BG61325B2 - Антивирусни гуанинови производни - Google Patents
Антивирусни гуанинови производни Download PDFInfo
- Publication number
- BG61325B2 BG61325B2 BG098210A BG9821093A BG61325B2 BG 61325 B2 BG61325 B2 BG 61325B2 BG 098210 A BG098210 A BG 098210A BG 9821093 A BG9821093 A BG 9821093A BG 61325 B2 BG61325 B2 BG 61325B2
- Authority
- BG
- Bulgaria
- Prior art keywords
- formula
- compound
- hydroxy
- group
- hydroxymethyl
- Prior art date
Links
- UYTPUPDQBNUYGX-UHFFFAOYSA-N guanine Chemical class O=C1NC(N)=NC2=C1N=CN2 UYTPUPDQBNUYGX-UHFFFAOYSA-N 0.000 title claims abstract description 57
- 230000000840 anti-viral effect Effects 0.000 title abstract description 7
- 150000001875 compounds Chemical class 0.000 claims abstract description 146
- 238000000034 method Methods 0.000 claims abstract description 28
- 238000002360 preparation method Methods 0.000 claims abstract description 11
- 230000009385 viral infection Effects 0.000 claims abstract description 7
- 208000036142 Viral infection Diseases 0.000 claims abstract description 6
- 241000700588 Human alphaherpesvirus 1 Species 0.000 claims abstract description 5
- 241000701074 Human alphaherpesvirus 2 Species 0.000 claims abstract description 4
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract description 4
- -1 phosphate ester Chemical class 0.000 claims description 44
- 125000002252 acyl group Chemical group 0.000 claims description 29
- 150000003839 salts Chemical class 0.000 claims description 29
- JNTOCHDNEULJHD-UHFFFAOYSA-N Penciclovir Chemical compound N1C(N)=NC(=O)C2=C1N(CCC(CO)CO)C=N2 JNTOCHDNEULJHD-UHFFFAOYSA-N 0.000 claims description 22
- 229910052739 hydrogen Inorganic materials 0.000 claims description 20
- 239000000460 chlorine Substances 0.000 claims description 18
- 229910019142 PO4 Inorganic materials 0.000 claims description 16
- 229910052801 chlorine Inorganic materials 0.000 claims description 16
- 239000001257 hydrogen Substances 0.000 claims description 16
- 239000010452 phosphate Substances 0.000 claims description 16
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 12
- 239000002253 acid Substances 0.000 claims description 12
- 238000006243 chemical reaction Methods 0.000 claims description 12
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 12
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 10
- 238000005917 acylation reaction Methods 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- OCUBTJWUNITBOW-UHFFFAOYSA-N 2-(2,2-dimethyl-1,3-dioxan-5-yl)ethanol Chemical compound CC1(C)OCC(CCO)CO1 OCUBTJWUNITBOW-UHFFFAOYSA-N 0.000 claims description 8
- 230000010933 acylation Effects 0.000 claims description 8
- MHDVGSVTJDSBDK-UHFFFAOYSA-N dibenzyl ether Chemical class C=1C=CC=CC=1COCC1=CC=CC=C1 MHDVGSVTJDSBDK-UHFFFAOYSA-N 0.000 claims description 7
- 230000008569 process Effects 0.000 claims description 7
- 229910052708 sodium Inorganic materials 0.000 claims description 7
- 239000011734 sodium Substances 0.000 claims description 7
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 239000003814 drug Substances 0.000 claims description 5
- OAGQDDDSIYTNMT-UHFFFAOYSA-N 2-[2-(2,6-diaminopurin-9-yl)ethyl]propane-1,3-diol Chemical compound NC1=NC(N)=C2N=CN(CCC(CO)CO)C2=N1 OAGQDDDSIYTNMT-UHFFFAOYSA-N 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- 229910021529 ammonia Inorganic materials 0.000 claims description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- 229910052794 bromium Inorganic materials 0.000 claims description 4
- 238000010511 deprotection reaction Methods 0.000 claims description 4
- 239000003937 drug carrier Substances 0.000 claims description 4
- 230000007062 hydrolysis Effects 0.000 claims description 4
- 238000006460 hydrolysis reaction Methods 0.000 claims description 4
- 125000002883 imidazolyl group Chemical group 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 claims description 4
- VDFVNEFVBPFDSB-UHFFFAOYSA-N 1,3-dioxane Chemical group C1COCOC1 VDFVNEFVBPFDSB-UHFFFAOYSA-N 0.000 claims description 3
- NJDPBWLDVFCXNP-UHFFFAOYSA-N 2-cyanoethyl dihydrogen phosphate Chemical compound OP(O)(=O)OCCC#N NJDPBWLDVFCXNP-UHFFFAOYSA-N 0.000 claims description 3
- AAVYTSAUFAJNDC-UHFFFAOYSA-N [2-(acetyloxymethyl)-4-bromobutyl] acetate Chemical compound CC(=O)OCC(CCBr)COC(C)=O AAVYTSAUFAJNDC-UHFFFAOYSA-N 0.000 claims description 3
- ZUABVXPGZXKVNA-UHFFFAOYSA-N [2-(acetyloxymethyl)-4-hydroxybutyl] acetate Chemical compound CC(=O)OCC(CCO)COC(C)=O ZUABVXPGZXKVNA-UHFFFAOYSA-N 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- 150000002431 hydrogen Chemical group 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 125000006239 protecting group Chemical group 0.000 claims description 3
- 239000000126 substance Substances 0.000 claims description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 2
- 238000010306 acid treatment Methods 0.000 claims description 2
- 239000011630 iodine Substances 0.000 claims description 2
- 229910052740 iodine Inorganic materials 0.000 claims description 2
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 2
- 230000001225 therapeutic effect Effects 0.000 claims description 2
- 125000004122 cyclic group Chemical group 0.000 claims 6
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims 4
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims 4
- 238000004519 manufacturing process Methods 0.000 claims 4
