CA1104820A - Pressure sensitive recording papers - Google Patents
Pressure sensitive recording papersInfo
- Publication number
- CA1104820A CA1104820A CA145,410A CA145410A CA1104820A CA 1104820 A CA1104820 A CA 1104820A CA 145410 A CA145410 A CA 145410A CA 1104820 A CA1104820 A CA 1104820A
- Authority
- CA
- Canada
- Prior art keywords
- acid
- dyestuff
- dimethylbenzyl
- salicylic acid
- acceptor
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000975 dye Substances 0.000 claims abstract description 183
- 229910052751 metal Inorganic materials 0.000 claims abstract description 62
- 239000002184 metal Substances 0.000 claims abstract description 62
- 150000003839 salts Chemical class 0.000 claims abstract description 46
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical class OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims abstract description 28
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 claims description 104
- -1 alkali metal salt Chemical class 0.000 claims description 71
- 239000002253 acid Substances 0.000 claims description 61
- 229960004889 salicylic acid Drugs 0.000 claims description 55
- 239000002243 precursor Substances 0.000 claims description 54
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 claims description 52
- 239000000203 mixture Substances 0.000 claims description 37
- 230000015572 biosynthetic process Effects 0.000 claims description 32
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 claims description 28
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 19
- 238000006243 chemical reaction Methods 0.000 claims description 15
- 238000000354 decomposition reaction Methods 0.000 claims description 14
- 229910052720 vanadium Inorganic materials 0.000 claims description 11
- 229910052782 aluminium Inorganic materials 0.000 claims description 10
- 239000000725 suspension Substances 0.000 claims description 10
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 8
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 8
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 8
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical class C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 claims description 8
- 229910052725 zinc Inorganic materials 0.000 claims description 8
- 239000011701 zinc Substances 0.000 claims description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 6
- YGSDEFSMJLZEOE-UHFFFAOYSA-M salicylate Chemical compound OC1=CC=CC=C1C([O-])=O YGSDEFSMJLZEOE-UHFFFAOYSA-M 0.000 claims description 5
- 229960001860 salicylate Drugs 0.000 claims description 5
- JXJMPLUETKHWLW-UHFFFAOYSA-N 3,5-dicyclohexyl-2-hydroxybenzoic acid Chemical compound OC=1C(C(=O)O)=CC(C2CCCCC2)=CC=1C1CCCCC1 JXJMPLUETKHWLW-UHFFFAOYSA-N 0.000 claims description 4
- 229910052742 iron Inorganic materials 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 150000003863 ammonium salts Chemical class 0.000 claims description 3
- 239000000835 fiber Substances 0.000 claims description 2
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical class OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 claims 1
- 239000004327 boric acid Chemical class 0.000 claims 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 claims 1
- 238000000151 deposition Methods 0.000 claims 1
- 229910044991 metal oxide Inorganic materials 0.000 claims 1
- 150000004706 metal oxides Chemical class 0.000 claims 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical class O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 claims 1
- 235000012239 silicon dioxide Nutrition 0.000 claims 1
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 claims 1
- 125000004432 carbon atom Chemical group C* 0.000 abstract description 26
- TUJKJAMUKRIRHC-UHFFFAOYSA-N hydroxyl Chemical compound [OH] TUJKJAMUKRIRHC-UHFFFAOYSA-N 0.000 abstract 1
- ORTFAQDWJHRMNX-UHFFFAOYSA-M oxidooxomethyl Chemical compound [O-][C]=O ORTFAQDWJHRMNX-UHFFFAOYSA-M 0.000 abstract 1
- 239000000370 acceptor Substances 0.000 description 111
- 239000000243 solution Substances 0.000 description 53
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 46
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 45
- 239000007864 aqueous solution Substances 0.000 description 35
- 239000011734 sodium Substances 0.000 description 32
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 31
- 229910052708 sodium Inorganic materials 0.000 description 31
- 239000002244 precipitate Substances 0.000 description 26
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 24
- 125000006182 dimethyl benzyl group Chemical group 0.000 description 22
- 150000002739 metals Chemical class 0.000 description 22
- 238000000034 method Methods 0.000 description 22
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 20
- 239000003518 caustics Substances 0.000 description 20
- 239000000463 material Substances 0.000 description 20
- 239000001257 hydrogen Substances 0.000 description 16
- 229910052739 hydrogen Inorganic materials 0.000 description 16
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 16
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 15
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 14
- 150000001875 compounds Chemical class 0.000 description 14
- 230000000694 effects Effects 0.000 description 13
- 239000007789 gas Substances 0.000 description 13
- 230000007935 neutral effect Effects 0.000 description 13
- 150000002989 phenols Chemical class 0.000 description 13
- 239000000843 powder Substances 0.000 description 13
- 150000003751 zinc Chemical class 0.000 description 13
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 238000003756 stirring Methods 0.000 description 12
- 239000008096 xylene Substances 0.000 description 12
- 239000001569 carbon dioxide Substances 0.000 description 10
- 229960004424 carbon dioxide Drugs 0.000 description 10
- 229910002092 carbon dioxide Inorganic materials 0.000 description 10
- 239000000126 substance Substances 0.000 description 10
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 description 10
- 125000001931 aliphatic group Chemical group 0.000 description 9
- 238000002844 melting Methods 0.000 description 9
- 230000008018 melting Effects 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- 235000010210 aluminium Nutrition 0.000 description 8
- 229960004279 formaldehyde Drugs 0.000 description 8
- 235000019256 formaldehyde Nutrition 0.000 description 8
- 150000002506 iron compounds Chemical class 0.000 description 8
- 239000003094 microcapsule Substances 0.000 description 8
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 7
- 125000003118 aryl group Chemical group 0.000 description 7
