NL8520343A - Herbicide 5-amino-3-oxo-4-(gesubstitueerd fenyl)-2,3-dihydrothiofeen en derivaten daarvan. - Google Patents
Herbicide 5-amino-3-oxo-4-(gesubstitueerd fenyl)-2,3-dihydrothiofeen en derivaten daarvan. Download PDFInfo
- Publication number
- NL8520343A NL8520343A NL8520343A NL8520343A NL8520343A NL 8520343 A NL8520343 A NL 8520343A NL 8520343 A NL8520343 A NL 8520343A NL 8520343 A NL8520343 A NL 8520343A NL 8520343 A NL8520343 A NL 8520343A
- Authority
- NL
- Netherlands
- Prior art keywords
- carbon atoms
- phenyl
- oxo
- compound
- methyl
- Prior art date
Links
- 230000008635 plant growth Effects 0.000 title claims description 10
- 230000001105 regulatory effect Effects 0.000 title claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 72
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 41
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 30
- 125000005843 halogen group Chemical group 0.000 claims abstract description 27
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 claims abstract description 19
- 125000001188 haloalkyl group Chemical group 0.000 claims abstract description 18
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 16
- 150000003839 salts Chemical class 0.000 claims abstract description 16
- 229910052740 iodine Inorganic materials 0.000 claims abstract description 14
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 13
- 125000003118 aryl group Chemical group 0.000 claims abstract description 13
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 claims abstract description 12
- 229910052794 bromium Inorganic materials 0.000 claims abstract description 12
- 125000002947 alkylene group Chemical group 0.000 claims abstract description 11
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 11
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims abstract description 8
- 125000000262 haloalkenyl group Chemical group 0.000 claims abstract description 6
- 125000004414 alkyl thio group Chemical group 0.000 claims abstract description 5
- 125000004429 atom Chemical group 0.000 claims abstract description 4
- 125000004995 haloalkylthio group Chemical group 0.000 claims abstract description 3
- -1 indene-1-yl Chemical group 0.000 claims description 280
- 150000001875 compounds Chemical class 0.000 claims description 155
- 125000004432 carbon atom Chemical group C* 0.000 claims description 71
- 238000000034 method Methods 0.000 claims description 68
- 239000000203 mixture Substances 0.000 claims description 62
- 229910052739 hydrogen Inorganic materials 0.000 claims description 52
- 239000001257 hydrogen Substances 0.000 claims description 52
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 36
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 29
- 230000002363 herbicidal effect Effects 0.000 claims description 23
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 18
- 239000000460 chlorine Substances 0.000 claims description 18
- 150000002431 hydrogen Chemical group 0.000 claims description 18
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 13
- 229910052736 halogen Inorganic materials 0.000 claims description 12
- 150000002367 halogens Chemical class 0.000 claims description 12
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 11
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 11
- 125000006350 alkyl thio alkyl group Chemical group 0.000 claims description 10
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 9
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 9
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 9
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 9
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 9
- 239000011630 iodine Substances 0.000 claims description 9
- 125000003107 substituted aryl group Chemical group 0.000 claims description 9
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 7
- 239000011737 fluorine Substances 0.000 claims description 7
- 229910052731 fluorine Inorganic materials 0.000 claims description 7
- 229910052757 nitrogen Inorganic materials 0.000 claims description 7
- 229920006395 saturated elastomer Polymers 0.000 claims description 7
- 239000002609 medium Substances 0.000 claims description 6
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 6
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 claims description 5
- 241000607479 Yersinia pestis Species 0.000 claims description 5
- 125000005078 alkoxycarbonylalkyl group Chemical group 0.000 claims description 5
- 239000001963 growth medium Substances 0.000 claims description 5
- 230000007773 growth pattern Effects 0.000 claims description 5
- 125000004438 haloalkoxy group Chemical group 0.000 claims description 5
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 claims description 5
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 4
- 230000001276 controlling effect Effects 0.000 claims description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 4
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 claims description 3
- 125000001246 bromo group Chemical group Br* 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 125000001153 fluoro group Chemical group F* 0.000 claims description 2
- 125000002346 iodo group Chemical group I* 0.000 claims description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims 1
- 230000008029 eradication Effects 0.000 claims 1
- 239000000575 pesticide Substances 0.000 claims 1
- OXBLVCZKDOZZOJ-UHFFFAOYSA-N 2,3-Dihydrothiophene Chemical compound C1CC=CS1 OXBLVCZKDOZZOJ-UHFFFAOYSA-N 0.000 abstract description 3
- 125000005037 alkyl phenyl group Chemical group 0.000 abstract description 2
- 125000003114 inden-1-yl group Chemical group [H]C1=C([H])C([H])(*)C2=C([H])C([H])=C([H])C([H])=C12 0.000 abstract 2
- JCXJVPUVTGWSNB-UHFFFAOYSA-N Nitrogen dioxide Chemical compound O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 abstract 1
- 125000000623 heterocyclic group Chemical group 0.000 abstract 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 30
- 238000006243 chemical reaction Methods 0.000 description 30
- 239000007858 starting material Substances 0.000 description 27
- 230000008569 process Effects 0.000 description 26
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 25