- XPPKVPWEQAFLFU-UHFFFAOYSA-J diphosphate(4-) Chemical compound [O-]P([O-])(=O)OP([O-])([O-])=O XPPKVPWEQAFLFU-UHFFFAOYSA-J 0.000 claims 3
- 235000011180 diphosphates Nutrition 0.000 claims 3
- FSJCDRZLIWVLEH-UHFFFAOYSA-N 2-[2-(2-amino-6-chloropurin-9-yl)ethyl]propane-1,3-diol Chemical compound NC1=NC(Cl)=C2N=CN(CCC(CO)CO)C2=N1 FSJCDRZLIWVLEH-UHFFFAOYSA-N 0.000 claims 2
- 208000005181 Varicella Zoster Virus Infection Diseases 0.000 claims 1
- QWPPOHNGKGFGJK-UHFFFAOYSA-N hypochlorous acid Chemical compound ClO QWPPOHNGKGFGJK-UHFFFAOYSA-N 0.000 claims 1
- YUIPXIWZMYWDKB-UHFFFAOYSA-M sodium 2-[2-(2-amino-6-chloropurin-9-yl)ethyl]propane-1,3-diol dihydrogen phosphate Chemical compound [Na+].OP(O)([O-])=O.NC1=NC(Cl)=C2N=CN(CCC(CO)CO)C2=N1 YUIPXIWZMYWDKB-UHFFFAOYSA-M 0.000 claims 1
- KYUPHSFPRFAUNG-UHFFFAOYSA-M sodium 2-amino-1,7-dihydropurin-6-one dihydrogen phosphate Chemical compound P(=O)([O-])(O)O.[Na+].N1C(N)=NC=2N=CNC2C1=O KYUPHSFPRFAUNG-UHFFFAOYSA-M 0.000 claims 1
- AJPJDKMHJJGVTQ-UHFFFAOYSA-M sodium dihydrogen phosphate Chemical compound [Na+].OP(O)([O-])=O AJPJDKMHJJGVTQ-UHFFFAOYSA-M 0.000 claims 1
- 208000010531 varicella zoster infection Diseases 0.000 claims 1
- 201000006082 Chickenpox Diseases 0.000 abstract 1
- 208000007514 Herpes zoster Diseases 0.000 abstract 1
- 206010046980 Varicella Diseases 0.000 abstract 1
- 239000000243 solution Substances 0.000 description 88
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 75
- 239000000203 mixture Substances 0.000 description 60
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 45
- 239000002904 solvent Substances 0.000 description 45
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 38
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 36
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 32
- 101150065749 Churc1 gene Proteins 0.000 description 32
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 32
- 102100038239 Protein Churchill Human genes 0.000 description 32
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 26
- 235000002639 sodium chloride Nutrition 0.000 description 24
- 238000010898 silica gel chromatography Methods 0.000 description 22
- WORJEOGGNQDSOE-UHFFFAOYSA-N chloroform;methanol Chemical compound OC.ClC(Cl)Cl WORJEOGGNQDSOE-UHFFFAOYSA-N 0.000 description 21
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 18
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 16
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 16
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- KDCGOANMDULRCW-UHFFFAOYSA-N 7H-purine Chemical compound N1=CNC2=NC=NC2=C1 KDCGOANMDULRCW-UHFFFAOYSA-N 0.000 description 14
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 14
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 14
- 239000000543 intermediate Substances 0.000 description 14
- 235000019441 ethanol Nutrition 0.000 description 13
- 239000000725 suspension Substances 0.000 description 12
- 239000000047 product Substances 0.000 description 11
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 10
- HJUGFYREWKUQJT-UHFFFAOYSA-N tetrabromomethane Chemical compound BrC(Br)(Br)Br HJUGFYREWKUQJT-UHFFFAOYSA-N 0.000 description 10
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 10
- LCBKOELNAHEPRY-UHFFFAOYSA-N 6-chloro-9-[2-(2,2-dimethyl-1,3-dioxan-5-yl)ethyl]purin-2-amine Chemical compound C1OC(C)(C)OCC1CCN1C2=NC(N)=NC(Cl)=C2N=C1 LCBKOELNAHEPRY-UHFFFAOYSA-N 0.000 description 9
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- 229960000583 acetic acid Drugs 0.000 description 9
- 229910052799 carbon Inorganic materials 0.000 description 9
- 239000003921 oil Substances 0.000 description 9
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- 230000008859 change Effects 0.000 description 8
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 8
- 239000002244 precipitate Substances 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 8
- 235000017557 sodium bicarbonate Nutrition 0.000 description 8
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 8
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 7
- 235000019341 magnesium sulphate Nutrition 0.000 description 7
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 7
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 210000004027 cell Anatomy 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- 238000004440 column chromatography Methods 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 4
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 4
- 239000003153 chemical reaction reagent Substances 0.000 description 4
- 239000012230 colorless oil Substances 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- KJIFKLIQANRMOU-UHFFFAOYSA-N oxidanium;4-methylbenzenesulfonate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1 KJIFKLIQANRMOU-UHFFFAOYSA-N 0.000 description 4
- 150000003014 phosphoric acid esters Chemical class 0.000 description 4
- 229910000027 potassium carbonate Inorganic materials 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- 210000003501 vero cell Anatomy 0.000 description 4
- HEWZVZIVELJPQZ-UHFFFAOYSA-N 2,2-dimethoxypropane Chemical compound COC(C)(C)OC HEWZVZIVELJPQZ-UHFFFAOYSA-N 0.000 description 3
- FPTZGUNAYOEVGA-UHFFFAOYSA-N 2-(2-phenylmethoxyethyl)propane-1,3-diol Chemical compound OCC(CO)CCOCC1=CC=CC=C1 FPTZGUNAYOEVGA-UHFFFAOYSA-N 0.000 description 3