- 238000010438 heat treatment Methods 0.000 description 7
- 239000002245 particle Substances 0.000 description 7
- 159000000000 sodium salts Chemical class 0.000 description 7
- NWONKYPBYAMBJT-UHFFFAOYSA-L zinc sulfate Chemical compound [Zn+2].[O-]S([O-])(=O)=O NWONKYPBYAMBJT-UHFFFAOYSA-L 0.000 description 7
- 229960001763 zinc sulfate Drugs 0.000 description 7
- 229910000368 zinc sulfate Inorganic materials 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 239000004372 Polyvinyl alcohol Substances 0.000 description 6
- 150000007513 acids Chemical class 0.000 description 6
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 6
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 6
- 239000013078 crystal Substances 0.000 description 6
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 6
- 239000002798 polar solvent Substances 0.000 description 6
- 229920002451 polyvinyl alcohol Polymers 0.000 description 6
- 239000004094 surface-active agent Substances 0.000 description 6
- ZJWUEJOPKFYFQD-UHFFFAOYSA-N 2-hydroxy-3-phenylbenzoic acid Chemical compound OC(=O)C1=CC=CC(C=2C=CC=CC=2)=C1O ZJWUEJOPKFYFQD-UHFFFAOYSA-N 0.000 description 5
- ZWQBZEFLFSFEOS-UHFFFAOYSA-N 3,5-ditert-butyl-2-hydroxybenzoic acid Chemical compound CC(C)(C)C1=CC(C(O)=O)=C(O)C(C(C)(C)C)=C1 ZWQBZEFLFSFEOS-UHFFFAOYSA-N 0.000 description 5
- 239000005711 Benzoic acid Substances 0.000 description 5
- DIZPMCHEQGEION-UHFFFAOYSA-H aluminium sulfate (anhydrous) Chemical compound [Al+3].[Al+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O DIZPMCHEQGEION-UHFFFAOYSA-H 0.000 description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 5
- 235000010233 benzoic acid Nutrition 0.000 description 5
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 5
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 5
- 230000008859 change Effects 0.000 description 5
- 239000000306 component Substances 0.000 description 5
- 229920001577 copolymer Polymers 0.000 description 5
- 150000002148 esters Chemical class 0.000 description 5
- 239000001301 oxygen Substances 0.000 description 5
- 229910052760 oxygen Inorganic materials 0.000 description 5
- 230000008569 process Effects 0.000 description 5
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 4
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 4
- 238000010521 absorption reaction Methods 0.000 description 4
- LLEMOWNGBBNAJR-UHFFFAOYSA-N biphenyl-2-ol Chemical compound OC1=CC=CC=C1C1=CC=CC=C1 LLEMOWNGBBNAJR-UHFFFAOYSA-N 0.000 description 4
- 239000003086 colorant Substances 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 229920001971 elastomer Polymers 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- LEQAOMBKQFMDFZ-UHFFFAOYSA-N glyoxal Chemical compound O=CC=O LEQAOMBKQFMDFZ-UHFFFAOYSA-N 0.000 description 4
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 4
- 238000002955 isolation Methods 0.000 description 4
- 239000011133 lead Substances 0.000 description 4
- 229920000609 methyl cellulose Polymers 0.000 description 4
- 239000001923 methylcellulose Substances 0.000 description 4
- 235000010981 methylcellulose Nutrition 0.000 description 4
- WWZKQHOCKIZLMA-UHFFFAOYSA-N octanoic acid Chemical compound CCCCCCCC(O)=O WWZKQHOCKIZLMA-UHFFFAOYSA-N 0.000 description 4
- 229920005989 resin Polymers 0.000 description 4
- 239000011347 resin Substances 0.000 description 4
- 239000005060 rubber Substances 0.000 description 4
- 229910052719 titanium Inorganic materials 0.000 description 4
- 239000010936 titanium Substances 0.000 description 4
- 238000011282 treatment Methods 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 3
- YKTSYUJCYHOUJP-UHFFFAOYSA-N [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] Chemical compound [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] YKTSYUJCYHOUJP-UHFFFAOYSA-N 0.000 description 3
- 229920006322 acrylamide copolymer Polymers 0.000 description 3
- 229910052787 antimony Inorganic materials 0.000 description 3
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 3
- 229910052797 bismuth Inorganic materials 0.000 description 3
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 description 3
- 229910052791 calcium Inorganic materials 0.000 description 3
- 239000011575 calcium Substances 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 239000004927 clay Substances 0.000 description 3
- 229910052570 clay Inorganic materials 0.000 description 3
- 239000006185 dispersion Substances 0.000 description 3
- 239000010419 fine particle Substances 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000002367 halogens Chemical class 0.000 description 3
- 238000002329 infrared spectrum Methods 0.000 description 3
- 229910010272 inorganic material Inorganic materials 0.000 description 3
- 239000011147 inorganic material Substances 0.000 description 3
- 150000002576 ketones Chemical class 0.000 description 3
- 239000011777 magnesium Substances 0.000 description 3
- 229910052749 magnesium Inorganic materials 0.000 description 3
- HCWCAKKEBCNQJP-UHFFFAOYSA-N magnesium orthosilicate Chemical compound [Mg+2].[Mg+2].[O-][Si]([O-])([O-])[O-] HCWCAKKEBCNQJP-UHFFFAOYSA-N 0.000 description 3
- 239000000391 magnesium silicate Substances 0.000 description 3
- 229910052919 magnesium silicate Inorganic materials 0.000 description 3
- 235000019792 magnesium silicate Nutrition 0.000 description 3
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 3
- 230000007246 mechanism Effects 0.000 description 3
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 3
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 description 3
- 229920002401 polyacrylamide Polymers 0.000 description 3
- 229910052573 porcelain Inorganic materials 0.000 description 3
- 235000019260 propionic acid Nutrition 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- 239000011787 zinc oxide Substances 0.000 description 3
- NYUCPFMRQPYIRQ-UHFFFAOYSA-N 2,4-dicyclohexylphenol Chemical compound OC1=CC=C(C2CCCCC2)C=C1C1CCCCC1 NYUCPFMRQPYIRQ-UHFFFAOYSA-N 0.000 description 2
- MFSJUURIAOOSJR-UHFFFAOYSA-N 2-hydroxy-5-(2,4,4-trimethylpentan-2-yl)benzoic acid Chemical compound CC(C)(C)CC(C)(C)C1=CC=C(O)C(C(O)=O)=C1 MFSJUURIAOOSJR-UHFFFAOYSA-N 0.000 description 2
- UPHOPMSGKZNELG-UHFFFAOYSA-N 2-hydroxynaphthalene-1-carboxylic acid Chemical compound C1=CC=C2C(C(=O)O)=C(O)C=CC2=C1 UPHOPMSGKZNELG-UHFFFAOYSA-N 0.000 description 2
- HXDOZKJGKXYMEW-UHFFFAOYSA-N 4-ethylphenol Chemical compound CCC1=CC=C(O)C=C1 HXDOZKJGKXYMEW-UHFFFAOYSA-N 0.000 description 2
- 125000003143 4-hydroxybenzyl group Chemical group [H]C([*])([H])C1=C([H])C([H])=C(O[H])C([H])=C1[H] 0.000 description 2
