OA10752A - Substituted (sulfinic acid sulfonic acid sulfonylamino or sulfinylamino) n-Ä(aminoiminomethyl) phenylalkylÜ-azaheterocyclylamide compounds - Google Patents
Substituted (sulfinic acid sulfonic acid sulfonylamino or sulfinylamino) n-Ä(aminoiminomethyl) phenylalkylÜ-azaheterocyclylamide compounds Download PDFInfo
- Publication number
- OA10752A OA10752A OA70149A OA70149A OA10752A OA 10752 A OA10752 A OA 10752A OA 70149 A OA70149 A OA 70149A OA 70149 A OA70149 A OA 70149A OA 10752 A OA10752 A OA 10752A
- Authority
- OA
- OAPI
- Prior art keywords
- oxopyrrolidin
- trifluoroacetate
- benzyl
- aminoiminomethyl
- sulfonic acid
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 title claims abstract description 656
- -1 sulfinylamino Chemical group 0.000 title claims description 224
- 108010074860 Factor Xa Proteins 0.000 claims abstract description 13
- 230000000694 effects Effects 0.000 claims abstract description 11
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract 2
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 claims description 272
- 229910052739 hydrogen Inorganic materials 0.000 claims description 247
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 187
- 239000002253 acid Substances 0.000 claims description 134
- 150000001408 amides Chemical class 0.000 claims description 119
- 239000001257 hydrogen Substances 0.000 claims description 60
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Natural products CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 56
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 claims description 53
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 53
- 125000000217 alkyl group Chemical group 0.000 claims description 49
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 47
- CKARHIGQRRNVFD-UHFFFAOYSA-N 7-methoxynaphthalene-2-sulfonic acid Chemical compound C1=CC(S(O)(=O)=O)=CC2=CC(OC)=CC=C21 CKARHIGQRRNVFD-UHFFFAOYSA-N 0.000 claims description 41
- 150000002431 hydrogen Chemical group 0.000 claims description 36
- 230000015572 biosynthetic process Effects 0.000 claims description 32
- 125000004475 heteroaralkyl group Chemical group 0.000 claims description 30
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 claims description 30
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims description 24
- 125000003118 aryl group Chemical group 0.000 claims description 23
- 238000000034 method Methods 0.000 claims description 21
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 20
- 125000001072 heteroaryl group Chemical group 0.000 claims description 20
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 17
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 15
- FOIKGWJGRNNGQP-UHFFFAOYSA-N 6-methoxynaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=CC2=CC(OC)=CC=C21 FOIKGWJGRNNGQP-UHFFFAOYSA-N 0.000 claims description 14
- 125000000440 benzylamino group Chemical group [H]N(*)C([H])([H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 12
- 125000003107 substituted aryl group Chemical group 0.000 claims description 12
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 claims description 11
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 11
- HPUKOXOQHIMLHG-MERQFXBCSA-N N[C@@H](CCN1CC2=CC(C=NN)=CC=C2)C1=O.OC(C(F)(F)F)=O Chemical compound N[C@@H](CCN1CC2=CC(C=NN)=CC=C2)C1=O.OC(C(F)(F)F)=O HPUKOXOQHIMLHG-MERQFXBCSA-N 0.000 claims description 10
- 125000003545 alkoxy group Chemical group 0.000 claims description 9
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 claims description 8
- 125000002252 acyl group Chemical group 0.000 claims description 8
- 125000000623 heterocyclic group Chemical group 0.000 claims description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 8
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 claims description 8
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 8
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 8
- QSELGEUCFNFITD-UHFFFAOYSA-N thiophene-2-carboximidamide Chemical compound NC(=N)C1=CC=CS1 QSELGEUCFNFITD-UHFFFAOYSA-N 0.000 claims description 8
- 125000001544 thienyl group Chemical group 0.000 claims description 7
- 125000006180 3-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C(=C1[H])C([H])([H])[H])C([H])([H])* 0.000 claims description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 6
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 6
- 238000002560 therapeutic procedure Methods 0.000 claims description 6
- GJJURAXVGOIXKG-UHFFFAOYSA-N 5-chloro-6,7-dimethoxynaphthalene-2-sulfonic acid Chemical compound OS(=O)(=O)C1=CC=C2C(Cl)=C(OC)C(OC)=CC2=C1 GJJURAXVGOIXKG-UHFFFAOYSA-N 0.000 claims description 5
- OKAUOXITMZTUOJ-UHFFFAOYSA-N 7-aminonaphthalene-2-sulfonic acid Chemical compound C1=CC(S(O)(=O)=O)=CC2=CC(N)=CC=C21 OKAUOXITMZTUOJ-UHFFFAOYSA-N 0.000 claims description 5
- 239000003146 anticoagulant agent Substances 0.000 claims description 5
- JWOCZCVIXWLBNG-UHFFFAOYSA-N benzenecarboximidamide;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.NC(=N)C1=CC=CC=C1 JWOCZCVIXWLBNG-UHFFFAOYSA-N 0.000 claims description 5
- 229910052799 carbon Inorganic materials 0.000 claims description 5
- GTCAXTIRRLKXRU-UHFFFAOYSA-N methyl carbamate Chemical group COC(N)=O GTCAXTIRRLKXRU-UHFFFAOYSA-N 0.000 claims description 5
- 125000006514 pyridin-2-ylmethyl group Chemical group [H]C1=C([H])C([H])=C([H])C(=N1)C([H])([H])* 0.000 claims description 5
- SEDIJOBQZYCMRX-UHFFFAOYSA-N 4,5-dichlorothiophene-2-sulfonic acid Chemical compound OS(=O)(=O)C1=CC(Cl)=C(Cl)S1 SEDIJOBQZYCMRX-UHFFFAOYSA-N 0.000 claims description 4
- GXWGRQOMOLFZDN-UHFFFAOYSA-N 5-chloro-3-methyl-1-benzothiophene-2-sulfonic acid Chemical compound C1=C(Cl)C=C2C(C)=C(S(O)(=O)=O)SC2=C1 GXWGRQOMOLFZDN-UHFFFAOYSA-N 0.000 claims description 4
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 125000001624 naphthyl group Chemical group 0.000 claims description 4
- 125000005346 substituted cycloalkyl group Chemical group 0.000 claims description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 claims description 4
- OEOCMBHDNUYLJG-UHFFFAOYSA-N 1-(1-oxidopyridin-1-ium-3-yl)cyclohexa-2,4-diene-1-sulfonic acid Chemical compound C=1C=C[N+]([O-])=CC=1C1(S(=O)(=O)O)CC=CC=C1 OEOCMBHDNUYLJG-UHFFFAOYSA-N 0.000 claims description 3
- 125000004847 2-fluorobenzyl group Chemical group [H]C1=C([H])C(F)=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- JLTUANWNGKWRQO-UHFFFAOYSA-N 5-chloro-3-methyl-1-benzothiophene-2-sulfonyl chloride Chemical group C1=C(Cl)C=C2C(C)=C(S(Cl)(=O)=O)SC2=C1 JLTUANWNGKWRQO-UHFFFAOYSA-N 0.000 claims description 3
- DLEXGQNBBCPGTH-UHFFFAOYSA-N 7-ethoxynaphthalene-2-sulfonic acid Chemical compound C1=CC(S(O)(=O)=O)=CC2=CC(OCC)=CC=C21 DLEXGQNBBCPGTH-UHFFFAOYSA-N 0.000 claims description 3
- MODKMHXGCGKTLE-UHFFFAOYSA-N N-acetylphenylethylamine Chemical compound CC(=O)NCCC1=CC=CC=C1 MODKMHXGCGKTLE-UHFFFAOYSA-N 0.000 claims description 3
- 150000001204 N-oxides Chemical class 0.000 claims description 3
- 208000007536 Thrombosis Diseases 0.000 claims description 3
- 230000001154 acute effect Effects 0.000 claims description 3
- 125000005078 alkoxycarbonylalkyl group Chemical group 0.000 claims description 3
- 230000002401 inhibitory effect Effects 0.000 claims description 3
- 230000002093 peripheral effect Effects 0.000 claims description 3
- KNXKVYCVGXFLES-UHFFFAOYSA-N pyridine-2-carboximidamide Chemical compound NC(=N)C1=CC=CC=N1 KNXKVYCVGXFLES-UHFFFAOYSA-N 0.000 claims description 3
- 230000002792 vascular Effects 0.000 claims description 3
- 210000005166 vasculature Anatomy 0.000 claims description 3
- HZKJAZKMSIAJRR-UHFFFAOYSA-N 1-(6-methoxypyridin-2-yl)cyclohexa-2,4-diene-1-sulfonic acid Chemical compound COC1=CC=CC(C2(C=CC=CC2)S(O)(=O)=O)=N1 HZKJAZKMSIAJRR-UHFFFAOYSA-N 0.000 claims description 2
- XPYLLZDJKWAGNP-NTISSMGPSA-N 4-[[(3s)-3-[benzyl-(4,5-dichlorothiophen-2-yl)sulfonylamino]-2-oxopyrrolidin-1-yl]methyl]thiophene-2-carboximidamide;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.S1C(C(=N)N)=CC(CN2C([C@@H](N(CC=3C=CC=CC=3)S(=O)(=O)C=3SC(Cl)=C(Cl)C=3)CC2)=O)=C1 XPYLLZDJKWAGNP-NTISSMGPSA-N 0.000 claims description 2
- 125000006181 4-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])C([H])([H])* 0.000 claims description 2
- GOSCQCGNFATPPM-FERBBOLQSA-N 5-[[(3s)-3-[(7-methoxynaphthalen-2-yl)sulfonylamino]-2-oxopyrrolidin-1-yl]methyl]thiophene-2-carboximidamide;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.C([C@@H](C1=O)NS(=O)(=O)C=2C=CC3=CC=C(C=C3C=2)OC)CN1CC1=CC=C(C(N)=N)S1 GOSCQCGNFATPPM-FERBBOLQSA-N 0.000 claims description 2
- QWZZUZAIHNZLEN-UHFFFAOYSA-N 5-pyridin-2-ylthiophene-2-sulfonic acid Chemical compound S1C(S(=O)(=O)O)=CC=C1C1=CC=CC=N1 QWZZUZAIHNZLEN-UHFFFAOYSA-N 0.000 claims description 2
- IMSZMAMIAUKQMV-UHFFFAOYSA-N 6,7-dimethoxynaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C2C=C(OC)C(OC)=CC2=C1 IMSZMAMIAUKQMV-UHFFFAOYSA-N 0.000 claims description 2
- 206010002388 Angina unstable Diseases 0.000 claims description 2
- 208000005189 Embolism Diseases 0.000 claims description 2
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 claims description 2
- 206010022562 Intermittent claudication Diseases 0.000 claims description 2
- UMQQZKPPZYVKBT-BDQAORGHSA-N N-[(3S)-1-[(3-methanehydrazonoylphenyl)methyl]-2-oxopyrrolidin-3-yl]quinoline-6-sulfonamide 2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.NN=CC1=CC=CC(CN2C([C@@H](NS(=O)(=O)C=3C=C4C=CC=NC4=CC=3)CC2)=O)=C1 UMQQZKPPZYVKBT-BDQAORGHSA-N 0.000 claims description 2
- 208000010378 Pulmonary Embolism Diseases 0.000 claims description 2
- 206010040070 Septic Shock Diseases 0.000 claims description 2
- 208000001435 Thromboembolism Diseases 0.000 claims description 2
- 208000007814 Unstable Angina Diseases 0.000 claims description 2
- 208000036142 Viral infection Diseases 0.000 claims description 2
- 230000002159 abnormal effect Effects 0.000 claims description 2
- 210000001367 artery Anatomy 0.000 claims description 2
- FWRPUWOMIWLQKH-UHFFFAOYSA-N benzenecarboximidamide;dihydrochloride Chemical compound Cl.Cl.NC(=N)C1=CC=CC=C1 FWRPUWOMIWLQKH-UHFFFAOYSA-N 0.000 claims description 2
- FUVVSNUVSKUJAS-UHFFFAOYSA-N furan-2-carboximidamide Chemical compound NC(=N)C1=CC=CO1 FUVVSNUVSKUJAS-UHFFFAOYSA-N 0.000 claims description 2
- 125000001475 halogen functional group Chemical group 0.000 claims description 2
- 201000004332 intermediate coronary syndrome Diseases 0.000 claims description 2
- 208000021156 intermittent vascular claudication Diseases 0.000 claims description 2
- 210000003127 knee Anatomy 0.000 claims description 2
- 230000007774 longterm Effects 0.000 claims description 2
- 210000003141 lower extremity Anatomy 0.000 claims description 2
- 238000012423 maintenance Methods 0.000 claims description 2
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 claims description 2
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 claims description 2
- 229940080818 propionamide Drugs 0.000 claims description 2
- 230000036303 septic shock Effects 0.000 claims description 2
- 238000001356 surgical procedure Methods 0.000 claims description 2
- 230000009885 systemic effect Effects 0.000 claims description 2
- LDJAAPXNPMYLFA-UHFFFAOYSA-N thiophene-2-carboximidamide;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.NC(=N)C1=CC=CS1 LDJAAPXNPMYLFA-UHFFFAOYSA-N 0.000 claims description 2
- 230000002537 thrombolytic effect Effects 0.000 claims description 2
- 230000001052 transient effect Effects 0.000 claims description 2
- 210000003462 vein Anatomy 0.000 claims description 2
- 230000009385 viral infection Effects 0.000 claims description 2
- OYQYQSQKSQRLFR-YCBFMBTMSA-N 2-[[(3s)-1-[(5-carbamimidoylthiophen-3-yl)methyl]-2-oxopyrrolidin-3-yl]-(7-methoxynaphthalen-2-yl)sulfonylamino]-n-(2-phenylethyl)acetamide;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.C=1C2=CC(OC)=CC=C2C=CC=1S(=O)(=O)N([C@@H]1C(N(CC=2C=C(SC=2)C(N)=N)CC1)=O)CC(=O)NCCC1=CC=CC=C1 OYQYQSQKSQRLFR-YCBFMBTMSA-N 0.000 claims 2
- SGPGESCZOCHFCL-UHFFFAOYSA-N Tilisolol hydrochloride Chemical compound [Cl-].C1=CC=C2C(=O)N(C)C=C(OCC(O)C[NH2+]C(C)(C)C)C2=C1 SGPGESCZOCHFCL-UHFFFAOYSA-N 0.000 claims 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims 2
- PNQPQIIGGUWDPR-UHFFFAOYSA-N 1-(3-chloropyridin-2-yl)oxycyclohexa-2,4-diene-1-sulfonic acid Chemical compound N=1C=CC=C(Cl)C=1OC1(S(=O)(=O)O)CC=CC=C1 PNQPQIIGGUWDPR-UHFFFAOYSA-N 0.000 claims 1