- SYNPRNNJJLRHTI-UHFFFAOYSA-N 2-(hydroxymethyl)butane-1,4-diol Chemical compound OCCC(CO)CO SYNPRNNJJLRHTI-UHFFFAOYSA-N 0.000 description 3
- QFLUXIUZRCNNHY-UHFFFAOYSA-N 5-(2-bromoethyl)-2,2-dimethyl-1,3-dioxane Chemical compound CC1(C)OCC(CCBr)CO1 QFLUXIUZRCNNHY-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 241000699670 Mus sp. Species 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- KXPSHSVVYGZKAV-UHFFFAOYSA-N [2-(acetyloxymethyl)-4-(2-amino-6-chloropurin-9-yl)butyl] acetate Chemical compound N1=C(N)N=C2N(CCC(COC(=O)C)COC(C)=O)C=NC2=C1Cl KXPSHSVVYGZKAV-UHFFFAOYSA-N 0.000 description 3
- BLAYUKYLAGRIMQ-UHFFFAOYSA-N [2-(acetyloxymethyl)-4-phenylmethoxybutyl] acetate Chemical compound CC(=O)OCC(COC(C)=O)CCOCC1=CC=CC=C1 BLAYUKYLAGRIMQ-UHFFFAOYSA-N 0.000 description 3
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 3
- 239000012346 acetyl chloride Substances 0.000 description 3
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000008280 blood Substances 0.000 description 3
- 210000004369 blood Anatomy 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 3
- UXTMROKLAAOEQO-UHFFFAOYSA-N chloroform;ethanol Chemical compound CCO.ClC(Cl)Cl UXTMROKLAAOEQO-UHFFFAOYSA-N 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 230000000120 cytopathologic effect Effects 0.000 description 3
- 230000003013 cytotoxicity Effects 0.000 description 3
- 231100000135 cytotoxicity Toxicity 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 239000012280 lithium aluminium hydride Substances 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- 239000006188 syrup Substances 0.000 description 3
- 235000020357 syrup Nutrition 0.000 description 3
- LVANIACBMALIHE-UHFFFAOYSA-N 2-[2-(2-amino-6-chloropurin-9-yl)ethyl]propane-1,3-diol;hydrochloride Chemical compound Cl.NC1=NC(Cl)=C2N=CN(CCC(CO)CO)C2=N1 LVANIACBMALIHE-UHFFFAOYSA-N 0.000 description 2
- NUMHIMHINXFURM-UHFFFAOYSA-N 2-[2-(2-amino-6-ethoxypurin-9-yl)ethyl]propane-1,3-diol Chemical compound CCOC1=NC(N)=NC2=C1N=CN2CCC(CO)CO NUMHIMHINXFURM-UHFFFAOYSA-N 0.000 description 2
- JSFLQOQEWLPOPH-UHFFFAOYSA-N 2-[2-(2-amino-6-methoxypurin-9-yl)ethyl]propane-1,3-diol Chemical compound COC1=NC(N)=NC2=C1N=CN2CCC(CO)CO JSFLQOQEWLPOPH-UHFFFAOYSA-N 0.000 description 2
- SKEPTERFAYJVPY-UHFFFAOYSA-N 2-[2-(2-amino-6-phenoxypurin-9-yl)ethyl]propane-1,3-diol Chemical compound C=12N=CN(CCC(CO)CO)C2=NC(N)=NC=1OC1=CC=CC=C1 SKEPTERFAYJVPY-UHFFFAOYSA-N 0.000 description 2
- TWDQVWJGUYXQLT-UHFFFAOYSA-N 2-[2-(2-amino-6-propan-2-yloxypurin-9-yl)ethyl]propane-1,3-diol Chemical compound CC(C)OC1=NC(N)=NC2=C1N=CN2CCC(CO)CO TWDQVWJGUYXQLT-UHFFFAOYSA-N 0.000 description 2
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- UDVRZHHUUZKECX-UHFFFAOYSA-N 6-azido-9-[2-(2,2-dimethyl-1,3-dioxan-5-yl)ethyl]purin-2-amine Chemical compound C1OC(C)(C)OCC1CCN1C2=NC(N)=NC(N=[N+]=[N-])=C2N=C1 UDVRZHHUUZKECX-UHFFFAOYSA-N 0.000 description 2
- WKBCDFRKYKSLHK-UHFFFAOYSA-N 9-[2-(2,2-dimethyl-1,3-dioxan-5-yl)ethyl]purine-2,6-diamine Chemical compound C1OC(C)(C)OCC1CCN1C2=NC(N)=NC(N)=C2N=C1 WKBCDFRKYKSLHK-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- 241000700605 Viruses Species 0.000 description 2
- WEHQKUAQWVHZQX-UHFFFAOYSA-N [2-(acetyloxymethyl)-4-(2-amino-6-chloropurin-7-yl)butyl] acetate Chemical compound NC1=NC(Cl)=C2N(CCC(COC(=O)C)COC(C)=O)C=NC2=N1 WEHQKUAQWVHZQX-UHFFFAOYSA-N 0.000 description 2
- RCBJCPSVFLTMLK-UHFFFAOYSA-N [4-(2-amino-6-oxo-3h-purin-9-yl)-2-(2,2-dimethylpropanoyloxymethyl)butyl] 2,2-dimethylpropanoate Chemical compound N1=C(N)NC(=O)C2=C1N(CCC(COC(=O)C(C)(C)C)COC(=O)C(C)(C)C)C=N2 RCBJCPSVFLTMLK-UHFFFAOYSA-N 0.000 description 2
- YNAMULWOQHJWTL-UHFFFAOYSA-N [4-(2-amino-6-oxo-3h-purin-9-yl)-2-(formyloxymethyl)butyl] formate Chemical compound N1C(N)=NC(=O)C2=C1N(CCC(COC=O)COC=O)C=N2 YNAMULWOQHJWTL-UHFFFAOYSA-N 0.000 description 2
- CVDWUUMREUVPOO-UHFFFAOYSA-N [4-(2-amino-6-oxo-3h-purin-9-yl)-2-(hexanoyloxymethyl)butyl] hexanoate Chemical compound N1C(N)=NC(=O)C2=C1N(CCC(COC(=O)CCCCC)COC(=O)CCCCC)C=N2 CVDWUUMREUVPOO-UHFFFAOYSA-N 0.000 description 2
- 150000008065 acid anhydrides Chemical class 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 125000002015 acyclic group Chemical group 0.000 description 2
- 239000000010 aprotic solvent Substances 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- DIKBFYAXUHHXCS-UHFFFAOYSA-N bromoform Chemical compound BrC(Br)Br DIKBFYAXUHHXCS-UHFFFAOYSA-N 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 229920001429 chelating resin Polymers 0.000 description 2
- FFBDKROYDQHPHC-UHFFFAOYSA-N diethyl 2-(2-phenylmethoxyethyl)propanedioate Chemical compound CCOC(=O)C(C(=O)OCC)CCOCC1=CC=CC=C1 FFBDKROYDQHPHC-UHFFFAOYSA-N 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- 238000010828 elution Methods 0.000 description 2
- ZYBWTEQKHIADDQ-UHFFFAOYSA-N ethanol;methanol Chemical compound OC.CCO ZYBWTEQKHIADDQ-UHFFFAOYSA-N 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 239000008098 formaldehyde solution Substances 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- MNWFXJYAOYHMED-UHFFFAOYSA-N hexane carboxylic acid Natural products CCCCCCC(O)=O MNWFXJYAOYHMED-UHFFFAOYSA-N 0.000 description 2
- YWGHUJQYGPDNKT-UHFFFAOYSA-N hexanoyl chloride Chemical compound CCCCCC(Cl)=O YWGHUJQYGPDNKT-UHFFFAOYSA-N 0.000 description 2
- 230000003301 hydrolyzing effect Effects 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000002674 ointment Substances 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 2