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 24
- 239000002585 base Substances 0.000 description 21
- 239000003960 organic solvent Substances 0.000 description 21
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 17
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 16
- MCQHSKFXMRIMJX-UHFFFAOYSA-N 2,3-dihydrothiophen-5-amine Chemical compound NC1=CCCS1 MCQHSKFXMRIMJX-UHFFFAOYSA-N 0.000 description 15
- 241000196324 Embryophyta Species 0.000 description 15
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical class CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- 239000003795 chemical substances by application Substances 0.000 description 15
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 14
- VWKNWLUNYMZECB-UHFFFAOYSA-N 5-methyl-2,3-dihydrothiophen-2-amine Chemical compound C1(SC(=CC1)C)N VWKNWLUNYMZECB-UHFFFAOYSA-N 0.000 description 12
- 239000000243 solution Substances 0.000 description 12
- 229910052783 alkali metal Inorganic materials 0.000 description 11
- 238000002360 preparation method Methods 0.000 description 11
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 11
- HTZCNXWZYVXIMZ-UHFFFAOYSA-M benzyl(triethyl)azanium;chloride Chemical compound [Cl-].CC[N+](CC)(CC)CC1=CC=CC=C1 HTZCNXWZYVXIMZ-UHFFFAOYSA-M 0.000 description 10
- 239000012071 phase Substances 0.000 description 10
- LVTJOONKWUXEFR-FZRMHRINSA-N protoneodioscin Natural products O(C[C@@H](CC[C@]1(O)[C@H](C)[C@@H]2[C@]3(C)[C@H]([C@H]4[C@@H]([C@]5(C)C(=CC4)C[C@@H](O[C@@H]4[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@@H](O)[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@H](CO)O4)CC5)CC3)C[C@@H]2O1)C)[C@H]1[C@H](O)[C@H](O)[C@H](O)[C@@H](CO)O1 LVTJOONKWUXEFR-FZRMHRINSA-N 0.000 description 10
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 10
- 238000012546 transfer Methods 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- ZLXOGETXENGOHE-UHFFFAOYSA-N n-methyl-2,3-dihydrothiophen-5-amine Chemical compound CNC1=CCCS1 ZLXOGETXENGOHE-UHFFFAOYSA-N 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 8
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 8
- 239000004009 herbicide Substances 0.000 description 8
- 238000012360 testing method Methods 0.000 description 8
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 description 7
- 229940126062 Compound A Drugs 0.000 description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 7
- RTYZCUMXOXNVSI-UHFFFAOYSA-N OOOOOOOOOOOOOOOOOO Chemical compound OOOOOOOOOOOOOOOOOO RTYZCUMXOXNVSI-UHFFFAOYSA-N 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N acetone Substances CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 7
- WEVYAHXRMPXWCK-UHFFFAOYSA-N acetonitrile Substances CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 7
- 239000007788 liquid Substances 0.000 description 7
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 7
- 235000019341 magnesium sulphate Nutrition 0.000 description 7
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- 231100000674 Phytotoxicity Toxicity 0.000 description 6
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 238000011065 in-situ storage Methods 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical group C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 5
- 239000002168 alkylating agent Substances 0.000 description 5
- 229940100198 alkylating agent Drugs 0.000 description 5
- 239000000969 carrier Substances 0.000 description 5
- 239000003921 oil Substances 0.000 description 5
- 230000003647 oxidation Effects 0.000 description 5
- 238000007254 oxidation reaction Methods 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- 125000001424 substituent group Chemical group 0.000 description 5
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical group [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 4
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 4
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical group BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 4
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 101150066742 TRI1 gene Proteins 0.000 description 4
- 230000006978 adaptation Effects 0.000 description 4
- 239000000443 aerosol Substances 0.000 description 4
- 238000005804 alkylation reaction Methods 0.000 description 4
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 4
- 150000001768 cations Chemical class 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- 230000000052 comparative effect Effects 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 235000013312 flour Nutrition 0.000 description 4
- 229910052744 lithium Chemical group 0.000 description 4
- 230000003287 optical effect Effects 0.000 description 4
- 239000007800 oxidant agent Substances 0.000 description 4
- 229910052700 potassium Inorganic materials 0.000 description 4
- 239000011591 potassium Substances 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 238000000926 separation method Methods 0.000 description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
- 235000017557 sodium bicarbonate Nutrition 0.000 description 4
- 239000012312 sodium hydride Substances 0.000 description 4
- 229910000104 sodium hydride Inorganic materials 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- 125000006275 3-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C([H])C(*)=C1[H] 0.000 description 3
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 3
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 3
- 125000006305 3-iodophenyl group Chemical group [H]C1=C([H])C(I)=C([H])C(*)=C1[H] 0.000 description 3
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 description 3
- RANMIORLMCIAPH-UHFFFAOYSA-N 3-oxo-4-phenyl-2-[3-(trifluoromethyl)phenyl]butanenitrile Chemical compound FC(F)(F)C1=CC=CC(C(C#N)C(=O)CC=2C=CC=CC=2)=C1 RANMIORLMCIAPH-UHFFFAOYSA-N 0.000 description 3
- JEFIPLGLKOWMOZ-UHFFFAOYSA-N 5-amino-2-phenyl-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound S1C(N)=C(C=2C=C(C=CC=2)C(F)(F)F)C(=O)C1C1=CC=CC=C1 JEFIPLGLKOWMOZ-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- 230000029936 alkylation Effects 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 239000012141 concentrate Substances 0.000 description 3
