=O)C1=C(F)C(F)=C(F)C(F)=C1Br FAEZVIMSZVCUOP-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 229940032049 enterococcus faecalis Drugs 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- SKBISNMFDIGTPW-UHFFFAOYSA-N ethyl 3-(2-bromo-3,4,5,6-tetrafluorophenyl)-3-oxopropanoate Chemical compound CCOC(=O)CC(=O)C1=C(F)C(F)=C(F)C(F)=C1Br SKBISNMFDIGTPW-UHFFFAOYSA-N 0.000 description 2
- YZSVCOSSFQKKHC-UHFFFAOYSA-N ethyl 5-bromo-1-cyclopropyl-6,7,8-trifluoro-4-oxoquinoline-3-carboxylate Chemical compound C12=C(F)C(F)=C(F)C(Br)=C2C(=O)C(C(=O)OCC)=CN1C1CC1 YZSVCOSSFQKKHC-UHFFFAOYSA-N 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- GYNNXHKOJHMOHS-UHFFFAOYSA-N methyl-cycloheptane Natural products CC1CCCCCC1 GYNNXHKOJHMOHS-UHFFFAOYSA-N 0.000 description 2
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 2
- 244000005700 microbiome Species 0.000 description 2
- 239000011368 organic material Substances 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(1+) nitrate Chemical compound [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000011775 sodium fluoride Substances 0.000 description 2
- 235000013024 sodium fluoride Nutrition 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- OJUYYFXYYWYJLE-UHFFFAOYSA-N tert-butyl n-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl)carbamate Chemical compound CC(C)(C)OC(=O)NC1C=CCC2C(=O)NC(=O)C12 OJUYYFXYYWYJLE-UHFFFAOYSA-N 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 238000011282 treatment Methods 0.000 description 2
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 2
- AVQQQNCBBIEMEU-UHFFFAOYSA-N 1,1,3,3-tetramethylurea Chemical compound CN(C)C(=O)N(C)C AVQQQNCBBIEMEU-UHFFFAOYSA-N 0.000 description 1
- FTTATHOUSOIFOQ-UHFFFAOYSA-N 1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine Chemical compound C1NCCN2CCCC21 FTTATHOUSOIFOQ-UHFFFAOYSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- CGXLVFZJJOXEDF-UHFFFAOYSA-N 1,8-naphthyridine-3-carboxylic acid Chemical compound N1=CC=CC2=CC(C(=O)O)=CN=C21 CGXLVFZJJOXEDF-UHFFFAOYSA-N 0.000 description 1
- RLKQFGFEEROESJ-UHFFFAOYSA-N 1-(2,4-difluorophenyl)-6,7,8-trifluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C12=C(F)C(F)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1=CC=C(F)C=C1F RLKQFGFEEROESJ-UHFFFAOYSA-N 0.000 description 1
- BNYMEXVJUDGTJS-UHFFFAOYSA-N 1-(2,4-difluorophenyl)-6,7-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C12=CC(F)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1=CC=C(F)C=C1F BNYMEXVJUDGTJS-UHFFFAOYSA-N 0.000 description 1
- DLHRNLONPBKVDC-UHFFFAOYSA-N 1-(2,4-difluorophenyl)-6-fluoro-7-[4-(methylamino)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-4-oxoquinoline-3-carboxylic acid;hydrochloride Chemical compound Cl.C1C2C(NC)C=CCC2CN1C(C(=CC=1C(=O)C(C(O)=O)=C2)F)=CC=1N2C1=CC=C(F)C=C1F DLHRNLONPBKVDC-UHFFFAOYSA-N 0.000 description 1
- FHJFNKXBIVGOJH-UHFFFAOYSA-N 1-(dimethylamino)-6,7,8-trifluoro-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C(F)C(F)=C2N(N(C)C)C=C(C(O)=O)C(=O)C2=C1 FHJFNKXBIVGOJH-UHFFFAOYSA-N 0.000 description 1
- DBNBWERWKLEPQT-UHFFFAOYSA-N 1-amino-6,7,8-trifluoro-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C(F)C(F)=C2N(N)C=C(C(O)=O)C(=O)C2=C1 DBNBWERWKLEPQT-UHFFFAOYSA-N 0.000 description 1
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- RFZHFIFSQNIHAI-UHFFFAOYSA-N 1-cyclopropyl-5,6,7,8-tetrafluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C12=C(F)C(F)=C(F)C(F)=C2C(=O)C(C(=O)O)=CN1C1CC1 RFZHFIFSQNIHAI-UHFFFAOYSA-N 0.000 description 1
- RRSXXLZPDQRYEU-UHFFFAOYSA-N 1-cyclopropyl-6,7,8-trifluoro-5-hydroxy-4-oxoquinoline-3-carboxylic acid Chemical compound C12=C(F)C(F)=C(F)C(O)=C2C(=O)C(C(=O)O)=CN1C1CC1 RRSXXLZPDQRYEU-UHFFFAOYSA-N 0.000 description 1
- UJEGPXIBZGRGIH-UHFFFAOYSA-N 1-cyclopropyl-6-fluoro-5-methyl-4-oxoquinoline-3-carboxylic acid Chemical compound C1=C(C(O)=O)C(=O)C=2C(C)=C(F)C=CC=2N1C1CC1 UJEGPXIBZGRGIH-UHFFFAOYSA-N 0.000 description 1
- UHVWBFPHSISZNU-UHFFFAOYSA-N 1-cyclopropyl-7-(1,3-dihydroisoindol-2-yl)-6,8-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C12=C(F)C(N3CC4=CC=CC=C4C3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 UHVWBFPHSISZNU-UHFFFAOYSA-N 0.000 description 1
- HEYIOFYFCUOKDL-UHFFFAOYSA-N 1-ethenyl-6,7-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C(F)C=C2C(=O)C(C(=O)O)=CN(C=C)C2=C1 HEYIOFYFCUOKDL-UHFFFAOYSA-N 0.000 description 1