- 125000002071 phenylalkoxy group Chemical group 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- 239000003826 tablet Substances 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 238000001665 trituration Methods 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- VWCUMTCXBIRRSG-UHFFFAOYSA-N 1-[chloro(diphenyl)methyl]-2-methoxybenzene Chemical compound COC1=CC=CC=C1C(Cl)(C=1C=CC=CC=1)C1=CC=CC=C1 VWCUMTCXBIRRSG-UHFFFAOYSA-N 0.000 description 1
- LTMRRSWNXVJMBA-UHFFFAOYSA-L 2,2-diethylpropanedioate Chemical compound CCC(CC)(C([O-])=O)C([O-])=O LTMRRSWNXVJMBA-UHFFFAOYSA-L 0.000 description 1
- RPLSBADGISFNSI-UHFFFAOYSA-N 2,2-dimethyl-1,3-dioxane Chemical compound CC1(C)OCCCO1 RPLSBADGISFNSI-UHFFFAOYSA-N 0.000 description 1
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 1
- LCZUOKDVTBMCMX-UHFFFAOYSA-N 2,5-Dimethylpyrazine Chemical compound CC1=CN=C(C)C=N1 LCZUOKDVTBMCMX-UHFFFAOYSA-N 0.000 description 1
- ZZODBPXITDVPTL-UHFFFAOYSA-N 2-[2-(2-amino-6-phenylmethoxypurin-9-yl)ethyl]propane-1,3-diol Chemical compound C=12N=CN(CCC(CO)CO)C2=NC(N)=NC=1OCC1=CC=CC=C1 ZZODBPXITDVPTL-UHFFFAOYSA-N 0.000 description 1
- FWOHDAGPWDEWIB-UHFFFAOYSA-N 2-bromoethoxymethylbenzene Chemical compound BrCCOCC1=CC=CC=C1 FWOHDAGPWDEWIB-UHFFFAOYSA-N 0.000 description 1
- 125000005999 2-bromoethyl group Chemical group 0.000 description 1
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 description 1
- HZLHRDBTVSZCBS-UVJJDBRNSA-N 4-[(e)-(4-aminophenyl)-(4-imino-3-methylcyclohexa-2,5-dien-1-ylidene)methyl]-2-methylaniline;hydrochloride Chemical compound Cl.C1=CC(=N)C(C)=C\C1=C(C=1C=C(C)C(N)=CC=1)/C1=CC=C(N)C=C1 HZLHRDBTVSZCBS-UVJJDBRNSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- ZKBQDFAWXLTYKS-UHFFFAOYSA-N 6-Chloro-1H-purine Chemical compound ClC1=NC=NC2=C1NC=N2 ZKBQDFAWXLTYKS-UHFFFAOYSA-N 0.000 description 1
- RYYIULNRIVUMTQ-UHFFFAOYSA-N 6-chloroguanine Chemical compound NC1=NC(Cl)=C2N=CNC2=N1 RYYIULNRIVUMTQ-UHFFFAOYSA-N 0.000 description 1
- 229920000936 Agarose Polymers 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 102100038902 Caspase-7 Human genes 0.000 description 1
- 241000282693 Cercopithecidae Species 0.000 description 1
- KMTRUDSVKNLOMY-UHFFFAOYSA-N Ethylene carbonate Chemical compound O=C1OCCO1 KMTRUDSVKNLOMY-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 208000009889 Herpes Simplex Diseases 0.000 description 1
- 101000741014 Homo sapiens Caspase-7 Proteins 0.000 description 1
- 101000669528 Homo sapiens Tachykinin-4 Proteins 0.000 description 1
- 241000701085 Human alphaherpesvirus 3 Species 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 102100039365 Tachykinin-4 Human genes 0.000 description 1
- PSLUFJFHTBIXMW-WYEYVKMPSA-N [(3r,4ar,5s,6s,6as,10s,10ar,10bs)-3-ethenyl-10,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-6-(2-pyridin-2-ylethylcarbamoyloxy)-5,6,6a,8,9,10-hexahydro-2h-benzo[f]chromen-5-yl] acetate Chemical compound O([C@@H]1[C@@H]([C@]2(O[C@](C)(CC(=O)[C@]2(O)[C@@]2(C)[C@@H](O)CCC(C)(C)[C@@H]21)C=C)C)OC(=O)C)C(=O)NCCC1=CC=CC=N1 PSLUFJFHTBIXMW-WYEYVKMPSA-N 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- VZTDIZULWFCMLS-UHFFFAOYSA-N ammonium formate Chemical compound [NH4+].[O-]C=O VZTDIZULWFCMLS-UHFFFAOYSA-N 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- IVRMZWNICZWHMI-UHFFFAOYSA-N azide group Chemical group [N-]=[N+]=[N-] IVRMZWNICZWHMI-UHFFFAOYSA-N 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 229950005228 bromoform Drugs 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical group 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 238000012754 cardiac puncture Methods 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- VWOQSIOHOUWUAL-UHFFFAOYSA-N chloroform methane Chemical compound [H]C[H].ClC(Cl)Cl.ClC(Cl)Cl VWOQSIOHOUWUAL-UHFFFAOYSA-N 0.000 description 1
- MVGLBXWFOSHCCP-UHFFFAOYSA-N chloroform;tetrachloromethane Chemical compound ClC(Cl)Cl.ClC(Cl)(Cl)Cl MVGLBXWFOSHCCP-UHFFFAOYSA-N 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000004891 communication Methods 0.000 description 1
- 229940125773 compound 10 Drugs 0.000 description 1
- 239000002537 cosmetic Substances 0.000 description 1
- 239000007822 coupling agent Substances 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000006196 drop Substances 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002169 ethanolamines Chemical class 0.000 description 1
- ZKQFHRVKCYFVCN-UHFFFAOYSA-N ethoxyethane;hexane Chemical compound CCOCC.CCCCCC ZKQFHRVKCYFVCN-UHFFFAOYSA-N 0.000 description 1
- MDKXBBPLEGPIRI-UHFFFAOYSA-N ethoxyethane;methanol Chemical compound OC.CCOCC MDKXBBPLEGPIRI-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000003889 eye drop Substances 0.000 description 1
- 229940012356 eye drops Drugs 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 230000004927 fusion Effects 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 235000001727 glucose Nutrition 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- ARBOVOVUTSQWSS-UHFFFAOYSA-N hexadecanoyl chloride Chemical compound CCCCCCCCCCCCCCCC(Cl)=O ARBOVOVUTSQWSS-UHFFFAOYSA-N 0.000 description 1