- GZEPXNUXMPYSOQ-UHFFFAOYSA-N 5-cyclohexyl-2-hydroxybenzoic acid Chemical compound C1=C(O)C(C(=O)O)=CC(C2CCCCC2)=C1 GZEPXNUXMPYSOQ-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- 239000005635 Caprylic acid (CAS 124-07-2) Substances 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- 229910002651 NO3 Inorganic materials 0.000 description 2
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 2
- 239000004793 Polystyrene Substances 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 2
- 239000004110 Zinc silicate Substances 0.000 description 2
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 239000002168 alkylating agent Substances 0.000 description 2
- 229940100198 alkylating agent Drugs 0.000 description 2
- XYLMUPLGERFSHI-UHFFFAOYSA-N alpha-Methylstyrene Chemical compound CC(=C)C1=CC=CC=C1 XYLMUPLGERFSHI-UHFFFAOYSA-N 0.000 description 2
- WNROFYMDJYEPJX-UHFFFAOYSA-K aluminium hydroxide Chemical compound [OH-].[OH-].[OH-].[Al+3] WNROFYMDJYEPJX-UHFFFAOYSA-K 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 125000000129 anionic group Chemical group 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 229910052788 barium Inorganic materials 0.000 description 2
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 229910052804 chromium Inorganic materials 0.000 description 2
- 239000011651 chromium Substances 0.000 description 2
- 229910017052 cobalt Inorganic materials 0.000 description 2
- 239000010941 cobalt Substances 0.000 description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 2
- ZOIVSVWBENBHNT-UHFFFAOYSA-N dizinc;silicate Chemical compound [Zn+2].[Zn+2].[O-][Si]([O-])([O-])[O-] ZOIVSVWBENBHNT-UHFFFAOYSA-N 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 229910052730 francium Inorganic materials 0.000 description 2
- KLMCZVJOEAUDNE-UHFFFAOYSA-N francium atom Chemical compound [Fr] KLMCZVJOEAUDNE-UHFFFAOYSA-N 0.000 description 2
- 229940015043 glyoxal Drugs 0.000 description 2
- 230000000266 injurious effect Effects 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 229920000126 latex Polymers 0.000 description 2
- 239000004816 latex Substances 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- IVSZLXZYQVIEFR-UHFFFAOYSA-N m-xylene Chemical group CC1=CC=CC(C)=C1 IVSZLXZYQVIEFR-UHFFFAOYSA-N 0.000 description 2
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 2
- 239000001095 magnesium carbonate Substances 0.000 description 2
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 2
- 229940099596 manganese sulfate Drugs 0.000 description 2
- 239000011702 manganese sulphate Substances 0.000 description 2
- 235000007079 manganese sulphate Nutrition 0.000 description 2
- SQQMAOCOWKFBNP-UHFFFAOYSA-L manganese(II) sulfate Chemical compound [Mn+2].[O-]S([O-])(=O)=O SQQMAOCOWKFBNP-UHFFFAOYSA-L 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 125000006178 methyl benzyl group Chemical group 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 2
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- CRVVHBFLWWQMPT-UHFFFAOYSA-N naphthalene-1-sulfonic acid;sodium Chemical compound [Na].C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 CRVVHBFLWWQMPT-UHFFFAOYSA-N 0.000 description 2
- 238000006386 neutralization reaction Methods 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- QWVGKYWNOKOFNN-UHFFFAOYSA-N o-cresol Chemical compound CC1=CC=CC=C1O QWVGKYWNOKOFNN-UHFFFAOYSA-N 0.000 description 2
- 229960002446 octanoic acid Drugs 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 235000010292 orthophenyl phenol Nutrition 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 230000036647 reaction Effects 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- 229910052712 strontium Inorganic materials 0.000 description 2
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 description 2
- 229920003048 styrene butadiene rubber Polymers 0.000 description 2
- 229910052718 tin Inorganic materials 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- 235000019352 zinc silicate Nutrition 0.000 description 2
- 229910052726 zirconium Inorganic materials 0.000 description 2
- LIZLYZVAYZQVPG-UHFFFAOYSA-N (3-bromo-2-fluorophenyl)methanol Chemical compound OCC1=CC=CC(Br)=C1F LIZLYZVAYZQVPG-UHFFFAOYSA-N 0.000 description 1
- OHVLMTFVQDZYHP-UHFFFAOYSA-N 1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)-2-[4-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]piperazin-1-yl]ethanone Chemical compound N1N=NC=2CN(CCC=21)C(CN1CCN(CC1)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)=O OHVLMTFVQDZYHP-UHFFFAOYSA-N 0.000 description 1
- BYLSIPUARIZAHZ-UHFFFAOYSA-N 2,4,6-tris(1-phenylethyl)phenol Chemical compound C=1C(C(C)C=2C=CC=CC=2)=C(O)C(C(C)C=2C=CC=CC=2)=CC=1C(C)C1=CC=CC=C1 BYLSIPUARIZAHZ-UHFFFAOYSA-N 0.000 description 1
- ICKWICRCANNIBI-UHFFFAOYSA-N 2,4-di-tert-butylphenol Chemical compound CC(C)(C)C1=CC=C(O)C(C(C)(C)C)=C1 ICKWICRCANNIBI-UHFFFAOYSA-N 0.000 description 1
- PJXFYWVQCOCKER-UHFFFAOYSA-N 2,5-dicyclohexyl-3,6-dihydroxybenzoic acid Chemical compound OC(=O)C1=C(O)C(C2CCCCC2)=CC(O)=C1C1CCCCC1 PJXFYWVQCOCKER-UHFFFAOYSA-N 0.000 description 1
- ZNWYDVLDVGROPG-UHFFFAOYSA-N 2,5-dicyclohexyl-6-hydroxy-3-methoxybenzoic acid Chemical compound OC=1C(C(O)=O)=C(C2CCCCC2)C(OC)=CC=1C1CCCCC1 ZNWYDVLDVGROPG-UHFFFAOYSA-N 0.000 description 1
- BWTPQCJWNPXHED-UHFFFAOYSA-N 2,5-dihydroxy-4-(2,4,4-trimethylpentan-2-yl)benzoic acid Chemical compound CC(C)(C)CC(C)(C)C1=CC(O)=C(C(O)=O)C=C1O BWTPQCJWNPXHED-UHFFFAOYSA-N 0.000 description 1
- AUEZNTKYSSUTGZ-UHFFFAOYSA-N 2,6-dicyclohexylphenol Chemical compound OC1=C(C2CCCCC2)C=CC=C1C1CCCCC1 AUEZNTKYSSUTGZ-UHFFFAOYSA-N 0.000 description 1
- LDXJRKWFNNFDSA-UHFFFAOYSA-N 2-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)-1-[4-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]piperazin-1-yl]ethanone Chemical compound C1CN(CC2=NNN=C21)CC(=O)N3CCN(CC3)C4=CN=C(N=C4)NCC5=CC(=CC=C5)OC(F)(F)F LDXJRKWFNNFDSA-UHFFFAOYSA-N 0.000 description 1
- IXQGCWUGDFDQMF-UHFFFAOYSA-N 2-Ethylphenol Chemical compound CCC1=CC=CC=C1O IXQGCWUGDFDQMF-UHFFFAOYSA-N 0.000 description 1
- WZFUQSJFWNHZHM-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)CC(=O)N1CC2=C(CC1)NN=N2 WZFUQSJFWNHZHM-UHFFFAOYSA-N 0.000 description 1
- JQMFQLVAJGZSQS-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]-N-(2-oxo-3H-1,3-benzoxazol-6-yl)acetamide Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)CC(=O)NC1=CC2=C(NC(O2)=O)C=C1 JQMFQLVAJGZSQS-UHFFFAOYSA-N 0.000 description 1
- ZRPAUEVGEGEPFQ-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]pyrazol-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C=1C=NN(C=1)CC(=O)N1CC2=C(CC1)NN=N2 ZRPAUEVGEGEPFQ-UHFFFAOYSA-N 0.000 description 1
