TWI577663B - 用於製備4-胺基-5-氟-3-鹵素-6-(經取代之)吡啶甲酸酯的方法 - Google Patents
用於製備4-胺基-5-氟-3-鹵素-6-(經取代之)吡啶甲酸酯的方法 Download PDFInfo
- Publication number
- TWI577663B TWI577663B TW102126266A TW102126266A TWI577663B TW I577663 B TWI577663 B TW I577663B TW 102126266 A TW102126266 A TW 102126266A TW 102126266 A TW102126266 A TW 102126266A TW I577663 B TWI577663 B TW I577663B
- Authority
- TW
- Taiwan
- Prior art keywords
- compound
- formula
- group
- alkyl
- halogen
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 72
- 238000002360 preparation method Methods 0.000 title description 28
- 230000008569 process Effects 0.000 title description 24
- 150000001875 compounds Chemical class 0.000 claims description 328
- 238000006243 chemical reaction Methods 0.000 claims description 146
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical group CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 claims description 85
- 239000000460 chlorine Substances 0.000 claims description 76
- 229910052736 halogen Inorganic materials 0.000 claims description 76
- -1 C 1 -C 4 alkyl Chemical group 0.000 claims description 72
- 229910052801 chlorine Inorganic materials 0.000 claims description 64
- 150000002367 halogens Chemical class 0.000 claims description 61
- 229910052794 bromium Inorganic materials 0.000 claims description 48
- 150000003839 salts Chemical class 0.000 claims description 41
- 239000003054 catalyst Substances 0.000 claims description 39
- 229910052740 iodine Inorganic materials 0.000 claims description 39
- 229910052739 hydrogen Inorganic materials 0.000 claims description 36
- 239000001257 hydrogen Substances 0.000 claims description 35
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 34
- 125000001424 substituent group Chemical group 0.000 claims description 34
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 31
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 28
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 claims description 26
- 238000005859 coupling reaction Methods 0.000 claims description 26
- 229910052731 fluorine Inorganic materials 0.000 claims description 26
- 125000004765 (C1-C4) haloalkyl group Chemical group 0.000 claims description 25
- 230000002140 halogenating effect Effects 0.000 claims description 24
- 239000002904 solvent Substances 0.000 claims description 24
- 239000012453 solvate Substances 0.000 claims description 23
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 22
- 229910052802 copper Inorganic materials 0.000 claims description 22
- 239000010949 copper Substances 0.000 claims description 22
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 21
- 229910052723 transition metal Inorganic materials 0.000 claims description 21
- 150000003624 transition metals Chemical class 0.000 claims description 21
- XJHCXCQVJFPJIK-UHFFFAOYSA-M caesium fluoride Chemical compound [F-].[Cs+] XJHCXCQVJFPJIK-UHFFFAOYSA-M 0.000 claims description 20
- 150000002431 hydrogen Chemical class 0.000 claims description 20
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 20
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 19
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 19
- 150000001412 amines Chemical class 0.000 claims description 18
- 125000003277 amino group Chemical group 0.000 claims description 17
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 16
- 230000008878 coupling Effects 0.000 claims description 16
- 238000010168 coupling process Methods 0.000 claims description 16
- 125000004400 (C1-C12) alkyl group Chemical group 0.000 claims description 15
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 15
- 239000002253 acid Substances 0.000 claims description 15
- 229910021529 ammonia Inorganic materials 0.000 claims description 14
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 14
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 claims description 13
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 12
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 11
- 239000011698 potassium fluoride Substances 0.000 claims description 11
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims description 9
- 230000015572 biosynthetic process Effects 0.000 claims description 8
- 238000003682 fluorination reaction Methods 0.000 claims description 8
- 125000004767 (C1-C4) haloalkoxy group Chemical group 0.000 claims description 7
- 229910001515 alkali metal fluoride Inorganic materials 0.000 claims description 7
- 239000002585 base Substances 0.000 claims description 6
- 150000003983 crown ethers Chemical class 0.000 claims description 6
- 235000003270 potassium fluoride Nutrition 0.000 claims description 6
- PUZPDOWCWNUUKD-UHFFFAOYSA-M sodium fluoride Chemical compound [F-].[Na+] PUZPDOWCWNUUKD-UHFFFAOYSA-M 0.000 claims description 5
- 238000000605 extraction Methods 0.000 claims description 4
- 125000006656 (C2-C4) alkenyl group Chemical group 0.000 claims description 3
- 239000004721 Polyphenylene oxide Substances 0.000 claims description 3
- 150000001335 aliphatic alkanes Chemical class 0.000 claims description 3
- 238000010511 deprotection reaction Methods 0.000 claims description 3
- 230000003301 hydrolyzing effect Effects 0.000 claims description 3
- 229920000570 polyether Polymers 0.000 claims description 3
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 2
- 238000002425 crystallisation Methods 0.000 claims description 2
- 230000008025 crystallization Effects 0.000 claims description 2
- 230000007935 neutral effect Effects 0.000 claims description 2
- 238000001556 precipitation Methods 0.000 claims description 2
- 239000011775 sodium fluoride Substances 0.000 claims description 2
- 235000013024 sodium fluoride Nutrition 0.000 claims description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 claims 2
- PLFFHJWXOGYWPR-HEDMGYOXSA-N (4r)-4-[(3r,3as,5ar,5br,7as,11as,11br,13ar,13bs)-5a,5b,8,8,11a,13b-hexamethyl-1,2,3,3a,4,5,6,7,7a,9,10,11,11b,12,13,13a-hexadecahydrocyclopenta[a]chrysen-3-yl]pentan-1-ol Chemical group C([C@]1(C)[C@H]2CC[C@H]34)CCC(C)(C)[C@@H]1CC[C@@]2(C)[C@]4(C)CC[C@@H]1[C@]3(C)CC[C@@H]1[C@@H](CCCO)C PLFFHJWXOGYWPR-HEDMGYOXSA-N 0.000 claims 1
- 150000003990 18-crown-6 derivatives Chemical group 0.000 claims 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims 1
- GKTNLYAAZKKMTQ-UHFFFAOYSA-N n-[bis(dimethylamino)phosphinimyl]-n-methylmethanamine Chemical class CN(C)P(=N)(N(C)C)N(C)C GKTNLYAAZKKMTQ-UHFFFAOYSA-N 0.000 claims 1
- 230000003472 neutralizing effect Effects 0.000 claims 1
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 claims 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 60
- 239000000203 mixture Substances 0.000 description 50
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 47
- 239000011541 reaction mixture Substances 0.000 description 45
- 239000007787 solid Substances 0.000 description 44
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 36
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 30
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 30
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 27
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 25
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 24
- 239000000047 product Substances 0.000 description 23
- 150000004820 halides Chemical class 0.000 description 22
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 21
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 21
- 229910052757 nitrogen Inorganic materials 0.000 description 21
- 239000000243 solution Substances 0.000 description 19
- 235000019439 ethyl acetate Nutrition 0.000 description 18
- 238000004949 mass spectrometry Methods 0.000 description 18
- 238000003756 stirring Methods 0.000 description 17
- 125000000217 alkyl group Chemical group 0.000 description 15
- 125000005843 halogen group Chemical group 0.000 description 14
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 13
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 13
- 235000017168 chlorine Nutrition 0.000 description 13
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 12
- 125000001153 fluoro group Chemical group F* 0.000 description 12
- SIOXPEMLGUPBBT-UHFFFAOYSA-M picolinate Chemical compound [O-]C(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-M 0.000 description 12