- KDCIHNCMPUBDKT-UHFFFAOYSA-N hexane;propan-2-one Chemical compound CC(C)=O.CCCCCC KDCIHNCMPUBDKT-UHFFFAOYSA-N 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- BHEPBYXIRTUNPN-UHFFFAOYSA-N hydridophosphorus(.) (triplet) Chemical compound [PH] BHEPBYXIRTUNPN-UHFFFAOYSA-N 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- ZLVXBBHTMQJRSX-VMGNSXQWSA-N jdtic Chemical compound C1([C@]2(C)CCN(C[C@@H]2C)C[C@H](C(C)C)NC(=O)[C@@H]2NCC3=CC(O)=CC=C3C2)=CC=CC(O)=C1 ZLVXBBHTMQJRSX-VMGNSXQWSA-N 0.000 description 1
- 210000003734 kidney Anatomy 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000006210 lotion Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- XOTXCIYPIYXPBZ-UHFFFAOYSA-N n-[9-[4-hydroxy-3-(hydroxymethyl)butyl]-6-oxo-3h-purin-2-yl]hexanamide Chemical compound O=C1NC(NC(=O)CCCCC)=NC2=C1N=CN2CCC(CO)CO XOTXCIYPIYXPBZ-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-M phenolate Chemical compound [O-]C1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-M 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- WYVAMUWZEOHJOQ-UHFFFAOYSA-N propionic anhydride Chemical compound CCC(=O)OC(=O)CC WYVAMUWZEOHJOQ-UHFFFAOYSA-N 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- HYHCSLBZRBJJCH-UHFFFAOYSA-M sodium hydrosulfide Chemical compound [Na+].[SH-] HYHCSLBZRBJJCH-UHFFFAOYSA-M 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical class O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- WBQTXTBONIWRGK-UHFFFAOYSA-N sodium;propan-2-olate Chemical compound [Na+].CC(C)[O-] WBQTXTBONIWRGK-UHFFFAOYSA-N 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000002211 ultraviolet spectrum Methods 0.000 description 1
- 241001529453 unidentified herpesvirus Species 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- 230000003612 virological effect Effects 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D473/00—Heterocyclic compounds containing purine ring systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/12—Antivirals
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/12—Antivirals
- A61P31/20—Antivirals for DNA viruses
- A61P31/22—Antivirals for DNA viruses for herpes viruses
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C31/00—Saturated compounds having hydroxy or O-metal groups bound to acyclic carbon atoms
- C07C31/18—Polyhydroxylic acyclic alcohols
- C07C31/22—Trihydroxylic alcohols, e.g. glycerol
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/03—Ethers having all ether-oxygen atoms bound to acyclic carbon atoms
- C07C43/14—Unsaturated ethers
- C07C43/178—Unsaturated ethers containing hydroxy or O-metal groups
- C07C43/1782—Unsaturated ethers containing hydroxy or O-metal groups containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/007—Esters of unsaturated alcohols having the esterified hydroxy group bound to an acyclic carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D319/00—Heterocyclic compounds containing six-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D319/04—1,3-Dioxanes; Hydrogenated 1,3-dioxanes
- C07D319/06—1,3-Dioxanes; Hydrogenated 1,3-dioxanes not condensed with other rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/547—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom
- C07F9/6561—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom containing systems of two or more relevant hetero rings condensed among themselves or condensed with a common carbocyclic ring or ring system, with or without other non-condensed hetero rings
- C07F9/65616—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom containing systems of two or more relevant hetero rings condensed among themselves or condensed with a common carbocyclic ring or ring system, with or without other non-condensed hetero rings containing the ring system having three or more than three double bonds between ring members or between ring members and non-ring members, e.g. purine or analogs
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Virology (AREA)
- Molecular Biology (AREA)
- General Chemical & Material Sciences (AREA)
- Public Health (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Communicable Diseases (AREA)
- Animal Behavior & Ethology (AREA)
- Oncology (AREA)
- Medicinal Chemistry (AREA)
- Veterinary Medicine (AREA)
- Biochemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Biotechnology (AREA)
- Engineering & Computer Science (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Heterocyclic Compounds That Contain Two Or More Ring Oxygen Atoms (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB838322199A GB8322199D0 (en) | 1983-08-18 | 1983-08-18 | Pharmaceutical composition |
| GB838325271A GB8325271D0 (en) | 1983-09-21 | 1983-09-21 | Compounds |
| GB848408322A GB8408322D0 (en) | 1984-03-30 | 1984-03-30 | Compounds |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| BG61325B2 true BG61325B2 (bg) | 1997-05-30 |
Family
ID=27262187
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| BG098210A BG61325B2 (bg) | 1983-08-18 | 1993-11-10 | Антивирусни гуанинови производни |
Country Status (14)
| Country | Link |
|---|---|
| US (3) | US5075445A (ja) |
| EP (1) | EP0141927B1 (ja) |
| JP (2) | JP2519882B2 (ja) |
| BG (1) | BG61325B2 (ja) |
| CA (1) | CA1339818C (ja) |
| CY (1) | CY1746A (ja) |
| CZ (1) | CZ283182B6 (ja) |
| DE (1) | DE3485225D1 (ja) |
| ES (3) | ES8602791A1 (ja) |
| GR (1) | GR80121B (ja) |
| HK (1) | HK126093A (ja) |
| IE (1) | IE58334B1 (ja) |
| MX (1) | MX160431A (ja) |
| NZ (1) | NZ209248A (ja) |
