TW201636327A - 被取代的單氮雜萘衍生物和多氮雜萘衍生物及其用途 - Google Patents
被取代的單氮雜萘衍生物和多氮雜萘衍生物及其用途 Download PDFInfo
- Publication number
- TW201636327A TW201636327A TW105104357A TW105104357A TW201636327A TW 201636327 A TW201636327 A TW 201636327A TW 105104357 A TW105104357 A TW 105104357A TW 105104357 A TW105104357 A TW 105104357A TW 201636327 A TW201636327 A TW 201636327A
- Authority
- TW
- Taiwan
- Prior art keywords
- group
- substituted
- mmol
- nitrogen
- compound
- Prior art date
Links
- 239000000203 mixture Substances 0.000 claims abstract description 280
- -1 N(R3)2 Chemical class 0.000 claims abstract description 245
- 150000001875 compounds Chemical class 0.000 claims abstract description 198
- 125000001424 substituent group Chemical group 0.000 claims abstract description 127
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims abstract description 118
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 110
- 125000001072 heteroaryl group Chemical group 0.000 claims abstract description 104
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 75
- 239000001257 hydrogen Substances 0.000 claims abstract description 73
- 125000002950 monocyclic group Chemical group 0.000 claims abstract description 68
- 125000003118 aryl group Chemical group 0.000 claims abstract description 63
- 206010028980 Neoplasm Diseases 0.000 claims abstract description 52
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 52
- 150000002367 halogens Chemical class 0.000 claims abstract description 52
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims abstract description 48
- 125000004093 cyano group Chemical group *C#N 0.000 claims abstract description 48
- 125000002619 bicyclic group Chemical group 0.000 claims abstract description 47
- 229910052717 sulfur Chemical group 0.000 claims abstract description 43
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 41
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 41
- 150000002431 hydrogen Chemical group 0.000 claims abstract description 36
- 125000004433 nitrogen atom Chemical group N* 0.000 claims abstract description 35
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims abstract description 35
- 125000000592 heterocycloalkyl group Chemical group 0.000 claims abstract description 33
- 125000005842 heteroatom Chemical group 0.000 claims abstract description 32
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims abstract description 28
- 150000003839 salts Chemical class 0.000 claims abstract description 28
- 239000011593 sulfur Chemical group 0.000 claims abstract description 25
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims abstract description 24
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 23
- 239000001301 oxygen Chemical group 0.000 claims abstract description 23
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 21
- 201000011510 cancer Diseases 0.000 claims abstract description 21
- 201000010099 disease Diseases 0.000 claims abstract description 21
- 238000011282 treatment Methods 0.000 claims abstract description 20
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims abstract description 19
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 16
- 229910052796 boron Inorganic materials 0.000 claims abstract description 11
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims abstract description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 130
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 58
- 229920006395 saturated elastomer Polymers 0.000 claims description 46
- 239000000460 chlorine Substances 0.000 claims description 31
- 125000000217 alkyl group Chemical group 0.000 claims description 28
- 125000004432 carbon atom Chemical group C* 0.000 claims description 25
- 238000000034 method Methods 0.000 claims description 24
- 125000004414 alkyl thio group Chemical group 0.000 claims description 21
- 125000004076 pyridyl group Chemical group 0.000 claims description 21
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 18
- 125000004995 haloalkylthio group Chemical group 0.000 claims description 18
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims description 17
- 125000004429 atom Chemical group 0.000 claims description 16
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 15
- 125000003709 fluoroalkyl group Chemical group 0.000 claims description 15
- 229910052801 chlorine Inorganic materials 0.000 claims description 14
- 238000002360 preparation method Methods 0.000 claims description 14
- 230000002062 proliferating effect Effects 0.000 claims description 14
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 claims description 13
- 239000008194 pharmaceutical composition Substances 0.000 claims description 13
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 12
- 229910052731 fluorine Inorganic materials 0.000 claims description 12
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 12
- 125000006413 ring segment Chemical group 0.000 claims description 11
- 125000004434 sulfur atom Chemical group 0.000 claims description 11
- 125000006570 (C5-C6) heteroaryl group Chemical group 0.000 claims description 10
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 10
- 239000011737 fluorine Substances 0.000 claims description 10
- 125000001624 naphthyl group Chemical group 0.000 claims description 10
- 241000124008 Mammalia Species 0.000 claims description 9
- 125000004244 benzofuran-2-yl group Chemical group [H]C1=C(*)OC2=C([H])C([H])=C([H])C([H])=C12 0.000 claims description 9
- 125000003545 alkoxy group Chemical group 0.000 claims description 8
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims description 7
- 125000003386 piperidinyl group Chemical group 0.000 claims description 7
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 claims description 6
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 claims description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 6
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 6
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 6
- 125000004482 piperidin-4-yl group Chemical group N1CCC(CC1)* 0.000 claims description 6
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 6
- 125000006850 spacer group Chemical group 0.000 claims description 6
- 239000003814 drug Substances 0.000 claims description 5
- 125000001188 haloalkyl group Chemical group 0.000 claims description 5
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 5
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 claims description 4
- 125000005605 benzo group Chemical group 0.000 claims description 4
- 125000004428 fluoroalkoxy group Chemical group 0.000 claims description 4
- 125000004438 haloalkoxy group Chemical group 0.000 claims description 4
- 125000005956 isoquinolyl group Chemical group 0.000 claims description 4
- 125000000719 pyrrolidinyl group Chemical group 0.000 claims description 4
- 125000005493 quinolyl group Chemical group 0.000 claims description 4
- 239000000126 substance Substances 0.000 claims description 4
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 claims description 3
- 125000004575 3-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 3
- 239000003937 drug carrier Substances 0.000 claims description 3
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 3
- 125000004483 piperidin-3-yl group Chemical group N1CC(CCC1)* 0.000 claims description 3
- 125000003226 pyrazolyl group Chemical group 0.000 claims description 3
- 125000003107 substituted aryl group Chemical group 0.000 claims description 3
- 125000004767 (C1-C4) haloalkoxy group Chemical group 0.000 claims description 2
- 125000004765 (C1-C4) haloalkyl group Chemical group 0.000 claims description 2
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000004531 indol-5-yl group Chemical group [H]N1C([H])=C([H])C2=C([H])C(*)=C([H])C([H])=C12 0.000 claims description 2
- 125000004497 pyrazol-5-yl group Chemical group N1N=CC=C1* 0.000 claims description 2
- 238000006467 substitution reaction Methods 0.000 claims description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 claims 2
- WFZCVZZPXZKOPL-UHFFFAOYSA-N 1h-pyrrolo[3,2-c]pyridine Chemical compound N1=CC=C2N[C]=CC2=C1 WFZCVZZPXZKOPL-UHFFFAOYSA-N 0.000 claims 1
- 230000001028 anti-proliverative effect Effects 0.000 claims 1
- 125000004190 benzothiazol-2-yl group Chemical group [H]C1=C([H])C([H])=C2N=C(*)SC2=C1[H] 0.000 claims 1
- 125000000623 heterocyclic group Chemical group 0.000 claims 1
- 125000002249 indol-2-yl group Chemical group [H]C1=C([H])C([H])=C2N([H])C([*])=C([H])C2=C1[H] 0.000 claims 1
- 125000004548 quinolin-3-yl group Chemical group N1=CC(=CC2=CC=CC=C12)* 0.000 claims 1
- 208000035475 disorder Diseases 0.000 abstract description 7
- 230000035755 proliferation Effects 0.000 abstract description 2
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 431
- 239000000243 solution Substances 0.000 description 274
- 235000019439 ethyl acetate Nutrition 0.000 description 220
- 238000005481 NMR spectroscopy Methods 0.000 description 190
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 177
- 239000007787 solid Substances 0.000 description 135
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 120
- JEXWUYHINKZLBT-UHFFFAOYSA-N 1-[[4-(1-benzofuran-2-yl)isoquinolin-6-yl]methyl]piperidin-4-amine Chemical compound NC1CCN(CC2=CC=C3C=NC=C(C4=CC5=CC=CC=C5O4)C3=C2)CC1 JEXWUYHINKZLBT-UHFFFAOYSA-N 0.000 description 114
- 239000011734 sodium Substances 0.000 description 110
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 102
- 239000011541 reaction mixture Substances 0.000 description 101
- 238000006243 chemical reaction Methods 0.000 description 96
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 82
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 81
- 239000012267 brine Substances 0.000 description 67
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 67
- 239000012043 crude product Substances 0.000 description 62
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 58
- 239000000047 product Substances 0.000 description 54
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 52
- 239000002904 solvent Substances 0.000 description 52
- 238000003756 stirring Methods 0.000 description 51
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 50
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 49
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 47
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 44
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 42
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 42
- 230000002829 reductive effect Effects 0.000 description 42
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 41
- 239000012300 argon atmosphere Substances 0.000 description 39
- 239000000706 filtrate Substances 0.000 description 39
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 37
- 239000012299 nitrogen atmosphere Substances 0.000 description 36
- 238000002953 preparative HPLC Methods 0.000 description 36
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 35
- PKRRNTJIHGOMRC-UHFFFAOYSA-N 1-benzofuran-2-ylboronic acid Chemical compound C1=CC=C2OC(B(O)O)=CC2=C1 PKRRNTJIHGOMRC-UHFFFAOYSA-N 0.000 description 34
- 239000003054 catalyst Substances 0.000 description 34
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 32
- 239000004698 Polyethylene Substances 0.000 description 29
- DZXVXQFMSACVAA-UHFFFAOYSA-N 4-bromo-6-(bromomethyl)isoquinoline Chemical compound C1=NC=C(Br)C2=CC(CBr)=CC=C21 DZXVXQFMSACVAA-UHFFFAOYSA-N 0.000 description 28
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 28
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 28
- 239000012074 organic phase Substances 0.000 description 27
- OJCSPXHYDFONPU-UHFFFAOYSA-N etoac etoac Chemical compound CCOC(C)=O.CCOC(C)=O OJCSPXHYDFONPU-UHFFFAOYSA-N 0.000 description 26
- VJOWMORERYNYON-UHFFFAOYSA-N 5-ethenyl-2-methylpyridine Chemical compound CC1=CC=C(C=C)C=N1 VJOWMORERYNYON-UHFFFAOYSA-N 0.000 description 24
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 24
- 238000001914 filtration Methods 0.000 description 24
- 239000000741 silica gel Substances 0.000 description 24
- 229910002027 silica gel Inorganic materials 0.000 description 24
- 238000004440 column chromatography Methods 0.000 description 23
- 239000000725 suspension Substances 0.000 description 23
- 150000002148 esters Chemical class 0.000 description 22
- 239000003921 oil Substances 0.000 description 21
- 235000019198 oils Nutrition 0.000 description 21
- 239000012044 organic layer Substances 0.000 description 21
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 20
- HXITXNWTGFUOAU-UHFFFAOYSA-N phenylboronic acid Chemical compound OB(O)C1=CC=CC=C1 HXITXNWTGFUOAU-UHFFFAOYSA-N 0.000 description 20
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 19
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 18
- 239000002253 acid Substances 0.000 description 18
- 239000004480 active ingredient Substances 0.000 description 18
- 238000010511 deprotection reaction Methods 0.000 description 18
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 18
- 229910052786 argon Inorganic materials 0.000 description 17
- 238000001816 cooling Methods 0.000 description 17
- 238000000746 purification Methods 0.000 description 17
- 238000010898 silica gel chromatography Methods 0.000 description 17
- 150000001412 amines Chemical class 0.000 description 16
- ORPCRWHRDIBEJE-UHFFFAOYSA-N butoxycarbonylcarbamic acid Chemical group CCCCOC(=O)NC(O)=O ORPCRWHRDIBEJE-UHFFFAOYSA-N 0.000 description 15
- SLAZBTLZPNMAOX-UHFFFAOYSA-N 4-(1-benzofuran-2-yl)-6-fluoroisoquinoline Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)F SLAZBTLZPNMAOX-UHFFFAOYSA-N 0.000 description 14
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 14
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 description 14
- CXNIUSPIQKWYAI-UHFFFAOYSA-N xantphos Chemical compound C=12OC3=C(P(C=4C=CC=CC=4)C=4C=CC=CC=4)C=CC=C3C(C)(C)C2=CC=CC=1P(C=1C=CC=CC=1)C1=CC=CC=C1 CXNIUSPIQKWYAI-UHFFFAOYSA-N 0.000 description 14
- SIOXPEMLGUPBBT-UHFFFAOYSA-N Picolinic acid Natural products OC(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-N 0.000 description 13
- 210000004027 cell Anatomy 0.000 description 13
- 239000013058 crude material Substances 0.000 description 13
- CKXZPVPIDOJLLM-UHFFFAOYSA-N tert-butyl n-piperidin-4-ylcarbamate Chemical compound CC(C)(C)OC(=O)NC1CCNCC1 CKXZPVPIDOJLLM-UHFFFAOYSA-N 0.000 description 13
- 238000004809 thin layer chromatography Methods 0.000 description 13
- ZADPBFCGQRWHPN-UHFFFAOYSA-N boronic acid Chemical compound OBO ZADPBFCGQRWHPN-UHFFFAOYSA-N 0.000 description 12
- UGOMMVLRQDMAQQ-UHFFFAOYSA-N xphos Chemical compound CC(C)C1=CC(C(C)C)=CC(C(C)C)=C1C1=CC=CC=C1P(C1CCCCC1)C1CCCCC1 UGOMMVLRQDMAQQ-UHFFFAOYSA-N 0.000 description 12
- 101001082110 Acanthamoeba polyphaga mimivirus Eukaryotic translation initiation factor 4E homolog Proteins 0.000 description 11
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 11
- 239000003039 volatile agent Substances 0.000 description 11
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 10
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 10
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 10
- 230000000694 effects Effects 0.000 description 10
- 125000001153 fluoro group Chemical group F* 0.000 description 10
