AU661076B2 - Indole derivatives - Google Patents
Indole derivatives Download PDFInfo
- Publication number
- AU661076B2 AU661076B2 AU30186/92A AU3018692A AU661076B2 AU 661076 B2 AU661076 B2 AU 661076B2 AU 30186/92 A AU30186/92 A AU 30186/92A AU 3018692 A AU3018692 A AU 3018692A AU 661076 B2 AU661076 B2 AU 661076B2
- Authority
- AU
- Australia
- Prior art keywords
- cis
- rac
- hexahydro
- mol
- benzo
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 229940054051 antipsychotic indole derivative Drugs 0.000 title claims abstract description 5
- 150000002475 indoles Chemical class 0.000 title claims abstract description 5
- 239000000203 mixture Substances 0.000 claims abstract description 256
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 34
- 150000003839 salts Chemical class 0.000 claims abstract description 22
- 208000024827 Alzheimer disease Diseases 0.000 claims abstract description 21
- 238000011282 treatment Methods 0.000 claims abstract description 18
- 239000002253 acid Substances 0.000 claims abstract description 17
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 15
- 239000001257 hydrogen Substances 0.000 claims abstract description 14
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 14
- 238000011321 prophylaxis Methods 0.000 claims abstract description 12
- DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 claims abstract description 11
- 206010039966 Senile dementia Diseases 0.000 claims abstract description 11
- 125000004122 cyclic group Chemical group 0.000 claims abstract description 11
- 230000006993 memory improvement Effects 0.000 claims abstract description 11
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims abstract description 11
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 claims abstract description 10
- 208000010877 cognitive disease Diseases 0.000 claims abstract description 10
- 125000005462 imide group Chemical group 0.000 claims abstract description 9
- 125000003435 aroyl group Chemical group 0.000 claims abstract description 8
- 125000003118 aryl group Chemical group 0.000 claims abstract description 8
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 7
- 125000005239 aroylamino group Chemical group 0.000 claims abstract description 5
- 230000001225 therapeutic effect Effects 0.000 claims abstract description 3
- -1 n- propyl Chemical group 0.000 claims description 91
- DWLVWMUCHSLGSU-UHFFFAOYSA-M n,n-dimethylcarbamate Chemical compound CN(C)C([O-])=O DWLVWMUCHSLGSU-UHFFFAOYSA-M 0.000 claims description 79
- 150000001875 compounds Chemical class 0.000 claims description 53
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 claims description 31
- 238000000034 method Methods 0.000 claims description 17
- 125000003277 amino group Chemical group 0.000 claims description 13
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 13
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 12
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 12
- 238000004519 manufacturing process Methods 0.000 claims description 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 10
- 239000003814 drug Substances 0.000 claims description 9
- GTCAXTIRRLKXRU-UHFFFAOYSA-N methyl carbamate Chemical compound COC(N)=O GTCAXTIRRLKXRU-UHFFFAOYSA-N 0.000 claims description 6
- 239000003795 chemical substances by application Substances 0.000 claims description 5
- 239000013543 active substance Substances 0.000 claims description 3
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 3
- SURZCVYFPAXNGN-UHFFFAOYSA-N methyl-carbamic acid ethyl ester Chemical compound CCOC(=O)NC SURZCVYFPAXNGN-UHFFFAOYSA-N 0.000 claims description 3
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000004042 4-aminobutyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])N([H])[H] 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims 3
- 208000035475 disorder Diseases 0.000 claims 2
- 102100037114 Elongin-C Human genes 0.000 claims 1
- 101001011859 Homo sapiens Elongin-A Proteins 0.000 claims 1
- 101001011846 Homo sapiens Elongin-B Proteins 0.000 claims 1
- 101000881731 Homo sapiens Elongin-C Proteins 0.000 claims 1
- 101000836005 Homo sapiens S-phase kinase-associated protein 1 Proteins 0.000 claims 1
- 230000001149 cognitive effect Effects 0.000 claims 1
- 239000003085 diluting agent Substances 0.000 claims 1
- 201000010099 disease Diseases 0.000 claims 1
- 239000003937 drug carrier Substances 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 427
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 399
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 293
- 239000000243 solution Substances 0.000 description 263
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 237
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 189
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 171
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 134
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 133
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 118
- 239000000741 silica gel Substances 0.000 description 116
- 229910002027 silica gel Inorganic materials 0.000 description 116
- 239000013078 crystal Substances 0.000 description 110
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 108
- 238000010992 reflux Methods 0.000 description 101
- 239000003921 oil Substances 0.000 description 99
- 235000019198 oils Nutrition 0.000 description 99
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 90
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 82
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 80
- 229910052938 sodium sulfate Inorganic materials 0.000 description 74
- 235000011152 sodium sulphate Nutrition 0.000 description 74
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 73
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 69
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 68
- 239000012074 organic phase Substances 0.000 description 63
- 238000004587 chromatography analysis Methods 0.000 description 60
- 239000002904 solvent Substances 0.000 description 55
- 229920006395 saturated elastomer Polymers 0.000 description 47
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 42
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 40
- 235000017557 sodium bicarbonate Nutrition 0.000 description 40
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 39
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 38
- YIIMEMSDCNDGTB-UHFFFAOYSA-N Dimethylcarbamoyl chloride Chemical compound CN(C)C(Cl)=O YIIMEMSDCNDGTB-UHFFFAOYSA-N 0.000 description 36
- 238000001035 drying Methods 0.000 description 32
- 239000007787 solid Substances 0.000 description 32
- 238000001914 filtration Methods 0.000 description 30
- 239000000725 suspension Substances 0.000 description 26
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 24
- 239000000047 product Substances 0.000 description 24