Families Citing this family (75)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5684153A (en) * | 1984-08-16 | 1997-11-04 | Beecham Group Plc | Process for the preparation of purine derivatives |
| EP0141927B1 (en) * | 1983-08-18 | 1991-10-30 | Beecham Group Plc | Antiviral guanine derivatives |
| IL73682A (en) * | 1983-12-20 | 1991-08-16 | Medivir Ab | Antiviral pharmaceutical compositions containing 9-hydroxy aliphatic derivatives of guanine,some new such derivatives and process for their preparation |
| DE3571810D1 (en) * | 1984-01-26 | 1989-08-31 | Merck & Co Inc | Substituted butyl guanines and their utilization in antiviral compositions |
| EP0182024B1 (en) * | 1984-09-20 | 1991-04-03 | Beecham Group Plc | Purine derivatives and their pharmaceutical use |
| GB8507606D0 (en) | 1985-03-23 | 1985-05-01 | Beecham Group Plc | Process |
| DE3671227D1 (de) * | 1985-07-27 | 1990-06-21 | Beecham Group Plc | 9-substituierte guaninmonohydrate. |
| GB8628826D0 (en) * | 1986-12-02 | 1987-01-07 | Beecham Group Plc | Pharmaceutical products |
| US5175288A (en) * | 1987-08-01 | 1992-12-29 | Beecham Group P.L.C. | Process for preparing purine derivatives and intermediates thereof |
| DE3855774T2 (de) * | 1987-08-01 | 1997-06-12 | Beecham Group Plc | Purinverbindungen und ihre Herstellung |
| US5284837A (en) * | 1988-05-06 | 1994-02-08 | Medivir Ab | Derivatives of purine, process for their preparation and a pharmaceutical preparation |
| GB8817607D0 (en) * | 1988-07-23 | 1988-09-01 | Beecham Group Plc | Novel process |
| US4966895A (en) * | 1989-02-02 | 1990-10-30 | Merck & Co. Inc. | Cyclic monophosphates of purine and pyrimidine acyclonucleosides as anti-retroviral agents |
| CA2009109A1 (en) * | 1989-02-02 | 1990-08-02 | John Hannah | Antiviral acyclonucleosides and acyclonucleotides |
| GB8904855D0 (en) * | 1989-03-03 | 1989-04-12 | Beecham Group Plc | Pharmaceutical treatment |
| GB8917959D0 (en) * | 1989-08-05 | 1989-09-20 | Beecham Group Plc | Pharmaceutical formulation |
| GB9001886D0 (en) * | 1990-01-26 | 1990-03-28 | Beecham Group Plc | Pharmaceutical formulation |
| US6469015B1 (en) | 1990-01-26 | 2002-10-22 | Novartis International Pharmaceutical Ltd | Pharmaceutical formulation |
| GB9004647D0 (en) * | 1990-03-01 | 1990-04-25 | Beecham Group Plc | Pharmaceuticals |
| US5674869A (en) * | 1990-07-07 | 1997-10-07 | Beecham Group Plc | Pharmaceutical treatment |
| GB9015051D0 (en) * | 1990-07-07 | 1990-08-29 | Beecham Group Plc | Pharmaceutical treatment |
| GB9102127D0 (en) * | 1991-01-31 | 1991-03-13 | Smithkline Beecham Plc | Pharmaceuticals |
| CA2076886C (en) * | 1991-11-22 | 2002-06-11 | Masami Igi | Method for production of 2-amino-6-halogenopurine and synthesis intermediate therefor |
| GB9201961D0 (en) | 1992-01-30 | 1992-03-18 | Smithkline Beecham Plc | Pharmaceuticals |
| US6124304A (en) * | 1993-10-05 | 2000-09-26 | Smithkline Beecham Plc | Penciclovir for the treatment of zoster associated pain |
| GB9326177D0 (en) * | 1993-12-22 | 1994-02-23 | Smithkline Beecham Plc | Pharmaceuticals |
| IL111138A (en) * | 1993-10-05 | 1997-04-15 | Smithkline Beecham Plc | Pharmaceutical compositions comprising penciclovir and/or its bioprecursor and/or its derivatives for the treatment and prophylaxis of post-herpetic neuralgia |
| US6683084B1 (en) | 1993-11-12 | 2004-01-27 | Novartis International Pharmaceutical Ltd. | Use of 2-amino purine derivatives for the treatment and prophylaxis of human herpes virus 6 infections |
| GB9323404D0 (en) * | 1993-11-12 | 1994-01-05 | Smithkline Beecham Plc | Pharmaceuticals |
| GB9323403D0 (en) * | 1993-11-12 | 1994-01-05 | Smithkline Beecham Plc | Pharmaceuticals |
| GB9402161D0 (en) * | 1994-02-04 | 1994-03-30 | Wellcome Found | Chloropyrimidine intermediates |
| GB9407698D0 (en) * | 1994-04-19 | 1994-06-15 | Smithkline Beecham Plc | Pharmaceuticals |
| US5525606A (en) * | 1994-08-01 | 1996-06-11 | The United States Of America As Represented By The Department Of Health And Human Services | Substituted 06-benzylguanines and 6(4)-benzyloxypyrimidines |
| UA51640C2 (uk) * | 1994-12-12 | 2002-12-16 | Смітклайн Бічам Плс | Спосіб утруднення встановлення або реактивації латентної інфекції, яка викликається вірусами герпесу |
| US5840763A (en) * | 1994-12-12 | 1998-11-24 | Smithkline Beecham Plc | Treatment of a latent infection of herpes viruses |
| US5559114A (en) * | 1994-12-16 | 1996-09-24 | Exley; Ray W. | Treatment of autoimmune disease using 2-amino purine derivatives |
| GB9504497D0 (en) | 1995-03-07 | 1995-04-26 | Smithkline Beecham Plc | Pharmaceuticals |
| CA2249598A1 (en) * | 1996-03-26 | 1997-10-02 | Paul Joseph Gilligan | Aryloxy- and arylthio-fused pyridines and pyrimidines and derivatives |
| GR1002949B (el) * | 1996-07-20 | 1998-07-29 | Smithkline Beecham P.L.C. | Φαρμακα |
| GB9615275D0 (en) * | 1996-07-20 | 1996-09-04 | Smithkline Beecham Plc | Pharmaceuticals |
| GB9615253D0 (en) * | 1996-07-20 | 1996-09-04 | Smithkline Beecham Plc | Pharmaceuticals |
| GB9615276D0 (en) * | 1996-07-20 | 1996-09-04 | Smithkline Beecham Plc | Pharmaceuticals |
| KR19980028023A (ko) * | 1996-10-19 | 1998-07-15 | 김준웅 | Ο-아실-ο-아미노산 9-(4-하이드록시-3-하이드록시메틸부트-1-일구아닌 에스테르 유도체 |
| US6060458A (en) * | 1998-02-13 | 2000-05-09 | The United States Of America As Represented By The Department Of Health And Human Services | Oligodeoxyribonucleotides comprising O6 -benzylguanine and their use |