- 150000003141 primary amines Chemical group 0.000 description 10
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 10
- COIQUVGFTILYGA-UHFFFAOYSA-N (4-hydroxyphenyl)boronic acid Chemical compound OB(O)C1=CC=C(O)C=C1 COIQUVGFTILYGA-UHFFFAOYSA-N 0.000 description 9
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- 101001082109 Danio rerio Eukaryotic translation initiation factor 4E-1B Proteins 0.000 description 9
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000006185 dispersion Substances 0.000 description 9
- 239000002244 precipitate Substances 0.000 description 9
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 9
- JUHXLNLAKXBYFP-UHFFFAOYSA-N [4-(1-benzofuran-2-yl)isoquinolin-6-yl] trifluoromethanesulfonate Chemical compound FC(S(=O)(=O)OC=1C=C2C(=CN=CC2=CC=1)C=1OC2=C(C=1)C=CC=C2)(F)F JUHXLNLAKXBYFP-UHFFFAOYSA-N 0.000 description 8
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 8
- 125000001309 chloro group Chemical group Cl* 0.000 description 8
- 239000013078 crystal Substances 0.000 description 8
- 238000003818 flash chromatography Methods 0.000 description 8
- 239000010410 layer Substances 0.000 description 8
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 8
- 108090000623 proteins and genes Proteins 0.000 description 8
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 8
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 8
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical class CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 7
- 102100026299 MAP kinase-interacting serine/threonine-protein kinase 1 Human genes 0.000 description 7
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 7
- 239000007864 aqueous solution Substances 0.000 description 7
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 7
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 7
- QKWWDTYDYOFRJL-UHFFFAOYSA-N 2,2-dimethoxyethanamine Chemical compound COC(CN)OC QKWWDTYDYOFRJL-UHFFFAOYSA-N 0.000 description 6
- NUKYPUAOHBNCPY-UHFFFAOYSA-N 4-aminopyridine Chemical compound NC1=CC=NC=C1 NUKYPUAOHBNCPY-UHFFFAOYSA-N 0.000 description 6
- 239000004342 Benzoyl peroxide Substances 0.000 description 6
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 6
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 6
- 101710139011 MAP kinase-interacting serine/threonine-protein kinase 1 Proteins 0.000 description 6
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 6
- 239000012298 atmosphere Substances 0.000 description 6
- 235000019400 benzoyl peroxide Nutrition 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 6
- 230000008878 coupling Effects 0.000 description 6
- 238000010168 coupling process Methods 0.000 description 6
- 238000005859 coupling reaction Methods 0.000 description 6
- 150000003840 hydrochlorides Chemical class 0.000 description 6
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 6
- BCIIMDOZSUCSEN-UHFFFAOYSA-N piperidin-4-amine Chemical compound NC1CCNCC1 BCIIMDOZSUCSEN-UHFFFAOYSA-N 0.000 description 6
- 239000007858 starting material Substances 0.000 description 6
- GFAOKSYHWNNOCO-UHFFFAOYSA-N 6-(3-aminopropoxymethyl)-4-bromoisoquinolin-1-amine Chemical compound NCCCOCC=1C=C2C(=CN=C(C2=CC=1)N)Br GFAOKSYHWNNOCO-UHFFFAOYSA-N 0.000 description 5
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 5
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 5
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 5
- 239000007821 HATU Substances 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- 108091000080 Phosphotransferase Proteins 0.000 description 5
- 238000006069 Suzuki reaction reaction Methods 0.000 description 5
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 5
- 239000004327 boric acid Substances 0.000 description 5
- 235000014113 dietary fatty acids Nutrition 0.000 description 5
- 239000000194 fatty acid Substances 0.000 description 5
- 229930195729 fatty acid Natural products 0.000 description 5
- 239000006260 foam Substances 0.000 description 5
- 238000004108 freeze drying Methods 0.000 description 5
- 230000002401 inhibitory effect Effects 0.000 description 5
- 108020004999 messenger RNA Proteins 0.000 description 5
- 239000002480 mineral oil Substances 0.000 description 5
- 235000010446 mineral oil Nutrition 0.000 description 5
- 102000020233 phosphotransferase Human genes 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- SGKANYYYKALPHW-UHFFFAOYSA-N (4-bromo-8-chloroisoquinolin-6-yl)methanol Chemical compound BrC1=CN=CC2=C(C=C(C=C12)CO)Cl SGKANYYYKALPHW-UHFFFAOYSA-N 0.000 description 4
- IANQTJSKSUMEQM-UHFFFAOYSA-N 1-benzofuran Chemical compound C1=CC=C2OC=CC2=C1 IANQTJSKSUMEQM-UHFFFAOYSA-N 0.000 description 4
- DOGVHEHFCWBXLB-UHFFFAOYSA-N 2-azidopyridin-4-amine Chemical compound NC1=CC=NC(N=[N+]=[N-])=C1 DOGVHEHFCWBXLB-UHFFFAOYSA-N 0.000 description 4
- FZZMTSNZRBFGGU-UHFFFAOYSA-N 2-chloro-7-fluoroquinazolin-4-amine Chemical compound FC1=CC=C2C(N)=NC(Cl)=NC2=C1 FZZMTSNZRBFGGU-UHFFFAOYSA-N 0.000 description 4
- JESRNIJXVIFVOV-UHFFFAOYSA-N 2-methylpyrazol-3-amine Chemical compound CN1N=CC=C1N JESRNIJXVIFVOV-UHFFFAOYSA-N 0.000 description 4
- KKLCYBZPQDOFQK-UHFFFAOYSA-N 4,4,5,5-tetramethyl-2-phenyl-1,3,2-dioxaborolane Chemical compound O1C(C)(C)C(C)(C)OB1C1=CC=CC=C1 KKLCYBZPQDOFQK-UHFFFAOYSA-N 0.000 description 4
- FCFGLZGJSHBDOJ-UHFFFAOYSA-N 4-(1-benzofuran-2-yl)-6-fluoroisoquinolin-1-amine Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=C(C2=CC=C(C=C12)F)N FCFGLZGJSHBDOJ-UHFFFAOYSA-N 0.000 description 4
- UAAUUEADLTYOPN-UHFFFAOYSA-N 4-(1-benzofuran-2-yl)isoquinolin-6-amine Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)N UAAUUEADLTYOPN-UHFFFAOYSA-N 0.000 description 4
- XLWCQTRYIQADHL-UHFFFAOYSA-N 4-bromoisoquinoline-6-carboxylic acid Chemical compound OC(=O)c1ccc2cncc(Br)c2c1 XLWCQTRYIQADHL-UHFFFAOYSA-N 0.000 description 4
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 4
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- MHABMANUFPZXEB-UHFFFAOYSA-N O-demethyl-aloesaponarin I Natural products O=C1C2=CC=CC(O)=C2C(=O)C2=C1C=C(O)C(C(O)=O)=C2C MHABMANUFPZXEB-UHFFFAOYSA-N 0.000 description 4
- 108700020796 Oncogene Proteins 0.000 description 4
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 238000006161 Suzuki-Miyaura coupling reaction Methods 0.000 description 4
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 4
- 230000002378 acidificating effect Effects 0.000 description 4
- 239000008346 aqueous phase Substances 0.000 description 4
- MUALRAIOVNYAIW-UHFFFAOYSA-N binap Chemical compound C1=CC=CC=C1P(C=1C(=C2C=CC=CC2=CC=1)C=1C2=CC=CC=C2C=CC=1P(C=1C=CC=CC=1)C=1C=CC=CC=1)C1=CC=CC=C1 MUALRAIOVNYAIW-UHFFFAOYSA-N 0.000 description 4
- 239000001768 carboxy methyl cellulose Substances 0.000 description 4
- 238000005119 centrifugation Methods 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 239000011248 coating agent Substances 0.000 description 4
- 238000000576 coating method Methods 0.000 description 4
- FAMRKDQNMBBFBR-BQYQJAHWSA-N diethyl azodicarboxylate Substances CCOC(=O)\N=N\C(=O)OCC FAMRKDQNMBBFBR-BQYQJAHWSA-N 0.000 description 4
- 239000002552 dosage form Substances 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- 238000010828 elution Methods 0.000 description 4
- 238000004128 high performance liquid chromatography Methods 0.000 description 4
- 150000002430 hydrocarbons Chemical group 0.000 description 4
- 239000005457 ice water Substances 0.000 description 4
- 150000002466 imines Chemical class 0.000 description 4
- 150000002576 ketones Chemical class 0.000 description 4
- 201000010260 leiomyoma Diseases 0.000 description 4
- 238000007911 parenteral administration Methods 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 4
- SIOXPEMLGUPBBT-UHFFFAOYSA-M picolinate Chemical compound [O-]C(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-M 0.000 description 4
- 229920001223 polyethylene glycol Polymers 0.000 description 4
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 4
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 4
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 4
- 229910000160 potassium phosphate Inorganic materials 0.000 description 4
- 235000011009 potassium phosphates Nutrition 0.000 description 4
- 102000004169 proteins and genes Human genes 0.000 description 4
- 239000012265 solid product Substances 0.000 description 4
- 239000003381 stabilizer Substances 0.000 description 4
- LZRDHSFPLUWYAX-UHFFFAOYSA-N tert-butyl 4-aminopiperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(N)CC1 LZRDHSFPLUWYAX-UHFFFAOYSA-N 0.000 description 4
- 125000001544 thienyl group Chemical group 0.000 description 4
- CYPYTURSJDMMMP-WVCUSYJESA-N (1e,4e)-1,5-diphenylpenta-1,4-dien-3-one;palladium Chemical compound [Pd].[Pd].C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 CYPYTURSJDMMMP-WVCUSYJESA-N 0.000 description 3
- BLNQYGZTOZJMRF-UHFFFAOYSA-N 1-[(4-bromoisoquinolin-6-yl)methyl]piperidin-4-amine Chemical compound NC1CCN(CC2=CC=C3C=NC=C(Br)C3=C2)CC1 BLNQYGZTOZJMRF-UHFFFAOYSA-N 0.000 description 3
- UJBKDUWYORYGON-UHFFFAOYSA-N 1-[[4-(1-benzofuran-2-yl)-8-chloroisoquinolin-6-yl]methyl]piperidin-4-amine Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=C(C=C(C=C12)CN1CCC(CC1)N)Cl UJBKDUWYORYGON-UHFFFAOYSA-N 0.000 description 3
- ULRNHSFEYAIMDM-UHFFFAOYSA-N 1-[[4-(1-benzofuran-2-yl)-8-methoxyisoquinolin-6-yl]methyl]piperidin-4-amine Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=C(C=C(C=C12)CN1CCC(CC1)N)OC ULRNHSFEYAIMDM-UHFFFAOYSA-N 0.000 description 3
- CKBIOWTZEGJMFU-UHFFFAOYSA-N 1-[[4-(1-benzofuran-2-yl)-8-nitroisoquinolin-6-yl]methyl]piperidin-4-amine Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=C(C=C(C=C12)CN1CCC(CC1)N)[N+](=O)[O-] CKBIOWTZEGJMFU-UHFFFAOYSA-N 0.000 description 3
- KVGAOVQYSHYZQK-UHFFFAOYSA-N 1-phenyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea Chemical compound O1C(C)(C)C(C)(C)OB1C(C=C1)=CC=C1NC(=O)NC1=CC=CC=C1 KVGAOVQYSHYZQK-UHFFFAOYSA-N 0.000 description 3
- SRSKXJVMVSSSHB-UHFFFAOYSA-N 1h-pyrrolo[3,2-c]pyridine Chemical compound N1=CC=C2NC=CC2=C1 SRSKXJVMVSSSHB-UHFFFAOYSA-N 0.000 description 3
- BPXKZEMBEZGUAH-UHFFFAOYSA-N 2-(chloromethoxy)ethyl-trimethylsilane Chemical compound C[Si](C)(C)CCOCCl BPXKZEMBEZGUAH-UHFFFAOYSA-N 0.000 description 3
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 3
- JXRPUNXNFKHTEA-UHFFFAOYSA-N 4-(1-benzofuran-2-yl)isoquinolin-6-ol Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)O JXRPUNXNFKHTEA-UHFFFAOYSA-N 0.000 description 3
- IXLPAFQCBBGXBG-UHFFFAOYSA-N 4-bromo-6-fluoroisoquinoline Chemical compound C1=NC=C(Br)C2=CC(F)=CC=C21 IXLPAFQCBBGXBG-UHFFFAOYSA-N 0.000 description 3
- UQKURXKBUHYNAT-UHFFFAOYSA-N 4-bromo-6-methylisoquinoline Chemical compound C1=NC=C(Br)C2=CC(C)=CC=C21 UQKURXKBUHYNAT-UHFFFAOYSA-N 0.000 description 3
- GQHSIDJIHBURNW-UHFFFAOYSA-N 4-bromo-8-chloro-6-methylisoquinolin-1-amine Chemical compound BrC1=CN=C(C2=C(C=C(C=C12)C)Cl)N GQHSIDJIHBURNW-UHFFFAOYSA-N 0.000 description 3
- KAHXMNVVZSUZPS-UHFFFAOYSA-N 4-bromo-8-chloro-6-methylisoquinoline Chemical compound BrC1=CN=CC2=C(C=C(C=C12)C)Cl KAHXMNVVZSUZPS-UHFFFAOYSA-N 0.000 description 3
- KOMFTCUQPUHQJP-UHFFFAOYSA-N 4-chloro-6-fluoroisoquinolin-1-amine Chemical compound ClC1=CN=C(C2=CC=C(C=C12)F)N KOMFTCUQPUHQJP-UHFFFAOYSA-N 0.000 description 3
- UORWTZYYTNAMNF-UHFFFAOYSA-N 4-chloro-6-fluoroisoquinoline Chemical compound C1=NC=C(Cl)C2=CC(F)=CC=C21 UORWTZYYTNAMNF-UHFFFAOYSA-N 0.000 description 3
- QGFYFOHMBDMGBZ-UHFFFAOYSA-N 5-[(7-chloroquinolin-4-yl)amino]-2-(diethylaminomethyl)phenol Chemical class C1=C(O)C(CN(CC)CC)=CC=C1NC1=CC=NC2=CC(Cl)=CC=C12 QGFYFOHMBDMGBZ-UHFFFAOYSA-N 0.000 description 3
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 3
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 3
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 108010010803 Gelatin Proteins 0.000 description 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 3
- 239000005909 Kieselgur Substances 0.000 description 3
- 229910010082 LiAlH Inorganic materials 0.000 description 3
- 102000043136 MAP kinase family Human genes 0.000 description 3
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 3
- ZVVPSJUXOJUNKL-UHFFFAOYSA-N N-[(2-aminopyridin-4-yl)methyl]-4-(1-benzofuran-2-yl)isoquinolin-6-amine Chemical compound NC1=NC=CC(=C1)CNC=1C=C2C(=CN=CC2=CC=1)C=1OC2=C(C=1)C=CC=C2 ZVVPSJUXOJUNKL-UHFFFAOYSA-N 0.000 description 3
- AVQQQUULBHXFML-UHFFFAOYSA-N N-[[4-(1-benzofuran-2-yl)isoquinolin-6-yl]methyl]-3-nitropyridin-4-amine Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)CNC1=C(C=NC=C1)[N+](=O)[O-] AVQQQUULBHXFML-UHFFFAOYSA-N 0.000 description 3
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 3
- 239000002202 Polyethylene glycol Substances 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- 229920002472 Starch Polymers 0.000 description 3
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 3
- 208000009956 adenocarcinoma Diseases 0.000 description 3
- 125000003277 amino group Chemical group 0.000 description 3
- 125000003943 azolyl group Chemical group 0.000 description 3
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 3
- HTZCNXWZYVXIMZ-UHFFFAOYSA-M benzyl(triethyl)azanium;chloride Chemical compound [Cl-].CC[N+](CC)(CC)CC1=CC=CC=C1 HTZCNXWZYVXIMZ-UHFFFAOYSA-M 0.000 description 3
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 3
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 3
- 239000004202 carbamide Substances 0.000 description 3
- 239000012230 colorless oil Substances 0.000 description 3
- REWLCYPYZCHYSS-UHFFFAOYSA-N ditert-butyl-[3,6-dimethoxy-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane Chemical compound COC1=CC=C(OC)C(C=2C(=CC(=CC=2C(C)C)C(C)C)C(C)C)=C1P(C(C)(C)C)C(C)(C)C REWLCYPYZCHYSS-UHFFFAOYSA-N 0.000 description 3
- 239000003480 eluent Substances 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 229960004979 fampridine Drugs 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 125000002541 furyl group Chemical group 0.000 description 3
- 239000008273 gelatin Substances 0.000 description 3
- 229920000159 gelatin Polymers 0.000 description 3
- 235000019322 gelatine Nutrition 0.000 description 3
- 235000011852 gelatine desserts Nutrition 0.000 description 3
- 230000012010 growth Effects 0.000 description 3
- 125000005843 halogen group Chemical group 0.000 description 3
- OSILBMSORKFRTB-UHFFFAOYSA-N isoquinolin-1-amine Chemical compound C1=CC=C2C(N)=NC=CC2=C1 OSILBMSORKFRTB-UHFFFAOYSA-N 0.000 description 3
- VYCKDIRCVDCQAE-UHFFFAOYSA-N isoquinolin-3-amine Chemical compound C1=CC=C2C=NC(N)=CC2=C1 VYCKDIRCVDCQAE-UHFFFAOYSA-N 0.000 description 3
- NGFCTYXFMDWFRQ-UHFFFAOYSA-N isoquinolin-6-amine Chemical compound C1=NC=CC2=CC(N)=CC=C21 NGFCTYXFMDWFRQ-UHFFFAOYSA-N 0.000 description 3
- 150000002537 isoquinolines Chemical class 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Substances [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 3
- 238000004949 mass spectrometry Methods 0.000 description 3
- MBABOKRGFJTBAE-UHFFFAOYSA-N methyl methanesulfonate Chemical compound COS(C)(=O)=O MBABOKRGFJTBAE-UHFFFAOYSA-N 0.000 description 3
- YXAMTQAVAJACLQ-UHFFFAOYSA-N n-(3-nitropyridin-4-yl)acetamide Chemical compound CC(=O)NC1=CC=NC=C1[N+]([O-])=O YXAMTQAVAJACLQ-UHFFFAOYSA-N 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 230000001613 neoplastic effect Effects 0.000 description 3