- YJLUBHOZZTYQIP-UHFFFAOYSA-N 2-[5-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-1,3,4-oxadiazol-2-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C1=NN=C(O1)CC(=O)N1CC2=C(CC1)NN=N2 YJLUBHOZZTYQIP-UHFFFAOYSA-N 0.000 description 1
- WWJYBZRILAEBKN-UHFFFAOYSA-N 2-butoxybenzoic acid;zinc Chemical compound [Zn].CCCCOC1=CC=CC=C1C(O)=O WWJYBZRILAEBKN-UHFFFAOYSA-N 0.000 description 1
- MMBZFKDQNOQTDC-UHFFFAOYSA-N 2-hydroxy-3,5-bis(2-methylbutan-2-yl)benzoic acid Chemical compound CCC(C)(C)C1=CC(C(O)=O)=C(O)C(C(C)(C)CC)=C1 MMBZFKDQNOQTDC-UHFFFAOYSA-N 0.000 description 1
- VZJBTQGMDGPHTI-UHFFFAOYSA-N 2-hydroxy-3-methyl-5-(2,4,4-trimethylpentan-2-yl)benzoic acid Chemical compound CC1=CC(C(C)(C)CC(C)(C)C)=CC(C(O)=O)=C1O VZJBTQGMDGPHTI-UHFFFAOYSA-N 0.000 description 1
- KXGUIHKHSLSFDP-UHFFFAOYSA-N 2-hydroxy-3-methyl-5-(2-methylbutan-2-yl)benzoic acid Chemical compound CCC(C)(C)C1=CC(C)=C(O)C(C(O)=O)=C1 KXGUIHKHSLSFDP-UHFFFAOYSA-N 0.000 description 1
- MPJWSQYVWORIJW-UHFFFAOYSA-N 2-hydroxy-3-methyl-5-nonylbenzoic acid Chemical compound CCCCCCCCCC1=CC(C)=C(O)C(C(O)=O)=C1 MPJWSQYVWORIJW-UHFFFAOYSA-N 0.000 description 1
- ZIHNKVLRTWFXPA-UHFFFAOYSA-N 2-hydroxy-3-nonylbenzoic acid Chemical compound CCCCCCCCCC1=CC=CC(C(O)=O)=C1O ZIHNKVLRTWFXPA-UHFFFAOYSA-N 0.000 description 1
- BJBVGFSSOKZLSC-UHFFFAOYSA-N 2-hydroxy-5-methyl-3-(2,4,4-trimethylpentan-2-yl)benzoic acid Chemical compound CC1=CC(C(O)=O)=C(O)C(C(C)(C)CC(C)(C)C)=C1 BJBVGFSSOKZLSC-UHFFFAOYSA-N 0.000 description 1
- YVLFTXRMFPVQHV-UHFFFAOYSA-N 2-hydroxy-5-methyl-3-(2-methylbutan-2-yl)benzoic acid Chemical compound CCC(C)(C)C1=CC(C)=CC(C(O)=O)=C1O YVLFTXRMFPVQHV-UHFFFAOYSA-N 0.000 description 1
- UIYCTSSRJGECEM-UHFFFAOYSA-N 2-hydroxy-5-nonylbenzoic acid Chemical compound CCCCCCCCCC1=CC=C(O)C(C(O)=O)=C1 UIYCTSSRJGECEM-UHFFFAOYSA-N 0.000 description 1
- XIIKROUWHAKQKZ-UHFFFAOYSA-N 2-hydroxy-5-octoxybenzoic acid Chemical compound CCCCCCCCOC1=CC=C(O)C(C(O)=O)=C1 XIIKROUWHAKQKZ-UHFFFAOYSA-N 0.000 description 1
- LGERKUYJCZOBTB-UHFFFAOYSA-N 2-hydroxy-5-phenylbenzoic acid Chemical compound C1=C(O)C(C(=O)O)=CC(C=2C=CC=CC=2)=C1 LGERKUYJCZOBTB-UHFFFAOYSA-N 0.000 description 1
- PNERJPORNFOLIT-UHFFFAOYSA-N 2-hydroxy-5-phenylmethoxybenzoic acid Chemical compound C1=C(O)C(C(=O)O)=CC(OCC=2C=CC=CC=2)=C1 PNERJPORNFOLIT-UHFFFAOYSA-N 0.000 description 1
- UEJVSOJRGUIWCY-UHFFFAOYSA-N 2-hydroxybenzoic acid;zinc Chemical compound [Zn].OC(=O)C1=CC=CC=C1O UEJVSOJRGUIWCY-UHFFFAOYSA-N 0.000 description 1
- WRVXGYISPLUWFY-UHFFFAOYSA-N 2-methoxy-5-methyl-1,3-di(propan-2-yl)benzene Chemical compound COC1=C(C(C)C)C=C(C)C=C1C(C)C WRVXGYISPLUWFY-UHFFFAOYSA-N 0.000 description 1
- QYQIGAQFKXEMGK-UHFFFAOYSA-N 2-phenoxy-5-(2,4,4-trimethylpentan-2-yl)benzoic acid Chemical compound C1(=CC=CC=C1)OC=1C(C(=O)O)=CC(=CC1)C(C)(C)CC(C)(C)C QYQIGAQFKXEMGK-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- IKEHOXWJQXIQAG-UHFFFAOYSA-N 2-tert-butyl-4-methylphenol Chemical compound CC1=CC=C(O)C(C(C)(C)C)=C1 IKEHOXWJQXIQAG-UHFFFAOYSA-N 0.000 description 1
- VRBHDMYZQYOBST-UHFFFAOYSA-N 3,5-dibenzyl-2-hydroxybenzoic acid Chemical compound C=1C(CC=2C=CC=CC=2)=C(O)C(C(=O)O)=CC=1CC1=CC=CC=C1 VRBHDMYZQYOBST-UHFFFAOYSA-N 0.000 description 1
- FCMOEWXMKJIEEU-UHFFFAOYSA-N 3,5-dicyclohexyl-2,6-dihydroxybenzoic acid Chemical compound OC=1C(C(=O)O)=C(O)C(C2CCCCC2)=CC=1C1CCCCC1 FCMOEWXMKJIEEU-UHFFFAOYSA-N 0.000 description 1
- XXOMGIOJFSQFPJ-UHFFFAOYSA-N 3,5-dicyclohexyl-2-hydroxybenzoic acid;zinc Chemical compound [Zn].OC=1C(C(=O)O)=CC(C2CCCCC2)=CC=1C1CCCCC1 XXOMGIOJFSQFPJ-UHFFFAOYSA-N 0.000 description 1
- FVQBNGXOHJYGMZ-UHFFFAOYSA-N 3,5-ditert-butyl-2,6-dihydroxybenzoic acid Chemical compound CC(C)(C)C1=CC(C(C)(C)C)=C(O)C(C(O)=O)=C1O FVQBNGXOHJYGMZ-UHFFFAOYSA-N 0.000 description 1
- YLZOPXRUQYQQID-UHFFFAOYSA-N 3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)-1-[4-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]piperazin-1-yl]propan-1-one Chemical compound N1N=NC=2CN(CCC=21)CCC(=O)N1CCN(CC1)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F YLZOPXRUQYQQID-UHFFFAOYSA-N 0.000 description 1
- YMIMIZAATKUMAU-UHFFFAOYSA-N 3-benzyl-2-hydroxy-5-methylbenzoic acid Chemical compound OC(=O)C1=CC(C)=CC(CC=2C=CC=CC=2)=C1O YMIMIZAATKUMAU-UHFFFAOYSA-N 0.000 description 1
- YUVVASYGZFERRP-UHFFFAOYSA-N 3-benzyl-2-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=CC(CC=2C=CC=CC=2)=C1O YUVVASYGZFERRP-UHFFFAOYSA-N 0.000 description 1
- VXZWFJBNGBJMQG-UHFFFAOYSA-N 3-benzyl-5-ethyl-2-hydroxybenzoic acid Chemical compound OC(=O)C1=CC(CC)=CC(CC=2C=CC=CC=2)=C1O VXZWFJBNGBJMQG-UHFFFAOYSA-N 0.000 description 1
- KRURQIHYKWJTSU-UHFFFAOYSA-N 3-cyclohexyl-2,5-dihydroxybenzoic acid Chemical compound OC(=O)C1=CC(O)=CC(C2CCCCC2)=C1O KRURQIHYKWJTSU-UHFFFAOYSA-N 0.000 description 1
- NMJRPFVZTPYVOS-UHFFFAOYSA-N 3-cyclohexyl-2-hydroxy-5-(2,4,4-trimethylpentan-2-yl)benzoic acid Chemical compound OC(=O)C1=CC(C(C)(C)CC(C)(C)C)=CC(C2CCCCC2)=C1O NMJRPFVZTPYVOS-UHFFFAOYSA-N 0.000 description 1
- PMHMGNPIZKQQPM-UHFFFAOYSA-N 3-cyclohexyl-2-hydroxy-5-(2-methylbutan-2-yl)benzoic acid Chemical compound OC(=O)C1=CC(C(C)(C)CC)=CC(C2CCCCC2)=C1O PMHMGNPIZKQQPM-UHFFFAOYSA-N 0.000 description 1
- BIKKCCLOPQKAHN-UHFFFAOYSA-N 3-cyclohexyl-2-hydroxy-5-methylbenzoic acid Chemical compound OC(=O)C1=CC(C)=CC(C2CCCCC2)=C1O BIKKCCLOPQKAHN-UHFFFAOYSA-N 0.000 description 1
- YEGFJLMDJNBOTQ-UHFFFAOYSA-N 3-cyclohexyl-2-hydroxy-5-nonylbenzoic acid Chemical compound OC(=O)C1=CC(CCCCCCCCC)=CC(C2CCCCC2)=C1O YEGFJLMDJNBOTQ-UHFFFAOYSA-N 0.000 description 1
- KDBRGZXQFVNHHY-UHFFFAOYSA-N 3-cyclohexyl-5-ethyl-2-hydroxybenzoic acid Chemical compound OC(=O)C1=CC(CC)=CC(C2CCCCC2)=C1O KDBRGZXQFVNHHY-UHFFFAOYSA-N 0.000 description 1
- ZTGYRAPTDJTYGC-UHFFFAOYSA-N 3-ethyl-2-hydroxybenzoic acid Chemical compound CCC1=CC=CC(C(O)=O)=C1O ZTGYRAPTDJTYGC-UHFFFAOYSA-N 0.000 description 1
- QMYGFTJCQFEDST-UHFFFAOYSA-N 3-methoxybutyl acetate Chemical group COC(C)CCOC(C)=O QMYGFTJCQFEDST-UHFFFAOYSA-N 0.000 description 1
- YHQXBTXEYZIYOV-UHFFFAOYSA-N 3-methylbut-1-ene Chemical compound CC(C)C=C YHQXBTXEYZIYOV-UHFFFAOYSA-N 0.000 description 1
- WPFOUMKVNYDAOU-UHFFFAOYSA-N 3-tert-butyl-2-hydroxy-5-methylbenzoic acid Chemical compound CC1=CC(C(O)=O)=C(O)C(C(C)(C)C)=C1 WPFOUMKVNYDAOU-UHFFFAOYSA-N 0.000 description 1
- CBTJRUVHCIAJNF-UHFFFAOYSA-N 3-tert-butyl-2-hydroxy-5-methylbenzoic acid;zinc Chemical compound [Zn].CC1=CC(C(O)=O)=C(O)C(C(C)(C)C)=C1 CBTJRUVHCIAJNF-UHFFFAOYSA-N 0.000 description 1
- MPQGAGLLKJNYMB-UHFFFAOYSA-N 3-tert-butyl-2-hydroxy-5-phenylbenzoic acid Chemical compound OC(=O)C1=C(O)C(C(C)(C)C)=CC(C=2C=CC=CC=2)=C1 MPQGAGLLKJNYMB-UHFFFAOYSA-N 0.000 description 1
- QLWBIEKGVNMENS-UHFFFAOYSA-N 3-tert-butyl-2-hydroxy-5-phenylmethoxybenzoic acid Chemical compound OC(=O)C1=C(O)C(C(C)(C)C)=CC(OCC=2C=CC=CC=2)=C1 QLWBIEKGVNMENS-UHFFFAOYSA-N 0.000 description 1