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- 239000012442 inert solvent Substances 0.000 description 3
- 230000001590 oxidative effect Effects 0.000 description 3
- 239000005648 plant growth regulator Substances 0.000 description 3
- RPDAUEIUDPHABB-UHFFFAOYSA-N potassium ethoxide Chemical compound [K+].CC[O-] RPDAUEIUDPHABB-UHFFFAOYSA-N 0.000 description 3
- NTTOTNSKUYCDAV-UHFFFAOYSA-N potassium hydride Chemical compound [KH] NTTOTNSKUYCDAV-UHFFFAOYSA-N 0.000 description 3
- 229910000105 potassium hydride Inorganic materials 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 3
- 239000002689 soil Substances 0.000 description 3
- 150000003457 sulfones Chemical class 0.000 description 3
- 150000003462 sulfoxides Chemical class 0.000 description 3
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- KVSKWDJMHWWVCI-UHFFFAOYSA-N 2-[3-(trifluoromethyl)phenyl]-2,3-dihydrothiophen-5-amine Chemical compound FC(C=1C=C(C=CC=1)C1SC(=CC1)N)(F)F KVSKWDJMHWWVCI-UHFFFAOYSA-N 0.000 description 2
- JOIYKSLWXLFGGR-UHFFFAOYSA-N 2-[3-(trifluoromethyl)phenyl]acetonitrile Chemical compound FC(F)(F)C1=CC=CC(CC#N)=C1 JOIYKSLWXLFGGR-UHFFFAOYSA-N 0.000 description 2
- 125000004847 2-fluorobenzyl group Chemical group [H]C1=C([H])C(F)=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 125000006494 2-trifluoromethyl benzyl group Chemical group [H]C1=C([H])C([H])=C(C(=C1[H])C([H])([H])*)C(F)(F)F 0.000 description 2
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 2
- MGPKTKXUWSVAMY-UHFFFAOYSA-N 3-oxo-4-phenylbutanenitrile Chemical compound N#CCC(=O)CC1=CC=CC=C1 MGPKTKXUWSVAMY-UHFFFAOYSA-N 0.000 description 2
- WDKSGEQEVSSGCX-UHFFFAOYSA-N 4-methyl-3-sulfanylidene-2-[3-(trifluoromethyl)phenyl]pentanenitrile Chemical compound CC(C)C(=S)C(C#N)C1=CC=CC(C(F)(F)F)=C1 WDKSGEQEVSSGCX-UHFFFAOYSA-N 0.000 description 2
- KPZJOYYFRNGJJJ-UHFFFAOYSA-N 5-amino-2-(1h-inden-1-yl)-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound O=C1C(C2C3=CC=CC=C3C=C2)SC(N)=C1C1=CC=CC(C(F)(F)F)=C1 KPZJOYYFRNGJJJ-UHFFFAOYSA-N 0.000 description 2
- JSXGNAOCHGEZAV-UHFFFAOYSA-N 5-amino-2-methyl-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound O=C1C(C)SC(N)=C1C1=CC=CC(C(F)(F)F)=C1 JSXGNAOCHGEZAV-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- 244000291564 Allium cepa Species 0.000 description 2
- 235000002732 Allium cepa var. cepa Nutrition 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical class N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- 241000209504 Poaceae Species 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 125000004946 alkenylalkyl group Chemical group 0.000 description 2
- 150000008051 alkyl sulfates Chemical class 0.000 description 2
- 230000002152 alkylating effect Effects 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 229940125890 compound Ia Drugs 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 150000008050 dialkyl sulfates Chemical class 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 239000012259 ether extract Substances 0.000 description 2
- 239000000417 fungicide Substances 0.000 description 2
- 238000007429 general method Methods 0.000 description 2
- 230000012010 growth Effects 0.000 description 2
- 125000005842 heteroatom Chemical group 0.000 description 2
- 239000002917 insecticide Substances 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- YNESATAKKCNGOF-UHFFFAOYSA-N lithium bis(trimethylsilyl)amide Chemical compound [Li+].C[Si](C)(C)[N-][Si](C)(C)C YNESATAKKCNGOF-UHFFFAOYSA-N 0.000 description 2
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 2
- 229910003002 lithium salt Inorganic materials 0.000 description 2
- 159000000002 lithium salts Chemical class 0.000 description 2
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 2
- ZZWPOYPWQTUZDY-UHFFFAOYSA-N methyl 2-aminobutanoate Chemical compound CCC(N)C(=O)OC ZZWPOYPWQTUZDY-UHFFFAOYSA-N 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- 239000002736 nonionic surfactant Substances 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 230000000885 phytotoxic effect Effects 0.000 description 2
- FEMRXDWBWXQOGV-UHFFFAOYSA-N potassium amide Chemical class [NH2-].[K+] FEMRXDWBWXQOGV-UHFFFAOYSA-N 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 235000011181 potassium carbonates Nutrition 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 239000002516 radical scavenger Substances 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 238000010898 silica gel chromatography Methods 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 239000012085 test solution Substances 0.000 description 2
- NHGXDBSUJJNIRV-UHFFFAOYSA-M tetrabutylammonium chloride Chemical compound [Cl-].CCCC[N+](CCCC)(CCCC)CCCC NHGXDBSUJJNIRV-UHFFFAOYSA-M 0.000 description 2
- 150000003577 thiophenes Chemical class 0.000 description 2
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 239000002023 wood Substances 0.000 description 2
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- JLIDRDJNLAWIKT-UHFFFAOYSA-N 1,2-dimethyl-3h-benzo[e]indole Chemical compound C1=CC=CC2=C(C(=C(C)N3)C)C3=CC=C21 JLIDRDJNLAWIKT-UHFFFAOYSA-N 0.000 description 1
- IBODDUNKEPPBKW-UHFFFAOYSA-N 1,5-dibromopentane Chemical compound BrCCCCCBr IBODDUNKEPPBKW-UHFFFAOYSA-N 0.000 description 1
- 125000004973 1-butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 1
- CZLWXIQQDQFBSF-UHFFFAOYSA-N 2-(1h-inden-1-ylmethylidene)-5-(methylamino)-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound O=C1C(=CC2C3=CC=CC=C3C=C2)SC(NC)=C1C1=CC=CC(C(F)(F)F)=C1 CZLWXIQQDQFBSF-UHFFFAOYSA-N 0.000 description 1
- NJZJGQORHDEABE-UHFFFAOYSA-N 2-(2,3-dinitrophenyl)-4-(3-iodophenyl)-5-(methylamino)thiophen-3-one Chemical compound S1C(NC)=C(C=2C=C(I)C=CC=2)C(=O)C1C1=CC=CC([N+]([O-])=O)=C1[N+]([O-])=O NJZJGQORHDEABE-UHFFFAOYSA-N 0.000 description 1
- RPFPHDMOHIQHEL-UHFFFAOYSA-N 2-(2,5-difluorophenyl)-4-naphthalen-1-ylbutanenitrile Chemical compound FC1=CC=C(F)C(C(CCC=2C3=CC=CC=C3C=CC=2)C#N)=C1 RPFPHDMOHIQHEL-UHFFFAOYSA-N 0.000 description 1
- QBMIWTNJRFKODT-UHFFFAOYSA-N 2-(3-bromophenyl)-3-oxo-4-phenylbutanenitrile Chemical compound BrC1=CC=CC(C(C#N)C(=O)CC=2C=CC=CC=2)=C1 QBMIWTNJRFKODT-UHFFFAOYSA-N 0.000 description 1