- 230000002018 overexpression Effects 0.000 description 3
- 229910052763 palladium Inorganic materials 0.000 description 3
- 239000000546 pharmaceutical excipient Substances 0.000 description 3
- 230000026731 phosphorylation Effects 0.000 description 3
- 238000006366 phosphorylation reaction Methods 0.000 description 3
- 150000004033 porphyrin derivatives Chemical class 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- TXQWFIVRZNOPCK-UHFFFAOYSA-N pyridin-4-ylmethanamine Chemical compound NCC1=CC=NC=C1 TXQWFIVRZNOPCK-UHFFFAOYSA-N 0.000 description 3
- 238000010791 quenching Methods 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 3
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 3
- 239000000600 sorbitol Substances 0.000 description 3
- 235000019698 starch Nutrition 0.000 description 3
- 239000000454 talc Substances 0.000 description 3
- 229910052623 talc Inorganic materials 0.000 description 3
- 235000012222 talc Nutrition 0.000 description 3
- FEYLUKDSKVSMSZ-UHFFFAOYSA-N tert-butyl n-(4-aminocyclohexyl)carbamate Chemical compound CC(C)(C)OC(=O)NC1CCC(N)CC1 FEYLUKDSKVSMSZ-UHFFFAOYSA-N 0.000 description 3
- 230000001225 therapeutic effect Effects 0.000 description 3
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 description 3
- VCPZIEOTCDIFEE-UHFFFAOYSA-N (4-aminopiperidin-1-yl)-[4-(4-hydroxyphenyl)isoquinolin-6-yl]methanone Chemical compound NC1CCN(CC1)C(=O)C=1C=C2C(=CN=CC2=CC=1)C1=CC=C(C=C1)O VCPZIEOTCDIFEE-UHFFFAOYSA-N 0.000 description 2
- UKGJZDSUJSPAJL-YPUOHESYSA-N (e)-n-[(1r)-1-[3,5-difluoro-4-(methanesulfonamido)phenyl]ethyl]-3-[2-propyl-6-(trifluoromethyl)pyridin-3-yl]prop-2-enamide Chemical compound CCCC1=NC(C(F)(F)F)=CC=C1\C=C\C(=O)N[C@H](C)C1=CC(F)=C(NS(C)(=O)=O)C(F)=C1 UKGJZDSUJSPAJL-YPUOHESYSA-N 0.000 description 2
- KZPYGQFFRCFCPP-UHFFFAOYSA-N 1,1'-bis(diphenylphosphino)ferrocene Chemical compound [Fe+2].C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1 KZPYGQFFRCFCPP-UHFFFAOYSA-N 0.000 description 2
- YPFDHNVEDLHUCE-UHFFFAOYSA-N 1,3-propanediol Substances OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 2
- SQHZTJPUWZFWNQ-UHFFFAOYSA-N 1-[(4-bromoisoquinolin-6-yl)methyl]-N,N-dimethylpiperidin-4-amine Chemical compound CN(C)C1CCN(CC2=CC=C3C=NC=C(Br)C3=C2)CC1 SQHZTJPUWZFWNQ-UHFFFAOYSA-N 0.000 description 2
- PTNYSGYPFSYHPO-UHFFFAOYSA-N 1-[(4-quinolin-2-ylisoquinolin-6-yl)methyl]piperidin-4-amine Chemical compound NC1CCN(CC2=CC=C3C=NC=C(C4=NC5=CC=CC=C5C=C4)C3=C2)CC1 PTNYSGYPFSYHPO-UHFFFAOYSA-N 0.000 description 2
- FGZRKGTZUWISOP-UHFFFAOYSA-N 1-[(7-chloro-4-phenylisoquinolin-6-yl)methyl]piperidin-4-amine Chemical compound NC1CCN(CC2=C(Cl)C=C3C=NC=C(C4=CC=CC=C4)C3=C2)CC1 FGZRKGTZUWISOP-UHFFFAOYSA-N 0.000 description 2
- PLBVEEHUXCWNFS-UHFFFAOYSA-N 1-[4-[6-[(4-aminopiperidin-1-yl)methyl]isoquinolin-4-yl]phenyl]-3-(4-chlorophenyl)urea Chemical compound NC1CCN(CC1)CC=1C=C2C(=CN=CC2=CC=1)C1=CC=C(C=C1)NC(=O)NC1=CC=C(C=C1)Cl PLBVEEHUXCWNFS-UHFFFAOYSA-N 0.000 description 2
- FTRWLLFGWSOTFA-UHFFFAOYSA-N 1-[4-[6-[(4-aminopiperidin-1-yl)methyl]isoquinolin-4-yl]phenyl]-3-phenylurea Chemical compound NC1CCN(CC2=CC=C3C=NC=C(C4=CC=C(NC(=O)NC5=CC=CC=C5)C=C4)C3=C2)CC1 FTRWLLFGWSOTFA-UHFFFAOYSA-N 0.000 description 2
- AZUYLZMQTIKGSC-UHFFFAOYSA-N 1-[6-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-5-methyl-3-(1-methylindazol-5-yl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one Chemical compound ClC=1C(=C2C=NNC2=CC=1C)C=1C(=NN(C=1C)C1CC2(CN(C2)C(C=C)=O)C1)C=1C=C2C=NN(C2=CC=1)C AZUYLZMQTIKGSC-UHFFFAOYSA-N 0.000 description 2
- KMBPHTQQFGNFCJ-UHFFFAOYSA-N 1-[[4-(1-benzofuran-2-yl)isoquinolin-6-yl]methyl]-N,N-dimethylpiperidin-4-amine Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)CN1CCC(CC1)N(C)C KMBPHTQQFGNFCJ-UHFFFAOYSA-N 0.000 description 2
- ZPPPZMCZCDFGOO-UHFFFAOYSA-N 1-[[4-(1-benzofuran-2-yl)isoquinolin-6-yl]methyl]indol-5-amine Chemical compound NC1=CC=C2N(CC3=CC=C4C=NC=C(C5=CC6=CC=CC=C6O5)C4=C3)C=CC2=C1 ZPPPZMCZCDFGOO-UHFFFAOYSA-N 0.000 description 2
- WZINRRWEZKPNGM-UHFFFAOYSA-N 1-[[4-(furan-2-yl)isoquinolin-6-yl]methyl]piperidin-4-amine Chemical compound O1C(=CC=C1)C1=CN=CC2=CC=C(C=C12)CN1CCC(CC1)N WZINRRWEZKPNGM-UHFFFAOYSA-N 0.000 description 2
- CZQIJQFTRGDODI-UHFFFAOYSA-N 1-bromo-4-isocyanatobenzene Chemical compound BrC1=CC=C(N=C=O)C=C1 CZQIJQFTRGDODI-UHFFFAOYSA-N 0.000 description 2
- XGLVDUUYFKXKPL-UHFFFAOYSA-N 2-(2-methoxyethoxy)-n,n-bis[2-(2-methoxyethoxy)ethyl]ethanamine Chemical compound COCCOCCN(CCOCCOC)CCOCCOC XGLVDUUYFKXKPL-UHFFFAOYSA-N 0.000 description 2
- AZZUNKUKVQWKFQ-UHFFFAOYSA-N 2-(3-aminocyclopentyl)isoindole-1,3-dione Chemical compound NC1CCC(C1)N1C(=O)C2=C(C=CC=C2)C1=O AZZUNKUKVQWKFQ-UHFFFAOYSA-N 0.000 description 2
- PIDMPPJXCBLLQN-UHFFFAOYSA-N 2-(3-azidocyclopentyl)isoindole-1,3-dione Chemical compound [N-]=[N+]=NC1CCC(C1)N1C(=O)C2=C(C=CC=C2)C1=O PIDMPPJXCBLLQN-UHFFFAOYSA-N 0.000 description 2
- IJCKQUWNYOBTKL-UHFFFAOYSA-N 2-(3-hydroxycyclopentyl)isoindole-1,3-dione Chemical compound C1C(O)CCC1N1C(=O)C2=CC=CC=C2C1=O IJCKQUWNYOBTKL-UHFFFAOYSA-N 0.000 description 2
- RTIZJQCGWLDNKT-UHFFFAOYSA-N 2-(3-oxocyclopentyl)isoindole-1,3-dione Chemical compound C1C(=O)CCC1N1C(=O)C2=CC=CC=C2C1=O RTIZJQCGWLDNKT-UHFFFAOYSA-N 0.000 description 2
- MFOMOILTSZMDMZ-UHFFFAOYSA-N 2-(aminomethyl)-N-[[4-(1-benzofuran-2-yl)isoquinolin-6-yl]methyl]aniline Chemical compound NCC1=C(NCC=2C=C3C(=CN=CC3=CC=2)C=2OC3=C(C=2)C=CC=C3)C=CC=C1 MFOMOILTSZMDMZ-UHFFFAOYSA-N 0.000 description 2
- GQISYBHQVDYXJO-UHFFFAOYSA-N 2-[3-[(4-bromoisoquinolin-6-yl)methylamino]cyclopentyl]isoindole-1,3-dione Chemical compound BrC1=CN=CC2=CC=C(CNC3CCC(C3)N3C(=O)C4=C(C=CC=C4)C3=O)C=C12 GQISYBHQVDYXJO-UHFFFAOYSA-N 0.000 description 2
- XLFYFSQWGPAWPI-UHFFFAOYSA-N 2-[3-[[4-(4-hydroxyphenyl)isoquinolin-6-yl]methylamino]cyclopentyl]isoindole-1,3-dione Chemical compound OC1=CC=C(C=C1)C1=CN=CC2=CC=C(CNC3CCC(C3)N3C(=O)C4=C(C=CC=C4)C3=O)C=C12 XLFYFSQWGPAWPI-UHFFFAOYSA-N 0.000 description 2
- AFOWNESPFGVDDO-UHFFFAOYSA-N 2-[4-(1-benzofuran-2-yl)isoquinolin-6-yl]oxy-N,N-dimethylethanamine Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)OCCN(C)C AFOWNESPFGVDDO-UHFFFAOYSA-N 0.000 description 2
- ZAAOUOISKXXING-UHFFFAOYSA-N 2-[4-(1-benzofuran-2-yl)isoquinolin-6-yl]oxyethanamine Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)OCCN ZAAOUOISKXXING-UHFFFAOYSA-N 0.000 description 2
- GNCLPNMQEGMNTG-UHFFFAOYSA-N 2-methylpyridin-4-amine Chemical compound CC1=CC(N)=CC=N1 GNCLPNMQEGMNTG-UHFFFAOYSA-N 0.000 description 2
- JVBMDNLMFTZWGD-UHFFFAOYSA-N 3-[[4-(1-benzofuran-2-yl)isoquinolin-6-yl]methoxy]propan-1-amine Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)COCCCN JVBMDNLMFTZWGD-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- RKJUIXBNRJVNHR-UHFFFAOYSA-N 3H-indole Chemical compound C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 2
- BJAFSAFEHZLMCB-UHFFFAOYSA-N 4,6-dibromo-2H-isoquinolin-1-one Chemical compound BrC1=CNC(C2=CC=C(C=C12)Br)=O BJAFSAFEHZLMCB-UHFFFAOYSA-N 0.000 description 2
- NKVNUKBQPOXTFR-UHFFFAOYSA-N 4-(1-benzofuran-2-yl)-6-(piperidin-1-ylmethyl)isoquinoline Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)CN1CCCCC1 NKVNUKBQPOXTFR-UHFFFAOYSA-N 0.000 description 2
- LGUBWXLHEVGLNQ-UHFFFAOYSA-N 4-(1-benzofuran-2-yl)-6-(pyridin-4-ylmethoxy)isoquinoline Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)OCC1=CC=NC=C1 LGUBWXLHEVGLNQ-UHFFFAOYSA-N 0.000 description 2
- XFRFYIDIBLUASD-UHFFFAOYSA-N 4-(1-benzofuran-2-yl)-6-(pyridin-4-ylmethylamino)-2H-isoquinolin-1-one Chemical compound O1C(=CC2=C1C=CC=C2)C1=CNC(C2=CC=C(C=C12)NCC1=CC=NC=C1)=O XFRFYIDIBLUASD-UHFFFAOYSA-N 0.000 description 2
- XMHLCHDPKCUNNH-UHFFFAOYSA-N 4-(1-benzofuran-2-yl)-6-(pyrrolo[2,3-c]pyridin-1-ylmethyl)isoquinoline Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)CN1C=CC=2C1=CN=CC=2 XMHLCHDPKCUNNH-UHFFFAOYSA-N 0.000 description 2
- ILNJKYJEWVVTIK-UHFFFAOYSA-N 4-(1-benzofuran-2-yl)-6-N-(pyridin-4-ylmethyl)isoquinoline-1,6-diamine Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=C(C2=CC=C(C=C12)NCC1=CC=NC=C1)N ILNJKYJEWVVTIK-UHFFFAOYSA-N 0.000 description 2
- ZIHQONNVTAAWLE-UHFFFAOYSA-N 4-(1-benzofuran-2-yl)-6-[(2-methylpyrazol-3-yl)oxymethyl]isoquinoline Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)COC=1N(N=CC=1)C ZIHQONNVTAAWLE-UHFFFAOYSA-N 0.000 description 2
- BHEQKFIOTDRSMY-UHFFFAOYSA-N 4-(1-benzofuran-2-yl)-6-[(pyridin-4-ylamino)methyl]isoquinolin-3-amine Chemical compound O1C(=CC2=C1C=CC=C2)C1=C(N=CC2=CC=C(C=C12)CNC1=CC=NC=C1)N BHEQKFIOTDRSMY-UHFFFAOYSA-N 0.000 description 2
- QLVXDQBJZLETJQ-UHFFFAOYSA-N 4-(1-benzofuran-2-yl)-6-[(quinolin-4-ylamino)methyl]isoquinolin-3-amine Chemical compound O1C(=CC2=C1C=CC=C2)C1=C(N=CC2=CC=C(C=C12)CNC1=CC=NC2=CC=CC=C12)N QLVXDQBJZLETJQ-UHFFFAOYSA-N 0.000 description 2
- KJOYHBRREYBHKO-UHFFFAOYSA-N 4-(1-benzofuran-2-yl)-6-[4-(2,5-dimethylpyrrol-1-yl)cyclohexyl]oxyisoquinoline Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)OC1CCC(CC1)N1C(=CC=C1C)C KJOYHBRREYBHKO-UHFFFAOYSA-N 0.000 description 2
- VDNPZAWAUGWRER-UHFFFAOYSA-N 4-(1-benzofuran-2-yl)-6-phenylmethoxyisoquinoline Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)OCC1=CC=CC=C1 VDNPZAWAUGWRER-UHFFFAOYSA-N 0.000 description 2
- PNZFYXIIEARCKA-UHFFFAOYSA-N 4-(1-benzofuran-2-yl)-6-piperidin-4-yloxyisoquinoline Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)OC1CCNCC1 PNZFYXIIEARCKA-UHFFFAOYSA-N 0.000 description 2
- YDVYUMQBAQHFLD-UHFFFAOYSA-N 4-(1-benzofuran-2-yl)-7-chloro-6-fluoroisoquinoline Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC(=C(C=C12)F)Cl YDVYUMQBAQHFLD-UHFFFAOYSA-N 0.000 description 2
- GVXZEOAJQXXDDE-UHFFFAOYSA-N 4-(1-benzofuran-2-yl)-8-chloro-6-fluoroisoquinoline Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=C(C=C(C=C12)F)Cl GVXZEOAJQXXDDE-UHFFFAOYSA-N 0.000 description 2
- WXCARQYHINEURG-UHFFFAOYSA-N 4-(1-benzofuran-2-yl)-N-(2-methylpyrazol-3-yl)isoquinolin-6-amine Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)NC=1N(N=CC=1)C WXCARQYHINEURG-UHFFFAOYSA-N 0.000 description 2
- PKFGICKTSHHDND-UHFFFAOYSA-N 4-(1-benzofuran-2-yl)-N-(pyridin-4-ylmethyl)isoquinolin-6-amine Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)NCC1=CC=NC=C1 PKFGICKTSHHDND-UHFFFAOYSA-N 0.000 description 2
- QRVUQZWSKCKMJS-UHFFFAOYSA-N 4-(1-benzofuran-2-yl)-N-pyridin-4-ylisoquinolin-6-amine Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)NC1=CC=NC=C1 QRVUQZWSKCKMJS-UHFFFAOYSA-N 0.000 description 2
- JNOQZCFZQYPCFX-UHFFFAOYSA-N 4-(2,5-dimethylpyrrol-1-yl)cyclohexane-1,1-diol Chemical compound CC=1N(C(=CC=1)C)C1CCC(CC1)(O)O JNOQZCFZQYPCFX-UHFFFAOYSA-N 0.000 description 2
- UDIUXGQYPTZDSM-UHFFFAOYSA-N 4-(4-phenylmethoxyphenyl)isoquinoline-6-carboxylic acid Chemical compound C(C1=CC=CC=C1)OC1=CC=C(C=C1)C1=CN=CC2=CC=C(C=C12)C(=O)O UDIUXGQYPTZDSM-UHFFFAOYSA-N 0.000 description 2
- PGHUOJUEAURNQC-UHFFFAOYSA-N 4-N-[4-(1-benzofuran-2-yl)-7-methoxyisoquinolin-6-yl]cyclohexane-1,4-diamine Chemical compound COC1=C(NC2CCC(N)CC2)C=C2C(C=NC=C2C2=CC3=CC=CC=C3O2)=C1 PGHUOJUEAURNQC-UHFFFAOYSA-N 0.000 description 2
- HZILKYLIFMZGGW-UHFFFAOYSA-N 4-N-[4-(1-benzofuran-2-yl)-8-chloroisoquinolin-6-yl]cyclohexane-1,4-diamine Chemical compound NC1CCC(CC1)NC1=CC(Cl)=C2C=NC=C(C3=CC4=CC=CC=C4O3)C2=C1 HZILKYLIFMZGGW-UHFFFAOYSA-N 0.000 description 2
- NXBAIKFVLAYEJB-UHFFFAOYSA-N 4-N-[4-(1-benzofuran-2-yl)isoquinolin-6-yl]benzene-1,4-diamine Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)NC1=CC=C(C=C1)N NXBAIKFVLAYEJB-UHFFFAOYSA-N 0.000 description 2
- VUNMUZIBSWKMJL-UHFFFAOYSA-N 4-N-[4-(1-benzofuran-2-yl)isoquinolin-6-yl]cyclohexane-1,4-diamine Chemical compound NC1CCC(CC1)NC1=CC=C2C=NC=C(C3=CC4=CC=CC=C4O3)C2=C1 VUNMUZIBSWKMJL-UHFFFAOYSA-N 0.000 description 2
- ZOMPKBNMLJYQIF-UHFFFAOYSA-N 4-N-[4-(1-benzofuran-2-yl)isoquinolin-6-yl]pyridine-2,4-diamine Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)NC1=CC(=NC=C1)N ZOMPKBNMLJYQIF-UHFFFAOYSA-N 0.000 description 2
- CZFSNSMAMXKDCA-UHFFFAOYSA-N 4-N-[[4-(1-benzofuran-2-yl)isoquinolin-6-yl]methyl]pyridine-3,4-diamine Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)CNC1=C(C=NC=C1)N CZFSNSMAMXKDCA-UHFFFAOYSA-N 0.000 description 2
- FYIYXLVIZNHFEB-UHFFFAOYSA-N 4-[4-(1-benzofuran-2-yl)isoquinolin-6-yl]oxycyclohexan-1-amine Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)OC1CCC(CC1)N FYIYXLVIZNHFEB-UHFFFAOYSA-N 0.000 description 2
- HNMTZMAOBIZRBE-UHFFFAOYSA-N 4-[6-(3-aminopropoxymethyl)isoquinolin-4-yl]phenol Chemical compound NCCCOCC=1C=C2C(=CN=CC2=CC=1)C1=CC=C(C=C1)O HNMTZMAOBIZRBE-UHFFFAOYSA-N 0.000 description 2
- KZPZKNRPPZKJPZ-UHFFFAOYSA-N 4-[6-[(4-aminobutylamino)methyl]isoquinolin-4-yl]phenol Chemical compound NCCCCNCC=1C=C2C(=CN=CC2=CC=1)C1=CC=C(C=C1)O KZPZKNRPPZKJPZ-UHFFFAOYSA-N 0.000 description 2
- ZRQWERDXQSOBGL-UHFFFAOYSA-N 4-[6-[(4-aminopiperidin-1-yl)methyl]isoquinolin-4-yl]benzoic acid Chemical compound NC1CCN(CC1)CC=1C=C2C(=CN=CC2=CC=1)C1=CC=C(C(=O)O)C=C1 ZRQWERDXQSOBGL-UHFFFAOYSA-N 0.000 description 2
- QHLNPFXFGZCOTR-UHFFFAOYSA-N 4-[6-[[(3-aminocyclopentyl)amino]methyl]isoquinolin-4-yl]phenol Chemical compound NC1CC(CC1)NCC=1C=C2C(=CN=CC2=CC=1)C1=CC=C(C=C1)O QHLNPFXFGZCOTR-UHFFFAOYSA-N 0.000 description 2
- JWONJVOQWSNWPS-UHFFFAOYSA-N 4-[6-[[3-(dimethylamino)propylamino]methyl]isoquinolin-4-yl]phenol Chemical compound CN(CCCNCC=1C=C2C(=CN=CC2=CC=1)C1=CC=C(C=C1)O)C JWONJVOQWSNWPS-UHFFFAOYSA-N 0.000 description 2
- FQYRLEXKXQRZDH-UHFFFAOYSA-N 4-aminoquinoline Chemical compound C1=CC=C2C(N)=CC=NC2=C1 FQYRLEXKXQRZDH-UHFFFAOYSA-N 0.000 description 2
- ZHKOIUWTFWRGCV-UHFFFAOYSA-N 4-bromo-6-(bromomethyl)-8-chloroisoquinoline Chemical compound BrC1=CN=CC2=C(C=C(C=C12)CBr)Cl ZHKOIUWTFWRGCV-UHFFFAOYSA-N 0.000 description 2
- PIKMURAVQBNNKH-UHFFFAOYSA-N 4-bromo-6-(pyrrolo[3,2-c]pyridin-1-ylmethyl)isoquinoline Chemical compound BrC1=CN=CC2=CC=C(C=C12)CN1C=CC=2C=NC=CC=21 PIKMURAVQBNNKH-UHFFFAOYSA-N 0.000 description 2
- HESCAPCNEZDOLP-UHFFFAOYSA-N 4-bromo-6-[(2-methylpyrazol-3-yl)oxymethyl]isoquinoline Chemical compound BrC1=CN=CC2=CC=C(C=C12)COC=1N(N=CC=1)C HESCAPCNEZDOLP-UHFFFAOYSA-N 0.000 description 2
- VQDJUAYRMCZPOY-UHFFFAOYSA-N 4-bromo-6-[(5-nitroindol-1-yl)methyl]isoquinoline Chemical compound BrC1=CN=CC2=CC=C(C=C12)CN1C=CC2=CC(=CC=C12)[N+](=O)[O-] VQDJUAYRMCZPOY-UHFFFAOYSA-N 0.000 description 2
- YETSBNVBLHJTGW-UHFFFAOYSA-N 4-bromo-6-[(quinolin-4-ylamino)methyl]isoquinolin-1-amine Chemical compound BrC1=CN=C(C2=CC=C(C=C12)CNC1=CC=NC2=CC=CC=C12)N YETSBNVBLHJTGW-UHFFFAOYSA-N 0.000 description 2
- JSZSYKFPVWUMLL-UHFFFAOYSA-N 4-bromo-6-[(quinolin-4-ylamino)methyl]isoquinolin-3-amine Chemical compound BrC1=C(N=CC2=CC=C(C=C12)CNC1=CC=NC2=CC=CC=C12)N JSZSYKFPVWUMLL-UHFFFAOYSA-N 0.000 description 2
- XEQBCCXHOOXUKT-UHFFFAOYSA-N 4-bromo-6-methyl-7-nitroisoquinoline Chemical compound BrC1=CN=CC2=CC(=C(C=C12)C)[N+](=O)[O-] XEQBCCXHOOXUKT-UHFFFAOYSA-N 0.000 description 2
- BBOMKUFXFZKOME-UHFFFAOYSA-N 4-bromo-6-methylisoquinolin-3-amine Chemical compound BrC1=C(N=CC2=CC=C(C=C12)C)N BBOMKUFXFZKOME-UHFFFAOYSA-N 0.000 description 2
- LFSNMZKTWDLKEC-UHFFFAOYSA-N 4-bromo-7-chloro-6-fluoroisoquinoline Chemical compound C1=NC=C2C=C(Cl)C(F)=CC2=C1Br LFSNMZKTWDLKEC-UHFFFAOYSA-N 0.000 description 2
- NZANTASDZLBERP-UHFFFAOYSA-N 4-bromo-8-chloro-6-fluoroisoquinoline Chemical compound BrC1=CN=CC2=C(C=C(C=C12)F)Cl NZANTASDZLBERP-UHFFFAOYSA-N 0.000 description 2
