AT396470B - Verfahren zur herstellung von neuen, herbizid wirksamen 5-amino-3-oxo-4-(substituiertes-phenyl)-2,3-dih drothiophenen und von deren derivaten, dieselben enthaltende mittel sowie deren verwendung - Google Patents
Verfahren zur herstellung von neuen, herbizid wirksamen 5-amino-3-oxo-4-(substituiertes-phenyl)-2,3-dih drothiophenen und von deren derivaten, dieselben enthaltende mittel sowie deren verwendung Download PDFInfo
- Publication number
- AT396470B AT396470B AT0908585A AT908585A AT396470B AT 396470 B AT396470 B AT 396470B AT 0908585 A AT0908585 A AT 0908585A AT 908585 A AT908585 A AT 908585A AT 396470 B AT396470 B AT 396470B
- Authority
- AT
- Austria
- Prior art keywords
- compound
- prepared
- dihydrothiophene
- hydrogen
- general formula
- Prior art date
Links
- -1 SUBSTITUTED-PHENYL Chemical class 0.000 title claims description 230
- 238000004519 manufacturing process Methods 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims description 172
- 238000000034 method Methods 0.000 claims description 111
- 239000000203 mixture Substances 0.000 claims description 61
- 125000004432 carbon atom Chemical group C* 0.000 claims description 53
- 229910052739 hydrogen Inorganic materials 0.000 claims description 47
- 239000001257 hydrogen Substances 0.000 claims description 47
- 125000000217 alkyl group Chemical group 0.000 claims description 41
- 230000008569 process Effects 0.000 claims description 41
- 238000006243 chemical reaction Methods 0.000 claims description 39
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 29
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 27
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 27
- 241000196324 Embryophyta Species 0.000 claims description 24
- 239000002585 base Substances 0.000 claims description 24
- 150000002431 hydrogen Chemical class 0.000 claims description 23
- 125000003545 alkoxy group Chemical group 0.000 claims description 22
- 230000002363 herbicidal effect Effects 0.000 claims description 21
- 239000003960 organic solvent Substances 0.000 claims description 20
- 125000002947 alkylene group Chemical group 0.000 claims description 19
- 229910052783 alkali metal Inorganic materials 0.000 claims description 18
- 238000002360 preparation method Methods 0.000 claims description 17
- 239000003795 chemical substances by application Substances 0.000 claims description 16
- 125000005843 halogen group Chemical group 0.000 claims description 16
- 150000003839 salts Chemical class 0.000 claims description 14
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 12
- 125000001188 haloalkyl group Chemical group 0.000 claims description 12
- 125000001424 substituent group Chemical group 0.000 claims description 12
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 11
- 239000002168 alkylating agent Substances 0.000 claims description 11
- 229940100198 alkylating agent Drugs 0.000 claims description 11
- 125000003118 aryl group Chemical group 0.000 claims description 11
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 11
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 10
- 229910052794 bromium Inorganic materials 0.000 claims description 10
- 230000000694 effects Effects 0.000 claims description 10
- 229910052736 halogen Inorganic materials 0.000 claims description 10
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 10
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 claims description 9
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 9
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 9
- 239000000460 chlorine Substances 0.000 claims description 9
- 229910052801 chlorine Inorganic materials 0.000 claims description 9
- 239000001963 growth medium Substances 0.000 claims description 9
- 150000002367 halogens Chemical class 0.000 claims description 9
- 230000008635 plant growth Effects 0.000 claims description 9
- 125000003107 substituted aryl group Chemical group 0.000 claims description 9
- 238000012546 transfer Methods 0.000 claims description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 8
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 8
- 239000002253 acid Substances 0.000 claims description 8
- 125000003342 alkenyl group Chemical group 0.000 claims description 8
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 8
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 8
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 7
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical group C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 7
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 7
- 125000006350 alkyl thio alkyl group Chemical group 0.000 claims description 7
- 229910052731 fluorine Inorganic materials 0.000 claims description 7
- 239000011737 fluorine Substances 0.000 claims description 7
- 239000011734 sodium Chemical group 0.000 claims description 7
- 229910052708 sodium Inorganic materials 0.000 claims description 7
- 229940126062 Compound A Drugs 0.000 claims description 6
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 claims description 6
- 231100000674 Phytotoxicity Toxicity 0.000 claims description 6
- 238000005804 alkylation reaction Methods 0.000 claims description 6
- 230000012010 growth Effects 0.000 claims description 6
- 238000012986 modification Methods 0.000 claims description 6
- 230000004048 modification Effects 0.000 claims description 6
- 229910052757 nitrogen Inorganic materials 0.000 claims description 6
- 230000001105 regulatory effect Effects 0.000 claims description 6
- 229920006395 saturated elastomer Polymers 0.000 claims description 6
- 125000005037 alkyl phenyl group Chemical group 0.000 claims description 5
- 230000029936 alkylation Effects 0.000 claims description 5
- 239000007795 chemical reaction product Substances 0.000 claims description 5
- 125000004438 haloalkoxy group Chemical group 0.000 claims description 5
- 239000004009 herbicide Substances 0.000 claims description 5
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 claims description 5
- 150000003462 sulfoxides Chemical class 0.000 claims description 5
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 5
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 claims description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 claims description 4
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical group [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 4
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 claims description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 claims description 4
- 125000005078 alkoxycarbonylalkyl group Chemical group 0.000 claims description 4
- 150000004820 halides Chemical class 0.000 claims description 4