- ZAAMQANODYDRDF-UHFFFAOYSA-N 3-tert-butyl-2-hydroxybenzoic acid Chemical compound CC(C)(C)C1=CC=CC(C(O)=O)=C1O ZAAMQANODYDRDF-UHFFFAOYSA-N 0.000 description 1
- HQLKLROACJZMDP-UHFFFAOYSA-N 3-tert-butyl-5-cyclohexyl-2-hydroxybenzoic acid Chemical compound OC(=O)C1=C(O)C(C(C)(C)C)=CC(C2CCCCC2)=C1 HQLKLROACJZMDP-UHFFFAOYSA-N 0.000 description 1
- UEEALPHOIIFDJY-UHFFFAOYSA-N 3-tert-butyl-5-ethoxy-2-hydroxybenzoic acid Chemical compound CCOC1=CC(C(O)=O)=C(O)C(C(C)(C)C)=C1 UEEALPHOIIFDJY-UHFFFAOYSA-N 0.000 description 1
- ZRSKFKLTWVKMPL-UHFFFAOYSA-N 3-tert-butyl-5-ethyl-2-hydroxybenzoic acid Chemical compound CCC1=CC(C(O)=O)=C(O)C(C(C)(C)C)=C1 ZRSKFKLTWVKMPL-UHFFFAOYSA-N 0.000 description 1
- PQNMGDGIXHFORR-UHFFFAOYSA-N 4,6-dicyclohexyl-2,3-dihydroxybenzoic acid Chemical compound OC(=O)C1=C(O)C(O)=C(C2CCCCC2)C=C1C1CCCCC1 PQNMGDGIXHFORR-UHFFFAOYSA-N 0.000 description 1
- ISKKKAJAIQODMB-UHFFFAOYSA-N 4,6-ditert-butyl-2,3-dihydroxybenzoic acid Chemical compound CC(C)(C)C1=CC(C(C)(C)C)=C(C(O)=O)C(O)=C1O ISKKKAJAIQODMB-UHFFFAOYSA-N 0.000 description 1
- JLBJTVDPSNHSKJ-UHFFFAOYSA-N 4-Methylstyrene Chemical compound CC1=CC=C(C=C)C=C1 JLBJTVDPSNHSKJ-UHFFFAOYSA-N 0.000 description 1
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 1
- WXNZTHHGJRFXKQ-UHFFFAOYSA-N 4-chlorophenol Chemical compound OC1=CC=C(Cl)C=C1 WXNZTHHGJRFXKQ-UHFFFAOYSA-N 0.000 description 1
- ZRKTXOPAVZTQFC-UHFFFAOYSA-N 4-cyclohexyl-2,5-dihydroxybenzoic acid Chemical compound C1=C(O)C(C(=O)O)=CC(O)=C1C1CCCCC1 ZRKTXOPAVZTQFC-UHFFFAOYSA-N 0.000 description 1
- HFRUPPHPJRZOCM-UHFFFAOYSA-N 4-octoxyphenol Chemical compound CCCCCCCCOC1=CC=C(O)C=C1 HFRUPPHPJRZOCM-UHFFFAOYSA-N 0.000 description 1
- CGGOICQTWQZELT-UHFFFAOYSA-N 5,7-ditert-butyl-3-hydroxynaphthalene-2-carboxylic acid Chemical compound C1=C(O)C(C(O)=O)=CC2=CC(C(C)(C)C)=CC(C(C)(C)C)=C21 CGGOICQTWQZELT-UHFFFAOYSA-N 0.000 description 1
- RFKNBSDIQLCADD-UHFFFAOYSA-N 5-benzyl-2-hydroxy-3-methylbenzoic acid Chemical compound OC(=O)C1=C(O)C(C)=CC(CC=2C=CC=CC=2)=C1 RFKNBSDIQLCADD-UHFFFAOYSA-N 0.000 description 1
- XSHSRHGUKNUUQC-UHFFFAOYSA-N 5-benzyl-3-cyclohexyl-2-hydroxybenzoic acid Chemical compound C=1C(C2CCCCC2)=C(O)C(C(=O)O)=CC=1CC1=CC=CC=C1 XSHSRHGUKNUUQC-UHFFFAOYSA-N 0.000 description 1
- VBTHGFRCYGIEIN-UHFFFAOYSA-N 5-benzyl-3-tert-butyl-2-hydroxybenzoic acid Chemical compound OC(=O)C1=C(O)C(C(C)(C)C)=CC(CC=2C=CC=CC=2)=C1 VBTHGFRCYGIEIN-UHFFFAOYSA-N 0.000 description 1
- JPFLTZJSVRHQLP-UHFFFAOYSA-N 5-chloro-2-hydroxy-3-phenylbenzoic acid Chemical compound OC(=O)C1=CC(Cl)=CC(C=2C=CC=CC=2)=C1O JPFLTZJSVRHQLP-UHFFFAOYSA-N 0.000 description 1
- BMHSLOMTPRAAIQ-UHFFFAOYSA-N 5-cyclohexyl-2,3-dihydroxybenzoic acid Chemical compound OC1=C(O)C(C(=O)O)=CC(C2CCCCC2)=C1 BMHSLOMTPRAAIQ-UHFFFAOYSA-N 0.000 description 1
- OCWOHTNEZQRRMD-UHFFFAOYSA-N 5-cyclohexyl-2-hydroxy-3-(2,4,4-trimethylpentan-2-yl)benzoic acid Chemical compound OC(=O)C1=C(O)C(C(C)(C)CC(C)(C)C)=CC(C2CCCCC2)=C1 OCWOHTNEZQRRMD-UHFFFAOYSA-N 0.000 description 1
- MBDRTDHYZLTMJT-UHFFFAOYSA-N 5-cyclohexyl-2-hydroxy-3-methylbenzoic acid Chemical compound OC(=O)C1=C(O)C(C)=CC(C2CCCCC2)=C1 MBDRTDHYZLTMJT-UHFFFAOYSA-N 0.000 description 1
- DJKBXNAGHAPRKW-UHFFFAOYSA-N 5-tert-butyl-2-hydroxy-3-phenylbenzoic acid Chemical compound CC(C)(C)C1=CC(C(O)=O)=C(O)C(C=2C=CC=CC=2)=C1 DJKBXNAGHAPRKW-UHFFFAOYSA-N 0.000 description 1
- XAICWTLLSRXZPB-UHFFFAOYSA-N 5-tert-butyl-2-hydroxybenzoic acid Chemical compound CC(C)(C)C1=CC=C(O)C(C(O)=O)=C1 XAICWTLLSRXZPB-UHFFFAOYSA-N 0.000 description 1
- MBOFLQUTBYOENG-UHFFFAOYSA-N 5-tert-butyl-2-phenoxybenzoic acid Chemical compound C1(=CC=CC=C1)OC=1C(C(=O)O)=CC(=CC1)C(C)(C)C MBOFLQUTBYOENG-UHFFFAOYSA-N 0.000 description 1
- FDDDCIALKREYBX-UHFFFAOYSA-N 5-tert-butyl-3-cyclohexyl-2-hydroxybenzoic acid Chemical compound OC(=O)C1=CC(C(C)(C)C)=CC(C2CCCCC2)=C1O FDDDCIALKREYBX-UHFFFAOYSA-N 0.000 description 1
- CONKBQPVFMXDOV-QHCPKHFHSA-N 6-[(5S)-5-[[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]methyl]-2-oxo-1,3-oxazolidin-3-yl]-3H-1,3-benzoxazol-2-one Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)C[C@H]1CN(C(O1)=O)C1=CC2=C(NC(O2)=O)C=C1 CONKBQPVFMXDOV-QHCPKHFHSA-N 0.000 description 1
- DFVOXRAAHOJJBN-UHFFFAOYSA-N 6-methylhept-1-ene Chemical compound CC(C)CCCC=C DFVOXRAAHOJJBN-UHFFFAOYSA-N 0.000 description 1
- HCJMNOSIAGSZBM-UHFFFAOYSA-N 6-methylsalicylic acid Chemical compound CC1=CC=CC(O)=C1C(O)=O HCJMNOSIAGSZBM-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 229940090898 Desensitizer Drugs 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 1
- GYHNNYVSQQEPJS-UHFFFAOYSA-N Gallium Chemical compound [Ga] GYHNNYVSQQEPJS-UHFFFAOYSA-N 0.000 description 1
- 239000001828 Gelatine Substances 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 244000043261 Hevea brasiliensis Species 0.000 description 1
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 1
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 1
- 229920000877 Melamine resin Polymers 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- CNCOEDDPFOAUMB-UHFFFAOYSA-N N-Methylolacrylamide Chemical compound OCNC(=O)C=C CNCOEDDPFOAUMB-UHFFFAOYSA-N 0.000 description 1
- HZFDKBPTVOENNB-GAFUQQFSSA-N N-[(2S)-1-[2-[(2R)-2-chloro-2-fluoroacetyl]-2-[[(3S)-2-oxopyrrolidin-3-yl]methyl]hydrazinyl]-3-(1-methylcyclopropyl)-1-oxopropan-2-yl]-5-(difluoromethyl)-1,2-oxazole-3-carboxamide Chemical compound CC1(C[C@@H](C(NN(C[C@H](CCN2)C2=O)C([C@H](F)Cl)=O)=O)NC(C2=NOC(C(F)F)=C2)=O)CC1 HZFDKBPTVOENNB-GAFUQQFSSA-N 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- 229920002845 Poly(methacrylic acid) Polymers 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 1
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 description 1
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 1
- 229920001807 Urea-formaldehyde Polymers 0.000 description 1
- FMRLDPWIRHBCCC-UHFFFAOYSA-L Zinc carbonate Chemical compound [Zn+2].[O-]C([O-])=O FMRLDPWIRHBCCC-UHFFFAOYSA-L 0.000 description 1
- 239000005083 Zinc sulfide Substances 0.000 description 1
- ZKURGBYDCVNWKH-UHFFFAOYSA-N [3,7-bis(dimethylamino)phenothiazin-10-yl]-phenylmethanone Chemical compound C12=CC=C(N(C)C)C=C2SC2=CC(N(C)C)=CC=C2N1C(=O)C1=CC=CC=C1 ZKURGBYDCVNWKH-UHFFFAOYSA-N 0.000 description 1
- USNWAMPROKAEIT-UHFFFAOYSA-N [Na].C(C=C)(=O)O Chemical compound [Na].C(C=C)(=O)O USNWAMPROKAEIT-UHFFFAOYSA-N 0.000 description 1
- FAWNVSNJFDIJRM-UHFFFAOYSA-N [Rb].[Cs] Chemical compound [Rb].[Cs] FAWNVSNJFDIJRM-UHFFFAOYSA-N 0.000 description 1
- BWFNRRFOFNPIQJ-UHFFFAOYSA-N [Zn].C(C)(C)(CC(C)(C)C)C1=C(C(C(=O)O)=CC(=C1)C)O Chemical compound [Zn].C(C)(C)(CC(C)(C)C)C1=C(C(C(=O)O)=CC(=C1)C)O BWFNRRFOFNPIQJ-UHFFFAOYSA-N 0.000 description 1