- DTRLPBIKMIQFEJ-UHFFFAOYSA-N 1-trimethylsilylpyrrole-2,5-dione Chemical compound C[Si](C)(C)N1C(=O)C=CC1=O DTRLPBIKMIQFEJ-UHFFFAOYSA-N 0.000 description 1
- LTMRRSWNXVJMBA-UHFFFAOYSA-L 2,2-diethylpropanedioate Chemical compound CCC(CC)(C([O-])=O)C([O-])=O LTMRRSWNXVJMBA-UHFFFAOYSA-L 0.000 description 1
- MZPZAIVRISPTJQ-UHFFFAOYSA-N 2,3,3a,4,5,6-hexahydro-1h-isoindole Chemical compound C1CCC2CNCC2=C1 MZPZAIVRISPTJQ-UHFFFAOYSA-N 0.000 description 1
- PADILUPDIURJJL-UHFFFAOYSA-N 2,3,3a,4,7,7a-hexahydro-1h-isoindol-4-ol Chemical compound OC1C=CCC2CNCC12 PADILUPDIURJJL-UHFFFAOYSA-N 0.000 description 1
- KLPRLRZZEGYDDK-UHFFFAOYSA-N 2,3,3a,4,7,7a-hexahydro-1h-isoindol-4-ylmethanamine Chemical compound NCC1C=CCC2CNCC12 KLPRLRZZEGYDDK-UHFFFAOYSA-N 0.000 description 1
- DOTTWZPJAUAGBM-UHFFFAOYSA-N 2,3,3a,4,7,7a-hexahydro-1h-isoindol-4-ylmethanol Chemical compound OCC1C=CCC2CNCC12 DOTTWZPJAUAGBM-UHFFFAOYSA-N 0.000 description 1
- XWCKIXLTBNGIHV-UHFFFAOYSA-N 2,3,4,5-tetrafluorobenzoyl chloride Chemical compound FC1=CC(C(Cl)=O)=C(F)C(F)=C1F XWCKIXLTBNGIHV-UHFFFAOYSA-N 0.000 description 1
- FWCXZCJLPBVQKT-UHFFFAOYSA-N 2,5-dichloro-3,4,6-trifluorobenzoic acid Chemical compound OC(=O)C1=C(F)C(Cl)=C(F)C(F)=C1Cl FWCXZCJLPBVQKT-UHFFFAOYSA-N 0.000 description 1
- YJQZKFQDWPRRDF-UHFFFAOYSA-N 2-[2,3,3a,4,7,7a-hexahydro-1h-isoindol-4-yl(methyl)amino]ethanol Chemical compound OCCN(C)C1C=CCC2CNCC12 YJQZKFQDWPRRDF-UHFFFAOYSA-N 0.000 description 1
- JLWMMYZWEHHTFF-UHFFFAOYSA-N 2-[6-(3-carbamimidoylphenoxy)-4-[di(propan-2-yl)amino]-3,5-difluoropyridin-2-yl]oxy-5-(2-methylpropylcarbamoyl)benzoic acid Chemical compound OC(=O)C1=CC(C(=O)NCC(C)C)=CC=C1OC1=NC(OC=2C=C(C=CC=2)C(N)=N)=C(F)C(N(C(C)C)C(C)C)=C1F JLWMMYZWEHHTFF-UHFFFAOYSA-N 0.000 description 1
- PMWQIKXUDUSWKO-UHFFFAOYSA-N 2-amino-5-chloro-3,4,6-trifluorobenzoic acid Chemical compound NC1=C(F)C(F)=C(Cl)C(F)=C1C(O)=O PMWQIKXUDUSWKO-UHFFFAOYSA-N 0.000 description 1
- FLVURBOAHUGHCH-UHFFFAOYSA-N 2-bromo-3,4,5,6-tetrafluorobenzoyl chloride Chemical compound FC1=C(F)C(F)=C(C(Cl)=O)C(Br)=C1F FLVURBOAHUGHCH-UHFFFAOYSA-N 0.000 description 1
- KBESHLYCSZINAJ-UHFFFAOYSA-N 3-chloro-2,4,5-trifluorobenzoic acid Chemical compound OC(=O)C1=CC(F)=C(F)C(Cl)=C1F KBESHLYCSZINAJ-UHFFFAOYSA-N 0.000 description 1
- GWFALVUXAGYMHR-UHFFFAOYSA-N 4-(bromomethyl)-5-methyl-1,3-dioxol-2-one Chemical group CC=1OC(=O)OC=1CBr GWFALVUXAGYMHR-UHFFFAOYSA-N 0.000 description 1
- QCLFSYYUWPUWQR-UHFFFAOYSA-N 4-(chloromethyl)-5-methyl-1,3-dioxol-2-one Chemical compound CC=1OC(=O)OC=1CCl QCLFSYYUWPUWQR-UHFFFAOYSA-N 0.000 description 1
- SBBDHANTMHIRGW-UHFFFAOYSA-N 4-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]butanoic acid Chemical compound OCC(C)(C)C(O)C(=O)NCCCC(O)=O SBBDHANTMHIRGW-UHFFFAOYSA-N 0.000 description 1
- ILNJBIQQAIIMEY-UHFFFAOYSA-N 4-oxo-1h-quinoline-3-carboxylic acid Chemical compound C1=CC=CC2=C(O)C(C(=O)O)=CN=C21 ILNJBIQQAIIMEY-UHFFFAOYSA-N 0.000 description 1
- YCAZALSUJDPQPP-UHFFFAOYSA-N 4-oxo-3h-quinoline-3-carboxylic acid Chemical compound C1=CC=C2C(=O)C(C(=O)O)C=NC2=C1 YCAZALSUJDPQPP-UHFFFAOYSA-N 0.000 description 1
- CQPUZLMNORVQPG-UHFFFAOYSA-N 5-amino-1-cyclopropyl-6,7,8-trifluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1=C(C(O)=O)C(=O)C=2C(N)=C(F)C(F)=C(F)C=2N1C1CC1 CQPUZLMNORVQPG-UHFFFAOYSA-N 0.000 description 1
- NSRDBSTUJJKANY-UHFFFAOYSA-N 6,7,8-trifluoro-1-(4-fluorophenyl)-4-oxoquinoline-3-carboxylic acid Chemical compound C12=C(F)C(F)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1=CC=C(F)C=C1 NSRDBSTUJJKANY-UHFFFAOYSA-N 0.000 description 1
- NVOQPHWCONTIQZ-UHFFFAOYSA-N 6,7,8-trifluoro-1-(methylamino)-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C(F)C(F)=C2N(NC)C=C(C(O)=O)C(=O)C2=C1 NVOQPHWCONTIQZ-UHFFFAOYSA-N 0.000 description 1
- AZPOPHWZZLZNJB-UHFFFAOYSA-N 6,7,8-trifluoro-4-oxo-1-phenylquinoline-3-carboxylic acid Chemical compound C12=C(F)C(F)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1=CC=CC=C1 AZPOPHWZZLZNJB-UHFFFAOYSA-N 0.000 description 1
- ZBGVFPLTIBCTRU-UHFFFAOYSA-N 6,7-difluoro-1-(2-fluoroethyl)-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C(F)C=C2C(=O)C(C(=O)O)=CN(CCF)C2=C1 ZBGVFPLTIBCTRU-UHFFFAOYSA-N 0.000 description 1