- 125000000623 heterocyclic group Chemical group 0.000 claims description 4
- 229910052744 lithium Inorganic materials 0.000 claims description 4
- YNESATAKKCNGOF-UHFFFAOYSA-N lithium bis(trimethylsilyl)amide Chemical compound [Li+].C[Si](C)(C)[N-][Si](C)(C)C YNESATAKKCNGOF-UHFFFAOYSA-N 0.000 claims description 4
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 claims description 4
- 150000003457 sulfones Chemical class 0.000 claims description 4
- 244000068988 Glycine max Species 0.000 claims description 3
- 235000010469 Glycine max Nutrition 0.000 claims description 3
- 150000008051 alkyl sulfates Chemical class 0.000 claims description 3
- 125000004414 alkyl thio group Chemical group 0.000 claims description 3
- 150000001408 amides Chemical class 0.000 claims description 3
- 230000001276 controlling effect Effects 0.000 claims description 3
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 claims description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical group [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 2
- 239000003513 alkali Substances 0.000 claims description 2
- 229910000042 hydrogen bromide Inorganic materials 0.000 claims description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims description 2
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims description 2
- AHNJTQYTRPXLLG-UHFFFAOYSA-N lithium;diethylazanide Chemical compound [Li+].CC[N-]CC AHNJTQYTRPXLLG-UHFFFAOYSA-N 0.000 claims description 2
- 229940098779 methanesulfonic acid Drugs 0.000 claims description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 230000000885 phytotoxic effect Effects 0.000 claims description 2
- 229910052700 potassium Chemical group 0.000 claims description 2
- 239000011591 potassium Chemical group 0.000 claims description 2
- IUBQJLUDMLPAGT-UHFFFAOYSA-N potassium bis(trimethylsilyl)amide Chemical compound C[Si](C)(C)N([K])[Si](C)(C)C IUBQJLUDMLPAGT-UHFFFAOYSA-N 0.000 claims description 2
- 125000006413 ring segment Chemical group 0.000 claims description 2
- XPSQRFGOPLDGPO-UHFFFAOYSA-N sodium;dimethylazanide Chemical compound [Na+].C[N-]C XPSQRFGOPLDGPO-UHFFFAOYSA-N 0.000 claims description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 claims 2
- 238000007363 ring formation reaction Methods 0.000 claims 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 claims 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 claims 1
- 238000006386 neutralization reaction Methods 0.000 claims 1
- 230000003472 neutralizing effect Effects 0.000 claims 1
- WRIKHQLVHPKCJU-UHFFFAOYSA-N sodium bis(trimethylsilyl)amide Chemical compound C[Si](C)(C)N([Na])[Si](C)(C)C WRIKHQLVHPKCJU-UHFFFAOYSA-N 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 30
- 239000007858 starting material Substances 0.000 description 26
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 24
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 21
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 21
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 19
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 16
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 15
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- 230000014509 gene expression Effects 0.000 description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 14
- 239000000243 solution Substances 0.000 description 12
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 11
- HTZCNXWZYVXIMZ-UHFFFAOYSA-M benzyl(triethyl)azanium;chloride Chemical compound [Cl-].CC[N+](CC)(CC)CC1=CC=CC=C1 HTZCNXWZYVXIMZ-UHFFFAOYSA-M 0.000 description 10
- 239000012071 phase Substances 0.000 description 10
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 10
- OXBLVCZKDOZZOJ-UHFFFAOYSA-N 2,3-Dihydrothiophene Chemical compound C1CC=CS1 OXBLVCZKDOZZOJ-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 9
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 8
- 235000019341 magnesium sulphate Nutrition 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- 125000006305 3-iodophenyl group Chemical group [H]C1=C([H])C(I)=C([H])C(*)=C1[H] 0.000 description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- 150000001340 alkali metals Chemical class 0.000 description 7
- 239000007788 liquid Substances 0.000 description 7
- 235000011121 sodium hydroxide Nutrition 0.000 description 7
- 238000012360 testing method Methods 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 238000011065 in-situ storage Methods 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- 239000000741 silica gel Substances 0.000 description 6
- 229910002027 silica gel Inorganic materials 0.000 description 6
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 5
- 239000011630 iodine Substances 0.000 description 5
- 229910052740 iodine Inorganic materials 0.000 description 5
- MGPKTKXUWSVAMY-UHFFFAOYSA-N 3-oxo-4-phenylbutanenitrile Chemical compound N#CCC(=O)CC1=CC=CC=C1 MGPKTKXUWSVAMY-UHFFFAOYSA-N 0.000 description 4
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 4
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 4
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 4
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 4
- 239000000443 aerosol Substances 0.000 description 4
- 239000000969 carrier Substances 0.000 description 4
- 235000013312 flour Nutrition 0.000 description 4
- 239000012442 inert solvent Substances 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- 230000003287 optical effect Effects 0.000 description 4
- 239000007800 oxidant agent Substances 0.000 description 4
- 230000003647 oxidation Effects 0.000 description 4
- 238000007254 oxidation reaction Methods 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 238000000926 separation method Methods 0.000 description 4
- 239000012312 sodium hydride Substances 0.000 description 4
- 229910000104 sodium hydride Inorganic materials 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Chemical compound C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 3
- 125000006275 3-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C([H])C(*)=C1[H] 0.000 description 3
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 3
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 3
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 description 3
- JEFIPLGLKOWMOZ-UHFFFAOYSA-N 5-amino-2-phenyl-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound S1C(N)=C(C=2C=C(C=CC=2)C(F)(F)F)C(=O)C1C1=CC=CC=C1 JEFIPLGLKOWMOZ-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 150000001768 cations Chemical class 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- 239000012141 concentrate Substances 0.000 description 3
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- 239000005648 plant growth regulator Substances 0.000 description 3