- 239000007858 starting material Substances 0.000 description 12
- 239000011737 fluorine Substances 0.000 description 11
- 238000010438 heat treatment Methods 0.000 description 11
- 239000003153 chemical reaction reagent Substances 0.000 description 10
- 238000004128 high performance liquid chromatography Methods 0.000 description 10
- RAOIDOHSFRTOEL-UHFFFAOYSA-N tetrahydrothiophene Chemical compound C1CCSC1 RAOIDOHSFRTOEL-UHFFFAOYSA-N 0.000 description 10
- 125000003118 aryl group Chemical group 0.000 description 9
- 229910052799 carbon Inorganic materials 0.000 description 9
- 239000012043 crude product Substances 0.000 description 9
- 239000012442 inert solvent Substances 0.000 description 9
- GTCAXTIRRLKXRU-UHFFFAOYSA-N methyl carbamate Chemical compound COC(N)=O GTCAXTIRRLKXRU-UHFFFAOYSA-N 0.000 description 9
- 125000006239 protecting group Chemical group 0.000 description 9
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- 238000004458 analytical method Methods 0.000 description 8
- 238000004821 distillation Methods 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 7
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 7
- YNHIGQDRGKUECZ-UHFFFAOYSA-L bis(triphenylphosphine)palladium(ii) dichloride Chemical compound [Cl-].[Cl-].[Pd+2].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 YNHIGQDRGKUECZ-UHFFFAOYSA-L 0.000 description 7
- 125000001309 chloro group Chemical group Cl* 0.000 description 7
- 238000002290 gas chromatography-mass spectrometry Methods 0.000 description 7
- AIYYMMQIMJOTBM-UHFFFAOYSA-L nickel(ii) acetate Chemical compound [Ni+2].CC([O-])=O.CC([O-])=O AIYYMMQIMJOTBM-UHFFFAOYSA-L 0.000 description 7
- 239000000376 reactant Substances 0.000 description 7
- 239000000725 suspension Substances 0.000 description 7
- JOYRKODLDBILNP-UHFFFAOYSA-N urethane group Chemical group NC(=O)OCC JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 7
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 238000002451 electron ionisation mass spectrometry Methods 0.000 description 6
- 150000002148 esters Chemical group 0.000 description 6
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 6
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 6
- 239000010410 layer Substances 0.000 description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 6
- 239000012044 organic layer Substances 0.000 description 6
- MUCAKBKIVUFYQH-UHFFFAOYSA-N propan-2-yl 4,5,6-trichloropyridine-2-carboxylate Chemical compound CC(C)OC(=O)C1=CC(Cl)=C(Cl)C(Cl)=N1 MUCAKBKIVUFYQH-UHFFFAOYSA-N 0.000 description 6
- XEZNGIUYQVAUSS-UHFFFAOYSA-N 18-crown-6 Chemical compound C1COCCOCCOCCOCCOCCO1 XEZNGIUYQVAUSS-UHFFFAOYSA-N 0.000 description 5
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 5
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- 150000007513 acids Chemical class 0.000 description 5
- 238000001914 filtration Methods 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- 229910052751 metal Inorganic materials 0.000 description 5
- 239000002184 metal Substances 0.000 description 5
- YRGNDQQIUXCCAI-UHFFFAOYSA-N propan-2-yl 4,5,6-trifluoropyridine-2-carboxylate Chemical compound CC(C)OC(=O)C1=CC(F)=C(F)C(F)=N1 YRGNDQQIUXCCAI-UHFFFAOYSA-N 0.000 description 5
- CICGUYUXQJWNFS-UHFFFAOYSA-N propan-2-yl 4-amino-6-(4-chloro-2-fluoro-3-methoxyphenyl)-5-fluoropyridine-2-carboxylate Chemical compound COC1=C(Cl)C=CC(C=2C(=C(N)C=C(N=2)C(=O)OC(C)C)F)=C1F CICGUYUXQJWNFS-UHFFFAOYSA-N 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 4
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 4
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 4
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 4
- 238000005576 amination reaction Methods 0.000 description 4
- 150000001732 carboxylic acid derivatives Chemical group 0.000 description 4
- 239000012320 chlorinating reagent Substances 0.000 description 4
- 239000008139 complexing agent Substances 0.000 description 4
- 125000000524 functional group Chemical group 0.000 description 4
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 4
- 150000004702 methyl esters Chemical class 0.000 description 4
- 238000012544 monitoring process Methods 0.000 description 4
- SIOXPEMLGUPBBT-UHFFFAOYSA-N picolinic acid Chemical class OC(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-N 0.000 description 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 4
- BRIULBRBZYPEDW-UHFFFAOYSA-N propan-2-yl 4-amino-6-bromo-5-fluoropyridine-2-carboxylate Chemical compound CC(C)OC(=O)C1=CC(N)=C(F)C(Br)=N1 BRIULBRBZYPEDW-UHFFFAOYSA-N 0.000 description 4
- 238000000746 purification Methods 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- YBCAZPLXEGKKFM-UHFFFAOYSA-K ruthenium(iii) chloride Chemical compound [Cl-].[Cl-].[Cl-].[Ru+3] YBCAZPLXEGKKFM-UHFFFAOYSA-K 0.000 description 4
- 239000002002 slurry Substances 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- XDLNRRRJZOJTRW-UHFFFAOYSA-N thiohypochlorous acid Chemical compound ClS XDLNRRRJZOJTRW-UHFFFAOYSA-N 0.000 description 4
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 4
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 3
- IGPQMIDJMOHHMP-UHFFFAOYSA-N 2,3,4-trichloropyridin-1-ium chloride Chemical compound [Cl-].ClC1=CC=[NH+]C(=C1Cl)Cl IGPQMIDJMOHHMP-UHFFFAOYSA-N 0.000 description 3
- 102100027324 2-hydroxyacyl-CoA lyase 1 Human genes 0.000 description 3
- PJAIMBYNTXNOCN-UHFFFAOYSA-N 3,6-dibromo-1h-indole Chemical compound BrC1=CC=C2C(Br)=CNC2=C1 PJAIMBYNTXNOCN-UHFFFAOYSA-N 0.000 description 3
- HBPSHBLIEQWDMD-UHFFFAOYSA-N 4,5-dichloro-6-phenylpyridine-2-carboxylic acid Chemical compound OC(=O)C1=CC(Cl)=C(Cl)C(C=2C=CC=CC=2)=N1 HBPSHBLIEQWDMD-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 3
- 101001009252 Homo sapiens 2-hydroxyacyl-CoA lyase 1 Proteins 0.000 description 3
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 3
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 3
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 3
- VEOLKVPRMPFSNF-UHFFFAOYSA-M [Cl-].Cl[N+]1=CC=CC=C1 Chemical compound [Cl-].Cl[N+]1=CC=CC=C1 VEOLKVPRMPFSNF-UHFFFAOYSA-M 0.000 description 3
- WAIPAZQMEIHHTJ-UHFFFAOYSA-N [Cr].[Co] Chemical group [Cr].[Co] WAIPAZQMEIHHTJ-UHFFFAOYSA-N 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 125000003342 alkenyl group Chemical group 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 125000004414 alkyl thio group Chemical group 0.000 description 3
- 125000000304 alkynyl group Chemical group 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 238000005660 chlorination reaction Methods 0.000 description 3
- 238000007796 conventional method Methods 0.000 description 3
- 125000004093 cyano group Chemical group *C#N 0.000 description 3
- YDVNLQGCLLPHAH-UHFFFAOYSA-N dichloromethane;hydrate Chemical compound O.ClCCl YDVNLQGCLLPHAH-UHFFFAOYSA-N 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 239000004009 herbicide Substances 0.000 description 3
- 125000001072 heteroaryl group Chemical group 0.000 description 3
- 239000011630 iodine Substances 0.000 description 3
- 150000002500 ions Chemical class 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- KRZUZKOBHVZRON-UHFFFAOYSA-N propan-2-yl 4-amino-5,6-difluoropyridine-2-carboxylate Chemical compound CC(C)OC(=O)C1=CC(N)=C(F)C(F)=N1 KRZUZKOBHVZRON-UHFFFAOYSA-N 0.000 description 3
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 229940124530 sulfonamide Drugs 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- MWDNZMWVENFVHT-UHFFFAOYSA-L (2-decoxy-2-oxoethyl)-[2-[2-[(2-decoxy-2-oxoethyl)-dimethylazaniumyl]ethylsulfanyl]ethyl]-dimethylazanium;dichloride Chemical compound [Cl-].[Cl-].CCCCCCCCCCOC(=O)C[N+](C)(C)CCSCC[N+](C)(C)CC(=O)OCCCCCCCCCC MWDNZMWVENFVHT-UHFFFAOYSA-L 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- MTAODLNXWYIKSO-UHFFFAOYSA-N 2-fluoropyridine Chemical compound FC1=CC=CC=N1 MTAODLNXWYIKSO-UHFFFAOYSA-N 0.000 description 2
- QIMMUPPBPVKWKM-UHFFFAOYSA-N 2-methylnaphthalene Chemical compound C1=CC=CC2=CC(C)=CC=C21 QIMMUPPBPVKWKM-UHFFFAOYSA-N 0.000 description 2
- XTMUXJBJCMRWPG-UHFFFAOYSA-N 3-chloropyridine-2-carboxylic acid Chemical class OC(=O)C1=NC=CC=C1Cl XTMUXJBJCMRWPG-UHFFFAOYSA-N 0.000 description 2