- KQYGFKRYWDRQQV-BDQAORGHSA-N 2-[[(3s)-1-[(4-carbamimidoylthiophen-2-yl)methyl]-2-oxopyrrolidin-3-yl]-(7-methoxynaphthalen-2-yl)sulfonylamino]acetamide;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.C([C@@H](C1=O)N(CC(N)=O)S(=O)(=O)C=2C=CC3=CC=C(C=C3C=2)OC)CN1CC1=CC(C(N)=N)=CS1 KQYGFKRYWDRQQV-BDQAORGHSA-N 0.000 claims 1
- KKPUHYNHYFSGJU-FERBBOLQSA-N 3-[[(3s)-2-oxo-3-(2-phenylethylsulfonylamino)pyrrolidin-1-yl]methyl]benzenecarboximidamide;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.NC(=N)C1=CC=CC(CN2C([C@@H](NS(=O)(=O)CCC=3C=CC=CC=3)CC2)=O)=C1 KKPUHYNHYFSGJU-FERBBOLQSA-N 0.000 claims 1
- 125000006284 3-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(F)=C1[H])C([H])([H])* 0.000 claims 1
- ITSMLVBLBSCNPN-UHFFFAOYSA-N 4-(2-methoxyphenyl)benzenesulfonic acid Chemical compound COC1=CC=CC=C1C1=CC=C(S(O)(=O)=O)C=C1 ITSMLVBLBSCNPN-UHFFFAOYSA-N 0.000 claims 1
- ADAKMYBJTQFVMB-UHFFFAOYSA-N 4-(3-methylphenyl)benzenesulfonic acid Chemical compound CC1=CC=CC(C=2C=CC(=CC=2)S(O)(=O)=O)=C1 ADAKMYBJTQFVMB-UHFFFAOYSA-N 0.000 claims 1
- YRDOJWMRCBPRCU-RMRYJAPISA-N 4-[[(3s)-3-[(6-aminonaphthalen-2-yl)sulfonylamino]-2-oxopyrrolidin-1-yl]methyl]thiophene-2-carboximidamide;dihydrochloride Chemical compound Cl.Cl.S1C(C(=N)N)=CC(CN2C([C@@H](NS(=O)(=O)C=3C=C4C=CC(N)=CC4=CC=3)CC2)=O)=C1 YRDOJWMRCBPRCU-RMRYJAPISA-N 0.000 claims 1
- NVHBZASBXMXHOU-ASMAMLKCSA-N 4-[[(3s)-3-[(7-aminonaphthalen-2-yl)sulfonyl-benzylamino]-2-oxopyrrolidin-1-yl]methyl]thiophene-2-carboximidamide;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.OC(=O)C(F)(F)F.S1C(C(=N)N)=CC(CN2C([C@@H](N(CC=3C=CC=CC=3)S(=O)(=O)C=3C=C4C=C(N)C=CC4=CC=3)CC2)=O)=C1 NVHBZASBXMXHOU-ASMAMLKCSA-N 0.000 claims 1
- BKODMNIABFWKMF-NRFANRHFSA-N 4-amino-3-[[(3s)-3-[(7-methoxynaphthalen-2-yl)sulfonylamino]-2-oxopyrrolidin-1-yl]methyl]benzenecarboximidamide Chemical compound C([C@@H](C1=O)NS(=O)(=O)C=2C=CC3=CC=C(C=C3C=2)OC)CN1CC1=CC(C(N)=N)=CC=C1N BKODMNIABFWKMF-NRFANRHFSA-N 0.000 claims 1
- CTEWUQNEQPLMMJ-UHFFFAOYSA-N 5,6,7,8-tetrahydronaphthalene-2-sulfonic acid Chemical compound C1CCCC2=CC(S(=O)(=O)O)=CC=C21 CTEWUQNEQPLMMJ-UHFFFAOYSA-N 0.000 claims 1
- BLKOSTJSUMJMSR-UHFFFAOYSA-N 5-chlorothiophene-2-sulfonic acid Chemical compound OS(=O)(=O)C1=CC=C(Cl)S1 BLKOSTJSUMJMSR-UHFFFAOYSA-N 0.000 claims 1
- AAQLVLMRJCRWNU-UHFFFAOYSA-N 6-chloro-6-(2-nitrophenoxy)cyclohexa-2,4-diene-1-sulfonic acid Chemical compound ClC1(C(C=CC=C1)S(=O)(=O)O)OC1=CC=CC=C1[N+](=O)[O-] AAQLVLMRJCRWNU-UHFFFAOYSA-N 0.000 claims 1
- LRYLPTQMSIXZGZ-UHFFFAOYSA-N 7-(methylamino)naphthalene-2-sulfonic acid Chemical compound C1=CC(S(O)(=O)=O)=CC2=CC(NC)=CC=C21 LRYLPTQMSIXZGZ-UHFFFAOYSA-N 0.000 claims 1
- AMTXWXZUNMMYFQ-UHFFFAOYSA-N 7-ethylnaphthalene-2-sulfonic acid Chemical compound C1=CC(S(O)(=O)=O)=CC2=CC(CC)=CC=C21 AMTXWXZUNMMYFQ-UHFFFAOYSA-N 0.000 claims 1
- QLROFPQYNZPJHK-FYZYNONXSA-N FC(C(=O)O)(F)F.COC1=CC=C2C=CC(=CC2=C1)S(=O)(=O)CN[C@@H]1C(N(CC1)CC1=CC=C(S1)C(=N)N)=O Chemical compound FC(C(=O)O)(F)F.COC1=CC=C2C=CC(=CC2=C1)S(=O)(=O)CN[C@@H]1C(N(CC1)CC1=CC=C(S1)C(=N)N)=O QLROFPQYNZPJHK-FYZYNONXSA-N 0.000 claims 1
- MFBILERJKRDWIH-FGJQBABTSA-N FC(C(=O)O)(F)F.FC(C(=O)O)(F)F.NN=CC=1C=C(CN2C([C@H](CC2)NS(=O)(=O)C2=CC3=CC(=CC=C3C=C2)N)=O)C=CC1 Chemical compound FC(C(=O)O)(F)F.FC(C(=O)O)(F)F.NN=CC=1C=C(CN2C([C@H](CC2)NS(=O)(=O)C2=CC3=CC(=CC=C3C=C2)N)=O)C=CC1 MFBILERJKRDWIH-FGJQBABTSA-N 0.000 claims 1
- COGJBLGCWBGBOA-FJSYBICCSA-N FC(C(=O)O)(F)F.FC(C(=O)O)(F)F.NN=CC=1C=C(CN2C([C@H](CC2)NS(=O)(=O)C2=CC3=CC=C(C(=C3C=C2)Cl)N)=O)C=CC1 Chemical compound FC(C(=O)O)(F)F.FC(C(=O)O)(F)F.NN=CC=1C=C(CN2C([C@H](CC2)NS(=O)(=O)C2=CC3=CC=C(C(=C3C=C2)Cl)N)=O)C=CC1 COGJBLGCWBGBOA-FJSYBICCSA-N 0.000 claims 1
- DGTUVYAXDYEJJL-JMAPEOGHSA-N FC(C(=O)O)(F)F.NN=CC=1C=C(CN2C([C@H](CC2)N(S(=O)(=O)C2=CC3=CC(=CC=C3C=C2)OC)CC2=C(C=CC=C2)[N+](=O)[O-])=O)C=CC1 Chemical compound FC(C(=O)O)(F)F.NN=CC=1C=C(CN2C([C@H](CC2)N(S(=O)(=O)C2=CC3=CC(=CC=C3C=C2)OC)CC2=C(C=CC=C2)[N+](=O)[O-])=O)C=CC1 DGTUVYAXDYEJJL-JMAPEOGHSA-N 0.000 claims 1
- NDKCBVHFROZHSR-JMAPEOGHSA-N FC(C(=O)O)(F)F.NN=CC=1C=C(CN2C([C@H](CC2)N(S(=O)(=O)C2=CC3=CC(=CC=C3C=C2)OC)CC2=CC=C(C=C2)[N+](=O)[O-])=O)C=CC1 Chemical compound FC(C(=O)O)(F)F.NN=CC=1C=C(CN2C([C@H](CC2)N(S(=O)(=O)C2=CC3=CC(=CC=C3C=C2)OC)CC2=CC=C(C=C2)[N+](=O)[O-])=O)C=CC1 NDKCBVHFROZHSR-JMAPEOGHSA-N 0.000 claims 1
- MTSLBGOYZKKCAD-BOXHHOBZSA-N FC(C(=O)O)(F)F.NN=CC=1C=C(CN2C([C@H](CC2)NS(=O)(=O)C2=CC3=CC=C(C=C3C=C2)O)=O)C=CC1 Chemical compound FC(C(=O)O)(F)F.NN=CC=1C=C(CN2C([C@H](CC2)NS(=O)(=O)C2=CC3=CC=C(C=C3C=C2)O)=O)C=CC1 MTSLBGOYZKKCAD-BOXHHOBZSA-N 0.000 claims 1
- 206010061216 Infarction Diseases 0.000 claims 1
- LKLRSOMXHGHIES-BOXHHOBZSA-N N-[(3S)-1-[(3-methanehydrazonoylphenyl)methyl]-2-oxoazetidin-3-yl]-7-methoxynaphthalene-2-sulfonamide 2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.C([C@@H](C1=O)NS(=O)(=O)C=2C=CC3=CC=C(C=C3C=2)OC)N1CC1=CC=CC(C=NN)=C1 LKLRSOMXHGHIES-BOXHHOBZSA-N 0.000 claims 1
- KMVPPBBMGRYJGU-GPZZPYCBSA-N N-[(3S)-1-[(3-methanehydrazonoylphenyl)methyl]-2-oxopyrrolidin-3-yl]-9,10-dioxo-8a,10a-dihydroanthracene-2-sulfonamide 2,2,2-trifluoroacetic acid Chemical compound FC(C(=O)O)(F)F.NN=CC=1C=C(CN2C([C@H](CC2)NS(=O)(=O)C2=CC=3C(C4C=CC=CC4C(C3C=C2)=O)=O)=O)C=CC1 KMVPPBBMGRYJGU-GPZZPYCBSA-N 0.000 claims 1
- PEEMLQRBMFADOG-BDQAORGHSA-N N-[(3S)-1-[(3-methanehydrazonoylphenyl)methyl]-2-oxopyrrolidin-3-yl]benzo[f][1,3]benzodioxole-6-sulfonamide 2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.NN=CC1=CC=CC(CN2C([C@@H](NS(=O)(=O)C=3C=C4C=C5OCOC5=CC4=CC=3)CC2)=O)=C1 PEEMLQRBMFADOG-BDQAORGHSA-N 0.000 claims 1
- HTGHPBDLIFOCHF-UHFFFAOYSA-N N-[1-[(3-methanehydrazonoylphenyl)methyl]-5-oxopyrrolidin-3-yl]dibenzofuran-2-sulfonamide 2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.NN=CC1=CC=CC(CN2C(CC(C2)NS(=O)(=O)C=2C=C3C4=CC=CC=C4OC3=CC=2)=O)=C1 HTGHPBDLIFOCHF-UHFFFAOYSA-N 0.000 claims 1
- UDHROQKVOJQESK-JCOPYZAKSA-N N-benzyl-N-[(3S)-1-[(3-methanehydrazonoylphenyl)methyl]-2-oxoazetidin-3-yl]-7-methoxynaphthalene-2-sulfonamide 2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.C=1C2=CC(OC)=CC=C2C=CC=1S(=O)(=O)N([C@@H]1C(N(CC=2C=C(C=NN)C=CC=2)C1)=O)CC1=CC=CC=C1 UDHROQKVOJQESK-JCOPYZAKSA-N 0.000 claims 1
- PSMSAULBRKZYPJ-JIDHJSLPSA-N OC(=O)C(F)(F)F.COC1=CC=CC(C=2C=CC(=CC=2)S(=O)(=O)N[C@@H]2C(N(CC=3C=C(C=NN)C=CC=3)CC2)=O)=C1 Chemical compound OC(=O)C(F)(F)F.COC1=CC=CC(C=2C=CC(=CC=2)S(=O)(=O)N[C@@H]2C(N(CC=3C=C(C=NN)C=CC=3)CC2)=O)=C1 PSMSAULBRKZYPJ-JIDHJSLPSA-N 0.000 claims 1
- PPWIGVRIZVXAMY-AXESWQTNSA-N OC(=O)C(F)(F)F.NN=CC1=CC=CC(CN2C([C@@H](NS(=O)(=O)C3(C=CC=CC3)OC=3C=CC=CC=3)CC2)=O)=C1 Chemical compound OC(=O)C(F)(F)F.NN=CC1=CC=CC(CN2C([C@@H](NS(=O)(=O)C3(C=CC=CC3)OC=3C=CC=CC=3)CC2)=O)=C1 PPWIGVRIZVXAMY-AXESWQTNSA-N 0.000 claims 1
- 230000003187 abdominal effect Effects 0.000 claims 1
- 210000005249 arterial vasculature Anatomy 0.000 claims 1
- PXXJHWLDUBFPOL-UHFFFAOYSA-N benzamidine Chemical compound NC(=N)C1=CC=CC=C1 PXXJHWLDUBFPOL-UHFFFAOYSA-N 0.000 claims 1
- 238000007887 coronary angioplasty Methods 0.000 claims 1
- 238000001631 haemodialysis Methods 0.000 claims 1
- 230000000322 hemodialysis Effects 0.000 claims 1
- 230000007574 infarction Effects 0.000 claims 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 claims 1
- OOXFGQNCCMTCSO-LMOVPXPDSA-N n-benzyl-2-[[(3s)-1-[(5-carbamimidoylthiophen-3-yl)methyl]-2-oxopyrrolidin-3-yl]-(4,5-dichlorothiophen-2-yl)sulfonylamino]acetamide;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.S1C(C(=N)N)=CC(CN2C([C@@H](N(CC(=O)NCC=3C=CC=CC=3)S(=O)(=O)C=3SC(Cl)=C(Cl)C=3)CC2)=O)=C1 OOXFGQNCCMTCSO-LMOVPXPDSA-N 0.000 claims 1
- VJBWAKTUJKTYRA-UHFFFAOYSA-N pyridine-2-carboximidamide 2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.NC(=N)c1ccccn1 VJBWAKTUJKTYRA-UHFFFAOYSA-N 0.000 claims 1
- 239000000203 mixture Substances 0.000 abstract description 113
- 239000003112 inhibitor Substances 0.000 abstract description 5
- 238000011282 treatment Methods 0.000 abstract description 5
- 230000001668 ameliorated effect Effects 0.000 abstract 1
- 230000000144 pharmacologic effect Effects 0.000 abstract 1
- 230000004962 physiological condition Effects 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 514
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 329
- 229910001868 water Inorganic materials 0.000 description 321
- 239000000243 solution Substances 0.000 description 310
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical class CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 297
- 235000019439 ethyl acetate Nutrition 0.000 description 255
- DTQVDTLACAAQTR-UHFFFAOYSA-N trifluoroacetic acid Substances OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 233
- 239000007787 solid Substances 0.000 description 220
- 239000012043 crude product Substances 0.000 description 214
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 193
- 229910052757 nitrogen Inorganic materials 0.000 description 186
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 122
- 239000000047 product Substances 0.000 description 122
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 106
- 238000004007 reversed phase HPLC Methods 0.000 description 95
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 87
- 238000004440 column chromatography Methods 0.000 description 87
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 84
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 80
- 238000000921 elemental analysis Methods 0.000 description 71
- 239000012044 organic layer Substances 0.000 description 69
- 238000005160 1H NMR spectroscopy Methods 0.000 description 68
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 68
- 239000006260 foam Substances 0.000 description 63
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 59
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 58
- 229920006395 saturated elastomer Polymers 0.000 description 57
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 54
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 50
- 239000011734 sodium Substances 0.000 description 47
- 229910052708 sodium Inorganic materials 0.000 description 46
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 44
- 239000007858 starting material Substances 0.000 description 43
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 42
- 235000019341 magnesium sulphate Nutrition 0.000 description 42
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 41
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 41
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 40
- 229960000583 acetic acid Drugs 0.000 description 39
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 37
- 239000011541 reaction mixture Substances 0.000 description 35
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 30
- 150000001409 amidines Chemical class 0.000 description 30
- 239000000543 intermediate Substances 0.000 description 30
- 239000010410 layer Substances 0.000 description 27
- 239000003921 oil Substances 0.000 description 27
- 235000019198 oils Nutrition 0.000 description 27
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 26
- 150000003839 salts Chemical class 0.000 description 25
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 24
- CEIPQQODRKXDSB-UHFFFAOYSA-N ethyl 3-(6-hydroxynaphthalen-2-yl)-1H-indazole-5-carboximidate dihydrochloride Chemical compound Cl.Cl.C1=C(O)C=CC2=CC(C3=NNC4=CC=C(C=C43)C(=N)OCC)=CC=C21 CEIPQQODRKXDSB-UHFFFAOYSA-N 0.000 description 23
- 238000006243 chemical reaction Methods 0.000 description 21
- 238000010992 reflux Methods 0.000 description 19
- 229940086542 triethylamine Drugs 0.000 description 19
- 238000004458 analytical method Methods 0.000 description 18
- 238000004587 chromatography analysis Methods 0.000 description 18
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 17
- OKKJLVBELUTLKV-MZCSYVLQSA-N Deuterated methanol Chemical compound [2H]OC([2H])([2H])[2H] OKKJLVBELUTLKV-MZCSYVLQSA-N 0.000 description 16
- BHHGXPLMPWCGHP-UHFFFAOYSA-N Phenethylamine Chemical compound NCCC1=CC=CC=C1 BHHGXPLMPWCGHP-UHFFFAOYSA-N 0.000 description 16
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 16
- 239000013058 crude material Substances 0.000 description 14
- 238000000746 purification Methods 0.000 description 14
- QYCDJXYAIDWYFK-UHFFFAOYSA-N 6-methoxynaphthalene-2-sulfonyl chloride Chemical compound C1=C(S(Cl)(=O)=O)C=CC2=CC(OC)=CC=C21 QYCDJXYAIDWYFK-UHFFFAOYSA-N 0.000 description 12
- 239000002585 base Substances 0.000 description 12
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 12
- ZHASTWZTZMFNOJ-MERQFXBCSA-N 3-[[(3s)-3-amino-2-oxopyrrolidin-1-yl]methyl]benzonitrile;hydrochloride Chemical compound Cl.O=C1[C@@H](N)CCN1CC1=CC=CC(C#N)=C1 ZHASTWZTZMFNOJ-MERQFXBCSA-N 0.000 description 11