- 238000000862 absorption spectrum Methods 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 229940117913 acrylamide Drugs 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 229920000180 alkyd Polymers 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 150000004996 alkyl benzenes Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- OJMOMXZKOWKUTA-UHFFFAOYSA-N aluminum;borate Chemical compound [Al+3].[O-]B([O-])[O-] OJMOMXZKOWKUTA-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 229910000410 antimony oxide Inorganic materials 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- AYJRCSIUFZENHW-DEQYMQKBSA-L barium(2+);oxomethanediolate Chemical compound [Ba+2].[O-][14C]([O-])=O AYJRCSIUFZENHW-DEQYMQKBSA-L 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- YXVFYQXJAXKLAK-UHFFFAOYSA-N biphenyl-4-ol Chemical compound C1=CC(O)=CC=C1C1=CC=CC=C1 YXVFYQXJAXKLAK-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 150000001642 boronic acid derivatives Chemical class 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 description 1
- 239000000292 calcium oxide Substances 0.000 description 1
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 1
- 239000000378 calcium silicate Substances 0.000 description 1
- 229910052918 calcium silicate Inorganic materials 0.000 description 1
- OYACROKNLOSFPA-UHFFFAOYSA-N calcium;dioxido(oxo)silane Chemical compound [Ca+2].[O-][Si]([O-])=O OYACROKNLOSFPA-UHFFFAOYSA-N 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 229920003064 carboxyethyl cellulose Polymers 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 239000002738 chelating agent Substances 0.000 description 1
- 229940089960 chloroacetate Drugs 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 235000019646 color tone Nutrition 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000010494 dissociation reaction Methods 0.000 description 1
- 230000005593 dissociations Effects 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000000909 electrodialysis Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- HDERJYVLTPVNRI-UHFFFAOYSA-N ethene;ethenyl acetate Chemical group C=C.CC(=O)OC=C HDERJYVLTPVNRI-UHFFFAOYSA-N 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- 229920001038 ethylene copolymer Polymers 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229910052733 gallium Inorganic materials 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 229910052732 germanium Inorganic materials 0.000 description 1
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 125000001475 halogen functional group Chemical group 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 229910000040 hydrogen fluoride Inorganic materials 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 125000006289 hydroxybenzyl group Chemical group 0.000 description 1
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 1
- 229940071826 hydroxyethyl cellulose Drugs 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 1
- 229910052622 kaolinite Inorganic materials 0.000 description 1
- CYPPCCJJKNISFK-UHFFFAOYSA-J kaolinite Chemical compound [OH-].[OH-].[OH-].[OH-].[Al+3].[Al+3].[O-][Si](=O)O[Si]([O-])=O CYPPCCJJKNISFK-UHFFFAOYSA-J 0.000 description 1
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 description 1
- 239000000347 magnesium hydroxide Substances 0.000 description 1
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical group [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- VYQNWZOUAUKGHI-UHFFFAOYSA-N monobenzone Chemical compound C1=CC(O)=CC=C1OCC1=CC=CC=C1 VYQNWZOUAUKGHI-UHFFFAOYSA-N 0.000 description 1
- UNFUYWDGSFDHCW-UHFFFAOYSA-N monochlorocyclohexane Chemical compound ClC1CCCCC1 UNFUYWDGSFDHCW-UHFFFAOYSA-N 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- NYUSKIVSFXNJTN-UHFFFAOYSA-N n-(hydroxymethyl)prop-2-enamide;prop-2-enamide Chemical compound NC(=O)C=C.OCNC(=O)C=C NYUSKIVSFXNJTN-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229920003052 natural elastomer Polymers 0.000 description 1
- 229920001194 natural rubber Polymers 0.000 description 1
- 229910052758 niobium Inorganic materials 0.000 description 1
- 239000010955 niobium Substances 0.000 description 1
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 239000004306 orthophenyl phenol Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- VTRUBDSFZJNXHI-UHFFFAOYSA-N oxoantimony Chemical compound [Sb]=O VTRUBDSFZJNXHI-UHFFFAOYSA-N 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- NWVVVBRKAWDGAB-UHFFFAOYSA-N p-methoxyphenol Chemical compound COC1=CC=C(O)C=C1 NWVVVBRKAWDGAB-UHFFFAOYSA-N 0.000 description 1
- 239000005011 phenolic resin Substances 0.000 description 1
- KHUXNRRPPZOJPT-UHFFFAOYSA-N phenoxy radical Chemical group O=C1C=C[CH]C=C1 KHUXNRRPPZOJPT-UHFFFAOYSA-N 0.000 description 1
- 150000003014 phosphoric acid esters Chemical class 0.000 description 1
- 229920001495 poly(sodium acrylate) polymer Polymers 0.000 description 1
- 229920002037 poly(vinyl butyral) polymer Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 150000008442 polyphenolic compounds Polymers 0.000 description 1
- 235000013824 polyphenols Nutrition 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 235000019422 polyvinyl alcohol Nutrition 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- ARQTVSWBVIWYSF-UHFFFAOYSA-N prop-2-enamide;prop-2-enenitrile Chemical compound C=CC#N.NC(=O)C=C ARQTVSWBVIWYSF-UHFFFAOYSA-N 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 229910052701 rubidium Inorganic materials 0.000 description 1
- IGLNJRXAVVLDKE-UHFFFAOYSA-N rubidium atom Chemical compound [Rb] IGLNJRXAVVLDKE-UHFFFAOYSA-N 0.000 description 1
- 150000003870 salicylic acids Chemical class 0.000 description 1
- 229910052706 scandium Inorganic materials 0.000 description 1
- SIXSYDAISGFNSX-UHFFFAOYSA-N scandium atom Chemical compound [Sc] SIXSYDAISGFNSX-UHFFFAOYSA-N 0.000 description 1
- 238000012216 screening Methods 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 229910001948 sodium oxide Inorganic materials 0.000 description 1
- NNMHYFLPFNGQFZ-UHFFFAOYSA-M sodium polyacrylate Chemical compound [Na+].[O-]C(=O)C=C NNMHYFLPFNGQFZ-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 150000004763 sulfides Chemical class 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 230000001502 supplementing effect Effects 0.000 description 1
- 239000002352 surface water Substances 0.000 description 1
- 229920003051 synthetic elastomer Polymers 0.000 description 1
- 239000005061 synthetic rubber Substances 0.000 description 1