- OOJSYCQGNGAGHK-UHFFFAOYSA-N 3-chloropyridine;hydrochloride Chemical compound Cl.ClC1=CC=CN=C1 OOJSYCQGNGAGHK-UHFFFAOYSA-N 0.000 description 2
- ZAYTUZJMFVYJSU-UHFFFAOYSA-N 4,5-dichloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)pyridine-2-carboxylic acid Chemical compound COC1=C(Cl)C=CC(C=2C(=C(Cl)C=C(N=2)C(O)=O)Cl)=C1F ZAYTUZJMFVYJSU-UHFFFAOYSA-N 0.000 description 2
- DOJINJNLDNIFBN-UHFFFAOYSA-N 4-fluoropyridine-2-carboxylic acid Chemical compound OC(=O)C1=CC(F)=CC=N1 DOJINJNLDNIFBN-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- IHOMXYFRHHFKGH-UHFFFAOYSA-N CCNC(C(F)=C(N=C1C(OC)=O)Cl)=C1Cl Chemical compound CCNC(C(F)=C(N=C1C(OC)=O)Cl)=C1Cl IHOMXYFRHHFKGH-UHFFFAOYSA-N 0.000 description 2
- XTEGARKTQYYJKE-UHFFFAOYSA-M Chlorate Chemical compound [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 description 2
- NIQCNGHVCWTJSM-UHFFFAOYSA-N Dimethyl phthalate Chemical compound COC(=O)C1=CC=CC=C1C(=O)OC NIQCNGHVCWTJSM-UHFFFAOYSA-N 0.000 description 2
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 2
- NPUFHDLBXOQJSG-UHFFFAOYSA-N FC1=CC=NC(F)=C1F.C1C(C=CC=C2)=C2C2=CC=CC=C12 Chemical compound FC1=CC=NC(F)=C1F.C1C(C=CC=C2)=C2C2=CC=CC=C12 NPUFHDLBXOQJSG-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- LQZMLBORDGWNPD-UHFFFAOYSA-N N-iodosuccinimide Chemical compound IN1C(=O)CCC1=O LQZMLBORDGWNPD-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- IALJJRXMHHHZGG-UHFFFAOYSA-N [Cl-].ClC1=CC=[NH+]C(=C1Cl)C1=CC=CC=C1 Chemical compound [Cl-].ClC1=CC=[NH+]C(=C1Cl)C1=CC=CC=C1 IALJJRXMHHHZGG-UHFFFAOYSA-N 0.000 description 2
- 238000013019 agitation Methods 0.000 description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 2
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 2
- 125000006242 amine protecting group Chemical group 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- MWPLVEDNUUSJAV-UHFFFAOYSA-N anthracene Chemical compound C1=CC=CC2=CC3=CC=CC=C3C=C21 MWPLVEDNUUSJAV-UHFFFAOYSA-N 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 150000007514 bases Chemical class 0.000 description 2
- PUJDIJCNWFYVJX-UHFFFAOYSA-N benzyl carbamate Chemical compound NC(=O)OCC1=CC=CC=C1 PUJDIJCNWFYVJX-UHFFFAOYSA-N 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 238000005893 bromination reaction Methods 0.000 description 2
- 125000001246 bromo group Chemical group Br* 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 description 2
- 239000012025 fluorinating agent Substances 0.000 description 2
- 238000005658 halogenation reaction Methods 0.000 description 2
- 230000002363 herbicidal effect Effects 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 2
- 229910000043 hydrogen iodide Inorganic materials 0.000 description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 239000011261 inert gas Substances 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 2
- PZSVMKWRONODDG-UHFFFAOYSA-N methyl 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-5-fluoropyridine-2-carboxylate Chemical compound NC1=C(Cl)C(C(=O)OC)=NC(C=2C(=C(OC)C(Cl)=CC=2)F)=C1F PZSVMKWRONODDG-UHFFFAOYSA-N 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 2
- HXITXNWTGFUOAU-UHFFFAOYSA-N phenylboronic acid Chemical compound OB(O)C1=CC=CC=C1 HXITXNWTGFUOAU-UHFFFAOYSA-N 0.000 description 2
- 239000002798 polar solvent Substances 0.000 description 2
- 229920001296 polysiloxane Polymers 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- GVTNRGPDFNRZDX-UHFFFAOYSA-N propan-2-yl 4,5-dichloro-6-(4-chlorophenyl)pyridine-2-carboxylate Chemical compound CC(C)OC(=O)C1=CC(Cl)=C(Cl)C(C=2C=CC(Cl)=CC=2)=N1 GVTNRGPDFNRZDX-UHFFFAOYSA-N 0.000 description 2
- UEMMMVIJKLOXHJ-UHFFFAOYSA-N propan-2-yl 4,5-dichloro-6-(4-methoxyphenyl)pyridine-2-carboxylate Chemical compound C1=CC(OC)=CC=C1C1=NC(C(=O)OC(C)C)=CC(Cl)=C1Cl UEMMMVIJKLOXHJ-UHFFFAOYSA-N 0.000 description 2
- WDBVGEMYQHJBDA-UHFFFAOYSA-N propan-2-yl 4,5-dichloro-6-phenylpyridine-2-carboxylate Chemical compound CC(C)OC(=O)C1=CC(Cl)=C(Cl)C(C=2C=CC=CC=2)=N1 WDBVGEMYQHJBDA-UHFFFAOYSA-N 0.000 description 2
- WIHGQWNSIGOEJP-UHFFFAOYSA-N propan-2-yl 4-amino-6-chloro-5-fluoropyridine-2-carboxylate Chemical compound CC(C)OC(=O)C1=CC(N)=C(F)C(Cl)=N1 WIHGQWNSIGOEJP-UHFFFAOYSA-N 0.000 description 2
- 239000001397 quillaja saponaria molina bark Substances 0.000 description 2
- 239000012429 reaction media Substances 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 229930182490 saponin Natural products 0.000 description 2
- 150000007949 saponins Chemical class 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 238000010561 standard procedure Methods 0.000 description 2
- 150000003456 sulfonamides Chemical class 0.000 description 2
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 229920001864 tannin Polymers 0.000 description 2
- 235000018553 tannin Nutrition 0.000 description 2
- 239000001648 tannin Substances 0.000 description 2
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 238000003828 vacuum filtration Methods 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- OUKYRKPPQMHVGV-UHFFFAOYSA-N (1,1,1-trichloro-2-methylpropan-2-yl)carbamic acid Chemical compound ClC(Cl)(Cl)C(C)(C)NC(O)=O OUKYRKPPQMHVGV-UHFFFAOYSA-N 0.000 description 1
- RFEZEFZASMKNBJ-UHFFFAOYSA-N (1,1-dibromo-2-methylpropan-2-yl)carbamic acid Chemical compound BrC(Br)C(C)(C)NC(O)=O RFEZEFZASMKNBJ-UHFFFAOYSA-N 0.000 description 1
- AFCTUKSQTSHXEZ-UHFFFAOYSA-N (1-cyano-2-methylpropan-2-yl) carbamate Chemical class N#CCC(C)(C)OC(N)=O AFCTUKSQTSHXEZ-UHFFFAOYSA-N 0.000 description 1
- FTVXFBJENACRRL-UHFFFAOYSA-N (1-hydroxypiperidin-2-yl) carbamate Chemical compound NC(=O)OC1CCCCN1O FTVXFBJENACRRL-UHFFFAOYSA-N 0.000 description 1
- SZIUEGFGVMDZLJ-UHFFFAOYSA-N (1-methylcyclohexyl)carbamic acid Chemical compound OC(=O)NC1(C)CCCCC1 SZIUEGFGVMDZLJ-UHFFFAOYSA-N 0.000 description 1
- GWFMCAZZUXHMRM-UHFFFAOYSA-N (2,4,6-tritert-butylphenyl)carbamic acid Chemical compound CC(C)(C)C1=CC(C(C)(C)C)=C(NC(O)=O)C(C(C)(C)C)=C1 GWFMCAZZUXHMRM-UHFFFAOYSA-N 0.000 description 1
- HIPYHINICCKLGX-UHFFFAOYSA-N (3,5-dimethoxyphenyl)methyl carbamate Chemical compound COC1=CC(COC(N)=O)=CC(OC)=C1 HIPYHINICCKLGX-UHFFFAOYSA-N 0.000 description 1
- WTKQMHWYSBWUBE-UHFFFAOYSA-N (3-nitropyridin-2-yl) thiohypochlorite Chemical compound [O-][N+](=O)C1=CC=CN=C1SCl WTKQMHWYSBWUBE-UHFFFAOYSA-N 0.000 description 1
- GDJCQSNQOHRAGY-UHFFFAOYSA-N (4-chloro-2-fluoro-3-methoxyphenyl)boronic acid Chemical compound COC1=C(Cl)C=CC(B(O)O)=C1F GDJCQSNQOHRAGY-UHFFFAOYSA-N 0.000 description 1
- CFPFMAGBHTVLCZ-UHFFFAOYSA-N (4-chlorophenoxy)boronic acid Chemical compound OB(O)OC1=CC=C(Cl)C=C1 CFPFMAGBHTVLCZ-UHFFFAOYSA-N 0.000 description 1
- TWASWUXYCIYRJW-UHFFFAOYSA-N (4-cyanophenyl)methyl N-aminocarbamate Chemical compound C(#N)C1=CC=C(C=C1)COC(NN)=O TWASWUXYCIYRJW-UHFFFAOYSA-N 0.000 description 1
- SXLHAMYMTUEALX-UHFFFAOYSA-N (4-methoxyphenoxy)boronic acid Chemical compound COC1=CC=C(OB(O)O)C=C1 SXLHAMYMTUEALX-UHFFFAOYSA-N 0.000 description 1
- QXENIPSNYCZWNY-UHFFFAOYSA-N (4-methoxyphenyl)-diphenylmethanamine Chemical compound C1=CC(OC)=CC=C1C(N)(C=1C=CC=CC=1)C1=CC=CC=C1 QXENIPSNYCZWNY-UHFFFAOYSA-N 0.000 description 1
- OKLFHGKWEQKSDZ-UHFFFAOYSA-N (4-methoxyphenyl)methanimine Chemical compound COC1=CC=C(C=N)C=C1 OKLFHGKWEQKSDZ-UHFFFAOYSA-N 0.000 description 1
- SDEOSHAQCMPJIJ-UHFFFAOYSA-N (4-methoxyphenyl)methyl carbamate Chemical compound COC1=CC=C(COC(N)=O)C=C1 SDEOSHAQCMPJIJ-UHFFFAOYSA-N 0.000 description 1
- OSQOGASVZHDGKF-UHFFFAOYSA-N (4-methylsulfanylphenyl)carbamic acid Chemical compound CSC1=CC=C(NC(O)=O)C=C1 OSQOGASVZHDGKF-UHFFFAOYSA-N 0.000 description 1
- LRJOVUGHUMSKFA-UHFFFAOYSA-N (4-nitrophenyl)methanimine Chemical compound [O-][N+](=O)C1=CC=C(C=N)C=C1 LRJOVUGHUMSKFA-UHFFFAOYSA-N 0.000 description 1
- PVPBBTJXIKFICP-UHFFFAOYSA-N (7-aminophenothiazin-3-ylidene)azanium;chloride Chemical compound [Cl-].C1=CC(=[NH2+])C=C2SC3=CC(N)=CC=C3N=C21 PVPBBTJXIKFICP-UHFFFAOYSA-N 0.000 description 1
- 125000006700 (C1-C6) alkylthio group Chemical group 0.000 description 1
- GHOKWGTUZJEAQD-ZETCQYMHSA-N (D)-(+)-Pantothenic acid Chemical compound OCC(C)(C)[C@@H](O)C(=O)NCCC(O)=O GHOKWGTUZJEAQD-ZETCQYMHSA-N 0.000 description 1
- 125000003088 (fluoren-9-ylmethoxy)carbonyl group Chemical group 0.000 description 1