- 125000005843 halogen group Chemical group 0.000 description 11
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 11
- 229910000104 sodium hydride Inorganic materials 0.000 description 11
- 238000003756 stirring Methods 0.000 description 11
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 11
- HCDMJFOHIXMBOV-UHFFFAOYSA-N 3-(2,6-difluoro-3,5-dimethoxyphenyl)-1-ethyl-8-(morpholin-4-ylmethyl)-4,7-dihydropyrrolo[4,5]pyrido[1,2-d]pyrimidin-2-one Chemical compound C=1C2=C3N(CC)C(=O)N(C=4C(=C(OC)C=C(OC)C=4F)F)CC3=CN=C2NC=1CN1CCOCC1 HCDMJFOHIXMBOV-UHFFFAOYSA-N 0.000 description 10
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 10
- 239000000725 suspension Substances 0.000 description 10
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- ZEXCZHWVXMIOFB-UHFFFAOYSA-N 7-methoxynaphthalene-2-sulfonyl chloride Chemical compound C1=CC(S(Cl)(=O)=O)=CC2=CC(OC)=CC=C21 ZEXCZHWVXMIOFB-UHFFFAOYSA-N 0.000 description 8
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 8
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 8
- 235000011054 acetic acid Nutrition 0.000 description 8
- 230000001476 alcoholic effect Effects 0.000 description 8
- MGJXBDMLVWIYOQ-UHFFFAOYSA-N methylazanide Chemical compound [NH-]C MGJXBDMLVWIYOQ-UHFFFAOYSA-N 0.000 description 8
- KVBGVZZKJNLNJU-UHFFFAOYSA-N naphthalene-2-sulfonic acid Chemical compound C1=CC=CC2=CC(S(=O)(=O)O)=CC=C21 KVBGVZZKJNLNJU-UHFFFAOYSA-N 0.000 description 8
- 229940117803 phenethylamine Drugs 0.000 description 8
- 229910000029 sodium carbonate Inorganic materials 0.000 description 8
- 235000017550 sodium carbonate Nutrition 0.000 description 8
- 239000012312 sodium hydride Substances 0.000 description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 7
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 7
- 235000011114 ammonium hydroxide Nutrition 0.000 description 7
- KXDHJXZQYSOELW-UHFFFAOYSA-N carbonic acid monoamide Natural products NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 7
- 150000002148 esters Chemical class 0.000 description 7
- 239000012458 free base Substances 0.000 description 7
- 239000007789 gas Substances 0.000 description 7
- 239000003960 organic solvent Substances 0.000 description 7
- KJAMZCVTJDTESW-UHFFFAOYSA-N tiracizine Chemical compound C1CC2=CC=CC=C2N(C(=O)CN(C)C)C2=CC(NC(=O)OCC)=CC=C21 KJAMZCVTJDTESW-UHFFFAOYSA-N 0.000 description 7
- URGYOOCIIWNIEX-NSHDSACASA-N 3-[[(3s)-3-amino-2-oxopyrrolidin-1-yl]methyl]benzonitrile Chemical compound O=C1[C@@H](N)CCN1CC1=CC=CC(C#N)=C1 URGYOOCIIWNIEX-NSHDSACASA-N 0.000 description 6
- MVEOHWRUBFWKJY-UHFFFAOYSA-N 7-hydroxynaphthalene-2-sulfonic acid Chemical compound C1=CC(S(O)(=O)=O)=CC2=CC(O)=CC=C21 MVEOHWRUBFWKJY-UHFFFAOYSA-N 0.000 description 6
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 6
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 150000001412 amines Chemical class 0.000 description 6
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 6
- 238000004128 high performance liquid chromatography Methods 0.000 description 6
- WUEQPLNKVFNLRV-QFIPXVFZSA-N n-[(3s)-1-[(3-cyanophenyl)methyl]-2-oxopyrrolidin-3-yl]-7-methoxynaphthalene-2-sulfonamide Chemical compound C([C@@H](C1=O)NS(=O)(=O)C=2C=CC3=CC=C(C=C3C=2)OC)CN1CC1=CC=CC(C#N)=C1 WUEQPLNKVFNLRV-QFIPXVFZSA-N 0.000 description 6
- 229910052760 oxygen Inorganic materials 0.000 description 6
- 239000002244 precipitate Substances 0.000 description 6
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 5
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical class CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 5
- 125000004432 carbon atom Chemical group C* 0.000 description 5
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 5
- 239000006185 dispersion Substances 0.000 description 5
- 238000010438 heat treatment Methods 0.000 description 5
- 239000005457 ice water Substances 0.000 description 5
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 5
- OPECTNGATDYLSS-UHFFFAOYSA-N naphthalene-2-sulfonyl chloride Chemical compound C1=CC=CC2=CC(S(=O)(=O)Cl)=CC=C21 OPECTNGATDYLSS-UHFFFAOYSA-N 0.000 description 5
- 239000012074 organic phase Substances 0.000 description 5
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 5
- 125000004076 pyridyl group Chemical group 0.000 description 5
- LFKDJXLFVYVEFG-UHFFFAOYSA-N tert-butyl carbamate Chemical compound CC(C)(C)OC(N)=O LFKDJXLFVYVEFG-UHFFFAOYSA-N 0.000 description 5
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 5
- BSXLLFUSNQCWJP-UHFFFAOYSA-N thiophene-2-sulfonic acid Chemical compound OS(=O)(=O)C1=CC=CS1 BSXLLFUSNQCWJP-UHFFFAOYSA-N 0.000 description 5
- LUGQQBPUAULKPK-UHFFFAOYSA-N 7-methylnaphthalene-2-sulfonic acid Chemical compound C1=CC(S(O)(=O)=O)=CC2=CC(C)=CC=C21 LUGQQBPUAULKPK-UHFFFAOYSA-N 0.000 description 4
- BWJHJLINOYAPEG-HOTGVXAUSA-N 8-chloro-6-[(6-chloropyridin-3-yl)methyl]-3-[(1S,2S)-2-hydroxycyclopentyl]-7-methyl-2H-1,3-benzoxazin-4-one Chemical compound ClC1=C(C(=CC=2C(N(COC=21)[C@@H]1[C@H](CCC1)O)=O)CC=1C=NC(=CC=1)Cl)C BWJHJLINOYAPEG-HOTGVXAUSA-N 0.000 description 4
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- 241000206607 Porphyra umbilicalis Species 0.000 description 4
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 4
- MKUXAQIIEYXACX-UHFFFAOYSA-N aciclovir Chemical compound N1C(N)=NC(=O)C2=C1N(COCCO)C=N2 MKUXAQIIEYXACX-UHFFFAOYSA-N 0.000 description 4
- 125000004442 acylamino group Chemical group 0.000 description 4
- 230000006978 adaptation Effects 0.000 description 4
- 125000004414 alkyl thio group Chemical group 0.000 description 4
- 150000001450 anions Chemical class 0.000 description 4
- 239000003125 aqueous solvent Substances 0.000 description 4
- 125000004104 aryloxy group Chemical group 0.000 description 4
- JPYQFYIEOUVJDU-UHFFFAOYSA-N beclamide Chemical compound ClCCC(=O)NCC1=CC=CC=C1 JPYQFYIEOUVJDU-UHFFFAOYSA-N 0.000 description 4
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 4
- 229940092714 benzenesulfonic acid Drugs 0.000 description 4
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 4
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 4
- 230000005587 bubbling Effects 0.000 description 4
- 239000006227 byproduct Substances 0.000 description 4
- 230000003197 catalytic effect Effects 0.000 description 4
- 125000000753 cycloalkyl group Chemical group 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 4
- 125000002883 imidazolyl group Chemical group 0.000 description 4
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 4
- RLSSMJSEOOYNOY-UHFFFAOYSA-N m-cresol Chemical compound CC1=CC=CC(O)=C1 RLSSMJSEOOYNOY-UHFFFAOYSA-N 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 235000017557 sodium bicarbonate Nutrition 0.000 description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
- 239000012279 sodium borohydride Substances 0.000 description 4
- 229910000033 sodium borohydride Inorganic materials 0.000 description 4
- 239000012265 solid product Substances 0.000 description 4
- BNWCETAHAJSBFG-UHFFFAOYSA-N tert-butyl 2-bromoacetate Chemical compound CC(C)(C)OC(=O)CBr BNWCETAHAJSBFG-UHFFFAOYSA-N 0.000 description 4
- HJUGFYREWKUQJT-UHFFFAOYSA-N tetrabromomethane Chemical compound BrC(Br)(Br)Br HJUGFYREWKUQJT-UHFFFAOYSA-N 0.000 description 4
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 4
- LDRWTKQWSXGSTM-LBPRGKRZSA-N (3s)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-phenylmethoxybutanoic acid Chemical compound CC(C)(C)OC(=O)N[C@@H](CC(O)=O)C(=O)OCC1=CC=CC=C1 LDRWTKQWSXGSTM-LBPRGKRZSA-N 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- OIRHKGBNGGSCGS-UHFFFAOYSA-N 1-bromo-2-iodobenzene Chemical compound BrC1=CC=CC=C1I OIRHKGBNGGSCGS-UHFFFAOYSA-N 0.000 description 3
- HTDQSWDEWGSAMN-UHFFFAOYSA-N 1-bromo-2-methoxybenzene Chemical compound COC1=CC=CC=C1Br HTDQSWDEWGSAMN-UHFFFAOYSA-N 0.000 description 3
- LUZDYPLAQQGJEA-UHFFFAOYSA-N 2-Methoxynaphthalene Chemical compound C1=CC=CC2=CC(OC)=CC=C21 LUZDYPLAQQGJEA-UHFFFAOYSA-N 0.000 description 3
- QBWKPGNFQQJGFY-QLFBSQMISA-N 3-[(1r)-1-[(2r,6s)-2,6-dimethylmorpholin-4-yl]ethyl]-n-[6-methyl-3-(1h-pyrazol-4-yl)imidazo[1,2-a]pyrazin-8-yl]-1,2-thiazol-5-amine Chemical compound N1([C@H](C)C2=NSC(NC=3C4=NC=C(N4C=C(C)N=3)C3=CNN=C3)=C2)C[C@H](C)O[C@H](C)C1 QBWKPGNFQQJGFY-QLFBSQMISA-N 0.000 description 3
- IIGVTBXGSGACRA-UHFFFAOYSA-N 4-(3-methoxyphenyl)benzenesulfonic acid Chemical compound COC1=CC=CC(C=2C=CC(=CC=2)S(O)(=O)=O)=C1 IIGVTBXGSGACRA-UHFFFAOYSA-N 0.000 description 3
- VVPHSMHEYVOVLH-UHFFFAOYSA-N 6-hydroxynaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=CC2=CC(O)=CC=C21 VVPHSMHEYVOVLH-UHFFFAOYSA-N 0.000 description 3
- XFKLOCCEYJPASF-UHFFFAOYSA-N 7-(phenylmethoxycarbonylamino)naphthalene-2-sulfonic acid Chemical compound C=1C2=CC(S(=O)(=O)O)=CC=C2C=CC=1NC(=O)OCC1=CC=CC=C1 XFKLOCCEYJPASF-UHFFFAOYSA-N 0.000 description 3
- TUBMBNKCTWXIDO-UHFFFAOYSA-N 7-phenylmethoxynaphthalene-2-sulfonic acid Chemical compound C=1C2=CC(S(=O)(=O)O)=CC=C2C=CC=1OCC1=CC=CC=C1 TUBMBNKCTWXIDO-UHFFFAOYSA-N 0.000 description 3
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 3
- 239000005695 Ammonium acetate Substances 0.000 description 3
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 3
- 206010051055 Deep vein thrombosis Diseases 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- PMDCZENCAXMSOU-UHFFFAOYSA-N N-ethylacetamide Chemical compound CCNC(C)=O PMDCZENCAXMSOU-UHFFFAOYSA-N 0.000 description 3
- YLFNODYYOXOFJO-IDMXKUIJSA-N N[C@@H](CCN1CC2=CC(C=NN)=CC=C2)C1=O.OC(C(F)(F)F)=O.OC(C(F)(F)F)=O Chemical compound N[C@@H](CCN1CC2=CC(C=NN)=CC=C2)C1=O.OC(C(F)(F)F)=O.OC(C(F)(F)F)=O YLFNODYYOXOFJO-IDMXKUIJSA-N 0.000 description 3
- 239000007832 Na2SO4 Substances 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 3
- 229940043376 ammonium acetate Drugs 0.000 description 3
- 235000019257 ammonium acetate Nutrition 0.000 description 3
- 229940127219 anticoagulant drug Drugs 0.000 description 3
- 125000003435 aroyl group Chemical group 0.000 description 3
- 125000004659 aryl alkyl thio group Chemical group 0.000 description 3
- 125000005110 aryl thio group Chemical group 0.000 description 3
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 3
- 125000001246 bromo group Chemical group Br* 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 125000001309 chloro group Chemical group Cl* 0.000 description 3
- WBLIXGSTEMXDSM-UHFFFAOYSA-N chloromethane Chemical compound Cl[CH2] WBLIXGSTEMXDSM-UHFFFAOYSA-N 0.000 description 3
- 235000015165 citric acid Nutrition 0.000 description 3
- 229940125846 compound 25 Drugs 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 125000004122 cyclic group Chemical group 0.000 description 3
- JANFYPHFIPGYTQ-UHFFFAOYSA-N dibenzofuran-2-sulfonic acid Chemical compound C1=CC=C2C3=CC(S(=O)(=O)O)=CC=C3OC2=C1 JANFYPHFIPGYTQ-UHFFFAOYSA-N 0.000 description 3
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 3
- AEOCXXJPGCBFJA-UHFFFAOYSA-N ethionamide Chemical compound CCC1=CC(C(N)=S)=CC=N1 AEOCXXJPGCBFJA-UHFFFAOYSA-N 0.000 description 3
- 125000001153 fluoro group Chemical group F* 0.000 description 3
- 239000008241 heterogeneous mixture Substances 0.000 description 3
- BHEPBYXIRTUNPN-UHFFFAOYSA-N hydridophosphorus(.) (triplet) Chemical compound [PH] BHEPBYXIRTUNPN-UHFFFAOYSA-N 0.000 description 3
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 3
- UBJFKNSINUCEAL-UHFFFAOYSA-N lithium;2-methylpropane Chemical compound [Li+].C[C-](C)C UBJFKNSINUCEAL-UHFFFAOYSA-N 0.000 description 3
- 125000003564 m-cyanobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(C#N)=C1[H])C([H])([H])* 0.000 description 3
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 3
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 3
- 125000003373 pyrazinyl group Chemical group 0.000 description 3
- 125000006413 ring segment Chemical group 0.000 description 3
- 239000002002 slurry Substances 0.000 description 3
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- 125000005270 trialkylamine group Chemical group 0.000 description 3
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Substances C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 3
- VVYVRNHXYGKJND-LBPRGKRZSA-N (3S)-3-(aminomethyl)-1-[(3-methanehydrazonoylphenyl)methyl]pyrrolidin-2-one Chemical compound NC[C@H](CCN1CC2=CC(C=NN)=CC=C2)C1=O VVYVRNHXYGKJND-LBPRGKRZSA-N 0.000 description 2
- MGEKRXDJQFJADS-RXMQYKEDSA-N (3s)-2,2-diamino-3-methyl-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid Chemical compound OC(=O)C(N)(N)[C@H](C)C(=O)OC(C)(C)C MGEKRXDJQFJADS-RXMQYKEDSA-N 0.000 description 2
- BIKLVMHYAOBYOU-UHFFFAOYSA-N (7-ethylnaphthalen-2-yl)-trimethylstannane Chemical compound C1=CC([Sn](C)(C)C)=CC2=CC(CC)=CC=C21 BIKLVMHYAOBYOU-UHFFFAOYSA-N 0.000 description 2
- QPYAKZNEJWYGDQ-UHFFFAOYSA-N 1,2,3,4-tetrahydroisoquinoline-7-sulfonic acid Chemical compound C1CNCC2=CC(S(=O)(=O)O)=CC=C21 QPYAKZNEJWYGDQ-UHFFFAOYSA-N 0.000 description 2
- ABDDQTDRAHXHOC-QMMMGPOBSA-N 1-[(7s)-5,7-dihydro-4h-thieno[2,3-c]pyran-7-yl]-n-methylmethanamine Chemical compound CNC[C@@H]1OCCC2=C1SC=C2 ABDDQTDRAHXHOC-QMMMGPOBSA-N 0.000 description 2
- DVFZTLPDJYSVOQ-UHFFFAOYSA-N 1-bromo-4-(2-methoxyphenyl)benzene Chemical compound COC1=CC=CC=C1C1=CC=C(Br)C=C1 DVFZTLPDJYSVOQ-UHFFFAOYSA-N 0.000 description 2
- PAMIQIKDUOTOBW-UHFFFAOYSA-N 1-methylpiperidine Chemical compound CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 2
- GJUCEJSGLTUDBP-UHFFFAOYSA-N 2-ethyl-7-(trifluoromethylsulfonyl)naphthalene Chemical compound C1=CC(S(=O)(=O)C(F)(F)F)=CC2=CC(CC)=CC=C21 GJUCEJSGLTUDBP-UHFFFAOYSA-N 0.000 description 2
- UCPTZHVHPVIYTF-UHFFFAOYSA-N 2-methoxy-7-(trifluoromethylsulfonyl)naphthalene Chemical compound C1=CC(S(=O)(=O)C(F)(F)F)=CC2=CC(OC)=CC=C21 UCPTZHVHPVIYTF-UHFFFAOYSA-N 0.000 description 2
- ACXAMVZBGIWPPD-UHFFFAOYSA-N 2-methoxy-7-methylnaphthalene Chemical compound C1=CC(C)=CC2=CC(OC)=CC=C21 ACXAMVZBGIWPPD-UHFFFAOYSA-N 0.000 description 2
- ONYKPBAPJPKYGG-UHFFFAOYSA-N 2-methoxyquinoline-7-sulfonyl chloride Chemical compound C1=CC(S(Cl)(=O)=O)=CC2=NC(OC)=CC=C21 ONYKPBAPJPKYGG-UHFFFAOYSA-N 0.000 description 2
- ZTJLYUVAFAMUKO-UHFFFAOYSA-N 2-phenylethanesulfonic acid Chemical compound OS(=O)(=O)CCC1=CC=CC=C1 ZTJLYUVAFAMUKO-UHFFFAOYSA-N 0.000 description 2
- JMTMSDXUXJISAY-UHFFFAOYSA-N 2H-benzotriazol-4-ol Chemical compound OC1=CC=CC2=C1N=NN2 JMTMSDXUXJISAY-UHFFFAOYSA-N 0.000 description 2
- WHNQTHDJEZTVHS-UHFFFAOYSA-N 3-(1,3-benzothiazol-2-yl)propanoic acid Chemical compound C1=CC=C2SC(CCC(=O)O)=NC2=C1 WHNQTHDJEZTVHS-UHFFFAOYSA-N 0.000 description 2
- XFKPORAVEUOIRF-UHFFFAOYSA-N 3-(aminomethyl)benzonitrile Chemical compound NCC1=CC=CC(C#N)=C1 XFKPORAVEUOIRF-UHFFFAOYSA-N 0.000 description 2
- GVFOHJNNQYRBHO-LBPRGKRZSA-N 3-[[(3S)-3-(aminomethyl)-2-oxopyrrolidin-1-yl]methyl]benzonitrile Chemical compound O=C1[C@H](CN)CCN1CC1=CC=CC(C#N)=C1 GVFOHJNNQYRBHO-LBPRGKRZSA-N 0.000 description 2
- FPQOCCYRCZNLEJ-UHFFFAOYSA-N 3-fluoro-4-phenylbenzenesulfonic acid Chemical compound FC1=CC(S(=O)(=O)O)=CC=C1C1=CC=CC=C1 FPQOCCYRCZNLEJ-UHFFFAOYSA-N 0.000 description 2
- GYJBDJGUNDKZKO-UHFFFAOYSA-N 4-(4-bromophenyl)pyridine Chemical compound C1=CC(Br)=CC=C1C1=CC=NC=C1 GYJBDJGUNDKZKO-UHFFFAOYSA-N 0.000 description 2
- QREZLLYPLRPULF-UHFFFAOYSA-N 4-(aminomethyl)benzonitrile;hydron;chloride Chemical compound Cl.NCC1=CC=C(C#N)C=C1 QREZLLYPLRPULF-UHFFFAOYSA-N 0.000 description 2
- ZCUZLOPAPSNDRY-UHFFFAOYSA-N 4-(bromomethyl)thiophene-2-carbonitrile Chemical compound BrCC1=CSC(C#N)=C1 ZCUZLOPAPSNDRY-UHFFFAOYSA-N 0.000 description 2
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 2
- XDTYUYVIGLIFCW-UHFFFAOYSA-N 4-phenylbenzenesulfonic acid Chemical compound C1=CC(S(=O)(=O)O)=CC=C1C1=CC=CC=C1 XDTYUYVIGLIFCW-UHFFFAOYSA-N 0.000 description 2
- NUYLILFFMSAMHM-UHFFFAOYSA-N 4-pyridin-3-ylbenzenesulfonic acid Chemical compound C1=CC(S(=O)(=O)O)=CC=C1C1=CC=CN=C1 NUYLILFFMSAMHM-UHFFFAOYSA-N 0.000 description 2
- GOXDYXBTGGZHMD-UHFFFAOYSA-N 5-(bromomethyl)thiophene-2-carbonitrile Chemical compound BrCC1=CC=C(C#N)S1 GOXDYXBTGGZHMD-UHFFFAOYSA-N 0.000 description 2
- RRELHGZMPGGKMS-UHFFFAOYSA-N 5-chloro-6-methoxynaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=CC2=C(Cl)C(OC)=CC=C21 RRELHGZMPGGKMS-UHFFFAOYSA-N 0.000 description 2
- DKJVSIITPZVTRO-UHFFFAOYSA-N 6,7-dihydroxynaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C2C=C(O)C(O)=CC2=C1 DKJVSIITPZVTRO-UHFFFAOYSA-N 0.000 description 2
- JBXFALYHFAZOTL-UHFFFAOYSA-N 7-ethylnaphthalen-2-ol Chemical compound C1=CC(O)=CC2=CC(CC)=CC=C21 JBXFALYHFAZOTL-UHFFFAOYSA-N 0.000 description 2
- 239000004342 Benzoyl peroxide Substances 0.000 description 2
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 2
- 108090000790 Enzymes Proteins 0.000 description 2
- 102000004190 Enzymes Human genes 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- GMPKIPWJBDOURN-UHFFFAOYSA-N Methoxyamine Chemical compound CON GMPKIPWJBDOURN-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- 206010000891 acute myocardial infarction Diseases 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 125000003342 alkenyl group Chemical group 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 125000005239 aroylamino group Chemical group 0.000 description 2
- 125000002102 aryl alkyloxo group Chemical group 0.000 description 2
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 2
- METKIMKYRPQLGS-UHFFFAOYSA-N atenolol Chemical compound CC(C)NCC(O)COC1=CC=C(CC(N)=O)C=C1 METKIMKYRPQLGS-UHFFFAOYSA-N 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 235000019400 benzoyl peroxide Nutrition 0.000 description 2
- 125000004181 carboxyalkyl group Chemical group 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 230000015271 coagulation Effects 0.000 description 2
- 238000005345 coagulation Methods 0.000 description 2
- 229940125810 compound 20 Drugs 0.000 description 2
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 208000035475 disorder Diseases 0.000 description 2
- 229940088598 enzyme Drugs 0.000 description 2
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 2
- 238000004992 fast atom bombardment mass spectroscopy Methods 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 125000002541 furyl group Chemical group 0.000 description 2
- JAXFJECJQZDFJS-XHEPKHHKSA-N gtpl8555 Chemical compound OC(=O)C[C@H](N)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N1CCC[C@@H]1C(=O)N[C@H](B1O[C@@]2(C)[C@H]3C[C@H](C3(C)C)C[C@H]2O1)CCC1=CC=C(F)C=C1 JAXFJECJQZDFJS-XHEPKHHKSA-N 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 2
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 125000002346 iodo group Chemical group I* 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 229940098779 methanesulfonic acid Drugs 0.000 description 2
- QNDREFDLEDXGIL-UHFFFAOYSA-N methyl 2-[2-(bromomethyl)-4-cyanophenoxy]acetate Chemical group COC(=O)COC1=CC=C(C#N)C=C1CBr QNDREFDLEDXGIL-UHFFFAOYSA-N 0.000 description 2
- 150000004702 methyl esters Chemical class 0.000 description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- 239000004533 oil dispersion Substances 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- PLUQFBYKHVFHMZ-UHFFFAOYSA-N quinoline-6-sulfonic acid Chemical compound N1=CC=CC2=CC(S(=O)(=O)O)=CC=C21 PLUQFBYKHVFHMZ-UHFFFAOYSA-N 0.000 description 2
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 2
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 125000006296 sulfonyl amino group Chemical group [H]N(*)S(*)(=O)=O 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 2
- PZYLFTPEOMFQFJ-UHFFFAOYSA-N tert-butyl 3-(bromomethyl)pyrazole-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1C=CC(CBr)=N1 PZYLFTPEOMFQFJ-UHFFFAOYSA-N 0.000 description 2
- DVWCHAUBYVZILO-LURJTMIESA-N tert-butyl n-[(3s)-2-oxopyrrolidin-3-yl]carbamate Chemical compound CC(C)(C)OC(=O)N[C@H]1CCNC1=O DVWCHAUBYVZILO-LURJTMIESA-N 0.000 description 2
- DPKBAXPHAYBPRL-UHFFFAOYSA-M tetrabutylazanium;iodide Chemical compound [I-].CCCC[N+](CCCC)(CCCC)CCCC DPKBAXPHAYBPRL-UHFFFAOYSA-M 0.000 description 2
- LAWUZBKFMNSOGG-UHFFFAOYSA-N thiophene-2-carbonitrile Chemical compound N#CC1=CC=[C]S1 LAWUZBKFMNSOGG-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- WJKHJLXJJJATHN-UHFFFAOYSA-N triflic anhydride Chemical compound FC(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)F WJKHJLXJJJATHN-UHFFFAOYSA-N 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- 239000011592 zinc chloride Substances 0.000 description 2
- 235000005074 zinc chloride Nutrition 0.000 description 2
- APALRPYIDIBHQN-UHFFFAOYSA-N (1-phenylcyclopropyl)methanol Chemical compound C=1C=CC=CC=1C1(CO)CC1 APALRPYIDIBHQN-UHFFFAOYSA-N 0.000 description 1
- SOHLZANWVLCPHK-LBPRGKRZSA-N (2s)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-phenylmethoxybutanoic acid Chemical compound CC(C)(C)OC(=O)N[C@H](C(O)=O)CC(=O)OCC1=CC=CC=C1 SOHLZANWVLCPHK-LBPRGKRZSA-N 0.000 description 1
- FHOAKXBXYSJBGX-YFKPBYRVSA-N (2s)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound CC(C)(C)OC(=O)N[C@@H](CO)C(O)=O FHOAKXBXYSJBGX-YFKPBYRVSA-N 0.000 description 1
- BQWSRNKFRAPUAH-UHFFFAOYSA-N (3-cyanophenyl)methylazanium;chloride Chemical compound Cl.NCC1=CC=CC(C#N)=C1 BQWSRNKFRAPUAH-UHFFFAOYSA-N 0.000 description 1
- AAWZDTNXLSGCEK-LNVDRNJUSA-N (3r,5r)-1,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid Chemical compound O[C@@H]1CC(O)(C(O)=O)C[C@@H](O)C1O AAWZDTNXLSGCEK-LNVDRNJUSA-N 0.000 description 1
- HMTSWYPNXFHGEP-UHFFFAOYSA-N (4-methylphenyl)methanamine Chemical compound CC1=CC=C(CN)C=C1 HMTSWYPNXFHGEP-UHFFFAOYSA-N 0.000 description 1
- WXCKZIPNFFKNFY-UHFFFAOYSA-N (5-iodothiophen-3-yl)methanol Chemical compound OCC1=CSC(I)=C1 WXCKZIPNFFKNFY-UHFFFAOYSA-N 0.000 description 1
- MOWXJLUYGFNTAL-DEOSSOPVSA-N (s)-[2-chloro-4-fluoro-5-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-(6-methoxypyridazin-3-yl)methanol Chemical compound N1=NC(OC)=CC=C1[C@@H](O)C1=CC(C=2C3=CC=C(C=C3N=CN=2)N2CCOCC2)=C(F)C=C1Cl MOWXJLUYGFNTAL-DEOSSOPVSA-N 0.000 description 1
- PEZWXANTSFRABD-UHFFFAOYSA-N 1,2,3,4-tetrahydroisoquinoline-7-sulfonyl chloride;3,3,3-trifluoropropanamide Chemical compound NC(=O)CC(F)(F)F.C1CNCC2=CC(S(=O)(=O)Cl)=CC=C21 PEZWXANTSFRABD-UHFFFAOYSA-N 0.000 description 1
- FFWQLZFIMNTUCZ-UHFFFAOYSA-N 1-(bromomethyl)-2-fluorobenzene Chemical compound FC1=CC=CC=C1CBr FFWQLZFIMNTUCZ-UHFFFAOYSA-N 0.000 description 1
- HXBMIQJOSHZCFX-UHFFFAOYSA-N 1-(bromomethyl)-2-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1CBr HXBMIQJOSHZCFX-UHFFFAOYSA-N 0.000 description 1
- SCBZBMXPJYMXRC-UHFFFAOYSA-N 1-(bromomethyl)-3-fluorobenzene Chemical compound FC1=CC=CC(CBr)=C1 SCBZBMXPJYMXRC-UHFFFAOYSA-N 0.000 description 1
- ZKSOJQDNSNJIQW-UHFFFAOYSA-N 1-(bromomethyl)-3-methoxybenzene Chemical compound COC1=CC=CC(CBr)=C1 ZKSOJQDNSNJIQW-UHFFFAOYSA-N 0.000 description 1
- FWLWTILKTABGKQ-UHFFFAOYSA-N 1-(bromomethyl)-3-methylbenzene Chemical compound CC1=CC=CC(CBr)=C1 FWLWTILKTABGKQ-UHFFFAOYSA-N 0.000 description 1
- UAWVMPOAIVZWFQ-UHFFFAOYSA-N 1-(chloromethyl)-2-methoxybenzene Chemical compound COC1=CC=CC=C1CCl UAWVMPOAIVZWFQ-UHFFFAOYSA-N 0.000 description 1
- MOHYOXXOKFQHDC-UHFFFAOYSA-N 1-(chloromethyl)-4-methoxybenzene Chemical compound COC1=CC=C(CCl)C=C1 MOHYOXXOKFQHDC-UHFFFAOYSA-N 0.000 description 1
- PLDWAJLZAAHOGG-UHFFFAOYSA-N 1-bromo-3-methoxybenzene Chemical compound COC1=CC=CC(Br)=C1 PLDWAJLZAAHOGG-UHFFFAOYSA-N 0.000 description 1
- WJIFKOVZNJTSGO-UHFFFAOYSA-N 1-bromo-3-methylbenzene Chemical group CC1=CC=CC(Br)=C1 WJIFKOVZNJTSGO-UHFFFAOYSA-N 0.000 description 1
- WXRCHIFZEUELKP-UHFFFAOYSA-N 1-bromo-4-(2-methylphenyl)benzene Chemical group CC1=CC=CC=C1C1=CC=C(Br)C=C1 WXRCHIFZEUELKP-UHFFFAOYSA-N 0.000 description 1
- CRRUGYDDEMGVDY-UHFFFAOYSA-N 1-bromoethylbenzene Chemical compound CC(Br)C1=CC=CC=C1 CRRUGYDDEMGVDY-UHFFFAOYSA-N 0.000 description 1
- FZSKNVYPWYXIEV-UHFFFAOYSA-N 1-methoxynaphthalene-2-sulfonic acid Chemical compound C1=CC=C2C(OC)=C(S(O)(=O)=O)C=CC2=C1 FZSKNVYPWYXIEV-UHFFFAOYSA-N 0.000 description 1
- BPDGXUXLCACGBF-UHFFFAOYSA-N 1-methoxynaphthalene-2-sulfonyl chloride Chemical compound C1=CC=C2C(OC)=C(S(Cl)(=O)=O)C=CC2=C1 BPDGXUXLCACGBF-UHFFFAOYSA-N 0.000 description 1
- MCTWTZJPVLRJOU-UHFFFAOYSA-N 1-methyl-1H-imidazole Chemical compound CN1C=CN=C1 MCTWTZJPVLRJOU-UHFFFAOYSA-N 0.000 description 1
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 1
- 125000001088 1-naphthoyl group Chemical group C1(=CC=CC2=CC=CC=C12)C(=O)* 0.000 description 1
- GYGFCILLQYSSGE-UHFFFAOYSA-N 1-phenoxycyclohexa-2,4-diene-1-sulfonyl chloride Chemical compound C=1C=CC=CC=1OC1(S(=O)(=O)Cl)CC=CC=C1 GYGFCILLQYSSGE-UHFFFAOYSA-N 0.000 description 1
- IBSUZZVWXUSKLV-UHFFFAOYSA-N 1-pyridin-3-ylcyclohexa-2,4-diene-1-sulfonic acid Chemical compound C=1C=CN=CC=1C1(S(=O)(=O)O)CC=CC=C1 IBSUZZVWXUSKLV-UHFFFAOYSA-N 0.000 description 1
- MAKFMOSBBNKPMS-UHFFFAOYSA-N 2,3-dichloropyridine Chemical compound ClC1=CC=CN=C1Cl MAKFMOSBBNKPMS-UHFFFAOYSA-N 0.000 description 1
- SVDZWRPQYYCMGG-UHFFFAOYSA-N 2,4-diaminoquinazoline-6-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=CC2=NC(N)=NC(N)=C21 SVDZWRPQYYCMGG-UHFFFAOYSA-N 0.000 description 1
- NUMXHEUHHRTBQT-AATRIKPKSA-N 2,4-dimethoxy-1-[(e)-2-nitroethenyl]benzene Chemical compound COC1=CC=C(\C=C\[N+]([O-])=O)C(OC)=C1 NUMXHEUHHRTBQT-AATRIKPKSA-N 0.000 description 1
- WXTMDXOMEHJXQO-UHFFFAOYSA-N 2,5-dihydroxybenzoic acid Chemical class OC(=O)C1=CC(O)=CC=C1O WXTMDXOMEHJXQO-UHFFFAOYSA-N 0.000 description 1
- KJUCPVIVNLPLEE-UHFFFAOYSA-N 2,6-difluoro-n-[2-fluoro-5-[5-[2-[(6-morpholin-4-ylpyridin-3-yl)amino]pyrimidin-4-yl]-2-propan-2-yl-1,3-thiazol-4-yl]phenyl]benzenesulfonamide Chemical compound S1C(C(C)C)=NC(C=2C=C(NS(=O)(=O)C=3C(=CC=CC=3F)F)C(F)=CC=2)=C1C(N=1)=CC=NC=1NC(C=N1)=CC=C1N1CCOCC1 KJUCPVIVNLPLEE-UHFFFAOYSA-N 0.000 description 1
- HBXXUQHCYFAVSC-UHFFFAOYSA-N 2-(2-bromophenyl)-1-methylimidazole Chemical compound CN1C=CN=C1C1=CC=CC=C1Br HBXXUQHCYFAVSC-UHFFFAOYSA-N 0.000 description 1
- QIGHEIDADWLOKV-UHFFFAOYSA-N 2-(4-bromophenoxy)-3-chloropyridine Chemical compound ClC1=CC=CN=C1OC1=CC=C(Br)C=C1 QIGHEIDADWLOKV-UHFFFAOYSA-N 0.000 description 1
- RUHJZSZTSCSTCC-UHFFFAOYSA-N 2-(bromomethyl)naphthalene Chemical compound C1=CC=CC2=CC(CBr)=CC=C21 RUHJZSZTSCSTCC-UHFFFAOYSA-N 0.000 description 1
- NJWIMFZLESWFIM-UHFFFAOYSA-N 2-(chloromethyl)pyridine Chemical compound ClCC1=CC=CC=N1 NJWIMFZLESWFIM-UHFFFAOYSA-N 0.000 description 1
- WAFBTSBLIAENAA-UHFFFAOYSA-N 2-(pyridin-4-ylamino)ethanesulfonic acid Chemical compound OS(=O)(=O)CCNC1=CC=NC=C1 WAFBTSBLIAENAA-UHFFFAOYSA-N 0.000 description 1
- LMHHFZAXSANGGM-UHFFFAOYSA-N 2-aminoindane Chemical compound C1=CC=C2CC(N)CC2=C1 LMHHFZAXSANGGM-UHFFFAOYSA-N 0.000 description 1
- WDRQIRQQLSDLCC-UHFFFAOYSA-N 2-bromo-2,3,3-trimethylbutanoic acid Chemical compound CC(C)(C)C(C)(Br)C(O)=O WDRQIRQQLSDLCC-UHFFFAOYSA-N 0.000 description 1
- KMODISUYWZPVGV-UHFFFAOYSA-N 2-bromo-6-methoxypyridine Chemical compound COC1=CC=CC(Br)=N1 KMODISUYWZPVGV-UHFFFAOYSA-N 0.000 description 1
- APSMUYYLXZULMS-UHFFFAOYSA-N 2-bromonaphthalene Chemical compound C1=CC=CC2=CC(Br)=CC=C21 APSMUYYLXZULMS-UHFFFAOYSA-N 0.000 description 1
- MOSNJRVOAPAQPH-UHFFFAOYSA-N 2-butylquinoline-6-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=CC2=NC(CCCC)=CC=C21 MOSNJRVOAPAQPH-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- MAPNKMVPGLYBTD-UHFFFAOYSA-N 2-methoxynaphthalene;sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O.C1=CC=CC2=CC(OC)=CC=C21 MAPNKMVPGLYBTD-UHFFFAOYSA-N 0.000 description 1
- RKIVBXUNCCKPJO-UHFFFAOYSA-N 2-methoxyquinoline-7-sulfonic acid Chemical compound C1=CC(S(O)(=O)=O)=CC2=NC(OC)=CC=C21 RKIVBXUNCCKPJO-UHFFFAOYSA-N 0.000 description 1
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 1
- 125000001216 2-naphthoyl group Chemical group C1=C(C=CC2=CC=CC=C12)C(=O)* 0.000 description 1
- RIOSJKSGNLGONI-UHFFFAOYSA-N 2-phenylbenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1C1=CC=CC=C1 RIOSJKSGNLGONI-UHFFFAOYSA-N 0.000 description 1
- AGBXYHCHUYARJY-UHFFFAOYSA-N 2-phenylethenesulfonic acid Chemical compound OS(=O)(=O)C=CC1=CC=CC=C1 AGBXYHCHUYARJY-UHFFFAOYSA-N 0.000 description 1
- WMPPDTMATNBGJN-UHFFFAOYSA-N 2-phenylethylbromide Chemical compound BrCCC1=CC=CC=C1 WMPPDTMATNBGJN-UHFFFAOYSA-N 0.000 description 1
- FCHUOBPHXDXZBK-UHFFFAOYSA-N 3-(4-bromophenyl)pyridine Chemical compound C1=CC(Br)=CC=C1C1=CC=CN=C1 FCHUOBPHXDXZBK-UHFFFAOYSA-N 0.000 description 1
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 1
- MUHKGZHQILLUQB-UHFFFAOYSA-N 3-[(3-amino-2-oxopiperidin-1-yl)methyl]benzonitrile Chemical compound O=C1C(N)CCCN1CC1=CC=CC(C#N)=C1 MUHKGZHQILLUQB-UHFFFAOYSA-N 0.000 description 1
- WNEODWDFDXWOLU-QHCPKHFHSA-N 3-[3-(hydroxymethyl)-4-[1-methyl-5-[[5-[(2s)-2-methyl-4-(oxetan-3-yl)piperazin-1-yl]pyridin-2-yl]amino]-6-oxopyridin-3-yl]pyridin-2-yl]-7,7-dimethyl-1,2,6,8-tetrahydrocyclopenta[3,4]pyrrolo[3,5-b]pyrazin-4-one Chemical compound C([C@@H](N(CC1)C=2C=NC(NC=3C(N(C)C=C(C=3)C=3C(=C(N4C(C5=CC=6CC(C)(C)CC=6N5CC4)=O)N=CC=3)CO)=O)=CC=2)C)N1C1COC1 WNEODWDFDXWOLU-QHCPKHFHSA-N 0.000 description 1
- PSHKKVQYQIKXIF-LBPRGKRZSA-N 3-[[(3S)-3-(methylamino)-2-oxopyrrolidin-1-yl]methyl]benzonitrile Chemical compound O=C1[C@@H](NC)CCN1CC1=CC=CC(C#N)=C1 PSHKKVQYQIKXIF-LBPRGKRZSA-N 0.000 description 1
- IFCQEFCYYXFBPT-IBGZPJMESA-N 3-[[(3S)-3-[(4-methylphenyl)methylamino]-2-oxopyrrolidin-1-yl]methyl]benzonitrile Chemical compound C1=CC(C)=CC=C1CN[C@@H]1C(=O)N(CC=2C=C(C=CC=2)C#N)CC1 IFCQEFCYYXFBPT-IBGZPJMESA-N 0.000 description 1
- UNPIGVYJSNRGBR-UHFFFAOYSA-N 3-amino-5-methylbenzonitrile Chemical compound CC1=CC(N)=CC(C#N)=C1 UNPIGVYJSNRGBR-UHFFFAOYSA-N 0.000 description 1
- RUROFEVDCUGKHD-UHFFFAOYSA-N 3-bromoprop-1-enylbenzene Chemical compound BrCC=CC1=CC=CC=C1 RUROFEVDCUGKHD-UHFFFAOYSA-N 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- BDAQHLRPAUPBNA-UHFFFAOYSA-N 3-fluoro-4-phenylbenzenesulfonyl chloride Chemical group FC1=CC(S(Cl)(=O)=O)=CC=C1C1=CC=CC=C1 BDAQHLRPAUPBNA-UHFFFAOYSA-N 0.000 description 1
- HGZJJKZPPMFIBU-UHFFFAOYSA-N 3-formylbenzonitrile Chemical compound O=CC1=CC=CC(C#N)=C1 HGZJJKZPPMFIBU-UHFFFAOYSA-N 0.000 description 1
- 125000006291 3-hydroxybenzyl group Chemical group [H]OC1=C([H])C([H])=C([H])C(=C1[H])C([H])([H])* 0.000 description 1
- ZUSZZRPRXRPYAH-UHFFFAOYSA-N 3-methoxy-4-phenylbenzenesulfonyl chloride Chemical compound COC1=C(C=CC(=C1)S(=O)(=O)Cl)C1=CC=CC=C1 ZUSZZRPRXRPYAH-UHFFFAOYSA-N 0.000 description 1
- IHVNKSXTJZNBQA-UHFFFAOYSA-N 3-methyl-4-nitrobenzonitrile Chemical compound CC1=CC(C#N)=CC=C1[N+]([O-])=O IHVNKSXTJZNBQA-UHFFFAOYSA-N 0.000 description 1
- LYUQWQRTDLVQGA-UHFFFAOYSA-N 3-phenylpropylamine Chemical compound NCCCC1=CC=CC=C1 LYUQWQRTDLVQGA-UHFFFAOYSA-N 0.000 description 1
- YACPNVHTJGEYHQ-ZDUSSCGKSA-N 4,5-dichloro-n-[(3s)-1-[(3-cyanophenyl)methyl]-2-oxopyrrolidin-3-yl]thiophene-2-sulfonamide Chemical compound S1C(Cl)=C(Cl)C=C1S(=O)(=O)N[C@@H]1C(=O)N(CC=2C=C(C=CC=2)C#N)CC1 YACPNVHTJGEYHQ-ZDUSSCGKSA-N 0.000 description 1
- IVTWLTRKVRJPNG-UHFFFAOYSA-N 4,5-dichlorothiophene-2-sulfonyl chloride Chemical group ClC=1C=C(S(Cl)(=O)=O)SC=1Cl IVTWLTRKVRJPNG-UHFFFAOYSA-N 0.000 description 1
- XLFSJIGVCSPHDH-UHFFFAOYSA-N 4-(1-methylimidazol-2-yl)benzenesulfonyl chloride Chemical compound CN1C=CN=C1C1=CC=C(S(Cl)(=O)=O)C=C1 XLFSJIGVCSPHDH-UHFFFAOYSA-N 0.000 description 1
- MEADNVSYEKRXDG-NRFANRHFSA-N 4-(3-chloropyridin-2-yl)oxy-n-[(3s)-1-[(3-cyanophenyl)methyl]-2-oxopyrrolidin-3-yl]benzenesulfonamide Chemical compound ClC1=CC=CN=C1OC1=CC=C(S(=O)(=O)N[C@@H]2C(N(CC=3C=C(C=CC=3)C#N)CC2)=O)C=C1 MEADNVSYEKRXDG-NRFANRHFSA-N 0.000 description 1
- HAMKYHNYPDJLJZ-UHFFFAOYSA-N 4-(3-chloropyridin-2-yl)oxybenzenesulfonyl chloride Chemical compound ClC1=CC=CN=C1OC1=CC=C(S(Cl)(=O)=O)C=C1 HAMKYHNYPDJLJZ-UHFFFAOYSA-N 0.000 description 1
- DVQBUJTYQXKLKZ-UHFFFAOYSA-N 4-(3-methoxyphenyl)benzenesulfonyl chloride Chemical compound COC1=CC=CC(C=2C=CC(=CC=2)S(Cl)(=O)=O)=C1 DVQBUJTYQXKLKZ-UHFFFAOYSA-N 0.000 description 1
- BGKRKGYBHIPDTK-UHFFFAOYSA-N 4-(6-methoxypyridin-2-yl)benzenesulfonyl chloride Chemical compound COC1=CC=CC(C=2C=CC(=CC=2)S(Cl)(=O)=O)=N1 BGKRKGYBHIPDTK-UHFFFAOYSA-N 0.000 description 1
- WZIYCIBURCPKAR-UHFFFAOYSA-N 4-(chloromethyl)pyridine Chemical compound ClCC1=CC=NC=C1 WZIYCIBURCPKAR-UHFFFAOYSA-N 0.000 description 1
- LXDQEBFSUIKJQI-UHFFFAOYSA-N 4-(hydroxymethyl)thiophene-2-carbonitrile Chemical compound OCC1=CSC(C#N)=C1 LXDQEBFSUIKJQI-UHFFFAOYSA-N 0.000 description 1
- OQGXZAQQHVSZRU-INIZCTEOSA-N 4-[[(3S)-3-(benzylamino)-2-oxopyrrolidin-1-yl]methyl]thiophene-2-carbonitrile Chemical compound C([C@@H](C1=O)NCC=2C=CC=CC=2)CN1CC1=CSC(C#N)=C1 OQGXZAQQHVSZRU-INIZCTEOSA-N 0.000 description 1
- GWOFKCKOEZWDOK-QHCPKHFHSA-N 4-[[(3s)-3-[(7-methoxynaphthalen-2-yl)sulfonyl-(thiophen-3-ylmethyl)amino]-2-oxopyrrolidin-1-yl]methyl]thiophene-2-carboximidamide Chemical compound C=1C2=CC(OC)=CC=C2C=CC=1S(=O)(=O)N([C@@H]1C(N(CC=2C=C(SC=2)C(N)=N)CC1)=O)CC=1C=CSC=1 GWOFKCKOEZWDOK-QHCPKHFHSA-N 0.000 description 1
- VDHZTKHCEVXDOO-FERBBOLQSA-N 4-[[(3s)-3-[(7-methoxynaphthalen-2-yl)sulfonylamino]-2-oxopyrrolidin-1-yl]methyl]thiophene-2-carboximidamide;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.C([C@@H](C1=O)NS(=O)(=O)C=2C=CC3=CC=C(C=C3C=2)OC)CN1CC1=CSC(C(N)=N)=C1 VDHZTKHCEVXDOO-FERBBOLQSA-N 0.000 description 1
- QYAANYADJMPKHC-MERQFXBCSA-N 4-[[(3s)-3-amino-2-oxopyrrolidin-1-yl]methyl]benzonitrile;hydrochloride Chemical compound Cl.O=C1[C@@H](N)CCN1CC1=CC=C(C#N)C=C1 QYAANYADJMPKHC-MERQFXBCSA-N 0.000 description 1
- MBZDCUMFFPWLTJ-UHFFFAOYSA-N 4-amino-3-methylbenzonitrile Chemical compound CC1=CC(C#N)=CC=C1N MBZDCUMFFPWLTJ-UHFFFAOYSA-N 0.000 description 1
- KVCQTKNUUQOELD-UHFFFAOYSA-N 4-amino-n-[1-(3-chloro-2-fluoroanilino)-6-methylisoquinolin-5-yl]thieno[3,2-d]pyrimidine-7-carboxamide Chemical compound N=1C=CC2=C(NC(=O)C=3C4=NC=NC(N)=C4SC=3)C(C)=CC=C2C=1NC1=CC=CC(Cl)=C1F KVCQTKNUUQOELD-UHFFFAOYSA-N 0.000 description 1
- NUKYPUAOHBNCPY-UHFFFAOYSA-N 4-aminopyridine Chemical compound NC1=CC=NC=C1 NUKYPUAOHBNCPY-UHFFFAOYSA-N 0.000 description 1
- HTRNHWBOBYFTQF-UHFFFAOYSA-N 4-bromo-2-fluoro-1-phenylbenzene Chemical group FC1=CC(Br)=CC=C1C1=CC=CC=C1 HTRNHWBOBYFTQF-UHFFFAOYSA-N 0.000 description 1
- SKXUZFJOLNNWIG-UHFFFAOYSA-N 4-bromo-3-methylbenzonitrile Chemical compound CC1=CC(C#N)=CC=C1Br SKXUZFJOLNNWIG-UHFFFAOYSA-N 0.000 description 1
- MPZMVUQGXAOJIK-UHFFFAOYSA-N 4-bromopyridine;hydron;chloride Chemical compound Cl.BrC1=CC=NC=C1 MPZMVUQGXAOJIK-UHFFFAOYSA-N 0.000 description 1
- PDONIKHDXYHTLS-UHFFFAOYSA-N 4-bromothiophene-2-carbaldehyde Chemical compound BrC1=CSC(C=O)=C1 PDONIKHDXYHTLS-UHFFFAOYSA-N 0.000 description 1
- VOLRSQPSJGXRNJ-UHFFFAOYSA-N 4-nitrobenzyl bromide Chemical compound [O-][N+](=O)C1=CC=C(CBr)C=C1 VOLRSQPSJGXRNJ-UHFFFAOYSA-N 0.000 description 1
- ALBQXDHCMLLQMB-UHFFFAOYSA-N 4-phenylbenzenesulfonyl chloride Chemical group C1=CC(S(=O)(=O)Cl)=CC=C1C1=CC=CC=C1 ALBQXDHCMLLQMB-UHFFFAOYSA-N 0.000 description 1
- UPTJKAOUCRHACW-UHFFFAOYSA-N 4-pyridin-3-ylbenzenesulfonyl chloride Chemical compound C1=CC(S(=O)(=O)Cl)=CC=C1C1=CC=CN=C1 UPTJKAOUCRHACW-UHFFFAOYSA-N 0.000 description 1
- ZQPOQWZJSQZACS-UHFFFAOYSA-N 5,6,7,8-tetrahydrophenanthrene-3-sulfonic acid Chemical compound C1CCCC2=C1C=CC1=CC=C(S(=O)(=O)O)C=C12 ZQPOQWZJSQZACS-UHFFFAOYSA-N 0.000 description 1
- GFBVUFQNHLUCPX-UHFFFAOYSA-N 5-bromothiophene-2-carbaldehyde Chemical compound BrC1=CC=C(C=O)S1 GFBVUFQNHLUCPX-UHFFFAOYSA-N 0.000 description 1
- SORSTNOXGOXWAO-UHFFFAOYSA-N 5-chlorothiophene-2-sulfonyl chloride Chemical compound ClC1=CC=C(S(Cl)(=O)=O)S1 SORSTNOXGOXWAO-UHFFFAOYSA-N 0.000 description 1
- SEWHHLSEXYDKMQ-UHFFFAOYSA-N 5-iodothiophene-3-carbaldehyde Chemical compound IC1=CC(C=O)=CS1 SEWHHLSEXYDKMQ-UHFFFAOYSA-N 0.000 description 1
- TVEHMYBLRFJWQM-UHFFFAOYSA-N 5-methoxynaphthalene-2-sulfonic acid Chemical compound OS(=O)(=O)C1=CC=C2C(OC)=CC=CC2=C1 TVEHMYBLRFJWQM-UHFFFAOYSA-N 0.000 description 1
- URNCEBDXFPRJCI-UHFFFAOYSA-N 6-(phenylmethoxycarbonylamino)naphthalene-2-sulfonic acid Chemical compound C1=CC2=CC(S(=O)(=O)O)=CC=C2C=C1NC(=O)OCC1=CC=CC=C1 URNCEBDXFPRJCI-UHFFFAOYSA-N 0.000 description 1
- FTPWWZQLXRBLHQ-UHFFFAOYSA-N 6-amino-5-chloronaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=CC2=C(Cl)C(N)=CC=C21 FTPWWZQLXRBLHQ-UHFFFAOYSA-N 0.000 description 1
- SEMRCUIXRUXGJX-UHFFFAOYSA-N 6-aminonaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=CC2=CC(N)=CC=C21 SEMRCUIXRUXGJX-UHFFFAOYSA-N 0.000 description 1
- IFIHYLCUKYCKRH-UHFFFAOYSA-N 6-bromoquinoline Chemical compound N1=CC=CC2=CC(Br)=CC=C21 IFIHYLCUKYCKRH-UHFFFAOYSA-N 0.000 description 1
- BQTHNGZXYBVSFF-UHFFFAOYSA-N 6-phenylmethoxynaphthalene-2-sulfonyl chloride Chemical compound C1=CC2=CC(S(=O)(=O)Cl)=CC=C2C=C1OCC1=CC=CC=C1 BQTHNGZXYBVSFF-UHFFFAOYSA-N 0.000 description 1
- HNCOXIKXVHLGMB-UHFFFAOYSA-N 7-[methyl(phenylmethoxycarbonyl)amino]naphthalene-2-sulfonic acid Chemical compound C=1C=C2C=CC(S(O)(=O)=O)=CC2=CC=1N(C)C(=O)OCC1=CC=CC=C1 HNCOXIKXVHLGMB-UHFFFAOYSA-N 0.000 description 1
- ARPAPTVOXJPIHY-UHFFFAOYSA-N 7-bromo-2-methoxyquinoline Chemical compound C1=CC(Br)=CC2=NC(OC)=CC=C21 ARPAPTVOXJPIHY-UHFFFAOYSA-N 0.000 description 1
- GXYIEWUWNPMHFU-UHFFFAOYSA-N 7-ethylnaphthalene-2-sulfonyl chloride Chemical compound C1=CC(S(Cl)(=O)=O)=CC2=CC(CC)=CC=C21 GXYIEWUWNPMHFU-UHFFFAOYSA-N 0.000 description 1
- UNFNRIIETORURP-UHFFFAOYSA-N 7-methoxynaphthalen-2-ol Chemical compound C1=CC(O)=CC2=CC(OC)=CC=C21 UNFNRIIETORURP-UHFFFAOYSA-N 0.000 description 1
- GTIHXWGIIDMONZ-UHFFFAOYSA-N 7-methylnaphthalene-2-sulfonyl chloride Chemical compound C1=CC(S(Cl)(=O)=O)=CC2=CC(C)=CC=C21 GTIHXWGIIDMONZ-UHFFFAOYSA-N 0.000 description 1
- CYJRNFFLTBEQSQ-UHFFFAOYSA-N 8-(3-methyl-1-benzothiophen-5-yl)-N-(4-methylsulfonylpyridin-3-yl)quinoxalin-6-amine Chemical compound CS(=O)(=O)C1=C(C=NC=C1)NC=1C=C2N=CC=NC2=C(C=1)C=1C=CC2=C(C(=CS2)C)C=1 CYJRNFFLTBEQSQ-UHFFFAOYSA-N 0.000 description 1
- QPDMCHLICUMDPX-UHFFFAOYSA-N 9,10-dioxo-8a,10a-dihydroanthracene-2-sulfonic acid Chemical compound C1=CC=CC2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C21 QPDMCHLICUMDPX-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 102000004411 Antithrombin III Human genes 0.000 description 1
- 108090000935 Antithrombin III Proteins 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- AQIPFOATORQZMT-KRWDZBQOSA-N C1CN(C(=O)[C@H]1NCS(=O)(=O)C2=CC3=C(C=C2)C(=C(C=C3)N)Cl)CC4=CSC(=C4)C(=N)N Chemical compound C1CN(C(=O)[C@H]1NCS(=O)(=O)C2=CC3=C(C=C2)C(=C(C=C3)N)Cl)CC4=CSC(=C4)C(=N)N AQIPFOATORQZMT-KRWDZBQOSA-N 0.000 description 1
- GGQSZTDQYNCCPN-UHFFFAOYSA-N C=1C2=CC(OC)=CC=C2C=CC=1S(=O)(=O)NCC(C1=O)CCN1CC1=CC(C#N)=CC=C1N Chemical compound C=1C2=CC(OC)=CC=C2C=CC=1S(=O)(=O)NCC(C1=O)CCN1CC1=CC(C#N)=CC=C1N GGQSZTDQYNCCPN-UHFFFAOYSA-N 0.000 description 1
- 101150049479 CCNC gene Proteins 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- 206010053567 Coagulopathies Diseases 0.000 description 1
- AAWZDTNXLSGCEK-UHFFFAOYSA-N Cordycepinsaeure Natural products OC1CC(O)(C(O)=O)CC(O)C1O AAWZDTNXLSGCEK-UHFFFAOYSA-N 0.000 description 1
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 1
- 101150003888 FASN gene Proteins 0.000 description 1
- OPPOFRGNBFHSFF-ARIINYJRSA-N FC(C(=O)O)(F)F.FC(C(=O)O)(F)F.NN=CC=1C=C(CN2C([C@H](CC2)N(CC(=O)NCCC=2C=NC=CC2)S(=O)(=O)C2=CC3=CC(=CC=C3C=C2)OC)=O)C=CC1 Chemical compound FC(C(=O)O)(F)F.FC(C(=O)O)(F)F.NN=CC=1C=C(CN2C([C@H](CC2)N(CC(=O)NCCC=2C=NC=CC2)S(=O)(=O)C2=CC3=CC(=CC=C3C=C2)OC)=O)C=CC1 OPPOFRGNBFHSFF-ARIINYJRSA-N 0.000 description 1
- 108010074105 Factor Va Proteins 0.000 description 1
- 229940123583 Factor Xa inhibitor Drugs 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- 241000562429 Jamides Species 0.000 description 1
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 description 1
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 1
- YPFWNVVTFIFYPA-UHFFFAOYSA-N N(=O)OC=1C=C(C=CC1)CBr Chemical compound N(=O)OC=1C=C(C=CC1)CBr YPFWNVVTFIFYPA-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- AYCPARAPKDAOEN-LJQANCHMSA-N N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[(2-methyl-4-thieno[3,2-d]pyrimidinyl)amino]-1,4-dihydropyrrolo[3,4-c]pyrazole-5-carboxamide Chemical compound C1([C@H](NC(=O)N2C(C=3NN=C(NC=4C=5SC=CC=5N=C(C)N=4)C=3C2)(C)C)CN(C)C)=CC=CC=C1 AYCPARAPKDAOEN-LJQANCHMSA-N 0.000 description 1
- DSOOOQPBJGYFQO-FQEVSTJZSA-N N-[(3S)-1-[(3-cyanophenyl)methyl]-2-oxopyrrolidin-3-yl]-1-methoxynaphthalene-2-sulfonamide Chemical compound C(#N)C=1C=C(CN2C([C@H](CC2)NS(=O)(=O)C2=C(C3=CC=CC=C3C=C2)OC)=O)C=CC1 DSOOOQPBJGYFQO-FQEVSTJZSA-N 0.000 description 1
- CBTIAQXKRXXQOQ-JIDHJSLPSA-N N-[(3S)-1-[(3-methanehydrazonoylphenyl)methyl]-2-oxoazepan-3-yl]-7-methoxynaphthalene-2-sulfonamide 2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.C([C@@H](C1=O)NS(=O)(=O)C=2C=CC3=CC=C(C=C3C=2)OC)CCCN1CC1=CC=CC(C=NN)=C1 CBTIAQXKRXXQOQ-JIDHJSLPSA-N 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- UILWWEMRSDNBAA-UHFFFAOYSA-N NC1=C(C=CC2=CC=CC=C12)S(=O)(=O)Cl Chemical compound NC1=C(C=CC2=CC=CC=C12)S(=O)(=O)Cl UILWWEMRSDNBAA-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- 206010028980 Neoplasm Diseases 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- GWDCVMIEISJHES-FTBISJDPSA-N OC(=O)C(F)(F)F.C([C@@H](C1=O)NS(=O)(=O)C2=CC3=CC=C(C=C3C=C2)OC)CN1CC1=CC=CC(C=NN)=C1 Chemical compound OC(=O)C(F)(F)F.C([C@@H](C1=O)NS(=O)(=O)C2=CC3=CC=C(C=C3C=C2)OC)CN1CC1=CC=CC(C=NN)=C1 GWDCVMIEISJHES-FTBISJDPSA-N 0.000 description 1
- MRTTYKVNJDOIEZ-FTBISJDPSA-N OC(=O)C(F)(F)F.C([C@@H](C1=O)NS(=O)(=O)C=2C=CC3=CC=C(C=C3C=2)C)CN1CC1=CC=CC(C=NN)=C1 Chemical compound OC(=O)C(F)(F)F.C([C@@H](C1=O)NS(=O)(=O)C=2C=CC3=CC=C(C=C3C=2)C)CN1CC1=CC=CC(C=NN)=C1 MRTTYKVNJDOIEZ-FTBISJDPSA-N 0.000 description 1
- NKBSYLJRVLPKJV-VZYDHVRKSA-N OC(=O)C(F)(F)F.C([C@H](C1=O)NS(=O)(=O)C=2C=CC3=CC=C(C=C3C=2)OC)CN1CC1=CC=CC(C=NN)=C1 Chemical compound OC(=O)C(F)(F)F.C([C@H](C1=O)NS(=O)(=O)C=2C=CC3=CC=C(C=C3C=2)OC)CN1CC1=CC=CC(C=NN)=C1 NKBSYLJRVLPKJV-VZYDHVRKSA-N 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 108010094028 Prothrombin Proteins 0.000 description 1
- 102100027378 Prothrombin Human genes 0.000 description 1
- AAWZDTNXLSGCEK-ZHQZDSKASA-N Quinic acid Natural products O[C@H]1CC(O)(C(O)=O)C[C@H](O)C1O AAWZDTNXLSGCEK-ZHQZDSKASA-N 0.000 description 1
- 101100391171 Schizosaccharomyces pombe (strain 972 / ATCC 24843) for3 gene Proteins 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- 241001133900 Tarne Species 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 108090000190 Thrombin Proteins 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- 206010047249 Venous thrombosis Diseases 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- LXRZVMYMQHNYJB-UNXOBOICSA-N [(1R,2S,4R)-4-[[5-[4-[(1R)-7-chloro-1,2,3,4-tetrahydroisoquinolin-1-yl]-5-methylthiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate Chemical compound CC1=C(C=C(S1)C(=O)C1=C(N[C@H]2C[C@H](O)[C@@H](COS(N)(=O)=O)C2)N=CN=C1)[C@@H]1NCCC2=C1C=C(Cl)C=C2 LXRZVMYMQHNYJB-UNXOBOICSA-N 0.000 description 1
- DIEDRUHXKKTURK-REOHCLBHSA-N [(3s)-2-oxoazetidin-3-yl]carbamic acid Chemical compound OC(=O)N[C@H]1CNC1=O DIEDRUHXKKTURK-REOHCLBHSA-N 0.000 description 1
- LBOOPDHYYSLYTI-VKHMYHEASA-N [(3s)-2-oxopyrrolidin-3-yl]carbamic acid Chemical compound OC(=O)N[C@H]1CCNC1=O LBOOPDHYYSLYTI-VKHMYHEASA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 150000001263 acyl chlorides Chemical class 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000005262 alkoxyamine group Chemical group 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 125000004644 alkyl sulfinyl group Chemical group 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 229940024606 amino acid Drugs 0.000 description 1
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 238000002399 angioplasty Methods 0.000 description 1
- 229960005348 antithrombin iii Drugs 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 125000005018 aryl alkenyl group Chemical group 0.000 description 1
- 125000005098 aryl alkoxy carbonyl group Chemical group 0.000 description 1
- 125000005161 aryl oxy carbonyl group Chemical group 0.000 description 1
- 125000005135 aryl sulfinyl group Chemical group 0.000 description 1
- 125000005334 azaindolyl group Chemical group N1N=C(C2=CC=CC=C12)* 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- UPABQMWFWCMOFV-UHFFFAOYSA-N benethamine Chemical compound C=1C=CC=CC=1CNCCC1=CC=CC=C1 UPABQMWFWCMOFV-UHFFFAOYSA-N 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- HLMGQSNPAYICCF-UHFFFAOYSA-N benzo[f][1,3]benzodioxole-6-sulfonic acid Chemical compound C1=C2OCOC2=CC2=CC(S(=O)(=O)O)=CC=C21 HLMGQSNPAYICCF-UHFFFAOYSA-N 0.000 description 1
- SHOHAMYHDHOAIU-UHFFFAOYSA-N benzo[f][1,3]benzodioxole-6-sulfonyl chloride Chemical compound C1=C2OCOC2=CC2=CC(S(=O)(=O)Cl)=CC=C21 SHOHAMYHDHOAIU-UHFFFAOYSA-N 0.000 description 1
- 125000004601 benzofurazanyl group Chemical group N1=C2C(=NO1)C(=CC=C2)* 0.000 description 1
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 1
- 239000012965 benzophenone Substances 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 229960004217 benzyl alcohol Drugs 0.000 description 1
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 1
- SYGVMKIYGPBACY-UHFFFAOYSA-N benzyl n-(1-chloro-6-chlorosulfonylnaphthalen-2-yl)carbamate Chemical compound C1=CC2=CC(S(Cl)(=O)=O)=CC=C2C(Cl)=C1NC(=O)OCC1=CC=CC=C1 SYGVMKIYGPBACY-UHFFFAOYSA-N 0.000 description 1
- KLFNVPJUJPGMNW-UHFFFAOYSA-N benzyl n-(7-chlorosulfonylnaphthalen-2-yl)-n-methylcarbamate Chemical compound C=1C=C2C=CC(S(Cl)(=O)=O)=CC2=CC=1N(C)C(=O)OCC1=CC=CC=C1 KLFNVPJUJPGMNW-UHFFFAOYSA-N 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 229950011260 betanaphthol Drugs 0.000 description 1
- 210000000941 bile Anatomy 0.000 description 1
- SIPUZPBQZHNSDW-UHFFFAOYSA-N bis(2-methylpropyl)aluminum Chemical compound CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 1
- 208000015294 blood coagulation disease Diseases 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- XMMFEKLHEGZKRS-UHFFFAOYSA-N butyl 5-methyl-1h-pyrazole-4-carboxylate Chemical compound CCCCOC(=O)C=1C=NNC=1C XMMFEKLHEGZKRS-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- YGHUUVGIRWMJGE-UHFFFAOYSA-N chlorodimethylsilane Chemical compound C[SiH](C)Cl YGHUUVGIRWMJGE-UHFFFAOYSA-N 0.000 description 1
- VDANGULDQQJODZ-UHFFFAOYSA-N chloroprocaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1Cl VDANGULDQQJODZ-UHFFFAOYSA-N 0.000 description 1
- 229960002023 chloroprocaine Drugs 0.000 description 1
- 230000001684 chronic effect Effects 0.000 description 1
- 230000009918 complex formation Effects 0.000 description 1
- ATDGTVJJHBUTRL-UHFFFAOYSA-N cyanogen bromide Chemical compound BrC#N ATDGTVJJHBUTRL-UHFFFAOYSA-N 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000004851 cyclopentylmethyl group Chemical group C1(CCCC1)C* 0.000 description 1
- ULCKEERECJMLHP-UHFFFAOYSA-N dibenzofuran-2-sulfonyl chloride Chemical compound C1=CC=C2C3=CC(S(=O)(=O)Cl)=CC=C3OC2=C1 ULCKEERECJMLHP-UHFFFAOYSA-N 0.000 description 1
- FJBFPHVGVWTDIP-UHFFFAOYSA-N dibromomethane Chemical compound BrCBr FJBFPHVGVWTDIP-UHFFFAOYSA-N 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- XHFGWHUWQXTGAT-UHFFFAOYSA-N dimethylamine hydrochloride Natural products CNC(C)C XHFGWHUWQXTGAT-UHFFFAOYSA-N 0.000 description 1
- IQDGSYLLQPDQDV-UHFFFAOYSA-N dimethylazanium;chloride Chemical compound Cl.CNC IQDGSYLLQPDQDV-UHFFFAOYSA-N 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 description 1
- 229960004979 fampridine Drugs 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 125000003838 furazanyl group Chemical group 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 125000004447 heteroarylalkenyl group Chemical group 0.000 description 1
- 125000004446 heteroarylalkyl group Chemical group 0.000 description 1
- 125000005368 heteroarylthio group Chemical group 0.000 description 1
- RCCPEORTSYDPMB-UHFFFAOYSA-N hydroxy benzenecarboximidothioate Chemical compound OSC(=N)C1=CC=CC=C1 RCCPEORTSYDPMB-UHFFFAOYSA-N 0.000 description 1
- 125000006289 hydroxybenzyl group Chemical group 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 150000002466 imines Chemical class 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- ICIWUVCWSCSTAQ-UHFFFAOYSA-N iodic acid Chemical compound OI(=O)=O ICIWUVCWSCSTAQ-UHFFFAOYSA-N 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical class OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- OVEHNNQXLPJPPL-UHFFFAOYSA-N lithium;n-propan-2-ylpropan-2-amine Chemical compound [Li].CC(C)NC(C)C OVEHNNQXLPJPPL-UHFFFAOYSA-N 0.000 description 1
- 201000004792 malaria Diseases 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- JTNAXVPWJICRRJ-UHFFFAOYSA-N methyl 2-(4-cyano-2-methylphenoxy)acetate Chemical group COC(=O)COC1=CC=C(C#N)C=C1C JTNAXVPWJICRRJ-UHFFFAOYSA-N 0.000 description 1
- YDCHPLOFQATIDS-UHFFFAOYSA-N methyl 2-bromoacetate Chemical compound COC(=O)CBr YDCHPLOFQATIDS-UHFFFAOYSA-N 0.000 description 1
- 125000006178 methyl benzyl group Chemical group 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 1
- OYTYTAXVYNHHKD-IBGZPJMESA-N n-[(3s)-1-[(3-cyanophenyl)methyl]-2-oxopyrrolidin-3-yl]-2-methoxyquinoline-7-sulfonamide Chemical compound C([C@@H](C1=O)NS(=O)(=O)C=2C=CC3=CC=C(N=C3C=2)OC)CN1CC1=CC=CC(C#N)=C1 OYTYTAXVYNHHKD-IBGZPJMESA-N 0.000 description 1
- TUSJYISYKKSYOT-DEOSSOPVSA-N n-[(3s)-1-[(3-cyanophenyl)methyl]-2-oxopyrrolidin-3-yl]-3-fluoro-n-methyl-4-phenylbenzenesulfonamide Chemical compound C([C@@H](C1=O)N(C)S(=O)(=O)C=2C=C(F)C(=CC=2)C=2C=CC=CC=2)CN1CC1=CC=CC(C#N)=C1 TUSJYISYKKSYOT-DEOSSOPVSA-N 0.000 description 1
- DQCTULKVFJUBNA-QHCPKHFHSA-N n-[(3s)-1-[(3-cyanophenyl)methyl]-2-oxopyrrolidin-3-yl]-4-phenylbenzenesulfonamide Chemical compound C([C@@H](C1=O)NS(=O)(=O)C=2C=CC(=CC=2)C=2C=CC=CC=2)CN1CC1=CC=CC(C#N)=C1 DQCTULKVFJUBNA-QHCPKHFHSA-N 0.000 description 1
- DBCQJALPCJPHFS-QFIPXVFZSA-N n-[(3s)-1-[(3-cyanophenyl)methyl]-2-oxopyrrolidin-3-yl]-6-methoxynaphthalene-2-sulfonamide Chemical compound C([C@@H](C1=O)NS(=O)(=O)C2=CC3=CC=C(C=C3C=C2)OC)CN1CC1=CC=CC(C#N)=C1 DBCQJALPCJPHFS-QFIPXVFZSA-N 0.000 description 1
- OVGYUIMOPMHMJP-PMERELPUSA-N n-[(3s)-1-[(3-cyanophenyl)methyl]-2-oxopyrrolidin-3-yl]-7-methoxy-n-[(3-methylphenyl)methyl]naphthalene-2-sulfonamide Chemical compound C=1C2=CC(OC)=CC=C2C=CC=1S(=O)(=O)N([C@@H]1C(N(CC=2C=C(C=CC=2)C#N)CC1)=O)CC1=CC=CC(C)=C1 OVGYUIMOPMHMJP-PMERELPUSA-N 0.000 description 1