- SMLSAJLTEYEBGO-UHFFFAOYSA-N 4-bromoisoquinoline-6-carbaldehyde Chemical compound BrC1=CN=CC2=CC=C(C=C12)C=O SMLSAJLTEYEBGO-UHFFFAOYSA-N 0.000 description 2
- BSDGZUDFPKIYQG-UHFFFAOYSA-N 4-bromopyridine Chemical compound BrC1=CC=NC=C1 BSDGZUDFPKIYQG-UHFFFAOYSA-N 0.000 description 2
- NSHBJRKIKWQDNH-UHFFFAOYSA-N 5-N-[4-(1-benzofuran-2-yl)isoquinolin-6-yl]pyridine-2,5-diamine Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)NC=1C=CC(=NC=1)N NSHBJRKIKWQDNH-UHFFFAOYSA-N 0.000 description 2
- RWXLGOSZZQXLDZ-UHFFFAOYSA-N 6-(3-aminopropoxymethyl)-4-(1-benzofuran-2-yl)isoquinolin-1-amine Chemical compound NCCCOCC=1C=C2C(=CN=C(C2=CC=1)N)C=1OC2=C(C=1)C=CC=C2 RWXLGOSZZQXLDZ-UHFFFAOYSA-N 0.000 description 2
- GATHBXMYZIIMOA-UHFFFAOYSA-N 6-[(4-aminocyclohexyl)amino]-4-(1-benzofuran-2-yl)-2H-isoquinolin-1-one Chemical compound NC1CCC(CC1)NC=1C=C2C(=CNC(C2=CC=1)=O)C=1OC2=C(C=1)C=CC=C2 GATHBXMYZIIMOA-UHFFFAOYSA-N 0.000 description 2
- QJOXNPATRLQENU-UHFFFAOYSA-N 6-[(4-aminopiperidin-1-yl)methyl]-4-(1-benzofuran-2-yl)-8-chloroisoquinolin-1-amine Chemical compound NC1CCN(CC1)CC=1C=C2C(=CN=C(C2=C(C=1)Cl)N)C=1OC2=C(C=1)C=CC=C2 QJOXNPATRLQENU-UHFFFAOYSA-N 0.000 description 2
- WFPBOMBWWOSVPW-UHFFFAOYSA-N 6-[(4-aminopiperidin-1-yl)methyl]-4-(1-benzofuran-2-yl)-8-methoxyisoquinolin-1-amine Chemical compound NC1CCN(CC1)CC=1C=C2C(=CN=C(C2=C(C=1)OC)N)C=1OC2=C(C=1)C=CC=C2 WFPBOMBWWOSVPW-UHFFFAOYSA-N 0.000 description 2
- OLESJWXKOGKKNP-UHFFFAOYSA-N 6-[(4-aminopiperidin-1-yl)methyl]-4-(1-benzofuran-2-yl)isoquinolin-3-amine Chemical compound NC1CCN(CC1)CC=1C=C2C(=C(N=CC2=CC=1)N)C=1OC2=C(C=1)C=CC=C2 OLESJWXKOGKKNP-UHFFFAOYSA-N 0.000 description 2
- UBAIDAWSBCBCBU-UHFFFAOYSA-N 6-[(4-aminopiperidin-1-yl)methyl]-4-(1-benzofuran-2-yl)isoquinolin-7-amine Chemical compound NC1CCN(CC1)CC=1C=C2C(=CN=CC2=CC=1N)C=1OC2=C(C=1)C=CC=C2 UBAIDAWSBCBCBU-UHFFFAOYSA-N 0.000 description 2
- XJGJCKYCSAIFGM-UHFFFAOYSA-N 6-[(4-aminopiperidin-1-yl)methyl]-4-phenylisoquinolin-3-amine Chemical compound NC1CCN(CC1)CC=1C=C2C(=C(N=CC2=CC=1)N)C1=CC=CC=C1 XJGJCKYCSAIFGM-UHFFFAOYSA-N 0.000 description 2
- WTVJKKVTJSUHNN-UHFFFAOYSA-N 6-azido-4-(1-benzofuran-2-yl)isoquinoline Chemical compound N(=[N+]=[N-])C=1C=C2C(=CN=CC2=CC=1)C=1OC2=C(C=1)C=CC=C2 WTVJKKVTJSUHNN-UHFFFAOYSA-N 0.000 description 2
- ZDYXSEQHOVSTPA-UHFFFAOYSA-N 6-bromo-2h-isoquinolin-1-one Chemical compound C1=CNC(=O)C=2C1=CC(Br)=CC=2 ZDYXSEQHOVSTPA-UHFFFAOYSA-N 0.000 description 2
- AALOETOHAVZCIE-UHFFFAOYSA-N 6-bromo-4-chloro-2h-isoquinolin-1-one Chemical compound C1=C(Br)C=C2C(Cl)=CNC(=O)C2=C1 AALOETOHAVZCIE-UHFFFAOYSA-N 0.000 description 2
- UKSVTOGMUNNCFO-UHFFFAOYSA-N 6-fluoro-4-phenylisoquinoline Chemical compound FC=1C=C2C(=CN=CC2=CC=1)C1=CC=CC=C1 UKSVTOGMUNNCFO-UHFFFAOYSA-N 0.000 description 2
- HMPDTQYNATWNPO-UHFFFAOYSA-N 6-methyl-4-quinolin-2-ylisoquinoline Chemical compound CC=1C=C2C(=CN=CC2=CC=1)C1=NC2=CC=CC=C2C=C1 HMPDTQYNATWNPO-UHFFFAOYSA-N 0.000 description 2
- GUDGKPYGXVDTRR-UHFFFAOYSA-N 6-methyl-7-nitroisoquinoline Chemical compound CC=1C=C2C=CN=CC2=CC=1[N+](=O)[O-] GUDGKPYGXVDTRR-UHFFFAOYSA-N 0.000 description 2
- DBOBOPSSKJMSSY-UHFFFAOYSA-N 6-methylisoquinolin-3-amine Chemical compound C1=NC(N)=CC2=CC(C)=CC=C21 DBOBOPSSKJMSSY-UHFFFAOYSA-N 0.000 description 2
- BCZPUVXMWIBIRE-UHFFFAOYSA-N 7-chloro-6-fluoroisoquinoline Chemical compound C1=NC=C2C=C(Cl)C(F)=CC2=C1 BCZPUVXMWIBIRE-UHFFFAOYSA-N 0.000 description 2
- WGEXKUOPBCSTCB-UHFFFAOYSA-N 8-chloro-6-methylisoquinoline Chemical compound CC1=CC(Cl)=C2C=NC=CC2=C1 WGEXKUOPBCSTCB-UHFFFAOYSA-N 0.000 description 2
- ZRPZPNYZFSJUPA-UHFFFAOYSA-N ARS-1620 Chemical compound Oc1cccc(F)c1-c1c(Cl)cc2c(ncnc2c1F)N1CCN(CC1)C(=O)C=C ZRPZPNYZFSJUPA-UHFFFAOYSA-N 0.000 description 2
- 208000003200 Adenoma Diseases 0.000 description 2
- 208000037540 Alveolar soft tissue sarcoma Diseases 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- 208000005440 Basal Cell Neoplasms Diseases 0.000 description 2
- 206010004146 Basal cell carcinoma Diseases 0.000 description 2
- KHBQMWCZKVMBLN-UHFFFAOYSA-N Benzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1 KHBQMWCZKVMBLN-UHFFFAOYSA-N 0.000 description 2
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 2
- 208000006274 Brain Stem Neoplasms Diseases 0.000 description 2
- IILHQAYXANRUAA-IYARVYRRSA-N C1(=CC=CC=C1)C1=CN=CC2=CC=C(C=C12)N[C@@H]1CC[C@H](CC1)N Chemical compound C1(=CC=CC=C1)C1=CN=CC2=CC=C(C=C12)N[C@@H]1CC[C@H](CC1)N IILHQAYXANRUAA-IYARVYRRSA-N 0.000 description 2
- 102000014914 Carrier Proteins Human genes 0.000 description 2
- 201000005262 Chondroma Diseases 0.000 description 2
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 2
- OKKJLVBELUTLKV-MZCSYVLQSA-N Deuterated methanol Chemical compound [2H]OC([2H])([2H])[2H] OKKJLVBELUTLKV-MZCSYVLQSA-N 0.000 description 2
- 229920002307 Dextran Polymers 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 108010007457 Extracellular Signal-Regulated MAP Kinases Proteins 0.000 description 2
- 208000007569 Giant Cell Tumors Diseases 0.000 description 2
- 206010018338 Glioma Diseases 0.000 description 2
- 201000005618 Glomus Tumor Diseases 0.000 description 2
- 208000005234 Granulosa Cell Tumor Diseases 0.000 description 2
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 2
- 206010024612 Lipoma Diseases 0.000 description 2
- 206010025219 Lymphangioma Diseases 0.000 description 2
- 102100037611 Lysophospholipase Human genes 0.000 description 2
- 108020002496 Lysophospholipase Proteins 0.000 description 2
- 108091054455 MAP kinase family Proteins 0.000 description 2
- 102100033610 MAP kinase-interacting serine/threonine-protein kinase 2 Human genes 0.000 description 2
- 229930195725 Mannitol Natural products 0.000 description 2
- 206010027406 Mesothelioma Diseases 0.000 description 2
- 102100024193 Mitogen-activated protein kinase 1 Human genes 0.000 description 2
- 102100023482 Mitogen-activated protein kinase 14 Human genes 0.000 description 2
- SOAFWHNQOBFUBW-UHFFFAOYSA-N N'-[4-(1-benzofuran-2-yl)isoquinolin-6-yl]ethane-1,2-diamine Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)NCCN SOAFWHNQOBFUBW-UHFFFAOYSA-N 0.000 description 2
- LSZBDMGMUHYCPF-UHFFFAOYSA-N N-(2-azidopyridin-4-yl)-4-(1-benzofuran-2-yl)isoquinolin-6-amine Chemical compound N(=[N+]=[N-])C1=NC=CC(=C1)NC=1C=C2C(=CN=CC2=CC=1)C=1OC2=C(C=1)C=CC=C2 LSZBDMGMUHYCPF-UHFFFAOYSA-N 0.000 description 2
- GRMKMTWGCKMRLT-UHFFFAOYSA-N N-[(2-chloro-4-methylphenyl)methyl]-2,2-dimethoxyethanamine Chemical compound ClC1=C(C=CC(=C1)C)CNCC(OC)OC GRMKMTWGCKMRLT-UHFFFAOYSA-N 0.000 description 2
- ALQFZSYBDZMXKY-UHFFFAOYSA-N N-[(4-bromoisoquinolin-6-yl)methyl]-3-nitropyridin-4-amine Chemical compound BrC1=CN=CC2=CC=C(C=C12)CNC1=C(C=NC=C1)[N+](=O)[O-] ALQFZSYBDZMXKY-UHFFFAOYSA-N 0.000 description 2
- CVOZBZAAVFUYJQ-UHFFFAOYSA-N N-[(4-bromoisoquinolin-6-yl)methyl]-N-(3-nitropyridin-4-yl)acetamide Chemical compound BrC1=CN=CC2=CC=C(C=C12)CN(C(C)=O)C1=C(C=NC=C1)[N+](=O)[O-] CVOZBZAAVFUYJQ-UHFFFAOYSA-N 0.000 description 2
- CUYSTFNZIBPDFX-UHFFFAOYSA-N N-[4-(1-benzofuran-2-yl)isoquinolin-6-yl]-N',N'-dimethylethane-1,2-diamine Chemical compound CN(C)CCNC1=CC=C2C=NC=C(C3=CC4=CC=CC=C4O3)C2=C1 CUYSTFNZIBPDFX-UHFFFAOYSA-N 0.000 description 2
- YEPZUDWPCKEWFM-UHFFFAOYSA-N N-[4-[6-[(4-aminopiperidin-1-yl)methyl]isoquinolin-4-yl]phenyl]acetamide Chemical compound NC1CCN(CC1)CC=1C=C2C(=CN=CC2=CC=1)C1=CC=C(C=C1)NC(C)=O YEPZUDWPCKEWFM-UHFFFAOYSA-N 0.000 description 2
- ZYPDZFXTFLBJCB-UHFFFAOYSA-N N-[[4-(1-benzofuran-2-yl)isoquinolin-6-yl]methyl]pyridin-3-amine Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)CNC=1C=NC=CC=1 ZYPDZFXTFLBJCB-UHFFFAOYSA-N 0.000 description 2
- CEWHVPGBFSICRT-RUCARUNLSA-N N[C@@H]1CC[C@H](CC1)CNC=1C=C2C(=CN=CC2=CC=1)C=1OC2=C(C=1)C=CC=C2 Chemical compound N[C@@H]1CC[C@H](CC1)CNC=1C=C2C(=CN=CC2=CC=1)C=1OC2=C(C=1)C=CC=C2 CEWHVPGBFSICRT-RUCARUNLSA-N 0.000 description 2
- WFCMKOWKGNEHBZ-WGSAOQKQSA-N N[C@@H]1CC[C@H](CC1)NC(=O)C=1C=C2C(=CN=CC2=CC=1)C=1OC2=C(C=1)C=CC=C2 Chemical compound N[C@@H]1CC[C@H](CC1)NC(=O)C=1C=C2C(=CN=CC2=CC=1)C=1OC2=C(C=1)C=CC=C2 WFCMKOWKGNEHBZ-WGSAOQKQSA-N 0.000 description 2
- VUNMUZIBSWKMJL-IYARVYRRSA-N O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)N[C@@H]1CC[C@H](CC1)N Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)N[C@@H]1CC[C@H](CC1)N VUNMUZIBSWKMJL-IYARVYRRSA-N 0.000 description 2
- IDRGFNPZDVBSSE-UHFFFAOYSA-N OCCN1CCN(CC1)c1ccc(Nc2ncc3cccc(-c4cccc(NC(=O)C=C)c4)c3n2)c(F)c1F Chemical compound OCCN1CCN(CC1)c1ccc(Nc2ncc3cccc(-c4cccc(NC(=O)C=C)c4)c3n2)c(F)c1F IDRGFNPZDVBSSE-UHFFFAOYSA-N 0.000 description 2
- 102000043276 Oncogene Human genes 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- 208000034541 Rare lymphatic malformation Diseases 0.000 description 2
- 206010039491 Sarcoma Diseases 0.000 description 2
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 2
- 206010068771 Soft tissue neoplasm Diseases 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 241000009298 Trigla lyra Species 0.000 description 2
- ALOHCOOPYLLDTG-UHFFFAOYSA-N [4-(1-benzofuran-2-yl)-8-methoxyisoquinolin-6-yl]methanol Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=C(C=C(C=C12)CO)OC ALOHCOOPYLLDTG-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-WFGJKAKNSA-N acetone d6 Chemical compound [2H]C([2H])([2H])C(=O)C([2H])([2H])[2H] CSCPPACGZOOCGX-WFGJKAKNSA-N 0.000 description 2
- DZBUGLKDJFMEHC-UHFFFAOYSA-N acridine Chemical compound C1=CC=CC2=CC3=CC=CC=C3N=C21 DZBUGLKDJFMEHC-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 108091008324 binding proteins Proteins 0.000 description 2
- 125000001246 bromo group Chemical group Br* 0.000 description 2
- 125000005997 bromomethyl group Chemical group 0.000 description 2
- 125000006630 butoxycarbonylamino group Chemical group 0.000 description 2
- JDWFIHOKPNSLHO-UHFFFAOYSA-N butyl n-piperidin-4-ylcarbamate Chemical group CCCCOC(=O)NC1CCNCC1 JDWFIHOKPNSLHO-UHFFFAOYSA-N 0.000 description 2
- 239000001506 calcium phosphate Substances 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 125000002837 carbocyclic group Chemical group 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 2
- JCWIWBWXCVGEAN-UHFFFAOYSA-L cyclopentyl(diphenyl)phosphane;dichloropalladium;iron Chemical compound [Fe].Cl[Pd]Cl.[CH]1[CH][CH][CH][C]1P(C=1C=CC=CC=1)C1=CC=CC=C1.[CH]1[CH][CH][CH][C]1P(C=1C=CC=CC=1)C1=CC=CC=C1 JCWIWBWXCVGEAN-UHFFFAOYSA-L 0.000 description 2
- 208000012106 cystic neoplasm Diseases 0.000 description 2
- GHVNFZFCNZKVNT-UHFFFAOYSA-N decanoic acid Chemical compound CCCCCCCCCC(O)=O GHVNFZFCNZKVNT-UHFFFAOYSA-N 0.000 description 2
- 239000002274 desiccant Substances 0.000 description 2
- WBKFWQBXFREOFH-UHFFFAOYSA-N dichloromethane;ethyl acetate Chemical compound ClCCl.CCOC(C)=O WBKFWQBXFREOFH-UHFFFAOYSA-N 0.000 description 2
- 150000002009 diols Chemical class 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 238000000105 evaporative light scattering detection Methods 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 description 2
- 125000000524 functional group Chemical group 0.000 description 2
- PZJSZBJLOWMDRG-UHFFFAOYSA-N furan-2-ylboronic acid Chemical compound OB(O)C1=CC=CO1 PZJSZBJLOWMDRG-UHFFFAOYSA-N 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 235000011187 glycerol Nutrition 0.000 description 2
- 229940093915 gynecological organic acid Drugs 0.000 description 2
- 239000007902 hard capsule Substances 0.000 description 2
- 201000011066 hemangioma Diseases 0.000 description 2
- 125000002632 imidazolidinyl group Chemical group 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- NNPPMTNAJDCUHE-UHFFFAOYSA-N isobutane Chemical compound CC(C)C NNPPMTNAJDCUHE-UHFFFAOYSA-N 0.000 description 2
- 125000001786 isothiazolyl group Chemical group 0.000 description 2
- 208000032839 leukemia Diseases 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 239000000594 mannitol Substances 0.000 description 2
- 235000010355 mannitol Nutrition 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 231100000682 maximum tolerated dose Toxicity 0.000 description 2
- 201000001441 melanoma Diseases 0.000 description 2
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 2
- SXGURHSLXPDJBC-UHFFFAOYSA-N n-(5-aminopyridin-2-yl)acetamide Chemical compound CC(=O)NC1=CC=C(N)C=N1 SXGURHSLXPDJBC-UHFFFAOYSA-N 0.000 description 2
- PWBBAFHDYQMQRY-UHFFFAOYSA-N n-[(2-chloro-4-fluorophenyl)methyl]-2,2-dimethoxyethanamine Chemical compound COC(OC)CNCC1=CC=C(F)C=C1Cl PWBBAFHDYQMQRY-UHFFFAOYSA-N 0.000 description 2
- CMNWRGRDHIALBO-UHFFFAOYSA-N n-[(3-chloro-4-fluorophenyl)methyl]-2,2-dimethoxyethanamine Chemical compound COC(OC)CNCC1=CC=C(F)C(Cl)=C1 CMNWRGRDHIALBO-UHFFFAOYSA-N 0.000 description 2
- 230000009826 neoplastic cell growth Effects 0.000 description 2
- 125000006574 non-aromatic ring group Chemical group 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 239000003791 organic solvent mixture Substances 0.000 description 2
- 150000002923 oximes Chemical class 0.000 description 2
- 108010068338 p38 Mitogen-Activated Protein Kinases Proteins 0.000 description 2
- 208000007312 paraganglioma Diseases 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- 235000010482 polyoxyethylene sorbitan monooleate Nutrition 0.000 description 2
- 229920000053 polysorbate 80 Polymers 0.000 description 2
- 150000004032 porphyrins Chemical class 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- CUQOHAYJWVTKDE-UHFFFAOYSA-N potassium;butan-1-olate Chemical compound [K+].CCCC[O-] CUQOHAYJWVTKDE-UHFFFAOYSA-N 0.000 description 2
- 239000003755 preservative agent Substances 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 230000000069 prophylactic effect Effects 0.000 description 2
- 150000003222 pyridines Chemical class 0.000 description 2
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 2
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- 150000003335 secondary amines Chemical class 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- APSBXTVYXVQYAB-UHFFFAOYSA-M sodium docusate Chemical compound [Na+].CCCCC(CC)COC(=O)CC(S([O-])(=O)=O)C(=O)OCC(CC)CCCC APSBXTVYXVQYAB-UHFFFAOYSA-M 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 239000007901 soft capsule Substances 0.000 description 2
- 208000017572 squamous cell neoplasm Diseases 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000000346 sugar Nutrition 0.000 description 2
- 239000000829 suppository Substances 0.000 description 2
- 239000002511 suppository base Substances 0.000 description 2
- 201000008753 synovium neoplasm Diseases 0.000 description 2
- ZTMJHPULXULBFM-UHFFFAOYSA-N tert-butyl 4-(benzylamino)-3,3-difluoropiperidine-1-carboxylate Chemical compound FC1(F)CN(C(=O)OC(C)(C)C)CCC1NCC1=CC=CC=C1 ZTMJHPULXULBFM-UHFFFAOYSA-N 0.000 description 2
- PWQLFIKTGRINFF-UHFFFAOYSA-N tert-butyl 4-hydroxypiperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(O)CC1 PWQLFIKTGRINFF-UHFFFAOYSA-N 0.000 description 2
- MWNVEHCFXOTYCR-UHFFFAOYSA-N tert-butyl N-[(4-bromoisoquinolin-6-yl)methyl]-N-[3-(dimethylamino)propyl]carbamate Chemical compound BrC1=CN=CC2=CC=C(C=C12)CN(C(OC(C)(C)C)=O)CCCN(C)C MWNVEHCFXOTYCR-UHFFFAOYSA-N 0.000 description 2
- GBLYZUPELQZGDF-UHFFFAOYSA-N tert-butyl N-[(4-bromoisoquinolin-6-yl)methyl]-N-pyridin-3-ylcarbamate Chemical compound BrC1=CN=CC2=CC=C(C=C12)CN(C(OC(C)(C)C)=O)C=1C=NC=CC=1 GBLYZUPELQZGDF-UHFFFAOYSA-N 0.000 description 2