- 239000000284 extract Substances 0.000 description 23
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 22
- 238000001816 cooling Methods 0.000 description 21
- 239000000463 material Substances 0.000 description 21
- XAWPKHNOFIWWNZ-UHFFFAOYSA-N 1h-indol-6-ol Chemical compound OC1=CC=C2C=CNC2=C1 XAWPKHNOFIWWNZ-UHFFFAOYSA-N 0.000 description 20
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 20
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 20
- 229910052786 argon Inorganic materials 0.000 description 19
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 18
- UTZVRFPLSSHYGF-UHFFFAOYSA-N carboxy(dimethyl)azanium;chloride Chemical compound [Cl-].C[NH+](C)C(O)=O UTZVRFPLSSHYGF-UHFFFAOYSA-N 0.000 description 18
- 125000000814 indol-3-yl group Chemical group [H]C1=C([H])C([H])=C2N([H])C([H])=C([*])C2=C1[H] 0.000 description 18
- 239000012280 lithium aluminium hydride Substances 0.000 description 18
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 18
- 239000000706 filtrate Substances 0.000 description 16
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 16
- 239000011734 sodium Substances 0.000 description 16
- 239000011780 sodium chloride Substances 0.000 description 16
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 15
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 15
- 238000002425 crystallisation Methods 0.000 description 15
- 230000008025 crystallization Effects 0.000 description 15
- 239000006260 foam Substances 0.000 description 15
- 239000007832 Na2SO4 Substances 0.000 description 14
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 14
- 238000004821 distillation Methods 0.000 description 14
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 14
- 238000001953 recrystallisation Methods 0.000 description 14
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 13
- 239000003610 charcoal Substances 0.000 description 13
- 238000006243 chemical reaction Methods 0.000 description 13
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 13
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 12
- 239000007868 Raney catalyst Substances 0.000 description 12
- 229910000564 Raney nickel Inorganic materials 0.000 description 12
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 12
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 12
- 239000002244 precipitate Substances 0.000 description 12
- 239000002585 base Substances 0.000 description 10
- 239000002775 capsule Substances 0.000 description 10
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 10
- 235000019341 magnesium sulphate Nutrition 0.000 description 10
- ZGBUJKAZQOPWGZ-UHFFFAOYSA-N ethyl 2-(5-methoxy-2-oxo-3,4-dihydro-1h-naphthalen-1-yl)acetate Chemical compound C1=CC=C2C(CC(=O)OCC)C(=O)CCC2=C1OC ZGBUJKAZQOPWGZ-UHFFFAOYSA-N 0.000 description 9
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 9
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 8
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 8
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 8
- 229960000583 acetic acid Drugs 0.000 description 8
- 238000000605 extraction Methods 0.000 description 8
- AQRLNPVMDITEJU-UHFFFAOYSA-N triethylsilane Chemical compound CC[SiH](CC)CC AQRLNPVMDITEJU-UHFFFAOYSA-N 0.000 description 8
- CMZHFAQXILXZNA-MJGOQNOKSA-N (3as,9br)-3-(2-cyclohexylethyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-ol Chemical compound C([C@@H]1C=2C=CC=C(C=2CC[C@@H]11)O)CN1CCC1CCCCC1 CMZHFAQXILXZNA-MJGOQNOKSA-N 0.000 description 7
- 239000004480 active ingredient Substances 0.000 description 7
- 239000007864 aqueous solution Substances 0.000 description 7
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 7
- PNEYBMLMFCGWSK-UHFFFAOYSA-N Alumina Chemical compound [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 6
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 6
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 6
- 239000001828 Gelatine Substances 0.000 description 6
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 6
- 235000011114 ammonium hydroxide Nutrition 0.000 description 6
- 239000000460 chlorine Substances 0.000 description 6
- 238000001704 evaporation Methods 0.000 description 6
- 230000008020 evaporation Effects 0.000 description 6
- 229920000159 gelatin Polymers 0.000 description 6
- 235000019322 gelatine Nutrition 0.000 description 6
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 6
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 6
- 239000000546 pharmaceutical excipient Substances 0.000 description 6
- 229910000027 potassium carbonate Inorganic materials 0.000 description 6
- 235000009518 sodium iodide Nutrition 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 5
- 230000010933 acylation Effects 0.000 description 5
- 238000005917 acylation reaction Methods 0.000 description 5
- 239000008346 aqueous phase Substances 0.000 description 5
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 5
- 125000001424 substituent group Chemical group 0.000 description 5
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 4
- XTFIVUDBNACUBN-UHFFFAOYSA-N 1,3,5-trinitro-1,3,5-triazinane Chemical compound [O-][N+](=O)N1CN([N+]([O-])=O)CN([N+]([O-])=O)C1 XTFIVUDBNACUBN-UHFFFAOYSA-N 0.000 description 4
- AJBWNNKDUMXZLM-UHFFFAOYSA-N 4-methylsulfonylbenzoic acid Chemical compound CS(=O)(=O)C1=CC=C(C(O)=O)C=C1 AJBWNNKDUMXZLM-UHFFFAOYSA-N 0.000 description 4
- WDYVUKGVKRZQNM-UHFFFAOYSA-N 6-phosphonohexylphosphonic acid Chemical compound OP(O)(=O)CCCCCCP(O)(O)=O WDYVUKGVKRZQNM-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 4
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 4
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- OIPILFWXSMYKGL-UHFFFAOYSA-N acetylcholine Chemical compound CC(=O)OCC[N+](C)(C)C OIPILFWXSMYKGL-UHFFFAOYSA-N 0.000 description 4
- 229960004373 acetylcholine Drugs 0.000 description 4
- 125000005605 benzo group Chemical group 0.000 description 4
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 4
- 239000008101 lactose Substances 0.000 description 4
- 235000019359 magnesium stearate Nutrition 0.000 description 4
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 4
- 239000008108 microcrystalline cellulose Substances 0.000 description 4
- 229940016286 microcrystalline cellulose Drugs 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- 125000005544 phthalimido group Chemical group 0.000 description 4
- 229920005862 polyol Polymers 0.000 description 4
- 150000003077 polyols Chemical class 0.000 description 4
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 238000006467 substitution reaction Methods 0.000 description 4
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 3
- MLYIUHOUXKYDNT-PWSUYJOCSA-N (3aS,9bR)-6-methoxy-2,3,3a,4,5,9b-hexahydro-1H-benzo[e]indole Chemical compound COC1=CC=CC=2[C@H]3CCN[C@H]3CCC21 MLYIUHOUXKYDNT-PWSUYJOCSA-N 0.000 description 3