- QAGNTEAWHKLCED-UHFFFAOYSA-N 2-(3-bromophenyl)-4-(2-nitrophenyl)-3-oxobutanenitrile Chemical compound [O-][N+](=O)C1=CC=CC=C1CC(=O)C(C#N)C1=CC=CC(Br)=C1 QAGNTEAWHKLCED-UHFFFAOYSA-N 0.000 description 1
- MIWAJIVEYAKTAK-UHFFFAOYSA-N 2-(3-butoxyphenyl)-3-oxo-4-phenylbutanenitrile Chemical compound CCCCOC1=CC=CC(C(C#N)C(=O)CC=2C=CC=CC=2)=C1 MIWAJIVEYAKTAK-UHFFFAOYSA-N 0.000 description 1
- CLEYOINSVPNJSI-UHFFFAOYSA-N 2-(3-butylphenyl)-3-oxo-4-phenylbutanenitrile Chemical compound CCCCC1=CC=CC(C(C#N)C(=O)CC=2C=CC=CC=2)=C1 CLEYOINSVPNJSI-UHFFFAOYSA-N 0.000 description 1
- XOZROGGJWVGSTN-UHFFFAOYSA-N 2-(3-chloro-8-fluoronaphthalen-1-yl)-5-(methylamino)-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound O=C1C(C=2C3=C(F)C=CC=C3C=C(Cl)C=2)SC(NC)=C1C1=CC=CC(C(F)(F)F)=C1 XOZROGGJWVGSTN-UHFFFAOYSA-N 0.000 description 1
- UAKHTRMELDDDKO-UHFFFAOYSA-N 2-(3-chlorophenyl)-3-oxo-4-phenylbutanenitrile Chemical compound ClC1=CC=CC(C(C#N)C(=O)CC=2C=CC=CC=2)=C1 UAKHTRMELDDDKO-UHFFFAOYSA-N 0.000 description 1
- FUTNOWFGOQSEBM-UHFFFAOYSA-N 2-(3-ethoxynaphthalen-1-yl)-5-(methylamino)-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound C=12C=CC=CC2=CC(OCC)=CC=1C(C1=O)SC(NC)=C1C1=CC=CC(C(F)(F)F)=C1 FUTNOWFGOQSEBM-UHFFFAOYSA-N 0.000 description 1
- OIOSQWQSTQKNQF-UHFFFAOYSA-N 2-(3-fluorophenyl)-3-[8-(trifluoromethyl)naphthalen-1-yl]prop-2-enenitrile Chemical compound FC1=CC=CC(C(=CC=2C3=C(C=CC=C3C=CC=2)C(F)(F)F)C#N)=C1 OIOSQWQSTQKNQF-UHFFFAOYSA-N 0.000 description 1
- MRAJHINOMKWSLN-UHFFFAOYSA-N 2-(3-iodophenyl)-4-(3-nitrophenyl)-3-oxobutanenitrile Chemical compound [O-][N+](=O)C1=CC=CC(CC(=O)C(C#N)C=2C=C(I)C=CC=2)=C1 MRAJHINOMKWSLN-UHFFFAOYSA-N 0.000 description 1
- VSSUIVAKMZLGSE-UHFFFAOYSA-N 2-(3-iodophenyl)-5-(methylamino)-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound S1C(NC)=C(C=2C=C(C=CC=2)C(F)(F)F)C(=O)C1C1=CC=CC(I)=C1 VSSUIVAKMZLGSE-UHFFFAOYSA-N 0.000 description 1
- DOVOOWWCJXNZJI-UHFFFAOYSA-N 2-(3-methoxy-2-nitrophenyl)-5-(methylamino)-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound S1C(NC)=C(C=2C=C(C=CC=2)C(F)(F)F)C(=O)C1C1=CC=CC(OC)=C1[N+]([O-])=O DOVOOWWCJXNZJI-UHFFFAOYSA-N 0.000 description 1
- HTBCLHUDISJSJV-UHFFFAOYSA-N 2-(methoxymethylidene)-5-(methylamino)-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound O=C1C(=COC)SC(NC)=C1C1=CC=CC(C(F)(F)F)=C1 HTBCLHUDISJSJV-UHFFFAOYSA-N 0.000 description 1
- SQMQBTTWXFDQSU-UHFFFAOYSA-N 2-[(2-chloro-8-methylnaphthalen-1-yl)methylidene]-5-(methylamino)-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound O=C1C(=CC=2C3=C(C)C=CC=C3C=CC=2Cl)SC(NC)=C1C1=CC=CC(C(F)(F)F)=C1 SQMQBTTWXFDQSU-UHFFFAOYSA-N 0.000 description 1
- JZHWHZFFGLIJIE-UHFFFAOYSA-N 2-[(2-fluoro-1h-inden-1-yl)methylidene]-5-(methylamino)-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound O=C1C(=CC2C3=CC=CC=C3C=C2F)SC(NC)=C1C1=CC=CC(C(F)(F)F)=C1 JZHWHZFFGLIJIE-UHFFFAOYSA-N 0.000 description 1
- UYSQDBNNFBDQQR-UHFFFAOYSA-N 2-[2-bromo-3-(trifluoromethyl)phenyl]-3-oxo-4-phenylbutanenitrile Chemical compound FC(F)(F)C1=CC=CC(C(C#N)C(=O)CC=2C=CC=CC=2)=C1Br UYSQDBNNFBDQQR-UHFFFAOYSA-N 0.000 description 1
- ACUFPXHFAFONNR-UHFFFAOYSA-N 2-[2-fluoro-5-(trifluoromethyl)phenyl]-3-oxo-4-phenylbutanenitrile Chemical compound FC1=CC=C(C(F)(F)F)C=C1C(C#N)C(=O)CC1=CC=CC=C1 ACUFPXHFAFONNR-UHFFFAOYSA-N 0.000 description 1
- NFKKKNUHUFWYJC-UHFFFAOYSA-N 2-[2-iodo-5-(trifluoromethyl)phenyl]-3-oxo-4-phenylbutanenitrile Chemical compound FC(F)(F)C1=CC=C(I)C(C(C#N)C(=O)CC=2C=CC=CC=2)=C1 NFKKKNUHUFWYJC-UHFFFAOYSA-N 0.000 description 1
- FUJJTDDEWVCVJK-UHFFFAOYSA-N 2-[3,5-bis(trifluoromethyl)phenyl]-3-oxo-4-phenylbutanenitrile Chemical compound FC(F)(F)C1=CC(C(F)(F)F)=CC(C(C#N)C(=O)CC=2C=CC=CC=2)=C1 FUJJTDDEWVCVJK-UHFFFAOYSA-N 0.000 description 1
- ZFPQQDMAMUXMHO-UHFFFAOYSA-N 2-[3-(2-fluoropropylsulfanyl)phenyl]-3-oxo-4-phenylbutanenitrile Chemical compound CC(F)CSC1=CC=CC(C(C#N)C(=O)CC=2C=CC=CC=2)=C1 ZFPQQDMAMUXMHO-UHFFFAOYSA-N 0.000 description 1
- FUPOTBIMVMPZBT-UHFFFAOYSA-N 2-[3-(chloromethylsulfanyl)phenyl]-3-oxo-4-phenylbutanenitrile Chemical compound ClCSC1=CC=CC(C(C#N)C(=O)CC=2C=CC=CC=2)=C1 FUPOTBIMVMPZBT-UHFFFAOYSA-N 0.000 description 1
- UHLXCKPQXVLVEV-UHFFFAOYSA-N 2-[3-(difluoromethoxy)phenyl]-3-oxo-4-phenylbutanenitrile Chemical compound FC(F)OC1=CC=CC(C(C#N)C(=O)CC=2C=CC=CC=2)=C1 UHLXCKPQXVLVEV-UHFFFAOYSA-N 0.000 description 1
- GMKKBEDSANTWFC-UHFFFAOYSA-N 2-[3-[(2-methylpropan-2-yl)oxy]phenyl]-3-oxo-4-phenylbutanenitrile Chemical compound CC(C)(C)OC1=CC=CC(C(C#N)C(=O)CC=2C=CC=CC=2)=C1 GMKKBEDSANTWFC-UHFFFAOYSA-N 0.000 description 1
- GQOCBALMIXUXRZ-UHFFFAOYSA-N 2-[3-chloro-5-(trifluoromethyl)phenyl]-3-oxo-4-phenylbutanenitrile Chemical compound FC(F)(F)C1=CC(Cl)=CC(C(C#N)C(=O)CC=2C=CC=CC=2)=C1 GQOCBALMIXUXRZ-UHFFFAOYSA-N 0.000 description 1
- GNHQQZYDEKYTFF-UHFFFAOYSA-N 2-[4-chloro-3-(trifluoromethyl)phenyl]-3-oxo-4-phenylbutanenitrile Chemical compound C1=C(Cl)C(C(F)(F)F)=CC(C(C#N)C(=O)CC=2C=CC=CC=2)=C1 GNHQQZYDEKYTFF-UHFFFAOYSA-N 0.000 description 1
- VLTCMPZXRQCRHV-UHFFFAOYSA-N 2-[[3-(2,2-dichloroethyl)-2-fluorophenyl]methyl]-5-(methylamino)-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound S1C(NC)=C(C=2C=C(C=CC=2)C(F)(F)F)C(=O)C1CC1=CC=CC(CC(Cl)Cl)=C1F VLTCMPZXRQCRHV-UHFFFAOYSA-N 0.000 description 1
- YAQLSKVCTLCIIE-UHFFFAOYSA-M 2-bromobutanoate Chemical compound CCC(Br)C([O-])=O YAQLSKVCTLCIIE-UHFFFAOYSA-M 0.000 description 1
- 125000006276 2-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C(*)C([H])=C1[H] 0.000 description 1
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 1
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 1
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 1
- XQFMSVMENUDAMA-UHFFFAOYSA-N 2-phenyl-5-piperidin-1-yl-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound FC(F)(F)C1=CC=CC(C=2C(C(SC=2N2CCCCC2)C=2C=CC=CC=2)=O)=C1 XQFMSVMENUDAMA-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- NLSLEBJTMCMEAT-UHFFFAOYSA-N 3-(2,7-difluoronaphthalen-1-yl)-2-(3-iodo-4-methylphenyl)prop-2-enenitrile Chemical compound C1=C(I)C(C)=CC=C1C(C#N)=CC1=C(F)C=CC2=CC=C(F)C=C12 NLSLEBJTMCMEAT-UHFFFAOYSA-N 0.000 description 1
- SNONIUNIQWYRLI-UHFFFAOYSA-N 3-(3-iodophenyl)-2-[3-(trifluoromethyl)phenyl]propanenitrile Chemical compound FC(F)(F)C1=CC=CC(C(CC=2C=C(I)C=CC=2)C#N)=C1 SNONIUNIQWYRLI-UHFFFAOYSA-N 0.000 description 1