- DZUWDJMYEYJSLY-UHFFFAOYSA-N tert-butyl N-[1-[(4-bromo-8-chloroisoquinolin-6-yl)methyl]piperidin-4-yl]carbamate Chemical compound CC(C)(C)OC(=O)NC1CCN(CC2=CC(Cl)=C3C=NC=C(Br)C3=C2)CC1 DZUWDJMYEYJSLY-UHFFFAOYSA-N 0.000 description 2
- ISDXQJVMIAIKIP-UHFFFAOYSA-N tert-butyl N-[3-[(4-bromoisoquinolin-6-yl)methoxy]propyl]carbamate Chemical compound BrC1=CN=CC2=CC=C(C=C12)COCCCNC(OC(C)(C)C)=O ISDXQJVMIAIKIP-UHFFFAOYSA-N 0.000 description 2
- KIHSOUODPYPPPT-UHFFFAOYSA-N tert-butyl N-[4-(1-benzofuran-2-yl)isoquinolin-6-yl]carbamate Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)NC(OC(C)(C)C)=O KIHSOUODPYPPPT-UHFFFAOYSA-N 0.000 description 2
- YODIFNHMKWVQGA-UHFFFAOYSA-N tert-butyl N-[4-[(4-bromoisoquinolin-6-yl)methylamino]butyl]carbamate Chemical compound BrC1=CN=CC2=CC=C(C=C12)CNCCCCNC(OC(C)(C)C)=O YODIFNHMKWVQGA-UHFFFAOYSA-N 0.000 description 2
- KVOLKUAJALWPKJ-UHFFFAOYSA-N tert-butyl N-[4-[[4-(1-benzofuran-2-yl)-7-methoxyisoquinolin-6-yl]amino]cyclohexyl]carbamate Chemical compound COC1=C(NC2CCC(CC2)NC(=O)OC(C)(C)C)C=C2C(C=NC=C2C2=CC3=CC=CC=C3O2)=C1 KVOLKUAJALWPKJ-UHFFFAOYSA-N 0.000 description 2
- XDJCYKMWJCYQJM-UHFFFAOYSA-N tert-butyl n-(3-hydroxypropyl)carbamate Chemical compound CC(C)(C)OC(=O)NCCCO XDJCYKMWJCYQJM-UHFFFAOYSA-N 0.000 description 2
- ZFQWJXFJJZUVPI-UHFFFAOYSA-N tert-butyl n-(4-aminobutyl)carbamate Chemical compound CC(C)(C)OC(=O)NCCCCN ZFQWJXFJJZUVPI-UHFFFAOYSA-N 0.000 description 2
- WKHGDPZRLXDVMJ-UHFFFAOYSA-N tert-butyl n-pyridin-3-ylcarbamate Chemical compound CC(C)(C)OC(=O)NC1=CC=CN=C1 WKHGDPZRLXDVMJ-UHFFFAOYSA-N 0.000 description 2
- 150000003512 tertiary amines Chemical group 0.000 description 2
- 125000000335 thiazolyl group Chemical group 0.000 description 2
- 206010044412 transitional cell carcinoma Diseases 0.000 description 2
- 208000010556 transitional cell papilloma Diseases 0.000 description 2
- 201000004420 transitional papilloma Diseases 0.000 description 2
- 238000013519 translation Methods 0.000 description 2
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical class [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 2
- WLPUWLXVBWGYMZ-UHFFFAOYSA-N tricyclohexylphosphine Chemical compound C1CCCCC1P(C1CCCCC1)C1CCCCC1 WLPUWLXVBWGYMZ-UHFFFAOYSA-N 0.000 description 2
- WJKHJLXJJJATHN-UHFFFAOYSA-N triflic anhydride Chemical compound FC(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)F WJKHJLXJJJATHN-UHFFFAOYSA-N 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- UCPYLLCMEDAXFR-UHFFFAOYSA-N triphosgene Chemical compound ClC(Cl)(Cl)OC(=O)OC(Cl)(Cl)Cl UCPYLLCMEDAXFR-UHFFFAOYSA-N 0.000 description 2
- 208000029387 trophoblastic neoplasm Diseases 0.000 description 2
- 235000015112 vegetable and seed oil Nutrition 0.000 description 2
- 239000008158 vegetable oil Substances 0.000 description 2
- DNIAPMSPPWPWGF-VKHMYHEASA-N (+)-propylene glycol Chemical compound C[C@H](O)CO DNIAPMSPPWPWGF-VKHMYHEASA-N 0.000 description 1
- VCGRFBXVSFAGGA-UHFFFAOYSA-N (1,1-dioxo-1,4-thiazinan-4-yl)-[6-[[3-(4-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methoxy]pyridin-3-yl]methanone Chemical compound CC=1ON=C(C=2C=CC(F)=CC=2)C=1COC(N=C1)=CC=C1C(=O)N1CCS(=O)(=O)CC1 VCGRFBXVSFAGGA-UHFFFAOYSA-N 0.000 description 1
- LERREUOVCXYKGR-UHFFFAOYSA-N (2-phenoxyphenyl)-phenylmethanone Chemical compound C=1C=CC=C(OC=2C=CC=CC=2)C=1C(=O)C1=CC=CC=C1 LERREUOVCXYKGR-UHFFFAOYSA-N 0.000 description 1
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- MAYZWDRUFKUGGP-VIFPVBQESA-N (3s)-1-[5-tert-butyl-3-[(1-methyltetrazol-5-yl)methyl]triazolo[4,5-d]pyrimidin-7-yl]pyrrolidin-3-ol Chemical compound CN1N=NN=C1CN1C2=NC(C(C)(C)C)=NC(N3C[C@@H](O)CC3)=C2N=N1 MAYZWDRUFKUGGP-VIFPVBQESA-N 0.000 description 1
- CAYQIZIAYYNFCS-UHFFFAOYSA-N (4-chlorophenyl)boronic acid Chemical compound OB(O)C1=CC=C(Cl)C=C1 CAYQIZIAYYNFCS-UHFFFAOYSA-N 0.000 description 1
- AVGQTJUPLKNPQP-UHFFFAOYSA-N 1,1,1-trichloropropane Chemical compound CCC(Cl)(Cl)Cl AVGQTJUPLKNPQP-UHFFFAOYSA-N 0.000 description 1
- DIIIISSCIXVANO-UHFFFAOYSA-N 1,2-Dimethylhydrazine Chemical class CNNC DIIIISSCIXVANO-UHFFFAOYSA-N 0.000 description 1
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 1
- CWTGISFTGLOJOL-UHFFFAOYSA-N 1-(4-bromophenyl)-3-phenylurea Chemical compound C1=CC(Br)=CC=C1NC(=O)NC1=CC=CC=C1 CWTGISFTGLOJOL-UHFFFAOYSA-N 0.000 description 1
- ARRFWNSHJMDDKA-UHFFFAOYSA-N 1-[4-[1-amino-6-(3-aminopropoxymethyl)isoquinolin-4-yl]phenyl]-3-phenylurea Chemical compound NCCCOCC1=CC=C2C(N)=NC=C(C3=CC=C(NC(=O)NC4=CC=CC=C4)C=C3)C2=C1 ARRFWNSHJMDDKA-UHFFFAOYSA-N 0.000 description 1
- ACTOZDCSVJKKQM-UHFFFAOYSA-N 1-[4-[6-(3-aminopropoxymethyl)isoquinolin-4-yl]phenyl]-3-phenylurea Chemical compound NCCCOCC1=CC=C2C=NC=C(C3=CC=C(NC(=O)NC4=CC=CC=C4)C=C3)C2=C1 ACTOZDCSVJKKQM-UHFFFAOYSA-N 0.000 description 1
- CJGMENWQHJMUED-UHFFFAOYSA-N 1-[[4-(1,3-benzothiazol-2-yl)isoquinolin-6-yl]methyl]piperidin-4-amine Chemical compound NC1CCN(CC2=CC=C3C=NC=C(C4=NC5=CC=CC=C5S4)C3=C2)CC1 CJGMENWQHJMUED-UHFFFAOYSA-N 0.000 description 1
- YZSXSQWYZGONKN-UHFFFAOYSA-N 1-[[4-(5-methylfuran-2-yl)isoquinolin-6-yl]methyl]piperidin-4-amine Chemical compound CC1=CC=C(O1)C1=CN=CC2=CC=C(C=C12)CN1CCC(CC1)N YZSXSQWYZGONKN-UHFFFAOYSA-N 0.000 description 1
- VBKBNFQWNBALDD-UHFFFAOYSA-N 1-chloro-6-methylisoquinoline Chemical compound ClC1=NC=CC2=CC(C)=CC=C21 VBKBNFQWNBALDD-UHFFFAOYSA-N 0.000 description 1
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- XOYGQDQOGPRQOV-UHFFFAOYSA-N 1-methyl-7-nitroisoquinoline Chemical compound C1=C([N+]([O-])=O)C=C2C(C)=NC=CC2=C1 XOYGQDQOGPRQOV-UHFFFAOYSA-N 0.000 description 1
- HVOAMIOKNARIMR-UHFFFAOYSA-N 1-pyridin-4-ylethanol Chemical compound CC(O)C1=CC=NC=C1 HVOAMIOKNARIMR-UHFFFAOYSA-N 0.000 description 1
- XLKDJOPOOHHZAN-UHFFFAOYSA-N 1h-pyrrolo[2,3-c]pyridine Chemical compound C1=NC=C2NC=CC2=C1 XLKDJOPOOHHZAN-UHFFFAOYSA-N 0.000 description 1
- IANXAXNUNBAWBA-UHFFFAOYSA-N 2,2,3-trimethylundecane Chemical compound CCCCCCCCC(C)C(C)(C)C IANXAXNUNBAWBA-UHFFFAOYSA-N 0.000 description 1
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 1
- RXWOHFUULDINMC-UHFFFAOYSA-N 2-(3-nitrothiophen-2-yl)acetic acid Chemical compound OC(=O)CC=1SC=CC=1[N+]([O-])=O RXWOHFUULDINMC-UHFFFAOYSA-N 0.000 description 1
- OQSYHAAVQAWZDK-UHFFFAOYSA-N 2-[3-[(4-bromoisoquinolin-6-yl)methoxy]propyl]isoindole-1,3-dione Chemical compound BrC1=CN=CC2=CC=C(C=C12)COCCCN1C(C2=CC=CC=C2C1=O)=O OQSYHAAVQAWZDK-UHFFFAOYSA-N 0.000 description 1
- YAMMKKPDFJQLOS-UHFFFAOYSA-N 2-[3-[[4-(1-benzofuran-2-yl)isoquinolin-6-yl]methoxy]propyl]isoindole-1,3-dione Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)COCCCN1C(C2=CC=CC=C2C1=O)=O YAMMKKPDFJQLOS-UHFFFAOYSA-N 0.000 description 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 1
- IVJPXLGEHJMLGG-UHFFFAOYSA-N 2-azido-N-[(4-bromoisoquinolin-6-yl)methyl]pyridin-4-amine Chemical compound N(=[N+]=[N-])C1=NC=CC(=C1)NCC=1C=C2C(=CN=CC2=CC=1)Br IVJPXLGEHJMLGG-UHFFFAOYSA-N 0.000 description 1
- QKJAZPHKNWSXDF-UHFFFAOYSA-N 2-bromoquinoline Chemical compound C1=CC=CC2=NC(Br)=CC=C21 QKJAZPHKNWSXDF-UHFFFAOYSA-N 0.000 description 1
- KMQWNQKESAHDKD-UHFFFAOYSA-N 2-chloro-4-fluorobenzaldehyde Chemical compound FC1=CC=C(C=O)C(Cl)=C1 KMQWNQKESAHDKD-UHFFFAOYSA-N 0.000 description 1
- OSPMNRDGMUPWNO-UHFFFAOYSA-N 2-chloro-4-methylbenzaldehyde Chemical compound CC1=CC=C(C=O)C(Cl)=C1 OSPMNRDGMUPWNO-UHFFFAOYSA-N 0.000 description 1
- 125000003006 2-dimethylaminoethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- LWOGZUMNXQXBFE-UHFFFAOYSA-N 2-isoquinolin-4-ylquinoline Chemical compound N1=C(C=CC2=CC=CC=C12)C1=CN=CC2=CC=CC=C12 LWOGZUMNXQXBFE-UHFFFAOYSA-N 0.000 description 1
- JMARSTSWTFXHMC-UHFFFAOYSA-N 2-methyl-1h-pyrazol-3-one Chemical compound CN1NC=CC1=O JMARSTSWTFXHMC-UHFFFAOYSA-N 0.000 description 1
- UADBLNUFIZQDOR-UHFFFAOYSA-N 2-methylpyrazol-3-ol Chemical compound CN1N=C[C]=C1O UADBLNUFIZQDOR-UHFFFAOYSA-N 0.000 description 1
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 1
- HPDNGBIRSIWOST-UHFFFAOYSA-N 2-pyridin-2-ylphenol Chemical compound OC1=CC=CC=C1C1=CC=CC=N1 HPDNGBIRSIWOST-UHFFFAOYSA-N 0.000 description 1
- RSEBUVRVKCANEP-UHFFFAOYSA-N 2-pyrroline Chemical group C1CC=CN1 RSEBUVRVKCANEP-UHFFFAOYSA-N 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- VHMICKWLTGFITH-UHFFFAOYSA-N 2H-isoindole Chemical compound C1=CC=CC2=CNC=C21 VHMICKWLTGFITH-UHFFFAOYSA-N 0.000 description 1
- SHXWCVYOXRDMCX-UHFFFAOYSA-N 3,4-methylenedioxymethamphetamine Chemical compound CNC(C)CC1=CC=C2OCOC2=C1 SHXWCVYOXRDMCX-UHFFFAOYSA-N 0.000 description 1
- LJGHYPLBDBRCRZ-UHFFFAOYSA-N 3-(3-aminophenyl)sulfonylaniline Chemical compound NC1=CC=CC(S(=O)(=O)C=2C=C(N)C=CC=2)=C1 LJGHYPLBDBRCRZ-UHFFFAOYSA-N 0.000 description 1
- BYHQTRFJOGIQAO-GOSISDBHSA-N 3-(4-bromophenyl)-8-[(2R)-2-hydroxypropyl]-1-[(3-methoxyphenyl)methyl]-1,3,8-triazaspiro[4.5]decan-2-one Chemical compound C[C@H](CN1CCC2(CC1)CN(C(=O)N2CC3=CC(=CC=C3)OC)C4=CC=C(C=C4)Br)O BYHQTRFJOGIQAO-GOSISDBHSA-N 0.000 description 1
- DLDPHVTYHJSYCU-UHFFFAOYSA-N 3-[(4-bromoisoquinolin-6-yl)methoxy]propan-1-ol Chemical compound BrC1=CN=CC2=CC=C(C=C12)COCCCO DLDPHVTYHJSYCU-UHFFFAOYSA-N 0.000 description 1
- WNEODWDFDXWOLU-QHCPKHFHSA-N 3-[3-(hydroxymethyl)-4-[1-methyl-5-[[5-[(2s)-2-methyl-4-(oxetan-3-yl)piperazin-1-yl]pyridin-2-yl]amino]-6-oxopyridin-3-yl]pyridin-2-yl]-7,7-dimethyl-1,2,6,8-tetrahydrocyclopenta[3,4]pyrrolo[3,5-b]pyrazin-4-one Chemical compound C([C@@H](N(CC1)C=2C=NC(NC=3C(N(C)C=C(C=3)C=3C(=C(N4C(C5=CC=6CC(C)(C)CC=6N5CC4)=O)N=CC=3)CO)=O)=CC=2)C)N1C1COC1 WNEODWDFDXWOLU-QHCPKHFHSA-N 0.000 description 1
- SRVXSISGYBMIHR-UHFFFAOYSA-N 3-[3-[3-(2-amino-2-oxoethyl)phenyl]-5-chlorophenyl]-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid Chemical compound S1C(C)=CN=C1C(CC(O)=O)C1=CC(Cl)=CC(C=2C=C(CC(N)=O)C=CC=2)=C1 SRVXSISGYBMIHR-UHFFFAOYSA-N 0.000 description 1
- GVORVQPNNSASDM-UHFFFAOYSA-N 3-chloro-4-fluorobenzaldehyde Chemical compound FC1=CC=C(C=O)C=C1Cl GVORVQPNNSASDM-UHFFFAOYSA-N 0.000 description 1
- OJFQNFVCICBYQC-UHFFFAOYSA-N 3-chloro-4-methylbenzaldehyde Chemical compound CC1=CC=C(C=O)C=C1Cl OJFQNFVCICBYQC-UHFFFAOYSA-N 0.000 description 1
- SRWILAKSARHZPR-UHFFFAOYSA-N 3-chlorobenzaldehyde Chemical compound ClC1=CC=CC(C=O)=C1 SRWILAKSARHZPR-UHFFFAOYSA-N 0.000 description 1
- JVQIKJMSUIMUDI-UHFFFAOYSA-N 3-pyrroline Chemical group C1NCC=C1 JVQIKJMSUIMUDI-UHFFFAOYSA-N 0.000 description 1
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- FNPZFZKLYGWKLH-UHFFFAOYSA-N 4,4,5,5-tetramethyl-2-(5-methylfuran-2-yl)-1,3,2-dioxaborolane Chemical compound O1C(C)=CC=C1B1OC(C)(C)C(C)(C)O1 FNPZFZKLYGWKLH-UHFFFAOYSA-N 0.000 description 1
- GWLPYUDGZGFEDU-UHFFFAOYSA-N 4-(1-benzofuran-2-yl)-6-(pyrrolo[3,2-c]pyridin-1-ylmethyl)isoquinoline Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)CN1C=CC=2C=NC=CC=21 GWLPYUDGZGFEDU-UHFFFAOYSA-N 0.000 description 1
- PPXGWMZEBXCPES-UHFFFAOYSA-N 4-(1-benzofuran-2-yl)-6-[(pyridin-4-ylamino)methyl]isoquinolin-1-amine Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=C(C2=CC=C(C=C12)CNC1=CC=NC=C1)N PPXGWMZEBXCPES-UHFFFAOYSA-N 0.000 description 1
- XWKKEZUPWNZCDT-UHFFFAOYSA-N 4-(1-benzofuran-2-yl)-8-nitro-6-(piperidin-1-ylmethyl)isoquinoline Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=C(C=C(C=C12)CN1CCCCC1)[N+](=O)[O-] XWKKEZUPWNZCDT-UHFFFAOYSA-N 0.000 description 1
- GCWNXJJFYJHYNX-UHFFFAOYSA-N 4-(4-phenylmethoxyphenyl)isoquinoline-6-carbaldehyde Chemical compound C(C1=CC=CC=C1)OC1=CC=C(C=C1)C1=CN=CC2=CC=C(C=C12)C=O GCWNXJJFYJHYNX-UHFFFAOYSA-N 0.000 description 1
- YKQKTLFFQSDTGM-UHFFFAOYSA-N 4-(aminomethyl)pyridin-2-amine Chemical compound NCC1=CC=NC(N)=C1 YKQKTLFFQSDTGM-UHFFFAOYSA-N 0.000 description 1
- BLBDTBCGPHPIJK-UHFFFAOYSA-N 4-Amino-2-chloropyridine Chemical compound NC1=CC=NC(Cl)=C1 BLBDTBCGPHPIJK-UHFFFAOYSA-N 0.000 description 1
- IILHQAYXANRUAA-UHFFFAOYSA-N 4-N-(4-phenylisoquinolin-6-yl)cyclohexane-1,4-diamine Chemical compound NC1CCC(CC1)NC1=CC=C2C=NC=C(C3=CC=CC=C3)C2=C1 IILHQAYXANRUAA-UHFFFAOYSA-N 0.000 description 1
- UVTRJSWQWLUZHT-UHFFFAOYSA-N 4-N-[4-(1-benzofuran-2-yl)-7-chloroisoquinolin-6-yl]cyclohexane-1,4-diamine Chemical compound NC1CCC(CC1)NC1=C(Cl)C=C2C=NC=C(C3=CC4=CC=CC=C4O3)C2=C1 UVTRJSWQWLUZHT-UHFFFAOYSA-N 0.000 description 1
- KOOVBPFIPMQZNB-UHFFFAOYSA-N 4-N-[4-(1-benzofuran-2-yl)-8-methoxyisoquinolin-6-yl]cyclohexane-1,4-diamine Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=C(C=C(C=C12)NC1CCC(CC1)N)OC KOOVBPFIPMQZNB-UHFFFAOYSA-N 0.000 description 1
- CSBAIBZWNJNZSI-UHFFFAOYSA-N 4-N-[[4-(1-benzofuran-2-yl)isoquinolin-6-yl]methyl]pyridine-2,4-diamine Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)CNC1=CC(=NC=C1)N CSBAIBZWNJNZSI-UHFFFAOYSA-N 0.000 description 1
- KXMRDHPZQHAXML-UHFFFAOYSA-N 4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid Chemical compound CC(C)(C)OC(=O)NC1CCC(C(O)=O)CC1 KXMRDHPZQHAXML-UHFFFAOYSA-N 0.000 description 1
- 125000004042 4-aminobutyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])N([H])[H] 0.000 description 1
- IMLXLGZJLAOKJN-UHFFFAOYSA-N 4-aminocyclohexan-1-ol Chemical compound NC1CCC(O)CC1 IMLXLGZJLAOKJN-UHFFFAOYSA-N 0.000 description 1
- AABHEVGNUVRPCB-UHFFFAOYSA-N 4-bromo-6-(bromomethyl)-7-chloroisoquinoline Chemical compound BrC1=CN=CC2=CC(=C(C=C12)CBr)Cl AABHEVGNUVRPCB-UHFFFAOYSA-N 0.000 description 1
- RWBNRWZCKKATBH-UHFFFAOYSA-N 4-bromo-6-(bromomethyl)-7-nitroisoquinoline Chemical compound BrC1=CN=CC2=CC(=C(C=C12)CBr)[N+](=O)[O-] RWBNRWZCKKATBH-UHFFFAOYSA-N 0.000 description 1
- CRHVBTMXKXCZNZ-UHFFFAOYSA-N 4-bromo-6-(dibromomethyl)isoquinoline Chemical compound BrC1=CN=CC2=CC=C(C=C12)C(Br)Br CRHVBTMXKXCZNZ-UHFFFAOYSA-N 0.000 description 1
- AIUGUIXRRRECNF-UHFFFAOYSA-N 4-bromo-6-(pyrrolo[2,3-c]pyridin-1-ylmethyl)isoquinoline Chemical compound BrC1=CN=CC2=CC=C(C=C12)CN1C=CC=2C1=CN=CC=2 AIUGUIXRRRECNF-UHFFFAOYSA-N 0.000 description 1
- CGXSMTXAIMBDDG-UHFFFAOYSA-N 4-bromo-6-[(pyridin-4-ylamino)methyl]isoquinolin-3-amine hydrochloride Chemical compound Cl.Nc1ncc2ccc(CNc3ccncc3)cc2c1Br CGXSMTXAIMBDDG-UHFFFAOYSA-N 0.000 description 1
- JXZZRVZCPFTYQV-UHFFFAOYSA-N 4-chloro-N-pyridin-4-ylisoquinolin-6-amine Chemical compound ClC1=CN=CC2=CC=C(C=C12)NC1=CC=NC=C1 JXZZRVZCPFTYQV-UHFFFAOYSA-N 0.000 description 1
- IRPVABHDSJVBNZ-RTHVDDQRSA-N 5-[1-(cyclopropylmethyl)-5-[(1R,5S)-3-(oxetan-3-yl)-3-azabicyclo[3.1.0]hexan-6-yl]pyrazol-3-yl]-3-(trifluoromethyl)pyridin-2-amine Chemical compound C1=C(C(F)(F)F)C(N)=NC=C1C1=NN(CC2CC2)C(C2[C@@H]3CN(C[C@@H]32)C2COC2)=C1 IRPVABHDSJVBNZ-RTHVDDQRSA-N 0.000 description 1
- ANPAWAXFULSFEF-UHFFFAOYSA-N 5-bromo-3-[4-(prop-2-enoylamino)piperidin-1-yl]sulfonyl-1H-indole-2-carboxamide Chemical compound C(C=C)(=O)NC1CCN(CC1)S(=O)(=O)C1=C(NC2=CC=C(C=C12)Br)C(=O)N ANPAWAXFULSFEF-UHFFFAOYSA-N 0.000 description 1
- OZFPSOBLQZPIAV-UHFFFAOYSA-N 5-nitro-1h-indole Chemical compound [O-][N+](=O)C1=CC=C2NC=CC2=C1 OZFPSOBLQZPIAV-UHFFFAOYSA-N 0.000 description 1
- KCBWAFJCKVKYHO-UHFFFAOYSA-N 6-(4-cyclopropyl-6-methoxypyrimidin-5-yl)-1-[[4-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]phenyl]methyl]pyrazolo[3,4-d]pyrimidine Chemical compound C1(CC1)C1=NC=NC(=C1C1=NC=C2C(=N1)N(N=C2)CC1=CC=C(C=C1)C=1N(C=C(N=1)C(F)(F)F)C(C)C)OC KCBWAFJCKVKYHO-UHFFFAOYSA-N 0.000 description 1
- QUPXDMURZIIQDS-UHFFFAOYSA-N 6-(bromomethyl)-4-quinolin-2-ylisoquinoline Chemical compound BrCC=1C=C2C(=CN=CC2=CC=1)C1=NC2=CC=CC=C2C=C1 QUPXDMURZIIQDS-UHFFFAOYSA-N 0.000 description 1