- XVLGOQGYEDZYKV-UHFFFAOYSA-N 6,7-difluoro-4-oxo-1-phenylquinoline-3-carboxylic acid Chemical compound C12=CC(F)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1=CC=CC=C1 XVLGOQGYEDZYKV-UHFFFAOYSA-N 0.000 description 1
- SUJKVJSPRDGSJX-UHFFFAOYSA-N 6,8-difluoro-4-oxo-1h-quinoline-3-carboxylic acid Chemical compound C1=C(F)C=C2C(=O)C(C(=O)O)=CNC2=C1F SUJKVJSPRDGSJX-UHFFFAOYSA-N 0.000 description 1
- JKMYMNAFQPMWLI-UHFFFAOYSA-N 7-(4-amino-7-propan-2-yl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-1-cyclopropyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1C2C(C(C)C)C=CC(N)C2CN1C(C=1F)=C(F)C=C(C(C(C(O)=O)=C2)=O)C=1N2C1CC1 JKMYMNAFQPMWLI-UHFFFAOYSA-N 0.000 description 1
- KYARBIJYVGJZLB-UHFFFAOYSA-N 7-amino-4-hydroxy-2-naphthalenesulfonic acid Chemical compound OC1=CC(S(O)(=O)=O)=CC2=CC(N)=CC=C21 KYARBIJYVGJZLB-UHFFFAOYSA-N 0.000 description 1
- WTCJJEJMYYASNT-UHFFFAOYSA-N 7-chloro-1-(2,4-difluorophenyl)-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound C12=NC(Cl)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1=CC=C(F)C=C1F WTCJJEJMYYASNT-UHFFFAOYSA-N 0.000 description 1
- OXNZWNNMJBOZQO-UHFFFAOYSA-N 7-chloro-1-cyclopropyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound C12=NC(Cl)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 OXNZWNNMJBOZQO-UHFFFAOYSA-N 0.000 description 1
- ISPVACVJFUIDPD-UHFFFAOYSA-N 7-chloro-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C12=CC(Cl)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 ISPVACVJFUIDPD-UHFFFAOYSA-N 0.000 description 1
- LJYJAEQCLXAHFQ-UHFFFAOYSA-N 7-chloro-1-ethyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound FC1=C(Cl)N=C2N(CC)C=C(C(O)=O)C(=O)C2=C1 LJYJAEQCLXAHFQ-UHFFFAOYSA-N 0.000 description 1
- FWTNXHJWMFQBTD-UHFFFAOYSA-N 7-chloro-6-fluoro-1-(2-hydroxyethyl)-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C(Cl)C=C2N(CCO)C=C(C(O)=O)C(=O)C2=C1 FWTNXHJWMFQBTD-UHFFFAOYSA-N 0.000 description 1
- FBAMWRYINJFGPJ-UHFFFAOYSA-N 7-chloro-6-fluoro-1-(4-fluorophenyl)-4-oxoquinoline-3-carboxylic acid Chemical compound C12=CC(Cl)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1=CC=C(F)C=C1 FBAMWRYINJFGPJ-UHFFFAOYSA-N 0.000 description 1
- RCNJBEXSAWUACU-UHFFFAOYSA-N 7-chloro-6-fluoro-1-(methylamino)-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C(Cl)C=C2N(NC)C=C(C(O)=O)C(=O)C2=C1 RCNJBEXSAWUACU-UHFFFAOYSA-N 0.000 description 1
- HSOIWELONVQDIV-UHFFFAOYSA-N 7-cyclopropyl-2,3,3a,4,7,7a-hexahydro-1h-isoindol-4-amine Chemical compound C12CNCC2C(N)C=CC1C1CC1 HSOIWELONVQDIV-UHFFFAOYSA-N 0.000 description 1
- PBVCGUONMUDNMH-UHFFFAOYSA-N 7-ethyl-n-methyl-2,3,3a,4,7,7a-hexahydro-1h-isoindol-4-amine Chemical compound CCC1C=CC(NC)C2CNCC12 PBVCGUONMUDNMH-UHFFFAOYSA-N 0.000 description 1
- WZLAZGPMHURVPH-UHFFFAOYSA-N 7-methyl-2,3,3a,4,7,7a-hexahydro-1h-isoindol-4-amine Chemical compound CC1C=CC(N)C2CNCC12 WZLAZGPMHURVPH-UHFFFAOYSA-N 0.000 description 1
- GPHDVZHPWUOPBG-UHFFFAOYSA-N 7-propan-2-yl-2,3,3a,4,7,7a-hexahydro-1h-isoindol-4-amine Chemical compound CC(C)C1C=CC(N)C2CNCC12 GPHDVZHPWUOPBG-UHFFFAOYSA-N 0.000 description 1
- OLQDIACPQOODCW-UHFFFAOYSA-N 8-chloro-1-(2,4-difluorophenyl)-6-fluoro-7-[4-(methylamino)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-4-oxoquinoline-3-carboxylic acid;hydrochloride Chemical compound Cl.C1C2C(NC)C=CCC2CN1C(C=1Cl)=C(F)C=C(C(C(C(O)=O)=C2)=O)C=1N2C1=CC=C(F)C=C1F OLQDIACPQOODCW-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 101150041968 CDC13 gene Proteins 0.000 description 1
- 229930186147 Cephalosporin Natural products 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- RGHNJXZEOKUKBD-UHFFFAOYSA-N D-gluconic acid Natural products OCC(O)C(O)C(O)C(O)C(O)=O RGHNJXZEOKUKBD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- 241000305071 Enterobacterales Species 0.000 description 1
- 241000192125 Firmicutes Species 0.000 description 1
- IAJILQKETJEXLJ-UHFFFAOYSA-N Galacturonsaeure Natural products O=CC(O)C(O)C(O)C(O)C(O)=O IAJILQKETJEXLJ-UHFFFAOYSA-N 0.000 description 1
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 1
- 206010061201 Helminthic infection Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 239000012448 Lithium borohydride Substances 0.000 description 1
- 241001024304 Mino Species 0.000 description 1