- BMDNJCNWTVMMKH-UHFFFAOYSA-N 1,1'-biphenyl;formamide Chemical compound NC=O.C1=CC=CC=C1C1=CC=CC=C1 BMDNJCNWTVMMKH-UHFFFAOYSA-N 0.000 description 1
- VZXTWGWHSMCWGA-UHFFFAOYSA-N 1,3,5-triazine-2,4-diamine Chemical group NC1=NC=NC(N)=N1 VZXTWGWHSMCWGA-UHFFFAOYSA-N 0.000 description 1
- TUSDEZXZIZRFGC-UHFFFAOYSA-N 1-O-galloyl-3,6-(R)-HHDP-beta-D-glucose Natural products OC1C(O2)COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC1C(O)C2OC(=O)C1=CC(O)=C(O)C(O)=C1 TUSDEZXZIZRFGC-UHFFFAOYSA-N 0.000 description 1
- FJANNOJSTOGZHK-UHFFFAOYSA-N 1-adamantyl carbamate Chemical compound C1C(C2)CC3CC2CC1(OC(=O)N)C3 FJANNOJSTOGZHK-UHFFFAOYSA-N 0.000 description 1
- SDECXXBYBNYSDK-UHFFFAOYSA-N 1-cyclopropylethylcarbamic acid Chemical compound OC(=O)NC(C)C1CC1 SDECXXBYBNYSDK-UHFFFAOYSA-N 0.000 description 1
- 125000004343 1-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C([H])([H])[H] 0.000 description 1
- MAHPVQDVMLWUAG-UHFFFAOYSA-N 1-phenylhexan-1-one Chemical compound CCCCCC(=O)C1=CC=CC=C1 MAHPVQDVMLWUAG-UHFFFAOYSA-N 0.000 description 1
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 1
- LJCZNYWLQZZIOS-UHFFFAOYSA-N 2,2,2-trichlorethoxycarbonyl chloride Chemical compound ClC(=O)OCC(Cl)(Cl)Cl LJCZNYWLQZZIOS-UHFFFAOYSA-N 0.000 description 1
- UPQQXPKAYZYUKO-UHFFFAOYSA-N 2,2,2-trichloroacetamide Chemical compound OC(=N)C(Cl)(Cl)Cl UPQQXPKAYZYUKO-UHFFFAOYSA-N 0.000 description 1
- QPLJYAKLSCXZSF-UHFFFAOYSA-N 2,2,2-trichloroethyl carbamate Chemical compound NC(=O)OCC(Cl)(Cl)Cl QPLJYAKLSCXZSF-UHFFFAOYSA-N 0.000 description 1
- NRKYWOKHZRQRJR-UHFFFAOYSA-N 2,2,2-trifluoroacetamide Chemical compound NC(=O)C(F)(F)F NRKYWOKHZRQRJR-UHFFFAOYSA-N 0.000 description 1
- XNMOEWPBTNQAQB-UHFFFAOYSA-N 2,2,5,7,8-pentamethyl-3,4-dihydrochromene-6-sulfonamide Chemical compound C1CC(C)(C)OC2=C1C(C)=C(S(N)(=O)=O)C(C)=C2C XNMOEWPBTNQAQB-UHFFFAOYSA-N 0.000 description 1
- PXVUDLXXKGSXHH-UHFFFAOYSA-N 2,4,6-trimethoxybenzenesulfonamide Chemical compound COC1=CC(OC)=C(S(N)(=O)=O)C(OC)=C1 PXVUDLXXKGSXHH-UHFFFAOYSA-N 0.000 description 1
- YECJUZIGFPJWGQ-UHFFFAOYSA-N 2,4,6-trimethylbenzenesulfonamide Chemical compound CC1=CC(C)=C(S(N)(=O)=O)C(C)=C1 YECJUZIGFPJWGQ-UHFFFAOYSA-N 0.000 description 1
- YJRISODHEYGPEL-UHFFFAOYSA-N 2,6-dimethoxy-4-methylbenzenesulfonamide Chemical compound COC1=CC(C)=CC(OC)=C1S(N)(=O)=O YJRISODHEYGPEL-UHFFFAOYSA-N 0.000 description 1
- AJOGMCIATUBFAT-UHFFFAOYSA-N 2-(1-adamantyl)propan-2-ylcarbamic acid Chemical compound C1C(C2)CC3CC2CC1(C(C)(NC(O)=O)C)C3 AJOGMCIATUBFAT-UHFFFAOYSA-N 0.000 description 1
- DVCVYHFEWYAJCP-UHFFFAOYSA-N 2-(2-nitrophenoxy)acetamide Chemical compound NC(=O)COC1=CC=CC=C1[N+]([O-])=O DVCVYHFEWYAJCP-UHFFFAOYSA-N 0.000 description 1
- MLJSAZNRAKTZKO-UHFFFAOYSA-N 2-(2-nitrophenyl)acetamide Chemical compound NC(=O)CC1=CC=CC=C1[N+]([O-])=O MLJSAZNRAKTZKO-UHFFFAOYSA-N 0.000 description 1
- KFPFJLHJCSKVTR-UHFFFAOYSA-N 2-(3,5-dimethoxyphenyl)propan-2-ylcarbamic acid Chemical compound COC1=CC(OC)=CC(C(C)(C)NC(O)=O)=C1 KFPFJLHJCSKVTR-UHFFFAOYSA-N 0.000 description 1
- VPVFQDMANSFAHW-UHFFFAOYSA-N 2-(3,5-ditert-butylphenyl)propan-2-ylcarbamic acid Chemical compound CC(C)(C)C1=CC(C(C)(C)C)=CC(C(C)(C)NC(O)=O)=C1 VPVFQDMANSFAHW-UHFFFAOYSA-N 0.000 description 1
- LMBJBXWOIJYFPG-UHFFFAOYSA-N 2-(4-phenyldiazenylphenyl)propan-2-ylcarbamic acid Chemical compound C1=CC(C(C)(NC(O)=O)C)=CC=C1N=NC1=CC=CC=C1 LMBJBXWOIJYFPG-UHFFFAOYSA-N 0.000 description 1
- WIKCRVWLLFGCSC-UHFFFAOYSA-N 2-(benzylamino)-4-chlorophenol Chemical compound OC1=CC=C(Cl)C=C1NCC1=CC=CC=C1 WIKCRVWLLFGCSC-UHFFFAOYSA-N 0.000 description 1
- QQZOPKMRPOGIEB-UHFFFAOYSA-N 2-Oxohexane Chemical compound CCCCC(C)=O QQZOPKMRPOGIEB-UHFFFAOYSA-N 0.000 description 1
- FZZMTSNZRBFGGU-UHFFFAOYSA-N 2-chloro-7-fluoroquinazolin-4-amine Chemical compound FC1=CC=C2C(N)=NC(Cl)=NC2=C1 FZZMTSNZRBFGGU-UHFFFAOYSA-N 0.000 description 1
- LPUAWADEOBHDIP-UHFFFAOYSA-N 2-methyl-2-(2-nitrophenoxy)propanamide Chemical compound NC(=O)C(C)(C)OC1=CC=CC=C1[N+]([O-])=O LPUAWADEOBHDIP-UHFFFAOYSA-N 0.000 description 1
- OBEJXZIQPCOKSK-UHFFFAOYSA-N 2-methyl-2-(2-phenyldiazenylphenoxy)propanamide Chemical compound NC(=O)C(C)(C)OC1=CC=CC=C1N=NC1=CC=CC=C1 OBEJXZIQPCOKSK-UHFFFAOYSA-N 0.000 description 1
- CCZIDHPRQBZATM-UHFFFAOYSA-N 2-methylbut-3-yn-2-yl N-aminocarbamate Chemical compound C(NN)(=O)OC(C#C)(C)C CCZIDHPRQBZATM-UHFFFAOYSA-N 0.000 description 1
- SRBIACYYKYKBKL-UHFFFAOYSA-N 2-methylpropylazanium carbamate Chemical compound C(C(C)C)N.C(N)(O)=O SRBIACYYKYKBKL-UHFFFAOYSA-N 0.000 description 1
- KLGQWSOYKYFBTR-UHFFFAOYSA-N 2-nitrobenzamide Chemical compound NC(=O)C1=CC=CC=C1[N+]([O-])=O KLGQWSOYKYFBTR-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- YJESALUAHUVISI-UHFFFAOYSA-N 3,5-dimethylhexan-2-one Chemical compound CC(C)CC(C)C(C)=O YJESALUAHUVISI-UHFFFAOYSA-N 0.000 description 1
- BBQDLDVSEDAYAA-UHFFFAOYSA-N 3-(2-nitrophenyl)prop-2-enoic acid Chemical compound OC(=O)C=CC1=CC=CC=C1[N+]([O-])=O BBQDLDVSEDAYAA-UHFFFAOYSA-N 0.000 description 1
- KADQHJDUFKAUEB-UHFFFAOYSA-N 3-(2-nitrophenyl)propanamide Chemical compound NC(=O)CCC1=CC=CC=C1[N+]([O-])=O KADQHJDUFKAUEB-UHFFFAOYSA-N 0.000 description 1
- OEHZEBOCZWCVMK-UHFFFAOYSA-N 3-(4-hydroxyphenyl)propanamide Chemical compound NC(=O)CCC1=CC=C(O)C=C1 OEHZEBOCZWCVMK-UHFFFAOYSA-N 0.000 description 1
- XJCGNMVYWONXCU-UHFFFAOYSA-N 3-amino-6-bromo-5-fluoropyridine-2-carboxylic acid Chemical compound NC1=CC(F)=C(Br)N=C1C(O)=O XJCGNMVYWONXCU-UHFFFAOYSA-N 0.000 description 1
- SCLGGNBFBLJQFU-UHFFFAOYSA-N 3-aminopropyl acetate Chemical compound CC(=O)OCCCN SCLGGNBFBLJQFU-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- ALKYHXVLJMQRLQ-UHFFFAOYSA-M 3-carboxynaphthalen-2-olate Chemical compound C1=CC=C2C=C(C([O-])=O)C(O)=CC2=C1 ALKYHXVLJMQRLQ-UHFFFAOYSA-M 0.000 description 1
- ZAFLZRNJFHWOQQ-UHFFFAOYSA-N 3-chloropyridine-2-carbonyl chloride Chemical class ClC(=O)C1=NC=CC=C1Cl ZAFLZRNJFHWOQQ-UHFFFAOYSA-N 0.000 description 1
- CELKOWQJPVJKIL-UHFFFAOYSA-N 3-fluoropyridine Chemical compound FC1=CC=CN=C1 CELKOWQJPVJKIL-UHFFFAOYSA-N 0.000 description 1
- VYIBCOSBNVFEIW-UHFFFAOYSA-N 3-phenylpropanamide Chemical compound NC(=O)CCC1=CC=CC=C1 VYIBCOSBNVFEIW-UHFFFAOYSA-N 0.000 description 1
- LHGHJAGVMNLDGA-UHFFFAOYSA-N 4,5,6-trichloropyridine-2-carboxylic acid Chemical compound OC(=O)C1=CC(Cl)=C(Cl)C(Cl)=N1 LHGHJAGVMNLDGA-UHFFFAOYSA-N 0.000 description 1
- ZHWBNBHTQZRIQD-UHFFFAOYSA-N 4,5-dichloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)pyridine-2-carbonyl chloride Chemical compound COC1=C(Cl)C=CC(C=2C(=C(Cl)C=C(N=2)C(Cl)=O)Cl)=C1F ZHWBNBHTQZRIQD-UHFFFAOYSA-N 0.000 description 1
- AHDFCMPBXDNBBR-UHFFFAOYSA-N 4,5-dichloro-6-(4-chlorophenyl)pyridine-2-carboxylic acid Chemical compound OC(=O)C1=CC(Cl)=C(Cl)C(C=2C=CC(Cl)=CC=2)=N1 AHDFCMPBXDNBBR-UHFFFAOYSA-N 0.000 description 1
- BNQYSFWLVLAPPF-UHFFFAOYSA-N 4,5-dichloro-6-(4-methoxyphenyl)pyridine-2-carboxylic acid Chemical compound C1=CC(OC)=CC=C1C1=NC(C(O)=O)=CC(Cl)=C1Cl BNQYSFWLVLAPPF-UHFFFAOYSA-N 0.000 description 1
- UBARRNXCKBFUEN-UHFFFAOYSA-N 4,5-diphenyl-5h-1,3-oxazol-2-one Chemical compound N=1C(=O)OC(C=2C=CC=CC=2)C=1C1=CC=CC=C1 UBARRNXCKBFUEN-UHFFFAOYSA-N 0.000 description 1
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 1
- BLEFBWAGWNSEGB-UHFFFAOYSA-N 4-[(4,8-dimethoxynaphthalen-1-yl)methyl]benzenesulfonamide Chemical compound C12=C(OC)C=CC=C2C(OC)=CC=C1CC1=CC=C(S(N)(=O)=O)C=C1 BLEFBWAGWNSEGB-UHFFFAOYSA-N 0.000 description 1
- JLECMHBIFUKLDZ-UHFFFAOYSA-N 4-acetamido-6-chloro-5-fluoropyridine-2-carboxylic acid Chemical compound CC(=O)NC1=CC(C(O)=O)=NC(Cl)=C1F JLECMHBIFUKLDZ-UHFFFAOYSA-N 0.000 description 1
- WRHDYOGDDZYNMT-UHFFFAOYSA-N 4-amino-3-chloro-5-fluoropyridine-2-carboxylic acid Chemical compound NC1=C(F)C=NC(C(O)=O)=C1Cl WRHDYOGDDZYNMT-UHFFFAOYSA-N 0.000 description 1
- RYOVMJCNDAAHAM-UHFFFAOYSA-N 4-amino-6-chloro-5-fluoropyridine-2-carboxylic acid Chemical compound NC1=CC(C(O)=O)=NC(Cl)=C1F RYOVMJCNDAAHAM-UHFFFAOYSA-N 0.000 description 1
- ZJJLGMUSGUYZQP-UHFFFAOYSA-N 4-methoxy-2,6-dimethylbenzenesulfonamide Chemical compound COC1=CC(C)=C(S(N)(=O)=O)C(C)=C1 ZJJLGMUSGUYZQP-UHFFFAOYSA-N 0.000 description 1
- DNKWKPATOPAAND-UHFFFAOYSA-N 4-methoxy-2-methylbenzenesulfonamide Chemical compound COC1=CC=C(S(N)(=O)=O)C(C)=C1 DNKWKPATOPAAND-UHFFFAOYSA-N 0.000 description 1