- VFZSGAJOEYFZRM-UHFFFAOYSA-N 6-[(4-aminopiperidin-1-yl)methyl]-4-(1-benzofuran-2-yl)isoquinolin-1-amine Chemical compound NC1CCN(CC1)CC=1C=C2C(=CN=C(C2=CC=1)N)C=1OC2=C(C=1)C=CC=C2 VFZSGAJOEYFZRM-UHFFFAOYSA-N 0.000 description 1
- CDMLLPMNUHXCDB-UHFFFAOYSA-N 6-bromo-4-chloroisoquinoline Chemical compound C1=C(Br)C=C2C(Cl)=CN=CC2=C1 CDMLLPMNUHXCDB-UHFFFAOYSA-N 0.000 description 1
- ALLJCJZVQMDEHE-UHFFFAOYSA-N 6-fluoroisoquinoline Chemical compound C1=NC=CC2=CC(F)=CC=C21 ALLJCJZVQMDEHE-UHFFFAOYSA-N 0.000 description 1
- 125000006164 6-membered heteroaryl group Chemical group 0.000 description 1
- LHRDOJQPLLZVFX-UHFFFAOYSA-N 7-chloro-6-methylisoquinoline Chemical compound C1=NC=C2C=C(Cl)C(C)=CC2=C1 LHRDOJQPLLZVFX-UHFFFAOYSA-N 0.000 description 1
- OGHAROSJZRTIOK-KQYNXXCUSA-O 7-methylguanosine Chemical compound C1=2N=C(N)NC(=O)C=2[N+](C)=CN1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O OGHAROSJZRTIOK-KQYNXXCUSA-O 0.000 description 1
- OKJGMKGYRXNFHN-UHFFFAOYSA-N 8-chloro-6-fluoroisoquinoline Chemical compound C1=NC=CC2=CC(F)=CC(Cl)=C21 OKJGMKGYRXNFHN-UHFFFAOYSA-N 0.000 description 1
- OZAIFHULBGXAKX-VAWYXSNFSA-N AIBN Substances N#CC(C)(C)\N=N\C(C)(C)C#N OZAIFHULBGXAKX-VAWYXSNFSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- OQLZINXFSUDMHM-UHFFFAOYSA-N Acetamidine Chemical compound CC(N)=N OQLZINXFSUDMHM-UHFFFAOYSA-N 0.000 description 1
- 101710134784 Agnoprotein Proteins 0.000 description 1
- 235000019489 Almond oil Nutrition 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 108020005544 Antisense RNA Proteins 0.000 description 1
- 102100021569 Apoptosis regulator Bcl-2 Human genes 0.000 description 1
- 102100021663 Baculoviral IAP repeat-containing protein 5 Human genes 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- 208000018084 Bone neoplasm Diseases 0.000 description 1
- 208000026310 Breast neoplasm Diseases 0.000 description 1
- PNFIBEYKHBFEQY-KYZUINATSA-N C(C)(=O)N[C@@H]1CC[C@H](CC1)CN Chemical compound C(C)(=O)N[C@@H]1CC[C@H](CC1)CN PNFIBEYKHBFEQY-KYZUINATSA-N 0.000 description 1
- 229910014033 C-OH Inorganic materials 0.000 description 1
- AMAVOBXJELXNPY-UHFFFAOYSA-N C1C=CC2=C(N1N)C=CC(=C2)N Chemical compound C1C=CC2=C(N1N)C=CC(=C2)N AMAVOBXJELXNPY-UHFFFAOYSA-N 0.000 description 1
- 125000000041 C6-C10 aryl group Chemical group 0.000 description 1
- ISHRKCUYRAQKCM-UHFFFAOYSA-N CC=1C=C2C(=CN=CC2=CC=1)B(O)O Chemical compound CC=1C=C2C(=CN=CC2=CC=1)B(O)O ISHRKCUYRAQKCM-UHFFFAOYSA-N 0.000 description 1
- JGLMVXWAHNTPRF-CMDGGOBGSA-N CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O Chemical compound CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O JGLMVXWAHNTPRF-CMDGGOBGSA-N 0.000 description 1
- 239000005632 Capric acid (CAS 334-48-5) Substances 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical compound NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 208000005623 Carcinogenesis Diseases 0.000 description 1
- GEWLYFZWVLXQME-UHFFFAOYSA-N Cercosporamide Natural products CC12C(=O)C(C(=O)C)=C(O)C=C1OC1=C2C(O)=CC(O)=C1C(N)=O GEWLYFZWVLXQME-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 206010009944 Colon cancer Diseases 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- 102000006311 Cyclin D1 Human genes 0.000 description 1
- 108010058546 Cyclin D1 Proteins 0.000 description 1
- 229910014570 C—OH Inorganic materials 0.000 description 1
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- 101100232687 Drosophila melanogaster eIF4A gene Proteins 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 101710091919 Eukaryotic translation initiation factor 4G Proteins 0.000 description 1
- 208000001382 Experimental Melanoma Diseases 0.000 description 1
- GISRWBROCYNDME-PELMWDNLSA-N F[C@H]1[C@H]([C@H](NC1=O)COC1=NC=CC2=CC(=C(C=C12)OC)C(=O)N)C Chemical compound F[C@H]1[C@H]([C@H](NC1=O)COC1=NC=CC2=CC(=C(C=C12)OC)C(=O)N)C GISRWBROCYNDME-PELMWDNLSA-N 0.000 description 1
- 208000007842 Fibroepithelial Neoplasms Diseases 0.000 description 1
- 208000021309 Germ cell tumor Diseases 0.000 description 1
- 208000032612 Glial tumor Diseases 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 229910004373 HOAc Inorganic materials 0.000 description 1
- 208000017604 Hodgkin disease Diseases 0.000 description 1
- 208000021519 Hodgkin lymphoma Diseases 0.000 description 1
- 208000010747 Hodgkins lymphoma Diseases 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- 101000971171 Homo sapiens Apoptosis regulator Bcl-2 Proteins 0.000 description 1
- 101000573522 Homo sapiens MAP kinase-interacting serine/threonine-protein kinase 1 Proteins 0.000 description 1
- 101001018978 Homo sapiens MAP kinase-interacting serine/threonine-protein kinase 2 Proteins 0.000 description 1
- 101500028620 Homo sapiens Motilin-associated peptide Proteins 0.000 description 1
- 101001059454 Homo sapiens Serine/threonine-protein kinase MARK2 Proteins 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 206010020880 Hypertrophy Diseases 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 108091026898 Leader sequence (mRNA) Proteins 0.000 description 1
- 208000030289 Lymphoproliferative disease Diseases 0.000 description 1
- 101710138999 MAP kinase-interacting serine/threonine-protein kinase 2 Proteins 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 206010027458 Metastases to lung Diseases 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 208000002406 Mucoepidermoid Tumor Diseases 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- 241000699660 Mus musculus Species 0.000 description 1
- 102100038895 Myc proto-oncogene protein Human genes 0.000 description 1
- 101710135898 Myc proto-oncogene protein Proteins 0.000 description 1
- 201000003793 Myelodysplastic syndrome Diseases 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- NRYBPYZEKHGEAP-UHFFFAOYSA-N N-(4-chloroisoquinolin-6-yl)-N',N'-dimethylethane-1,2-diamine Chemical compound ClC1=CN=CC2=CC=C(C=C12)NCCN(C)C NRYBPYZEKHGEAP-UHFFFAOYSA-N 0.000 description 1
- ZRKWMRDKSOPRRS-UHFFFAOYSA-N N-Methyl-N-nitrosourea Chemical compound O=NN(C)C(N)=O ZRKWMRDKSOPRRS-UHFFFAOYSA-N 0.000 description 1
- DBCWEMQACXCGSI-UHFFFAOYSA-N N-[(2-chloro-4-methylphenyl)methyl]-N-(2,2-dimethoxyethyl)-4-methylbenzenesulfonamide Chemical compound ClC1=C(C=CC(=C1)C)CN(S(=O)(=O)C1=CC=C(C=C1)C)CC(OC)OC DBCWEMQACXCGSI-UHFFFAOYSA-N 0.000 description 1
- FFUQUBYTCAIQAS-UHFFFAOYSA-N N-[1-[(4-bromoisoquinolin-6-yl)methyl]-3,3-difluoropiperidin-4-yl]acetamide Chemical compound CC(=O)NC1CCN(CC2=CC=C3C=NC=C(Br)C3=C2)CC1(F)F FFUQUBYTCAIQAS-UHFFFAOYSA-N 0.000 description 1
- QHVFWMDPNQMNAC-UHFFFAOYSA-N N-[3-(trifluoromethyl)pyridin-4-yl]acetamide Chemical compound FC(C=1C=NC=CC=1NC(C)=O)(F)F QHVFWMDPNQMNAC-UHFFFAOYSA-N 0.000 description 1
- KCBJXDUPZWYTRQ-UHFFFAOYSA-N N-[5-[[4-(1-benzofuran-2-yl)isoquinolin-6-yl]amino]pyridin-2-yl]acetamide Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)NC=1C=CC(=NC=1)NC(C)=O KCBJXDUPZWYTRQ-UHFFFAOYSA-N 0.000 description 1
- UEEJHVSXFDXPFK-UHFFFAOYSA-N N-dimethylaminoethanol Chemical compound CN(C)CCO UEEJHVSXFDXPFK-UHFFFAOYSA-N 0.000 description 1
- HLHRFPIWNKZNMZ-UHFFFAOYSA-N N1=CC=CC2=CN=C3C=CC=CC231 Chemical class N1=CC=CC2=CN=C3C=CC=CC231 HLHRFPIWNKZNMZ-UHFFFAOYSA-N 0.000 description 1
- IMLXLGZJLAOKJN-IZLXSQMJSA-N N[C@H]1CC[C@H](O)CC1 Chemical compound N[C@H]1CC[C@H](O)CC1 IMLXLGZJLAOKJN-IZLXSQMJSA-N 0.000 description 1
- 208000034176 Neoplasms, Germ Cell and Embryonal Diseases 0.000 description 1
- 208000005289 Neoplastic Cell Transformation Diseases 0.000 description 1
- 208000015914 Non-Hodgkin lymphomas Diseases 0.000 description 1
- 208000007871 Odontogenic Tumors Diseases 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 239000005662 Paraffin oil Substances 0.000 description 1
- 206010061332 Paraganglion neoplasm Diseases 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 208000007452 Plasmacytoma Diseases 0.000 description 1
- 229920001214 Polysorbate 60 Polymers 0.000 description 1
- 206010036790 Productive cough Diseases 0.000 description 1
- 102000001253 Protein Kinase Human genes 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- 102000015097 RNA Splicing Factors Human genes 0.000 description 1
- 108010039259 RNA Splicing Factors Proteins 0.000 description 1
- 229940123690 Raf kinase inhibitor Drugs 0.000 description 1
- 102000004389 Ribonucleoproteins Human genes 0.000 description 1
- 108010081734 Ribonucleoproteins Proteins 0.000 description 1
- MTCFGRXMJLQNBG-UHFFFAOYSA-N Serine Natural products OCC(N)C(O)=O MTCFGRXMJLQNBG-UHFFFAOYSA-N 0.000 description 1
- 102100028904 Serine/threonine-protein kinase MARK2 Human genes 0.000 description 1
- 208000019802 Sexually transmitted disease Diseases 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- 108010002687 Survivin Proteins 0.000 description 1
- 101710150448 Transcriptional regulator Myc Proteins 0.000 description 1
- 108700019146 Transgenes Proteins 0.000 description 1
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 244000098338 Triticum aestivum Species 0.000 description 1
- 208000007097 Urinary Bladder Neoplasms Diseases 0.000 description 1
- 108010019530 Vascular Endothelial Growth Factors Proteins 0.000 description 1
- 102000005789 Vascular Endothelial Growth Factors Human genes 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- PIKAHTZTFKKRKO-UHFFFAOYSA-N [1-amino-4-(1-benzofuran-2-yl)-8-methoxyisoquinolin-6-yl]methanol Chemical compound COC1=C2C(N)=NC=C(C3=CC4=CC=CC=C4O3)C2=CC(CO)=C1 PIKAHTZTFKKRKO-UHFFFAOYSA-N 0.000 description 1
- PEOJULVWBASZSJ-UHFFFAOYSA-N [4-(1-benzofuran-2-yl)-8-chloroisoquinolin-6-yl]methanol Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=C(C=C(C=C12)CO)Cl PEOJULVWBASZSJ-UHFFFAOYSA-N 0.000 description 1
- 230000001594 aberrant effect Effects 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- VRYAIUMHCRSUDX-UHFFFAOYSA-N acetic acid;tert-butyl piperazine-1-carboxylate Chemical compound CC(O)=O.CC(C)(C)OC(=O)N1CCNCC1 VRYAIUMHCRSUDX-UHFFFAOYSA-N 0.000 description 1
- 125000000641 acridinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3C=C12)* 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 125000004448 alkyl carbonyl group Chemical group 0.000 description 1
- 125000005213 alkyl heteroaryl group Chemical group 0.000 description 1
- 239000008168 almond oil Substances 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000003927 aminopyridines Chemical class 0.000 description 1
- 150000003868 ammonium compounds Chemical class 0.000 description 1
- 239000003708 ampul Substances 0.000 description 1
- 230000001093 anti-cancer Effects 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 235000006708 antioxidants Nutrition 0.000 description 1
- YTFOGBLNSANTGN-UHFFFAOYSA-N argon 2H-isoquinolin-1-one Chemical compound C1(NC=CC2=CC=CC=C12)=O.[Ar] YTFOGBLNSANTGN-UHFFFAOYSA-N 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- SJSWRKNSCWKNIR-UHFFFAOYSA-N azane;dihydrochloride Chemical compound N.Cl.Cl SJSWRKNSCWKNIR-UHFFFAOYSA-N 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 150000003935 benzaldehydes Chemical class 0.000 description 1
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzenecarboxaldehyde Natural products O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000004604 benzisothiazolyl group Chemical group S1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000004533 benzofuran-5-yl group Chemical group O1C=CC2=C1C=CC(=C2)* 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 1
- 239000012965 benzophenone Substances 0.000 description 1
- 125000004619 benzopyranyl group Chemical group O1C(C=CC2=C1C=CC=C2)* 0.000 description 1
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical compound C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- BNWSMJIOBMXAJH-UHFFFAOYSA-N benzyl n-[(2-methylpropan-2-yl)oxycarbonyl]carbamate Chemical compound CC(C)(C)OC(=O)NC(=O)OCC1=CC=CC=C1 BNWSMJIOBMXAJH-UHFFFAOYSA-N 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 125000004744 butyloxycarbonyl group Chemical group 0.000 description 1
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 1
- 229910000024 caesium carbonate Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- FUFJGUQYACFECW-UHFFFAOYSA-L calcium hydrogenphosphate Chemical compound [Ca+2].OP([O-])([O-])=O FUFJGUQYACFECW-UHFFFAOYSA-L 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 230000009702 cancer cell proliferation Effects 0.000 description 1
- 230000036952 cancer formation Effects 0.000 description 1
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 231100000504 carcinogenesis Toxicity 0.000 description 1
- 239000004359 castor oil Substances 0.000 description 1
- 235000019438 castor oil Nutrition 0.000 description 1
- 108020001778 catalytic domains Proteins 0.000 description 1
- 230000010307 cell transformation Effects 0.000 description 1
- 230000001413 cellular effect Effects 0.000 description 1
- GEWLYFZWVLXQME-MRXNPFEDSA-N cercosporamide Chemical compound O=C([C@]12C)C(C(=O)C)=C(O)C=C1OC1=C2C(O)=CC(O)=C1C(N)=O GEWLYFZWVLXQME-MRXNPFEDSA-N 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- FCYRSDMGOLYDHL-UHFFFAOYSA-N chloromethoxyethane Chemical compound CCOCCl FCYRSDMGOLYDHL-UHFFFAOYSA-N 0.000 description 1
- 229940117975 chromium trioxide Drugs 0.000 description 1
- WGLPBDUCMAPZCE-UHFFFAOYSA-N chromium trioxide Inorganic materials O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 1
- GAMDZJFZMJECOS-UHFFFAOYSA-N chromium(6+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Cr+6] GAMDZJFZMJECOS-UHFFFAOYSA-N 0.000 description 1
- 208000029742 colonic neoplasm Diseases 0.000 description 1
- 239000003184 complementary RNA Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 235000012343 cottonseed oil Nutrition 0.000 description 1
- 239000002385 cottonseed oil Substances 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 125000001047 cyclobutenyl group Chemical group C1(=CCC1)* 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- JVXNCJLLOUQYBF-UHFFFAOYSA-N cyclohex-4-ene-1,3-dione Chemical compound O=C1CC=CC(=O)C1 JVXNCJLLOUQYBF-UHFFFAOYSA-N 0.000 description 1
- VKIRRGRTJUUZHS-UHFFFAOYSA-N cyclohexane-1,4-diamine Chemical group NC1CCC(N)CC1 VKIRRGRTJUUZHS-UHFFFAOYSA-N 0.000 description 1
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- NXQGGXCHGDYOHB-UHFFFAOYSA-L cyclopenta-1,4-dien-1-yl(diphenyl)phosphane;dichloropalladium;iron(2+) Chemical compound [Fe+2].Cl[Pd]Cl.[CH-]1C=CC(P(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1.[CH-]1C=CC(P(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 NXQGGXCHGDYOHB-UHFFFAOYSA-L 0.000 description 1
- 125000000058 cyclopentadienyl group Chemical group C1(=CC=CC1)* 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- ZOCHARZZJNPSEU-UHFFFAOYSA-N diboron Chemical compound B#B ZOCHARZZJNPSEU-UHFFFAOYSA-N 0.000 description 1
- 235000019700 dicalcium phosphate Nutrition 0.000 description 1
- ZFTFAPZRGNKQPU-UHFFFAOYSA-N dicarbonic acid Chemical compound OC(=O)OC(O)=O ZFTFAPZRGNKQPU-UHFFFAOYSA-N 0.000 description 1
- WGLUMOCWFMKWIL-UHFFFAOYSA-N dichloromethane;methanol Chemical compound OC.ClCCl WGLUMOCWFMKWIL-UHFFFAOYSA-N 0.000 description 1
- LCSNDSFWVKMJCT-UHFFFAOYSA-N dicyclohexyl-(2-phenylphenyl)phosphane Chemical group C1CCCCC1P(C=1C(=CC=CC=1)C=1C=CC=CC=1)C1CCCCC1 LCSNDSFWVKMJCT-UHFFFAOYSA-N 0.000 description 1