- CGBFOAGXUAVIFJ-UHFFFAOYSA-N N,1-dimethyl-2,3,3a,4,7,7a-hexahydro-1H-isoindol-4-amine Chemical compound CC1NCC2C(C=CCC12)NC CGBFOAGXUAVIFJ-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- 239000007832 Na2SO4 Substances 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 229930182555 Penicillin Natural products 0.000 description 1
- ATTZFSUZZUNHBP-UHFFFAOYSA-N Piperonyl sulfoxide Chemical compound CCCCCCCCS(=O)C(C)CC1=CC=C2OCOC2=C1 ATTZFSUZZUNHBP-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 101100463797 Rattus norvegicus Pgrmc1 gene Proteins 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 239000004098 Tetracycline Substances 0.000 description 1
- 229910021536 Zeolite Inorganic materials 0.000 description 1
- JEDZLBFUGJTJGQ-UHFFFAOYSA-N [Na].COCCO[AlH]OCCOC Chemical compound [Na].COCCO[AlH]OCCOC JEDZLBFUGJTJGQ-UHFFFAOYSA-N 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- IAJILQKETJEXLJ-RSJOWCBRSA-N aldehydo-D-galacturonic acid Chemical compound O=C[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)C(O)=O IAJILQKETJEXLJ-RSJOWCBRSA-N 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 239000004411 aluminium Substances 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 150000001409 amidines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229940126575 aminoglycoside Drugs 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 235000003704 aspartic acid Nutrition 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 1
- GPRLTFBKWDERLU-UHFFFAOYSA-N bicyclo[2.2.2]octane Chemical compound C1CC2CCC1CC2 GPRLTFBKWDERLU-UHFFFAOYSA-N 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- JFIOVJDNOJYLKP-UHFFFAOYSA-N bithionol Chemical compound OC1=C(Cl)C=C(Cl)C=C1SC1=CC(Cl)=CC(Cl)=C1O JFIOVJDNOJYLKP-UHFFFAOYSA-N 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 229940124587 cephalosporin Drugs 0.000 description 1
- 150000001780 cephalosporins Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 230000000973 chemotherapeutic effect Effects 0.000 description 1
- 238000002512 chemotherapy Methods 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 230000001332 colony forming effect Effects 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- 150000001993 dienes Chemical class 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000003113 dilution method Methods 0.000 description 1
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 1
- 229940113088 dimethylacetamide Drugs 0.000 description 1
- ZWWCURLKEXEFQT-UHFFFAOYSA-N dinitrogen pentoxide Inorganic materials [O-][N+](=O)O[N+]([O-])=O ZWWCURLKEXEFQT-UHFFFAOYSA-N 0.000 description 1
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 1
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- ODCCJTMPMUFERV-UHFFFAOYSA-N ditert-butyl carbonate Chemical compound CC(C)(C)OC(=O)OC(C)(C)C ODCCJTMPMUFERV-UHFFFAOYSA-N 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- SRCZQMGIVIYBBJ-UHFFFAOYSA-N ethoxyethane;ethyl acetate Chemical compound CCOCC.CCOC(C)=O SRCZQMGIVIYBBJ-UHFFFAOYSA-N 0.000 description 1
- AUJJAFQISQCQHB-UHFFFAOYSA-N ethyl 2-(2,5-dichloro-3,4,6-trifluorobenzoyl)-3-(2,4-difluoroanilino)prop-2-enoate Chemical compound FC=1C(Cl)=C(F)C(F)=C(Cl)C=1C(=O)C(C(=O)OCC)=CNC1=CC=C(F)C=C1F AUJJAFQISQCQHB-UHFFFAOYSA-N 0.000 description 1
- ILKIUBXOAWKGFM-UHFFFAOYSA-N ethyl 2-(2,5-dichloro-3,4,6-trifluorobenzoyl)-3-ethoxyprop-2-enoate Chemical compound CCOC=C(C(=O)OCC)C(=O)C1=C(F)C(Cl)=C(F)C(F)=C1Cl ILKIUBXOAWKGFM-UHFFFAOYSA-N 0.000 description 1
- JZNPQRHPQJCBOE-UHFFFAOYSA-N ethyl 2-(2-bromo-3,4,5,6-tetrafluorobenzoyl)-3-(cyclopropylamino)prop-2-enoate Chemical compound FC=1C(F)=C(F)C(F)=C(Br)C=1C(=O)C(C(=O)OCC)=CNC1CC1 JZNPQRHPQJCBOE-UHFFFAOYSA-N 0.000 description 1
- BHTQWJYMOPTFOV-UHFFFAOYSA-N ethyl 2-(2-bromo-3,4,5,6-tetrafluorobenzoyl)-3-ethoxyprop-2-enoate Chemical compound CCOC=C(C(=O)OCC)C(=O)C1=C(F)C(F)=C(F)C(F)=C1Br BHTQWJYMOPTFOV-UHFFFAOYSA-N 0.000 description 1
- XPWDOJGOSKXBSX-UHFFFAOYSA-N ethyl 3-(2,5-dichloro-3,4,6-trifluorophenyl)-3-oxopropanoate Chemical compound CCOC(=O)CC(=O)C1=C(F)C(Cl)=C(F)C(F)=C1Cl XPWDOJGOSKXBSX-UHFFFAOYSA-N 0.000 description 1
- AQOYFZDUIVZXJK-UHFFFAOYSA-N ethyl 3-(cyclopropylamino)-2-(2,5-dichloro-3,4,6-trifluorobenzoyl)prop-2-enoate Chemical compound FC=1C(Cl)=C(F)C(F)=C(Cl)C=1C(=O)C(C(=O)OCC)=CNC1CC1 AQOYFZDUIVZXJK-UHFFFAOYSA-N 0.000 description 1