- 125000003852 3-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(Cl)=C1[H])C([H])([H])* 0.000 description 1
- XZVZAAGBNWNAJW-UHFFFAOYSA-N 3-naphthalen-2-yl-2-(3-propan-2-yloxyphenyl)prop-2-enenitrile Chemical compound CC(C)OC1=CC=CC(C(=CC=2C=C3C=CC=CC3=CC=2)C#N)=C1 XZVZAAGBNWNAJW-UHFFFAOYSA-N 0.000 description 1
- DXODZMAVYCAATB-UHFFFAOYSA-N 3-sulfanylidene-2-[3-(trifluoromethyl)phenyl]pentanenitrile Chemical compound CCC(=S)C(C#N)C1=CC=CC(C(F)(F)F)=C1 DXODZMAVYCAATB-UHFFFAOYSA-N 0.000 description 1
- XTWUUYMLBXXTQT-UHFFFAOYSA-N 4,4-dimethoxy-3-oxo-2-[3-(trifluoromethyl)phenyl]butanenitrile Chemical compound COC(OC)C(=O)C(C#N)C1=CC=CC(C(F)(F)F)=C1 XTWUUYMLBXXTQT-UHFFFAOYSA-N 0.000 description 1
- XBSXAZYPZDISKQ-UHFFFAOYSA-N 4-(2,3-dichlorophenyl)-3-oxo-2-[3-(trifluoromethyl)phenyl]butanenitrile Chemical compound FC(F)(F)C1=CC=CC(C(C#N)C(=O)CC=2C(=C(Cl)C=CC=2)Cl)=C1 XBSXAZYPZDISKQ-UHFFFAOYSA-N 0.000 description 1
- KNXMIEPYMMOKNF-UHFFFAOYSA-N 4-(2,3-dinitrophenyl)-2-(3-iodophenyl)-3-oxobutanenitrile Chemical compound [O-][N+](=O)C1=CC=CC(CC(=O)C(C#N)C=2C=C(I)C=CC=2)=C1[N+]([O-])=O KNXMIEPYMMOKNF-UHFFFAOYSA-N 0.000 description 1
- XWSMSEHETJJWGA-UHFFFAOYSA-N 4-(2,6-difluorophenyl)-3-oxo-2-[3-(trifluoromethyl)phenyl]butanenitrile Chemical compound FC1=CC=CC(F)=C1CC(=O)C(C#N)C1=CC=CC(C(F)(F)F)=C1 XWSMSEHETJJWGA-UHFFFAOYSA-N 0.000 description 1
- AUUBFGQFYJOWES-UHFFFAOYSA-N 4-(2-amino-4-oxothiophen-3-yl)benzenesulfonic acid Chemical compound O=C1CSC(N)=C1C1=CC=C(S(O)(=O)=O)C=C1 AUUBFGQFYJOWES-UHFFFAOYSA-N 0.000 description 1
- IUBYIBWYOYGWLO-UHFFFAOYSA-N 4-(3-bromophenyl)-5-(methylamino)-2-phenylthiophen-3-one Chemical compound S1C(NC)=C(C=2C=C(Br)C=CC=2)C(=O)C1C1=CC=CC=C1 IUBYIBWYOYGWLO-UHFFFAOYSA-N 0.000 description 1
- NWITYEUAPDWPPY-UHFFFAOYSA-N 4-(3-butylphenyl)-5-(methylamino)-2-phenylthiophen-3-one Chemical compound CCCCC1=CC=CC(C=2C(C(SC=2NC)C=2C=CC=CC=2)=O)=C1 NWITYEUAPDWPPY-UHFFFAOYSA-N 0.000 description 1
- IHYVFZFPXDREIJ-UHFFFAOYSA-N 4-(3-butylsulfanylphenyl)-2-[(3-chlorophenyl)methyl]-5-(methylamino)thiophen-3-one Chemical compound CCCCSC1=CC=CC(C=2C(C(CC=3C=C(Cl)C=CC=3)SC=2NC)=O)=C1 IHYVFZFPXDREIJ-UHFFFAOYSA-N 0.000 description 1
- PRSCGUQBGLBGNW-UHFFFAOYSA-N 4-(3-chlorophenyl)-5-(methylamino)-2-phenylthiophen-3-one Chemical compound S1C(NC)=C(C=2C=C(Cl)C=CC=2)C(=O)C1C1=CC=CC=C1 PRSCGUQBGLBGNW-UHFFFAOYSA-N 0.000 description 1
- KJAUSSMKAJCBMS-UHFFFAOYSA-N 4-(3-fluorophenyl)-5-(methylamino)-2-[8-(trifluoromethyl)naphthalen-1-yl]thiophen-3-one Chemical compound O=C1C(C=2C3=C(C=CC=C3C=CC=2)C(F)(F)F)SC(NC)=C1C1=CC=CC(F)=C1 KJAUSSMKAJCBMS-UHFFFAOYSA-N 0.000 description 1
- LPKSVTCWFGSCLU-UHFFFAOYSA-N 4-(3-methoxyphenyl)-5-(methylamino)-2-naphthalen-1-ylthiophen-3-one Chemical compound O=C1C(C=2C3=CC=CC=C3C=CC=2)SC(NC)=C1C1=CC=CC(OC)=C1 LPKSVTCWFGSCLU-UHFFFAOYSA-N 0.000 description 1
- GISVTSLYFNXATQ-UHFFFAOYSA-N 4-[2-bromo-3-(trifluoromethyl)phenyl]-5-(methylamino)-2-phenylthiophen-3-one Chemical compound S1C(NC)=C(C=2C(=C(C=CC=2)C(F)(F)F)Br)C(=O)C1C1=CC=CC=C1 GISVTSLYFNXATQ-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- MLKKWIRUTNHEQM-UHFFFAOYSA-N 4-methyl-4-phenyl-3-sulfanylidene-2-[3-(trifluoromethyl)phenyl]pentanenitrile Chemical compound C=1C=CC=CC=1C(C)(C)C(=S)C(C#N)C1=CC=CC(C(F)(F)F)=C1 MLKKWIRUTNHEQM-UHFFFAOYSA-N 0.000 description 1
- LGEKDPDGDJRDBT-UHFFFAOYSA-N 5-(ethylsulfanylmethylamino)-2-phenyl-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound S1C(NCSCC)=C(C=2C=C(C=CC=2)C(F)(F)F)C(=O)C1C1=CC=CC=C1 LGEKDPDGDJRDBT-UHFFFAOYSA-N 0.000 description 1
- WUAZKYKXWKUKDC-UHFFFAOYSA-N 5-(methylamino)-2-(1-phenylpropan-2-yl)-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound S1C(NC)=C(C=2C=C(C=CC=2)C(F)(F)F)C(=O)C1C(C)CC1=CC=CC=C1 WUAZKYKXWKUKDC-UHFFFAOYSA-N 0.000 description 1
- DEAZWELJCYFUNO-UHFFFAOYSA-N 5-(methylamino)-2-(2-methylnaphthalen-1-yl)-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound O=C1C(C=2C3=CC=CC=C3C=CC=2C)SC(NC)=C1C1=CC=CC(C(F)(F)F)=C1 DEAZWELJCYFUNO-UHFFFAOYSA-N 0.000 description 1
- PJKANMRNVDPXJP-UHFFFAOYSA-N 5-(methylamino)-2-(naphthalen-1-ylmethylidene)-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound O=C1C(=CC=2C3=CC=CC=C3C=CC=2)SC(NC)=C1C1=CC=CC(C(F)(F)F)=C1 PJKANMRNVDPXJP-UHFFFAOYSA-N 0.000 description 1
- NJITYNAYWTZEJF-UHFFFAOYSA-N 5-(methylamino)-2-(trifluoromethyl)-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound O=C1C(C(F)(F)F)SC(NC)=C1C1=CC=CC(C(F)(F)F)=C1 NJITYNAYWTZEJF-UHFFFAOYSA-N 0.000 description 1
- OCKGFTQIICXDQW-ZEQRLZLVSA-N 5-[(1r)-1-hydroxy-2-[4-[(2r)-2-hydroxy-2-(4-methyl-1-oxo-3h-2-benzofuran-5-yl)ethyl]piperazin-1-yl]ethyl]-4-methyl-3h-2-benzofuran-1-one Chemical compound C1=C2C(=O)OCC2=C(C)C([C@@H](O)CN2CCN(CC2)C[C@H](O)C2=CC=C3C(=O)OCC3=C2C)=C1 OCKGFTQIICXDQW-ZEQRLZLVSA-N 0.000 description 1
- YOLNGJDJHJRCLA-UHFFFAOYSA-N 5-amino-1-oxo-2-phenyl-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound O=S1C(N)=C(C=2C=C(C=CC=2)C(F)(F)F)C(=O)C1C1=CC=CC=C1 YOLNGJDJHJRCLA-UHFFFAOYSA-N 0.000 description 1
- VDGQSDJANRHFCL-UHFFFAOYSA-N 5-amino-2-(1h-inden-1-ylmethylidene)-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound O=C1C(=CC2C3=CC=CC=C3C=C2)SC(N)=C1C1=CC=CC(C(F)(F)F)=C1 VDGQSDJANRHFCL-UHFFFAOYSA-N 0.000 description 1
- GJZMODKBIVFUSJ-UHFFFAOYSA-N 5-amino-2-(2-fluorophenyl)-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound S1C(N)=C(C=2C=C(C=CC=2)C(F)(F)F)C(=O)C1C1=CC=CC=C1F GJZMODKBIVFUSJ-UHFFFAOYSA-N 0.000 description 1
- NWTIYLGQEABRHS-UHFFFAOYSA-N 5-amino-2-(2-nitrophenyl)-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound S1C(N)=C(C=2C=C(C=CC=2)C(F)(F)F)C(=O)C1C1=CC=CC=C1[N+]([O-])=O NWTIYLGQEABRHS-UHFFFAOYSA-N 0.000 description 1
- UNMITDSCLZZVKH-UHFFFAOYSA-N 5-amino-2-(3-chloro-8-fluoronaphthalen-1-yl)-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound ClC=1C=C(C2=C(C=CC=C2C=1)F)C1SC(=C(C1=O)C1=CC(=CC=C1)C(F)(F)F)N UNMITDSCLZZVKH-UHFFFAOYSA-N 0.000 description 1
- GDZQYABXZNHNIR-UHFFFAOYSA-N 5-amino-2-(3-nitronaphthalen-1-yl)-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound O=C1C(C=2C3=CC=CC=C3C=C(C=2)[N+]([O-])=O)SC(N)=C1C1=CC=CC(C(F)(F)F)=C1 GDZQYABXZNHNIR-UHFFFAOYSA-N 0.000 description 1