| GB9807116D0 (en) * | 1998-04-02 | 1998-06-03 | Smithkline Beecham Plc | Novel process |
| ES2314157T3 (es) | 1998-11-02 | 2009-03-16 | Gilead Sciences, Inc. | Terapia de combinacion para tratar el virus de la hepatitis b. |
| US6407077B1 (en) | 1998-11-05 | 2002-06-18 | Emory University | β-L nucleosides for the treatment of HIV infection |
| US6107303A (en) * | 1999-03-15 | 2000-08-22 | Demarco; Charlene C. | Treatment of Epstein Barr infection |
| AUPQ806700A0 (en) * | 2000-06-08 | 2000-07-06 | Commonwealth Scientific And Industrial Research Organisation | Antiviral agents |
| KR101150250B1 (ko) | 2001-03-01 | 2012-06-12 | 아보트 래버러토리즈 | 시스-ｆｔｃ의 다형 및 기타 결정형 |
| ITMI20021533A1 (it) * | 2002-07-12 | 2004-01-12 | Recordati Chem Pharm | Processo per la preparazione di 2-acetossimetil-4-alo-but-1-il acetati |
| SI1583542T1 (sl) * | 2003-01-14 | 2008-12-31 | Gilead Sciences Inc | Sestavki in postopki za kombinacijsko antivirusnoterapijo |
| AU2005311534B2 (en) * | 2004-12-03 | 2011-02-17 | F. Hoffmann-La Roche Ag | 3-substituted pyridine derivatives as H3 antagonists |
| DE602005010744D1 (de) * | 2004-12-16 | 2008-12-11 | Hoffmann La Roche | Piperazinylpyridinderivate als mittel gegen adipositas |
| AU2006230269A1 (en) | 2005-03-30 | 2006-10-05 | Novartis Ag | Penciclovir or famciclovir for the treatment of recurrent genital herpes with a one-day application |
| GB2426247A (en) * | 2005-05-20 | 2006-11-22 | Arrow Int Ltd | Methods of preparing purine derivatives such as famciclovir |
| TWI375560B (en) * | 2005-06-13 | 2012-11-01 | Gilead Sciences Inc | Composition comprising dry granulated emtricitabine and tenofovir df and method for making the same |
| TWI471145B (zh) | 2005-06-13 | 2015-02-01 | Bristol Myers Squibb & Gilead Sciences Llc | 單一式藥學劑量型 |
| WO2008155613A1 (en) * | 2007-06-21 | 2008-12-24 | Aurobindo Pharma Ltd | An improved process for preparing purine derivative |
| US20110105434A1 (en) | 2007-11-21 | 2011-05-05 | Exley Ray W | 2-amino purine derivatives and their use as anti-herpetic agents |
| WO2009120358A1 (en) * | 2008-03-27 | 2009-10-01 | Nektar Therapeutics | Oligomer-nitrogenous base conjugates |
| WO2009129385A1 (en) * | 2008-04-16 | 2009-10-22 | Abbott Laboratories | Cationic lipids and uses thereof |
| US8173621B2 (en) | 2008-06-11 | 2012-05-08 | Gilead Pharmasset Llc | Nucleoside cyclicphosphates |
| SG172361A1 (en) * | 2008-12-23 | 2011-07-28 | Pharmasset Inc | Nucleoside analogs |
| EP2376515A1 (en) | 2008-12-23 | 2011-10-19 | Pharmasset, Inc. | Synthesis of purine nucleosides |
| AR074897A1 (es) | 2008-12-23 | 2011-02-23 | Pharmasset Inc | Fosforamidatos de nucleosidos |
| US20110065655A1 (en) * | 2009-09-17 | 2011-03-17 | Karry Whitten | Therapeutic composition to treat lesions caused by herpes simplex virus |
| PT3290428T (pt) | 2010-03-31 | 2021-12-27 | Gilead Pharmasset Llc | Comprimido compreendendo 2-(((s)-(((2r,3r,4r,5r)-5-(2,4-dioxo-3,4-dihidropirimidin-1-(2h)-il)¿4¿fluoro¿3¿hidroxi¿4¿metiltetrahidrofuran¿2¿il)metoxi) (fenoxi)fosforil)amino)propanoato de (s)- isopropil cristalino |
| JP2015520144A (ja) | 2012-05-11 | 2015-07-16 | アクロン・モレキュールズ・アクチェンゲゼルシャフトＡｋｒｏｎ Ｍｏｌｅｃｕｌｅｓ Ａｇ | 疼痛の治療のための化合物の使用 |
| US10342372B2 (en) | 2012-07-27 | 2019-07-09 | Anthony C. Farris | Combination bracket and garment hanger system and assembly mountable to an overhead trim piece associated with a doorway such as for rotatably supporting a garment during steam cleaning |
| US9474400B2 (en) | 2012-07-27 | 2016-10-25 | Anthony C. Farris | Combination bracket and garment hanger system and assembly mountable to an overhead trim piece associated with a doorway such as for rotatably supporting a garment during steam cleaning |
| AU2013340559B2 (en) | 2012-10-29 | 2018-03-15 | Cipla Limited | Antiviral phosphonate analogues and process for preparation thereof |
| CN104086552B (zh) * | 2014-07-31 | 2016-01-13 | 济南兆康医药科技有限公司 | 一种喷昔洛韦的精制方法 |
| MX2019002129A (es) * | 2016-08-29 | 2019-06-20 | Hoffmann La Roche | Nuevos compuestos sulfonimidoilpurinona 7-sustituidos y derivados para el tratamiento y la profilaxis de la infeccion virica. |
| CN108314685B (zh) * | 2018-03-16 | 2020-08-25 | 上药康丽（常州）药业有限公司 | 一种2-氨基-6-氯-9-(4-乙酰氧基-3-乙酰氧甲基丁基)嘌呤的制备方法 |
Family Cites Families (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3624251A (en) * | 1970-01-16 | 1971-11-30 | Diagnostic Data Inc | Orgotein purification process by heating above 65{20 {0 c. |
| US3706181A (en) * | 1970-11-20 | 1972-12-19 | Tenneco Chem | Process for the safe handling of c{11 {11 and c{11 {11 acetylenic hydrocarbons |
| US3688438A (en) * | 1970-12-28 | 1972-09-05 | Texaco Development Corp | Production of a methane-rich synthesis gas |
| US3790365A (en) * | 1971-06-21 | 1974-02-05 | Ethyl Corp | Method of making metal foams by sequential expansion |
| US4146715A (en) * | 1975-08-27 | 1979-03-27 | Burroughs Wellcome Co. | 2-amido-9-(2-acyloxyethoxymethyl)hypoxanthines |
| IL64501A (en) * | 1980-12-22 | 1985-07-31 | Astra Laekemedel Ab | 9-substituted 4-hydroxybutyl guanine derivatives,their preparation and antiviral use |
| US4507305A (en) * | 1981-05-21 | 1985-03-26 | Syntex (U.S.A.) Inc. | 9-(1,3-Dihydroxy-2-propoxymethyl)guanine as antiviral agent |
| KR880002276B1 (ko) * | 1981-08-11 | 1988-10-21 | 더 웰컴 화운데이션 리미티드 | 항비루스성 화합물의 제조방법 |
| US4451478A (en) * | 1982-03-12 | 1984-05-29 | Newport Pharmaceuticals International, Inc. | Imidazole compounds |