- XJRIRFLTONLWJG-UHFFFAOYSA-N ethyl 5,8-dichloro-1-cyclopropyl-6,7-difluoro-4-oxoquinoline-3-carboxylate Chemical compound C12=C(Cl)C(F)=C(F)C(Cl)=C2C(=O)C(C(=O)OCC)=CN1C1CC1 XJRIRFLTONLWJG-UHFFFAOYSA-N 0.000 description 1
- YQCJXLHCQJDKAX-UHFFFAOYSA-N ethyl 5-bromo-1-(2,4-difluorophenyl)-6,7,8-trifluoro-4-oxoquinoline-3-carboxylate Chemical compound C12=C(F)C(F)=C(F)C(Br)=C2C(=O)C(C(=O)OCC)=CN1C1=CC=C(F)C=C1F YQCJXLHCQJDKAX-UHFFFAOYSA-N 0.000 description 1
- JLSXYCZRMYCIMY-UHFFFAOYSA-N ethyl 7-chloro-1-(2,4-difluorophenyl)-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylate Chemical compound C12=NC(Cl)=C(F)C=C2C(=O)C(C(=O)OCC)=CN1C1=CC=C(F)C=C1F JLSXYCZRMYCIMY-UHFFFAOYSA-N 0.000 description 1
- RWCZOVMOKFTUAD-UHFFFAOYSA-N ethyl 7-chloro-1-cyclopropyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylate Chemical compound C12=NC(Cl)=C(F)C=C2C(=O)C(C(=O)OCC)=CN1C1CC1 RWCZOVMOKFTUAD-UHFFFAOYSA-N 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 238000004992 fast atom bombardment mass spectroscopy Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 229940052308 general anesthetics halogenated hydrocarbons Drugs 0.000 description 1
- 239000000174 gluconic acid Substances 0.000 description 1
- 235000012208 gluconic acid Nutrition 0.000 description 1
- 239000004220 glutamic acid Substances 0.000 description 1
- 235000013922 glutamic acid Nutrition 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 238000011081 inoculation Methods 0.000 description 1
- 239000002054 inoculum Substances 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 229960004592 isopropanol Drugs 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000006210 lotion Substances 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 229910001629 magnesium chloride Inorganic materials 0.000 description 1
- AUHZEENZYGFFBQ-UHFFFAOYSA-N mesitylene Substances CC1=CC(C)=CC(C)=C1 AUHZEENZYGFFBQ-UHFFFAOYSA-N 0.000 description 1
- 125000001827 mesitylenyl group Chemical group [H]C1=C(C(*)=C(C([H])=C1C([H])([H])[H])C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- FFACAHMRMSJQDK-UHFFFAOYSA-N methyl hexa-3,5-dienoate Chemical compound COC(=O)CC=CC=C FFACAHMRMSJQDK-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- BUYXVBOFHPFEIB-UHFFFAOYSA-N n,n-dimethyl-2,3,3a,4,7,7a-hexahydro-1h-isoindol-4-amine Chemical compound CN(C)C1C=CCC2CNCC12 BUYXVBOFHPFEIB-UHFFFAOYSA-N 0.000 description 1
- OSZKJPGPCAAACZ-UHFFFAOYSA-N n-ethyl-2,3,3a,4,7,7a-hexahydro-1h-isoindol-4-amine Chemical compound CCNC1C=CCC2CNCC12 OSZKJPGPCAAACZ-UHFFFAOYSA-N 0.000 description 1
- XBDPVNKGUTWIMJ-UHFFFAOYSA-N n-methyl-2,3,3a,4,7,7a-hexahydro-1h-isoindol-4-amine;dihydrochloride Chemical compound Cl.Cl.CNC1C=CCC2CNCC12 XBDPVNKGUTWIMJ-UHFFFAOYSA-N 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- VQTGUFBGYOIUFS-UHFFFAOYSA-N nitrosylsulfuric acid Chemical compound OS(=O)(=O)ON=O VQTGUFBGYOIUFS-UHFFFAOYSA-N 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- HVFSJXUIRWUHRG-UHFFFAOYSA-N oic acid Natural products C1CC2C3CC=C4CC(OC5C(C(O)C(O)C(CO)O5)O)CC(O)C4(C)C3CCC2(C)C1C(C)C(O)CC(C)=C(C)C(=O)OC1OC(COC(C)=O)C(O)C(O)C1OC(C(C1O)O)OC(COC(C)=O)C1OC1OC(CO)C(O)C(O)C1O HVFSJXUIRWUHRG-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- WLJNZVDCPSBLRP-UHFFFAOYSA-N pamoic acid Chemical compound C1=CC=C2C(CC=3C4=CC=CC=C4C=C(C=3O)C(=O)O)=C(O)C(C(O)=O)=CC2=C1 WLJNZVDCPSBLRP-UHFFFAOYSA-N 0.000 description 1
- 239000000123 paper Substances 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 150000002960 penicillins Chemical class 0.000 description 1
- HSFHMJJDUVEWRQ-UHFFFAOYSA-N penta-2,4-dien-1-amine Chemical compound NCC=CC=C HSFHMJJDUVEWRQ-UHFFFAOYSA-N 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 238000004321 preservation Methods 0.000 description 1
- 239000000651 prodrug Substances 0.000 description 1
- 229940002612 prodrug Drugs 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- JWEQRJSCTFBRSI-PCLIKHOPSA-N rboxylate Chemical compound COC(=O)C1C(N2C3=O)C4=CC=CC=C4OC1(C)N=C2S\C3=C\C(C=1)=CC=C(OC)C=1COC1=CC=CC=C1C JWEQRJSCTFBRSI-PCLIKHOPSA-N 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 150000003378 silver Chemical class 0.000 description 1
- 229910001961 silver nitrate Inorganic materials 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- GGCZERPQGJTIQP-UHFFFAOYSA-N sodium;9,10-dioxoanthracene-2-sulfonic acid Chemical compound [Na+].C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C2=C1 GGCZERPQGJTIQP-UHFFFAOYSA-N 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 1