- LTMCZRGSEBGBAN-UHFFFAOYSA-N 5-amino-2-[(2-fluoro-1h-inden-1-yl)methylidene]-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound O=C1C(=CC2C3=CC=CC=C3C=C2F)SC(N)=C1C1=CC=CC(C(F)(F)F)=C1 LTMCZRGSEBGBAN-UHFFFAOYSA-N 0.000 description 1
- XDYGDYIHUGYHEA-UHFFFAOYSA-N 5-amino-2-[(2-fluoronaphthalen-1-yl)methylidene]-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound O=C1C(=CC=2C3=CC=CC=C3C=CC=2F)SC(N)=C1C1=CC=CC(C(F)(F)F)=C1 XDYGDYIHUGYHEA-UHFFFAOYSA-N 0.000 description 1
- KLXFODRALACFNG-UHFFFAOYSA-N 5-amino-2-[(3-butylnaphthalen-1-yl)methylidene]-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound C=12C=CC=CC2=CC(CCCC)=CC=1C=C(C1=O)SC(N)=C1C1=CC=CC(C(F)(F)F)=C1 KLXFODRALACFNG-UHFFFAOYSA-N 0.000 description 1
- JMJZKDDXERMUPP-UHFFFAOYSA-N 5-amino-2-butyl-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound O=C1C(CCCC)SC(N)=C1C1=CC=CC(C(F)(F)F)=C1 JMJZKDDXERMUPP-UHFFFAOYSA-N 0.000 description 1
- LASAWHLZQUAEMO-UHFFFAOYSA-N 5-amino-2-ethyl-4-[3-(trifluoromethyl)phenyl]thiophen-3-one Chemical compound O=C1C(CC)SC(N)=C1C1=CC=CC(C(F)(F)F)=C1 LASAWHLZQUAEMO-UHFFFAOYSA-N 0.000 description 1
- JAWIRWJIZMUYRD-UHFFFAOYSA-N 5-amino-2-phenyl-4-[3-(trifluoromethylsulfanyl)phenyl]thiophen-3-one Chemical compound S1C(N)=C(C=2C=C(SC(F)(F)F)C=CC=2)C(=O)C1C1=CC=CC=C1 JAWIRWJIZMUYRD-UHFFFAOYSA-N 0.000 description 1
- NFVGBQOPLJCMBN-UHFFFAOYSA-N 5-amino-4-(2-chloro-3-propylphenyl)-2-(6-nitronaphthalen-1-yl)thiophen-3-one Chemical compound CCCC1=CC=CC(C=2C(C(SC=2N)C=2C3=CC=C(C=C3C=CC=2)[N+]([O-])=O)=O)=C1Cl NFVGBQOPLJCMBN-UHFFFAOYSA-N 0.000 description 1
- RKBSHGZQXAVMHG-UHFFFAOYSA-N 5-amino-4-(2-chlorophenyl)thiophen-3-one Chemical compound O=C1CSC(N)=C1C1=CC=CC=C1Cl RKBSHGZQXAVMHG-UHFFFAOYSA-N 0.000 description 1
- YXRKZNGYPHIZNK-UHFFFAOYSA-N 5-amino-4-(2-fluorophenyl)thiophen-3-one Chemical compound O=C1CSC(N)=C1C1=CC=CC=C1F YXRKZNGYPHIZNK-UHFFFAOYSA-N 0.000 description 1
- ZGPGTLROADJMBV-UHFFFAOYSA-N 5-amino-4-(3-bromophenyl)-2-(2-nitrophenyl)thiophen-3-one Chemical compound S1C(N)=C(C=2C=C(Br)C=CC=2)C(=O)C1C1=CC=CC=C1[N+]([O-])=O ZGPGTLROADJMBV-UHFFFAOYSA-N 0.000 description 1
- HSNGPSQNVXEWRH-UHFFFAOYSA-N 5-amino-4-(3-butoxyphenyl)-2-phenylthiophen-3-one Chemical compound CCCCOC1=CC=CC(C=2C(C(SC=2N)C=2C=CC=CC=2)=O)=C1 HSNGPSQNVXEWRH-UHFFFAOYSA-N 0.000 description 1
- TZACGNVUMYAOLS-UHFFFAOYSA-N 5-amino-4-(3-butylphenyl)-2-phenylthiophen-3-one Chemical compound CCCCC1=CC=CC(C=2C(C(SC=2N)C=2C=CC=CC=2)=O)=C1 TZACGNVUMYAOLS-UHFFFAOYSA-N 0.000 description 1
- UJYXXFFMNRBQMH-UHFFFAOYSA-N 5-amino-4-(3-iodophenyl)-2-(3-nitrophenyl)thiophen-3-one Chemical compound S1C(N)=C(C=2C=C(I)C=CC=2)C(=O)C1C1=CC=CC([N+]([O-])=O)=C1 UJYXXFFMNRBQMH-UHFFFAOYSA-N 0.000 description 1
- RDEBMPYRCZZJLL-UHFFFAOYSA-N 5-amino-4-[2-bromo-3-(trifluoromethyl)phenyl]-2-phenylthiophen-3-one Chemical compound S1C(N)=C(C=2C(=C(C=CC=2)C(F)(F)F)Br)C(=O)C1C1=CC=CC=C1 RDEBMPYRCZZJLL-UHFFFAOYSA-N 0.000 description 1
- YJVKLIKASOLQMM-UHFFFAOYSA-N 5-amino-4-[3-(4-fluorobutyl)phenyl]-2-methylthiophen-3-one Chemical compound O=C1C(C)SC(N)=C1C1=CC=CC(CCCCF)=C1 YJVKLIKASOLQMM-UHFFFAOYSA-N 0.000 description 1
- VCJOLFGHQHJXKE-UHFFFAOYSA-N 5-amino-4-[3-(difluoromethoxy)phenyl]-2-ethylthiophen-3-one Chemical compound O=C1C(CC)SC(N)=C1C1=CC=CC(OC(F)F)=C1 VCJOLFGHQHJXKE-UHFFFAOYSA-N 0.000 description 1
- KNYVKHOJYVFNFV-UHFFFAOYSA-N 5-amino-4-[3-(fluoromethylsulfanyl)phenyl]-2-hexylthiophen-3-one Chemical compound O=C1C(CCCCCC)SC(N)=C1C1=CC=CC(SCF)=C1 KNYVKHOJYVFNFV-UHFFFAOYSA-N 0.000 description 1
- TYOOLGQMVOZEMU-UHFFFAOYSA-N 5-amino-4-[4-bromo-3-(trifluoromethyl)phenyl]-2-(trifluoromethyl)thiophen-3-one Chemical compound O=C1C(C(F)(F)F)SC(N)=C1C1=CC=C(Br)C(C(F)(F)F)=C1 TYOOLGQMVOZEMU-UHFFFAOYSA-N 0.000 description 1
- NCTGXCULXMEVHC-UHFFFAOYSA-N 5-amino-4-phenylthiophen-3-one Chemical compound O=C1CSC(N)=C1C1=CC=CC=C1 NCTGXCULXMEVHC-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 101100244083 Arabidopsis thaliana PKL gene Proteins 0.000 description 1
- 235000007320 Avena fatua Nutrition 0.000 description 1
- 244000075850 Avena orientalis Species 0.000 description 1
- AUDOKEXTBDXCSD-UHFFFAOYSA-N CNC1=C(C(=O)C(=CC2=CC=CC3=C2C=C(C=C3)C(F)(F)F)S1)C4=CC(=CC=C4)C(F)(F)F Chemical compound CNC1=C(C(=O)C(=CC2=CC=CC3=C2C=C(C=C3)C(F)(F)F)S1)C4=CC(=CC=C4)C(F)(F)F AUDOKEXTBDXCSD-UHFFFAOYSA-N 0.000 description 1
- 101100328884 Caenorhabditis elegans sqt-3 gene Proteins 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- 240000007049 Juglans regia Species 0.000 description 1
- 235000009496 Juglans regia Nutrition 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- JLNTWVDSQRNWFU-UHFFFAOYSA-N OOOOOOO Chemical compound OOOOOOO JLNTWVDSQRNWFU-UHFFFAOYSA-N 0.000 description 1
- 244000236458 Panicum colonum Species 0.000 description 1
- 235000015225 Panicum colonum Nutrition 0.000 description 1
- 235000008331 Pinus X rigitaeda Nutrition 0.000 description 1
- 235000011613 Pinus brutia Nutrition 0.000 description 1
- 241000018646 Pinus brutia Species 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 101150046432 Tril gene Proteins 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 244000098338 Triticum aestivum Species 0.000 description 1
- 235000005373 Uvularia sessilifolia Nutrition 0.000 description 1
- KOOADCGQJDGAGA-UHFFFAOYSA-N [amino(dimethyl)silyl]methane Chemical compound C[Si](C)(C)N KOOADCGQJDGAGA-UHFFFAOYSA-N 0.000 description 1
- IPBVNPXQWQGGJP-UHFFFAOYSA-N acetic acid phenyl ester Natural products CC(=O)OC1=CC=CC=C1 IPBVNPXQWQGGJP-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000001351 alkyl iodides Chemical class 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 239000012752 auxiliary agent Substances 0.000 description 1
- CREXVNNSNOKDHW-UHFFFAOYSA-N azaniumylideneazanide Chemical group N[N] CREXVNNSNOKDHW-UHFFFAOYSA-N 0.000 description 1
- 150000007962 benzene acetonitriles Chemical group 0.000 description 1
- DULCUDSUACXJJC-UHFFFAOYSA-N benzeneacetic acid ethyl ester Natural products CCOC(=O)CC1=CC=CC=C1 DULCUDSUACXJJC-UHFFFAOYSA-N 0.000 description 1