| US4461757A (en) * | 1983-02-23 | 1984-07-24 | Ens Bio Logicals Inc. | Dimethylaminomethylenated anti-herpes compounds |
| EP0141927B1 (en) * | 1983-08-18 | 1991-10-30 | Beecham Group Plc | Antiviral guanine derivatives |
| IL73682A (en) * | 1983-12-20 | 1991-08-16 | Medivir Ab | Antiviral pharmaceutical compositions containing 9-hydroxy aliphatic derivatives of guanine,some new such derivatives and process for their preparation |
| US4565867A (en) * | 1984-01-05 | 1986-01-21 | Melamine Chemicals, Inc. | Anhydrous high-pressure melamine synthesis |
| DE3571810D1 (en) * | 1984-01-26 | 1989-08-31 | Merck & Co Inc | Substituted butyl guanines and their utilization in antiviral compositions |
| US4845084A (en) * | 1984-01-26 | 1989-07-04 | Merck & Co., Inc. | Phosphate derivatives of substituted butyl guanines, antiviral compositions containing them, and methods of treating viral infections with them |
| US4689129A (en) * | 1985-07-16 | 1987-08-25 | The Dow Chemical Company | Process for the preparation of submicron-sized titanium diboride |
| DE3671227D1 (de) * | 1985-07-27 | 1990-06-21 | Beecham Group Plc | 9-substituierte guaninmonohydrate. |
| US4714787A (en) * | 1985-09-03 | 1987-12-22 | Mobil Oil Corporation | Production of ethers from linear olefins |
| US4910035A (en) * | 1989-03-08 | 1990-03-20 | Consolidated Flavor Corporation | Process and product for making flavored milk |
| US5401861A (en) * | 1992-06-22 | 1995-03-28 | Eli Lilly And Company | Low temperature process for preparing alpha-anomer enriched 2-deoxy-2,2-difluoro-D-ribofuranosyl sulfonates |
| US5185365A (en) * | 1992-06-24 | 1993-02-09 | Cornell Research Foundation, Inc. | Insect deterrent azamcrolides |
| US5670668A (en) * | 1996-07-03 | 1997-09-23 | Eastman Chemical Company | Crystalline tocotrienol esters |
-
1984
- 1984-08-10 EP EP84109539A patent/EP0141927B1/en not_active Expired - Lifetime
- 1984-08-10 DE DE8484109539T patent/DE3485225D1/de not_active Expired - Lifetime
- 1984-08-16 NZ NZ209248A patent/NZ209248A/en unknown
- 1984-08-16 MX MX6893A patent/MX160431A/es unknown
- 1984-08-16 GR GR80121A patent/GR80121B/el unknown
- 1984-08-16 IE IE212384A patent/IE58334B1/en not_active IP Right Cessation
- 1984-08-16 CA CA000461212A patent/CA1339818C/en not_active Expired - Lifetime
- 1984-08-17 JP JP59171381A patent/JP2519882B2/ja not_active Expired - Lifetime
- 1984-08-17 ES ES535283A patent/ES8602791A1/es not_active Expired
-
1985
- 1985-05-16 ES ES543214A patent/ES543214A0/es active Granted
- 1985-05-16 ES ES543213A patent/ES543213A0/es active Granted
-
1987
- 1987-08-12 US US07/085,216 patent/US5075445A/en not_active Expired - Lifetime
-
1991
- 1991-12-19 CZ CS913914A patent/CZ283182B6/cs unknown
-
1993
- 1993-09-08 JP JP5246065A patent/JP2543822B2/ja not_active Expired - Lifetime
- 1993-11-10 BG BG098210A patent/BG61325B2/bg unknown
- 1993-11-11 HK HK1260/93A patent/HK126093A/xx not_active IP Right Cessation
-
1994
- 1994-06-03 CY CY174694A patent/CY1746A/xx unknown
- 1994-09-23 US US08/311,291 patent/US6579981B1/en not_active Expired - Lifetime
- 1994-12-15 US US08/357,363 patent/US6573378B1/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| ES8603888A1 (es) | 1986-01-01 |
| DE3485225D1 (de) | 1991-12-05 |
| JPS6058982A (ja) | 1985-04-05 |
| CA1339818C (en) | 1998-04-14 |
| ES535283A0 (es) | 1985-12-01 |
| JPH06293764A (ja) | 1994-10-21 |
| CZ283182B6 (cs) | 1998-01-14 |
| IE842123L (en) | 1985-02-18 |
| EP0141927B1 (en) | 1991-10-30 |
| EP0141927A3 (en) | 1986-03-12 |
| MX160431A (es) | 1990-02-22 |
| US6579981B1 (en) | 2003-06-17 |
| CZ391491A3 (en) | 1993-01-13 |
| ES543214A0 (es) | 1986-01-01 |
| JP2519882B2 (ja) | 1996-07-31 |
| GR80121B (en) | 1984-12-17 |
| HK126093A (en) | 1993-11-19 |
| US5075445A (en) | 1991-12-24 |
| CY1746A (en) | 1994-06-03 |
| ES8603887A1 (es) | 1986-01-01 |
| JP2543822B2 (ja) | 1996-10-16 |
| NZ209248A (en) | 1988-01-08 |
| EP0141927A2 (en) | 1985-05-22 |
| IE58334B1 (en) | 1993-09-08 |
| ES8602791A1 (es) | 1985-12-01 |
| ES543213A0 (es) | 1986-01-01 |
| US6573378B1 (en) | 2003-06-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| BG61325B2 (bg) | Антивирусни гуанинови производни | |
| FI76086B (fi) | Foerfarande foer framstaellning av antivirala purinderivat. | |
| EP0074306B1 (en) | Anti-viral guanine derivatives | |
| US6057305A (en) | Antiretroviral enantiomeric nucleotide analogs | |
| EP0182024B1 (en) | Purine derivatives and their pharmaceutical use | |
| DE69230349T2 (de) | Cyclopropanderivat | |
| KR940010033B1 (ko) | 항비루스 활성을 갖는 화합물의 제조방법 | |
| EP0152316B1 (en) | Substituted butyl guanines and their utilization in antiviral compositions | |
| US5247085A (en) | Antiviral purine compounds | |
| US4845084A (en) | Phosphate derivatives of substituted butyl guanines, antiviral compositions containing them, and methods of treating viral infections with them | |
| DE3852008T2 (de) | Verbindungen. | |
| DE69110528T2 (de) | Chirale 2-(Phosphonomethoxy)propyl-Guanine als antivirale Agentien. | |
| EP0294069A2 (en) | Purine compounds, process for their preparation, intermediates and pharmaceutical compositions | |
| CA1287832C (en) | Anti-viral compounds | |
| WO1993006112A1 (en) | Therapeutic nucleosides | |
| JPH013185A (ja) | 活性化合物、その製法及びそれを含む医薬組成物 | |
| JPH03218392A (ja) | オキセタノシン類のリン酸エステル、その用途およびその製造法 |