- NTTOTNSKUYCDAV-UHFFFAOYSA-N potassium hydride Chemical compound [KH] NTTOTNSKUYCDAV-UHFFFAOYSA-N 0.000 description 3
- 229910000105 potassium hydride Inorganic materials 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 3
- 239000002689 soil Substances 0.000 description 3
- 229930192474 thiophene Natural products 0.000 description 3
- 239000000080 wetting agent Substances 0.000 description 3
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 2
- 125000006276 2-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C(*)C([H])=C1[H] 0.000 description 2
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 2
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 description 2
- RANMIORLMCIAPH-UHFFFAOYSA-N 3-oxo-4-phenyl-2-[3-(trifluoromethyl)phenyl]butanenitrile Chemical compound FC(F)(F)C1=CC=CC(C(C#N)C(=O)CC=2C=CC=CC=2)=C1 RANMIORLMCIAPH-UHFFFAOYSA-N 0.000 description 2
- WDKSGEQEVSSGCX-UHFFFAOYSA-N 4-methyl-3-sulfanylidene-2-[3-(trifluoromethyl)phenyl]pentanenitrile Chemical compound CC(C)C(=S)C(C#N)C1=CC=CC(C(F)(F)F)=C1 WDKSGEQEVSSGCX-UHFFFAOYSA-N 0.000 description 2
- MLKKWIRUTNHEQM-UHFFFAOYSA-N 4-methyl-4-phenyl-3-sulfanylidene-2-[3-(trifluoromethyl)phenyl]pentanenitrile Chemical compound C=1C=CC=CC=1C(C)(C)C(=S)C(C#N)C1=CC=CC(C(F)(F)F)=C1 MLKKWIRUTNHEQM-UHFFFAOYSA-N 0.000 description 2
- KPZJOYYFRNGJJJ-UHFFFAOYSA-N 5-amino-2-(1h-inden-1-yl)-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound O=C1C(C2C3=CC=CC=C3C=C2)SC(N)=C1C1=CC=CC(C(F)(F)F)=C1 KPZJOYYFRNGJJJ-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical class N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical class [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical group BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- IVDBGHPEQSTHRK-UHFFFAOYSA-N OOOOOOOOOOOOOOOOOOOOOO Chemical compound OOOOOOOOOOOOOOOOOOOOOO IVDBGHPEQSTHRK-UHFFFAOYSA-N 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- 241000209504 Poaceae Species 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 2
- 150000001242 acetic acid derivatives Chemical class 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 150000001335 aliphatic alkanes Chemical class 0.000 description 2
- 125000004946 alkenylalkyl group Chemical group 0.000 description 2
- 230000002152 alkylating effect Effects 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 239000010779 crude oil Substances 0.000 description 2
- 150000008050 dialkyl sulfates Chemical class 0.000 description 2
- 235000013399 edible fruits Nutrition 0.000 description 2
- 239000012259 ether extract Substances 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000000417 fungicide Substances 0.000 description 2
- 125000000262 haloalkenyl group Chemical group 0.000 description 2
- 239000002917 insecticide Substances 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- 229910003002 lithium salt Inorganic materials 0.000 description 2
- 159000000002 lithium salts Chemical class 0.000 description 2
- 239000002609 medium Substances 0.000 description 2
- XKBGEWXEAPTVCK-UHFFFAOYSA-M methyltrioctylammonium chloride Chemical compound [Cl-].CCCCCCCC[N+](C)(CCCCCCCC)CCCCCCCC XKBGEWXEAPTVCK-UHFFFAOYSA-M 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 235000011181 potassium carbonates Nutrition 0.000 description 2
- RPDAUEIUDPHABB-UHFFFAOYSA-N potassium ethoxide Chemical compound [K+].CC[O-] RPDAUEIUDPHABB-UHFFFAOYSA-N 0.000 description 2
- 235000011118 potassium hydroxide Nutrition 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- LVTJOONKWUXEFR-FZRMHRINSA-N protoneodioscin Natural products O(C[C@@H](CC[C@]1(O)[C@H](C)[C@@H]2[C@]3(C)[C@H]([C@H]4[C@@H]([C@]5(C)C(=CC4)C[C@@H](O[C@@H]4[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@@H](O)[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@H](CO)O4)CC5)CC3)C[C@@H]2O1)C)[C@H]1[C@H](O)[C@H](O)[C@H](O)[C@@H](CO)O1 LVTJOONKWUXEFR-FZRMHRINSA-N 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- 239000012085 test solution Substances 0.000 description 2
- NHGXDBSUJJNIRV-UHFFFAOYSA-M tetrabutylammonium chloride Chemical compound [Cl-].CCCC[N+](CCCC)(CCCC)CCCC NHGXDBSUJJNIRV-UHFFFAOYSA-M 0.000 description 2
- XGINAUQXFXVBND-UHFFFAOYSA-N 1,2,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrimidine Chemical compound N1CC=CN2CCCC21 XGINAUQXFXVBND-UHFFFAOYSA-N 0.000 description 1
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- JLIDRDJNLAWIKT-UHFFFAOYSA-N 1,2-dimethyl-3h-benzo[e]indole Chemical compound C1=CC=CC2=C(C(=C(C)N3)C)C3=CC=C21 JLIDRDJNLAWIKT-UHFFFAOYSA-N 0.000 description 1
- IBODDUNKEPPBKW-UHFFFAOYSA-N 1,5-dibromopentane Chemical compound BrCCCCCBr IBODDUNKEPPBKW-UHFFFAOYSA-N 0.000 description 1
- 125000004973 1-butenyl group Chemical group C(=CCC)* 0.000 description 1
- DOPROHTZKDRGFX-UHFFFAOYSA-N 2,3-dihydrothiophen-2-amine Chemical compound NC1CC=CS1 DOPROHTZKDRGFX-UHFFFAOYSA-N 0.000 description 1
- MCQHSKFXMRIMJX-UHFFFAOYSA-N 2,3-dihydrothiophen-5-amine Chemical compound NC1=CCCS1 MCQHSKFXMRIMJX-UHFFFAOYSA-N 0.000 description 1
- GUDNGSWMNSWNLR-UHFFFAOYSA-N 2-(1h-inden-1-yl)-5-(methylamino)-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound O=C1C(C2C3=CC=CC=C3C=C2)SC(NC)=C1C1=CC=CC(C(F)(F)F)=C1 GUDNGSWMNSWNLR-UHFFFAOYSA-N 0.000 description 1
- QAUCFMKJJJPIAA-UHFFFAOYSA-N 2-(3-bromo-2-ethylphenyl)-3-naphthalen-1-ylprop-2-enenitrile Chemical compound CCC1=C(Br)C=CC=C1C(C#N)=CC1=CC=CC2=CC=CC=C12 QAUCFMKJJJPIAA-UHFFFAOYSA-N 0.000 description 1
- QAGNTEAWHKLCED-UHFFFAOYSA-N 2-(3-bromophenyl)-4-(2-nitrophenyl)-3-oxobutanenitrile Chemical compound [O-][N+](=O)C1=CC=CC=C1CC(=O)C(C#N)C1=CC=CC(Br)=C1 QAGNTEAWHKLCED-UHFFFAOYSA-N 0.000 description 1
- MIWAJIVEYAKTAK-UHFFFAOYSA-N 2-(3-butoxyphenyl)-3-oxo-4-phenylbutanenitrile Chemical compound CCCCOC1=CC=CC(C(C#N)C(=O)CC=2C=CC=CC=2)=C1 MIWAJIVEYAKTAK-UHFFFAOYSA-N 0.000 description 1
- CLEYOINSVPNJSI-UHFFFAOYSA-N 2-(3-butylphenyl)-3-oxo-4-phenylbutanenitrile Chemical compound CCCCC1=CC=CC(C(C#N)C(=O)CC=2C=CC=CC=2)=C1 CLEYOINSVPNJSI-UHFFFAOYSA-N 0.000 description 1
- UAKHTRMELDDDKO-UHFFFAOYSA-N 2-(3-chlorophenyl)-3-oxo-4-phenylbutanenitrile Chemical compound ClC1=CC=CC(C(C#N)C(=O)CC=2C=CC=CC=2)=C1 UAKHTRMELDDDKO-UHFFFAOYSA-N 0.000 description 1
- DOVOOWWCJXNZJI-UHFFFAOYSA-N 2-(3-methoxy-2-nitrophenyl)-5-(methylamino)-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound S1C(NC)=C(C=2C=C(C=CC=2)C(F)(F)F)C(=O)C1C1=CC=CC(OC)=C1[N+]([O-])=O DOVOOWWCJXNZJI-UHFFFAOYSA-N 0.000 description 1
- UYSQDBNNFBDQQR-UHFFFAOYSA-N 2-[2-bromo-3-(trifluoromethyl)phenyl]-3-oxo-4-phenylbutanenitrile Chemical compound FC(F)(F)C1=CC=CC(C(C#N)C(=O)CC=2C=CC=CC=2)=C1Br UYSQDBNNFBDQQR-UHFFFAOYSA-N 0.000 description 1
- ACUFPXHFAFONNR-UHFFFAOYSA-N 2-[2-fluoro-5-(trifluoromethyl)phenyl]-3-oxo-4-phenylbutanenitrile Chemical compound FC1=CC=C(C(F)(F)F)C=C1C(C#N)C(=O)CC1=CC=CC=C1 ACUFPXHFAFONNR-UHFFFAOYSA-N 0.000 description 1