- NDKBVBUGCNGSJJ-UHFFFAOYSA-M benzyltrimethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)CC1=CC=CC=C1 NDKBVBUGCNGSJJ-UHFFFAOYSA-M 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- JAMFGQBENKSWOF-UHFFFAOYSA-N bromo(methoxy)methane Chemical compound COCBr JAMFGQBENKSWOF-UHFFFAOYSA-N 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- OEXWAMFYSLBJBF-UHFFFAOYSA-N bromomethylsulfanylethane Chemical compound CCSCBr OEXWAMFYSLBJBF-UHFFFAOYSA-N 0.000 description 1
- 239000000404 calcium aluminium silicate Substances 0.000 description 1
- 235000012215 calcium aluminium silicate Nutrition 0.000 description 1
- WNCYAPRTYDMSFP-UHFFFAOYSA-N calcium aluminosilicate Chemical compound [Al+3].[Al+3].[Ca+2].[O-][Si]([O-])=O.[O-][Si]([O-])=O.[O-][Si]([O-])=O.[O-][Si]([O-])=O WNCYAPRTYDMSFP-UHFFFAOYSA-N 0.000 description 1
- 229940078583 calcium aluminosilicate Drugs 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000007810 chemical reaction solvent Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 239000002837 defoliant Substances 0.000 description 1
- 239000002274 desiccant Substances 0.000 description 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 1
- 239000002283 diesel fuel Substances 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000011363 dried mixture Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000005837 enolization reaction Methods 0.000 description 1
- 125000001207 fluorophenyl group Chemical group 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 239000000295 fuel oil Substances 0.000 description 1
- 150000002240 furans Chemical class 0.000 description 1
- 230000008570 general process Effects 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 125000005059 halophenyl group Chemical group 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- AHNJTQYTRPXLLG-UHFFFAOYSA-N lithium;diethylazanide Chemical compound [Li+].CC[N-]CC AHNJTQYTRPXLLG-UHFFFAOYSA-N 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- CJCCWKFFYKUBPL-UHFFFAOYSA-N methyl 2-[[5-(1h-inden-1-yl)-4-oxo-3-[3-(trifluoromethyl)phenyl]thiophen-2-yl]amino]butanoate Chemical compound O=C1C(C2C3=CC=CC=C3C=C2)SC(NC(CC)C(=O)OC)=C1C1=CC=CC(C(F)(F)F)=C1 CJCCWKFFYKUBPL-UHFFFAOYSA-N 0.000 description 1
- YDCHPLOFQATIDS-UHFFFAOYSA-N methyl 2-bromoacetate Chemical compound COC(=O)CBr YDCHPLOFQATIDS-UHFFFAOYSA-N 0.000 description 1
- 125000006357 methylene carbonyl group Chemical group [H]C([H])([*:1])C([*:2])=O 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- 230000000877 morphologic effect Effects 0.000 description 1
- NRILCYLRULVXEL-UHFFFAOYSA-N n,n-dimethyl-2,4-diphenyl-2,3-dihydrofuran-5-amine Chemical compound O1C(N(C)C)=C(C=2C=CC=CC=2)CC1C1=CC=CC=C1 NRILCYLRULVXEL-UHFFFAOYSA-N 0.000 description 1
- IUSOXUFUXZORBF-UHFFFAOYSA-N n,n-dioctyloctan-1-amine;hydrochloride Chemical compound [Cl-].CCCCCCCC[NH+](CCCCCCCC)CCCCCCCC IUSOXUFUXZORBF-UHFFFAOYSA-N 0.000 description 1
- SUSQOBVLVYHIEX-UHFFFAOYSA-N o-phenylene-diaceto-nitrile Natural products N#CCC1=CC=CC=C1 SUSQOBVLVYHIEX-UHFFFAOYSA-N 0.000 description 1
- 238000005457 optimization Methods 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 229940049953 phenylacetate Drugs 0.000 description 1
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical class OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 231100000208 phytotoxic Toxicity 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- BYTCDABWEGFPLT-UHFFFAOYSA-L potassium;sodium;dihydroxide Chemical compound [OH-].[OH-].[Na+].[K+] BYTCDABWEGFPLT-UHFFFAOYSA-L 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- WHMDPDGBKYUEMW-UHFFFAOYSA-N pyridine-2-thiol Chemical class SC1=CC=CC=N1 WHMDPDGBKYUEMW-UHFFFAOYSA-N 0.000 description 1
- 229910052903 pyrophyllite Inorganic materials 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- XPSQRFGOPLDGPO-UHFFFAOYSA-N sodium;dimethylazanide Chemical compound [Na+].C[N-]C XPSQRFGOPLDGPO-UHFFFAOYSA-N 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000011550 stock solution Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 229940078499 tricalcium phosphate Drugs 0.000 description 1
- 229910000391 tricalcium phosphate Inorganic materials 0.000 description 1
- 235000019731 tricalcium phosphate Nutrition 0.000 description 1
- 229940086542 triethylamine Drugs 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 235000020234 walnut Nutrition 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/46—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings substituted on the ring sulfur atom
- C07D333/48—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings substituted on the ring sulfur atom by oxygen atoms
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/02—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms
- A01N43/04—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms with one hetero atom
- A01N43/06—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms with one hetero atom five-membered rings
- A01N43/10—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms with one hetero atom five-membered rings with sulfur as the ring hetero atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/30—Hetero atoms other than halogen
- C07D333/36—Nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Dentistry (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Agronomy & Crop Science (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/623,805 US4596595A (en) | 1984-06-22 | 1984-06-22 | Herbicidal 5-amino-3-oxo-4-(substituted-phenyl)-2,3-dihydrothiophene and derivatives thereof |
| US62380584 | 1984-06-22 | ||
| PCT/US1985/002004 WO1987002220A1 (en) | 1984-06-22 | 1985-10-11 | Herbicidal 5-amino-3-oxo-4-(substituted-phenyl)-2,3-dihydrothiophene and derivatives thereof |
| US8502004 | 1985-10-11 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NL8520343A true NL8520343A (nl) | 1987-09-01 |
Family
ID=33030360
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NL8520343A NL8520343A (nl) | 1984-06-22 | 1985-10-11 | Herbicide 5-amino-3-oxo-4-(gesubstitueerd fenyl)-2,3-dihydrothiofeen en derivaten daarvan. |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4596595A (enExample) |
| JP (1) | JPS63501073A (enExample) |
| AT (1) | AT396470B (enExample) |
| AU (1) | AU593224B2 (enExample) |
| BR (1) | BR8507300A (enExample) |
| CH (1) | CH673651A5 (enExample) |
| DE (1) | DE3590848T1 (enExample) |
| FR (1) | FR2590253B1 (enExample) |
| GB (1) | GB2191191B (enExample) |
| NL (1) | NL8520343A (enExample) |
| WO (1) | WO1987002220A1 (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4978386A (en) * | 1985-06-11 | 1990-12-18 | Chevron Research Company | Herbicidal 2-(substituted-phenyl)-3-amino-2-cyclopentenone derivatives |
| DE3738963A1 (de) * | 1987-11-17 | 1989-05-24 | Bayer Ag | 3-aminopyrazolin-5-one |
| DE3804794A1 (de) * | 1988-02-16 | 1989-08-24 | Hoechst Ag | Verfahren zur herstellung von thiophenderivaten sowie neue dihydrothiophen-1-oxide |
| US5166346A (en) * | 1987-12-11 | 1992-11-24 | Hoechst Aktiengesellschaft | Process for the preparation of thiophene derivatives and also new dihydrothiophene 1-oxides |
| EP2654433B1 (en) | 2010-12-21 | 2017-08-30 | Bayer Cropscience LP | Sandpaper mutants of bacillus and methods of their use to enhance plant growth, promote plant health and control diseases and pests |
| MX2014002890A (es) | 2011-09-12 | 2015-01-19 | Bayer Cropscience Lp | Metodo para mejorar la salud y/o promover el crecimiento de una planta y/o mejorar la maduracion de frutos. |
| EP4600175A3 (en) | 2020-11-25 | 2025-12-31 | DEKA Products Limited Partnership | SYSTEMS, PROCESSES AND APPARATUS FOR THE PRODUCTION AND PACKAGING OF FLUIDS |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US444910A (en) * | 1891-01-20 | Rail-tie | ||
| NZ178426A (en) * | 1974-08-28 | 1978-06-20 | Lilly Co Eli | 3-phenyl-1-substituted-4(1h)-pyridones or-pyridine-thionesand herbicidal compositions |
| SU767105A1 (ru) * | 1978-12-12 | 1980-09-30 | Киевский Ордена Ленина Государственный Университет Им. Т.Г.Шевченко | Способ получени 2-амино-4/5н/-кетотиофенов |
| IL60158A (en) * | 1979-06-01 | 1986-04-29 | Chevron Res | Fungicidal 3-(n-acyl-n-arylamino)-and 3-(n-thionoacyl-n-aryl-amino)-gamma-butyrolactones and gamma-thiobutyrolactones |
| US4405357A (en) * | 1980-06-02 | 1983-09-20 | Fmc Corporation | Herbicidal 3-isoxazolidinones and hydroxamic acids |
| US4441910A (en) * | 1981-03-24 | 1984-04-10 | E. I. Du Pont De Nemours And Company | Thiophene or furan herbicides |
-
1984
- 1984-06-22 US US06/623,805 patent/US4596595A/en not_active Expired - Fee Related
-
1985
- 1985-10-11 WO PCT/US1985/002004 patent/WO1987002220A1/en not_active Ceased
- 1985-10-11 BR BR8507300A patent/BR8507300A/pt not_active IP Right Cessation
- 1985-10-11 CH CH2274/87A patent/CH673651A5/de not_active IP Right Cessation
- 1985-10-11 NL NL8520343A patent/NL8520343A/nl not_active Application Discontinuation
- 1985-10-11 GB GB8709948A patent/GB2191191B/en not_active Expired
- 1985-10-11 DE DE19853590848 patent/DE3590848T1/de not_active Ceased
- 1985-10-11 AT AT0908585A patent/AT396470B/de not_active IP Right Cessation
- 1985-10-11 AU AU48672/85A patent/AU593224B2/en not_active Ceased
- 1985-10-11 JP JP60504754A patent/JPS63501073A/ja active Pending
- 1985-11-19 FR FR8517064A patent/FR2590253B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| WO1987002220A1 (en) | 1987-04-23 |
| GB8709948D0 (en) | 1987-06-03 |
| CH673651A5 (enExample) | 1990-03-30 |
| GB2191191A (en) | 1987-12-09 |
| DE3590848T1 (enExample) | 1987-12-10 |
| JPS63501073A (ja) | 1988-04-21 |
| ATA908585A (de) | 1993-01-15 |
| FR2590253B1 (fr) | 1988-02-12 |
| FR2590253A1 (fr) | 1987-05-22 |
| AT396470B (de) | 1993-09-27 |
| AU593224B2 (en) | 1990-02-08 |
| BR8507300A (pt) | 1987-11-03 |
| US4596595A (en) | 1986-06-24 |
| GB2191191B (en) | 1989-09-13 |
| AU4867285A (en) | 1987-05-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4913721A (en) | Fungicides | |
| KR910000247B1 (ko) | 살충성 폴리할로알켄 유도체 | |
| EP0438209B1 (en) | Uracil derivatives and pesticides containing the same as active ingredient | |
| RU2140739C1 (ru) | Способ подавления роста нежелательной растительности, замещенные гетероциклами пиридины, способы их получения и гербицидная композиция | |
| AU2006278950B2 (en) | Insecticidal 3-acylaminobenzanilides | |
| EP1178038A1 (en) | Fungicidal phenylamidine derivatives | |
| NL8700976A (nl) | Pyrazoolderivaten, werkwijze voor het bereiden ervan alsmede voor toepassing in de land- en tuinbouw geschikte fungicide preparaten, die deze verbindingen bevatten. | |
| EP0455300B1 (en) | Barbituric acid derivatives having insecticidal activity | |
| WO2000029398A1 (en) | Isothiazolecarboxylic acid derivatives | |
| US4432786A (en) | Thienylmethoxyiminoalkyl cyclohexanedione herbicides | |
| NL193833C (nl) | 5-Amino-3-oxo-4(gesubstitueerd fenyl)-2,3-dihydrofuranverbindingen met herbicide werking en herbicide preparaat dat deze verbindingen bevat. | |
| AU593224B2 (en) | 4-phenyl-3-oxo-2,3-dihydrothiophene derivatives and their useas herbicides | |
| CN113387942B (zh) | 一种吡唑羧酸酯类化合物及其应用 | |
| EP0234622A1 (en) | New thio compounds having fungicidal activity | |
| US5026418A (en) | Pyrimidine derivatives | |
| SK282788B6 (sk) | Spôsob ničenia hmyzích a roztočových škodcov a spôsob ochrany rastlín pred týmito škodcami, derivát N-aryltiohydrazónu, spôsob jeho prípravy a prostriedok na jeho báze | |
| US5814629A (en) | Microbicides | |
| US4606756A (en) | Herbicidal 2-(nitrogen heterocycle)5-amino-3-oxo-4-(substituted-phenyl)-2,3-dihydrofurans | |
| US5229393A (en) | Fungicidal alpha substituted acrylates | |
| KR930007422B1 (ko) | 제초성 2-(치환된-페닐)-3-아미노-2-사이클로펜테논 유도체의 제조방법 | |
| CN114787138A (zh) | 一种含烯的酰胺类化合物及其应用 | |
| US4643762A (en) | Herbicidal 5-amino-3-oxo-4-(3-substituted-phenyl)-4-pyrroline and derivatives thereof | |
| US4029646A (en) | Benzyl N,N-hexamethylenethiolcarbamate compounds and herbicidal compositions | |
| CZ28896A3 (en) | £1,2,4|thiazoles, process of their preparation, herbicidal agent based thereon and method of suppressing growth of plants | |
| CA1280752C (en) | Herbicidal 5-amino-3-oxo-4-substituted-phenyl)-2,3- dihydrothiophene and derivatives thereof |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| DNT | Communications of changes of names of applicants whose applications have been laid open to public inspection |
Free format text: CHEVRON RESEARCH AND TECHNOLOGY COMPANY |
|
| BA | A request for search or an international-type search has been filed | ||
| BB | A search report has been drawn up | ||
| BC | A request for examination has been filed | ||
| BV | The patent application has lapsed |