- MSFQEZBRFPAFEX-UHFFFAOYSA-N 4-methoxybenzenesulfonamide Chemical compound COC1=CC=C(S(N)(=O)=O)C=C1 MSFQEZBRFPAFEX-UHFFFAOYSA-N 0.000 description 1
- JTKFIIQGMVKDNZ-UHFFFAOYSA-N 5-fluoropyridine-2-carboxylic acid Chemical compound OC(=O)C1=CC=C(F)C=N1 JTKFIIQGMVKDNZ-UHFFFAOYSA-N 0.000 description 1
- XYFCLYQCZXCDEM-UHFFFAOYSA-N 9-phenyldecan-1-amine Chemical compound C1(=CC=CC=C1)C(CCCCCCCCN)C XYFCLYQCZXCDEM-UHFFFAOYSA-N 0.000 description 1
- QNZFKNSCVZGFJH-UHFFFAOYSA-N 9h-fluoren-9-yl n-aminocarbamate Chemical compound C1=CC=C2C(OC(=O)NN)C3=CC=CC=C3C2=C1 QNZFKNSCVZGFJH-UHFFFAOYSA-N 0.000 description 1
- OQLZINXFSUDMHM-UHFFFAOYSA-N Acetamidine Chemical compound CC(N)=N OQLZINXFSUDMHM-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- DJHGAFSJWGLOIV-UHFFFAOYSA-K Arsenate3- Chemical compound [O-][As]([O-])([O-])=O DJHGAFSJWGLOIV-UHFFFAOYSA-K 0.000 description 1
- KHBQMWCZKVMBLN-UHFFFAOYSA-N Benzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1 KHBQMWCZKVMBLN-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 229910014265 BrCl Inorganic materials 0.000 description 1
- QLENYSCUIIFLCV-UHFFFAOYSA-N C(=O)O.C(C)(C)C1=NC(=C(C(=C1)F)F)C1=CC=C(C=C1)Cl Chemical compound C(=O)O.C(C)(C)C1=NC(=C(C(=C1)F)F)C1=CC=C(C=C1)Cl QLENYSCUIIFLCV-UHFFFAOYSA-N 0.000 description 1
- LOXWBDRJOLJNKG-UHFFFAOYSA-N C(=O)ONC1(CCC1)C Chemical compound C(=O)ONC1(CCC1)C LOXWBDRJOLJNKG-UHFFFAOYSA-N 0.000 description 1
- IMZCNCIXOZLUDW-UHFFFAOYSA-N C(=O)ONCC1=C(C=C(C=C1)Cl)Cl Chemical compound C(=O)ONCC1=C(C=C(C=C1)Cl)Cl IMZCNCIXOZLUDW-UHFFFAOYSA-N 0.000 description 1
- GLPKAHSTIHGGAH-UHFFFAOYSA-N C(=O)ONCC1=C(C=C(C=C1C)C)C Chemical compound C(=O)ONCC1=C(C=C(C=C1C)C)C GLPKAHSTIHGGAH-UHFFFAOYSA-N 0.000 description 1
- LNDGEVGZOCPDHO-UHFFFAOYSA-N C(C)N(C(=N)N)C1=C(C(=NC(=C1F)C1=C(C(=C(C=C1)Cl)OC)F)C(=O)OC)Cl Chemical compound C(C)N(C(=N)N)C1=C(C(=NC(=C1F)C1=C(C(=C(C=C1)Cl)OC)F)C(=O)OC)Cl LNDGEVGZOCPDHO-UHFFFAOYSA-N 0.000 description 1
- DFICKBBVXMQOFZ-UHFFFAOYSA-N C(C=CC1=CC=CC=C1)NC(=O)OCC Chemical compound C(C=CC1=CC=CC=C1)NC(=O)OCC DFICKBBVXMQOFZ-UHFFFAOYSA-N 0.000 description 1
- WPMIKYFDVLNJBJ-UHFFFAOYSA-N C(N)([O-])=O.ClC1=CC=C(C[NH3+])C=C1 Chemical compound C(N)([O-])=O.ClC1=CC=C(C[NH3+])C=C1 WPMIKYFDVLNJBJ-UHFFFAOYSA-N 0.000 description 1
- SBAPAADWAZNFKP-UHFFFAOYSA-N C1(=CC=CC=C1)C(CCCCCCCCCNC1SC=CC=C1)C1=CC=CC=C1 Chemical compound C1(=CC=CC=C1)C(CCCCCCCCCNC1SC=CC=C1)C1=CC=CC=C1 SBAPAADWAZNFKP-UHFFFAOYSA-N 0.000 description 1
- RQPPDWNNKYEANR-UHFFFAOYSA-N C1=C(C(=C(C(=N1)C(=O)O)Cl)Br)F Chemical compound C1=C(C(=C(C(=N1)C(=O)O)Cl)Br)F RQPPDWNNKYEANR-UHFFFAOYSA-N 0.000 description 1
- FECFRUKDXMFYAZ-UHFFFAOYSA-N C1=CC(=CC=C1CNNC(=O)O)[N+](=O)[O-] Chemical compound C1=CC(=CC=C1CNNC(=O)O)[N+](=O)[O-] FECFRUKDXMFYAZ-UHFFFAOYSA-N 0.000 description 1
- RNJFBYQABQCQCX-UHFFFAOYSA-N C1=CC=C(C=C1)C2=NC(=C(C(=C2)F)F)C(=O)O Chemical compound C1=CC=C(C=C1)C2=NC(=C(C(=C2)F)F)C(=O)O RNJFBYQABQCQCX-UHFFFAOYSA-N 0.000 description 1
- BCDCEBCMACKGEN-UHFFFAOYSA-N CC(CCCCCCCCCCCOCN)(C)C Chemical compound CC(CCCCCCCCCCCOCN)(C)C BCDCEBCMACKGEN-UHFFFAOYSA-N 0.000 description 1
- CKQUPTQSZWWDGC-UHFFFAOYSA-N COC(=O)C(=CNC(=O)OCC)C(=O)OC Chemical compound COC(=O)C(=CNC(=O)OCC)C(=O)OC CKQUPTQSZWWDGC-UHFFFAOYSA-N 0.000 description 1
- ROJXTJGDAOCWOB-UHFFFAOYSA-N COC1=CC([N+]([O-])=O)=CC=C1.NS(O)(=O)=O Chemical compound COC1=CC([N+]([O-])=O)=CC=C1.NS(O)(=O)=O ROJXTJGDAOCWOB-UHFFFAOYSA-N 0.000 description 1
- AETXROODEDTFFI-UHFFFAOYSA-N COC1=CC=C(C=C1)C(CNC(=O)O)C2=CC=CC=C2 Chemical compound COC1=CC=C(C=C1)C(CNC(=O)O)C2=CC=CC=C2 AETXROODEDTFFI-UHFFFAOYSA-N 0.000 description 1
- KPQKYBWHNDHRGW-UHFFFAOYSA-N COC1=CC=C(C=C1)C2=NC(=C(C(=C2)F)F)C(=O)O Chemical compound COC1=CC=C(C=C1)C2=NC(=C(C(=C2)F)F)C(=O)O KPQKYBWHNDHRGW-UHFFFAOYSA-N 0.000 description 1
- FVBAJWZCTLFTJJ-UHFFFAOYSA-N CS(=O)(=O)N.C(C1=CC=CC=C1)(=N)N Chemical compound CS(=O)(=O)N.C(C1=CC=CC=C1)(=N)N FVBAJWZCTLFTJJ-UHFFFAOYSA-N 0.000 description 1
- WDEVZHRNLSTICL-UHFFFAOYSA-N CS(=O)C1=CC=C(C=C1)CNNC(=O)O Chemical compound CS(=O)C1=CC=C(C=C1)CNNC(=O)O WDEVZHRNLSTICL-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- PECFQFGVSRADRE-UHFFFAOYSA-N ClC1=CC=NC(=C1Cl)C1=CC=C(C=C1)Cl Chemical compound ClC1=CC=NC(=C1Cl)C1=CC=C(C=C1)Cl PECFQFGVSRADRE-UHFFFAOYSA-N 0.000 description 1
- RGHNJXZEOKUKBD-SQOUGZDYSA-M D-gluconate Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O RGHNJXZEOKUKBD-SQOUGZDYSA-M 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- 239000001263 FEMA 3042 Substances 0.000 description 1
- PNKUSGQVOMIXLU-UHFFFAOYSA-N Formamidine Chemical compound NC=N PNKUSGQVOMIXLU-UHFFFAOYSA-N 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- QZRGKCOWNLSUDK-UHFFFAOYSA-N Iodochlorine Chemical compound ICl QZRGKCOWNLSUDK-UHFFFAOYSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-M L-tartrate(1-) Chemical compound OC(=O)[C@H](O)[C@@H](O)C([O-])=O FEWJPZIEWOKRBE-JCYAYHJZSA-M 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- 101100170604 Mus musculus Dmap1 gene Proteins 0.000 description 1
- HXTGGPKOEKKUQO-VQHVLOKHSA-N N-BENZYLIDENEMETHYLAMINE Chemical compound C\N=C\C1=CC=CC=C1 HXTGGPKOEKKUQO-VQHVLOKHSA-N 0.000 description 1
- FVUXUEOOEAWPNG-UHFFFAOYSA-N N1=C(C=CC=C1)C=1C(=C(C(=CC1C)C)CN)C Chemical compound N1=C(C=CC=C1)C=1C(=C(C(=CC1C)C)CN)C FVUXUEOOEAWPNG-UHFFFAOYSA-N 0.000 description 1
- GAYDMFBUWCDIPY-UHFFFAOYSA-N NC(C(C=C1Cl)=NC(C(C=C2)=CC=C2Cl)=C1Cl)=N.Cl Chemical compound NC(C(C=C1Cl)=NC(C(C=C2)=CC=C2Cl)=C1Cl)=N.Cl GAYDMFBUWCDIPY-UHFFFAOYSA-N 0.000 description 1
- GNQMUXCEYCAOOP-UHFFFAOYSA-N NC(C(C=C1Cl)=NC(C2=CC=CC=C2)=C1Cl)=N.Cl Chemical compound NC(C(C=C1Cl)=NC(C2=CC=CC=C2)=C1Cl)=N.Cl GNQMUXCEYCAOOP-UHFFFAOYSA-N 0.000 description 1
- DHDNEKGTVJXDQL-UHFFFAOYSA-N NC(C(C=C1F)=NC(F)=C1F)=N.F Chemical compound NC(C(C=C1F)=NC(F)=C1F)=N.F DHDNEKGTVJXDQL-UHFFFAOYSA-N 0.000 description 1
- MUZXOVWWXWXZKW-UHFFFAOYSA-N NNC(O)=O.[N+](=O)([O-])C1=C(C(=O)O)C=CC=C1 Chemical compound NNC(O)=O.[N+](=O)([O-])C1=C(C(=O)O)C=CC=C1 MUZXOVWWXWXZKW-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 1
- 229910021586 Nickel(II) chloride Inorganic materials 0.000 description 1
- DFPAKSUCGFBDDF-UHFFFAOYSA-N Nicotinamide Chemical compound NC(=O)C1=CC=CN=C1 DFPAKSUCGFBDDF-UHFFFAOYSA-N 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- AKSGGFPTRYIXRE-UHFFFAOYSA-N OC(=O)NNC(C)(C)C1=CC=CC=C1 Chemical compound OC(=O)NNC(C)(C)C1=CC=CC=C1 AKSGGFPTRYIXRE-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- LRBQNJMCXXYXIU-PPKXGCFTSA-N Penta-digallate-beta-D-glucose Natural products OC1=C(O)C(O)=CC(C(=O)OC=2C(=C(O)C=C(C=2)C(=O)OC[C@@H]2[C@H]([C@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)[C@@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)[C@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)O2)OC(=O)C=2C=C(OC(=O)C=3C=C(O)C(O)=C(O)C=3)C(O)=C(O)C=2)O)=C1 LRBQNJMCXXYXIU-PPKXGCFTSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 239000005864 Sulphur Substances 0.000 description 1
- 241001122767 Theaceae Species 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- DHPKAXMDBPOPSV-UHFFFAOYSA-N [(4-bromophenyl)methylamino]carbamic acid Chemical compound OC(=O)NNCC1=CC=C(Br)C=C1 DHPKAXMDBPOPSV-UHFFFAOYSA-N 0.000 description 1
- ZZXYOKJAVPIWSG-UHFFFAOYSA-N [Cl-].ClC1=CC=[NH+]C(=C1Cl)C1=CC=C(C=C1)Cl Chemical compound [Cl-].ClC1=CC=[NH+]C(=C1Cl)C1=CC=C(C=C1)Cl ZZXYOKJAVPIWSG-UHFFFAOYSA-N 0.000 description 1
- UNHIWWVSAOLVAI-UHFFFAOYSA-N [F-].C1=CC=CC=2C3=CC=CC=C3CC12.ClC1=CC=C(C=C1)C1=C(C(=CC=[NH+]1)F)F Chemical compound [F-].C1=CC=CC=2C3=CC=CC=C3CC12.ClC1=CC=C(C=C1)C1=C(C(=CC=[NH+]1)F)F UNHIWWVSAOLVAI-UHFFFAOYSA-N 0.000 description 1
- ACPWQEIUFOCESM-UHFFFAOYSA-N [F-].C1=CC=CC=2C3=CC=CC=C3CC12.FC1=CC=[NH+]C(=C1F)C1=CC=C(C=C1)OC Chemical compound [F-].C1=CC=CC=2C3=CC=CC=C3CC12.FC1=CC=[NH+]C(=C1F)C1=CC=C(C=C1)OC ACPWQEIUFOCESM-UHFFFAOYSA-N 0.000 description 1
- FVVBQZPWOIUVAD-UHFFFAOYSA-N [F-].C1=CC=CC=2C3=CC=CC=C3CC12.FC1=CC=[NH+]C(=C1F)C1=CC=CC=C1 Chemical compound [F-].C1=CC=CC=2C3=CC=CC=C3CC12.FC1=CC=[NH+]C(=C1F)C1=CC=CC=C1 FVVBQZPWOIUVAD-UHFFFAOYSA-N 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 230000004075 alteration Effects 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 229940000489 arsenate Drugs 0.000 description 1