- 229920006174 synthetic rubber latex Polymers 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- BIKXLKXABVUSMH-UHFFFAOYSA-N trizinc;diborate Chemical compound [Zn+2].[Zn+2].[Zn+2].[O-]B([O-])[O-].[O-]B([O-])[O-] BIKXLKXABVUSMH-UHFFFAOYSA-N 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 229910052727 yttrium Inorganic materials 0.000 description 1
- VWQVUPCCIRVNHF-UHFFFAOYSA-N yttrium atom Chemical compound [Y] VWQVUPCCIRVNHF-UHFFFAOYSA-N 0.000 description 1
- 239000011667 zinc carbonate Substances 0.000 description 1
- 235000004416 zinc carbonate Nutrition 0.000 description 1
- 229910000010 zinc carbonate Inorganic materials 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
- 229910052984 zinc sulfide Inorganic materials 0.000 description 1
- DRDVZXDWVBGGMH-UHFFFAOYSA-N zinc;sulfide Chemical compound [S-2].[Zn+2] DRDVZXDWVBGGMH-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B41—PRINTING; LINING MACHINES; TYPEWRITERS; STAMPS
- B41M—PRINTING, DUPLICATING, MARKING, OR COPYING PROCESSES; COLOUR PRINTING
- B41M5/00—Duplicating or marking methods; Sheet materials for use therein
- B41M5/124—Duplicating or marking methods; Sheet materials for use therein using pressure to make a masked colour visible, e.g. to make a coloured support visible, to create an opaque or transparent pattern, or to form colour by uniting colour-forming components
- B41M5/132—Chemical colour-forming components; Additives or binders therefor
- B41M5/155—Colour-developing components, e.g. acidic compounds; Additives or binders therefor; Layers containing such colour-developing components, additives or binders
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C37/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring
- C07C37/11—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by reactions increasing the number of carbon atoms
- C07C37/14—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by reactions increasing the number of carbon atoms by addition reactions, i.e. reactions involving at least one carbon-to-carbon unsaturated bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C65/00—Compounds having carboxyl groups bound to carbon atoms of six—membered aromatic rings and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C65/01—Compounds having carboxyl groups bound to carbon atoms of six—membered aromatic rings and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups containing hydroxy or O-metal groups
- C07C65/105—Compounds having carboxyl groups bound to carbon atoms of six—membered aromatic rings and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups containing hydroxy or O-metal groups polycyclic
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C65/00—Compounds having carboxyl groups bound to carbon atoms of six—membered aromatic rings and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C65/01—Compounds having carboxyl groups bound to carbon atoms of six—membered aromatic rings and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups containing hydroxy or O-metal groups
- C07C65/105—Compounds having carboxyl groups bound to carbon atoms of six—membered aromatic rings and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups containing hydroxy or O-metal groups polycyclic
- C07C65/11—Compounds having carboxyl groups bound to carbon atoms of six—membered aromatic rings and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups containing hydroxy or O-metal groups polycyclic with carboxyl groups on a condensed ring system containing two rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C65/00—Compounds having carboxyl groups bound to carbon atoms of six—membered aromatic rings and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C65/01—Compounds having carboxyl groups bound to carbon atoms of six—membered aromatic rings and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups containing hydroxy or O-metal groups
- C07C65/17—Compounds having carboxyl groups bound to carbon atoms of six—membered aromatic rings and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups containing hydroxy or O-metal groups containing rings other than six-membered aromatic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Color Printing (AREA)
- Heat Sensitive Colour Forming Recording (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP65129/1971 | 1971-08-27 | ||
| JP46065129A JPS4832011A (OSRAM) | 1971-08-27 | 1971-08-27 | |
| JP46073791A JPS4840509A (OSRAM) | 1971-09-23 | 1971-09-23 | |
| JP73791/1971 | 1971-09-23 | ||
| JP30665/1972 | 1972-03-29 | ||
| JP47030665A JPS5125174B2 (OSRAM) | 1971-08-27 | 1972-03-29 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1104820A true CA1104820A (en) | 1981-07-14 |
Family
ID=27287052
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA145,410A Expired CA1104820A (en) | 1971-08-27 | 1972-06-22 | Pressure sensitive recording papers |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3983292A (OSRAM) |
| JP (1) | JPS5125174B2 (OSRAM) |
| AU (1) | AU469804B2 (OSRAM) |
| BE (1) | BE795268A (OSRAM) |
| CA (1) | CA1104820A (OSRAM) |
| CH (1) | CH562697A5 (OSRAM) |
| DE (1) | DE2242250C3 (OSRAM) |
| FR (1) | FR2151830A5 (OSRAM) |
| GB (1) | GB1392946A (OSRAM) |
| IT (1) | IT964289B (OSRAM) |
| NL (1) | NL173932C (OSRAM) |
Families Citing this family (35)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS527372B2 (OSRAM) * | 1972-07-14 | 1977-03-02 | ||
| JPS51127815A (en) * | 1975-04-28 | 1976-11-08 | Ncr Co | Recording materials sensitive to pressure |
| US4022936A (en) * | 1975-04-28 | 1977-05-10 | Ncr Corporation | Record material |
| DE2534559A1 (de) * | 1975-08-02 | 1977-02-10 | Bayer Ag | Verfahren zur herstellung kernalkylierter mehrkernphenole und ihre verwendung |
| GB1536601A (en) * | 1976-02-25 | 1978-12-20 | Ciba Geigy Ag | Image producing system |
| GB1602677A (en) * | 1978-05-25 | 1981-11-11 | Hartley Simon Ltd | Sludge thickening |
| EP0036117B1 (de) * | 1980-03-14 | 1986-02-05 | Spezial-Papiermaschinenfabrik August Alfred Krupp GmbH & Co | Druckempfindliches Aufzeichnungsmaterial |
| US4303719A (en) * | 1980-07-29 | 1981-12-01 | Vassiliades Anthony E | Chromogenic copy system |
| US4372583A (en) * | 1980-07-29 | 1983-02-08 | Vassiliades Anthony E | Chromogenic copy system and method |
| US4509065A (en) * | 1981-12-04 | 1985-04-02 | The Wiggins Teape Group Limited | Record material |
| ZA828474B (en) * | 1981-12-04 | 1983-08-31 | Wiggins Teape Group Ltd | Record material |
| JPS59155092A (ja) * | 1983-02-23 | 1984-09-04 | Fuji Photo Film Co Ltd | 顕色剤シ−トの製造方法 |
| JPS60107384A (ja) * | 1983-11-16 | 1985-06-12 | Fuji Photo Film Co Ltd | 感圧記録シ−ト |
| US4687869A (en) * | 1984-10-22 | 1987-08-18 | Ciba-Geigy Corporation | Metal salicylates, process for their preparation and use thereof as color developers in pressure-sensitive or heat-sensitive recording materials |