- NFKKKNUHUFWYJC-UHFFFAOYSA-N 2-[2-iodo-5-(trifluoromethyl)phenyl]-3-oxo-4-phenylbutanenitrile Chemical compound FC(F)(F)C1=CC=C(I)C(C(C#N)C(=O)CC=2C=CC=CC=2)=C1 NFKKKNUHUFWYJC-UHFFFAOYSA-N 0.000 description 1
- JOIYKSLWXLFGGR-UHFFFAOYSA-N 2-[3-(trifluoromethyl)phenyl]acetonitrile Chemical compound FC(F)(F)C1=CC=CC(CC#N)=C1 JOIYKSLWXLFGGR-UHFFFAOYSA-N 0.000 description 1
- GMKKBEDSANTWFC-UHFFFAOYSA-N 2-[3-[(2-methylpropan-2-yl)oxy]phenyl]-3-oxo-4-phenylbutanenitrile Chemical compound CC(C)(C)OC1=CC=CC(C(C#N)C(=O)CC=2C=CC=CC=2)=C1 GMKKBEDSANTWFC-UHFFFAOYSA-N 0.000 description 1
- GQOCBALMIXUXRZ-UHFFFAOYSA-N 2-[3-chloro-5-(trifluoromethyl)phenyl]-3-oxo-4-phenylbutanenitrile Chemical compound FC(F)(F)C1=CC(Cl)=CC(C(C#N)C(=O)CC=2C=CC=CC=2)=C1 GQOCBALMIXUXRZ-UHFFFAOYSA-N 0.000 description 1
- GNHQQZYDEKYTFF-UHFFFAOYSA-N 2-[4-chloro-3-(trifluoromethyl)phenyl]-3-oxo-4-phenylbutanenitrile Chemical compound C1=C(Cl)C(C(F)(F)F)=CC(C(C#N)C(=O)CC=2C=CC=CC=2)=C1 GNHQQZYDEKYTFF-UHFFFAOYSA-N 0.000 description 1
- LRQMACGPWKGVLY-UHFFFAOYSA-N 2-[4-methyl-3-(trifluoromethyl)phenyl]-3-oxo-4-phenylbutanenitrile Chemical compound C1=C(C(F)(F)F)C(C)=CC=C1C(C#N)C(=O)CC1=CC=CC=C1 LRQMACGPWKGVLY-UHFFFAOYSA-N 0.000 description 1
- AQRKXTDQWSOVNY-UHFFFAOYSA-N 2-[7-(fluoromethyl)-3-methoxy-5-nitronaphthalen-1-yl]-5-(methylamino)-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound O=C1C(C=2C3=CC(CF)=CC(=C3C=C(OC)C=2)[N+]([O-])=O)SC(NC)=C1C1=CC=CC(C(F)(F)F)=C1 AQRKXTDQWSOVNY-UHFFFAOYSA-N 0.000 description 1
- OXMBRSPZXYHOLM-UHFFFAOYSA-N 2-butoxy-5-(methylamino)-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound O=C1C(OCCCC)SC(NC)=C1C1=CC=CC(C(F)(F)F)=C1 OXMBRSPZXYHOLM-UHFFFAOYSA-N 0.000 description 1
- OGFRDKJDWBRXKX-UHFFFAOYSA-N 2-butyl-5-(methylamino)-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound O=C1C(CCCC)SC(NC)=C1C1=CC=CC(C(F)(F)F)=C1 OGFRDKJDWBRXKX-UHFFFAOYSA-N 0.000 description 1
- CBWIAUJSSZUGBQ-UHFFFAOYSA-N 2-ethyl-5-(ethylsulfanylmethylamino)-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound O=C1C(CC)SC(NCSCC)=C1C1=CC=CC(C(F)(F)F)=C1 CBWIAUJSSZUGBQ-UHFFFAOYSA-N 0.000 description 1
- WKMICZHARHBQOX-UHFFFAOYSA-N 2-ethyl-5-(methoxymethylamino)-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound O=C1C(CC)SC(NCOC)=C1C1=CC=CC(C(F)(F)F)=C1 WKMICZHARHBQOX-UHFFFAOYSA-N 0.000 description 1
- MKAKBFLXNMLFHV-UHFFFAOYSA-N 2-methoxy-5-(methylamino)-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound O=C1C(OC)SC(NC)=C1C1=CC=CC(C(F)(F)F)=C1 MKAKBFLXNMLFHV-UHFFFAOYSA-N 0.000 description 1
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 1
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 1
- XGVNQOSDPNRINC-UHFFFAOYSA-N 2-phenyl-3-sulfanylidenepentanenitrile Chemical class CCC(=S)C(C#N)C1=CC=CC=C1 XGVNQOSDPNRINC-UHFFFAOYSA-N 0.000 description 1
- MVJXQGMVIBEHHV-UHFFFAOYSA-N 2-phenyl-5-pyrrol-1-yl-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound FC(F)(F)C1=CC=CC(C=2C(C(SC=2N2C=CC=C2)C=2C=CC=CC=2)=O)=C1 MVJXQGMVIBEHHV-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000006494 2-trifluoromethyl benzyl group Chemical group [H]C1=C([H])C([H])=C(C(=C1[H])C([H])([H])*)C(F)(F)F 0.000 description 1
- NLSLEBJTMCMEAT-UHFFFAOYSA-N 3-(2,7-difluoronaphthalen-1-yl)-2-(3-iodo-4-methylphenyl)prop-2-enenitrile Chemical compound C1=C(I)C(C)=CC=C1C(C#N)=CC1=C(F)C=CC2=CC=C(F)C=C12 NLSLEBJTMCMEAT-UHFFFAOYSA-N 0.000 description 1
- ZLUJMEQNWXPSKE-UHFFFAOYSA-N 3-(2-methylnaphthalen-1-yl)-2-[3-(trifluoromethyl)phenyl]prop-2-enenitrile Chemical compound CC1=CC=C2C=CC=CC2=C1C=C(C#N)C1=CC=CC(C(F)(F)F)=C1 ZLUJMEQNWXPSKE-UHFFFAOYSA-N 0.000 description 1
- MCDJFJPIHWBZGO-UHFFFAOYSA-N 3-(3-ethoxynaphthalen-1-yl)-2-[3-(trifluoromethyl)phenyl]prop-2-enenitrile Chemical compound C=12C=CC=CC2=CC(OCC)=CC=1C=C(C#N)C1=CC=CC(C(F)(F)F)=C1 MCDJFJPIHWBZGO-UHFFFAOYSA-N 0.000 description 1
- SNONIUNIQWYRLI-UHFFFAOYSA-N 3-(3-iodophenyl)-2-[3-(trifluoromethyl)phenyl]propanenitrile Chemical compound FC(F)(F)C1=CC=CC(C(CC=2C=C(I)C=CC=2)C#N)=C1 SNONIUNIQWYRLI-UHFFFAOYSA-N 0.000 description 1
- HXQNDQIAJXVKOG-UHFFFAOYSA-N 3-naphthalen-1-yl-2-[3-(trifluoromethyl)phenyl]prop-2-enenitrile Chemical compound FC(F)(F)C1=CC=CC(C(=CC=2C3=CC=CC=C3C=CC=2)C#N)=C1 HXQNDQIAJXVKOG-UHFFFAOYSA-N 0.000 description 1
- XZVZAAGBNWNAJW-UHFFFAOYSA-N 3-naphthalen-2-yl-2-(3-propan-2-yloxyphenyl)prop-2-enenitrile Chemical compound CC(C)OC1=CC=CC(C(=CC=2C=C3C=CC=CC3=CC=2)C#N)=C1 XZVZAAGBNWNAJW-UHFFFAOYSA-N 0.000 description 1
- YYJNZXUWQCENHJ-UHFFFAOYSA-N 3-oxo-4-phenyl-2-[3-(trifluoromethylsulfanyl)phenyl]butanenitrile Chemical compound FC(F)(F)SC1=CC=CC(C(C#N)C(=O)CC=2C=CC=CC=2)=C1 YYJNZXUWQCENHJ-UHFFFAOYSA-N 0.000 description 1
- DXODZMAVYCAATB-UHFFFAOYSA-N 3-sulfanylidene-2-[3-(trifluoromethyl)phenyl]pentanenitrile Chemical compound CCC(=S)C(C#N)C1=CC=CC(C(F)(F)F)=C1 DXODZMAVYCAATB-UHFFFAOYSA-N 0.000 description 1
- XBSXAZYPZDISKQ-UHFFFAOYSA-N 4-(2,3-dichlorophenyl)-3-oxo-2-[3-(trifluoromethyl)phenyl]butanenitrile Chemical compound FC(F)(F)C1=CC=CC(C(C#N)C(=O)CC=2C(=C(Cl)C=CC=2)Cl)=C1 XBSXAZYPZDISKQ-UHFFFAOYSA-N 0.000 description 1
- KNXMIEPYMMOKNF-UHFFFAOYSA-N 4-(2,3-dinitrophenyl)-2-(3-iodophenyl)-3-oxobutanenitrile Chemical compound [O-][N+](=O)C1=CC=CC(CC(=O)C(C#N)C=2C=C(I)C=CC=2)=C1[N+]([O-])=O KNXMIEPYMMOKNF-UHFFFAOYSA-N 0.000 description 1
- XWSMSEHETJJWGA-UHFFFAOYSA-N 4-(2,6-difluorophenyl)-3-oxo-2-[3-(trifluoromethyl)phenyl]butanenitrile Chemical compound FC1=CC=CC(F)=C1CC(=O)C(C#N)C1=CC=CC(C(F)(F)F)=C1 XWSMSEHETJJWGA-UHFFFAOYSA-N 0.000 description 1
- AUUBFGQFYJOWES-UHFFFAOYSA-N 4-(2-amino-4-oxothiophen-3-yl)benzenesulfonic acid Chemical compound O=C1CSC(N)=C1C1=CC=C(S(O)(=O)=O)C=C1 AUUBFGQFYJOWES-UHFFFAOYSA-N 0.000 description 1
- CJBJVHYPUQQSRU-UHFFFAOYSA-N 4-(2-chloro-3-fluorophenyl)-2-ethyl-5-(methylamino)thiophen-3-one Chemical compound O=C1C(CC)SC(NC)=C1C1=CC=CC(F)=C1Cl CJBJVHYPUQQSRU-UHFFFAOYSA-N 0.000 description 1
- KSHSLNTZPIXYCM-UHFFFAOYSA-N 4-(2-chloro-3-fluorophenyl)-5-(methylamino)-2-propan-2-ylthiophen-3-one Chemical compound O=C1C(C(C)C)SC(NC)=C1C1=CC=CC(F)=C1Cl KSHSLNTZPIXYCM-UHFFFAOYSA-N 0.000 description 1
- RURCBRUMXATQCE-UHFFFAOYSA-N 4-(3-butoxy-2-nitrophenyl)-2-ethenyl-5-(methylamino)thiophen-3-one Chemical compound CCCCOC1=CC=CC(C=2C(C(C=C)SC=2NC)=O)=C1[N+]([O-])=O RURCBRUMXATQCE-UHFFFAOYSA-N 0.000 description 1
- XCFVLKNNBRQLST-UHFFFAOYSA-N 4-(3-butylphenyl)-2-ethenyl-5-(methylamino)thiophen-3-one Chemical compound CCCCC1=CC=CC(C=2C(C(C=C)SC=2NC)=O)=C1 XCFVLKNNBRQLST-UHFFFAOYSA-N 0.000 description 1
- LZSMGUDNQRNJKC-UHFFFAOYSA-N 4-(3-fluorophenyl)-5-(methylamino)-2-(3-nitronaphthalen-1-yl)thiophen-3-one Chemical compound O=C1C(C=2C3=CC=CC=C3C=C(C=2)[N+]([O-])=O)SC(NC)=C1C1=CC=CC(F)=C1 LZSMGUDNQRNJKC-UHFFFAOYSA-N 0.000 description 1