- VZVDXIFQKAZFGJ-FQEVSTJZSA-N n-[(3s)-1-[(3-cyanophenyl)methyl]-2-oxopyrrolidin-3-yl]benzo[f][1,3]benzodioxole-6-sulfonamide Chemical compound C([C@@H](C1=O)NS(=O)(=O)C=2C=C3C=C4OCOC4=CC3=CC=2)CN1CC1=CC=CC(C#N)=C1 VZVDXIFQKAZFGJ-FQEVSTJZSA-N 0.000 description 1
- MYHFINDNIJVRFK-ZDUSSCGKSA-N n-[(3s)-1-[(3-cyanophenyl)methyl]-2-oxopyrrolidin-3-yl]ethenesulfonamide Chemical compound O=C1[C@@H](NS(=O)(=O)C=C)CCN1CC1=CC=CC(C#N)=C1 MYHFINDNIJVRFK-ZDUSSCGKSA-N 0.000 description 1
- TZRDBGOIVNEENX-FQEVSTJZSA-N n-[(3s)-1-[(3-cyanophenyl)methyl]-2-oxopyrrolidin-3-yl]quinoline-6-sulfonamide Chemical compound C([C@@H](C1=O)NS(=O)(=O)C=2C=C3C=CC=NC3=CC=2)CN1CC1=CC=CC(C#N)=C1 TZRDBGOIVNEENX-FQEVSTJZSA-N 0.000 description 1
- VGXAXDMAJHEEJI-NRFANRHFSA-N n-[(3s)-1-[(4-cyanothiophen-2-yl)methyl]-2-oxopyrrolidin-3-yl]-7-methoxy-n-methylnaphthalene-2-sulfonamide Chemical compound C([C@@H](C1=O)N(C)S(=O)(=O)C=2C=CC3=CC=C(C=C3C=2)OC)CN1CC1=CC(C#N)=CS1 VGXAXDMAJHEEJI-NRFANRHFSA-N 0.000 description 1
- WGOOCXOJSBOEOY-FQEVSTJZSA-N n-[(3s)-1-[(5-cyanothiophen-3-yl)methyl]-2-oxopyrrolidin-3-yl]-7-methoxynaphthalene-2-sulfonamide Chemical compound C([C@@H](C1=O)NS(=O)(=O)C=2C=CC3=CC=C(C=C3C=2)OC)CN1CC1=CSC(C#N)=C1 WGOOCXOJSBOEOY-FQEVSTJZSA-N 0.000 description 1
- XEKKCLKOYUWYOE-FQEVSTJZSA-N n-[(3s)-1-[(5-cyanothiophen-3-yl)methyl]-2-oxopyrrolidin-3-yl]-n-naphthalen-2-ylmethanesulfonamide Chemical compound C([C@@H](C1=O)N(S(=O)(=O)C)C=2C=C3C=CC=CC3=CC=2)CN1CC1=CSC(C#N)=C1 XEKKCLKOYUWYOE-FQEVSTJZSA-N 0.000 description 1
- NIYCWDHSWVJIKD-ZOWNYOTGSA-N n-[(3s)-pyrrolidin-3-yl]naphthalene-2-sulfonamide;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.C=1C=C2C=CC=CC2=CC=1S(=O)(=O)N[C@H]1CCNC1 NIYCWDHSWVJIKD-ZOWNYOTGSA-N 0.000 description 1
- SGYAEZLTAXCMHM-UHFFFAOYSA-N n-[1-[(2-amino-5-cyanophenyl)methyl]-2-oxopyrrolidin-3-yl]-3-tert-butylbenzenesulfonamide Chemical compound CC(C)(C)C1=CC=CC(S(=O)(=O)NC2C(N(CC=3C(=CC=C(C=3)C#N)N)CC2)=O)=C1 SGYAEZLTAXCMHM-UHFFFAOYSA-N 0.000 description 1
- KVUMTOFGJNTJNN-UHFFFAOYSA-N n-[1-[(3-cyanophenyl)methyl]-5-oxopyrrolidin-3-yl]dibenzofuran-2-sulfonamide Chemical compound O=C1CC(NS(=O)(=O)C=2C=C3C4=CC=CC=C4OC3=CC=2)CN1CC1=CC=CC(C#N)=C1 KVUMTOFGJNTJNN-UHFFFAOYSA-N 0.000 description 1
- FXNYECAOJHKOBG-IBGZPJMESA-N n-[[(3s)-1-[(3-cyanophenyl)methyl]-2-oxopyrrolidin-3-yl]methyl]-1,2,3,4-tetrahydroisoquinoline-7-sulfonamide Chemical compound C([C@@H](CNS(=O)(=O)C=1C=C2CNCCC2=CC=1)C1=O)CN1CC1=CC=CC(C#N)=C1 FXNYECAOJHKOBG-IBGZPJMESA-N 0.000 description 1
- IRHJKWHTARNEKT-QHCPKHFHSA-N n-benzyl-5-chloro-n-[(3s)-1-[(5-cyanothiophen-3-yl)methyl]-2-oxopyrrolidin-3-yl]-3-methyl-1-benzothiophene-2-sulfonamide Chemical compound S1C2=CC=C(Cl)C=C2C(C)=C1S(=O)(=O)N([C@@H]1C(N(CC=2C=C(SC=2)C#N)CC1)=O)CC1=CC=CC=C1 IRHJKWHTARNEKT-QHCPKHFHSA-N 0.000 description 1
- UZJLYRRDVFWSGA-UHFFFAOYSA-N n-benzylacetamide Chemical compound CC(=O)NCC1=CC=CC=C1 UZJLYRRDVFWSGA-UHFFFAOYSA-N 0.000 description 1
- 125000006606 n-butoxy group Chemical group 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- JNHZPXFARRJZQR-UHFFFAOYSA-N n-ethylpyridin-3-amine Chemical compound CCNC1=CC=CN=C1 JNHZPXFARRJZQR-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 230000000802 nitrating effect Effects 0.000 description 1
- 150000002826 nitrites Chemical class 0.000 description 1
- 210000004789 organ system Anatomy 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 125000005740 oxycarbonyl group Chemical group [*:1]OC([*:2])=O 0.000 description 1
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 1
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 125000005936 piperidyl group Chemical group 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 229940086066 potassium hydrogencarbonate Drugs 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 229960004919 procaine Drugs 0.000 description 1
- 125000001325 propanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229940039716 prothrombin Drugs 0.000 description 1
- 108010014806 prothrombinase complex Proteins 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- XELRMPRLCPFTBH-UHFFFAOYSA-N quinazoline-2,4-diamine Chemical compound C1=CC=CC2=NC(N)=NC(N)=C21 XELRMPRLCPFTBH-UHFFFAOYSA-N 0.000 description 1
- AUDKCUOUBLCZQR-UHFFFAOYSA-N quinoline-6-sulfonyl chloride Chemical compound N1=CC=CC2=CC(S(=O)(=O)Cl)=CC=C21 AUDKCUOUBLCZQR-UHFFFAOYSA-N 0.000 description 1
- 238000006268 reductive amination reaction Methods 0.000 description 1
- 208000037803 restenosis Diseases 0.000 description 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-M salicylate Chemical compound OC1=CC=CC=C1C([O-])=O YGSDEFSMJLZEOE-UHFFFAOYSA-M 0.000 description 1
- 229960001860 salicylate Drugs 0.000 description 1
- 239000012321 sodium triacetoxyborohydride Substances 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-M sulfamate Chemical compound NS([O-])(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-M 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- BUUPQKDIAURBJP-UHFFFAOYSA-N sulfinic acid Chemical compound OS=O BUUPQKDIAURBJP-UHFFFAOYSA-N 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- OWKBOTVGPHTUKQ-UHFFFAOYSA-N tert-butyl n-[1-[(4-cyanothiophen-2-yl)methyl]-2-oxopyrrolidin-3-yl]carbamate Chemical compound O=C1C(NC(=O)OC(C)(C)C)CCN1CC1=CC(C#N)=CS1 OWKBOTVGPHTUKQ-UHFFFAOYSA-N 0.000 description 1
- FQFILJKFZCVHNH-UHFFFAOYSA-N tert-butyl n-[3-[(5-bromo-2-chloropyrimidin-4-yl)amino]propyl]carbamate Chemical compound CC(C)(C)OC(=O)NCCCNC1=NC(Cl)=NC=C1Br FQFILJKFZCVHNH-UHFFFAOYSA-N 0.000 description 1
- HBUBRNBOYWHGHQ-UHFFFAOYSA-N tert-butyl-dimethyl-(3-methylphenoxy)silane Chemical compound CC1=CC=CC(O[Si](C)(C)C(C)(C)C)=C1 HBUBRNBOYWHGHQ-UHFFFAOYSA-N 0.000 description 1
- NLJDBTZLVTWXRG-UHFFFAOYSA-N tert-butylazanium;iodide Chemical compound [I-].CC(C)(C)[NH3+] NLJDBTZLVTWXRG-UHFFFAOYSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000005958 tetrahydrothienyl group Chemical group 0.000 description 1
- 125000004632 tetrahydrothiopyranyl group Chemical group S1C(CCCC1)* 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- VXKWYPOMXBVZSJ-UHFFFAOYSA-N tetramethyltin Chemical compound C[Sn](C)(C)C VXKWYPOMXBVZSJ-UHFFFAOYSA-N 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- VNNLHYZDXIBHKZ-UHFFFAOYSA-N thiophene-2-sulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CS1 VNNLHYZDXIBHKZ-UHFFFAOYSA-N 0.000 description 1
- VTHCULBLEKIUTL-UHFFFAOYSA-N thiophene-3-carbonitrile Chemical compound N#CC1=[C]SC=C1 VTHCULBLEKIUTL-UHFFFAOYSA-N 0.000 description 1
- 229960004072 thrombin Drugs 0.000 description 1
- 230000001732 thrombotic effect Effects 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- GJINSWLNWKLWCH-UHFFFAOYSA-N trimethyl(naphthalen-1-yl)stannane Chemical compound C1=CC=C2C([Sn](C)(C)C)=CC=CC2=C1 GJINSWLNWKLWCH-UHFFFAOYSA-N 0.000 description 1
- CCRMAATUKBYMPA-UHFFFAOYSA-N trimethyltin Chemical compound C[Sn](C)C.C[Sn](C)C CCRMAATUKBYMPA-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- UGZADUVQMDAIAO-UHFFFAOYSA-L zinc hydroxide Chemical compound [OH-].[OH-].[Zn+2] UGZADUVQMDAIAO-UHFFFAOYSA-L 0.000 description 1
- 229940007718 zinc hydroxide Drugs 0.000 description 1
- 229910021511 zinc hydroxide Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
- C07D207/26—2-Pyrrolidones
- C07D207/273—2-Pyrrolidones with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to other ring carbon atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/44—Non condensed pyridines; Hydrogenated derivatives thereof
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P7/00—Drugs for disorders of the blood or the extracellular fluid
- A61P7/02—Antithrombotic agents; Anticoagulants; Platelet aggregation inhibitors
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D205/00—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom
- C07D205/02—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D205/06—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D205/08—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with one oxygen atom directly attached in position 2, e.g. beta-lactams
- C07D205/085—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with one oxygen atom directly attached in position 2, e.g. beta-lactams with a nitrogen atom directly attached in position 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/10—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/14—Nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/34—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/36—Oxygen or sulfur atoms
- C07D207/40—2,5-Pyrrolidine-diones
- C07D207/416—2,5-Pyrrolidine-diones with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to other ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/68—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D211/72—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D211/74—Oxygen atoms
- C07D211/76—Oxygen atoms attached in position 2 or 6
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D223/00—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom
- C07D223/02—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D223/06—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom not condensed with other rings with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D223/12—Nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/06—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/06—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing three or more hetero rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- General Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Animal Behavior & Ethology (AREA)
- Pharmacology & Pharmacy (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Epidemiology (AREA)
- Hematology (AREA)
- Diabetes (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Pyrrole Compounds (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US08/481,024 US5612353A (en) | 1995-06-07 | 1995-06-07 | Substituted (sulfinic acid, sulfonic acid, sulfonylamino or sulfinylamino) N-[(aminoiminomethyl)phenylalkyl]-azaheterocyclylamide compounds |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| OA10752A true OA10752A (en) | 2001-07-04 |
Family
ID=23910281
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| OA70149A OA10752A (en) | 1995-06-07 | 1997-12-03 | Substituted (sulfinic acid sulfonic acid sulfonylamino or sulfinylamino) n-Ä(aminoiminomethyl) phenylalkylÜ-azaheterocyclylamide compounds |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US5612353A (cs) |
| EP (1) | EP0853618B1 (cs) |
| JP (1) | JP4312829B2 (cs) |
| KR (1) | KR100291711B1 (cs) |
| CN (1) | CN1190395A (cs) |
| AP (1) | AP799A (cs) |
| AT (1) | ATE520655T1 (cs) |
| AU (1) | AU714319B2 (cs) |
| BG (1) | BG63628B1 (cs) |
| BR (1) | BR9608405A (cs) |
| CA (1) | CA2223403C (cs) |
| CZ (1) | CZ385397A3 (cs) |
| EA (1) | EA000700B1 (cs) |
| HU (1) | HUP9801882A3 (cs) |
| MX (1) | MX9709977A (cs) |
| NO (1) | NO310457B1 (cs) |
| OA (1) | OA10752A (cs) |
| PL (1) | PL323780A1 (cs) |
| SI (1) | SI9620093A (cs) |
| SK (1) | SK160697A3 (cs) |
| WO (1) | WO1996040679A1 (cs) |
Families Citing this family (60)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5731315A (en) * | 1995-06-07 | 1998-03-24 | Rhone-Poulenc Rorer Pharmaceuticals Inc. | Substituted sulfonic acid n- (aminoiminomethyl)phenylalkyl!-azaheterocyclamide compounds |
| US6034093A (en) * | 1995-06-07 | 2000-03-07 | Rhone-Poulenc Rorer Pharmaceuticals Inc. | Substituted sulfonic acid N-[(aminoiminomethyl)phenylalkyl]-azaheterocyclylamide compounds |
| US5958918A (en) * | 1995-06-07 | 1999-09-28 | Rhone-Poulenc Rorer Pharmaceuticals Inc. | Substituted (sulfinic acid, sulfonic acid, sulfonylamino or sulfinylamino) N- (aminominomethyl)phenylalkyl!-azaheterocyclylamide compounds |
| US6080767A (en) * | 1996-01-02 | 2000-06-27 | Aventis Pharmaceuticals Products Inc. | Substituted n-[(aminoiminomethyl or aminomethyl)phenyl]propyl amides |
| US6057342A (en) * | 1996-08-16 | 2000-05-02 | Dupont Pharmaceutical Co. | Amidinophenyl-pyrrolidines, -pyrrolines, and -isoxazolidines and derivatives thereof |
| US6602864B1 (en) * | 1996-12-13 | 2003-08-05 | Aventis Pharma Deutschland Gmbh | Sulfonic acid or sulfonylamino N-(heteroaralkyl)-azaheterocyclylamide compounds |
| WO1998025611A1 (en) * | 1996-12-13 | 1998-06-18 | Rhône-Poulenc Rorer Pharmaceuticals Inc. | Sulfonic acid or sulfonylamino n-(heteroaralkyl)-azaheterocyclylamide compounds |
| AU7453498A (en) | 1997-05-30 | 1998-12-30 | Takeda Chemical Industries Ltd. | Sulfonamide derivatives, their production and use |
| ZA985247B (en) * | 1997-06-19 | 1999-12-17 | Du Pont Merck Pharma | Guanidine mimics as factor Xa inhibitors. |
| WO1999016747A1 (en) | 1997-09-30 | 1999-04-08 | Daiichi Pharmaceutical Co., Ltd. | Sulfonyl derivatives |
| US6271237B1 (en) | 1997-12-22 | 2001-08-07 | Dupont Pharmaceuticals Company | Nitrogen containing heteromatics with ortho-substituted P1s as factor Xa inhabitors |
| CA2314401A1 (en) * | 1997-12-22 | 1999-07-01 | Du Pont Pharmaceuticals Company | Nitrogen containing heteroaromatics with ortho-substituted p1's as factor xa inhibitors |
| JP4676613B2 (ja) * | 1998-01-27 | 2011-04-27 | アベンティス・ファーマスーティカルズ・インコーポレイテツド | 置換オキソアザヘテロシクリルXa因子阻害剤 |
| EP1054005A4 (en) | 1998-02-05 | 2003-02-05 | Takeda Chemical Industries Ltd | SULPHONAMIDE DERIVATIVES, METHOD FOR THE PRODUCTION AND THEIR USE |
| JP2002502852A (ja) * | 1998-02-09 | 2002-01-29 | 3−ディメンショナル ファーマシューティカルズ, インコーポレイテッド | プロテアーゼ阻害剤、特にウロキナーゼ阻害剤としてのヘテロアリールアミジン、メチルアミジンおよびグアニジン |
| US6291514B1 (en) | 1998-02-09 | 2001-09-18 | 3-Dimensional Pharmaceuticals, Inc. | Heteroaryl amidines, methylamidines and guanidines, preparation thereof, and use thereof as protease inhibitors |
| US6747023B1 (en) * | 1998-08-11 | 2004-06-08 | Daiichi Pharmaceutical Co., Ltd. | Sulfonyl derivatives |
| DE19839499A1 (de) * | 1998-08-29 | 2000-03-02 | Merck Patent Gmbh | 2-Oxo-2H-chinolinderivate |
| JP2003529531A (ja) * | 1998-11-25 | 2003-10-07 | アヴェンティス ファーマシューティカルズ インコーポレイテッド | 置換オキソアザへテロシクリルXa因子阻害剤 |
| AU5671799A (en) * | 1999-02-09 | 2000-08-29 | 3-Dimensional Pharmaceuticals, Inc. | Heteroaryl amidines, methylamidines and guanidines as protease inhibitors |
| DE19909237A1 (de) * | 1999-03-03 | 2000-09-07 | Merck Patent Gmbh | Pyrazol-3-on-derivate |
| US6794412B1 (en) * | 1999-03-11 | 2004-09-21 | Bristol-Myers Squibb Pharma Company | Treatment of thrombosis by combined use of a factor Xa inhibitor and aspirin |
| JP2001026506A (ja) * | 1999-04-28 | 2001-01-30 | Takeda Chem Ind Ltd | スルホンアミド誘導体 |
| US6586617B1 (en) | 1999-04-28 | 2003-07-01 | Sumitomo Chemical Takeda Agro Company, Limited | Sulfonamide derivatives |
| DE60027718T2 (de) | 1999-06-22 | 2007-05-16 | Takeda Pharmaceutical Co. Ltd. | Acylhydrazinderivate, verfahren zu ihrer herstellung und ihre verwendung |
| ATE423113T1 (de) * | 1999-07-28 | 2009-03-15 | Aventis Pharma Inc | Substituierte oxoazaheterozyclische verbindungen |
| US6544981B2 (en) | 2000-06-09 | 2003-04-08 | Bristol-Myers Squibb Company | Lactam inhibitors of factor Xa and method |
| US6511973B2 (en) * | 2000-08-02 | 2003-01-28 | Bristol-Myers Squibb Co. | Lactam inhibitors of FXa and method |
| US6410733B1 (en) | 2000-09-11 | 2002-06-25 | Genentech, Inc. | Amidine inhibitors of serine proteases |
| WO2002038560A1 (en) * | 2000-11-08 | 2002-05-16 | Takeda Chemical Industries, Ltd. | Carbamate derivatives, process for producing the same and use thereof |
| US6982251B2 (en) | 2000-12-20 | 2006-01-03 | Schering Corporation | Substituted 2-azetidinones useful as hypocholesterolemic agents |
| AR032230A1 (es) * | 2001-01-16 | 2003-10-29 | Sumitomo Chem Takeda Agro Co | Derivado sulfonamida conteniendo una composicion agricola y horticola |
| US7071181B2 (en) | 2001-01-26 | 2006-07-04 | Schering Corporation | Methods and therapeutic combinations for the treatment of diabetes using sterol absorption inhibitors |
| ME00145B (me) | 2001-01-26 | 2010-10-10 | Merck Sharp & Dohme | Upotreba supstituisanih jedinjenja azetidinona za lečenje sitosterolemije |
| IL156445A0 (en) | 2001-01-26 | 2004-01-04 | Schering Corp | Combinations of peroxisome proliferator-activated receptor (ppar) activator(s) and sterol absorption inhibitor(s) and treatments for vascular indications |
| US20060287254A1 (en) * | 2001-01-26 | 2006-12-21 | Schering Corporation | Use of substituted azetidinone compounds for the treatment of sitosterolemia |
| JP2004518688A (ja) * | 2001-01-30 | 2004-06-24 | ブリストル−マイヤーズ スクイブ カンパニー | ファクターXa阻害剤のスルホンアミドラクタムおよびその方法 |
| CA2440389A1 (en) | 2001-03-09 | 2002-10-03 | Ortho-Mcneil Pharmaceutical, Inc. | Aminopyrrolidine sulfonamides as serine protease inhibitors |
| US6710061B2 (en) * | 2001-03-09 | 2004-03-23 | Ortho-Mcneil Pharamceutical, Inc. | Aminopyrrolidine sulfonamides as serine protease inhibitors |
| DE10112768A1 (de) * | 2001-03-16 | 2002-09-19 | Merck Patent Gmbh | Phenylderivate 3 |
| DE10139060A1 (de) | 2001-08-08 | 2003-02-20 | Merck Patent Gmbh | Phenylderivate |
| US7053080B2 (en) * | 2001-09-21 | 2006-05-30 | Schering Corporation | Methods and therapeutic combinations for the treatment of obesity using sterol absorption inhibitors |
| ES2272776T3 (es) | 2001-09-21 | 2007-05-01 | Schering Corporation | Tratamiento de xantomas con derivados de azetidinona como inhibidores de la absorcion de esterol. |
| DE10239821A1 (de) | 2002-08-29 | 2004-03-11 | Roche Diagnostics Gmbh | Verbesserung der Spezifität bei der Bestimmung von Antithrombin |
| WO2004043457A1 (en) | 2002-11-06 | 2004-05-27 | Schering Corporation | Cholesterol absorptions inhibitors for the treatment of autoimmune disorders |
| AU2003284596A1 (en) | 2002-11-22 | 2004-06-18 | Takeda Pharmaceutical Company Limited | Imidazole derivative, process for producing the same, and use |
| HUE025683T2 (hu) | 2002-12-03 | 2016-04-28 | Pharmacyclics Llc | VIIA faktor inhibitor 2-(2-hidroxi-bifenil-3-il)-1H-benzoimidazol-5-karboxamidin-származékok |
| DE10302500A1 (de) | 2003-01-23 | 2004-07-29 | Merck Patent Gmbh | Carbonsäureamidderivate |
| US7459442B2 (en) * | 2003-03-07 | 2008-12-02 | Schering Corporation | Substituted azetidinone compounds, processes for preparing the same, formulations and uses thereof |
| DE602004016123D1 (de) * | 2003-03-07 | 2008-10-09 | Schering Corp | Substituierte azetidinon-derivate, deren pharmazeutische formulierungen und deren verwendung zur behandlung von hypercholesterolemia |
| DE602004018617D1 (de) * | 2003-03-07 | 2009-02-05 | Schering Corp | Substituierte azetidinon-derivate, deren pharmazeutische formulierungen und deren verwendung zur behandlung von hypercholesterolemia |
| US7192944B2 (en) | 2003-03-07 | 2007-03-20 | Schering Corp. | Substituted azetidinone compounds, processes for preparing the same, formulations and uses thereof |
| JP2007500221A (ja) | 2003-05-20 | 2007-01-11 | ジェネンテック・インコーポレーテッド | 第VIIa因子のベンゾフラン阻害剤 |
| US7250447B2 (en) | 2003-05-20 | 2007-07-31 | Genentech, Inc. | Acylsulfamide inhibitors of factor VIIa |
| US7208488B2 (en) * | 2003-10-29 | 2007-04-24 | Elan Pharmaceuticals, Inc. | N-substituted benzene sulfonamides |
| EP1533298A1 (en) | 2003-11-21 | 2005-05-25 | Newron Pharmaceuticals S.p.A. | 3-aminopyrrolidone derivatives |
| TWI396686B (zh) | 2004-05-21 | 2013-05-21 | Takeda Pharmaceutical | 環狀醯胺衍生物、以及其製品和用法 |
| UY29223A1 (es) * | 2004-11-23 | 2006-06-30 | Astrazeneca Ab | Ácidos fenoxiacéticos sustituidos, composiciones farmacéuticas que los contienen y procesos para su preparación |
| KR20080015102A (ko) | 2005-05-10 | 2008-02-18 | 버텍스 파마슈티칼스 인코포레이티드 | 이온 채널 조절인자로서의 바이사이클릭 유도체 |
| EP3886854A4 (en) | 2018-11-30 | 2022-07-06 | Nuvation Bio Inc. | Pyrrole and pyrazole compounds and methods of use thereof |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4121947A1 (de) * | 1991-07-03 | 1993-01-07 | Basf Ag | 2-(3-(4-amidino-phenyl))-propionsaeurederivate, ihre herstellung und verwendung |
| WO1993007141A1 (en) * | 1991-10-11 | 1993-04-15 | Smithkline Beecham Corporation | Heterocyclic 3-phenylpyrrolidin-2-ones, their preparation and use for the manufacture of a medicament for inhibiting tumor necrosis factor production |
| JPH05201971A (ja) * | 1992-01-28 | 1993-08-10 | Hokuriku Seiyaku Co Ltd | 環状アミン含有ベンゼンスルホンアミド誘導体 |
| US5665754A (en) * | 1993-09-20 | 1997-09-09 | Glaxo Wellcome Inc. | Substituted pyrrolidines |
| WO1995008533A1 (en) * | 1993-09-21 | 1995-03-30 | Yamanouchi Pharmaceutical Co., Ltd. | N-(3-pyrrolidinyl)benzamide derivative |
| FR2714378B1 (fr) * | 1993-12-24 | 1996-03-15 | Sanofi Sa | Dérivés de l'indol-2-one substitués en 3 par un groupe azoté, leur préparation, les compositions pharmaceutiques en contenant. |
-
1995
- 1995-06-07 US US08/481,024 patent/US5612353A/en not_active Expired - Lifetime
-
1996
- 1996-06-07 SK SK1606-97A patent/SK160697A3/sk unknown
- 1996-06-07 BR BR9608405A patent/BR9608405A/pt not_active Application Discontinuation
- 1996-06-07 AP APAP/P/1997/001144A patent/AP799A/en active
- 1996-06-07 CN CN96194489A patent/CN1190395A/zh active Pending
- 1996-06-07 JP JP50202997A patent/JP4312829B2/ja not_active Expired - Fee Related
- 1996-06-07 CA CA002223403A patent/CA2223403C/en not_active Expired - Fee Related
- 1996-06-07 CZ CZ973853A patent/CZ385397A3/cs unknown
- 1996-06-07 AT AT96919298T patent/ATE520655T1/de not_active IP Right Cessation
- 1996-06-07 EA EA199800043A patent/EA000700B1/ru not_active IP Right Cessation
- 1996-06-07 EP EP96919298A patent/EP0853618B1/en not_active Expired - Lifetime
- 1996-06-07 WO PCT/US1996/009816 patent/WO1996040679A1/en not_active Ceased
- 1996-06-07 HU HU9801882A patent/HUP9801882A3/hu unknown
- 1996-06-07 AU AU61669/96A patent/AU714319B2/en not_active Ceased
- 1996-06-07 PL PL96323780A patent/PL323780A1/xx unknown
- 1996-06-07 SI SI9620093A patent/SI9620093A/sl unknown
- 1996-06-07 KR KR1019970708866A patent/KR100291711B1/ko not_active Expired - Fee Related
-
1997
- 1997-12-03 OA OA70149A patent/OA10752A/en unknown
- 1997-12-08 MX MX9709977A patent/MX9709977A/es not_active IP Right Cessation
- 1997-12-08 NO NO19975762A patent/NO310457B1/no unknown
-
1998
- 1998-01-06 BG BG102162A patent/BG63628B1/bg unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CZ385397A3 (cs) | 1999-05-12 |
| CN1190395A (zh) | 1998-08-12 |
| AP9701144A0 (en) | 1998-01-31 |
| BR9608405A (pt) | 1999-08-24 |
| NO975762L (no) | 1998-02-06 |
| EP0853618A4 (en) | 2000-03-15 |
| KR100291711B1 (ko) | 2001-09-17 |
| NO975762D0 (no) | 1997-12-08 |
| PL323780A1 (en) | 1998-04-27 |
| US5612353A (en) | 1997-03-18 |
| NO310457B1 (no) | 2001-07-09 |
| EA000700B1 (ru) | 2000-02-28 |
| SI9620093A (sl) | 1999-02-28 |
| AU714319B2 (en) | 2000-01-06 |
| BG63628B1 (bg) | 2002-07-31 |
| BG102162A (en) | 1998-09-30 |
| EA199800043A1 (ru) | 1998-08-27 |
| CA2223403C (en) | 2002-04-23 |
| MX9709977A (es) | 1998-07-31 |
| EP0853618A1 (en) | 1998-07-22 |
| WO1996040679A1 (en) | 1996-12-19 |
| HUP9801882A3 (en) | 1999-01-28 |
| AP799A (en) | 2000-01-19 |
| KR19990022386A (ko) | 1999-03-25 |
| AU6166996A (en) | 1996-12-30 |
| JPH11507368A (ja) | 1999-06-29 |
| JP4312829B2 (ja) | 2009-08-12 |
| ATE520655T1 (de) | 2011-09-15 |
| CA2223403A1 (en) | 1996-12-19 |
| HUP9801882A2 (hu) | 1998-12-28 |
| EP0853618B1 (en) | 2011-08-17 |
| SK160697A3 (en) | 1998-11-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| OA10752A (en) | Substituted (sulfinic acid sulfonic acid sulfonylamino or sulfinylamino) n-Ä(aminoiminomethyl) phenylalkylÜ-azaheterocyclylamide compounds | |
| US5731315A (en) | Substituted sulfonic acid n- (aminoiminomethyl)phenylalkyl!-azaheterocyclamide compounds | |
| KR100348338B1 (ko) | 치환된n-[(아미노이미노메틸또는아미노메틸)페닐]프로필아미드및이를포함하는약제학적조성물 | |
| CZ20031773A3 (cs) | Derivát karboxamidu, způsob jeho přípravy, farmaceutický prostředek, který ho obsahuje a jeho použití pro ošetřování tromboembolických nemocí a nádorů | |
| MX2008002732A (es) | Nuevas cicloalcano carboxamidas como inhibidores del factor xa. | |
| PL191115B1 (pl) | Podstawione N-[(aminoiminometylo- lub aminometylo)fenylo]-propyloamidy, kompozycja farmaceutyczna zawierająca te związki oraz ich zastosowanie | |
| UA59433C2 (uk) | ЗАМІЩЕНІ ОКСОАЗАГЕТЕРОЦИКЛІЧНІ ІНГІБІТОРИ ФАКТОРА Хa ТА ПРОМІЖНІ СПОЛУКИ ДЛЯ ЇХ ОТРИМАННЯ | |
| HRP20020076A2 (en) | Substituted oxoazaheterocyclyl compounds | |
| US6034093A (en) | Substituted sulfonic acid N-[(aminoiminomethyl)phenylalkyl]-azaheterocyclylamide compounds | |
| AU726637B2 (en) | Sulfonic acid or sulfonylamino N-(heteroaralkyl)-azaheterocyclylamide compounds | |
| WO2001039759A2 (en) | Sulfonic acid or sulfonylamino n-(heteroaralkyl)-azaheterocyclylamide compounds | |
| AU758642B2 (en) | Sulfonic acid or sulfonylamino N-(heteroaralkyl)-azaheterocyclylamide compounds | |
| CZ20012350A3 (cs) | Substituované (aminoiminomethyl nebo aminomethyl) benzoheteroarylové sloučeniny | |
| US5958918A (en) | Substituted (sulfinic acid, sulfonic acid, sulfonylamino or sulfinylamino) N- (aminominomethyl)phenylalkyl!-azaheterocyclylamide compounds | |
| US6770640B1 (en) | 1-Carboxymethyl-2-oxo-azepan derivatives useful as selective inhibitors of MMP-12 |