AP799A - Substituted (sulfinic acid, sulfonic acid, sulfonylamino or sulfinylamino) N-[(aminoiminomethyl) phenylalkyl]-azaheterocyclylamide compounds. - Google Patents
Substituted (sulfinic acid, sulfonic acid, sulfonylamino or sulfinylamino) N-[(aminoiminomethyl) phenylalkyl]-azaheterocyclylamide compounds. Download PDFInfo
- Publication number
- AP799A AP799A APAP/P/1997/001144A AP9701144A AP799A AP 799 A AP799 A AP 799A AP 9701144 A AP9701144 A AP 9701144A AP 799 A AP799 A AP 799A
- Authority
- AP
- ARIPO
- Prior art keywords
- oxopyrrolidin
- aminoiminomethyl
- benzyl
- trifiuoroacetate
- amide
- Prior art date
Links
- -1 sulfinylamino Chemical group 0.000 title description 66
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 title description 2
- BUUPQKDIAURBJP-UHFFFAOYSA-N sulfinic acid Chemical compound OS=O BUUPQKDIAURBJP-UHFFFAOYSA-N 0.000 title description 2
- 125000003884 phenylalkyl group Chemical group 0.000 title 1
- 125000006296 sulfonyl amino group Chemical group [H]N(*)S(*)(=O)=O 0.000 title 1
- 150000001875 compounds Chemical class 0.000 abstract description 37
- 108010074860 Factor Xa Proteins 0.000 abstract description 12
- 230000000694 effects Effects 0.000 abstract description 5
- 239000003112 inhibitor Substances 0.000 abstract description 5
- 238000011282 treatment Methods 0.000 abstract description 3
- 230000001668 ameliorated effect Effects 0.000 abstract description 2
- 239000000203 mixture Substances 0.000 abstract description 2
- 239000008194 pharmaceutical composition Substances 0.000 abstract description 2
- 230000000144 pharmacologic effect Effects 0.000 abstract description 2
- 230000004962 physiological condition Effects 0.000 abstract 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 52
- 125000000217 alkyl group Chemical group 0.000 description 35
- 229910052739 hydrogen Inorganic materials 0.000 description 25
- 239000001257 hydrogen Substances 0.000 description 25
- 125000003710 aryl alkyl group Chemical group 0.000 description 20
- 150000002431 hydrogen Chemical group 0.000 description 20
- 150000001408 amides Chemical class 0.000 description 19
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 17
- 125000001072 heteroaryl group Chemical group 0.000 description 15
- 125000003118 aryl group Chemical group 0.000 description 13
- 125000004475 heteroaralkyl group Chemical group 0.000 description 12
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 11
- 239000002253 acid Substances 0.000 description 8
- 125000002252 acyl group Chemical group 0.000 description 8
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 8
- CKARHIGQRRNVFD-UHFFFAOYSA-N 7-methoxynaphthalene-2-sulfonic acid Chemical compound C1=CC(S(O)(=O)=O)=CC2=CC(OC)=CC=C21 CKARHIGQRRNVFD-UHFFFAOYSA-N 0.000 description 7
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 7
- 125000003545 alkoxy group Chemical group 0.000 description 7
- 125000005843 halogen group Chemical group 0.000 description 7
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- 125000000753 cycloalkyl group Chemical group 0.000 description 6
- 125000000623 heterocyclic group Chemical group 0.000 description 6
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 6
- 125000000547 substituted alkyl group Chemical group 0.000 description 6
- 125000001544 thienyl group Chemical group 0.000 description 6
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 5
- 239000003146 anticoagulant agent Substances 0.000 description 5
- 125000004104 aryloxy group Chemical group 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 5
- 125000004076 pyridyl group Chemical group 0.000 description 5
- 238000002560 therapeutic procedure Methods 0.000 description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- HPUKOXOQHIMLHG-MERQFXBCSA-N N[C@@H](CCN1CC2=CC(C=NN)=CC=C2)C1=O.OC(C(F)(F)F)=O Chemical compound N[C@@H](CCN1CC2=CC(C=NN)=CC=C2)C1=O.OC(C(F)(F)F)=O HPUKOXOQHIMLHG-MERQFXBCSA-N 0.000 description 4
- 125000003342 alkenyl group Chemical group 0.000 description 4
- 125000004414 alkyl thio group Chemical group 0.000 description 4
- 229940127219 anticoagulant drug Drugs 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 4
- 125000002883 imidazolyl group Chemical group 0.000 description 4
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 4
- 125000001624 naphthyl group Chemical group 0.000 description 4
- 125000003107 substituted aryl group Chemical group 0.000 description 4
- 206010051055 Deep vein thrombosis Diseases 0.000 description 3
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 3
- 125000003435 aroyl group Chemical group 0.000 description 3
- 125000005239 aroylamino group Chemical group 0.000 description 3
- 125000004659 aryl alkyl thio group Chemical group 0.000 description 3
- 125000005161 aryl oxy carbonyl group Chemical group 0.000 description 3
- 125000005110 aryl thio group Chemical group 0.000 description 3
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 3
- 125000000440 benzylamino group Chemical group [H]N(*)C([H])([H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 3
- 125000001309 chloro group Chemical group Cl* 0.000 description 3
- 125000004093 cyano group Chemical group *C#N 0.000 description 3
- 125000004122 cyclic group Chemical group 0.000 description 3
- 208000035475 disorder Diseases 0.000 description 3
- 125000001153 fluoro group Chemical group F* 0.000 description 3
- KVBGVZZKJNLNJU-UHFFFAOYSA-N naphthalene-2-sulfonic acid Chemical compound C1=CC=CC2=CC(S(=O)(=O)O)=CC=C21 KVBGVZZKJNLNJU-UHFFFAOYSA-N 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 3
- 125000003373 pyrazinyl group Chemical group 0.000 description 3
- 125000006413 ring segment Chemical group 0.000 description 3
- 125000006180 3-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C(=C1[H])C([H])([H])[H])C([H])([H])* 0.000 description 2
- GXWGRQOMOLFZDN-UHFFFAOYSA-N 5-chloro-3-methyl-1-benzothiophene-2-sulfonic acid Chemical compound C1=C(Cl)C=C2C(C)=C(S(O)(=O)=O)SC2=C1 GXWGRQOMOLFZDN-UHFFFAOYSA-N 0.000 description 2
- FOIKGWJGRNNGQP-UHFFFAOYSA-N 6-methoxynaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=CC2=CC(OC)=CC=C21 FOIKGWJGRNNGQP-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Natural products CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 108090000790 Enzymes Proteins 0.000 description 2
- 102000004190 Enzymes Human genes 0.000 description 2
- 150000001204 N-oxides Chemical class 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- 108090000190 Thrombin Proteins 0.000 description 2
- 208000007536 Thrombosis Diseases 0.000 description 2
- 230000001154 acute effect Effects 0.000 description 2
- 206010000891 acute myocardial infarction Diseases 0.000 description 2
- 125000004644 alkyl sulfinyl group Chemical group 0.000 description 2
- 210000001367 artery Anatomy 0.000 description 2
- 125000002102 aryl alkyloxo group Chemical group 0.000 description 2
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- PXXJHWLDUBFPOL-UHFFFAOYSA-N benzamidine Chemical compound NC(=N)C1=CC=CC=C1 PXXJHWLDUBFPOL-UHFFFAOYSA-N 0.000 description 2
- 125000001246 bromo group Chemical group Br* 0.000 description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 230000001684 chronic effect Effects 0.000 description 2
- 229940088598 enzyme Drugs 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 125000002541 furyl group Chemical group 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- 125000002950 monocyclic group Chemical group 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 230000002093 peripheral effect Effects 0.000 description 2
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 2
- 125000005346 substituted cycloalkyl group Chemical group 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 229960004072 thrombin Drugs 0.000 description 2
- 230000001732 thrombotic effect Effects 0.000 description 2
- 230000002792 vascular Effects 0.000 description 2
- 210000005166 vasculature Anatomy 0.000 description 2
- HZKJAZKMSIAJRR-UHFFFAOYSA-N 1-(6-methoxypyridin-2-yl)cyclohexa-2,4-diene-1-sulfonic acid Chemical compound COC1=CC=CC(C2(C=CC=CC2)S(O)(=O)=O)=N1 HZKJAZKMSIAJRR-UHFFFAOYSA-N 0.000 description 1
- 125000001088 1-naphthoyl group Chemical group C1(=CC=CC2=CC=CC=C12)C(=O)* 0.000 description 1
- SVDZWRPQYYCMGG-UHFFFAOYSA-N 2,4-diaminoquinazoline-6-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=CC2=NC(N)=NC(N)=C21 SVDZWRPQYYCMGG-UHFFFAOYSA-N 0.000 description 1
- IXOFKWNMYWVYPS-JMAPEOGHSA-N 2-[[(3s)-1-[(2-carbamimidoylpyridin-4-yl)methyl]-2-oxopyrrolidin-3-yl]-(7-methoxynaphthalen-2-yl)sulfonylamino]-n-(2-phenylethyl)acetamide;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.C=1C2=CC(OC)=CC=C2C=CC=1S(=O)(=O)N([C@@H]1C(N(CC=2C=C(N=CC=2)C(N)=N)CC1)=O)CC(=O)NCCC1=CC=CC=C1 IXOFKWNMYWVYPS-JMAPEOGHSA-N 0.000 description 1
- 125000004847 2-fluorobenzyl group Chemical group [H]C1=C([H])C(F)=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- 125000001216 2-naphthoyl group Chemical group C1=C(C=CC2=CC=CC=C12)C(=O)* 0.000 description 1
- PYLYBGPDWHXOMR-SFHVURJKSA-N 3-[[(3S)-2-oxo-3-(2-phenylethenylsulfonylamino)pyrrolidin-1-yl]methyl]benzenecarboximidamide Chemical compound NC(=N)C1=CC=CC(CN2C([C@@H](NS(=O)(=O)C=CC=3C=CC=CC=3)CC2)=O)=C1 PYLYBGPDWHXOMR-SFHVURJKSA-N 0.000 description 1
- OIUQBFUDCXVJLM-IBGZPJMESA-N 3-[[(3s)-3-[[4-(1-methylimidazol-2-yl)phenyl]sulfonylamino]-2-oxopyrrolidin-1-yl]methyl]benzenecarboximidamide Chemical compound CN1C=CN=C1C1=CC=C(S(=O)(=O)N[C@@H]2C(N(CC=3C=C(C=CC=3)C(N)=N)CC2)=O)C=C1 OIUQBFUDCXVJLM-IBGZPJMESA-N 0.000 description 1
- SRVMTFXBPLBKQW-FGJQBABTSA-N 3-amino-5-[[(3s)-3-[(7-methoxynaphthalen-2-yl)sulfonylamino]-2-oxopyrrolidin-1-yl]methyl]benzenecarboximidamide;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.OC(=O)C(F)(F)F.C([C@@H](C1=O)NS(=O)(=O)C=2C=CC3=CC=C(C=C3C=2)OC)CN1CC1=CC(N)=CC(C(N)=N)=C1 SRVMTFXBPLBKQW-FGJQBABTSA-N 0.000 description 1
- FPQOCCYRCZNLEJ-UHFFFAOYSA-N 3-fluoro-4-phenylbenzenesulfonic acid Chemical compound FC1=CC(S(=O)(=O)O)=CC=C1C1=CC=CC=C1 FPQOCCYRCZNLEJ-UHFFFAOYSA-N 0.000 description 1
- 125000006284 3-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(F)=C1[H])C([H])([H])* 0.000 description 1
- ADAKMYBJTQFVMB-UHFFFAOYSA-N 4-(3-methylphenyl)benzenesulfonic acid Chemical compound CC1=CC=CC(C=2C=CC(=CC=2)S(O)(=O)=O)=C1 ADAKMYBJTQFVMB-UHFFFAOYSA-N 0.000 description 1
- PRQNUELZKQBHRX-KRWDZBQOSA-N 4-[[(3S)-3-[methylsulfonyl(3-phenylpropyl)amino]-2-oxopyrrolidin-1-yl]methyl]thiophene-2-carboximidamide Chemical compound CS(=O)(=O)N([C@@H]1C(N(CC=2C=C(SC=2)C(N)=N)CC1)=O)CCCC1=CC=CC=C1 PRQNUELZKQBHRX-KRWDZBQOSA-N 0.000 description 1
- KTHHXNVRFKTMND-RSAXXLAASA-N 4-[[(3s)-3-[(5-chloro-3-methyl-1-benzothiophen-2-yl)sulfonylamino]-2-oxopyrrolidin-1-yl]methyl]pyridine-2-carboximidamide;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.C([C@@H](C1=O)NS(=O)(=O)C2=C(C3=CC(Cl)=CC=C3S2)C)CN1CC1=CC=NC(C(N)=N)=C1 KTHHXNVRFKTMND-RSAXXLAASA-N 0.000 description 1
- VUMVOECAGYRLJH-UQIIZPHYSA-N 4-[[(3s)-3-[(7-methoxynaphthalen-2-yl)sulfonyl-(thiophen-3-ylmethyl)amino]-2-oxopyrrolidin-1-yl]methyl]pyridine-2-carboximidamide;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.C=1C2=CC(OC)=CC=C2C=CC=1S(=O)(=O)N([C@@H]1C(N(CC=2C=C(N=CC=2)C(N)=N)CC1)=O)CC=1C=CSC=1 VUMVOECAGYRLJH-UQIIZPHYSA-N 0.000 description 1
- DKFBSNLAEFJLHM-BQAIUKQQSA-N 4-[[(3s)-3-[(7-methoxynaphthalen-2-yl)sulfonyl-(thiophen-3-ylmethyl)amino]-2-oxopyrrolidin-1-yl]methyl]thiophene-2-carboximidamide;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.C=1C2=CC(OC)=CC=C2C=CC=1S(=O)(=O)N([C@@H]1C(N(CC=2C=C(SC=2)C(N)=N)CC1)=O)CC=1C=CSC=1 DKFBSNLAEFJLHM-BQAIUKQQSA-N 0.000 description 1
- RGKUDWDXKLGLJJ-FYZYNONXSA-N 4-[[(3s)-3-[(7-methoxynaphthalen-2-yl)sulfonylamino]-2-oxopyrrolidin-1-yl]methyl]pyridine-2-carboximidamide;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.C([C@@H](C1=O)NS(=O)(=O)C=2C=CC3=CC=C(C=C3C=2)OC)CN1CC1=CC=NC(C(N)=N)=C1 RGKUDWDXKLGLJJ-FYZYNONXSA-N 0.000 description 1
- SRRQGYUGZWLNCN-LMOVPXPDSA-N 4-[[(3s)-3-[[4-(2-chloro-6-nitrophenoxy)phenyl]sulfonylamino]-2-oxopyrrolidin-1-yl]methyl]thiophene-2-carboximidamide;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.S1C(C(=N)N)=CC(CN2C([C@@H](NS(=O)(=O)C=3C=CC(OC=4C(=CC=CC=4Cl)[N+]([O-])=O)=CC=3)CC2)=O)=C1 SRRQGYUGZWLNCN-LMOVPXPDSA-N 0.000 description 1
- OZVHTTBCBZLULV-VWLOTQADSA-N 4-[[(3s)-3-[benzyl-(7-methoxynaphthalen-2-yl)sulfonylamino]-2-oxopyrrolidin-1-yl]methyl]thiophene-2-carboximidamide Chemical compound C=1C2=CC(OC)=CC=C2C=CC=1S(=O)(=O)N([C@@H]1C(N(CC=2C=C(SC=2)C(N)=N)CC1)=O)CC1=CC=CC=C1 OZVHTTBCBZLULV-VWLOTQADSA-N 0.000 description 1
- 125000006181 4-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])C([H])([H])* 0.000 description 1
- NUYLILFFMSAMHM-UHFFFAOYSA-N 4-pyridin-3-ylbenzenesulfonic acid Chemical compound C1=CC(S(=O)(=O)O)=CC=C1C1=CC=CN=C1 NUYLILFFMSAMHM-UHFFFAOYSA-N 0.000 description 1
- LRKJKHNZRCAUSV-UHFFFAOYSA-N 4-pyridin-4-ylbenzenesulfonic acid Chemical compound C1=CC(S(=O)(=O)O)=CC=C1C1=CC=NC=C1 LRKJKHNZRCAUSV-UHFFFAOYSA-N 0.000 description 1
- KKFJNRXJRRYNRJ-VWLOTQADSA-N 5-[[(3s)-3-[benzyl-(7-methoxynaphthalen-2-yl)sulfonylamino]-2-oxopyrrolidin-1-yl]methyl]thiophene-2-carboximidamide Chemical compound C=1C2=CC(OC)=CC=C2C=CC=1S(=O)(=O)N([C@@H]1C(N(CC=2SC(=CC=2)C(N)=N)CC1)=O)CC1=CC=CC=C1 KKFJNRXJRRYNRJ-VWLOTQADSA-N 0.000 description 1
- RRELHGZMPGGKMS-UHFFFAOYSA-N 5-chloro-6-methoxynaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=CC2=C(Cl)C(OC)=CC=C21 RRELHGZMPGGKMS-UHFFFAOYSA-N 0.000 description 1
- BLKOSTJSUMJMSR-UHFFFAOYSA-N 5-chlorothiophene-2-sulfonic acid Chemical compound OS(=O)(=O)C1=CC=C(Cl)S1 BLKOSTJSUMJMSR-UHFFFAOYSA-N 0.000 description 1
- OKAUOXITMZTUOJ-UHFFFAOYSA-N 7-aminonaphthalene-2-sulfonic acid Chemical compound C1=CC(S(O)(=O)=O)=CC2=CC(N)=CC=C21 OKAUOXITMZTUOJ-UHFFFAOYSA-N 0.000 description 1
- DLEXGQNBBCPGTH-UHFFFAOYSA-N 7-ethoxynaphthalene-2-sulfonic acid Chemical compound C1=CC(S(O)(=O)=O)=CC2=CC(OCC)=CC=C21 DLEXGQNBBCPGTH-UHFFFAOYSA-N 0.000 description 1
- ZELYYTVHQRSLGT-BQAIUKQQSA-N 7-ethyl-N-[(3S)-1-[(3-methanehydrazonoylphenyl)methyl]-2-oxopyrrolidin-3-yl]naphthalene-2-sulfonamide 2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.C([C@@H](C1=O)NS(=O)(=O)C=2C=CC3=CC=C(C=C3C=2)CC)CN1CC1=CC=CC(C=NN)=C1 ZELYYTVHQRSLGT-BQAIUKQQSA-N 0.000 description 1
- 206010002388 Angina unstable Diseases 0.000 description 1
- 102000004411 Antithrombin III Human genes 0.000 description 1
- 108090000935 Antithrombin III Proteins 0.000 description 1
- 108010039209 Blood Coagulation Factors Proteins 0.000 description 1
- 102000015081 Blood Coagulation Factors Human genes 0.000 description 1
- DNUKIZCJNSQAEF-KRWDZBQOSA-N C([C@@H](C1=O)N(CC(=O)N)S(=O)(=O)C=2C=C3C=CC(N)=C(Cl)C3=CC=2)CN1CC1=CSC(C(N)=N)=C1 Chemical compound C([C@@H](C1=O)N(CC(=O)N)S(=O)(=O)C=2C=C3C=CC(N)=C(Cl)C3=CC=2)CN1CC1=CSC(C(N)=N)=C1 DNUKIZCJNSQAEF-KRWDZBQOSA-N 0.000 description 1
- VHBDVFAJUXCKJL-FQEVSTJZSA-N C([C@@H](C1=O)N(CC(N)=O)S(=O)(=O)C=2C=CC3=CC=C(C=C3C=2)OC)CN1CC1=CC(C(N)=N)=CS1 Chemical compound C([C@@H](C1=O)N(CC(N)=O)S(=O)(=O)C=2C=CC3=CC=C(C=C3C=2)OC)CN1CC1=CC(C(N)=N)=CS1 VHBDVFAJUXCKJL-FQEVSTJZSA-N 0.000 description 1
- WLBGVTQLMNEBHM-IBGZPJMESA-N C([C@@H](C1=O)N(CC(N)=O)S(=O)(=O)C=2C=CC3=CC=C(C=C3C=2)OC)CN1CC1=CSC(C(N)=N)=C1 Chemical compound C([C@@H](C1=O)N(CC(N)=O)S(=O)(=O)C=2C=CC3=CC=C(C=C3C=2)OC)CN1CC1=CSC(C(N)=N)=C1 WLBGVTQLMNEBHM-IBGZPJMESA-N 0.000 description 1
- NAGNFMHYLNJJNL-SFHVURJKSA-N C([C@@H](C1=O)N(S(=O)(=O)C)C=2C=C3C=CC=CC3=CC=2)CN1CC1=CSC(C(N)=N)=C1 Chemical compound C([C@@H](C1=O)N(S(=O)(=O)C)C=2C=C3C=CC=CC3=CC=2)CN1CC1=CSC(C(N)=N)=C1 NAGNFMHYLNJJNL-SFHVURJKSA-N 0.000 description 1
- PBQLQFUELDOXLH-MHZLTWQESA-N C=1C2=CC(OC)=CC=C2C=CC=1S(=O)(=O)N([C@@H]1C(N(CC=2C=C(SC=2)C(N)=N)CC1)=O)CC(=O)NCCC1=CC=CC=C1 Chemical compound C=1C2=CC(OC)=CC=C2C=CC=1S(=O)(=O)N([C@@H]1C(N(CC=2C=C(SC=2)C(N)=N)CC1)=O)CC(=O)NCCC1=CC=CC=C1 PBQLQFUELDOXLH-MHZLTWQESA-N 0.000 description 1
- SWEYFBZIUZRZBP-IBGZPJMESA-N COC1=CC=C2C=CC(=CC2=C1)S(=O)(=O)CN[C@@H]1C(N(CC1)CC1=CC=C(S1)C(=N)N)=O Chemical compound COC1=CC=C2C=CC(=CC2=C1)S(=O)(=O)CN[C@@H]1C(N(CC1)CC1=CC=C(S1)C(=N)N)=O SWEYFBZIUZRZBP-IBGZPJMESA-N 0.000 description 1
- DOXTYVVEFJXWHH-IBGZPJMESA-N COc1ccc2ccc(cc2c1)S(=O)(=O)CN[C@H]1CCN(Cc2csc(c2)C(N)=N)C1=O Chemical compound COc1ccc2ccc(cc2c1)S(=O)(=O)CN[C@H]1CCN(Cc2csc(c2)C(N)=N)C1=O DOXTYVVEFJXWHH-IBGZPJMESA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 206010053567 Coagulopathies Diseases 0.000 description 1
- 208000005189 Embolism Diseases 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- KURIZQKRORFWPW-NTEVMMBTSA-N FC(C(=O)O)(F)F.FC(C(=O)O)(F)F.NC1=CC=C2C=CC(=CC2=C1)S(=O)(=O)CN[C@@H]1C(N(CC1)CC=1C=C(SC1)C(=N)N)=O Chemical compound FC(C(=O)O)(F)F.FC(C(=O)O)(F)F.NC1=CC=C2C=CC(=CC2=C1)S(=O)(=O)CN[C@@H]1C(N(CC1)CC=1C=C(SC1)C(=N)N)=O KURIZQKRORFWPW-NTEVMMBTSA-N 0.000 description 1
- OPPOFRGNBFHSFF-ARIINYJRSA-N FC(C(=O)O)(F)F.FC(C(=O)O)(F)F.NN=CC=1C=C(CN2C([C@H](CC2)N(CC(=O)NCCC=2C=NC=CC2)S(=O)(=O)C2=CC3=CC(=CC=C3C=C2)OC)=O)C=CC1 Chemical compound FC(C(=O)O)(F)F.FC(C(=O)O)(F)F.NN=CC=1C=C(CN2C([C@H](CC2)N(CC(=O)NCCC=2C=NC=CC2)S(=O)(=O)C2=CC3=CC(=CC=C3C=C2)OC)=O)C=CC1 OPPOFRGNBFHSFF-ARIINYJRSA-N 0.000 description 1
- RMDOMQOXOHVXCB-UJXPALLWSA-N FC(C(=O)O)(F)F.FC(C(=O)O)(F)F.NN=CC=1C=C(CN2C([C@H](CC2)N(S(=O)(=O)C2=CC3=CC(=CC=C3C=C2)OC)CC2=CC=C(C=C2)N)=O)C=CC1 Chemical compound FC(C(=O)O)(F)F.FC(C(=O)O)(F)F.NN=CC=1C=C(CN2C([C@H](CC2)N(S(=O)(=O)C2=CC3=CC(=CC=C3C=C2)OC)CC2=CC=C(C=C2)N)=O)C=CC1 RMDOMQOXOHVXCB-UJXPALLWSA-N 0.000 description 1
- RQHDPUXJNFJSQZ-IKXQUJFKSA-N FC(C(=O)O)(F)F.FC(C(=O)O)(F)F.NN=CC=1C=C(CN2C([C@H](CC2)NS(=O)(=O)C2=CC3=CC(=CC=C3C=C2)NC)=O)C=CC1 Chemical compound FC(C(=O)O)(F)F.FC(C(=O)O)(F)F.NN=CC=1C=C(CN2C([C@H](CC2)NS(=O)(=O)C2=CC3=CC(=CC=C3C=C2)NC)=O)C=CC1 RQHDPUXJNFJSQZ-IKXQUJFKSA-N 0.000 description 1
- COGJBLGCWBGBOA-FJSYBICCSA-N FC(C(=O)O)(F)F.FC(C(=O)O)(F)F.NN=CC=1C=C(CN2C([C@H](CC2)NS(=O)(=O)C2=CC3=CC=C(C(=C3C=C2)Cl)N)=O)C=CC1 Chemical compound FC(C(=O)O)(F)F.FC(C(=O)O)(F)F.NN=CC=1C=C(CN2C([C@H](CC2)NS(=O)(=O)C2=CC3=CC=C(C(=C3C=C2)Cl)N)=O)C=CC1 COGJBLGCWBGBOA-FJSYBICCSA-N 0.000 description 1
- ZQHNLKVUTFQYTI-UQIIZPHYSA-N FC(C(=O)O)(F)F.NN=CC=1C=C(CN2C([C@H](CC2)N(CC(=O)N(C)C)S(=O)(=O)C2=CC3=CC(=CC=C3C=C2)OC)=O)C=CC1 Chemical compound FC(C(=O)O)(F)F.NN=CC=1C=C(CN2C([C@H](CC2)N(CC(=O)N(C)C)S(=O)(=O)C2=CC3=CC(=CC=C3C=C2)OC)=O)C=CC1 ZQHNLKVUTFQYTI-UQIIZPHYSA-N 0.000 description 1
- UBYDCDMXHCFYEO-YNMZEGNTSA-N FC(C(=O)O)(F)F.NN=CC=1C=C(CN2C([C@H](CC2)N(CC(=O)NCCC2=CC=CC=C2)S(=O)(=O)C2=CC3=CC=C(C=C3C=C2)OC)=O)C=CC1 Chemical compound FC(C(=O)O)(F)F.NN=CC=1C=C(CN2C([C@H](CC2)N(CC(=O)NCCC2=CC=CC=C2)S(=O)(=O)C2=CC3=CC=C(C=C3C=C2)OC)=O)C=CC1 UBYDCDMXHCFYEO-YNMZEGNTSA-N 0.000 description 1
- KREXWMQEFYDYQH-CZCBIWLKSA-N FC(C(=O)O)(F)F.NN=CC=1C=C(CN2C([C@H](CC2)N(CC(=O)NCCC2=CC=CC=C2)S(=O)(=O)C2=CC3=CC=CC=C3C=C2)=O)C=CC1 Chemical compound FC(C(=O)O)(F)F.NN=CC=1C=C(CN2C([C@H](CC2)N(CC(=O)NCCC2=CC=CC=C2)S(=O)(=O)C2=CC3=CC=CC=C3C=C2)=O)C=CC1 KREXWMQEFYDYQH-CZCBIWLKSA-N 0.000 description 1
- MUPXGPKWBWACFA-UCRKPPETSA-N FC(C(=O)O)(F)F.NN=CC=1C=C(CN2C([C@H](CC2)N(CC(=O)NCCC2=CC=CC=C2)S(=O)(=O)C2=CC=C(C=C2)C2=CC=CC=C2)=O)C=CC1 Chemical compound FC(C(=O)O)(F)F.NN=CC=1C=C(CN2C([C@H](CC2)N(CC(=O)NCCC2=CC=CC=C2)S(=O)(=O)C2=CC=C(C=C2)C2=CC=CC=C2)=O)C=CC1 MUPXGPKWBWACFA-UCRKPPETSA-N 0.000 description 1
- KISOLBMUZFDONM-UCRKPPETSA-N FC(C(=O)O)(F)F.NN=CC=1C=C(CN2C([C@H](CC2)N(CC(=O)NCCCC2=CC=CC=C2)S(=O)(=O)C2=CC3=CC(=CC=C3C=C2)OC)=O)C=CC1 Chemical compound FC(C(=O)O)(F)F.NN=CC=1C=C(CN2C([C@H](CC2)N(CC(=O)NCCCC2=CC=CC=C2)S(=O)(=O)C2=CC3=CC(=CC=C3C=C2)OC)=O)C=CC1 KISOLBMUZFDONM-UCRKPPETSA-N 0.000 description 1
- SBXOZKPZNSZOMT-BOXHHOBZSA-N FC(C(=O)O)(F)F.NN=CC=1C=C(CN2C([C@H](CC2)NS(=O)(=O)C2=CC3=CC(=CC=C3C=C2)O)=O)C=CC1 Chemical compound FC(C(=O)O)(F)F.NN=CC=1C=C(CN2C([C@H](CC2)NS(=O)(=O)C2=CC3=CC(=CC=C3C=C2)O)=O)C=CC1 SBXOZKPZNSZOMT-BOXHHOBZSA-N 0.000 description 1
- 108010074105 Factor Va Proteins 0.000 description 1
- 229940123583 Factor Xa inhibitor Drugs 0.000 description 1
- 206010022562 Intermittent claudication Diseases 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- CBTIAQXKRXXQOQ-JIDHJSLPSA-N N-[(3S)-1-[(3-methanehydrazonoylphenyl)methyl]-2-oxoazepan-3-yl]-7-methoxynaphthalene-2-sulfonamide 2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.C([C@@H](C1=O)NS(=O)(=O)C=2C=CC3=CC=C(C=C3C=2)OC)CCCN1CC1=CC=CC(C=NN)=C1 CBTIAQXKRXXQOQ-JIDHJSLPSA-N 0.000 description 1
- ANPMQVDEBFEXIU-FYZYNONXSA-N N-[(3S)-1-[(3-methanehydrazonoylphenyl)methyl]-2-oxopyrrolidin-3-yl]-2-methoxyquinoline-7-sulfonamide 2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.C([C@@H](C1=O)NS(=O)(=O)C=2C=CC3=CC=C(N=C3C=2)OC)CN1CC1=CC=CC(C=NN)=C1 ANPMQVDEBFEXIU-FYZYNONXSA-N 0.000 description 1
- HYUZUJGWAXJHHJ-BQAIUKQQSA-N N-[(3S)-1-[(3-methanehydrazonoylphenyl)methyl]-2-oxopyrrolidin-3-yl]-4-phenylbenzenesulfonamide 2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.NN=CC1=CC=CC(CN2C([C@@H](NS(=O)(=O)C=3C=CC(=CC=3)C=3C=CC=CC=3)CC2)=O)=C1 HYUZUJGWAXJHHJ-BQAIUKQQSA-N 0.000 description 1
- KOSRXDWVXPMSMD-FERBBOLQSA-N N-[(3S)-1-[(3-methanehydrazonoylphenyl)methyl]-2-oxopyrrolidin-3-yl]-5-pyridin-2-ylthiophene-2-sulfonamide 2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.NN=CC1=CC=CC(CN2C([C@@H](NS(=O)(=O)C=3SC(=CC=3)C=3N=CC=CC=3)CC2)=O)=C1 KOSRXDWVXPMSMD-FERBBOLQSA-N 0.000 description 1
- MMATVCXCASXGKF-LJAQVGFWSA-N N-[(3S)-1-[(3-methanehydrazonoylphenyl)methyl]-2-oxopyrrolidin-3-yl]-7-methoxy-N-[(2-nitrophenyl)methyl]naphthalene-2-sulfonamide Chemical compound NN=CC=1C=C(CN2C([C@H](CC2)N(S(=O)(=O)C2=CC3=CC(=CC=C3C=C2)OC)CC2=C(C=CC=C2)[N+](=O)[O-])=O)C=CC=1 MMATVCXCASXGKF-LJAQVGFWSA-N 0.000 description 1
- QVBKSRCAAVGQQF-LJAQVGFWSA-N N-[(3S)-1-[(3-methanehydrazonoylphenyl)methyl]-2-oxopyrrolidin-3-yl]-7-methoxy-N-[(3-nitrophenyl)methyl]naphthalene-2-sulfonamide Chemical compound NN=CC=1C=C(CN2C([C@H](CC2)N(S(=O)(=O)C2=CC3=CC(=CC=C3C=C2)OC)CC2=CC(=CC=C2)[N+](=O)[O-])=O)C=CC1 QVBKSRCAAVGQQF-LJAQVGFWSA-N 0.000 description 1
- PEEMLQRBMFADOG-BDQAORGHSA-N N-[(3S)-1-[(3-methanehydrazonoylphenyl)methyl]-2-oxopyrrolidin-3-yl]benzo[f][1,3]benzodioxole-6-sulfonamide 2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.NN=CC1=CC=CC(CN2C([C@@H](NS(=O)(=O)C=3C=C4C=C5OCOC5=CC4=CC=3)CC2)=O)=C1 PEEMLQRBMFADOG-BDQAORGHSA-N 0.000 description 1
- HTGHPBDLIFOCHF-UHFFFAOYSA-N N-[1-[(3-methanehydrazonoylphenyl)methyl]-5-oxopyrrolidin-3-yl]dibenzofuran-2-sulfonamide 2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.NN=CC1=CC=CC(CN2C(CC(C2)NS(=O)(=O)C=2C=C3C4=CC=CC=C4OC3=CC=2)=O)=C1 HTGHPBDLIFOCHF-UHFFFAOYSA-N 0.000 description 1
- AHALMHABNIGJCP-BDQAORGHSA-N N-[[(3S)-1-[(3-methanehydrazonoylphenyl)methyl]-2-oxopyrrolidin-3-yl]methyl]-7-methoxynaphthalene-2-sulfonamide 2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.C([C@H](C1=O)CNS(=O)(=O)C=2C=CC3=CC=C(C=C3C=2)OC)CN1CC1=CC=CC(C=NN)=C1 AHALMHABNIGJCP-BDQAORGHSA-N 0.000 description 1
- PJKGHUYRTOUTKC-KRWDZBQOSA-N N-benzyl-2-[[(3S)-1-[(5-carbamimidoylthiophen-3-yl)methyl]-2-oxopyrrolidin-3-yl]-(4,5-dichlorothiophen-2-yl)sulfonylamino]acetamide Chemical compound S1C(C(=N)N)=CC(CN2C([C@@H](N(CC(=O)NCC=3C=CC=CC=3)S(=O)(=O)C=3SC(Cl)=C(Cl)C=3)CC2)=O)=C1 PJKGHUYRTOUTKC-KRWDZBQOSA-N 0.000 description 1
- CHSKPWNHVCXTAA-SFHVURJKSA-N NC(=N)C1=CC=CC(CN2C([C@@H](NS(=O)(=O)CCC=3C=CC=CC=3)CC2)=O)=C1 Chemical compound NC(=N)C1=CC=CC(CN2C([C@@H](NS(=O)(=O)CCC=3C=CC=CC=3)CC2)=O)=C1 CHSKPWNHVCXTAA-SFHVURJKSA-N 0.000 description 1
- FSYVVTIQANZSIE-QFIPXVFZSA-N NN=CC1=CC=C(CN2C([C@H](CC2)NS(=O)(=O)C2=CC3=CC(=CC=C3C=C2)OC)=O)C=C1 Chemical compound NN=CC1=CC=C(CN2C([C@H](CC2)NS(=O)(=O)C2=CC3=CC(=CC=C3C=C2)OC)=O)C=C1 FSYVVTIQANZSIE-QFIPXVFZSA-N 0.000 description 1
- 206010028980 Neoplasm Diseases 0.000 description 1
- GWDCVMIEISJHES-FTBISJDPSA-N OC(=O)C(F)(F)F.C([C@@H](C1=O)NS(=O)(=O)C2=CC3=CC=C(C=C3C=C2)OC)CN1CC1=CC=CC(C=NN)=C1 Chemical compound OC(=O)C(F)(F)F.C([C@@H](C1=O)NS(=O)(=O)C2=CC3=CC=C(C=C3C=C2)OC)CN1CC1=CC=CC(C=NN)=C1 GWDCVMIEISJHES-FTBISJDPSA-N 0.000 description 1
- MRTTYKVNJDOIEZ-FTBISJDPSA-N OC(=O)C(F)(F)F.C([C@@H](C1=O)NS(=O)(=O)C=2C=CC3=CC=C(C=C3C=2)C)CN1CC1=CC=CC(C=NN)=C1 Chemical compound OC(=O)C(F)(F)F.C([C@@H](C1=O)NS(=O)(=O)C=2C=CC3=CC=C(C=C3C=2)C)CN1CC1=CC=CC(C=NN)=C1 MRTTYKVNJDOIEZ-FTBISJDPSA-N 0.000 description 1
- PSMSAULBRKZYPJ-JIDHJSLPSA-N OC(=O)C(F)(F)F.COC1=CC=CC(C=2C=CC(=CC=2)S(=O)(=O)N[C@@H]2C(N(CC=3C=C(C=NN)C=CC=3)CC2)=O)=C1 Chemical compound OC(=O)C(F)(F)F.COC1=CC=CC(C=2C=CC(=CC=2)S(=O)(=O)N[C@@H]2C(N(CC=3C=C(C=NN)C=CC=3)CC2)=O)=C1 PSMSAULBRKZYPJ-JIDHJSLPSA-N 0.000 description 1
- JQSYPFLHUFEIQH-FTBISJDPSA-N OC(=O)C(F)(F)F.CONN=CC1=CC=CC(CN2C([C@H](CNS(=O)(=O)C=3C=C4C=CC(OC)=CC4=CC=3)CC2)=O)=C1 Chemical compound OC(=O)C(F)(F)F.CONN=CC1=CC=CC(CN2C([C@H](CNS(=O)(=O)C=3C=C4C=CC(OC)=CC4=CC=3)CC2)=O)=C1 JQSYPFLHUFEIQH-FTBISJDPSA-N 0.000 description 1
- YBVDZPABCBSXEY-UHFFFAOYSA-N OC(=O)C(F)(F)F.NN=CC1=CC=CC(CN2C(C(NS(=O)(=O)C=3C=C4C=CC=CC4=CC=3)CCC2)=O)=C1 Chemical compound OC(=O)C(F)(F)F.NN=CC1=CC=CC(CN2C(C(NS(=O)(=O)C=3C=C4C=CC=CC4=CC=3)CCC2)=O)=C1 YBVDZPABCBSXEY-UHFFFAOYSA-N 0.000 description 1
- GOWSSNKUORTWFJ-GTVPGWBMSA-N OC(=O)C(F)(F)F.NN=CC1=CC=CC(CN2C([C@@H](NS(=O)(=O)C3(C=CC=CC3)C=3C=[N+]([O-])C=CC=3)CC2)=O)=C1 Chemical compound OC(=O)C(F)(F)F.NN=CC1=CC=CC(CN2C([C@@H](NS(=O)(=O)C3(C=CC=CC3)C=3C=[N+]([O-])C=CC=3)CC2)=O)=C1 GOWSSNKUORTWFJ-GTVPGWBMSA-N 0.000 description 1
- BKSPDZSTIVXCHF-HAABMKSFSA-N OC(=O)C(F)(F)F.NN=CC1=CC=CC(CN2C([C@@H](NS(=O)(=O)C3(C=CC=CC3)OC=3C(=CC=CN=3)Cl)CC2)=O)=C1 Chemical compound OC(=O)C(F)(F)F.NN=CC1=CC=CC(CN2C([C@@H](NS(=O)(=O)C3(C=CC=CC3)OC=3C(=CC=CN=3)Cl)CC2)=O)=C1 BKSPDZSTIVXCHF-HAABMKSFSA-N 0.000 description 1
- SNKPSXCJWCTAMZ-BDQAORGHSA-N OC(=O)C(F)(F)F.NN=CC1=CC=CC(CN2C([C@@H](NS(=O)(=O)C=3C4=CC=CC=C4C=CC=3)CC2)=O)=C1 Chemical compound OC(=O)C(F)(F)F.NN=CC1=CC=CC(CN2C([C@@H](NS(=O)(=O)C=3C4=CC=CC=C4C=CC=3)CC2)=O)=C1 SNKPSXCJWCTAMZ-BDQAORGHSA-N 0.000 description 1
- BIMQSYXGQFKQPR-BOXHHOBZSA-N OC(=O)C(F)(F)F.NN=CC1=CC=CC(CN2C([C@@H](NS(=O)(=O)C=3C=C4C=CC=CC4=CC=3)CC2)=O)=C1 Chemical compound OC(=O)C(F)(F)F.NN=CC1=CC=CC(CN2C([C@@H](NS(=O)(=O)C=3C=C4C=CC=CC4=CC=3)CC2)=O)=C1 BIMQSYXGQFKQPR-BOXHHOBZSA-N 0.000 description 1
- 108010094028 Prothrombin Proteins 0.000 description 1
- 102100027378 Prothrombin Human genes 0.000 description 1
- 208000010378 Pulmonary Embolism Diseases 0.000 description 1
- 206010040070 Septic Shock Diseases 0.000 description 1
- 208000006011 Stroke Diseases 0.000 description 1
- 208000001435 Thromboembolism Diseases 0.000 description 1
- 208000032109 Transient ischaemic attack Diseases 0.000 description 1
- 208000007814 Unstable Angina Diseases 0.000 description 1
- 206010047249 Venous thrombosis Diseases 0.000 description 1
- 208000036142 Viral infection Diseases 0.000 description 1
- 230000003187 abdominal effect Effects 0.000 description 1
- 230000002159 abnormal effect Effects 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000005078 alkoxycarbonylalkyl group Chemical group 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 1
- 229960005348 antithrombin iii Drugs 0.000 description 1
- 210000005249 arterial vasculature Anatomy 0.000 description 1
- 125000005018 aryl alkenyl group Chemical group 0.000 description 1
- 125000005098 aryl alkoxy carbonyl group Chemical group 0.000 description 1
- 125000005135 aryl sulfinyl group Chemical group 0.000 description 1
- 125000005334 azaindolyl group Chemical group N1N=C(C2=CC=CC=C12)* 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- FWRPUWOMIWLQKH-UHFFFAOYSA-N benzenecarboximidamide;dihydrochloride Chemical compound Cl.Cl.NC(=N)C1=CC=CC=C1 FWRPUWOMIWLQKH-UHFFFAOYSA-N 0.000 description 1
- 125000004601 benzofurazanyl group Chemical group N1=C2C(=NO1)C(=CC=C2)* 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 208000015294 blood coagulation disease Diseases 0.000 description 1
- 239000003114 blood coagulation factor Substances 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 125000004181 carboxyalkyl group Chemical group 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 230000002490 cerebral effect Effects 0.000 description 1
- 230000015271 coagulation Effects 0.000 description 1
- 238000005345 coagulation Methods 0.000 description 1
- 230000009918 complex formation Effects 0.000 description 1
- 238000007887 coronary angioplasty Methods 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000004851 cyclopentylmethyl group Chemical group C1(CCCC1)C* 0.000 description 1
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- FUVVSNUVSKUJAS-UHFFFAOYSA-N furan-2-carboximidamide Chemical compound NC(=N)C1=CC=CO1 FUVVSNUVSKUJAS-UHFFFAOYSA-N 0.000 description 1
- 125000003838 furazanyl group Chemical group 0.000 description 1
- 238000001631 haemodialysis Methods 0.000 description 1
- 230000000322 hemodialysis Effects 0.000 description 1
- 125000004447 heteroarylalkenyl group Chemical group 0.000 description 1
- 125000004446 heteroarylalkyl group Chemical group 0.000 description 1
- 125000005150 heteroarylsulfinyl group Chemical group 0.000 description 1
- 125000005143 heteroarylsulfonyl group Chemical group 0.000 description 1
- 125000005368 heteroarylthio group Chemical group 0.000 description 1
- 125000001183 hydrocarbyl group Chemical group 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- RCCPEORTSYDPMB-UHFFFAOYSA-N hydroxy benzenecarboximidothioate Chemical compound OSC(=N)C1=CC=CC=C1 RCCPEORTSYDPMB-UHFFFAOYSA-N 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 201000004332 intermediate coronary syndrome Diseases 0.000 description 1
- 208000021156 intermittent vascular claudication Diseases 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- 210000003127 knee Anatomy 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 210000003141 lower extremity Anatomy 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- GTCAXTIRRLKXRU-UHFFFAOYSA-N methyl carbamate Chemical group COC(N)=O GTCAXTIRRLKXRU-UHFFFAOYSA-N 0.000 description 1
- 125000006606 n-butoxy group Chemical group 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005029 naphthylthio group Chemical group C1(=CC=CC2=CC=CC=C12)S* 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 125000002868 norbornyl group Chemical group C12(CCC(CC1)C2)* 0.000 description 1
- 210000004789 organ system Anatomy 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 125000001312 palmitoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000001575 pathological effect Effects 0.000 description 1
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 150000003904 phospholipids Chemical class 0.000 description 1
- 125000005936 piperidyl group Chemical group 0.000 description 1
- 125000001325 propanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 description 1
- 229940080818 propionamide Drugs 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229940039716 prothrombin Drugs 0.000 description 1
- 108010014806 prothrombinase complex Proteins 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000006514 pyridin-2-ylmethyl group Chemical group [H]C1=C([H])C([H])=C([H])C(=N1)C([H])([H])* 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- PLUQFBYKHVFHMZ-UHFFFAOYSA-N quinoline-6-sulfonic acid Chemical compound N1=CC=CC2=CC(S(=O)(=O)O)=CC=C21 PLUQFBYKHVFHMZ-UHFFFAOYSA-N 0.000 description 1
- 208000037803 restenosis Diseases 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 230000036303 septic shock Effects 0.000 description 1
- 239000012453 solvate Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 238000001356 surgical procedure Methods 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000005958 tetrahydrothienyl group Chemical group 0.000 description 1
- 125000004632 tetrahydrothiopyranyl group Chemical group S1C(CCCC1)* 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- QSELGEUCFNFITD-UHFFFAOYSA-N thiophene-2-carboximidamide Chemical compound NC(=N)C1=CC=CS1 QSELGEUCFNFITD-UHFFFAOYSA-N 0.000 description 1
- 230000002537 thrombolytic effect Effects 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 201000010875 transient cerebral ischemia Diseases 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 210000003462 vein Anatomy 0.000 description 1
- 230000009385 viral infection Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
- C07D207/26—2-Pyrrolidones
- C07D207/273—2-Pyrrolidones with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to other ring carbon atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/44—Non condensed pyridines; Hydrogenated derivatives thereof
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P7/00—Drugs for disorders of the blood or the extracellular fluid
- A61P7/02—Antithrombotic agents; Anticoagulants; Platelet aggregation inhibitors
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D205/00—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom
- C07D205/02—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D205/06—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D205/08—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with one oxygen atom directly attached in position 2, e.g. beta-lactams
- C07D205/085—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with one oxygen atom directly attached in position 2, e.g. beta-lactams with a nitrogen atom directly attached in position 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/10—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/14—Nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/34—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/36—Oxygen or sulfur atoms
- C07D207/40—2,5-Pyrrolidine-diones
- C07D207/416—2,5-Pyrrolidine-diones with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to other ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/68—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D211/72—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D211/74—Oxygen atoms
- C07D211/76—Oxygen atoms attached in position 2 or 6
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D223/00—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom
- C07D223/02—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D223/06—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom not condensed with other rings with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D223/12—Nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/06—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/06—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing three or more hetero rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- General Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Animal Behavior & Ethology (AREA)
- Pharmacology & Pharmacy (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Epidemiology (AREA)
- Hematology (AREA)
- Diabetes (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Pyrrole Compounds (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US08/481,024 US5612353A (en) | 1995-06-07 | 1995-06-07 | Substituted (sulfinic acid, sulfonic acid, sulfonylamino or sulfinylamino) N-[(aminoiminomethyl)phenylalkyl]-azaheterocyclylamide compounds |
| PCT/US1996/009816 WO1996040679A1 (en) | 1995-06-07 | 1996-06-07 | Substituted (sulfinic acid, sulfonic acid, sulfonylamino or sulfinylamino) n-[(aminoiminomethyl)phenylalkyl]-azaheterocyclylamide compounds |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| AP9701144A0 AP9701144A0 (en) | 1998-01-31 |
| AP799A true AP799A (en) | 2000-01-19 |
Family
ID=23910281
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| APAP/P/1997/001144A AP799A (en) | 1995-06-07 | 1996-06-07 | Substituted (sulfinic acid, sulfonic acid, sulfonylamino or sulfinylamino) N-[(aminoiminomethyl) phenylalkyl]-azaheterocyclylamide compounds. |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US5612353A (cs) |
| EP (1) | EP0853618B1 (cs) |
| JP (1) | JP4312829B2 (cs) |
| KR (1) | KR100291711B1 (cs) |
| CN (1) | CN1190395A (cs) |
| AP (1) | AP799A (cs) |
| AT (1) | ATE520655T1 (cs) |
| AU (1) | AU714319B2 (cs) |
| BG (1) | BG63628B1 (cs) |
| BR (1) | BR9608405A (cs) |
| CA (1) | CA2223403C (cs) |
| CZ (1) | CZ385397A3 (cs) |
| EA (1) | EA000700B1 (cs) |
| HU (1) | HUP9801882A3 (cs) |
| MX (1) | MX9709977A (cs) |
| NO (1) | NO310457B1 (cs) |
| OA (1) | OA10752A (cs) |
| PL (1) | PL323780A1 (cs) |
| SI (1) | SI9620093A (cs) |
| SK (1) | SK160697A3 (cs) |
| WO (1) | WO1996040679A1 (cs) |
Families Citing this family (60)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5731315A (en) * | 1995-06-07 | 1998-03-24 | Rhone-Poulenc Rorer Pharmaceuticals Inc. | Substituted sulfonic acid n- (aminoiminomethyl)phenylalkyl!-azaheterocyclamide compounds |
| US6034093A (en) * | 1995-06-07 | 2000-03-07 | Rhone-Poulenc Rorer Pharmaceuticals Inc. | Substituted sulfonic acid N-[(aminoiminomethyl)phenylalkyl]-azaheterocyclylamide compounds |
| US5958918A (en) * | 1995-06-07 | 1999-09-28 | Rhone-Poulenc Rorer Pharmaceuticals Inc. | Substituted (sulfinic acid, sulfonic acid, sulfonylamino or sulfinylamino) N- (aminominomethyl)phenylalkyl!-azaheterocyclylamide compounds |
| US6080767A (en) * | 1996-01-02 | 2000-06-27 | Aventis Pharmaceuticals Products Inc. | Substituted n-[(aminoiminomethyl or aminomethyl)phenyl]propyl amides |
| US6057342A (en) * | 1996-08-16 | 2000-05-02 | Dupont Pharmaceutical Co. | Amidinophenyl-pyrrolidines, -pyrrolines, and -isoxazolidines and derivatives thereof |
| US6602864B1 (en) * | 1996-12-13 | 2003-08-05 | Aventis Pharma Deutschland Gmbh | Sulfonic acid or sulfonylamino N-(heteroaralkyl)-azaheterocyclylamide compounds |
| WO1998025611A1 (en) * | 1996-12-13 | 1998-06-18 | Rhône-Poulenc Rorer Pharmaceuticals Inc. | Sulfonic acid or sulfonylamino n-(heteroaralkyl)-azaheterocyclylamide compounds |
| AU7453498A (en) | 1997-05-30 | 1998-12-30 | Takeda Chemical Industries Ltd. | Sulfonamide derivatives, their production and use |
| ZA985247B (en) * | 1997-06-19 | 1999-12-17 | Du Pont Merck Pharma | Guanidine mimics as factor Xa inhibitors. |
| WO1999016747A1 (en) | 1997-09-30 | 1999-04-08 | Daiichi Pharmaceutical Co., Ltd. | Sulfonyl derivatives |
| US6271237B1 (en) | 1997-12-22 | 2001-08-07 | Dupont Pharmaceuticals Company | Nitrogen containing heteromatics with ortho-substituted P1s as factor Xa inhabitors |
| CA2314401A1 (en) * | 1997-12-22 | 1999-07-01 | Du Pont Pharmaceuticals Company | Nitrogen containing heteroaromatics with ortho-substituted p1's as factor xa inhibitors |
| JP4676613B2 (ja) * | 1998-01-27 | 2011-04-27 | アベンティス・ファーマスーティカルズ・インコーポレイテツド | 置換オキソアザヘテロシクリルXa因子阻害剤 |
| EP1054005A4 (en) | 1998-02-05 | 2003-02-05 | Takeda Chemical Industries Ltd | SULPHONAMIDE DERIVATIVES, METHOD FOR THE PRODUCTION AND THEIR USE |
| JP2002502852A (ja) * | 1998-02-09 | 2002-01-29 | 3−ディメンショナル ファーマシューティカルズ, インコーポレイテッド | プロテアーゼ阻害剤、特にウロキナーゼ阻害剤としてのヘテロアリールアミジン、メチルアミジンおよびグアニジン |
| US6291514B1 (en) | 1998-02-09 | 2001-09-18 | 3-Dimensional Pharmaceuticals, Inc. | Heteroaryl amidines, methylamidines and guanidines, preparation thereof, and use thereof as protease inhibitors |
| US6747023B1 (en) * | 1998-08-11 | 2004-06-08 | Daiichi Pharmaceutical Co., Ltd. | Sulfonyl derivatives |
| DE19839499A1 (de) * | 1998-08-29 | 2000-03-02 | Merck Patent Gmbh | 2-Oxo-2H-chinolinderivate |
| JP2003529531A (ja) * | 1998-11-25 | 2003-10-07 | アヴェンティス ファーマシューティカルズ インコーポレイテッド | 置換オキソアザへテロシクリルXa因子阻害剤 |
| AU5671799A (en) * | 1999-02-09 | 2000-08-29 | 3-Dimensional Pharmaceuticals, Inc. | Heteroaryl amidines, methylamidines and guanidines as protease inhibitors |
| DE19909237A1 (de) * | 1999-03-03 | 2000-09-07 | Merck Patent Gmbh | Pyrazol-3-on-derivate |
| US6794412B1 (en) * | 1999-03-11 | 2004-09-21 | Bristol-Myers Squibb Pharma Company | Treatment of thrombosis by combined use of a factor Xa inhibitor and aspirin |
| JP2001026506A (ja) * | 1999-04-28 | 2001-01-30 | Takeda Chem Ind Ltd | スルホンアミド誘導体 |
| US6586617B1 (en) | 1999-04-28 | 2003-07-01 | Sumitomo Chemical Takeda Agro Company, Limited | Sulfonamide derivatives |
| DE60027718T2 (de) | 1999-06-22 | 2007-05-16 | Takeda Pharmaceutical Co. Ltd. | Acylhydrazinderivate, verfahren zu ihrer herstellung und ihre verwendung |
| ATE423113T1 (de) * | 1999-07-28 | 2009-03-15 | Aventis Pharma Inc | Substituierte oxoazaheterozyclische verbindungen |
| US6544981B2 (en) | 2000-06-09 | 2003-04-08 | Bristol-Myers Squibb Company | Lactam inhibitors of factor Xa and method |
| US6511973B2 (en) * | 2000-08-02 | 2003-01-28 | Bristol-Myers Squibb Co. | Lactam inhibitors of FXa and method |
| US6410733B1 (en) | 2000-09-11 | 2002-06-25 | Genentech, Inc. | Amidine inhibitors of serine proteases |
| WO2002038560A1 (en) * | 2000-11-08 | 2002-05-16 | Takeda Chemical Industries, Ltd. | Carbamate derivatives, process for producing the same and use thereof |
| US6982251B2 (en) | 2000-12-20 | 2006-01-03 | Schering Corporation | Substituted 2-azetidinones useful as hypocholesterolemic agents |
| AR032230A1 (es) * | 2001-01-16 | 2003-10-29 | Sumitomo Chem Takeda Agro Co | Derivado sulfonamida conteniendo una composicion agricola y horticola |
| US7071181B2 (en) | 2001-01-26 | 2006-07-04 | Schering Corporation | Methods and therapeutic combinations for the treatment of diabetes using sterol absorption inhibitors |
| ME00145B (me) | 2001-01-26 | 2010-10-10 | Merck Sharp & Dohme | Upotreba supstituisanih jedinjenja azetidinona za lečenje sitosterolemije |
| IL156445A0 (en) | 2001-01-26 | 2004-01-04 | Schering Corp | Combinations of peroxisome proliferator-activated receptor (ppar) activator(s) and sterol absorption inhibitor(s) and treatments for vascular indications |
| US20060287254A1 (en) * | 2001-01-26 | 2006-12-21 | Schering Corporation | Use of substituted azetidinone compounds for the treatment of sitosterolemia |
| JP2004518688A (ja) * | 2001-01-30 | 2004-06-24 | ブリストル−マイヤーズ スクイブ カンパニー | ファクターXa阻害剤のスルホンアミドラクタムおよびその方法 |
| CA2440389A1 (en) | 2001-03-09 | 2002-10-03 | Ortho-Mcneil Pharmaceutical, Inc. | Aminopyrrolidine sulfonamides as serine protease inhibitors |
| US6710061B2 (en) * | 2001-03-09 | 2004-03-23 | Ortho-Mcneil Pharamceutical, Inc. | Aminopyrrolidine sulfonamides as serine protease inhibitors |
| DE10112768A1 (de) * | 2001-03-16 | 2002-09-19 | Merck Patent Gmbh | Phenylderivate 3 |
| DE10139060A1 (de) | 2001-08-08 | 2003-02-20 | Merck Patent Gmbh | Phenylderivate |
| US7053080B2 (en) * | 2001-09-21 | 2006-05-30 | Schering Corporation | Methods and therapeutic combinations for the treatment of obesity using sterol absorption inhibitors |
| ES2272776T3 (es) | 2001-09-21 | 2007-05-01 | Schering Corporation | Tratamiento de xantomas con derivados de azetidinona como inhibidores de la absorcion de esterol. |
| DE10239821A1 (de) | 2002-08-29 | 2004-03-11 | Roche Diagnostics Gmbh | Verbesserung der Spezifität bei der Bestimmung von Antithrombin |
| WO2004043457A1 (en) | 2002-11-06 | 2004-05-27 | Schering Corporation | Cholesterol absorptions inhibitors for the treatment of autoimmune disorders |
| AU2003284596A1 (en) | 2002-11-22 | 2004-06-18 | Takeda Pharmaceutical Company Limited | Imidazole derivative, process for producing the same, and use |
| HUE025683T2 (hu) | 2002-12-03 | 2016-04-28 | Pharmacyclics Llc | VIIA faktor inhibitor 2-(2-hidroxi-bifenil-3-il)-1H-benzoimidazol-5-karboxamidin-származékok |
| DE10302500A1 (de) | 2003-01-23 | 2004-07-29 | Merck Patent Gmbh | Carbonsäureamidderivate |
| US7459442B2 (en) * | 2003-03-07 | 2008-12-02 | Schering Corporation | Substituted azetidinone compounds, processes for preparing the same, formulations and uses thereof |
| DE602004016123D1 (de) * | 2003-03-07 | 2008-10-09 | Schering Corp | Substituierte azetidinon-derivate, deren pharmazeutische formulierungen und deren verwendung zur behandlung von hypercholesterolemia |
| DE602004018617D1 (de) * | 2003-03-07 | 2009-02-05 | Schering Corp | Substituierte azetidinon-derivate, deren pharmazeutische formulierungen und deren verwendung zur behandlung von hypercholesterolemia |
| US7192944B2 (en) | 2003-03-07 | 2007-03-20 | Schering Corp. | Substituted azetidinone compounds, processes for preparing the same, formulations and uses thereof |
| JP2007500221A (ja) | 2003-05-20 | 2007-01-11 | ジェネンテック・インコーポレーテッド | 第VIIa因子のベンゾフラン阻害剤 |
| US7250447B2 (en) | 2003-05-20 | 2007-07-31 | Genentech, Inc. | Acylsulfamide inhibitors of factor VIIa |
| US7208488B2 (en) * | 2003-10-29 | 2007-04-24 | Elan Pharmaceuticals, Inc. | N-substituted benzene sulfonamides |
| EP1533298A1 (en) | 2003-11-21 | 2005-05-25 | Newron Pharmaceuticals S.p.A. | 3-aminopyrrolidone derivatives |
| TWI396686B (zh) | 2004-05-21 | 2013-05-21 | Takeda Pharmaceutical | 環狀醯胺衍生物、以及其製品和用法 |
| UY29223A1 (es) * | 2004-11-23 | 2006-06-30 | Astrazeneca Ab | Ácidos fenoxiacéticos sustituidos, composiciones farmacéuticas que los contienen y procesos para su preparación |
| KR20080015102A (ko) | 2005-05-10 | 2008-02-18 | 버텍스 파마슈티칼스 인코포레이티드 | 이온 채널 조절인자로서의 바이사이클릭 유도체 |
| EP3886854A4 (en) | 2018-11-30 | 2022-07-06 | Nuvation Bio Inc. | Pyrrole and pyrazole compounds and methods of use thereof |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4121947A1 (de) * | 1991-07-03 | 1993-01-07 | Basf Ag | 2-(3-(4-amidino-phenyl))-propionsaeurederivate, ihre herstellung und verwendung |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1993007141A1 (en) * | 1991-10-11 | 1993-04-15 | Smithkline Beecham Corporation | Heterocyclic 3-phenylpyrrolidin-2-ones, their preparation and use for the manufacture of a medicament for inhibiting tumor necrosis factor production |
| JPH05201971A (ja) * | 1992-01-28 | 1993-08-10 | Hokuriku Seiyaku Co Ltd | 環状アミン含有ベンゼンスルホンアミド誘導体 |
| US5665754A (en) * | 1993-09-20 | 1997-09-09 | Glaxo Wellcome Inc. | Substituted pyrrolidines |
| WO1995008533A1 (en) * | 1993-09-21 | 1995-03-30 | Yamanouchi Pharmaceutical Co., Ltd. | N-(3-pyrrolidinyl)benzamide derivative |
| FR2714378B1 (fr) * | 1993-12-24 | 1996-03-15 | Sanofi Sa | Dérivés de l'indol-2-one substitués en 3 par un groupe azoté, leur préparation, les compositions pharmaceutiques en contenant. |
-
1995
- 1995-06-07 US US08/481,024 patent/US5612353A/en not_active Expired - Lifetime
-
1996
- 1996-06-07 SK SK1606-97A patent/SK160697A3/sk unknown
- 1996-06-07 BR BR9608405A patent/BR9608405A/pt not_active Application Discontinuation
- 1996-06-07 AP APAP/P/1997/001144A patent/AP799A/en active
- 1996-06-07 CN CN96194489A patent/CN1190395A/zh active Pending
- 1996-06-07 JP JP50202997A patent/JP4312829B2/ja not_active Expired - Fee Related
- 1996-06-07 CA CA002223403A patent/CA2223403C/en not_active Expired - Fee Related
- 1996-06-07 CZ CZ973853A patent/CZ385397A3/cs unknown
- 1996-06-07 AT AT96919298T patent/ATE520655T1/de not_active IP Right Cessation
- 1996-06-07 EA EA199800043A patent/EA000700B1/ru not_active IP Right Cessation
- 1996-06-07 EP EP96919298A patent/EP0853618B1/en not_active Expired - Lifetime
- 1996-06-07 WO PCT/US1996/009816 patent/WO1996040679A1/en not_active Ceased
- 1996-06-07 HU HU9801882A patent/HUP9801882A3/hu unknown
- 1996-06-07 AU AU61669/96A patent/AU714319B2/en not_active Ceased
- 1996-06-07 PL PL96323780A patent/PL323780A1/xx unknown
- 1996-06-07 SI SI9620093A patent/SI9620093A/sl unknown
- 1996-06-07 KR KR1019970708866A patent/KR100291711B1/ko not_active Expired - Fee Related
-
1997
- 1997-12-03 OA OA70149A patent/OA10752A/en unknown
- 1997-12-08 MX MX9709977A patent/MX9709977A/es not_active IP Right Cessation
- 1997-12-08 NO NO19975762A patent/NO310457B1/no unknown
-
1998
- 1998-01-06 BG BG102162A patent/BG63628B1/bg unknown
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4121947A1 (de) * | 1991-07-03 | 1993-01-07 | Basf Ag | 2-(3-(4-amidino-phenyl))-propionsaeurederivate, ihre herstellung und verwendung |
Non-Patent Citations (1)
| Title |
|---|
| Chemical Abstract, vol. 119, No. 2, Col. 1, Abstract 28,018n, (MACK) * |
Also Published As
| Publication number | Publication date |
|---|---|
| CZ385397A3 (cs) | 1999-05-12 |
| CN1190395A (zh) | 1998-08-12 |
| AP9701144A0 (en) | 1998-01-31 |
| BR9608405A (pt) | 1999-08-24 |
| NO975762L (no) | 1998-02-06 |
| EP0853618A4 (en) | 2000-03-15 |
| KR100291711B1 (ko) | 2001-09-17 |
| NO975762D0 (no) | 1997-12-08 |
| PL323780A1 (en) | 1998-04-27 |
| OA10752A (en) | 2001-07-04 |
| US5612353A (en) | 1997-03-18 |
| NO310457B1 (no) | 2001-07-09 |
| EA000700B1 (ru) | 2000-02-28 |
| SI9620093A (sl) | 1999-02-28 |
| AU714319B2 (en) | 2000-01-06 |
| BG63628B1 (bg) | 2002-07-31 |
| BG102162A (en) | 1998-09-30 |
| EA199800043A1 (ru) | 1998-08-27 |
| CA2223403C (en) | 2002-04-23 |
| MX9709977A (es) | 1998-07-31 |
| EP0853618A1 (en) | 1998-07-22 |
| WO1996040679A1 (en) | 1996-12-19 |
| HUP9801882A3 (en) | 1999-01-28 |
| KR19990022386A (ko) | 1999-03-25 |
| AU6166996A (en) | 1996-12-30 |
| JPH11507368A (ja) | 1999-06-29 |
| JP4312829B2 (ja) | 2009-08-12 |
| ATE520655T1 (de) | 2011-09-15 |
| CA2223403A1 (en) | 1996-12-19 |
| HUP9801882A2 (hu) | 1998-12-28 |
| EP0853618B1 (en) | 2011-08-17 |
| SK160697A3 (en) | 1998-11-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AP799A (en) | Substituted (sulfinic acid, sulfonic acid, sulfonylamino or sulfinylamino) N-[(aminoiminomethyl) phenylalkyl]-azaheterocyclylamide compounds. | |
| AP861A (en) | Substituted N-({Aminoiminomethyl or aminomethyl} phenyl] propyl amides. | |
| AP800A (en) | Substituted sulfonic acid n-[{aminoiminomethyl)phenylalkyl] -azaheterocyclamide compounds. | |
| AP1032A (en) | Sulfonic acid or sulfonylamino n-(Heterorlkyl)-zheterocyclylmie compounds. | |
| KR100630986B1 (ko) | 프로테아제 억제제 | |
| KR20010034442A (ko) | 치환된 옥소아자헤테로사이클릴 인자 Xa 억제제 | |
| WO2001039759A2 (en) | Sulfonic acid or sulfonylamino n-(heteroaralkyl)-azaheterocyclylamide compounds | |
| US6034093A (en) | Substituted sulfonic acid N-[(aminoiminomethyl)phenylalkyl]-azaheterocyclylamide compounds | |
| EP1086099A1 (en) | Sulfonic acid or sulfonylamino n-(heteroaralkyl)-azaheterocyclylamide compounds | |
| SK17592002A3 (sk) | 4-Amino-azepán-3-ónové zlúčeniny, spôsob ich prípravy, farmaceutický prostriedok s ich obsahom, ich použitie a medziprodukty | |
| US20040002487A1 (en) | Protease inhibitors | |
| US5958918A (en) | Substituted (sulfinic acid, sulfonic acid, sulfonylamino or sulfinylamino) N- (aminominomethyl)phenylalkyl!-azaheterocyclylamide compounds | |
| EP1384713A1 (en) | 4-amino-azepan-3-one derivatives as protease inhibitors | |
| AU2003261482B2 (en) | Protease inhibitors | |
| HK1035489A (en) | Substituted oxoazaheterocyclyl factor xa inhibitors | |
| MXPA01006613A (en) | Protease inhibitors |