- IZIHVVDVPIXTBB-UHFFFAOYSA-N tert-butyl n-(5-methylhexa-1,3-dienyl)carbamate Chemical compound CC(C)C=CC=CNC(=O)OC(C)(C)C IZIHVVDVPIXTBB-UHFFFAOYSA-N 0.000 description 1
- KTMNQGDEQPAFIO-UHFFFAOYSA-N tert-butyl n-[(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl)methyl]carbamate Chemical compound CC(C)(C)OC(=O)NCC1C=CCC2C(=O)NC(=O)C12 KTMNQGDEQPAFIO-UHFFFAOYSA-N 0.000 description 1
- DKBQOIAVVRJJJL-UHFFFAOYSA-N tert-butyl n-buta-1,3-dienylcarbamate Chemical compound CC(C)(C)OC(=O)NC=CC=C DKBQOIAVVRJJJL-UHFFFAOYSA-N 0.000 description 1
- XUKALTRSOXMVKA-UHFFFAOYSA-N tert-butyl n-penta-1,3-dienylcarbamate Chemical compound CC=CC=CNC(=O)OC(C)(C)C XUKALTRSOXMVKA-UHFFFAOYSA-N 0.000 description 1
- 235000019364 tetracycline Nutrition 0.000 description 1
- 150000003522 tetracyclines Chemical class 0.000 description 1
- 229940040944 tetracyclines Drugs 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 239000010457 zeolite Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/48—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
- C07D215/54—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3
- C07D215/56—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3 with oxygen atoms in position 4
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/44—Iso-indoles; Hydrogenated iso-indoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Life Sciences & Earth Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Communicable Diseases (AREA)
- Pharmacology & Pharmacy (AREA)
- Oncology (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE4120646A DE4120646A1 (de) | 1991-06-22 | 1991-06-22 | 7-isoindolinyl-chinolon- und naphthyridoncarbonsaeure-derivate |
| DEP4120646.0 | 1991-06-22 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA2071677A1 true CA2071677A1 (en) | 1992-12-23 |
Family
ID=6434522
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA002071677A Abandoned CA2071677A1 (en) | 1991-06-22 | 1992-06-19 | 7-isoindolinyl-quinolone- and -naphthyridonecarboxylic acid derivatives |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US5464796A (Direct) |
| EP (1) | EP0520240A1 (Direct) |
| JP (1) | JPH05239051A (Direct) |
| KR (1) | KR930000503A (Direct) |
| CN (1) | CN1068115A (Direct) |
| AU (1) | AU648669B2 (Direct) |
| CA (1) | CA2071677A1 (Direct) |
| CZ (1) | CZ190192A3 (Direct) |
| DE (1) | DE4120646A1 (Direct) |
| FI (1) | FI922873A7 (Direct) |
| HU (1) | HUT62288A (Direct) |
| IE (1) | IE922003A1 (Direct) |
| IL (1) | IL102261A (Direct) |
| MX (1) | MX9202982A (Direct) |
| NO (1) | NO922226L (Direct) |
| NZ (1) | NZ243214A (Direct) |
| PH (1) | PH30227A (Direct) |
| RU (1) | RU2056411C1 (Direct) |
| SK (1) | SK190192A3 (Direct) |
| TW (1) | TW202442B (Direct) |
Families Citing this family (36)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4230804A1 (de) * | 1992-09-15 | 1994-03-17 | Bayer Ag | 7-Isoindolinyl-chinolon- und -naphthyridon-Derivate |
| US5527910A (en) * | 1992-12-30 | 1996-06-18 | Cheil Foods & Chemicals, Inc. | Pyridone carboxylic acid compounds and their uses for treating infectious diseases caused by bacteria |
| DE4301246A1 (de) * | 1993-01-19 | 1994-07-21 | Bayer Ag | Chinolon- und Naphthyridoncarbonsäurederivate |
| US5532239A (en) * | 1993-08-02 | 1996-07-02 | Assistance Publique - Hopitaux De Paris | Therapeutic application of fluoroquinolone derivatives |
| DE4329600A1 (de) * | 1993-09-02 | 1995-03-09 | Bayer Ag | Pyrido [1,2,3-d,e] [1,3,4] benzoxadiazinderivate |
| DE4418510A1 (de) * | 1994-05-27 | 1995-11-30 | Bayer Ag | 1,9-überbrückte Thiazolol[3,4-a]chinolinderivate |
| DE4427530A1 (de) * | 1994-08-04 | 1996-02-08 | Bayer Ag | Chinolon- und Naphthyridoncarbonsäure-Derivate |
| DE4435479A1 (de) | 1994-10-04 | 1996-04-11 | Bayer Ag | Chinolon- und Naphthyridoncarbonsäure-Derivate |
| DE19500792A1 (de) * | 1995-01-13 | 1996-07-18 | Bayer Ag | Chinolon- und Naphthyridoncarbonsäure-Derivate |
| JPH08213881A (ja) * | 1995-02-02 | 1996-08-20 | Fujitsu Ltd | 周波数制御回路 |
| DE19506535A1 (de) * | 1995-02-09 | 1996-08-14 | Bayer Ag | 1,6-Naphthyridoncarbonsäurederivate |
| DE19512484A1 (de) | 1995-04-04 | 1996-10-17 | Bayer Ag | Kohlenhydratmodifizierte Cytostatika |