- HONGJSNHFKNBGL-GCJKJVERSA-N 2-[4-[(3aS,9bR)-6-methoxy-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-3-yl]butyl]isoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1CCCCN1CC[C@@H]2C(C=CC=C3OC)=C3CC[C@@H]21 HONGJSNHFKNBGL-GCJKJVERSA-N 0.000 description 3
- TXVLRUUCFLXUPI-UHFFFAOYSA-N 6-methoxy-1,3,4,5-tetrahydrobenzo[e]indol-2-one Chemical compound N1C(=O)CC2=C1CCC1=C2C=CC=C1OC TXVLRUUCFLXUPI-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- PLQWBFBGUOMDSF-UHFFFAOYSA-N Cl.C1=CNC=2C=CC3=C(C12)C=CC=C3OC(N(C)C)=O Chemical compound Cl.C1=CNC=2C=CC3=C(C12)C=CC=C3OC(N(C)C)=O PLQWBFBGUOMDSF-UHFFFAOYSA-N 0.000 description 3
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 3
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- 229920000881 Modified starch Polymers 0.000 description 3
- 239000004368 Modified starch Substances 0.000 description 3
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 3
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 3
- 235000019270 ammonium chloride Nutrition 0.000 description 3
- 239000000908 ammonium hydroxide Substances 0.000 description 3
- 239000012300 argon atmosphere Substances 0.000 description 3
- 238000005661 deetherification reaction Methods 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- WUDNUHPRLBTKOJ-UHFFFAOYSA-N ethyl isocyanate Chemical compound CCN=C=O WUDNUHPRLBTKOJ-UHFFFAOYSA-N 0.000 description 3
- 239000000796 flavoring agent Substances 0.000 description 3
- 235000019634 flavors Nutrition 0.000 description 3
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 3
- QNLOWBMKUIXCOW-UHFFFAOYSA-N indol-2-one Chemical compound C1=CC=CC2=NC(=O)C=C21 QNLOWBMKUIXCOW-UHFFFAOYSA-N 0.000 description 3
- PXZQEOJJUGGUIB-UHFFFAOYSA-N isoindolin-1-one Chemical compound C1=CC=C2C(=O)NCC2=C1 PXZQEOJJUGGUIB-UHFFFAOYSA-N 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 235000019426 modified starch Nutrition 0.000 description 3
- 239000012452 mother liquor Substances 0.000 description 3
- 125000004043 oxo group Chemical group O=* 0.000 description 3
- 239000000825 pharmaceutical preparation Substances 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 3
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 3
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 3
- 239000000454 talc Substances 0.000 description 3
- 229910052623 talc Inorganic materials 0.000 description 3
- 239000001993 wax Substances 0.000 description 3
- BJULDDXCRSVBCO-QUCCMNQESA-N (3aS,9bR)-3-(2-cyclohexylethyl)-6-methoxy-1,2,3a,4,5,9b-hexahydrobenzo[e]indole Chemical compound C1(CCCCC1)CCN1CC[C@@H]2C3=C(CC[C@H]12)C(=CC=C3)OC BJULDDXCRSVBCO-QUCCMNQESA-N 0.000 description 2
- HGDBNXTVPRTDOP-AEFFLSMTSA-N (3aS,9bR)-3-(2-cyclopentylethyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-ol Chemical compound C1(CCCC1)CCN1CC[C@@H]2C3=C(CC[C@H]12)C(=CC=C3)O HGDBNXTVPRTDOP-AEFFLSMTSA-N 0.000 description 2
- AHIUBASZEIHYLW-CTNGQTDRSA-N (3aS,9bR)-3-(3-cyclohexylpropyl)-6-methoxy-1,2,3a,4,5,9b-hexahydrobenzo[e]indole Chemical compound C1(CCCCC1)CCCN1CC[C@@H]2C3=C(CC[C@H]12)C(=CC=C3)OC AHIUBASZEIHYLW-CTNGQTDRSA-N 0.000 description 2
- SRVYLYFAXOMCRS-MJGOQNOKSA-N (3aS,9bR)-3-(3-cyclopentylpropyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-ol Chemical compound C1(CCCC1)CCCN1CC[C@@H]2C3=C(CC[C@H]12)C(=CC=C3)O SRVYLYFAXOMCRS-MJGOQNOKSA-N 0.000 description 2
- QTLHLLNZGHENFX-ZBFHGGJFSA-N (3aS,9bR)-3-(3-methylbutyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-ol Chemical compound CC(CCN1CC[C@@H]2C3=C(CC[C@H]12)C(=CC=C3)O)C QTLHLLNZGHENFX-ZBFHGGJFSA-N 0.000 description 2
- PYXBVGGYKDYDLN-QUCCMNQESA-N (3aS,9bR)-3-(3-phenylpropyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-ol Chemical compound C1(=CC=CC=C1)CCCN1CC[C@@H]2C3=C(CC[C@H]12)C(=CC=C3)O PYXBVGGYKDYDLN-QUCCMNQESA-N 0.000 description 2
- JRADUAQQCKYGOH-CTNGQTDRSA-N (3aS,9bR)-3-(4-cyclohexylbutyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-ol Chemical compound C1(CCCCC1)CCCCN1CC[C@@H]2C3=C(CC[C@H]12)C(=CC=C3)O JRADUAQQCKYGOH-CTNGQTDRSA-N 0.000 description 2
- QDKTXDLTCZTTEB-IRLDBZIGSA-N (3aS,9bR)-3-(4-cyclohexylbutyl)-6-methoxy-1,2,3a,4,5,9b-hexahydrobenzo[e]indole Chemical compound C1(CCCCC1)CCCCN1CC[C@@H]2C3=C(CC[C@H]12)C(=CC=C3)OC QDKTXDLTCZTTEB-IRLDBZIGSA-N 0.000 description 2
- ATBGWANMMRTMLX-MNOVXSKESA-N (3aS,9bR)-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]indol-2-one Chemical compound COC1=CC=CC=2[C@H]3CC(N[C@H]3CCC21)=O ATBGWANMMRTMLX-MNOVXSKESA-N 0.000 description 2
- CSDSGGRCZDDZJL-MOPGFXCFSA-N (3aS,9bR)-6-methoxy-3-(2-phenylethyl)-3a,4,5,9b-tetrahydro-1H-benzo[e]indol-2-one Chemical compound COC1=CC=CC=2[C@H]3CC(N([C@H]3CCC=21)CCC1=CC=CC=C1)=O CSDSGGRCZDDZJL-MOPGFXCFSA-N 0.000 description 2
- NSPXMCHRVNNOTO-UXHICEINSA-N (3aS,9bR)-6-methoxy-3-(3-phenylpropyl)-3a,4,5,9b-tetrahydro-1H-benzo[e]indol-2-one Chemical compound COC1=CC=CC=2[C@H]3CC(N([C@H]3CCC21)CCCC2=CC=CC=C2)=O NSPXMCHRVNNOTO-UXHICEINSA-N 0.000 description 2
- HPUKPOAWHHZLIX-KBPBESRZSA-N (3as,9br)-9-methoxy-3-propyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indole Chemical compound C1=CC(OC)=C2[C@H]3CCN(CCC)[C@H]3CCC2=C1 HPUKPOAWHHZLIX-KBPBESRZSA-N 0.000 description 2
- UBOXGVDOUJQMTN-UHFFFAOYSA-N 1,1,2-trichloroethane Chemical compound ClCC(Cl)Cl UBOXGVDOUJQMTN-UHFFFAOYSA-N 0.000 description 2
- OQURWGJAWSLGQG-UHFFFAOYSA-N 1-isocyanatopropane Chemical compound CCCN=C=O OQURWGJAWSLGQG-UHFFFAOYSA-N 0.000 description 2
- XEWKLFGFFIZRTL-JKSHRDEXSA-N 2-[4-[(3aS,9bR)-6-hydroxy-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-3-yl]butyl]isoindole-1,3-dione hydrochloride Chemical compound Cl.O=C1C2=CC=CC=C2C(=O)N1CCCCN1CC[C@@H]2C(C=CC=C3O)=C3CC[C@@H]21 XEWKLFGFFIZRTL-JKSHRDEXSA-N 0.000 description 2
- JHCFSPVXDOTKBG-GZAZMHIXSA-N 2-[6-[(3aS,9bR)-6-hydroxy-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-3-yl]hexyl]isoindole-1,3-dione hydrochloride Chemical compound Cl.OC1=CC=CC=2[C@H]3CCN([C@H]3CCC21)CCCCCCN2C(C=1C(C2=O)=CC=CC1)=O JHCFSPVXDOTKBG-GZAZMHIXSA-N 0.000 description 2
- JRQAAYVLPPGEHT-UHFFFAOYSA-N 2-bromoethylcyclohexane Chemical compound BrCCC1CCCCC1 JRQAAYVLPPGEHT-UHFFFAOYSA-N 0.000 description 2
- NILLIUYSJFTTRH-UHFFFAOYSA-N 2-cyclopentylacetyl chloride Chemical compound ClC(=O)CC1CCCC1 NILLIUYSJFTTRH-UHFFFAOYSA-N 0.000 description 2
- ZUKTUEOOOXEFML-UHFFFAOYSA-N 2-methoxy-3,4-dihydro-2h-naphthalen-1-one Chemical compound C1=CC=C2C(=O)C(OC)CCC2=C1 ZUKTUEOOOXEFML-UHFFFAOYSA-N 0.000 description 2
- SZQVEGOXJYTLLB-UHFFFAOYSA-N 3-cyclopentylpropanoyl chloride Chemical compound ClC(=O)CCC1CCCC1 SZQVEGOXJYTLLB-UHFFFAOYSA-N 0.000 description 2
- LYUQWQRTDLVQGA-UHFFFAOYSA-N 3-phenylpropylamine Chemical compound NCCCC1=CC=CC=C1 LYUQWQRTDLVQGA-UHFFFAOYSA-N 0.000 description 2