- 150000003975 aryl alkyl amines Chemical class 0.000 description 1
- 125000004659 aryl alkyl thio group Chemical group 0.000 description 1
- 125000001769 aryl amino group Chemical group 0.000 description 1
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 1
- 125000005110 aryl thio group Chemical group 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- PXXJHWLDUBFPOL-UHFFFAOYSA-N benzamidine Chemical compound NC(=N)C1=CC=CC=C1 PXXJHWLDUBFPOL-UHFFFAOYSA-N 0.000 description 1
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- NBPHWSDVAIQDLB-UHFFFAOYSA-N benzene;ethanamine Chemical compound CCN.C1=CC=CC=C1 NBPHWSDVAIQDLB-UHFFFAOYSA-N 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- YSEGTGYADYGXPR-UHFFFAOYSA-N benzhydrylcarbamic acid Chemical compound C=1C=CC=CC=1C(NC(=O)O)C1=CC=CC=C1 YSEGTGYADYGXPR-UHFFFAOYSA-N 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 239000012455 biphasic mixture Substances 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- CODNYICXDISAEA-UHFFFAOYSA-N bromine monochloride Chemical compound BrCl CODNYICXDISAEA-UHFFFAOYSA-N 0.000 description 1
- ABBZJHFBQXYTLU-UHFFFAOYSA-N but-3-enamide Chemical compound NC(=O)CC=C ABBZJHFBQXYTLU-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- TWFZGCMQGLPBSX-UHFFFAOYSA-N carbendazim Chemical compound C1=CC=C2NC(NC(=O)OC)=NC2=C1 TWFZGCMQGLPBSX-UHFFFAOYSA-N 0.000 description 1
- 239000006013 carbendazim Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000013522 chelant Substances 0.000 description 1
- 125000003636 chemical group Chemical group 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- VXIVSQZSERGHQP-UHFFFAOYSA-N chloroacetamide Chemical compound NC(=O)CCl VXIVSQZSERGHQP-UHFFFAOYSA-N 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000013058 crude material Substances 0.000 description 1
- 239000010779 crude oil Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000000000 cycloalkoxy group Chemical group 0.000 description 1
- 125000006310 cycloalkyl amino group Chemical group 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000005366 cycloalkylthio group Chemical group 0.000 description 1
- LWABFMLTBBNLTA-UHFFFAOYSA-N cyclobutyl carbamate Chemical compound NC(=O)OC1CCC1 LWABFMLTBBNLTA-UHFFFAOYSA-N 0.000 description 1
- AUELWJRRASQDKI-UHFFFAOYSA-N cyclohexyl carbamate Chemical compound NC(=O)OC1CCCCC1 AUELWJRRASQDKI-UHFFFAOYSA-N 0.000 description 1
- WZOVRVYGPDTSSI-UHFFFAOYSA-N cyclopentyl n-aminocarbamate Chemical compound NNC(=O)OC1CCCC1 WZOVRVYGPDTSSI-UHFFFAOYSA-N 0.000 description 1
- VBJNVGFACHOKLX-UHFFFAOYSA-N cyclopropylmethyl N-aminocarbamate Chemical compound C1(CC1)COC(=O)NN VBJNVGFACHOKLX-UHFFFAOYSA-N 0.000 description 1
- VRLDVERQJMEPIF-UHFFFAOYSA-N dbdmh Chemical compound CC1(C)N(Br)C(=O)N(Br)C1=O VRLDVERQJMEPIF-UHFFFAOYSA-N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- ACYGYJFTZSAZKR-UHFFFAOYSA-J dicalcium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate Chemical compound [Ca+2].[Ca+2].[O-]C(=O)CN(CC([O-])=O)CCN(CC([O-])=O)CC([O-])=O ACYGYJFTZSAZKR-UHFFFAOYSA-J 0.000 description 1
- 150000004683 dihydrates Chemical class 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- FBSAITBEAPNWJG-UHFFFAOYSA-N dimethyl phthalate Natural products CC(=O)OC1=CC=CC=C1OC(C)=O FBSAITBEAPNWJG-UHFFFAOYSA-N 0.000 description 1
- 229960001826 dimethylphthalate Drugs 0.000 description 1
- MGHPNCMVUAKAIE-UHFFFAOYSA-N diphenylmethanamine Chemical compound C=1C=CC=CC=1C(N)C1=CC=CC=C1 MGHPNCMVUAKAIE-UHFFFAOYSA-N 0.000 description 1
- 239000001177 diphosphate Substances 0.000 description 1
- XPPKVPWEQAFLFU-UHFFFAOYSA-J diphosphate(4-) Chemical compound [O-]P([O-])(=O)OP([O-])([O-])=O XPPKVPWEQAFLFU-UHFFFAOYSA-J 0.000 description 1
- 235000011180 diphosphates Nutrition 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000012990 dithiocarbamate Substances 0.000 description 1
- 229940009662 edetate Drugs 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 229950000206 estolate Drugs 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- 229960004756 ethanol Drugs 0.000 description 1
- CQDHIWVDRRGMQV-UHFFFAOYSA-N ethyl N-(2-methylsulfonylethyl)carbamate Chemical compound CCOC(=O)NCCS(C)(=O)=O CQDHIWVDRRGMQV-UHFFFAOYSA-N 0.000 description 1
- XFIHTSZJHKINLA-UHFFFAOYSA-N ethyl N-(2-pyridin-4-ylpropan-2-yl)carbamate Chemical compound CCOC(=O)NC(C)(C)c1ccncc1 XFIHTSZJHKINLA-UHFFFAOYSA-N 0.000 description 1
- FECLNUMYMPXVAI-UHFFFAOYSA-N ethyl N-[2-(4-methylphenyl)sulfonylethyl]carbamate Chemical compound CCOC(=O)NCCS(=O)(=O)C1=CC=C(C)C=C1 FECLNUMYMPXVAI-UHFFFAOYSA-N 0.000 description 1
- LRJHYQLNLMGEPR-UHFFFAOYSA-N ethyl n,n-di(propan-2-yl)carbamate Chemical compound CCOC(=O)N(C(C)C)C(C)C LRJHYQLNLMGEPR-UHFFFAOYSA-N 0.000 description 1
- WNYUNJHJWFBHAY-UHFFFAOYSA-N ethyl n-(2-iodoethyl)carbamate Chemical compound CCOC(=O)NCCI WNYUNJHJWFBHAY-UHFFFAOYSA-N 0.000 description 1
- DYZBXPKEPCTAOO-UHFFFAOYSA-N ethyl n-(2-methylpentan-3-yl)carbamate Chemical compound CCOC(=O)NC(CC)C(C)C DYZBXPKEPCTAOO-UHFFFAOYSA-N 0.000 description 1
- WXDDBYFBIIAYSM-UHFFFAOYSA-N ethyl n-(2-phenylethyl)carbamate Chemical compound CCOC(=O)NCCC1=CC=CC=C1 WXDDBYFBIIAYSM-UHFFFAOYSA-N 0.000 description 1
- JWPGACMNGJBXHB-UHFFFAOYSA-N ethyl n-(3-nitrophenyl)carbamate Chemical compound CCOC(=O)NC1=CC=CC([N+]([O-])=O)=C1 JWPGACMNGJBXHB-UHFFFAOYSA-N 0.000 description 1
- MCQWOCBABOZJSN-UHFFFAOYSA-N ethyl n-[(4-methoxyphenyl)methyl]carbamate Chemical compound CCOC(=O)NCC1=CC=C(OC)C=C1 MCQWOCBABOZJSN-UHFFFAOYSA-N 0.000 description 1
- XSXLCQLOFRENHC-UHFFFAOYSA-N ethyl n-benzylcarbamate Chemical compound CCOC(=O)NCC1=CC=CC=C1 XSXLCQLOFRENHC-UHFFFAOYSA-N 0.000 description 1
- HNPDNOZNULJJDL-UHFFFAOYSA-N ethyl n-ethenylcarbamate Chemical compound CCOC(=O)NC=C HNPDNOZNULJJDL-UHFFFAOYSA-N 0.000 description 1
- LBKPGNUOUPTQKA-UHFFFAOYSA-N ethyl n-phenylcarbamate Chemical compound CCOC(=O)NC1=CC=CC=C1 LBKPGNUOUPTQKA-UHFFFAOYSA-N 0.000 description 1
- GTOKAWYXANYGFG-UHFFFAOYSA-N ethyl n-propylcarbamate Chemical compound CCCNC(=O)OCC GTOKAWYXANYGFG-UHFFFAOYSA-N 0.000 description 1
- NPNXPNFLITYXQW-UHFFFAOYSA-N ethyl n-quinolin-8-ylcarbamate Chemical compound C1=CN=C2C(NC(=O)OCC)=CC=CC2=C1 NPNXPNFLITYXQW-UHFFFAOYSA-N 0.000 description 1
- 229940071106 ethylenediaminetetraacetate Drugs 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 229960004979 fampridine Drugs 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000003818 flash chromatography Methods 0.000 description 1
- 150000002222 fluorine compounds Chemical class 0.000 description 1
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 description 1
- 229940050411 fumarate Drugs 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 229960001731 gluceptate Drugs 0.000 description 1
- KWMLJOLKUYYJFJ-VFUOTHLCSA-N glucoheptonic acid Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)C(O)=O KWMLJOLKUYYJFJ-VFUOTHLCSA-N 0.000 description 1
- 229940050410 gluconate Drugs 0.000 description 1
- 229930195712 glutamate Natural products 0.000 description 1
- 229940049906 glutamate Drugs 0.000 description 1
- 125000004438 haloalkoxy group Chemical group 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 125000004404 heteroalkyl group Chemical group 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- XGIHQYAWBCFNPY-AZOCGYLKSA-N hydrabamine Chemical compound C([C@@H]12)CC3=CC(C(C)C)=CC=C3[C@@]2(C)CCC[C@@]1(C)CNCCNC[C@@]1(C)[C@@H]2CCC3=CC(C(C)C)=CC=C3[C@@]2(C)CCC1 XGIHQYAWBCFNPY-AZOCGYLKSA-N 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 238000010952 in-situ formation Methods 0.000 description 1
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 230000010354 integration Effects 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 239000012336 iodinating agent Substances 0.000 description 1
- 238000006192 iodination reaction Methods 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- 159000000014 iron salts Chemical class 0.000 description 1
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical compound OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 1
- 229940001447 lactate Drugs 0.000 description 1
- 229940099584 lactobionate Drugs 0.000 description 1