| AU735186B2 (en) * | 1997-09-15 | 2001-07-05 | Warner Chilcott Company, Llc | Antimicrobial quinolones, their compositions and uses |
| PA8466701A1 (es) | 1998-01-21 | 2000-09-29 | Pfizer Prod Inc | Comprimido de mesilato de trovafloxacino |
| SE9801474D0 (sv) * | 1998-04-27 | 1998-04-27 | Active Biotech Ab | Quinoline Derivatives |
| SE9802550D0 (sv) * | 1998-07-15 | 1998-07-15 | Active Biotech Ab | Quinoline derivatives |
| SE9802549D0 (sv) * | 1998-07-15 | 1998-07-15 | Active Biotech Ab | Quinoline derivatives |
| EP1134219B1 (en) * | 1998-11-24 | 2005-06-15 | Daiichi Pharmaceutical Co., Ltd. | Cycloalkyl-substituted aminomethylpyrrolidine derivatives |
| DE19854357A1 (de) * | 1998-11-25 | 2000-05-31 | Bayer Ag | Semi-Hydrochlorid von 8-Cyan-1-cyclopropyl-7-(1S,6S-2,8-diazabicyclo/4.3.0/ -nonan-8-yl)-6-fluor-1,4-dihydro-4-oxo-3-chinolincarbonsäure |
| US7176313B2 (en) * | 2000-02-09 | 2007-02-13 | Daiichi Pharmaceutical Co., Ltd. | Anti acid-fast bacterial agent containing pyridonecarboxylic acids as active ingredient |
| PT1277471E (pt) * | 2000-04-24 | 2008-08-26 | Daiichi Sankyo Co Ltd | Preparação líquida estável compreendendo sitafloxacina |
| US7220824B1 (en) | 2000-08-28 | 2007-05-22 | Bayer Aktiengesellschaft | Integrin-mediated drug targeting |
| EP1219634A1 (en) * | 2000-12-27 | 2002-07-03 | Bayer Aktiengesellschaft | Cytostatic-glycoconjugates having specifically cleavable peptidic linking units |
| CZ20032514A3 (cs) * | 2001-02-21 | 2004-05-12 | Zentariságmbh | ChinolinovéŹ isochinolinové a ftalazinové deriváty jako antagonisté gonadoliberinu |
| EP1238678A1 (en) * | 2001-03-08 | 2002-09-11 | Bayer Aktiengesellschaft | Enzyme-activated cytostatic conjugates with integrin ligands |
| RU2275361C3 (ru) * | 2002-11-20 | 2021-10-01 | Джапан Тобакко Инк. | Соединение 4-оксохинолина и его применение в качестве ингибитора вич интегразы |
| SI1937642T1 (sl) * | 2005-10-19 | 2015-01-30 | Teva Pharmaceutical Industries Ltd. | Kristali natrijevega lakvinimoda in postopek za njihovo pripravo |
| US20070196398A1 (en) * | 2006-02-17 | 2007-08-23 | Murthy Yerramilli V S | Fluoroquinolone fatty acid salt compositions |
| US20070197548A1 (en) * | 2006-02-17 | 2007-08-23 | Murthy Yerramilli V S | Fluoroquinolone compositions |
| US7973022B2 (en) | 2006-02-17 | 2011-07-05 | Idexx Laboratories, Inc. | Fluoroquinolone carboxylic acid salt compositions |
| EP1999125A2 (en) * | 2006-03-28 | 2008-12-10 | The Procter and Gamble Company | A coupling process for preparing quinolone intermediates |
| AU2007230630B2 (en) * | 2006-03-28 | 2012-12-20 | Taigen Biotechnology Co., Ltd | Malate salts, and polymorphs of (3S,5S)-7-[3-amino-5-methyl-piperidinyl]-1-cyclopropyl-1,4-dihydro-8-methoxy-4-oxo-3-quinolinecarboxylic acid |
| RU2399616C1 (ru) * | 2006-06-23 | 2010-09-20 | Джапан Тобакко Инк. | Производное 6-(гетероциклзамещенный бензил)-4-оксохинолина и его применение в качестве ингибитора интегразы вич |
| KR100690084B1 (ko) * | 2006-11-01 | 2007-03-09 | 주식회사 세홍이엔씨 | 출입문과 연동하는 주택 내 배전반 |
| USD612227S1 (en) | 2009-02-06 | 2010-03-23 | Rockler Companies, Inc. | Workpiece finishing support |
| WO2013111158A2 (en) * | 2012-01-03 | 2013-08-01 | Msn Laboratories Limited | Process for the preparation of dpp-iv inhibitor |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5746986A (en) * | 1980-09-02 | 1982-03-17 | Dai Ichi Seiyaku Co Ltd | Pyrido(1,2,3-de)(1,4)benzoxazine derivative |
| NZ208470A (en) * | 1983-07-18 | 1988-06-30 | Abbott Lab | 6-fluoro-1,4-dihydro-4-oxo-quinoline-3-carboxylic acid derivatives and antibacterial compositions containing such |
| NZ210847A (en) * | 1984-01-26 | 1988-02-29 | Abbott Lab | Naphthyridine and pyridopyrimidine derivatives and pharmaceutical compositions |
| DE3577089D1 (de) * | 1984-01-26 | 1990-05-17 | Abbott Lab | Antibakterielle chinolinderivate. |
| DE3420743A1 (de) * | 1984-06-04 | 1985-12-05 | Bayer Ag, 5090 Leverkusen | 7-amino-1-cyclopropyl-6,8-dihalogen-1,4-dihydro-4-oxo-3-chinolincarbonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel |
| GB8612137D0 (en) * | 1986-05-19 | 1986-06-25 | Fujisawa Pharmaceutical Co | Quinolone compounds |
| JPH0262875A (ja) * | 1988-05-23 | 1990-03-02 | Wakunaga Pharmaceut Co Ltd | 新規イソインドリン誘導体 |
| JP2844079B2 (ja) * | 1988-05-23 | 1999-01-06 | 塩野義製薬株式会社 | ピリドンカルボン酸系抗菌剤 |
| DE3906365A1 (de) * | 1988-07-15 | 1990-01-18 | Bayer Ag | 7-(1-pyrrolidinyl)-3-chinolon- und -naphthyridoncarbonsaeure-derivate, verfahren sowie substituierte (oxa)diazabicyclooctane und -nonane als zwischenprodukte zu ihrer herstellung, und sie enthaltende antibakterielle mittel und futterzusatzstoffe |
| DE3910663A1 (de) * | 1989-04-03 | 1990-10-04 | Bayer Ag | 5-alkylchinoloncarbonsaeuren |
| AU5404790A (en) * | 1989-04-26 | 1990-11-16 | Upjohn Company, The | Antibacterial pyrido(1,2,3-de)-1,4-benzoxazinone agents |
| CA2030217A1 (en) * | 1989-11-21 | 1991-05-22 | Jun Imose | Pyridone-carboxylic acid derivatives useful as veterinary medicines |
-
1991
- 1991-06-22 DE DE4120646A patent/DE4120646A1/de not_active Withdrawn
-
1992
- 1992-05-22 TW TW081103997A patent/TW202442B/zh active
- 1992-06-03 AU AU17391/92A patent/AU648669B2/en not_active Ceased
- 1992-06-05 NO NO92922226A patent/NO922226L/no unknown
- 1992-06-10 EP EP92109742A patent/EP0520240A1/de not_active Withdrawn
- 1992-06-11 US US07/896,955 patent/US5464796A/en not_active Expired - Fee Related
- 1992-06-17 PH PH44526A patent/PH30227A/en unknown
- 1992-06-18 MX MX9202982A patent/MX9202982A/es unknown
- 1992-06-18 FI FI922873A patent/FI922873A7/fi unknown
- 1992-06-19 JP JP4184679A patent/JPH05239051A/ja active Pending
- 1992-06-19 IL IL10226192A patent/IL102261A/en not_active IP Right Cessation
- 1992-06-19 CA CA002071677A patent/CA2071677A1/en not_active Abandoned
- 1992-06-19 CZ CS921901A patent/CZ190192A3/cs unknown
- 1992-06-19 RU SU925052282A patent/RU2056411C1/ru active
- 1992-06-19 SK SK1901-92A patent/SK190192A3/sk unknown
- 1992-06-19 NZ NZ243214A patent/NZ243214A/en unknown
- 1992-06-20 KR KR1019920010775A patent/KR930000503A/ko not_active Withdrawn
- 1992-06-22 HU HU9202085A patent/HUT62288A/hu unknown
- 1992-06-22 CN CN92104849A patent/CN1068115A/zh active Pending
- 1992-07-01 IE IE200392A patent/IE922003A1/en not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| CZ190192A3 (en) | 1993-01-13 |
| PH30227A (en) | 1997-02-05 |
| AU648669B2 (en) | 1994-04-28 |
| IL102261A (en) | 1996-10-16 |
| MX9202982A (es) | 1992-12-01 |
| IL102261A0 (en) | 1993-01-14 |
| FI922873A7 (fi) | 1992-12-23 |
| RU2056411C1 (ru) | 1996-03-20 |
| NO922226L (no) | 1992-12-23 |
| SK190192A3 (en) | 1995-08-09 |
| EP0520240A1 (de) | 1992-12-30 |
| NO922226D0 (no) | 1992-06-05 |
| US5464796A (en) | 1995-11-07 |
| HU9202085D0 (en) | 1992-09-28 |
| TW202442B (Direct) | 1993-03-21 |
| AU1739192A (en) | 1992-12-24 |
| IE922003A1 (en) | 1992-12-30 |
| NZ243214A (en) | 1995-07-26 |
| HUT62288A (en) | 1993-04-28 |
| FI922873A0 (fi) | 1992-06-18 |
| DE4120646A1 (de) | 1992-12-24 |
| KR930000503A (ko) | 1993-01-15 |
| JPH05239051A (ja) | 1993-09-17 |
| CN1068115A (zh) | 1993-01-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA2071677A1 (en) | 7-isoindolinyl-quinolone- and -naphthyridonecarboxylic acid derivatives | |
| AU671575B2 (en) | Intermediates for the manufacture of 6-fluoro-1,4-dihydro-4- oxo-3-quinoline carboxylic acids | |
| US5457104A (en) | Quinolone- and naphthyridonecarboxylic acid derivatives | |
| CZ192892A3 (en) | Derivatives of 7-azaisoindolinyl-quinolonecarboxylic and naphthyridonecarboxylic acids | |
| JPH05271229A (ja) | キノロン−およびナフチリドン−カルボン酸誘導体類 | |
| HU208128B (en) | Process for producing pyridonecarboxylic acid derivates and pharmaceutical compositions comprising such compounds as active ingredient | |
| CZ288493B6 (en) | Derivatives of 7-isoindolinylquinolone and 7-isoindolinylnaphthyridone, process of their preparation, intermediates for their preparation, their use as well as medicaments in which the derivatives are comprised | |
| JP2799222B2 (ja) | 7―(3―アミノ―および3―アミノメチル―1―ピロリジニル)―3―キノロンカルボン酸および―ナフチリドンカルボン酸の調製 | |
| KR100371883B1 (ko) | 퀴놀론-및나프티리돈카르복실산유도체 | |
| US5621105A (en) | Preparation of 7-(aminomethyl-oxa-7-aza-bicyclo[3.3.0]oct-7-yl) quinolonecarboxylic and 7-(aminomethyl-oxa-7-aza-bicyclo[3.3.0]oct-7-yl naphthyridonecarboxylic acid derivatives | |
| US5753669A (en) | Quinolone--and naphthyridonecarboxylic acid derivatives | |
| NZ250005A (en) | 4-amino-hexahydroisoindoles as process intermediates | |
| JPH07300472A (ja) | 新規キノロンカルボン酸誘導体およびその製造方法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| FZDE | Discontinued |