- CRWJQKJNKYLQAB-CLRXKPRGSA-N 4-[2-[(3aS,9bR)-6-methoxy-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-3-yl]ethyl]morpholine hydrochloride Chemical compound Cl.COC1=CC=CC=2[C@H]3CCN([C@H]3CCC21)CCN2CCOCC2 CRWJQKJNKYLQAB-CLRXKPRGSA-N 0.000 description 2
- MDAIAXRTLTVEOU-UHFFFAOYSA-N 5-methoxy-3,4-dihydro-1h-naphthalen-2-one Chemical compound C1C(=O)CCC2=C1C=CC=C2OC MDAIAXRTLTVEOU-UHFFFAOYSA-N 0.000 description 2
- RTVCWWWUVMVCQI-UHFFFAOYSA-N 6-methoxy-2,3,3a,4,5,5a-hexahydro-1H-benzo[e]indole Chemical compound COC1=CC=CC2=C3CCNC3CCC21 RTVCWWWUVMVCQI-UHFFFAOYSA-N 0.000 description 2
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- CKDWPUIZGOQOOM-UHFFFAOYSA-N Carbamyl chloride Chemical class NC(Cl)=O CKDWPUIZGOQOOM-UHFFFAOYSA-N 0.000 description 2
- BBWXUNMVLYFPRO-UHFFFAOYSA-N Cl.Cl.CN(C(O)=O)C Chemical compound Cl.Cl.CN(C(O)=O)C BBWXUNMVLYFPRO-UHFFFAOYSA-N 0.000 description 2
- 229940126062 Compound A Drugs 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- 244000068988 Glycine max Species 0.000 description 2
- 235000010469 Glycine max Nutrition 0.000 description 2
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 2
- 102000014415 Muscarinic acetylcholine receptor Human genes 0.000 description 2
- 108050003473 Muscarinic acetylcholine receptor Proteins 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- BHHGXPLMPWCGHP-UHFFFAOYSA-N Phenethylamine Chemical compound NCCC1=CC=CC=C1 BHHGXPLMPWCGHP-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 244000052585 Rosa centifolia Species 0.000 description 2
- 235000016588 Rosa centifolia Nutrition 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- SXDBWCPKPHAZSM-UHFFFAOYSA-N bromic acid Chemical compound OBr(=O)=O SXDBWCPKPHAZSM-UHFFFAOYSA-N 0.000 description 2
- PCDHSSHKDZYLLI-UHFFFAOYSA-N butan-1-one Chemical compound CCC[C]=O PCDHSSHKDZYLLI-UHFFFAOYSA-N 0.000 description 2
- SKKTUOZKZKCGTB-UHFFFAOYSA-N butyl carbamate Chemical compound CCCCOC(N)=O SKKTUOZKZKCGTB-UHFFFAOYSA-N 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 150000002081 enamines Chemical class 0.000 description 2
- 239000002329 esterase inhibitor Substances 0.000 description 2
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 2
- RKBMQOVVAKWFBU-UHFFFAOYSA-N ethylcarbamic acid;hydrochloride Chemical compound Cl.CCNC(O)=O RKBMQOVVAKWFBU-UHFFFAOYSA-N 0.000 description 2
- 239000003925 fat Substances 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 125000005842 heteroatom Chemical group 0.000 description 2
- MOMDHKVDJYHNRF-UHFFFAOYSA-N hexan-1-one Chemical compound CCCCC[C]=O MOMDHKVDJYHNRF-UHFFFAOYSA-N 0.000 description 2
- 150000002430 hydrocarbons Chemical group 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- PGLTVOMIXTUURA-UHFFFAOYSA-N iodoacetamide Chemical compound NC(=O)CI PGLTVOMIXTUURA-UHFFFAOYSA-N 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 239000012948 isocyanate Substances 0.000 description 2
- 150000002513 isocyanates Chemical class 0.000 description 2
- QXNCRJVBIMSYRT-UHFFFAOYSA-N isoindole-1,3-dione;hydrochloride Chemical compound Cl.C1=CC=C2C(=O)NC(=O)C2=C1 QXNCRJVBIMSYRT-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N isopropyl alcohol Natural products CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 2
- YNTOKMNHRPSGFU-UHFFFAOYSA-N n-Propyl carbamate Chemical compound CCCOC(N)=O YNTOKMNHRPSGFU-UHFFFAOYSA-N 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- KJIFKLIQANRMOU-UHFFFAOYSA-N oxidanium;4-methylbenzenesulfonate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1 KJIFKLIQANRMOU-UHFFFAOYSA-N 0.000 description 2
- PIJVFDBKTWXHHD-HIFRSBDPSA-N physostigmine Chemical compound C12=CC(OC(=O)NC)=CC=C2N(C)[C@@H]2[C@@]1(C)CCN2C PIJVFDBKTWXHHD-HIFRSBDPSA-N 0.000 description 2
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 108020003175 receptors Proteins 0.000 description 2
- 102000005962 receptors Human genes 0.000 description 2
- 229930195734 saturated hydrocarbon Natural products 0.000 description 2
- 108010085082 sigma receptors Proteins 0.000 description 2
- 229910021653 sulphate ion Inorganic materials 0.000 description 2
- 239000000829 suppository Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 235000015112 vegetable and seed oil Nutrition 0.000 description 2
- 239000008158 vegetable oil Substances 0.000 description 2
- OFBLAAHAENUFKV-ZFNKBKEPSA-N (3aS,9bR)-3-(2-cyclohexylethyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-ol hydrochloride Chemical compound Cl.C([C@@H]1C=2C=CC=C(C=2CC[C@@H]11)O)CN1CCC1CCCCC1 OFBLAAHAENUFKV-ZFNKBKEPSA-N 0.000 description 1
- HSQLGJLMHPOLGR-MJGOQNOKSA-N (3aS,9bR)-3-(2-cyclopentylethyl)-6-methoxy-1,2,3a,4,5,9b-hexahydrobenzo[e]indole Chemical compound C1(CCCC1)CCN1CC[C@@H]2C3=C(CC[C@H]12)C(=CC=C3)OC HSQLGJLMHPOLGR-MJGOQNOKSA-N 0.000 description 1
- IKNMPWVJAFCFOC-MJGOQNOKSA-N (3aS,9bR)-3-(2-phenylethyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-ol Chemical compound C1(=CC=CC=C1)CCN1CC[C@@H]2C3=C(CC[C@H]12)C(=CC=C3)O IKNMPWVJAFCFOC-MJGOQNOKSA-N 0.000 description 1
- NKDPKZKIMYBHIV-UFUZANHXSA-N (3aS,9bR)-3-(2-piperidin-1-ylethyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-ol dihydrochloride Chemical compound Cl.Cl.C([C@@H]1C=2C=CC=C(C=2CC[C@@H]11)O)CN1CCN1CCCCC1 NKDPKZKIMYBHIV-UFUZANHXSA-N 0.000 description 1
- LKBFECJKYMRJBN-QUCCMNQESA-N (3aS,9bR)-3-(3-cyclohexylpropyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-ol Chemical compound C1(CCCCC1)CCCN1CC[C@@H]2C3=C(CC[C@H]12)C(=CC=C3)O LKBFECJKYMRJBN-QUCCMNQESA-N 0.000 description 1
- XDTANFMOOXYNLX-QUCCMNQESA-N (3aS,9bR)-3-(3-cyclopentylpropyl)-6-methoxy-1,2,3a,4,5,9b-hexahydrobenzo[e]indole Chemical compound C([C@@H]1C=2C=CC=C(C=2CC[C@@H]11)OC)CN1CCCC1CCCC1 XDTANFMOOXYNLX-QUCCMNQESA-N 0.000 description 1
- DQJDRHXIFDAPEF-AEFFLSMTSA-N (3aS,9bR)-3-(3-morpholin-4-ylpropyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-ol Chemical compound N1(CCOCC1)CCCN1CC[C@@H]2C3=C(CC[C@H]12)C(=CC=C3)O DQJDRHXIFDAPEF-AEFFLSMTSA-N 0.000 description 1
- ROSSVIOKORCUKL-MJGOQNOKSA-N (3aS,9bR)-3-(cyclohexylmethyl)-6-methoxy-1,2,3a,4,5,9b-hexahydrobenzo[e]indole Chemical compound C1(CCCCC1)CN1CC[C@@H]2C3=C(CC[C@H]12)C(=CC=C3)OC ROSSVIOKORCUKL-MJGOQNOKSA-N 0.000 description 1
- YMDGAGKYLOUEJT-MSOLQXFVSA-N (3aS,9bR)-3-(cyclohexylmethyl)-6-methoxy-3a,4,5,9b-tetrahydro-1H-benzo[e]indol-2-one Chemical compound C1(CCCCC1)CN1C(C[C@@H]2C3=C(CC[C@H]12)C(=CC=C3)OC)=O YMDGAGKYLOUEJT-MSOLQXFVSA-N 0.000 description 1
- BSTZUIYRUXOZMM-XMZRARIVSA-N (3aS,9bR)-3-cyclopentyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-ol hydrochloride Chemical compound Cl.C1(CCCC1)N1CC[C@@H]2C3=C(CC[C@H]12)C(=CC=C3)O BSTZUIYRUXOZMM-XMZRARIVSA-N 0.000 description 1
- PJOWJCSXNMGBOG-CVEARBPZSA-N (3aS,9bR)-3-cyclopentyl-6-methoxy-3a,4,5,9b-tetrahydro-1H-benzo[e]indol-2-one Chemical compound C1(CCCC1)N1C(C[C@@H]2C3=C(CC[C@H]12)C(=CC=C3)OC)=O PJOWJCSXNMGBOG-CVEARBPZSA-N 0.000 description 1