| US4745203A (en) * | 1985-10-03 | 1988-05-17 | Ciba-Geigy Corporation | Process for the preparation of mixtures of metal salts of ring-substituted salicylic acid compounds |
| US4748259A (en) * | 1985-10-03 | 1988-05-31 | Ciba-Geigy Corporation | Process for the preparation of mixtures of metal salts of ring-substituted salicylic acid compounds |
| JPH0623132B2 (ja) * | 1985-10-07 | 1994-03-30 | 富士写真フイルム株式会社 | アルコキシサリチル酸誘導体の製造方法 |
| JPH0675992B2 (ja) * | 1985-10-23 | 1994-09-28 | 富士写真フイルム株式会社 | 記録材料 |
| EP0253666A3 (en) * | 1986-07-16 | 1988-04-27 | Fuji Photo Film Co., Ltd. | Heat-sensitive recording material containing dye-forming components |
| DE3879721T2 (de) * | 1987-01-14 | 1993-10-28 | Kanzaki Paper Mfg Co Ltd | Wässerige Entwicklerdispersion für ein druckempfindliches Aufzeichnungsblatt und Verfahren zu deren Herstellung. |
| CA1339023C (en) * | 1987-12-01 | 1997-03-25 | Toranosuke Saito | Developer for pressure-sensitive recording sheets, aqueous dispersion of the developer and method for preparing the developer |
| JP2558486B2 (ja) * | 1988-01-27 | 1996-11-27 | 富士写真フイルム株式会社 | 記録材料 |
| US4853364A (en) * | 1988-02-05 | 1989-08-01 | The Mead Corporation | Developer composition comprising phenol resins and vinylic or acrylic resins |
| US5049685A (en) * | 1988-11-22 | 1991-09-17 | Sanko Kaihatsu Kagaku Kenkyusho | Nuclear substituted salicylic acids and their salts |
| JPH02268136A (ja) * | 1989-04-07 | 1990-11-01 | Sanko Chem Co Ltd | 核置換サリチル酸塩のクラスレイト化合物 |
| JPH03138189A (ja) * | 1989-10-24 | 1991-06-12 | Fuji Photo Film Co Ltd | 受像材料 |
| AU1965192A (en) * | 1991-07-18 | 1993-01-21 | Mitsui Toatsu Chemicals Inc. | Color-developing compositions and their use |
| JP3107173B2 (ja) * | 1991-12-27 | 2000-11-06 | 株式会社三光開発科学研究所 | 核置換サリチル酸金属塩の製造方法 |
| DE59309872D1 (de) * | 1992-03-13 | 1999-12-23 | Ciba Sc Holding Ag | Chromogene Lactamverbindungen, ihre Herstellung und Verwendung |
| DE59306627D1 (de) * | 1992-03-17 | 1997-07-10 | Ciba Geigy Ag | Fluoran Farbbildner |
| US5525686A (en) * | 1993-12-21 | 1996-06-11 | Mitsui Toatsu Chemicals, Inc. | Polyvalent metal salt of salicyclic acid resin and process for preparing it |
| EP0714785B1 (en) * | 1994-11-08 | 1999-01-07 | Mitsui Chemicals, Inc. | Sulfonated phenol (salt) containing color-developing agents and color-developing sheets |
| GB9426290D0 (en) * | 1994-12-28 | 1995-02-22 | Zeneca Ltd | Composition,compound and use |
| JP5247505B2 (ja) * | 2009-02-04 | 2013-07-24 | 富士フイルム株式会社 | 熱分布表示体及び熱分布確認方法 |
| WO2013024664A1 (ja) * | 2011-08-17 | 2013-02-21 | 富士フイルム株式会社 | 熱分布表示体 |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2972547A (en) * | 1957-08-05 | 1961-02-21 | Antioch College | Acyl hydrazine compositions and methods of producing color therewith |
| US3346571A (en) * | 1963-06-05 | 1967-10-10 | Allied Chem | 2-(omega-substituted vinylene)-3, 3-disubstituted-3h-indoles |
| US3488207A (en) * | 1965-10-22 | 1970-01-06 | Us Plywood Champ Papers Inc | Process of preparing a colored substance and transfer copy set |
| US3464823A (en) * | 1965-12-28 | 1969-09-02 | Ibm | Diazotype materials |
| ES369481A1 (es) * | 1968-07-15 | 1971-06-01 | Fuji Photo Film Co Ltd | Mejoras en el procedimiento de fabricacion de un papel paracopias sensible a las presiones. |
| US3732120A (en) * | 1971-06-14 | 1973-05-08 | Ncr Co | Pressure-sensitive recording sheet |
| US3723156A (en) * | 1971-06-14 | 1973-03-27 | Ncr | Record material |
| JPS5418165B2 (OSRAM) * | 1971-10-29 | 1979-07-05 | ||
| JPS5126152B2 (OSRAM) * | 1972-05-31 | 1976-08-04 |
-
0
- BE BE795268D patent/BE795268A/xx not_active IP Right Cessation
-
1972
- 1972-03-29 JP JP47030665A patent/JPS5125174B2/ja not_active Expired
- 1972-06-22 CA CA145,410A patent/CA1104820A/en not_active Expired
- 1972-06-28 FR FR7223404A patent/FR2151830A5/fr not_active Expired
- 1972-08-25 GB GB3972272A patent/GB1392946A/en not_active Expired
- 1972-08-26 IT IT28533/72A patent/IT964289B/it active
- 1972-08-28 DE DE2242250A patent/DE2242250C3/de not_active Expired
-
1973
- 1973-01-31 NL NLAANVRAGE7301343,A patent/NL173932C/xx not_active IP Right Cessation
- 1973-02-08 CH CH178673A patent/CH562697A5/xx not_active IP Right Cessation
- 1973-02-08 AU AU52010/73A patent/AU469804B2/en not_active Expired
-
1974
- 1974-08-01 US US05/493,834 patent/US3983292A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| AU469804B2 (en) | 1976-02-26 |
| DE2242250C3 (de) | 1980-01-17 |
| DE2242250A1 (de) | 1973-03-08 |
| BE795268A (fr) | 1973-05-29 |
| NL7301343A (OSRAM) | 1973-10-02 |
| GB1392946A (en) | 1975-05-07 |
| IT964289B (it) | 1974-01-21 |
| JPS5125174B2 (OSRAM) | 1976-07-29 |
| DE2242250B2 (de) | 1974-01-10 |
| AU5201073A (en) | 1974-08-08 |
| US3983292A (en) | 1976-09-28 |
| JPS4898914A (OSRAM) | 1973-12-15 |
| NL173932B (nl) | 1983-11-01 |
| FR2151830A5 (OSRAM) | 1973-04-20 |
| NL173932C (nl) | 1984-04-02 |
| CH562697A5 (OSRAM) | 1975-06-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1104820A (en) | Pressure sensitive recording papers | |
| US4154463A (en) | Pressure-sensitive or heat-sensitive recording material containing a carbazolyl methane compound | |
| FI87763B (fi) | Som faergframkallare anvaenbara metallsalicylater och deras anvaendning | |
| US4533930A (en) | Recording materials | |
| EP0112710B1 (en) | Fluoran derivatives | |
| US4400492A (en) | Color-developer for pressure-sensitive recording sheets | |
| US4536779A (en) | Heat-sensitive recording material | |
| CA1083576A (en) | Chromenoindole compounds | |
| US5017546A (en) | Alkyl salicylate developer resin for carbonless copy paper and imaging use | |
| US4379897A (en) | Color-developer for pressure-sensitive sheets | |
| JP3105354B2 (ja) | 顕色剤組成物、水性懸濁液及びそれを用いた感圧複写紙用顕色シート | |
| US3857721A (en) | Sheet containing developer for pressure-sensitive recording | |
| CH626568A5 (OSRAM) | ||
| JPS6014718B2 (ja) | 感圧複写紙用顕色剤組成物 | |
| AU612812B2 (en) | Alkyl salicylate resin for carbonless copy paper and imaging use | |
| US5024987A (en) | Recording material | |
| JPS6014716B2 (ja) | 感圧複写シ−ト用顕色剤組成物 | |
| US5208209A (en) | Fluoran compounds, process for preparation thereof and recording materials comprising said compound | |
| US5087706A (en) | Fluoran compounds, process for preparation thereof and recording materials comprising said compound | |
| JPH02653A (ja) | 水性懸濁液 | |
| JP2726686B2 (ja) | 感圧複写紙用顕色シート | |
| JP3225095B2 (ja) | 顕色剤組成物及びその用途 | |
| JPS62176875A (ja) | 感圧複写紙用顕色シ−ト | |
| JP2598798B2 (ja) | 水性懸濁液 | |
| JPH0258574A (ja) | フレオラン化合物および記録材料 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |