ZA200400451B - Process for preparation of cyclohexanol derivatives - Google Patents
Process for preparation of cyclohexanol derivatives Download PDFInfo
- Publication number
- ZA200400451B ZA200400451B ZA2004/00451A ZA200400451A ZA200400451B ZA 200400451 B ZA200400451 B ZA 200400451B ZA 2004/00451 A ZA2004/00451 A ZA 2004/00451A ZA 200400451 A ZA200400451 A ZA 200400451A ZA 200400451 B ZA200400451 B ZA 200400451B
- Authority
- ZA
- South Africa
- Prior art keywords
- alkyl
- formula
- hydrogen
- compound
- cycloalkyl
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 40
- 238000002360 preparation method Methods 0.000 title claims description 16
- HPXRVTGHNJAIIH-PTQBSOBMSA-N cyclohexanol Chemical class O[13CH]1CCCCC1 HPXRVTGHNJAIIH-PTQBSOBMSA-N 0.000 title claims description 13
- 125000000217 alkyl group Chemical group 0.000 claims description 43
- 150000001875 compounds Chemical class 0.000 claims description 35
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 claims description 32
- 229910052739 hydrogen Inorganic materials 0.000 claims description 23
- 239000001257 hydrogen Substances 0.000 claims description 23
- 238000006243 chemical reaction Methods 0.000 claims description 22
- 125000002524 organometallic group Chemical group 0.000 claims description 19
- PACGLQCRGWFBJH-UHFFFAOYSA-N 2-(4-methoxyphenyl)acetonitrile Chemical compound COC1=CC=C(CC#N)C=C1 PACGLQCRGWFBJH-UHFFFAOYSA-N 0.000 claims description 14
- 239000003054 catalyst Substances 0.000 claims description 12
- 150000002431 hydrogen Chemical class 0.000 claims description 12
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 11
- 229920000642 polymer Polymers 0.000 claims description 11
- FVKFHMNJTHKMRX-UHFFFAOYSA-N 3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-a]pyrimidine Chemical compound C1CCN2CCCNC2=N1 FVKFHMNJTHKMRX-UHFFFAOYSA-N 0.000 claims description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 7
- KYVBNYUBXIEUFW-UHFFFAOYSA-N 1,1,3,3-tetramethylguanidine Chemical compound CN(C)C(=N)N(C)C KYVBNYUBXIEUFW-UHFFFAOYSA-N 0.000 claims description 6
- 230000029936 alkylation Effects 0.000 claims description 6
- 238000005804 alkylation reaction Methods 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- 125000004423 acyloxy group Chemical group 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000004414 alkyl thio group Chemical group 0.000 claims description 4
- 125000001475 halogen functional group Chemical group 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 125000001424 substituent group Chemical group 0.000 claims description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 4
- SGUVLZREKBPKCE-UHFFFAOYSA-N 1,5-diazabicyclo[4.3.0]-non-5-ene Chemical compound C1CCN=C2CCCN21 SGUVLZREKBPKCE-UHFFFAOYSA-N 0.000 claims description 3
- OEBXWWBYZJNKRK-UHFFFAOYSA-N 1-methyl-2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidine Chemical compound C1CCN=C2N(C)CCCN21 OEBXWWBYZJNKRK-UHFFFAOYSA-N 0.000 claims description 3
- 125000002252 acyl group Chemical group 0.000 claims description 3
- 150000001409 amidines Chemical class 0.000 claims description 3
- 239000007810 chemical reaction solvent Substances 0.000 claims description 3
- 150000003839 salts Chemical class 0.000 claims description 3
- 239000002904 solvent Substances 0.000 claims description 3
- 125000001589 carboacyl group Chemical group 0.000 claims description 2
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 2
- 150000002357 guanidines Chemical class 0.000 claims description 2
- 239000000203 mixture Substances 0.000 claims description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 36
- 238000003756 stirring Methods 0.000 description 21
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 20
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 19
- ASYJSBPNAIDUHX-UHFFFAOYSA-N 2-(1-hydroxycyclohexyl)-2-(4-methoxyphenyl)acetonitrile Chemical compound C1=CC(OC)=CC=C1C(C#N)C1(O)CCCCC1 ASYJSBPNAIDUHX-UHFFFAOYSA-N 0.000 description 17
- 239000008213 purified water Substances 0.000 description 17
- 239000000243 solution Substances 0.000 description 17
- 239000007787 solid Substances 0.000 description 16
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 238000001914 filtration Methods 0.000 description 12
- 239000002244 precipitate Substances 0.000 description 10
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 8
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 7
- 239000002253 acid Substances 0.000 description 7
- 125000004093 cyano group Chemical group *C#N 0.000 description 7
- SUSQOBVLVYHIEX-UHFFFAOYSA-N o-phenylene-diaceto-nitrile Natural products N#CCC1=CC=CC=C1 SUSQOBVLVYHIEX-UHFFFAOYSA-N 0.000 description 7
- 239000003960 organic solvent Substances 0.000 description 7
- -1 phenylacetonitrile anion Chemical class 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 6
- 238000004519 manufacturing process Methods 0.000 description 6
- 150000001450 anions Chemical class 0.000 description 5
- 238000004880 explosion Methods 0.000 description 5
- 238000005481 NMR spectroscopy Methods 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- 238000003786 synthesis reaction Methods 0.000 description 4
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 150000002825 nitriles Chemical class 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 238000010183 spectrum analysis Methods 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 description 2
- 229910010082 LiAlH Inorganic materials 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- UORVGPXVDQYIDP-UHFFFAOYSA-N borane Chemical compound B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- 238000005191 phase separation Methods 0.000 description 2
- QZAYGJVTTNCVMB-UHFFFAOYSA-N serotonin Chemical compound C1=C(O)C=C2C(CCN)=CNC2=C1 QZAYGJVTTNCVMB-UHFFFAOYSA-N 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- SFLSHLFXELFNJZ-QMMMGPOBSA-N (-)-norepinephrine Chemical compound NC[C@H](O)C1=CC=C(O)C(O)=C1 SFLSHLFXELFNJZ-QMMMGPOBSA-N 0.000 description 1
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- AXQUONJGMAVWJA-UHFFFAOYSA-N 1,1,2,3,3-pentabutylguanidine Chemical compound CCCCN=C(N(CCCC)CCCC)N(CCCC)CCCC AXQUONJGMAVWJA-UHFFFAOYSA-N 0.000 description 1
- ISNICOKBNZOJQG-UHFFFAOYSA-N 1,1,2,3,3-pentamethylguanidine Chemical compound CN=C(N(C)C)N(C)C ISNICOKBNZOJQG-UHFFFAOYSA-N 0.000 description 1
- 238000001644 13C nuclear magnetic resonance spectroscopy Methods 0.000 description 1
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 1
- CGWBIHLHAGNJCX-UHFFFAOYSA-N 2-butylguanidine Chemical compound CCCCNC(N)=N CGWBIHLHAGNJCX-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical class [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- RRXSYZFVDIRTFB-UHFFFAOYSA-N C[CH]C1=CC=C(OC)C=C1 Chemical group C[CH]C1=CC=C(OC)C=C1 RRXSYZFVDIRTFB-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 101150065749 Churc1 gene Proteins 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical group CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- VKEQBMCRQDSRET-UHFFFAOYSA-N Methylone Chemical compound CNC(C)C(=O)C1=CC=C2OCOC2=C1 VKEQBMCRQDSRET-UHFFFAOYSA-N 0.000 description 1
- 238000007126 N-alkylation reaction Methods 0.000 description 1
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 description 1
- 238000010934 O-alkylation reaction Methods 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 102100038239 Protein Churchill Human genes 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 230000001430 anti-depressive effect Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229910000085 borane Inorganic materials 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000002485 combustion reaction Methods 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- NHGVZTMBVDFPHJ-UHFFFAOYSA-N formyl fluoride Chemical compound FC=O NHGVZTMBVDFPHJ-UHFFFAOYSA-N 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 239000002815 homogeneous catalyst Substances 0.000 description 1
- 230000036571 hydration Effects 0.000 description 1
- 238000006703 hydration reaction Methods 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- PSGAAPLEWMOORI-PEINSRQWSA-N medroxyprogesterone acetate Chemical compound C([C@@]12C)CC(=O)C=C1[C@@H](C)C[C@@H]1[C@@H]2CC[C@]2(C)[C@@](OC(C)=O)(C(C)=O)CC[C@H]21 PSGAAPLEWMOORI-PEINSRQWSA-N 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000002858 neurotransmitter agent Substances 0.000 description 1
- 229960002748 norepinephrine Drugs 0.000 description 1
- SFLSHLFXELFNJZ-UHFFFAOYSA-N norepinephrine Natural products NCC(O)C1=CC=C(O)C(O)=C1 SFLSHLFXELFNJZ-UHFFFAOYSA-N 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 238000004445 quantitative analysis Methods 0.000 description 1
- VMXUWOKSQNHOCA-UKTHLTGXSA-N ranitidine Chemical compound [O-][N+](=O)\C=C(/NC)NCCSCC1=CC=C(CN(C)C)O1 VMXUWOKSQNHOCA-UKTHLTGXSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 229940076279 serotonin Drugs 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- JABYJIQOLGWMQW-UHFFFAOYSA-N undec-4-ene Chemical compound CCCCCCC=CCCC JABYJIQOLGWMQW-UHFFFAOYSA-N 0.000 description 1
- PNVNVHUZROJLTJ-UHFFFAOYSA-N venlafaxine Chemical compound C1=CC(OC)=CC=C1C(CN(C)C)C1(O)CCCCC1 PNVNVHUZROJLTJ-UHFFFAOYSA-N 0.000 description 1
- 229960004688 venlafaxine Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C253/00—Preparation of carboxylic acid nitriles
- C07C253/30—Preparation of carboxylic acid nitriles by reactions not involving the formation of cyano groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/14—The ring being saturated
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| KR1020010035889A KR20030000217A (ko) | 2001-06-22 | 2001-06-22 | 시클로헥사놀 유도체의 제조방법 |
| PCT/US2002/019753 WO2003000652A1 (en) | 2001-06-22 | 2002-06-21 | Process for preparation of cyclohexanol derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA200400451B true ZA200400451B (en) | 2005-06-29 |
Family
ID=36604137
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA2004/00451A ZA200400451B (en) | 2001-06-22 | 2004-01-21 | Process for preparation of cyclohexanol derivatives |
Country Status (21)
| Country | Link |
|---|---|
| EP (1) | EP1397344A1 (no) |
| JP (1) | JP2004531577A (no) |
| KR (2) | KR20030000217A (no) |
| CN (1) | CN1267410C (no) |
| AR (1) | AR034609A1 (no) |
| BR (1) | BR0210542A (no) |
| CA (1) | CA2450914A1 (no) |
| CO (1) | CO5540339A2 (no) |
| EA (1) | EA007486B1 (no) |
| EC (1) | ECSP034920A (no) |
| HU (1) | HUP0400867A3 (no) |
| IL (1) | IL159448A0 (no) |
| MX (1) | MXPA03011401A (no) |
| NO (1) | NO20035586D0 (no) |
| NZ (1) | NZ530594A (no) |
| PL (1) | PL366613A1 (no) |
| SG (1) | SG156520A1 (no) |
| TW (1) | TWI250973B (no) |
| UA (1) | UA78511C2 (no) |
| WO (1) | WO2003000652A1 (no) |
| ZA (1) | ZA200400451B (no) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| KR100651353B1 (ko) * | 2002-02-01 | 2006-11-28 | 에스케이 주식회사 | 고수율로 벤라팩신 중간체를 연속적으로 제조하는 방법 |
| WO2005049560A2 (en) * | 2003-09-29 | 2005-06-02 | Sun Pharmaceutical Industries Limited | Process for the preparation of anti-depressant compound |
| TW200523258A (en) * | 2003-10-02 | 2005-07-16 | Wyeth Corp | Process for the preparation of 1-[cyano(phenyl)methyl]-cyclohexanol compounds |
| JP2008546818A (ja) * | 2005-06-29 | 2008-12-25 | ワイエス | １−［シアノ（４−ヒドロキシフェニル）メチル］シクロヘキサノール化合物の製造方法 |
| MX2007016179A (es) | 2006-04-17 | 2008-03-11 | Teva Pharma | Formas cristalinas de o-desmetilvenlafaxina. |
| CA2656166A1 (en) * | 2006-07-26 | 2008-01-31 | Teva Pharmaceutical Industries Ltd. | Processes for the synthesis of o-desmethylvenlafaxine |
| US20080177110A1 (en) * | 2006-07-26 | 2008-07-24 | Valerie Niddam-Hildesheim | Processes for the synthesis of O-desmethylvenlafaxine |
| CA2795023A1 (en) | 2010-03-29 | 2011-10-06 | Pliva Hrvatska D.O.O. | Crystal forms of o-desmethylvenlafaxine fumarate |
| BR112016021706A2 (pt) | 2014-03-28 | 2018-07-10 | Cummins Filtration Ip Inc | aditivos de óleo sem cinzas e uso dos mesmos como reforçadores de tbn. |
| PL3737726T3 (pl) | 2018-01-10 | 2024-04-22 | Huntsman International Llc | Formulacje zawierające poliuretan o funkcjonalności izocyjanianu |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4535186A (en) * | 1983-04-19 | 1985-08-13 | American Home Products Corporation | 2-Phenyl-2-(1-hydroxycycloalkyl or 1-hydroxycycloalk-2-enyl)ethylamine derivatives |
| GB8902209D0 (en) * | 1989-02-01 | 1989-03-22 | Wyeth John And Brother Limited | Preparation of cyclohexanol derivatives and novel thioamide intermediates |
| TWI228118B (en) * | 2000-08-30 | 2005-02-21 | Ciba Sc Holding Ag | Process for the preparation of substituted phenylacetonitriles |
-
2001
- 2001-06-22 KR KR1020010035889A patent/KR20030000217A/ko not_active Application Discontinuation
-
2002
- 2002-06-21 CA CA002450914A patent/CA2450914A1/en not_active Abandoned
- 2002-06-21 WO PCT/US2002/019753 patent/WO2003000652A1/en active Application Filing
- 2002-06-21 TW TW091113830A patent/TWI250973B/zh not_active IP Right Cessation
- 2002-06-21 CN CNB028124669A patent/CN1267410C/zh not_active Expired - Fee Related
- 2002-06-21 EP EP02744526A patent/EP1397344A1/en not_active Withdrawn
- 2002-06-21 PL PL02366613A patent/PL366613A1/xx not_active Application Discontinuation
- 2002-06-21 BR BR0210542-0A patent/BR0210542A/pt not_active IP Right Cessation
- 2002-06-21 UA UA2004010467A patent/UA78511C2/uk unknown
- 2002-06-21 JP JP2003507059A patent/JP2004531577A/ja not_active Ceased
- 2002-06-21 HU HU0400867A patent/HUP0400867A3/hu unknown
- 2002-06-21 SG SG200508264-9A patent/SG156520A1/en unknown
- 2002-06-21 IL IL15944802A patent/IL159448A0/xx unknown
- 2002-06-21 AR ARP020102341A patent/AR034609A1/es unknown
- 2002-06-21 NZ NZ530594A patent/NZ530594A/en not_active IP Right Cessation
- 2002-06-21 KR KR1020037016739A patent/KR100874835B1/ko not_active IP Right Cessation
- 2002-06-21 MX MXPA03011401A patent/MXPA03011401A/es not_active Application Discontinuation
- 2002-06-21 EA EA200400069A patent/EA007486B1/ru not_active IP Right Cessation
-
2003
- 2003-12-15 NO NO20035586A patent/NO20035586D0/no not_active Application Discontinuation
- 2003-12-22 CO CO03111625A patent/CO5540339A2/es not_active Application Discontinuation
- 2003-12-22 EC EC2003004920A patent/ECSP034920A/es unknown
-
2004
- 2004-01-21 ZA ZA2004/00451A patent/ZA200400451B/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| HUP0400867A2 (hu) | 2004-08-30 |
| EP1397344A1 (en) | 2004-03-17 |
| TWI250973B (en) | 2006-03-11 |
| UA78511C2 (en) | 2007-04-10 |
| HUP0400867A3 (en) | 2005-04-28 |
| EA007486B1 (ru) | 2006-10-27 |
| CN1531524A (zh) | 2004-09-22 |
| MXPA03011401A (es) | 2004-04-05 |
| SG156520A1 (en) | 2009-11-26 |
| CO5540339A2 (es) | 2005-07-29 |
| NO20035586L (no) | 2003-12-15 |
| ECSP034920A (es) | 2004-02-26 |
| BR0210542A (pt) | 2004-06-22 |
| NZ530594A (en) | 2006-06-30 |
| WO2003000652A8 (en) | 2004-05-21 |
| IL159448A0 (en) | 2004-06-01 |
| CA2450914A1 (en) | 2003-01-03 |
| PL366613A1 (en) | 2005-02-07 |
| KR20040011548A (ko) | 2004-02-05 |
| NO20035586D0 (no) | 2003-12-15 |
| AR034609A1 (es) | 2004-03-03 |
| EA200400069A1 (ru) | 2004-06-24 |
| KR20030000217A (ko) | 2003-01-06 |
| KR100874835B1 (ko) | 2008-12-19 |
| WO2003000652A1 (en) | 2003-01-03 |
| JP2004531577A (ja) | 2004-10-14 |
| CN1267410C (zh) | 2006-08-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US9944616B2 (en) | Processes for the preparation of Tasimelteon and intermediates thereof | |
| ZA200400451B (en) | Process for preparation of cyclohexanol derivatives | |
| Alexakis et al. | A practical, solvent free, one-pot synthesis of C2-symmetrical secondary amines | |
| US20040106818A1 (en) | Process for the preparation of cyclohexanol derivatives | |
| SK12992000A3 (sk) | Spôsob prípravy chráneného 4-aminometyl-pyrolidin-3-ónu | |
| US6437171B1 (en) | Process for preparing 1,2-diamino compounds | |
| WO2007047972A2 (en) | Process for the preparation of highly pure 1-[2-dimethylamino-(4-methoxyphenyl) ethyl]cyclohexanol hydrochloride | |
| US7476762B2 (en) | Methods for preparing sulfonamide compounds | |
| US6506941B1 (en) | Venlafaxine production process | |
| AU725484B2 (en) | Compounds and method for preparing substituted 4-phenyl-4-cyanocyclohexanoic acids | |
| US20040186310A1 (en) | Process for preparation of cyclohexanol derivatives | |
| CN102105438B (zh) | 取代的4-氨基-嘧啶类化合物的合成方法 | |
| WO2007094008A2 (en) | A novel process for preparation of venlafaxine hydrochloride and its intermediates | |
| EP2674414A1 (en) | Method for the preparation of 1-aryl-1-alkyl-3-dialkylaminopropane compounds | |
| AU2002345776A1 (en) | Process for preparation of cycloalkanol (and cycloalkenol) derivatives | |
| JP2002226450A (ja) | 環状脂肪族ビシナル第１級ジアミンからの新規なポリニトリルの合成 | |
| WO2007006132A1 (en) | An efficient method for preparing 3-aryloxy-3- arylpropylamines and their optical stereoisomers | |
| US20100094055A1 (en) | Process for the preparation of phenethylamine derivatives | |
| US7485754B2 (en) | Efficient method for preparing 3-aryloxy-3-arylpropylamines and their optical stereoisomers | |
| WO2012081036A2 (en) | A process for preparation of 4,4'-(1-methyl-1,2-ethandiyl)-bis-(2,6-piperazinedione) | |
| EP4077270A1 (en) | Process for synthesis of twin-tail triamines | |
| CN101321725B (zh) | 制备o-烷基化氨基醇的方法 | |
| EP0672646B1 (en) | Process for producing beta-nitro-enamines and intermediates thereof | |
| CN112321451A (zh) | 一种用于制备盐酸西那卡塞药物中间体的方法 | |
| EP1237848A1 (en) | Process for the preparation of 3-amino-3-cyclopropylpropanoate esters |