- INXBNRUOTLRZHH-SJORKVTESA-N (3aS,9bR)-6-methoxy-3-(2-morpholin-4-ylethyl)-3a,4,5,9b-tetrahydro-1H-benzo[e]indol-2-one Chemical compound COC1=CC=CC=2[C@H]3CC(N([C@H]3CCC21)CCN2CCOCC2)=O INXBNRUOTLRZHH-SJORKVTESA-N 0.000 description 1
- YOANZQZDVAEUIO-QUCCMNQESA-N (3aS,9bR)-6-methoxy-3-(2-phenylethyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indole Chemical compound COC1=CC=CC=2[C@H]3CCN([C@H]3CCC21)CCC2=CC=CC=C2 YOANZQZDVAEUIO-QUCCMNQESA-N 0.000 description 1
- GSXSIFLWRSXTAY-MJGOQNOKSA-N (3aS,9bR)-6-methoxy-3-(2-piperidin-1-ylethyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indole Chemical compound COC1=CC=CC=2[C@H]3CCN([C@H]3CCC21)CCN2CCCCC2 GSXSIFLWRSXTAY-MJGOQNOKSA-N 0.000 description 1
- QTYYJHVOFZNOOE-WBVHZDCISA-N (3aS,9bR)-6-methoxy-3-(3-methylbutyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indole Chemical compound COC1=CC=CC=2[C@H]3CCN([C@H]3CCC21)CCC(C)C QTYYJHVOFZNOOE-WBVHZDCISA-N 0.000 description 1
- WUFWWRATPXCXRP-CVEARBPZSA-N (3aS,9bR)-6-methoxy-3-(3-methylbutyl)-3a,4,5,9b-tetrahydro-1H-benzo[e]indol-2-one Chemical compound COC1=CC=CC=2[C@H]3CC(N([C@H]3CCC21)CCC(C)C)=O WUFWWRATPXCXRP-CVEARBPZSA-N 0.000 description 1
- FKNFJSXQXGGBPU-CTNGQTDRSA-N (3aS,9bR)-6-methoxy-3-(3-phenylpropyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indole Chemical compound COC1=CC=CC=2[C@H]3CCN([C@H]3CCC21)CCCC2=CC=CC=C2 FKNFJSXQXGGBPU-CTNGQTDRSA-N 0.000 description 1
- VUKJBNUKLLGULS-HIFRSBDPSA-N (3as,9br)-6-methoxy-3-propyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indole Chemical compound C1=CC=C2[C@H]3CCN(CCC)[C@H]3CCC2=C1OC VUKJBNUKLLGULS-HIFRSBDPSA-N 0.000 description 1
- QQCSGYBVHXFEFG-UHFFFAOYSA-N 1-(4-bromobutyl)-4,4-dimethylpiperidine-2,6-dione Chemical compound CC1(C)CC(=O)N(CCCCBr)C(=O)C1 QQCSGYBVHXFEFG-UHFFFAOYSA-N 0.000 description 1
- DOGQFDKGPZUREJ-UHFFFAOYSA-N 1-(5-bromopentyl)-4,4-dimethylpiperidine-2,6-dione Chemical compound CC1(C)CC(=O)N(CCCCCBr)C(=O)C1 DOGQFDKGPZUREJ-UHFFFAOYSA-N 0.000 description 1
- AECIGPRUJQYUBJ-UHFFFAOYSA-N 1-(6-bromohexyl)-4,4-dimethylpiperidine-2,6-dione Chemical compound CC1(C)CC(=O)N(CCCCCCBr)C(=O)C1 AECIGPRUJQYUBJ-UHFFFAOYSA-N 0.000 description 1
- OSSIFCNFAKXSIX-UHFFFAOYSA-N 1-(cyclohexylmethyl)-2,3,3a,4,5,9b-hexahydro-1H-benzo[e]indol-6-ol Chemical compound C1(CCCCC1)CC1CNC2CCC3=C(C12)C=CC=C3O OSSIFCNFAKXSIX-UHFFFAOYSA-N 0.000 description 1
- BYROBVPJVFUGFX-AEFFLSMTSA-N 1-[(3aS,9bR)-6-methoxy-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-3-yl]-2-cyclopentylethanone Chemical compound C1(CCCC1)CC(=O)N1CC[C@@H]2C3=C(CC[C@H]12)C(=CC=C3)OC BYROBVPJVFUGFX-AEFFLSMTSA-N 0.000 description 1
- BIMWFJICEDBMRB-MJGOQNOKSA-N 1-[(3aS,9bR)-6-methoxy-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-3-yl]-3-cyclopentylpropan-1-one Chemical compound C1(CCCC1)CCC(=O)N1CC[C@@H]2C3=C(CC[C@H]12)C(=CC=C3)OC BIMWFJICEDBMRB-MJGOQNOKSA-N 0.000 description 1
- IYIIQZWEKMYBMY-VDWUQFQWSA-N 1-[4-[(3aS,9bR)-6-methoxy-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-3-yl]butyl]-4,4-dimethylpiperidine-2,6-dione hydrochloride Chemical compound Cl.COC1=CC=CC=2[C@H]3CCN([C@H]3CCC21)CCCCN2C(CC(CC2=O)(C)C)=O IYIIQZWEKMYBMY-VDWUQFQWSA-N 0.000 description 1
- VVUNYVOKEUEZHW-CTNGQTDRSA-N 1-[5-[(3aS,9bR)-6-methoxy-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-3-yl]pentyl]-4,4-dimethylpiperidine-2,6-dione Chemical compound COC1=CC=CC=2[C@H]3CCN([C@H]3CCC21)CCCCCN2C(CC(CC2=O)(C)C)=O VVUNYVOKEUEZHW-CTNGQTDRSA-N 0.000 description 1
- JVWPNQJKPUUURF-UHFFFAOYSA-N 1-methoxy-1H-benzo[e]indole Chemical compound COC1C=NC=2C=CC3=C(C1=2)C=CC=C3 JVWPNQJKPUUURF-UHFFFAOYSA-N 0.000 description 1
- UXFWTIGUWHJKDD-UHFFFAOYSA-N 2-(4-bromobutyl)isoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(CCCCBr)C(=O)C2=C1 UXFWTIGUWHJKDD-UHFFFAOYSA-N 0.000 description 1
- OAZFTIPKNPTDIO-UHFFFAOYSA-N 2-(6-bromohexyl)isoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(CCCCCCBr)C(=O)C2=C1 OAZFTIPKNPTDIO-UHFFFAOYSA-N 0.000 description 1
- XYXSQAHEKIVPLB-YKSBVNFPSA-N 2-[6-[(3aS,9bR)-6-methoxy-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-3-yl]hexyl]isoindole-1,3-dione Chemical compound COC1=CC=CC=2[C@H]3CCN([C@H]3CCC21)CCCCCCN2C(C=1C(C2=O)=CC=CC1)=O XYXSQAHEKIVPLB-YKSBVNFPSA-N 0.000 description 1
- YNKKYOKUJBFUTP-UHFFFAOYSA-N 2-bromo-1-(3,4-dimethoxyphenyl)pentan-1-one Chemical compound CCCC(Br)C(=O)C1=CC=C(OC)C(OC)=C1 YNKKYOKUJBFUTP-UHFFFAOYSA-N 0.000 description 1
- RWAKBGVDMQRDNA-UHFFFAOYSA-N 2-chloro-1-phenylbutan-1-one Chemical compound CCC(Cl)C(=O)C1=CC=CC=C1 RWAKBGVDMQRDNA-UHFFFAOYSA-N 0.000 description 1
- XYIVCHSFBIWCOD-UHFFFAOYSA-N 2-methoxy-2-(2-oxo-1H-naphthalen-1-yl)acetic acid Chemical compound COC(C1C(=O)C=CC2=CC=CC=C12)C(=O)O XYIVCHSFBIWCOD-UHFFFAOYSA-N 0.000 description 1
- CJNRGSHEMCMUOE-UHFFFAOYSA-N 2-piperidin-1-ylethanamine Chemical compound NCCN1CCCCC1 CJNRGSHEMCMUOE-UHFFFAOYSA-N 0.000 description 1
- UIKUBYKUYUSRSM-UHFFFAOYSA-N 3-morpholinopropylamine Chemical compound NCCCN1CCOCC1 UIKUBYKUYUSRSM-UHFFFAOYSA-N 0.000 description 1
- 125000006201 3-phenylpropyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- BPPVUXSMLBXYGG-UHFFFAOYSA-N 4-[3-(4,5-dihydro-1,2-oxazol-3-yl)-2-methyl-4-methylsulfonylbenzoyl]-2-methyl-1h-pyrazol-3-one Chemical compound CC1=C(C(=O)C=2C(N(C)NC=2)=O)C=CC(S(C)(=O)=O)=C1C1=NOCC1 BPPVUXSMLBXYGG-UHFFFAOYSA-N 0.000 description 1
- CVTHNUJWESOLMW-MJGOQNOKSA-N 4-[3-[(3aS,9bR)-6-methoxy-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-3-yl]propyl]morpholine Chemical compound COC1=CC=CC=2[C@H]3CCN([C@H]3CCC21)CCCN2CCOCC2 CVTHNUJWESOLMW-MJGOQNOKSA-N 0.000 description 1
- AGNFWIZBEATIAK-UHFFFAOYSA-N 4-phenylbutylamine Chemical compound NCCCCC1=CC=CC=C1 AGNFWIZBEATIAK-UHFFFAOYSA-N 0.000 description 1
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 1
- SPMMLIBJDHHTEK-UHFFFAOYSA-N 5-bromo-1-(3,4-dimethoxyphenyl)pentan-1-one Chemical compound COC1=CC=C(C(=O)CCCCBr)C=C1OC SPMMLIBJDHHTEK-UHFFFAOYSA-N 0.000 description 1
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 1
- VICVESMTJSXFHZ-UHFFFAOYSA-N 6-methoxy-1,3,3a,4,5,5a-hexahydrobenzo[e]indol-2-one Chemical compound COC1=CC=CC2=C3CC(NC3CCC21)=O VICVESMTJSXFHZ-UHFFFAOYSA-N 0.000 description 1
- BTYBORAHYUCUMH-UHFFFAOYSA-N 8-methoxy-3,4-dihydro-1h-naphthalen-2-one Chemical compound C1CC(=O)CC2=C1C=CC=C2OC BTYBORAHYUCUMH-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- SDAHBXRPTIUEJE-STQMWFEESA-N COC1=CC=CC2=C1[C@H]1CC(N([C@H]1CC2)CCC)=O Chemical compound COC1=CC=CC2=C1[C@H]1CC(N([C@H]1CC2)CCC)=O SDAHBXRPTIUEJE-STQMWFEESA-N 0.000 description 1
- RFPQPZZKJLRNHU-KGLIPLIRSA-N COC1=CC=CC=2[C@H]3CC(N([C@H]3CCC21)CCC)=O Chemical compound COC1=CC=CC=2[C@H]3CC(N([C@H]3CCC21)CCC)=O RFPQPZZKJLRNHU-KGLIPLIRSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 241000700199 Cavia porcellus Species 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- DAICDZGOCUQBNW-DGXMUYMBSA-N Cl.C([C@@H]1C=2C=CC=C(C=2CC[C@@H]11)OC(=O)N(C)C)CN1CCC1CCCCC1 Chemical compound Cl.C([C@@H]1C=2C=CC=C(C=2CC[C@@H]11)OC(=O)N(C)C)CN1CCC1CCCCC1 DAICDZGOCUQBNW-DGXMUYMBSA-N 0.000 description 1