- DXPIZCZNFUTPEI-UHFFFAOYSA-O diphenylphosphanium;azide Chemical compound [N-]=[N+]=[N-].C=1C=CC=CC=1[PH2+]C1=CC=CC=C1 DXPIZCZNFUTPEI-UHFFFAOYSA-O 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000006196 drop Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- ZSWFCLXCOIISFI-UHFFFAOYSA-N endo-cyclopentadiene Natural products C1C=CC=C1 ZSWFCLXCOIISFI-UHFFFAOYSA-N 0.000 description 1
- 201000005616 epidermal appendage tumor Diseases 0.000 description 1
- WCQOBLXWLRDEQA-UHFFFAOYSA-N ethanimidamide;hydrochloride Chemical compound Cl.CC(N)=N WCQOBLXWLRDEQA-UHFFFAOYSA-N 0.000 description 1
- BEFDCLMNVWHSGT-UHFFFAOYSA-N ethenylcyclopentane Chemical compound C=CC1CCCC1 BEFDCLMNVWHSGT-UHFFFAOYSA-N 0.000 description 1
- CGKOEKDEQBSGBT-UHFFFAOYSA-N ethyl N-(2-bromoethyl)-N-tert-butylcarbamate Chemical compound C(C)OC(N(CCBr)C(C)(C)C)=O CGKOEKDEQBSGBT-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- DATAFVIEPBKYPV-UHFFFAOYSA-N ethyl n-butoxycarbonylcarbamate Chemical compound CCCCOC(=O)NC(=O)OCC DATAFVIEPBKYPV-UHFFFAOYSA-N 0.000 description 1
- PQVSTLUFSYVLTO-UHFFFAOYSA-N ethyl n-ethoxycarbonylcarbamate Chemical compound CCOC(=O)NC(=O)OCC PQVSTLUFSYVLTO-UHFFFAOYSA-N 0.000 description 1
- FAMRKDQNMBBFBR-UHFFFAOYSA-N ethyl n-ethoxycarbonyliminocarbamate Chemical compound CCOC(=O)N=NC(=O)OCC FAMRKDQNMBBFBR-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000010685 fatty oil Substances 0.000 description 1
- 210000002950 fibroblast Anatomy 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 125000003838 furazanyl group Chemical group 0.000 description 1
- 125000004615 furo[2,3-b]pyridinyl group Chemical group O1C(=CC=2C1=NC=CC2)* 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 230000014509 gene expression Effects 0.000 description 1
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 1
- 230000002710 gonadal effect Effects 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 239000003102 growth factor Substances 0.000 description 1
- 208000014829 head and neck neoplasm Diseases 0.000 description 1
- 210000003958 hematopoietic stem cell Anatomy 0.000 description 1
- 150000002390 heteroarenes Chemical class 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 1
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 1
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 1
- UFVKGYZPFZQRLF-UHFFFAOYSA-N hydroxypropyl methyl cellulose Chemical compound OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC2C(C(O)C(OC3C(C(O)C(O)C(CO)O3)O)C(CO)O2)O)C(CO)O1 UFVKGYZPFZQRLF-UHFFFAOYSA-N 0.000 description 1
- 229940031704 hydroxypropyl methylcellulose phthalate Drugs 0.000 description 1
- 229920003132 hydroxypropyl methylcellulose phthalate Polymers 0.000 description 1
- 206010020718 hyperplasia Diseases 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 1
- VUSYGSNEEYEGGX-UHFFFAOYSA-N indol-1-amine Chemical compound C1=CC=C2N(N)C=CC2=C1 VUSYGSNEEYEGGX-UHFFFAOYSA-N 0.000 description 1
- 239000003978 infusion fluid Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 235000013847 iso-butane Nutrition 0.000 description 1
- 125000001977 isobenzofuranyl group Chemical group C=1(OC=C2C=CC=CC12)* 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- VDBNYAPERZTOOF-UHFFFAOYSA-N isoquinolin-1(2H)-one Chemical class C1=CC=C2C(=O)NC=CC2=C1 VDBNYAPERZTOOF-UHFFFAOYSA-N 0.000 description 1
- ZEQWUILSOJDNTF-UHFFFAOYSA-N isoquinolin-3-amine hydrochloride Chemical compound Cl.C1=NC(=CC2=CC=CC=C12)N ZEQWUILSOJDNTF-UHFFFAOYSA-N 0.000 description 1
- MBJVWMQHKCGMLZ-UHFFFAOYSA-N isoquinoline-6-carboxamide Chemical compound C1=NC=CC2=CC(C(=O)N)=CC=C21 MBJVWMQHKCGMLZ-UHFFFAOYSA-N 0.000 description 1
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 1
- 238000011813 knockout mouse model Methods 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 125000005647 linker group Chemical group 0.000 description 1
- 238000004811 liquid chromatography Methods 0.000 description 1
- DLEDOFVPSDKWEF-UHFFFAOYSA-N lithium butane Chemical compound [Li+].CCC[CH2-] DLEDOFVPSDKWEF-UHFFFAOYSA-N 0.000 description 1
- 229940040692 lithium hydroxide monohydrate Drugs 0.000 description 1
- GLXDVVHUTZTUQK-UHFFFAOYSA-M lithium hydroxide monohydrate Substances [Li+].O.[OH-] GLXDVVHUTZTUQK-UHFFFAOYSA-M 0.000 description 1
- 150000004668 long chain fatty acids Chemical class 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 230000001926 lymphatic effect Effects 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 206010027191 meningioma Diseases 0.000 description 1
- RTWNYYOXLSILQN-UHFFFAOYSA-N methanediamine Chemical compound NCN RTWNYYOXLSILQN-UHFFFAOYSA-N 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M methanesulfonate group Chemical class CS(=O)(=O)[O-] AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- MSSYNKGHKVEZDL-UHFFFAOYSA-N methyl 3-[6-[(4-aminopiperidin-1-yl)methyl]isoquinolin-4-yl]benzoate Chemical compound NC1CCN(CC1)CC=1C=C2C(=CN=CC2=CC=1)C=1C=C(C(=O)OC)C=CC=1 MSSYNKGHKVEZDL-UHFFFAOYSA-N 0.000 description 1
- CKGPPMATFKFVSB-UHFFFAOYSA-N methyl 4-[6-[(4-aminopiperidin-1-yl)methyl]isoquinolin-4-yl]benzoate Chemical compound NC1CCN(CC1)CC=1C=C2C(=CN=CC2=CC=1)C1=CC=C(C(=O)OC)C=C1 CKGPPMATFKFVSB-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- DDCYYCUMAFYDDU-UHFFFAOYSA-N methyl thiohypochlorite Chemical compound CSCl DDCYYCUMAFYDDU-UHFFFAOYSA-N 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 230000003641 microbiacidal effect Effects 0.000 description 1
- 229940124561 microbicide Drugs 0.000 description 1
- 230000002906 microbiologic effect Effects 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000012046 mixed solvent Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 210000003097 mucus Anatomy 0.000 description 1
- 230000002071 myeloproliferative effect Effects 0.000 description 1
- DILRJUIACXKSQE-UHFFFAOYSA-N n',n'-dimethylethane-1,2-diamine Chemical compound CN(C)CCN DILRJUIACXKSQE-UHFFFAOYSA-N 0.000 description 1
- XCJNSBCFLUPJAP-UHFFFAOYSA-N n,n-dimethylpiperidin-4-amine;dihydrochloride Chemical compound Cl.Cl.CN(C)C1CCNCC1 XCJNSBCFLUPJAP-UHFFFAOYSA-N 0.000 description 1
- FMASTMURQSHELY-UHFFFAOYSA-N n-(4-fluoro-2-methylphenyl)-3-methyl-n-[(2-methyl-1h-indol-4-yl)methyl]pyridine-4-carboxamide Chemical compound C1=CC=C2NC(C)=CC2=C1CN(C=1C(=CC(F)=CC=1)C)C(=O)C1=CC=NC=C1C FMASTMURQSHELY-UHFFFAOYSA-N 0.000 description 1
- MZRVEZGGRBJDDB-UHFFFAOYSA-N n-Butyllithium Substances [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 1
- BPQHACCSMMFJNV-UHFFFAOYSA-N n-[(2-chloro-4-fluorophenyl)methyl]-n-(2,2-dimethoxyethyl)-4-methylbenzenesulfonamide Chemical compound C=1C=C(C)C=CC=1S(=O)(=O)N(CC(OC)OC)CC1=CC=C(F)C=C1Cl BPQHACCSMMFJNV-UHFFFAOYSA-N 0.000 description 1
- JVVSXUBENIFPMW-UHFFFAOYSA-N n-[(3-chloro-4-fluorophenyl)methyl]-n-(2,2-dimethoxyethyl)-4-methylbenzenesulfonamide Chemical compound C=1C=C(C)C=CC=1S(=O)(=O)N(CC(OC)OC)CC1=CC=C(F)C(Cl)=C1 JVVSXUBENIFPMW-UHFFFAOYSA-N 0.000 description 1
- OWIUPIRUAQMTTK-UHFFFAOYSA-M n-aminocarbamate Chemical compound NNC([O-])=O OWIUPIRUAQMTTK-UHFFFAOYSA-M 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229930014626 natural product Natural products 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 208000027831 neuroepithelial neoplasm Diseases 0.000 description 1
- 150000002829 nitrogen Chemical class 0.000 description 1
- 208000002154 non-small cell lung carcinoma Diseases 0.000 description 1
- 238000011580 nude mouse model Methods 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 208000027825 odontogenic neoplasm Diseases 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- LXNAVEXFUKBNMK-UHFFFAOYSA-N palladium(II) acetate Substances [Pd].CC(O)=O.CC(O)=O LXNAVEXFUKBNMK-UHFFFAOYSA-N 0.000 description 1
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 102000051624 phosphatidylethanolamine binding protein Human genes 0.000 description 1
- 108700021017 phosphatidylethanolamine binding protein Proteins 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 125000005936 piperidyl group Chemical group 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920000166 polytrimethylene carbonate Polymers 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 229940116317 potato starch Drugs 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 238000012746 preparative thin layer chromatography Methods 0.000 description 1
- 239000000651 prodrug Substances 0.000 description 1
- 229940002612 prodrug Drugs 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000005767 propoxymethyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])[#8]C([H])([H])* 0.000 description 1
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical group CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 1
- 208000023958 prostate neoplasm Diseases 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 108060006633 protein kinase Proteins 0.000 description 1
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 1
- USPWKWBDZOARPV-UHFFFAOYSA-N pyrazolidine Chemical compound C1CNNC1 USPWKWBDZOARPV-UHFFFAOYSA-N 0.000 description 1
- 125000004527 pyrimidin-4-yl group Chemical group N1=CN=C(C=C1)* 0.000 description 1
- 125000002112 pyrrolidino group Chemical group [*]N1C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 125000004549 quinolin-4-yl group Chemical group N1=CC=C(C2=CC=CC=C12)* 0.000 description 1
- RZAUIOKDXQWSQE-UHFFFAOYSA-N quinolin-7-amine Chemical compound C1=CC=NC2=CC(N)=CC=C21 RZAUIOKDXQWSQE-UHFFFAOYSA-N 0.000 description 1
- 150000004060 quinone imines Chemical class 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 229940100486 rice starch Drugs 0.000 description 1
- 238000002390 rotary evaporation Methods 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 208000015891 sexual disease Diseases 0.000 description 1
- 230000001568 sexual effect Effects 0.000 description 1
- 230000019491 signal transduction Effects 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 1
- MFRIHAYPQRLWNB-UHFFFAOYSA-N sodium tert-butoxide Chemical compound [Na+].CC(C)(C)[O-] MFRIHAYPQRLWNB-UHFFFAOYSA-N 0.000 description 1
- SYXYWTXQFUUWLP-UHFFFAOYSA-N sodium;butan-1-olate Chemical group [Na+].CCCC[O-] SYXYWTXQFUUWLP-UHFFFAOYSA-N 0.000 description 1
- 239000012453 solvate Substances 0.000 description 1
- 239000004334 sorbic acid Substances 0.000 description 1
- 235000010199 sorbic acid Nutrition 0.000 description 1
- 229940075582 sorbic acid Drugs 0.000 description 1
- 239000003549 soybean oil Substances 0.000 description 1
- 235000012424 soybean oil Nutrition 0.000 description 1
- 241000894007 species Species 0.000 description 1
- VNFWTIYUKDMAOP-UHFFFAOYSA-N sphos Chemical group COC1=CC=CC(OC)=C1C1=CC=CC=C1P(C1CCCCC1)C1CCCCC1 VNFWTIYUKDMAOP-UHFFFAOYSA-N 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 210000003802 sputum Anatomy 0.000 description 1
- 208000024794 sputum Diseases 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 125000005346 substituted cycloalkyl group Chemical group 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 230000004083 survival effect Effects 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000002700 tablet coating Substances 0.000 description 1
- 238000009492 tablet coating Methods 0.000 description 1
- 238000003419 tautomerization reaction Methods 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 210000002435 tendon Anatomy 0.000 description 1
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 1
- GTZRSWPYDOEFTL-UHFFFAOYSA-N tert-butyl 4-[4-(1-benzofuran-2-yl)isoquinolin-6-yl]oxypiperidine-1-carboxylate Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)OC1CCN(CC1)C(=O)OC(C)(C)C GTZRSWPYDOEFTL-UHFFFAOYSA-N 0.000 description 1
- APZOOTJWPGQYSZ-UHFFFAOYSA-N tert-butyl 4-amino-3,3-difluoropiperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(N)C(F)(F)C1 APZOOTJWPGQYSZ-UHFFFAOYSA-N 0.000 description 1
- CJWBXWLUBCMXMG-UHFFFAOYSA-N tert-butyl N-(4-bromo-6-methylisoquinolin-1-yl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate Chemical compound BrC1=CN=C(C2=CC=C(C=C12)C)N(C(OC(C)(C)C)=O)C(=O)OC(C)(C)C CJWBXWLUBCMXMG-UHFFFAOYSA-N 0.000 description 1
- HJZPNIPDZPNRBV-UHFFFAOYSA-N tert-butyl N-(4-bromoisoquinolin-6-yl)carbamate Chemical compound BrC1=CN=CC2=CC=C(C=C12)NC(OC(C)(C)C)=O HJZPNIPDZPNRBV-UHFFFAOYSA-N 0.000 description 1
- PDOSMBRIGPGECL-UHFFFAOYSA-N tert-butyl N-[1-[(4-bromo-7-chloroisoquinolin-6-yl)methyl]piperidin-4-yl]carbamate Chemical compound CC(C)(C)OC(=O)NC1CCN(CC2=C(Cl)C=C3C=NC=C(Br)C3=C2)CC1 PDOSMBRIGPGECL-UHFFFAOYSA-N 0.000 description 1
- YSZJYWZCUCGHHV-UHFFFAOYSA-N tert-butyl N-[1-[(4-bromoisoquinolin-6-yl)methyl]piperidin-4-yl]carbamate Chemical compound CC(C)(C)OC(=O)NC1CCN(CC2=CC=C3C=NC=C(Br)C3=C2)CC1 YSZJYWZCUCGHHV-UHFFFAOYSA-N 0.000 description 1
- YFZDGFOBTSMXMM-UHFFFAOYSA-N tert-butyl N-[1-[[4-(1-benzofuran-2-yl)-7-chloroisoquinolin-6-yl]methyl]piperidin-4-yl]carbamate Chemical compound CC(C)(C)OC(=O)NC1CCN(CC2=C(Cl)C=C3C=NC=C(C4=CC5=CC=CC=C5O4)C3=C2)CC1 YFZDGFOBTSMXMM-UHFFFAOYSA-N 0.000 description 1
- FZNRNCNCLBQFMZ-UHFFFAOYSA-N tert-butyl N-[1-[[4-(1-benzofuran-2-yl)-8-chloroisoquinolin-6-yl]methyl]piperidin-4-yl]carbamate Chemical compound CC(C)(C)OC(=O)NC1CCN(CC2=CC(Cl)=C3C=NC=C(C4=CC5=CC=CC=C5O4)C3=C2)CC1 FZNRNCNCLBQFMZ-UHFFFAOYSA-N 0.000 description 1
- GYYDOUSIRRFRPP-UHFFFAOYSA-N tert-butyl N-[1-[[4-(1-benzofuran-2-yl)-8-nitroisoquinolin-6-yl]methyl]piperidin-4-yl]carbamate Chemical compound CC(C)(C)OC(=O)NC1CCN(CC2=CC(=C3C=NC=C(C4=CC5=CC=CC=C5O4)C3=C2)[N+]([O-])=O)CC1 GYYDOUSIRRFRPP-UHFFFAOYSA-N 0.000 description 1
- ZJKLWYYHRCGLJA-UHFFFAOYSA-N tert-butyl N-[1-[[4-(1-benzofuran-2-yl)isoquinolin-6-yl]methyl]piperidin-4-yl]carbamate Chemical compound CC(C)(C)OC(=O)NC1CCN(CC2=CC=C3C=NC=C(C4=CC5=CC=CC=C5O4)C3=C2)CC1 ZJKLWYYHRCGLJA-UHFFFAOYSA-N 0.000 description 1
- IWQFOOLUDMDONE-UHFFFAOYSA-N tert-butyl N-[1-[[4-(furan-2-yl)isoquinolin-6-yl]methyl]piperidin-4-yl]carbamate Chemical compound CC(C)(C)OC(=O)NC1CCN(CC2=CC=C3C=NC=C(C4=CC=CO4)C3=C2)CC1 IWQFOOLUDMDONE-UHFFFAOYSA-N 0.000 description 1
- PZHQFFKAMXSRNX-UHFFFAOYSA-N tert-butyl N-[1-[[7-amino-4-(1-benzofuran-2-yl)isoquinolin-6-yl]methyl]piperidin-4-yl]carbamate Chemical compound NC1=C(C=C2C(=CN=CC2=C1)C=1OC2=C(C=1)C=CC=C2)CN1CCC(CC1)NC(OC(C)(C)C)=O PZHQFFKAMXSRNX-UHFFFAOYSA-N 0.000 description 1
- YACVXPBMBAAKQD-UHFFFAOYSA-N tert-butyl N-[3-(dimethylamino)propyl]-N-[[4-(4-hydroxyphenyl)isoquinolin-6-yl]methyl]carbamate Chemical compound CN(C)CCCN(CC1=CC=C2C=NC=C(C3=CC=C(O)C=C3)C2=C1)C(=O)OC(C)(C)C YACVXPBMBAAKQD-UHFFFAOYSA-N 0.000 description 1
- APQNJYJBSNBEEZ-UHFFFAOYSA-N tert-butyl N-[3-[[4-(4-hydroxyphenyl)isoquinolin-6-yl]methoxy]propyl]carbamate Chemical compound OC1=CC=C(C=C1)C1=CN=CC2=CC=C(C=C12)COCCCNC(OC(C)(C)C)=O APQNJYJBSNBEEZ-UHFFFAOYSA-N 0.000 description 1
- HEBFSPALRCUKBR-UHFFFAOYSA-N tert-butyl N-[4-[[4-(1-benzofuran-2-yl)-7-chloroisoquinolin-6-yl]amino]cyclohexyl]carbamate Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC(=C(C=C12)NC1CCC(CC1)NC(OC(C)(C)C)=O)Cl HEBFSPALRCUKBR-UHFFFAOYSA-N 0.000 description 1
- PKCXGVXLRNNLJI-UHFFFAOYSA-N tert-butyl N-[4-[[4-(1-benzofuran-2-yl)-7-hydroxyisoquinolin-6-yl]amino]cyclohexyl]carbamate Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC(=C(C=C12)NC1CCC(CC1)NC(OC(C)(C)C)=O)O PKCXGVXLRNNLJI-UHFFFAOYSA-N 0.000 description 1