- JYTUSYBCFIZPBE-AMTLMPIISA-N lactobionic acid Chemical compound OC(=O)[C@H](O)[C@@H](O)[C@@H]([C@H](O)CO)O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O JYTUSYBCFIZPBE-AMTLMPIISA-N 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 229940049920 malate Drugs 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N malic acid Chemical compound OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-M mandelate Chemical compound [O-]C(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-M 0.000 description 1
- HNQIVZYLYMDVSB-UHFFFAOYSA-N methanesulfonimidic acid Chemical compound CS(N)(=O)=O HNQIVZYLYMDVSB-UHFFFAOYSA-N 0.000 description 1
- ZBSGARQIFGWSSH-UHFFFAOYSA-N methyl 4-acetamido-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-5-fluoropyridine-2-carboxylate Chemical compound CC(=O)NC1=C(Cl)C(C(=O)OC)=NC(C=2C(=C(OC)C(Cl)=CC=2)F)=C1F ZBSGARQIFGWSSH-UHFFFAOYSA-N 0.000 description 1
- QOFUARQHIKDCMB-UHFFFAOYSA-N methyl 4-acetamido-6-(4-chloro-2-fluoro-3-methoxyphenyl)-5-fluoropyridine-2-carboxylate Chemical compound COC(=O)C1=CC(NC(C)=O)=C(F)C(C=2C(=C(OC)C(Cl)=CC=2)F)=N1 QOFUARQHIKDCMB-UHFFFAOYSA-N 0.000 description 1
- KIKNEFFJHGIUKZ-UHFFFAOYSA-N methyl 4-amino-3,6-dichloro-5-fluoropyridine-2-carboxylate Chemical compound COC(=O)C1=NC(Cl)=C(F)C(N)=C1Cl KIKNEFFJHGIUKZ-UHFFFAOYSA-N 0.000 description 1
- FRMBCYILCYTPHY-UHFFFAOYSA-N methyl 4-amino-3,6-dichloropyridine-2-carboxylate Chemical compound COC(=O)C1=NC(Cl)=CC(N)=C1Cl FRMBCYILCYTPHY-UHFFFAOYSA-N 0.000 description 1
- CVYZJUXLXNJDEU-UHFFFAOYSA-N methyl 4-amino-6-bromo-3-chloro-5-fluoropyridine-2-carboxylate Chemical compound COC(=O)C1=NC(Br)=C(F)C(N)=C1Cl CVYZJUXLXNJDEU-UHFFFAOYSA-N 0.000 description 1
- GJRCHXIGVQXIPY-UHFFFAOYSA-N methyl 4-amino-6-bromo-5-fluoropyridine-2-carboxylate Chemical compound COC(=O)C1=CC(N)=C(F)C(Br)=N1 GJRCHXIGVQXIPY-UHFFFAOYSA-N 0.000 description 1
- ODRFMIJNQNBMMJ-UHFFFAOYSA-N methyl 6-(4-chloro-2-fluoro-3-methoxyphenyl)-4,5-difluoropyridine-2-carboxylate Chemical compound COC(=O)C1=CC(F)=C(F)C(C=2C(=C(OC)C(Cl)=CC=2)F)=N1 ODRFMIJNQNBMMJ-UHFFFAOYSA-N 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- QMMRZOWCJAIUJA-UHFFFAOYSA-L nickel dichloride Chemical compound Cl[Ni]Cl QMMRZOWCJAIUJA-UHFFFAOYSA-L 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- NIHNNTQXNPWCJQ-UHFFFAOYSA-N o-biphenylenemethane Natural products C1=CC=C2CC3=CC=CC=C3C2=C1 NIHNNTQXNPWCJQ-UHFFFAOYSA-N 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 150000002902 organometallic compounds Chemical class 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- LXNAVEXFUKBNMK-UHFFFAOYSA-N palladium(II) acetate Substances [Pd].CC(O)=O.CC(O)=O LXNAVEXFUKBNMK-UHFFFAOYSA-N 0.000 description 1
- 229940014662 pantothenate Drugs 0.000 description 1
- 235000019161 pantothenic acid Nutrition 0.000 description 1
- 239000011713 pantothenic acid Substances 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- KHIWWQKSHDUIBK-UHFFFAOYSA-N periodic acid Chemical compound OI(=O)(=O)=O KHIWWQKSHDUIBK-UHFFFAOYSA-N 0.000 description 1
- ZBIATYBWQSJYDC-UHFFFAOYSA-N phenyl n-[(2-nitrophenyl)methyl]carbamate Chemical compound [O-][N+](=O)C1=CC=CC=C1CNC(=O)OC1=CC=CC=C1 ZBIATYBWQSJYDC-UHFFFAOYSA-N 0.000 description 1
- ABOYDMHGKWRPFD-UHFFFAOYSA-N phenylmethanesulfonamide Chemical compound NS(=O)(=O)CC1=CC=CC=C1 ABOYDMHGKWRPFD-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 125000005496 phosphonium group Chemical group 0.000 description 1
- 239000003880 polar aprotic solvent Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- MZFXHSQFQLKKFD-UHFFFAOYSA-M potassium;fluoride;dihydrate Chemical compound O.O.[F-].[K+] MZFXHSQFQLKKFD-UHFFFAOYSA-M 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- AMLFJZRZIOZGPW-UHFFFAOYSA-N prop-1-en-1-amine Chemical compound CC=CN AMLFJZRZIOZGPW-UHFFFAOYSA-N 0.000 description 1
- CUCADYTVGOVTKY-UHFFFAOYSA-N propan-2-yl 4,5-difluoro-6-(4-methoxyphenyl)pyridine-2-carboxylate Chemical compound C1=CC(OC)=CC=C1C1=NC(C(=O)OC(C)C)=CC(F)=C1F CUCADYTVGOVTKY-UHFFFAOYSA-N 0.000 description 1
- PCHKPGRAPBRHIZ-UHFFFAOYSA-N propan-2-yl 4,5-difluoro-6-phenylpyridine-2-carboxylate Chemical compound CC(C)OC(=O)C1=CC(F)=C(F)C(C=2C=CC=CC=2)=N1 PCHKPGRAPBRHIZ-UHFFFAOYSA-N 0.000 description 1
- FHCDQJCSRTZQJW-UHFFFAOYSA-N propan-2-yl 4-acetamido-6-chloro-5-fluoropyridine-2-carboxylate Chemical compound CC(C)OC(=O)C1=CC(NC(C)=O)=C(F)C(Cl)=N1 FHCDQJCSRTZQJW-UHFFFAOYSA-N 0.000 description 1
- PIBVWUSLWKKFOU-UHFFFAOYSA-N propan-2-yl 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-5-fluoropyridine-2-carboxylate Chemical compound COC1=C(Cl)C=CC(C=2C(=C(N)C(Cl)=C(C(=O)OC(C)C)N=2)F)=C1F PIBVWUSLWKKFOU-UHFFFAOYSA-N 0.000 description 1
- FWPXDYCSECBKSZ-UHFFFAOYSA-N propan-2-yl 6-(4-chlorophenyl)-4,5-difluoropyridine-2-carboxylate Chemical compound CC(C)OC(=O)C1=CC(F)=C(F)C(C=2C=CC(Cl)=CC=2)=N1 FWPXDYCSECBKSZ-UHFFFAOYSA-N 0.000 description 1
- ZNZJJSYHZBXQSM-UHFFFAOYSA-N propane-2,2-diamine Chemical compound CC(C)(N)N ZNZJJSYHZBXQSM-UHFFFAOYSA-N 0.000 description 1
- 230000005588 protonation Effects 0.000 description 1
- 238000010926 purge Methods 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- BDEZGPKAMAVGBE-UHFFFAOYSA-N s-(3-nitropyridin-2-yl)thiohydroxylamine Chemical compound NSC1=NC=CC=C1[N+]([O-])=O BDEZGPKAMAVGBE-UHFFFAOYSA-N 0.000 description 1
- LOFZYSZWOLKUGE-UHFFFAOYSA-N s-benzyl carbamothioate Chemical compound NC(=O)SCC1=CC=CC=C1 LOFZYSZWOLKUGE-UHFFFAOYSA-N 0.000 description 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-M salicylate Chemical compound OC1=CC=CC=C1C([O-])=O YGSDEFSMJLZEOE-UHFFFAOYSA-M 0.000 description 1
- 229960001860 salicylate Drugs 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- UGJCNRLBGKEGEH-UHFFFAOYSA-N sodium-binding benzofuran isophthalate Chemical compound COC1=CC=2C=C(C=3C(=CC(=CC=3)C(O)=O)C(O)=O)OC=2C=C1N(CCOCC1)CCOCCOCCN1C(C(=CC=1C=2)OC)=CC=1OC=2C1=CC=C(C(O)=O)C=C1C(O)=O UGJCNRLBGKEGEH-UHFFFAOYSA-N 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- SSTZGACKDAVIGZ-UHFFFAOYSA-N sulfanium;bromide Chemical compound [SH3+].[Br-] SSTZGACKDAVIGZ-UHFFFAOYSA-N 0.000 description 1
- 125000006296 sulfonyl amino group Chemical group [H]N(*)S(*)(=O)=O 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- FWMUJAIKEJWSSY-UHFFFAOYSA-N sulfur dichloride Chemical compound ClSCl FWMUJAIKEJWSSY-UHFFFAOYSA-N 0.000 description 1
- LRBQNJMCXXYXIU-NRMVVENXSA-N tannic acid Chemical compound OC1=C(O)C(O)=CC(C(=O)OC=2C(=C(O)C=C(C=2)C(=O)OC[C@@H]2[C@H]([C@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)[C@@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)[C@@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)O2)OC(=O)C=2C=C(OC(=O)C=3C=C(O)C(O)=C(O)C=3)C(O)=C(O)C=2)O)=C1 LRBQNJMCXXYXIU-NRMVVENXSA-N 0.000 description 1
- 235000015523 tannic acid Nutrition 0.000 description 1
- 229940033123 tannic acid Drugs 0.000 description 1
- 229920002258 tannic acid Polymers 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- XBXCNNQPRYLIDE-UHFFFAOYSA-N tert-butylcarbamic acid Chemical compound CC(C)(C)NC(O)=O XBXCNNQPRYLIDE-UHFFFAOYSA-N 0.000 description 1
- 150000004685 tetrahydrates Chemical class 0.000 description 1
- 150000003544 thiamines Chemical class 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 125000004149 thio group Chemical group *S* 0.000 description 1
- RSPCKAHMRANGJZ-UHFFFAOYSA-N thiohydroxylamine Chemical group SN RSPCKAHMRANGJZ-UHFFFAOYSA-N 0.000 description 1
- PIZNQHDTOZMVBH-UHFFFAOYSA-N thionylimide Chemical compound N=S=O PIZNQHDTOZMVBH-UHFFFAOYSA-N 0.000 description 1
- LMYRWZFENFIFIT-UHFFFAOYSA-N toluene-4-sulfonamide Chemical compound CC1=CC=C(S(N)(=O)=O)C=C1 LMYRWZFENFIFIT-UHFFFAOYSA-N 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- KAKQVSNHTBLJCH-UHFFFAOYSA-N trifluoromethanesulfonimidic acid Chemical compound NS(=O)(=O)C(F)(F)F KAKQVSNHTBLJCH-UHFFFAOYSA-N 0.000 description 1
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 150000004684 trihydrates Chemical class 0.000 description 1
- BZVJOYBTLHNRDW-UHFFFAOYSA-N triphenylmethanamine Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(N)C1=CC=CC=C1 BZVJOYBTLHNRDW-UHFFFAOYSA-N 0.000 description 1