- QFQISURFCNUKRV-BUDDBBPTSA-N Cl.C([C@@H]1C=2C=CC=C(C=2CC[C@@H]11)OC(=O)N(C)C)CN1CCCCCNC(=O)C1=CC=C(S(C)(=O)=O)C=C1 Chemical compound Cl.C([C@@H]1C=2C=CC=C(C=2CC[C@@H]11)OC(=O)N(C)C)CN1CCCCCNC(=O)C1=CC=C(S(C)(=O)=O)C=C1 QFQISURFCNUKRV-BUDDBBPTSA-N 0.000 description 1
- BXZNGMVKTNHGKJ-LBPAWUGGSA-N Cl.C([C@@H]1C=2C=CC=C(C=2CC[C@@H]11)OC(=O)NCCC)CN1CCC1CCCCC1 Chemical compound Cl.C([C@@H]1C=2C=CC=C(C=2CC[C@@H]11)OC(=O)NCCC)CN1CCC1CCCCC1 BXZNGMVKTNHGKJ-LBPAWUGGSA-N 0.000 description 1
- HDPXRRBHNJGDJG-UHFFFAOYSA-N Cl.CN(C(=O)OC1=CC=C2C=CNC2=C1)C Chemical compound Cl.CN(C(=O)OC1=CC=C2C=CNC2=C1)C HDPXRRBHNJGDJG-UHFFFAOYSA-N 0.000 description 1
- XMNDONOKEZKWBG-YYLIZZNMSA-N Cl.CN(C(OC1=CC=CC2=C1[C@H]1CCN([C@H]1CC2)CCC)=O)C Chemical compound Cl.CN(C(OC1=CC=CC2=C1[C@H]1CCN([C@H]1CC2)CCC)=O)C XMNDONOKEZKWBG-YYLIZZNMSA-N 0.000 description 1
- UEWHPMBCSZUMOW-VDWUQFQWSA-N Cl.CN(C(OC1=CC=CC=2[C@H]3CCN([C@H]3CCC21)CCC2CCCC2)=O)C Chemical compound Cl.CN(C(OC1=CC=CC=2[C@H]3CCN([C@H]3CCC21)CCC2CCCC2)=O)C UEWHPMBCSZUMOW-VDWUQFQWSA-N 0.000 description 1
- WAFVURBIPTUZGB-IYJPBCIQSA-N Cl.COC1=CC=CC=2[C@H]3CCN[C@H]3CCC21 Chemical compound Cl.COC1=CC=CC=2[C@H]3CCN[C@H]3CCC21 WAFVURBIPTUZGB-IYJPBCIQSA-N 0.000 description 1
- ZMCHXSMFSXTZRN-UHFFFAOYSA-N Cl.Cl.C1C=NC=2C=CC3=C(C12)C=CC=C3O Chemical compound Cl.Cl.C1C=NC=2C=CC3=C(C12)C=CC=C3O ZMCHXSMFSXTZRN-UHFFFAOYSA-N 0.000 description 1
- 241001091551 Clio Species 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000371 Esterases Proteins 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 241000575946 Ione Species 0.000 description 1
- 150000000994 L-ascorbates Chemical class 0.000 description 1
- LTXREWYXXSTFRX-QGZVFWFLSA-N Linagliptin Chemical compound N=1C=2N(C)C(=O)N(CC=3N=C4C=CC=CC4=C(C)N=3)C(=O)C=2N(CC#CC)C=1N1CCC[C@@H](N)C1 LTXREWYXXSTFRX-QGZVFWFLSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical class CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 1
- WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinyl-2-pyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 description 1
- 230000006181 N-acylation Effects 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 229910019567 Re Re Inorganic materials 0.000 description 1
- 101100112128 Staphylococcus aureus capL gene Proteins 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- CMAGDQUPFXAXLA-FXMYHANSSA-N [(3aS,9bR)-2,3,3a,4,5,9b-hexahydro-1H-benzo[e]indol-9-yl] N,N-dimethylcarbamate hydrochloride Chemical compound Cl.CN(C(OC1=CC=CC2=C1[C@H]1CCN[C@H]1CC2)=O)C CMAGDQUPFXAXLA-FXMYHANSSA-N 0.000 description 1
- ZFRRYMKUWNBSPT-MJGOQNOKSA-N [(3aS,9bR)-3-(2-morpholin-4-ylethyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-yl] N,N-dimethylcarbamate Chemical compound CN(C(OC1=CC=CC=2[C@H]3CCN([C@H]3CCC21)CCN2CCOCC2)=O)C ZFRRYMKUWNBSPT-MJGOQNOKSA-N 0.000 description 1
- AMFQNJHGKHYWOT-QFZUCXBQSA-N [(3aS,9bR)-3-(2-morpholin-4-ylethyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-yl] N,N-dimethylcarbamate dihydrochloride Chemical compound Cl.Cl.C([C@@H]1C=2C=CC=C(C=2CC[C@@H]11)OC(=O)N(C)C)CN1CCN1CCOCC1 AMFQNJHGKHYWOT-QFZUCXBQSA-N 0.000 description 1
- GFBXXHGRFOKYRI-CTNGQTDRSA-N [(3aS,9bR)-3-(2-phenylethyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-yl] N,N-dimethylcarbamate Chemical compound CN(C(OC1=CC=CC=2[C@H]3CCN([C@H]3CCC21)CCC2=CC=CC=C2)=O)C GFBXXHGRFOKYRI-CTNGQTDRSA-N 0.000 description 1
- BXGCYCAUIHGOAH-QUCCMNQESA-N [(3aS,9bR)-3-(2-piperidin-1-ylethyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-yl] N,N-dimethylcarbamate Chemical compound C([C@@H]1C=2C=CC=C(C=2CC[C@@H]11)OC(=O)N(C)C)CN1CCN1CCCCC1 BXGCYCAUIHGOAH-QUCCMNQESA-N 0.000 description 1
- LINBXJURIDXOTN-QRIJJCFISA-N [(3aS,9bR)-3-(4-cyclohexylbutyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-yl] N,N-dimethylcarbamate hydrochloride Chemical compound Cl.CN(C(OC1=CC=CC=2[C@H]3CCN([C@H]3CCC21)CCCCC2CCCCC2)=O)C LINBXJURIDXOTN-QRIJJCFISA-N 0.000 description 1
- JBGYYUFGDQQMKX-QUCCMNQESA-N [(3aS,9bR)-3-(cyclohexylmethyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-yl] N,N-dimethylcarbamate Chemical compound CN(C(OC1=CC=CC=2[C@H]3CCN([C@H]3CCC21)CC2CCCCC2)=O)C JBGYYUFGDQQMKX-QUCCMNQESA-N 0.000 description 1
- TTWBEJAUGRIKKW-GZAZMHIXSA-N [(3aS,9bR)-3-[4-(1,3-dioxoisoindol-2-yl)butyl]-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-yl] N,N-dimethylcarbamate hydrochloride Chemical compound Cl.CN(C(OC1=CC=CC=2[C@H]3CCN([C@H]3CCC21)CCCCN2C(C=1C(C2=O)=CC=CC1)=O)=O)C TTWBEJAUGRIKKW-GZAZMHIXSA-N 0.000 description 1
- IIXXCEKEPDSJLE-CLRXKPRGSA-N [(3aS,9bR)-3-cyclopentyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-yl] N,N-dimethylcarbamate hydrochloride Chemical compound Cl.CN(C(OC1=CC=CC=2[C@H]3CCN([C@H]3CCC21)C2CCCC2)=O)C IIXXCEKEPDSJLE-CLRXKPRGSA-N 0.000 description 1
- GXMHAHSLRYIDHI-CTNGQTDRSA-N [(3as,9br)-3-(2-cyclohexylethyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-yl] n,n-dimethylcarbamate Chemical compound C([C@@H]1C=2C=CC=C(C=2CC[C@@H]11)OC(=O)N(C)C)CN1CCC1CCCCC1 GXMHAHSLRYIDHI-CTNGQTDRSA-N 0.000 description 1
- GXMHAHSLRYIDHI-FPOVZHCZSA-N [(3as,9bs)-3-(2-cyclohexylethyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-yl] n,n-dimethylcarbamate Chemical compound C([C@H]1C=2C=CC=C(C=2CC[C@@H]11)OC(=O)N(C)C)CN1CCC1CCCCC1 GXMHAHSLRYIDHI-FPOVZHCZSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910001516 alkali metal iodide Inorganic materials 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- JKRWZLOCPLZZEI-UHFFFAOYSA-N alpha-Trichloromethylbenzyl acetate Chemical class CC(=O)OC(C(Cl)(Cl)Cl)C1=CC=CC=C1 JKRWZLOCPLZZEI-UHFFFAOYSA-N 0.000 description 1
- 230000003042 antagnostic effect Effects 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 235000006708 antioxidants Nutrition 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 210000004556 brain Anatomy 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- NJEDSVQZLAUYLH-UHFFFAOYSA-N butylcarbamic acid;hydrochloride Chemical compound Cl.CCCCNC(O)=O NJEDSVQZLAUYLH-UHFFFAOYSA-N 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- WZFYVLITWYLKET-UHFFFAOYSA-N carboxy(methyl)azanium;chloride Chemical compound Cl.CNC(O)=O WZFYVLITWYLKET-UHFFFAOYSA-N 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 235000010980 cellulose Nutrition 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- WBLIXGSTEMXDSM-UHFFFAOYSA-N chloromethane Chemical compound Cl[CH2] WBLIXGSTEMXDSM-UHFFFAOYSA-N 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 230000008602 contraction Effects 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 229960000913 crospovidone Drugs 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- 150000003950 cyclic amides Chemical group 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- AVKNGPAMCBSNSO-UHFFFAOYSA-N cyclohexylmethanamine Chemical compound NCC1CCCCC1 AVKNGPAMCBSNSO-UHFFFAOYSA-N 0.000 description 1