- GMGWUNFIDJICEI-UHFFFAOYSA-N 4-(butoxymethoxy)-3-oxo-2-[3-(trifluoromethyl)phenyl]butanenitrile Chemical compound CCCCOCOCC(=O)C(C#N)C1=CC=CC(C(F)(F)F)=C1 GMGWUNFIDJICEI-UHFFFAOYSA-N 0.000 description 1
- GISVTSLYFNXATQ-UHFFFAOYSA-N 4-[2-bromo-3-(trifluoromethyl)phenyl]-5-(methylamino)-2-phenylthiophen-3-one Chemical compound S1C(NC)=C(C=2C(=C(C=CC=2)C(F)(F)F)Br)C(=O)C1C1=CC=CC=C1 GISVTSLYFNXATQ-UHFFFAOYSA-N 0.000 description 1
- GPOFLXPHLQPVRI-UHFFFAOYSA-N 4-[3-(2-fluoropropylsulfanyl)phenyl]-5-(methylamino)-2-phenylthiophen-3-one Chemical compound S1C(NC)=C(C=2C=C(SCC(C)F)C=CC=2)C(=O)C1C1=CC=CC=C1 GPOFLXPHLQPVRI-UHFFFAOYSA-N 0.000 description 1
- VYGLHJAHFOTPAR-UHFFFAOYSA-N 4-[3-(fluoromethylsulfanyl)phenyl]-2-hexyl-5-(methylamino)thiophen-3-one Chemical compound O=C1C(CCCCCC)SC(NC)=C1C1=CC=CC(SCF)=C1 VYGLHJAHFOTPAR-UHFFFAOYSA-N 0.000 description 1
- PMQIFFUROGPBDU-UHFFFAOYSA-N 4-[3-chloro-5-(trifluoromethyl)phenyl]-5-(methylamino)-2-phenylthiophen-3-one Chemical compound S1C(NC)=C(C=2C=C(C=C(Cl)C=2)C(F)(F)F)C(=O)C1C1=CC=CC=C1 PMQIFFUROGPBDU-UHFFFAOYSA-N 0.000 description 1
- SIMHLONYEOIBGP-UHFFFAOYSA-N 4-[3-methoxy-5-(trifluoromethyl)phenyl]-5-(methylamino)-2-phenylthiophen-3-one Chemical compound S1C(NC)=C(C=2C=C(C=C(OC)C=2)C(F)(F)F)C(=O)C1C1=CC=CC=C1 SIMHLONYEOIBGP-UHFFFAOYSA-N 0.000 description 1
- ACBMWBCSTPUFJC-UHFFFAOYSA-N 4-[4-bromo-3-(trifluoromethyl)phenyl]-5-(methylamino)-2-(trifluoromethyl)thiophen-3-one Chemical compound O=C1C(C(F)(F)F)SC(NC)=C1C1=CC=C(Br)C(C(F)(F)F)=C1 ACBMWBCSTPUFJC-UHFFFAOYSA-N 0.000 description 1
- IRSUXKGVZODWIN-UHFFFAOYSA-N 4-[4-chloro-3-(trifluoromethyl)phenyl]-5-(methylamino)-2-phenylthiophen-3-one Chemical compound S1C(NC)=C(C=2C=C(C(Cl)=CC=2)C(F)(F)F)C(=O)C1C1=CC=CC=C1 IRSUXKGVZODWIN-UHFFFAOYSA-N 0.000 description 1
- LGEKDPDGDJRDBT-UHFFFAOYSA-N 5-(ethylsulfanylmethylamino)-2-phenyl-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound S1C(NCSCC)=C(C=2C=C(C=CC=2)C(F)(F)F)C(=O)C1C1=CC=CC=C1 LGEKDPDGDJRDBT-UHFFFAOYSA-N 0.000 description 1
- VIEYNTDPFZUBDS-UHFFFAOYSA-N 5-(methoxymethylamino)-2-methyl-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound O=C1C(C)SC(NCOC)=C1C1=CC=CC(C(F)(F)F)=C1 VIEYNTDPFZUBDS-UHFFFAOYSA-N 0.000 description 1
- ZHQWLTVANOPARE-UHFFFAOYSA-N 5-(methoxymethylamino)-2-phenyl-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound S1C(NCOC)=C(C=2C=C(C=CC=2)C(F)(F)F)C(=O)C1C1=CC=CC=C1 ZHQWLTVANOPARE-UHFFFAOYSA-N 0.000 description 1
- OHTHHZDUUNNUGN-UHFFFAOYSA-N 5-(methylamino)-1,1-dioxo-2-phenyl-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound O=S1(=O)C(NC)=C(C=2C=C(C=CC=2)C(F)(F)F)C(=O)C1C1=CC=CC=C1 OHTHHZDUUNNUGN-UHFFFAOYSA-N 0.000 description 1
- DEAZWELJCYFUNO-UHFFFAOYSA-N 5-(methylamino)-2-(2-methylnaphthalen-1-yl)-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound O=C1C(C=2C3=CC=CC=C3C=CC=2C)SC(NC)=C1C1=CC=CC(C(F)(F)F)=C1 DEAZWELJCYFUNO-UHFFFAOYSA-N 0.000 description 1
- ZUGRFNKISWSWKY-UHFFFAOYSA-N 5-(methylamino)-2-phenyl-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound S1C(NC)=C(C=2C=C(C=CC=2)C(F)(F)F)C(=O)C1C1=CC=CC=C1 ZUGRFNKISWSWKY-UHFFFAOYSA-N 0.000 description 1
- DZCYYZWSPPYZGZ-UHFFFAOYSA-N 5-(methylamino)-4-[3-(trifluoromethyl)phenyl]-2-[[2-(trifluoromethyl)phenyl]methyl]thiophen-3-one Chemical compound S1C(NC)=C(C=2C=C(C=CC=2)C(F)(F)F)C(=O)C1CC1=CC=CC=C1C(F)(F)F DZCYYZWSPPYZGZ-UHFFFAOYSA-N 0.000 description 1
- XNSKHVMDXAQZSY-UHFFFAOYSA-N 5-(methylamino)-4-[3-[(2-methylpropan-2-yl)oxy]phenyl]-2-phenylthiophen-3-one Chemical compound S1C(NC)=C(C=2C=C(OC(C)(C)C)C=CC=2)C(=O)C1C1=CC=CC=C1 XNSKHVMDXAQZSY-UHFFFAOYSA-N 0.000 description 1
- YPSDDMDKSMHIRE-UHFFFAOYSA-N 5-(methylamino)-4-[4-methyl-3-(trifluoromethyl)phenyl]-2-phenylthiophen-3-one Chemical compound S1C(NC)=C(C=2C=C(C(C)=CC=2)C(F)(F)F)C(=O)C1C1=CC=CC=C1 YPSDDMDKSMHIRE-UHFFFAOYSA-N 0.000 description 1
- OCKGFTQIICXDQW-ZEQRLZLVSA-N 5-[(1r)-1-hydroxy-2-[4-[(2r)-2-hydroxy-2-(4-methyl-1-oxo-3h-2-benzofuran-5-yl)ethyl]piperazin-1-yl]ethyl]-4-methyl-3h-2-benzofuran-1-one Chemical compound C1=C2C(=O)OCC2=C(C)C([C@@H](O)CN2CCN(CC2)C[C@H](O)C2=CC=C3C(=O)OCC3=C2C)=C1 OCKGFTQIICXDQW-ZEQRLZLVSA-N 0.000 description 1
- YOLNGJDJHJRCLA-UHFFFAOYSA-N 5-amino-1-oxo-2-phenyl-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound O=S1C(N)=C(C=2C=C(C=CC=2)C(F)(F)F)C(=O)C1C1=CC=CC=C1 YOLNGJDJHJRCLA-UHFFFAOYSA-N 0.000 description 1
- OXRGTWADUSHZPI-UHFFFAOYSA-N 5-amino-2-(1-propylsulfanylethyl)-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound O=C1C(C(C)SCCC)SC(N)=C1C1=CC=CC(C(F)(F)F)=C1 OXRGTWADUSHZPI-UHFFFAOYSA-N 0.000 description 1
- UYAKXJLMNZFHFY-UHFFFAOYSA-N 5-amino-2-(2-naphthalen-1-ylethyl)-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound O=C1C(CCC=2C3=CC=CC=C3C=CC=2)SC(N)=C1C1=CC=CC(C(F)(F)F)=C1 UYAKXJLMNZFHFY-UHFFFAOYSA-N 0.000 description 1
- UNMITDSCLZZVKH-UHFFFAOYSA-N 5-amino-2-(3-chloro-8-fluoronaphthalen-1-yl)-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound ClC=1C=C(C2=C(C=CC=C2C=1)F)C1SC(=C(C1=O)C1=CC(=CC=C1)C(F)(F)F)N UNMITDSCLZZVKH-UHFFFAOYSA-N 0.000 description 1
- OOLMSWSNFVAXBN-UHFFFAOYSA-N 5-amino-2-(3-ethoxynaphthalen-1-yl)-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound C=12C=CC=CC2=CC(OCC)=CC=1C(C1=O)SC(N)=C1C1=CC=CC(C(F)(F)F)=C1 OOLMSWSNFVAXBN-UHFFFAOYSA-N 0.000 description 1
- GDZQYABXZNHNIR-UHFFFAOYSA-N 5-amino-2-(3-nitronaphthalen-1-yl)-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound O=C1C(C=2C3=CC=CC=C3C=C(C=2)[N+]([O-])=O)SC(N)=C1C1=CC=CC(C(F)(F)F)=C1 GDZQYABXZNHNIR-UHFFFAOYSA-N 0.000 description 1
- FMDNGSNCHRYBSO-UHFFFAOYSA-N 5-amino-2-(methoxymethylidene)-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound O=C1C(=COC)SC(N)=C1C1=CC=CC(C(F)(F)F)=C1 FMDNGSNCHRYBSO-UHFFFAOYSA-N 0.000 description 1
- BCYSBQDWTKDCAF-UHFFFAOYSA-N 5-amino-2-(naphthalen-1-ylmethylidene)-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound O=C1C(=CC=2C3=CC=CC=C3C=CC=2)SC(N)=C1C1=CC=CC(C(F)(F)F)=C1 BCYSBQDWTKDCAF-UHFFFAOYSA-N 0.000 description 1
- FATOFZXKULJYSM-UHFFFAOYSA-N 5-amino-2-(trifluoromethyl)-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound O=C1C(C(F)(F)F)SC(N)=C1C1=CC=CC(C(F)(F)F)=C1 FATOFZXKULJYSM-UHFFFAOYSA-N 0.000 description 1
- NVCYZHVPELQCGM-UHFFFAOYSA-N 5-amino-2-[(2-fluorophenyl)methyl]-4-(3-methylphenyl)thiophen-3-one Chemical compound CC1=CC=CC(C=2C(C(CC=3C(=CC=CC=3)F)SC=2N)=O)=C1 NVCYZHVPELQCGM-UHFFFAOYSA-N 0.000 description 1
- ZPRMFAJCKOINOF-UHFFFAOYSA-N 5-amino-2-[(6-nitronaphthalen-1-yl)methylidene]-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound O=C1C(=CC=2C3=CC=C(C=C3C=CC=2)[N+]([O-])=O)SC(N)=C1C1=CC=CC(C(F)(F)F)=C1 ZPRMFAJCKOINOF-UHFFFAOYSA-N 0.000 description 1
- DCZCIFMADVCOGZ-UHFFFAOYSA-N 5-amino-2-[8-methoxy-3-methyl-2-(trifluoromethyl)naphthalen-1-yl]-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound C=12C(OC)=CC=CC2=CC(C)=C(C(F)(F)F)C=1C(C1=O)SC(N)=C1C1=CC=CC(C(F)(F)F)=C1 DCZCIFMADVCOGZ-UHFFFAOYSA-N 0.000 description 1
- JMJZKDDXERMUPP-UHFFFAOYSA-N 5-amino-2-butyl-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound O=C1C(CCCC)SC(N)=C1C1=CC=CC(C(F)(F)F)=C1 JMJZKDDXERMUPP-UHFFFAOYSA-N 0.000 description 1
- AAMBHFHEJWMBJF-UHFFFAOYSA-N 5-amino-2-ethenyl-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound O=C1C(C=C)SC(N)=C1C1=CC=CC(C(F)(F)F)=C1 AAMBHFHEJWMBJF-UHFFFAOYSA-N 0.000 description 1
- LASAWHLZQUAEMO-UHFFFAOYSA-N 5-amino-2-ethyl-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound O=C1C(CC)SC(N)=C1C1=CC=CC(C(F)(F)F)=C1 LASAWHLZQUAEMO-UHFFFAOYSA-N 0.000 description 1
- ZUEUDUBSRGUVPV-UHFFFAOYSA-N 5-amino-2-methoxy-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound O=C1C(OC)SC(N)=C1C1=CC=CC(C(F)(F)F)=C1 ZUEUDUBSRGUVPV-UHFFFAOYSA-N 0.000 description 1
- AEJAJZUFLODBLJ-UHFFFAOYSA-N 5-amino-2-naphthalen-1-yl-4-(3-propan-2-yloxyphenyl)thiophen-3-one Chemical compound CC(C)OC1=CC=CC(C=2C(C(SC=2N)C=2C3=CC=CC=C3C=CC=2)=O)=C1 AEJAJZUFLODBLJ-UHFFFAOYSA-N 0.000 description 1
- JAWIRWJIZMUYRD-UHFFFAOYSA-N 5-amino-2-phenyl-4-[3-(trifluoromethylsulfanyl)phenyl]thiophen-3-one Chemical compound S1C(N)=C(C=2C=C(SC(F)(F)F)C=CC=2)C(=O)C1C1=CC=CC=C1 JAWIRWJIZMUYRD-UHFFFAOYSA-N 0.000 description 1
- AVSJQBWRBPGBMW-UHFFFAOYSA-N 5-amino-2-propyl-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound O=C1C(CCC)SC(N)=C1C1=CC=CC(C(F)(F)F)=C1 AVSJQBWRBPGBMW-UHFFFAOYSA-N 0.000 description 1
- QSHAUCPQRSYXQF-UHFFFAOYSA-N 5-amino-4-(2-chloro-3-fluorophenyl)-2-ethylthiophen-3-one Chemical compound O=C1C(CC)SC(N)=C1C1=CC=CC(F)=C1Cl QSHAUCPQRSYXQF-UHFFFAOYSA-N 0.000 description 1
- RKBSHGZQXAVMHG-UHFFFAOYSA-N 5-amino-4-(2-chlorophenyl)thiophen-3-one Chemical compound O=C1CSC(N)=C1C1=CC=CC=C1Cl RKBSHGZQXAVMHG-UHFFFAOYSA-N 0.000 description 1
- YXRKZNGYPHIZNK-UHFFFAOYSA-N 5-amino-4-(2-fluorophenyl)thiophen-3-one Chemical compound O=C1CSC(N)=C1C1=CC=CC=C1F YXRKZNGYPHIZNK-UHFFFAOYSA-N 0.000 description 1
- BORICZASHXZBNN-UHFFFAOYSA-N 5-amino-4-(3-butylsulfanylphenyl)-2-[(3-chlorophenyl)methyl]thiophen-3-one Chemical compound CCCCSC1=CC=CC(C=2C(C(CC=3C=C(Cl)C=CC=3)SC=2N)=O)=C1 BORICZASHXZBNN-UHFFFAOYSA-N 0.000 description 1
- FVHHNHVMIDGOSA-UHFFFAOYSA-N 5-amino-4-(3-chloro-2-methoxyphenyl)-2-methylthiophen-3-one Chemical compound COC1=C(Cl)C=CC=C1C1=C(N)SC(C)C1=O FVHHNHVMIDGOSA-UHFFFAOYSA-N 0.000 description 1
- QGUNUTNFVGTVHS-UHFFFAOYSA-N 5-amino-4-(3-chlorophenyl)-2-phenylthiophen-3-one Chemical compound S1C(N)=C(C=2C=C(Cl)C=CC=2)C(=O)C1C1=CC=CC=C1 QGUNUTNFVGTVHS-UHFFFAOYSA-N 0.000 description 1
- UJYXXFFMNRBQMH-UHFFFAOYSA-N 5-amino-4-(3-iodophenyl)-2-(3-nitrophenyl)thiophen-3-one Chemical compound S1C(N)=C(C=2C=C(I)C=CC=2)C(=O)C1C1=CC=CC([N+]([O-])=O)=C1 UJYXXFFMNRBQMH-UHFFFAOYSA-N 0.000 description 1
- MMHLXMKGLLRZLB-UHFFFAOYSA-N 5-amino-4-(4-methoxyphenyl)thiophen-3-one Chemical compound C1=CC(OC)=CC=C1C1=C(N)SCC1=O MMHLXMKGLLRZLB-UHFFFAOYSA-N 0.000 description 1
- RDEBMPYRCZZJLL-UHFFFAOYSA-N 5-amino-4-[2-bromo-3-(trifluoromethyl)phenyl]-2-phenylthiophen-3-one Chemical compound S1C(N)=C(C=2C(=C(C=CC=2)C(F)(F)F)Br)C(=O)C1C1=CC=CC=C1 RDEBMPYRCZZJLL-UHFFFAOYSA-N 0.000 description 1
- RDOZHWFFSBQQGD-UHFFFAOYSA-N 5-amino-4-[2-fluoro-5-(trifluoromethyl)phenyl]-2-phenylthiophen-3-one Chemical compound S1C(N)=C(C=2C(=CC=C(C=2)C(F)(F)F)F)C(=O)C1C1=CC=CC=C1 RDOZHWFFSBQQGD-UHFFFAOYSA-N 0.000 description 1
- ZTXHYZPTTSTAJZ-UHFFFAOYSA-N 5-amino-4-[2-iodo-5-(trifluoromethyl)phenyl]-2-phenylthiophen-3-one Chemical compound S1C(N)=C(C=2C(=CC=C(C=2)C(F)(F)F)I)C(=O)C1C1=CC=CC=C1 ZTXHYZPTTSTAJZ-UHFFFAOYSA-N 0.000 description 1
- LKTHRFZSIMCUCK-UHFFFAOYSA-N 5-amino-4-[3-(2-chloroethyl)phenyl]-2-phenylthiophen-3-one Chemical compound S1C(N)=C(C=2C=C(CCCl)C=CC=2)C(=O)C1C1=CC=CC=C1 LKTHRFZSIMCUCK-UHFFFAOYSA-N 0.000 description 1
- WDTSUXZYQJVMGG-UHFFFAOYSA-N 5-amino-4-[3-(2-fluoropropylsulfanyl)phenyl]-2-phenylthiophen-3-one Chemical compound CC(F)CSC1=CC=CC(C=2C(C(SC=2N)C=2C=CC=CC=2)=O)=C1 WDTSUXZYQJVMGG-UHFFFAOYSA-N 0.000 description 1
- PZNDENVZLNVCCJ-UHFFFAOYSA-N 5-amino-4-[3-(difluoromethoxy)phenyl]-2-methylthiophen-3-one Chemical compound O=C1C(C)SC(N)=C1C1=CC=CC(OC(F)F)=C1 PZNDENVZLNVCCJ-UHFFFAOYSA-N 0.000 description 1
- PUQSCAVPKIKBNI-UHFFFAOYSA-N 5-amino-4-[3-[(2-methylpropan-2-yl)oxy]phenyl]-2-phenylthiophen-3-one Chemical compound CC(C)(C)OC1=CC=CC(C=2C(C(SC=2N)C=2C=CC=CC=2)=O)=C1 PUQSCAVPKIKBNI-UHFFFAOYSA-N 0.000 description 1
- ZIHSOVYISCWDKP-UHFFFAOYSA-N 5-amino-4-[3-chloro-5-(trifluoromethyl)phenyl]-2-phenylthiophen-3-one Chemical compound S1C(N)=C(C=2C=C(C=C(Cl)C=2)C(F)(F)F)C(=O)C1C1=CC=CC=C1 ZIHSOVYISCWDKP-UHFFFAOYSA-N 0.000 description 1
- TYOOLGQMVOZEMU-UHFFFAOYSA-N 5-amino-4-[4-bromo-3-(trifluoromethyl)phenyl]-2-(trifluoromethyl)thiophen-3-one Chemical compound O=C1C(C(F)(F)F)SC(N)=C1C1=CC=C(Br)C(C(F)(F)F)=C1 TYOOLGQMVOZEMU-UHFFFAOYSA-N 0.000 description 1
- LMBNVTLCQJIHIC-UHFFFAOYSA-N 5-amino-4-[4-chloro-3-(trifluoromethyl)phenyl]-2-phenylthiophen-3-one Chemical compound S1C(N)=C(C=2C=C(C(Cl)=CC=2)C(F)(F)F)C(=O)C1C1=CC=CC=C1 LMBNVTLCQJIHIC-UHFFFAOYSA-N 0.000 description 1
- NCTGXCULXMEVHC-UHFFFAOYSA-N 5-amino-4-phenylthiophen-3-one Chemical compound O=C1CSC(N)=C1C1=CC=CC=C1 NCTGXCULXMEVHC-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 241000272878 Apodiformes Species 0.000 description 1
- 101001053401 Arabidopsis thaliana Acid beta-fructofuranosidase 3, vacuolar Proteins 0.000 description 1
- 235000007320 Avena fatua Nutrition 0.000 description 1
- 244000075850 Avena orientalis Species 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- 206010061217 Infestation Diseases 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 101100269376 Mus musculus Agfg2 gene Proteins 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- CQGRLHBOVUGVEA-UHFFFAOYSA-N OOOOOOOOOOOOOOO Chemical compound OOOOOOOOOOOOOOO CQGRLHBOVUGVEA-UHFFFAOYSA-N 0.000 description 1
- PWTOMWQKTVMNMM-UHFFFAOYSA-N OOOOOOOOOOOOOOOOOOOOOOOO Chemical compound OOOOOOOOOOOOOOOOOOOOOOOO PWTOMWQKTVMNMM-UHFFFAOYSA-N 0.000 description 1
- YKPBZBDBCKCXOR-UHFFFAOYSA-N OOOOOOOOOOOOOOOOOOOOOOOOOOOOOOOO Chemical compound OOOOOOOOOOOOOOOOOOOOOOOOOOOOOOOO YKPBZBDBCKCXOR-UHFFFAOYSA-N 0.000 description 1
- 244000236458 Panicum colonum Species 0.000 description 1
- 235000015225 Panicum colonum Nutrition 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 244000098338 Triticum aestivum Species 0.000 description 1
- 235000005373 Uvularia sessilifolia Nutrition 0.000 description 1
- 241001464837 Viridiplantae Species 0.000 description 1
- KOOADCGQJDGAGA-UHFFFAOYSA-N [amino(dimethyl)silyl]methane Chemical compound C[Si](C)(C)N KOOADCGQJDGAGA-UHFFFAOYSA-N 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000001347 alkyl bromides Chemical class 0.000 description 1
- 150000001351 alkyl iodides Chemical class 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- CREXVNNSNOKDHW-UHFFFAOYSA-N azaniumylideneazanide Chemical group N[N] CREXVNNSNOKDHW-UHFFFAOYSA-N 0.000 description 1
- 150000007962 benzene acetonitriles Chemical class 0.000 description 1
- DULCUDSUACXJJC-UHFFFAOYSA-N benzeneacetic acid ethyl ester Natural products CCOC(=O)CC1=CC=CC=C1 DULCUDSUACXJJC-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- JAMFGQBENKSWOF-UHFFFAOYSA-N bromo(methoxy)methane Chemical compound COCBr JAMFGQBENKSWOF-UHFFFAOYSA-N 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- OEXWAMFYSLBJBF-UHFFFAOYSA-N bromomethylsulfanylethane Chemical compound CCSCBr OEXWAMFYSLBJBF-UHFFFAOYSA-N 0.000 description 1
- 235000012215 calcium aluminium silicate Nutrition 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 229940125890 compound Ia Drugs 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 239000002837 defoliant Substances 0.000 description 1
- 239000002274 desiccant Substances 0.000 description 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 1
- 239000002283 diesel fuel Substances 0.000 description 1
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 1
- 229940008406 diethyl sulfate Drugs 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000011363 dried mixture Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000005837 enolization reaction Methods 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- RDSGFKPHDNUIAB-UHFFFAOYSA-N furan-2-ylsulfonylurea Chemical class NC(=O)NS(=O)(=O)C1=CC=CO1 RDSGFKPHDNUIAB-UHFFFAOYSA-N 0.000 description 1
- 230000008570 general process Effects 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 125000004995 haloalkylthio group Chemical group 0.000 description 1
- 125000005059 halophenyl group Chemical group 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 125000006303 iodophenyl group Chemical group 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- APPICNGHBHSANK-UHFFFAOYSA-N methyl 2-[5-amino-5-fluoro-4-oxo-3-[3-(trifluoromethyl)phenyl]thiophen-2-yl]butanoate Chemical compound FC1(SC(=C(C1=O)C1=CC(=CC=C1)C(F)(F)F)C(CC)C(=O)OC)N APPICNGHBHSANK-UHFFFAOYSA-N 0.000 description 1
- JVVNZGHLHZKGAG-UHFFFAOYSA-N methyl 2-[5-amino-5-methyl-4-oxo-3-[3-(trifluoromethyl)phenyl]thiophen-2-yl]butanoate Chemical compound CC1(SC(=C(C1=O)C1=CC(=CC=C1)C(F)(F)F)C(CC)C(=O)OC)N JVVNZGHLHZKGAG-UHFFFAOYSA-N 0.000 description 1
- ZZPFHMKULLDZHS-UHFFFAOYSA-N methyl 2-[5-amino-5-naphthalen-1-yl-4-oxo-3-[3-(trifluoromethyl)phenyl]thiophen-2-yl]butanoate Chemical compound CCC(C(=O)OC)C1=C(C(=O)C(N)(S1)C1=CC=CC2=CC=CC=C12)C1=CC(=CC=C1)C(F)(F)F ZZPFHMKULLDZHS-UHFFFAOYSA-N 0.000 description 1
- POAGKPCXURFDIJ-UHFFFAOYSA-N methyl 2-[[5-ethyl-4-oxo-3-[3-(trifluoromethyl)phenyl]thiophen-2-yl]amino]acetate Chemical compound O=C1C(CC)SC(NCC(=O)OC)=C1C1=CC=CC(C(F)(F)F)=C1 POAGKPCXURFDIJ-UHFFFAOYSA-N 0.000 description 1
- YDCHPLOFQATIDS-UHFFFAOYSA-N methyl 2-bromoacetate Chemical compound COC(=O)CBr YDCHPLOFQATIDS-UHFFFAOYSA-N 0.000 description 1
- UFQQDNMQADCHGH-UHFFFAOYSA-N methyl 2-bromobutanoate Chemical compound CCC(Br)C(=O)OC UFQQDNMQADCHGH-UHFFFAOYSA-N 0.000 description 1
- 125000006357 methylene carbonyl group Chemical group [H]C([H])([*:1])C([*:2])=O 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- 230000000877 morphologic effect Effects 0.000 description 1
- SUSQOBVLVYHIEX-UHFFFAOYSA-N o-phenylene-diaceto-nitrile Natural products N#CCC1=CC=CC=C1 SUSQOBVLVYHIEX-UHFFFAOYSA-N 0.000 description 1
- 238000005457 optimization Methods 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- KHIWWQKSHDUIBK-UHFFFAOYSA-N periodic acid Chemical compound OI(=O)(=O)=O KHIWWQKSHDUIBK-UHFFFAOYSA-N 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- BDAWXSQJJCIFIK-UHFFFAOYSA-N potassium methoxide Chemical compound [K+].[O-]C BDAWXSQJJCIFIK-UHFFFAOYSA-N 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000011550 stock solution Substances 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- KLPPUPBECAHKEF-UHFFFAOYSA-N thiophen-2-ylsulfonylurea Chemical class NC(=O)NS(=O)(=O)C1=CC=CS1 KLPPUPBECAHKEF-UHFFFAOYSA-N 0.000 description 1
- 150000003577 thiophenes Chemical class 0.000 description 1
- 238000013519 translation Methods 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 235000019731 tricalcium phosphate Nutrition 0.000 description 1
- 229940078499 tricalcium phosphate Drugs 0.000 description 1
- 229910000391 tricalcium phosphate Inorganic materials 0.000 description 1
- BJAARRARQJZURR-UHFFFAOYSA-N trimethylazanium;hydroxide Chemical compound O.CN(C)C BJAARRARQJZURR-UHFFFAOYSA-N 0.000 description 1
- 238000007738 vacuum evaporation Methods 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/46—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings substituted on the ring sulfur atom
- C07D333/48—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings substituted on the ring sulfur atom by oxygen atoms
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/02—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms
- A01N43/04—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms with one hetero atom
- A01N43/06—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms with one hetero atom five-membered rings
- A01N43/10—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms with one hetero atom five-membered rings with sulfur as the ring hetero atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/30—Hetero atoms other than halogen
- C07D333/36—Nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Dentistry (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Agronomy & Crop Science (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/623,805 US4596595A (en) | 1984-06-22 | 1984-06-22 | Herbicidal 5-amino-3-oxo-4-(substituted-phenyl)-2,3-dihydrothiophene and derivatives thereof |
| PCT/US1985/002004 WO1987002220A1 (en) | 1984-06-22 | 1985-10-11 | Herbicidal 5-amino-3-oxo-4-(substituted-phenyl)-2,3-dihydrothiophene and derivatives thereof |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| ATA908585A ATA908585A (de) | 1993-01-15 |
| AT396470B true AT396470B (de) | 1993-09-27 |
Family
ID=33030360
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT0908585A AT396470B (de) | 1984-06-22 | 1985-10-11 | Verfahren zur herstellung von neuen, herbizid wirksamen 5-amino-3-oxo-4-(substituiertes-phenyl)-2,3-dih drothiophenen und von deren derivaten, dieselben enthaltende mittel sowie deren verwendung |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4596595A (enExample) |
| JP (1) | JPS63501073A (enExample) |
| AT (1) | AT396470B (enExample) |
| AU (1) | AU593224B2 (enExample) |
| BR (1) | BR8507300A (enExample) |
| CH (1) | CH673651A5 (enExample) |
| DE (1) | DE3590848T1 (enExample) |
| FR (1) | FR2590253B1 (enExample) |
| GB (1) | GB2191191B (enExample) |
| NL (1) | NL8520343A (enExample) |
| WO (1) | WO1987002220A1 (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4978386A (en) * | 1985-06-11 | 1990-12-18 | Chevron Research Company | Herbicidal 2-(substituted-phenyl)-3-amino-2-cyclopentenone derivatives |
| DE3738963A1 (de) * | 1987-11-17 | 1989-05-24 | Bayer Ag | 3-aminopyrazolin-5-one |
| US5166346A (en) * | 1987-12-11 | 1992-11-24 | Hoechst Aktiengesellschaft | Process for the preparation of thiophene derivatives and also new dihydrothiophene 1-oxides |
| DE3804794A1 (de) * | 1988-02-16 | 1989-08-24 | Hoechst Ag | Verfahren zur herstellung von thiophenderivaten sowie neue dihydrothiophen-1-oxide |
| RU2013133873A (ru) | 2010-12-21 | 2015-01-27 | БАЙЕР КРОПСАЙЕНС ЭлПи | ШЕРОХОВАТЫЕ МУТАНТЫ Bacillus И СПОСОБЫ ИХ ПРИМЕНЕНИЯ ДЛЯ УСКОРЕНИЯ РОСТА РАСТЕНИЙ, УЛУЧШЕНИЯ ЗДОРОВЬЯ РАСТЕНИЙ И БОРЬБЫ С БОЛЕЗНЯМИ И ВРЕДИТЕЛЯМИ |
| BR112014005654A2 (pt) | 2011-09-12 | 2017-03-28 | Bayer Cropscience Lp | métodos para melhorar a saúde e promover o crescimento de uma planta e/ou de melhorar o amadurecimento da fruta |
| NZ799839A (en) | 2020-11-25 | 2024-12-20 | Deka Products Lp | Systems, methods, and apparatuses for producing and packaging fluids |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1521092A (en) * | 1974-08-28 | 1978-08-09 | Lilly Co Eli | 3-phenyl-5-substituted-4 (1h)-pyridones-(thiones) |
| GB2080289A (en) * | 1980-06-02 | 1982-02-03 | Fmc Corp | Herbicidal 3-isoxazolidinones and hydroxamic acid intermediates |
| US4441910A (en) * | 1981-03-24 | 1984-04-10 | E. I. Du Pont De Nemours And Company | Thiophene or furan herbicides |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US444910A (en) * | 1891-01-20 | Rail-tie | ||
| SU767105A1 (ru) * | 1978-12-12 | 1980-09-30 | Киевский Ордена Ленина Государственный Университет Им. Т.Г.Шевченко | Способ получени 2-амино-4/5н/-кетотиофенов |
| IL60158A (en) * | 1979-06-01 | 1986-04-29 | Chevron Res | Fungicidal 3-(n-acyl-n-arylamino)-and 3-(n-thionoacyl-n-aryl-amino)-gamma-butyrolactones and gamma-thiobutyrolactones |
-
1984
- 1984-06-22 US US06/623,805 patent/US4596595A/en not_active Expired - Fee Related
-
1985
- 1985-10-11 JP JP60504754A patent/JPS63501073A/ja active Pending
- 1985-10-11 BR BR8507300A patent/BR8507300A/pt not_active IP Right Cessation
- 1985-10-11 NL NL8520343A patent/NL8520343A/nl not_active Application Discontinuation
- 1985-10-11 WO PCT/US1985/002004 patent/WO1987002220A1/en not_active Ceased
- 1985-10-11 CH CH2274/87A patent/CH673651A5/de not_active IP Right Cessation
- 1985-10-11 DE DE19853590848 patent/DE3590848T1/de not_active Ceased
- 1985-10-11 AT AT0908585A patent/AT396470B/de not_active IP Right Cessation
- 1985-10-11 GB GB8709948A patent/GB2191191B/en not_active Expired
- 1985-10-11 AU AU48672/85A patent/AU593224B2/en not_active Ceased
- 1985-11-19 FR FR8517064A patent/FR2590253B1/fr not_active Expired
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1521092A (en) * | 1974-08-28 | 1978-08-09 | Lilly Co Eli | 3-phenyl-5-substituted-4 (1h)-pyridones-(thiones) |
| GB2080289A (en) * | 1980-06-02 | 1982-02-03 | Fmc Corp | Herbicidal 3-isoxazolidinones and hydroxamic acid intermediates |
| US4441910A (en) * | 1981-03-24 | 1984-04-10 | E. I. Du Pont De Nemours And Company | Thiophene or furan herbicides |
Also Published As
| Publication number | Publication date |
|---|---|
| ATA908585A (de) | 1993-01-15 |
| GB8709948D0 (en) | 1987-06-03 |
| NL8520343A (nl) | 1987-09-01 |
| DE3590848T1 (enExample) | 1987-12-10 |
| GB2191191B (en) | 1989-09-13 |
| GB2191191A (en) | 1987-12-09 |
| CH673651A5 (enExample) | 1990-03-30 |
| AU593224B2 (en) | 1990-02-08 |
| JPS63501073A (ja) | 1988-04-21 |
| FR2590253B1 (fr) | 1988-02-12 |
| BR8507300A (pt) | 1987-11-03 |
| AU4867285A (en) | 1987-05-05 |
| WO1987002220A1 (en) | 1987-04-23 |
| FR2590253A1 (fr) | 1987-05-22 |
| US4596595A (en) | 1986-06-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0010723B1 (de) | Imidazol-Kupferkomplexverbindungen, Verfahren zu ihrer Herstellung und diese enthaltende Fungizide | |
| AT396470B (de) | Verfahren zur herstellung von neuen, herbizid wirksamen 5-amino-3-oxo-4-(substituiertes-phenyl)-2,3-dih drothiophenen und von deren derivaten, dieselben enthaltende mittel sowie deren verwendung | |
| EP0097822A1 (de) | Aminomethyldioxolane als Schädlingsbekämpfungsmittel | |
| DD154520A5 (de) | Mittel zur bekaempfung von fungi und unerwuenschtem pflanzenwachstum | |
| DD147992A5 (de) | Fungizide mittel | |
| DE2854600A1 (de) | Substituierte cyanamide | |
| DE3902031A1 (de) | Substituierte azolylmethylcycloalkan-derivate, ihre herstellung und verwendung sowie diese enthaltende arzneimittel | |
| DE3422346C2 (enExample) | ||
| DE2948704A1 (de) | N-substituierte 2-methylnaphthylamide, verfahren zu ihrer herstellung und diese enthaltende fungizide | |
| DE69114014T2 (de) | 3,3-bis[alkylthio]-2-pyridylacrylsäurederivate als fungizide. | |
| EP0075840A2 (de) | Heterocyclische Phenyläther, Verfahren zu deren Herstellung und diese enthaltende herbizide Mittel | |
| EP0278352A2 (de) | Aminomethyltetrahydrofurane | |
| DE69013427T2 (de) | Glyoxyl-Cyclohexendione. | |
| EP0193065B1 (de) | Morpholinderivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Fungizide | |
| DE2259218A1 (de) | Phenylformamidine, verfahren zu ihrer herstellung und deren verwendung zur schaedlingsbekaempfung | |
| DE2918801A1 (de) | Carbinolether | |
| EP0065723A1 (de) | N-substituierte 2-Methylnaphthylamide, Verfahren zu ihrer Herstellung und ihre Verwendung zur Bekämpfung von Pilzen | |
| DE2101698A1 (de) | Substituierte m-Trifluormethylphenylharnstoffderivate | |
| DE69522452T2 (de) | Herbizide 1,2,4,6-thiatriazine | |
| DE3021834A1 (de) | Azolyl-4-nitro-2-trichlormethyl-benzolsulfone, ihre herstellung und verwendung | |
| EP0207389B1 (de) | Mittel zur Regelierung des Pflanzenwachstums | |
| EP0075167B1 (de) | N-(1-Alkenyl)-carbonsäureanilide, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide | |
| EP0275417A2 (de) | Trifluormethylsubstituierte Azole, Verfahren zu ihrer Herstellung und ihre Verwendung als Mittel mit herbizider Wirkung | |
| AT395507B (de) | Unkrautvernichtungsmittel | |
| DE3018716A1 (de) | 4-nitro-2-trichlormethylbenzolsulfensaeurederivate, verfahren zu ihrer herstellung, und diese enthaltende fungizide |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ELJ | Ceased due to non-payment of the annual fee |