- BPIBEKPIZVPARD-UHFFFAOYSA-N triphenylmethanesulfinamide Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(S(=O)N)C1=CC=CC=C1 BPIBEKPIZVPARD-UHFFFAOYSA-N 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 238000001291 vacuum drying Methods 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/79—Acids; Esters
- C07D213/803—Processes of preparation
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US201261675235P | 2012-07-24 | 2012-07-24 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| TW201406726A TW201406726A (zh) | 2014-02-16 |
| TWI577663B true TWI577663B (zh) | 2017-04-11 |
Family
ID=48901197
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| TW102126266A TWI577663B (zh) | 2012-07-24 | 2013-07-23 | 用於製備4-胺基-5-氟-3-鹵素-6-(經取代之)吡啶甲酸酯的方法 |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US8871943B2 (enExample) |
| EP (1) | EP2877453B1 (enExample) |
| JP (1) | JP6046817B2 (enExample) |
| KR (1) | KR101946681B1 (enExample) |
| CN (1) | CN104640844B (enExample) |
| AR (1) | AR091856A1 (enExample) |
| AU (1) | AU2013293200B2 (enExample) |
| BR (1) | BR112015001615B8 (enExample) |
| CA (1) | CA2879530C (enExample) |
| CO (1) | CO7200265A2 (enExample) |
| IL (1) | IL236816A (enExample) |
| IN (1) | IN2015DN00821A (enExample) |
| MX (1) | MX351886B (enExample) |
| NZ (1) | NZ704103A (enExample) |
| PL (1) | PL2877453T3 (enExample) |
| RU (1) | RU2632203C2 (enExample) |
| TW (1) | TWI577663B (enExample) |
| UY (1) | UY34946A (enExample) |
| WO (1) | WO2014018502A1 (enExample) |
| ZA (1) | ZA201500701B (enExample) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AR092355A1 (es) * | 2012-07-24 | 2015-04-15 | Dow Agrosciences Llc | Fluoruros de fluoropicolinoilo y procesos para su preparacion |
| US8764316B1 (en) * | 2013-05-23 | 2014-07-01 | Corning Cable Systems Llc | Fiber optic connector with vented ferrule holder |
| BR102014028162A2 (pt) | 2013-11-12 | 2015-09-08 | Dow Agrosciences Llc | processo para fluoração de compostos |
| BR102014028164A2 (pt) * | 2013-11-12 | 2015-09-08 | Dow Agrosciences Llc | processo para fluoração de compostos |
| TW201609651A (zh) | 2013-11-12 | 2016-03-16 | 陶氏農業科學公司 | 用於氟化化合物之過程(一) |
| TWI726900B (zh) | 2015-08-04 | 2021-05-11 | 美商陶氏農業科學公司 | 用於氟化化合物之過程 |
| RU2018130270A (ru) * | 2016-01-22 | 2020-02-25 | ДАУ АГРОСАЙЕНСИЗ ЭлЭлСи | Способ получения 4-алкокси-3-ацетоксипиколиновых кислот |
| CA3023935A1 (en) * | 2016-05-19 | 2017-11-23 | Dow Agrosciences Llc | Synthesis of 6-aryl-4-aminopicolinates and 2-aryl-6-aminopyrimidine-4-carboxylates by direct suzuki coupling |
| EP3555049A4 (en) | 2016-12-13 | 2020-04-29 | Dow AgroSciences LLC | Method of preparing benzy 4-amino-3-chloro-5-fluoro-6-(4-chloro-2-fluoro-3-methoxyphenyl)picolinate |
| US11401242B2 (en) | 2018-09-19 | 2022-08-02 | Corteva Agriscience Llc | Preparation of halogen analogs of picloram |
| EP4121414A1 (en) * | 2020-03-18 | 2023-01-25 | Corteva Agriscience LLC | Improved synthesis of 4-amino-6-(heterocyclic)picolinates |
| CN114702440B (zh) * | 2022-04-26 | 2024-06-18 | 永农生物科学有限公司 | 一种氨氯吡啶酸的制备方法及制备的氨氯吡啶酸 |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2003101926A1 (de) * | 2002-06-04 | 2003-12-11 | Clariant Gmbh | Verfahren zur herstellung von fluor enthaltenden verbindungen über fluor-halogenaustausch durch spezielle polyaminophosphazen-katalysatoren |
| TW200512194A (en) * | 2003-04-02 | 2005-04-01 | Dow Agrosciences Llc | 6-alkyl or alkenyl-4-aminopicolinates and their use as herbicides |
| TW200736224A (en) * | 2006-01-13 | 2007-10-01 | Dow Agrosciences Llc | 6-(Poly-substituted aryl)-4-aminopicolinates and their use as herbicides |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP2520254B2 (ja) * | 1987-04-28 | 1996-07-31 | イハラケミカル工業株式会社 | 3,4,5−トリフルオロ安息香酸誘導体およびその製造方法 |
| US4847442A (en) * | 1988-07-18 | 1989-07-11 | Allied-Signal Inc. | Process for the preparation of difluorobenzenes |
| US6297197B1 (en) | 2000-01-14 | 2001-10-02 | Dow Agrosciences Llc | 4-aminopicolinates and their use as herbicides |
| AR037228A1 (es) | 2001-07-30 | 2004-11-03 | Dow Agrosciences Llc | Compuestos del acido 6-(aril o heteroaril)-4-aminopicolinico, composicion herbicida que los comprende y metodo para controlar vegetacion no deseada |
| TWI537252B (zh) | 2011-01-25 | 2016-06-11 | 陶氏農業科學公司 | 用於製備4-胺基-5-氟-3-鹵素-6-(經取代之)吡啶甲酸酯的方法(一) |
| TWI529163B (zh) | 2011-01-25 | 2016-04-11 | 陶氏農業科學公司 | 用於製備4-胺基-5-氟-3-鹵素-6-(經取代之)吡啶甲酸酯的方法 |
-
2013
- 2013-07-22 AR ARP130102597A patent/AR091856A1/es active IP Right Grant
- 2013-07-23 AU AU2013293200A patent/AU2013293200B2/en active Active
- 2013-07-23 WO PCT/US2013/051623 patent/WO2014018502A1/en not_active Ceased
- 2013-07-23 MX MX2015001141A patent/MX351886B/es active IP Right Grant
- 2013-07-23 BR BR112015001615A patent/BR112015001615B8/pt active IP Right Grant
- 2013-07-23 TW TW102126266A patent/TWI577663B/zh active
- 2013-07-23 CA CA2879530A patent/CA2879530C/en active Active
- 2013-07-23 UY UY0001034946A patent/UY34946A/es active IP Right Grant
- 2013-07-23 KR KR1020157004099A patent/KR101946681B1/ko active Active
- 2013-07-23 EP EP13742581.5A patent/EP2877453B1/en active Active
- 2013-07-23 RU RU2015106019A patent/RU2632203C2/ru active
- 2013-07-23 CN CN201380048518.6A patent/CN104640844B/zh active Active
- 2013-07-23 US US13/949,060 patent/US8871943B2/en active Active
- 2013-07-23 PL PL13742581T patent/PL2877453T3/pl unknown
- 2013-07-23 NZ NZ704103A patent/NZ704103A/en unknown
- 2013-07-23 IN IN821DEN2015 patent/IN2015DN00821A/en unknown
- 2013-07-23 JP JP2015524380A patent/JP6046817B2/ja active Active
-
2015
- 2015-01-20 IL IL236816A patent/IL236816A/en active IP Right Grant
- 2015-01-30 ZA ZA2015/00701A patent/ZA201500701B/en unknown
- 2015-02-06 CO CO15024012A patent/CO7200265A2/es unknown
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2003101926A1 (de) * | 2002-06-04 | 2003-12-11 | Clariant Gmbh | Verfahren zur herstellung von fluor enthaltenden verbindungen über fluor-halogenaustausch durch spezielle polyaminophosphazen-katalysatoren |
| TW200512194A (en) * | 2003-04-02 | 2005-04-01 | Dow Agrosciences Llc | 6-alkyl or alkenyl-4-aminopicolinates and their use as herbicides |
| TW200736224A (en) * | 2006-01-13 | 2007-10-01 | Dow Agrosciences Llc | 6-(Poly-substituted aryl)-4-aminopicolinates and their use as herbicides |
Also Published As
| Publication number | Publication date |
|---|---|
| KR101946681B1 (ko) | 2019-02-11 |
| ZA201500701B (en) | 2016-10-26 |
| BR112015001615A2 (pt) | 2017-07-04 |
| EP2877453A1 (en) | 2015-06-03 |
| AR091856A1 (es) | 2015-03-04 |
| KR20150036673A (ko) | 2015-04-07 |
| RU2632203C2 (ru) | 2017-10-03 |
| IN2015DN00821A (enExample) | 2015-06-12 |
| US20140031556A1 (en) | 2014-01-30 |
| MX2015001141A (es) | 2015-09-08 |
| IL236816A (en) | 2016-11-30 |
| HK1210613A1 (en) | 2016-04-29 |
| JP2015530367A (ja) | 2015-10-15 |
| WO2014018502A1 (en) | 2014-01-30 |
| JP6046817B2 (ja) | 2016-12-21 |
| MX351886B (es) | 2017-11-01 |
| US8871943B2 (en) | 2014-10-28 |
| CO7200265A2 (es) | 2015-02-27 |
| AU2013293200A1 (en) | 2015-02-19 |
| TW201406726A (zh) | 2014-02-16 |
| BR112015001615B1 (pt) | 2019-10-22 |
| CN104640844B (zh) | 2016-11-09 |
| CA2879530C (en) | 2019-06-18 |
| NZ704103A (en) | 2016-08-26 |
| EP2877453B1 (en) | 2016-07-06 |
| BR112015001615B8 (pt) | 2022-08-23 |
| CA2879530A1 (en) | 2014-01-30 |
| CN104640844A (zh) | 2015-05-20 |
| AU2013293200B2 (en) | 2016-11-17 |
| PL2877453T3 (pl) | 2017-08-31 |
| RU2015106019A (ru) | 2016-09-10 |
| UY34946A (es) | 2014-02-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| TWI577663B (zh) | 用於製備4-胺基-5-氟-3-鹵素-6-(經取代之)吡啶甲酸酯的方法 | |
| KR101379070B1 (ko) | 특정 치환된 술필이민의 살충성 술폭시민으로의 산화 방법 | |
| KR101547044B1 (ko) | 4-아미노-5-플루오로-3-할로-6-(치환된)피콜리네이트의 제조 방법 | |
| RU2542985C1 (ru) | Способ получения 4-амино-5-фтор-3-галоген-6-(замещенных)пиколинатов | |
| TWI547482B (zh) | 增加可回收之3-氯-4,5,6-三氟-2-氰吡啶之量的改良方法 | |
| US9376388B2 (en) | Fluoropicolinoyl fluorides and processes for their preparation | |
| US6531605B1 (en) | Process for the manufacture of arylsulfonyl chloride | |
| CN105007734A (zh) | 制备4-氨基-5-氟-3-氯-6-(取代的)吡啶甲酸酯的方法 | |
| HK1210613B (en) | Process for the preparation of 4-amino-5-fluoro-3-halo-6-(substituted)picolinates | |
| HK1210465B (en) | Fluoropicolinoyl fluorides and processes for their preparation | |
| KR20170029421A (ko) | 4-(1-(4-(퍼플루오로에톡시)페닐)-1h-1,2,4-트리아졸-3-일)벤조일 아지드의 개선된 제조 방법 |