- NISGSNTVMOOSJQ-UHFFFAOYSA-N cyclopentanamine Chemical compound NC1CCCC1 NISGSNTVMOOSJQ-UHFFFAOYSA-N 0.000 description 1
- 125000005265 dialkylamine group Chemical group 0.000 description 1
- WGLUMOCWFMKWIL-UHFFFAOYSA-N dichloromethane;methanol Chemical compound OC.ClCCl WGLUMOCWFMKWIL-UHFFFAOYSA-N 0.000 description 1
- 235000013681 dietary sucrose Nutrition 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- ZIXPDURIPSAQNX-UHFFFAOYSA-N ethyl(methyl)carbamic acid;hydrochloride Chemical compound Cl.CCN(C)C(O)=O ZIXPDURIPSAQNX-UHFFFAOYSA-N 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 229960001031 glucose Drugs 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 239000008240 homogeneous mixture Substances 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 229940076701 hydro 35 Drugs 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 239000008172 hydrogenated vegetable oil Substances 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- RJTZUHVCZIGJMB-UHFFFAOYSA-N hydron;1h-indole;chloride Chemical compound Cl.C1=CC=C2NC=CC2=C1 RJTZUHVCZIGJMB-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 1
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 1
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 1
- UFVKGYZPFZQRLF-UHFFFAOYSA-N hydroxypropyl methyl cellulose Chemical compound OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC2C(C(O)C(OC3C(C(O)C(O)C(CO)O3)O)C(CO)O2)O)C(CO)O1 UFVKGYZPFZQRLF-UHFFFAOYSA-N 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 229960004903 invert sugar Drugs 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- KEHCHOCBAJSEKS-UHFFFAOYSA-N iron(2+);oxygen(2-);titanium(4+) Chemical compound [O-2].[O-2].[O-2].[Ti+4].[Fe+2] KEHCHOCBAJSEKS-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- BMFVGAAISNGQNM-UHFFFAOYSA-N isopentylamine Chemical compound CC(C)CCN BMFVGAAISNGQNM-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 231100000636 lethal dose Toxicity 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- XONPDZSGENTBNJ-UHFFFAOYSA-N molecular hydrogen;sodium Chemical compound [Na].[H][H] XONPDZSGENTBNJ-UHFFFAOYSA-N 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- 125000006203 morpholinoethyl group Chemical group [H]C([H])(*)C([H])([H])N1C([H])([H])C([H])([H])OC([H])([H])C1([H])[H] 0.000 description 1
- 239000000472 muscarinic agonist Substances 0.000 description 1
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 1
- HNHVTXYLRVGMHD-UHFFFAOYSA-N n-butyl isocyanate Chemical compound CCCCN=C=O HNHVTXYLRVGMHD-UHFFFAOYSA-N 0.000 description 1
- XZVYDRLPXWFRIS-UHFFFAOYSA-N n-ethyl-n-methylcarbamoyl chloride Chemical compound CCN(C)C(Cl)=O XZVYDRLPXWFRIS-UHFFFAOYSA-N 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- 150000003891 oxalate salts Chemical class 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 230000003285 pharmacodynamic effect Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 229960004633 pirenzepine Drugs 0.000 description 1
- 235000013809 polyvinylpolypyrrolidone Nutrition 0.000 description 1
- 229920000523 polyvinylpolypyrrolidone Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- SSOLNOMRVKKSON-UHFFFAOYSA-N proguanil Chemical compound CC(C)\N=C(/N)N=C(N)NC1=CC=C(Cl)C=C1 SSOLNOMRVKKSON-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 239000002287 radioligand Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000010666 rose oil Substances 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 229960004793 sucrose Drugs 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 150000003892 tartrate salts Chemical class 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical class CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- UGKSITLWMZJTHC-UHFFFAOYSA-N tribromo-$l^{3}-bromane Chemical compound BrBr(Br)Br UGKSITLWMZJTHC-UHFFFAOYSA-N 0.000 description 1
- UCPYLLCMEDAXFR-UHFFFAOYSA-N triphosgene Chemical compound ClC(Cl)(Cl)OC(=O)OC(Cl)(Cl)Cl UCPYLLCMEDAXFR-UHFFFAOYSA-N 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/56—Ring systems containing three or more rings
- C07D209/58—[b]- or [c]-condensed
- C07D209/60—Naphtho [b] pyrroles; Hydrogenated naphtho [b] pyrroles
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/28—Drugs for disorders of the nervous system for treating neurodegenerative disorders of the central nervous system, e.g. nootropic agents, cognition enhancers, drugs for treating Alzheimer's disease or other forms of dementia
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Neurosurgery (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Biomedical Technology (AREA)
- Neurology (AREA)
- Medicinal Chemistry (AREA)
- General Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Hospice & Palliative Care (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Psychiatry (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Indole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Plural Heterocyclic Compounds (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH380691 | 1991-12-20 | ||
| CH3806/91 | 1991-12-20 | ||
| CH3254/92 | 1992-10-19 | ||
| CH325492 | 1992-10-19 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| AU3018692A AU3018692A (en) | 1993-06-24 |
| AU661076B2 true AU661076B2 (en) | 1995-07-13 |
Family
ID=25692569
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU30186/92A Ceased AU661076B2 (en) | 1991-12-20 | 1992-12-15 | Indole derivatives |
Country Status (21)
| Country | Link |
|---|---|
| US (2) | US5318966A (OSRAM) |
| EP (1) | EP0548664B1 (OSRAM) |
| JP (1) | JPH07119215B2 (OSRAM) |
| CN (1) | CN1037510C (OSRAM) |
| AT (1) | ATE123277T1 (OSRAM) |
| AU (1) | AU661076B2 (OSRAM) |
| BG (1) | BG61186B1 (OSRAM) |
| CA (1) | CA2084442A1 (OSRAM) |
| CZ (1) | CZ381092A3 (OSRAM) |
| DE (1) | DE59202406D1 (OSRAM) |
| DK (1) | DK0548664T3 (OSRAM) |
| ES (1) | ES2073847T3 (OSRAM) |
| FI (1) | FI925774A7 (OSRAM) |
| GR (1) | GR3017256T3 (OSRAM) |
| HU (2) | HU9203956D0 (OSRAM) |
| IL (1) | IL104080A (OSRAM) |
| IS (1) | IS3961A (OSRAM) |
| MY (1) | MY108026A (OSRAM) |
| NO (1) | NO179325C (OSRAM) |
| NZ (1) | NZ245463A (OSRAM) |
| TW (1) | TW239127B (OSRAM) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE69030665T2 (de) * | 1989-07-13 | 1997-10-02 | Pharmacia & Upjohn Co., Kalamazoo, Mich. | (1,2n) und (3,2n)-karbozyklische-2-amino-tetralinderivate |
| US5486611A (en) * | 1989-07-13 | 1996-01-23 | The Upjohn Company | Carboxamido-(1,2N)-carbocyclic-2-aminotetralin derivatives |
| AU639301B2 (en) * | 1990-01-11 | 1993-07-22 | Pharmacia & Upjohn Company | New centrally acting 6,7,8,9-tetrahydro-3h-benz(e)indole heterocyclics |
| US5434170A (en) * | 1993-12-23 | 1995-07-18 | Andrulis Pharmaceuticals Corp. | Method for treating neurocognitive disorders |
| CA2196046A1 (en) * | 1994-07-27 | 1996-02-08 | Nigel Birdsall | Heterocyclic compounds, useful as allosteric effectors at muscarinic receptors |
| US5859295A (en) * | 1994-12-05 | 1999-01-12 | University Of Kentucky Research Foundation | Canavanine analogs and their use as chemotherapeutic agents |
| IL117149A0 (en) * | 1995-02-23 | 1996-06-18 | Schering Corp | Muscarinic antagonists |
| US5889006A (en) * | 1995-02-23 | 1999-03-30 | Schering Corporation | Muscarinic antagonists |
| GB9612153D0 (en) * | 1996-06-11 | 1996-08-14 | Smithkline Beecham Plc | Compounds |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1277789A (en) * | 1969-09-08 | 1972-06-14 | Logeais Labor Jacques | Improvements in or relating to new polycyclic pyrrole derivatives |
| US4612316A (en) * | 1983-04-27 | 1986-09-16 | Astra Lakemedel Aktiebolag | Tricyclic amines with central dopaminergic activity |
| AU6145390A (en) * | 1989-07-13 | 1991-02-06 | Pharmacia & Upjohn Company | (1,2n) and (3,2n)-carbocyclic-2-amino tetralin derivatives |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS4930836B1 (OSRAM) * | 1971-07-22 | 1974-08-16 | ||
| JPS4916862A (OSRAM) * | 1972-06-14 | 1974-02-14 | ||
| SE8004002L (sv) * | 1980-05-29 | 1981-11-30 | Arvidsson Folke Lars Erik | Terapeutiskt anvendbara tetralinderivat |
| ES2123500T3 (es) * | 1989-05-31 | 1999-01-16 | Upjohn Co | Derivados de 8-heterociclil-2-aminotetralina activos sobre el sistema nervioso central. |
-
1992
- 1992-11-27 TW TW081109528A patent/TW239127B/zh active
- 1992-12-03 CA CA002084442A patent/CA2084442A1/en not_active Abandoned
- 1992-12-09 AT AT92120925T patent/ATE123277T1/de active
- 1992-12-09 ES ES92120925T patent/ES2073847T3/es not_active Expired - Lifetime
- 1992-12-09 EP EP92120925A patent/EP0548664B1/de not_active Expired - Lifetime
- 1992-12-09 DK DK92120925.0T patent/DK0548664T3/da active
- 1992-12-09 DE DE59202406T patent/DE59202406D1/de not_active Expired - Fee Related
- 1992-12-14 HU HU9203956A patent/HU9203956D0/hu unknown
- 1992-12-14 NO NO924829A patent/NO179325C/no unknown
- 1992-12-14 NZ NZ245463A patent/NZ245463A/en unknown
- 1992-12-14 HU HU9203956A patent/HUT68178A/hu unknown
- 1992-12-14 IL IL104080A patent/IL104080A/xx not_active IP Right Cessation
- 1992-12-15 AU AU30186/92A patent/AU661076B2/en not_active Ceased
- 1992-12-18 MY MYPI92002338A patent/MY108026A/en unknown
- 1992-12-18 FI FI925774A patent/FI925774A7/fi not_active Application Discontinuation
- 1992-12-18 IS IS3961A patent/IS3961A/is unknown
- 1992-12-18 BG BG97201A patent/BG61186B1/bg unknown
- 1992-12-19 CN CN92114640A patent/CN1037510C/zh not_active Expired - Fee Related
- 1992-12-21 CZ CS923810A patent/CZ381092A3/cs unknown
- 1992-12-21 JP JP4355382A patent/JPH07119215B2/ja not_active Expired - Lifetime
-
1993
- 1993-07-16 US US08/093,412 patent/US5318966A/en not_active Expired - Fee Related
- 1993-09-03 US US08/118,831 patent/US5318967A/en not_active Expired - Fee Related
-
1995
- 1995-08-30 GR GR950402372T patent/GR3017256T3/el unknown
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1277789A (en) * | 1969-09-08 | 1972-06-14 | Logeais Labor Jacques | Improvements in or relating to new polycyclic pyrrole derivatives |
| US4612316A (en) * | 1983-04-27 | 1986-09-16 | Astra Lakemedel Aktiebolag | Tricyclic amines with central dopaminergic activity |
| AU6145390A (en) * | 1989-07-13 | 1991-02-06 | Pharmacia & Upjohn Company | (1,2n) and (3,2n)-carbocyclic-2-amino tetralin derivatives |
Also Published As
| Publication number | Publication date |
|---|---|
| CZ381092A3 (en) | 1993-09-15 |
| IL104080A0 (en) | 1993-05-13 |
| NO924829L (no) | 1993-06-21 |
| BG61186B1 (bg) | 1997-02-28 |
| GR3017256T3 (en) | 1995-11-30 |
| CN1088576A (zh) | 1994-06-29 |
| CA2084442A1 (en) | 1993-06-21 |
| NZ245463A (en) | 1995-05-26 |
| CN1037510C (zh) | 1998-02-25 |
| EP0548664B1 (de) | 1995-05-31 |
| FI925774L (fi) | 1993-06-21 |
| EP0548664A1 (de) | 1993-06-30 |
| JPH06128228A (ja) | 1994-05-10 |
| IL104080A (en) | 1997-04-15 |
| DK0548664T3 (da) | 1995-09-04 |
| HU9203956D0 (en) | 1993-03-29 |
| ATE123277T1 (de) | 1995-06-15 |
| NO179325C (no) | 1996-09-18 |
| HUT68178A (en) | 1995-05-29 |
| US5318966A (en) | 1994-06-07 |
| ES2073847T3 (es) | 1995-08-16 |
| TW239127B (OSRAM) | 1995-01-21 |
| BG97201A (bg) | 1993-12-24 |
| DE59202406D1 (de) | 1995-07-06 |
| JPH07119215B2 (ja) | 1995-12-20 |
| MY108026A (en) | 1996-07-30 |
| FI925774A7 (fi) | 1993-06-21 |
| AU3018692A (en) | 1993-06-24 |
| US5318967A (en) | 1994-06-07 |
| FI925774A0 (fi) | 1992-12-18 |
| NO179325B (no) | 1996-06-10 |
| NO924829D0 (no) | 1992-12-14 |
| IS3961A (is) | 1993-06-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA2006356C (en) | Arylpiperazinylbutyl-dihydroindoles and related compounds | |
| CA1242193A (en) | 1-benzyl-aminoalkyl-pyrrolidinones and the acid addition salts thereof, processes for preparing them and pharmaceutical compositions | |
| US5143916A (en) | Naphthylpiperazines useful as 5-ht1a receptor ligands | |
| JPH04230362A (ja) | 新規なピペリジン、テトラヒドロピリジンおよびピロリジン誘導体およびこれらを含有する製薬組成物 | |
| CA2110574A1 (en) | Tryptamine analogues, their synthesis and their use as 5-ht1-like or 5-ht2 receptor agonists | |
| JPH07149723A (ja) | 1−アミノエチルインドール誘導体 | |
| CZ283398B6 (cs) | Indolové deriváty jako 5-HT1A a/nebo 5-HT2 ligandy | |
| AU661076B2 (en) | Indole derivatives | |
| NZ197998A (en) | 5-amino(methyl)-1h-indol-3-ylalkaneamines | |
| EP0162695B1 (en) | 6-oxygenated-1,3,,4,5-tetrahydrobenz(cd)indol-4-amines | |
| NO300809B1 (no) | Tricykliske kondenserte heterocykliske forbindelser og deres anvendelse | |
| EP0496314B1 (en) | Substituted 1,2,3,4-tetrahydrocyclopent[b]indoles, 1,2,3,3a,4,8a-hexahydrocyclopent[b]indoles and related compounds, intermediates and a process for the preparation thereof and their use as medicaments | |
| EP0444853B1 (en) | Hexahydrobenz[cd]indoles | |
| CA2450271A1 (en) | Novel phenylalkyl diamine and amide analogs | |
| JP3174158B2 (ja) | 6−オキソ−アゼピノインドール化合物、該化合物を含有する、胃の運動機能を調整する作用を有する医薬品および抗偏頭痛作用するセロトニン拮抗作用を有する医薬品並びに該化合物を製造する方法および該化合物を製造するための中間生成物 | |
| US4254134A (en) | Antidepressant 2-amino- and -2-(substituted amino)-cis-hexahydro-carbazoles | |
| US2995566A (en) | Preparation of tryptamine derivatives | |
| US5773448A (en) | Pharmaceutical compounds | |
| US5298626A (en) | Select cyclopent[b]indoles | |
| US4343812A (en) | Antidepressant 2-amino-and-2-(substituted amino)-cis-hexahydro-carbazoles, compositions and use | |
| US4024265A (en) | Benzo[5,6]cyclohepta[1,2-c]pyridines | |
| US4387230A (en) | Process for preparing a dihydropyridine derivative | |
| AU596494B2 (en) | 1-((4-morpholinyl)alkyl)-1h-indoles useful as analgesics and preparation thereof | |
| US3546236A (en) | 1 - (benzoheterocyclic cyclopropylmethyl) - 4 - phenyl - 1,2,5,6 - tetrahydropyridines | |
| SI9200401A (en) | Indole derivatives |