- QLEXAQINDMVKLE-UHFFFAOYSA-N tert-butyl N-[4-[[4-(1-benzofuran-2-yl)-8-chloroisoquinolin-6-yl]amino]cyclohexyl]carbamate Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=C(C=C(C=C12)NC1CCC(CC1)NC(OC(C)(C)C)=O)Cl QLEXAQINDMVKLE-UHFFFAOYSA-N 0.000 description 1
- VMAAUKATWBFSOW-UHFFFAOYSA-N tert-butyl N-[4-[[4-(1-benzofuran-2-yl)isoquinolin-6-yl]amino]phenyl]carbamate Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)NC1=CC=C(C=C1)NC(OC(C)(C)C)=O VMAAUKATWBFSOW-UHFFFAOYSA-N 0.000 description 1
- NSBBQZCLKSRWIV-UHFFFAOYSA-N tert-butyl N-[4-[[4-(4-hydroxyphenyl)isoquinolin-6-yl]methylamino]butyl]carbamate Chemical compound OC1=CC=C(C=C1)C1=CN=CC2=CC=C(C=C12)CNCCCCNC(OC(C)(C)C)=O NSBBQZCLKSRWIV-UHFFFAOYSA-N 0.000 description 1
- GTHTVZKGPZWUNC-UHFFFAOYSA-N tert-butyl N-[4-bromo-6-(bromomethyl)isoquinolin-1-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate Chemical compound BrC1=CN=C(C2=CC=C(C=C12)CBr)N(C(OC(C)(C)C)=O)C(=O)OC(C)(C)C GTHTVZKGPZWUNC-UHFFFAOYSA-N 0.000 description 1
- SHZIQDOTSHTMJW-UHFFFAOYSA-N tert-butyl N-[[2-[[4-(1-benzofuran-2-yl)isoquinolin-6-yl]methylamino]phenyl]methyl]carbamate Chemical compound CC(C)(C)OC(=O)NCC1=C(NCC2=CC=C3C=NC=C(C4=CC5=CC=CC=C5O4)C3=C2)C=CC=C1 SHZIQDOTSHTMJW-UHFFFAOYSA-N 0.000 description 1
- SSQVOBQJOCWVGA-UHFFFAOYSA-N tert-butyl N-[[4-(1-benzofuran-2-yl)isoquinolin-6-yl]methyl]-N-pyridin-3-ylcarbamate Chemical compound O1C(=CC2=C1C=CC=C2)C1=CN=CC2=CC=C(C=C12)CN(C(OC(C)(C)C)=O)C=1C=NC=CC=1 SSQVOBQJOCWVGA-UHFFFAOYSA-N 0.000 description 1
- RUPAXCPQAAOIPB-UHFFFAOYSA-N tert-butyl formate Chemical group CC(C)(C)OC=O RUPAXCPQAAOIPB-UHFFFAOYSA-N 0.000 description 1
- GPTXCAZYUMDUMN-UHFFFAOYSA-N tert-butyl n-(2-hydroxyethyl)carbamate Chemical compound CC(C)(C)OC(=O)NCCO GPTXCAZYUMDUMN-UHFFFAOYSA-N 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- 125000003507 tetrahydrothiofenyl group Chemical group 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- XDLNRRRJZOJTRW-UHFFFAOYSA-N thiohypochlorous acid Chemical compound ClS XDLNRRRJZOJTRW-UHFFFAOYSA-N 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- LMYRWZFENFIFIT-UHFFFAOYSA-N toluene-4-sulfonamide Chemical compound CC1=CC=C(S(N)(=O)=O)C=C1 LMYRWZFENFIFIT-UHFFFAOYSA-N 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 230000014621 translational initiation Effects 0.000 description 1
- 238000011269 treatment regimen Methods 0.000 description 1
- 150000003626 triacylglycerols Chemical class 0.000 description 1
- 125000005310 triazolidinyl group Chemical group N1(NNCC1)* 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- 229940078499 tricalcium phosphate Drugs 0.000 description 1
- 235000019731 tricalcium phosphate Nutrition 0.000 description 1
- 229910000391 tricalcium phosphate Inorganic materials 0.000 description 1
- 125000002889 tridecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical compound [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 description 1
- SMBZJSVIKJMSFP-UHFFFAOYSA-N trifluoromethyl hypofluorite Chemical group FOC(F)(F)F SMBZJSVIKJMSFP-UHFFFAOYSA-N 0.000 description 1
- WRECIMRULFAWHA-UHFFFAOYSA-N trimethyl borate Chemical compound COB(OC)OC WRECIMRULFAWHA-UHFFFAOYSA-N 0.000 description 1
- 210000004881 tumor cell Anatomy 0.000 description 1
- 230000004614 tumor growth Effects 0.000 description 1
- 208000013706 tumor of meninges Diseases 0.000 description 1
- 208000029729 tumor suppressor gene on chromosome 11 Diseases 0.000 description 1
- 238000011144 upstream manufacturing Methods 0.000 description 1
- 208000024719 uterine cervix neoplasm Diseases 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 239000003643 water by type Substances 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 229940100445 wheat starch Drugs 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/47—Quinolines; Isoquinolines
- A61K31/472—Non-condensed isoquinolines, e.g. papaverine
- A61K31/4725—Non-condensed isoquinolines, e.g. papaverine containing further heterocyclic rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
- A61P35/02—Antineoplastic agents specific for leukemia
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/04—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to the ring carbon atoms
- C07D215/06—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to the ring carbon atoms having only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/02—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines
- C07D217/04—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines with hydrocarbon or substituted hydrocarbon radicals attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/12—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with radicals, substituted by hetero atoms, attached to carbon atoms of the nitrogen-containing ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/22—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to carbon atoms of the nitrogen-containing ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D237/00—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings
- C07D237/26—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings condensed with carbocyclic rings or ring systems
- C07D237/28—Cinnolines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/10—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a carbon chain containing aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/04—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/14—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D491/00—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00
- C07D491/02—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00 in which the condensed system contains two hetero rings
- C07D491/04—Ortho-condensed systems
- C07D491/044—Ortho-condensed systems with only one oxygen atom as ring hetero atom in the oxygen-containing ring
- C07D491/048—Ortho-condensed systems with only one oxygen atom as ring hetero atom in the oxygen-containing ring the oxygen-containing ring being five-membered
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Epidemiology (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Hematology (AREA)
- Oncology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| EP15154685 | 2015-02-11 | ||
| EP15197976 | 2015-12-04 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| TW201636327A true TW201636327A (zh) | 2016-10-16 |
Family
ID=55345828
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| TW105104357A TW201636327A (zh) | 2015-02-11 | 2016-02-15 | 被取代的單氮雜萘衍生物和多氮雜萘衍生物及其用途 |
Country Status (13)
| Country | Link |
|---|---|
| US (2) | US10487075B2 (https=) |
| EP (1) | EP3256217A1 (https=) |
| JP (1) | JP2018505207A (https=) |
| KR (1) | KR20170117479A (https=) |
| CN (1) | CN107428692A (https=) |
| AU (1) | AU2016217874A1 (https=) |
| BR (1) | BR112017017032A2 (https=) |
| CA (1) | CA2974874A1 (https=) |
| EA (1) | EA201791781A1 (https=) |
| IL (1) | IL253656A0 (https=) |
| MX (1) | MX2017010230A (https=) |
| TW (1) | TW201636327A (https=) |
| WO (1) | WO2016128465A1 (https=) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK2935222T3 (en) | 2012-12-21 | 2019-01-07 | Epizyme Inc | PRMT5 INHIBITORS AND APPLICATIONS THEREOF |
| CN106674085B (zh) * | 2016-12-20 | 2020-06-23 | 苏州汉德创宏生化科技有限公司 | N-1,3-二氟异丙基-4-氨基哌啶类化合物的合成方法 |
| CN108033909A (zh) * | 2017-12-20 | 2018-05-15 | 北京六合宁远科技有限公司 | 一种6-甲基-4-溴-异喹啉的制备方法 |
| CN108484489A (zh) * | 2018-05-25 | 2018-09-04 | 陈海鹏 | 一种含金刚烷取代基的吡啶类化合物及其在制备抗肿瘤药物中的用途 |
| CN108373443A (zh) * | 2018-05-25 | 2018-08-07 | 陈海鹏 | 一种含金刚烷取代基的吡啶类化合物及其在制备抗肿瘤药物中的用途 |
| CN108774167A (zh) * | 2018-05-25 | 2018-11-09 | 陈海鹏 | 一种含金刚烷取代基的吡啶类化合物及其在制备抗肿瘤药物中的用途 |
| CN110903286B (zh) * | 2019-12-16 | 2021-09-24 | 沈阳药科大学 | 4,6-双取代吡啶[3,2-d]嘧啶类化合物及其制备和应用 |
| US11691971B2 (en) | 2020-06-19 | 2023-07-04 | Incyte Corporation | Naphthyridinone compounds as JAK2 V617F inhibitors |
| WO2021257863A1 (en) | 2020-06-19 | 2021-12-23 | Incyte Corporation | Pyrrolotriazine compounds as jak2 v617f inhibitors |
| US11767323B2 (en) | 2020-07-02 | 2023-09-26 | Incyte Corporation | Tricyclic pyridone compounds as JAK2 V617F inhibitors |
| CR20230057A (es) | 2020-07-02 | 2023-08-15 | Incyte Corp | Compuestos tríciclicos de urea como inhibidores de jak2 v617f |
| US20230339936A1 (en) * | 2020-07-23 | 2023-10-26 | Cytosinlab Therapeutics Co. Ltd. | Compound having kinase inhibitory activity |
| WO2022026380A1 (en) * | 2020-07-29 | 2022-02-03 | Board Of Regents, The University Of Texas System | Urea inhibitors of micro-rna |
| US11661422B2 (en) | 2020-08-27 | 2023-05-30 | Incyte Corporation | Tricyclic urea compounds as JAK2 V617F inhibitors |
| US11919908B2 (en) | 2020-12-21 | 2024-03-05 | Incyte Corporation | Substituted pyrrolo[2,3-d]pyrimidine compounds as JAK2 V617F inhibitors |
| CN112876412B (zh) * | 2021-01-21 | 2022-05-24 | 温州大学 | 掺杂发光材料及其制备方法和应用 |
| AR125273A1 (es) | 2021-02-25 | 2023-07-05 | Incyte Corp | Lactamas espirocíclicas como inhibidores de jak2 v617f |
| WO2023143344A1 (zh) * | 2022-01-30 | 2023-08-03 | 微境生物医药科技(上海)有限公司 | 新型egfr抑制剂 |
| AU2023235313A1 (en) | 2022-03-17 | 2024-10-03 | Incyte Corporation | Tricyclic urea compounds as jak2 v617f inhibitors |
| AU2023247721A1 (en) * | 2022-03-31 | 2024-11-14 | Shanghai Shijiang Biotechnology Co., Ltd | Aromatic ring compound and use thereof |
| PE20251585A1 (es) * | 2022-10-12 | 2025-06-16 | Adama Makhteshim Ltd | Proceso para la preparacion de derivados de aminopiridazina |
| AR131541A1 (es) | 2023-01-07 | 2025-04-09 | Syngenta Crop Protection Ag | Compuestos de carboxamida novedosos |
| WO2025109114A1 (en) | 2023-11-24 | 2025-05-30 | Syngenta Crop Protection Ag | Novel carboxamide compounds |
| PY2501648A (es) | 2024-01-12 | 2025-10-31 | Syngenta Crop Protection Ag | Nuevos compuestos de carboxamida |
| WO2025149637A1 (en) | 2024-01-12 | 2025-07-17 | Syngenta Crop Protection Ag | Novel carboxamide compounds |
| WO2026008750A1 (en) | 2024-07-05 | 2026-01-08 | Syngenta Crop Protection Ag | Novel carboxamide compounds |
Family Cites Families (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SG64322A1 (en) | 1991-05-10 | 1999-04-27 | Rhone Poulenc Rorer Int | Bis mono and bicyclic aryl and heteroaryl compounds which inhibit egf and/or pdgf receptor tyrosine kinase |
| US5451596A (en) | 1992-12-29 | 1995-09-19 | Rhone Poulenc Rorer Pharmaceuticals Inc. | Cycloalkyl amine bis-aryl squalene synthase inhibitors |
| ES2316383T3 (es) | 1999-09-17 | 2009-04-16 | Millennium Pharmaceuticals, Inc. | Benzamidas e inhibidores relacionados del factor xa. |
| EP1217000A1 (en) | 2000-12-23 | 2002-06-26 | Aventis Pharma Deutschland GmbH | Inhibitors of factor Xa and factor VIIa |
| WO2004087153A2 (en) | 2003-03-28 | 2004-10-14 | Chiron Corporation | Use of organic compounds for immunopotentiation |
| AR045944A1 (es) | 2003-09-24 | 2005-11-16 | Novartis Ag | Derivados de isoquinolina 1.4-disustituidas |
| US7282506B2 (en) * | 2004-08-03 | 2007-10-16 | Serenex, Inc. | 2,8-disubstituted naphthyridine derivatives |
| US20070287707A1 (en) * | 2006-02-28 | 2007-12-13 | Arrington Mark P | Phosphodiesterase 10 inhibitors |
| US20090099175A1 (en) | 2006-03-01 | 2009-04-16 | Arrington Mark P | Phosphodiesterase 10 inhibitors |
| WO2007103554A1 (en) | 2006-03-08 | 2007-09-13 | Amgen Inc. | Quinoline and isoquinoline derivatives as phosphodiesterase 10 inhibitors |
| US20090062277A1 (en) | 2007-08-21 | 2009-03-05 | Essa Hu | Phosphodiesterase 10 inhibitors |
| AU2010221417A1 (en) | 2009-03-02 | 2011-09-22 | Sirtris Pharmaceuticals, Inc. | 8-substituted quinolines and related analogs as sirtuin modulators |
| GB0905441D0 (en) | 2009-03-30 | 2009-05-13 | Syngenta Ltd | Herbicidal compounds |
| KR20120006016A (ko) * | 2009-04-06 | 2012-01-17 | 다이이찌 산쿄 가부시키가이샤 | 치환 페닐기를 갖는 고리형 화합물 |
| TW201116281A (en) | 2009-08-06 | 2011-05-16 | Astellas Pharma Inc | N atom containing ring acylguanidine derivatives |
| TW201311149A (zh) * | 2011-06-24 | 2013-03-16 | Ishihara Sangyo Kaisha | 有害生物防治劑 |
| WO2013142390A1 (en) | 2012-03-21 | 2013-09-26 | Gtx, Inc. | Aldo-keto reductase subfamily 1c3 (akr1c3) inhibitors |
| CN104812387A (zh) * | 2012-11-20 | 2015-07-29 | 霍夫曼-拉罗奇有限公司 | 取代的1,6-萘啶 |
| US9321786B2 (en) | 2013-03-15 | 2016-04-26 | Celgene Avilomics Research, Inc. | Heteroaryl compounds and uses thereof |
| CN105163727B (zh) * | 2013-05-03 | 2018-08-17 | 豪夫迈·罗氏有限公司 | 刺激神经发生的异喹啉衍生物 |
| ES2750236T3 (es) | 2013-12-09 | 2020-03-25 | UCB Biopharma SRL | Derivados heteroaromáticos bicíclicos condensados como moduladores de la actividad del TNF |
| JP2017522324A (ja) | 2014-07-17 | 2017-08-10 | メルク パテント ゲゼルシャフト ミット ベシュレンクテル ハフツングMerck Patent Gesellschaft mit beschraenkter Haftung | 新規ナフチリジン及びイソキノリンならびにcdk8/19阻害剤としてのその使用 |
| WO2018119263A1 (en) | 2016-12-22 | 2018-06-28 | Incyte Corporation | Heterocyclic compounds derivatives as pd-l1 internalization inducers |
-
2016
- 2016-02-10 EP EP16703791.0A patent/EP3256217A1/en not_active Withdrawn
- 2016-02-10 CN CN201680009637.4A patent/CN107428692A/zh active Pending
- 2016-02-10 CA CA2974874A patent/CA2974874A1/en not_active Abandoned
- 2016-02-10 KR KR1020177025452A patent/KR20170117479A/ko not_active Withdrawn
- 2016-02-10 WO PCT/EP2016/052828 patent/WO2016128465A1/en not_active Ceased
- 2016-02-10 BR BR112017017032A patent/BR112017017032A2/pt not_active Application Discontinuation
- 2016-02-10 EA EA201791781A patent/EA201791781A1/ru unknown
- 2016-02-10 AU AU2016217874A patent/AU2016217874A1/en not_active Abandoned
- 2016-02-10 MX MX2017010230A patent/MX2017010230A/es unknown
- 2016-02-10 US US15/545,149 patent/US10487075B2/en not_active Expired - Fee Related
- 2016-02-10 JP JP2017542888A patent/JP2018505207A/ja not_active Ceased
- 2016-02-15 TW TW105104357A patent/TW201636327A/zh unknown
-
2017
- 2017-07-25 IL IL253656A patent/IL253656A0/en unknown
-
2019
- 2019-10-04 US US16/593,231 patent/US20200031811A1/en not_active Abandoned
Also Published As
| Publication number | Publication date |
|---|---|
| US20200031811A1 (en) | 2020-01-30 |
| BR112017017032A2 (pt) | 2018-04-10 |
| KR20170117479A (ko) | 2017-10-23 |
| EA201791781A1 (ru) | 2018-02-28 |
| IL253656A0 (en) | 2017-09-28 |
| US10487075B2 (en) | 2019-11-26 |
| CA2974874A1 (en) | 2016-08-18 |
| WO2016128465A1 (en) | 2016-08-18 |
| AU2016217874A1 (en) | 2017-08-10 |
| US20180002321A1 (en) | 2018-01-04 |
| EP3256217A1 (en) | 2017-12-20 |
| MX2017010230A (es) | 2017-12-04 |
| CN107428692A (zh) | 2017-12-01 |
| JP2018505207A (ja) | 2018-02-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| TW201636327A (zh) | 被取代的單氮雜萘衍生物和多氮雜萘衍生物及其用途 | |
| CN107072985B (zh) | 治疗性抑制化合物 | |
| TW202309025A (zh) | Parp1抑制劑及其用途 | |
| CN103097384B (zh) | 取代的咪唑并[1,2‑a]嘧啶和吡啶 | |
| TWI532727B (zh) | 吡羧醯胺化合物 | |
| TW202409002A (zh) | 作用於g12d突變kras蛋白之雜環化合物 | |
| CN104507933B (zh) | 氨基喹唑啉和吡啶并嘧啶衍生物 | |
| TW202334169A (zh) | 六元環並噻唑類化合物及其應用 | |
| CN112469720B (zh) | 用于抗肿瘤疗法中的双重atm和dna-pk抑制剂 | |
| CN112105609A (zh) | 作为prmt5抑制剂的取代的咪唑烷-2-酮衍生物 | |
| TWI481601B (zh) | 含氮化合物及藥學組成物 | |
| TWI721104B (zh) | 6‐芳基或6‐雜芳基‐4‐嗎啉‐4‐芳基‐吡啶‐2‐酮化合物 | |
| KR20140071384A (ko) | C-kit 키나제 억제제로서의 화합물 및 조성물 | |
| TWI639601B (zh) | Syk抑制劑 | |
| CN117177972A (zh) | Parp1抑制剂及其用途 | |
| CN113943294A (zh) | 一种作为btk抑制剂的化合物及其制备方法与用途 | |
| WO2020215998A1 (zh) | 嘧啶并五元杂环类化合物及其作为突变型idh2抑制剂的用途 | |
| WO2021197250A1 (zh) | 作为转染期间重排激酶抑制剂的新的化合物 | |
| US20220388962A1 (en) | Molecules that bind to tdp-43 for the treatment of amyotrophic lateral sclerosis and related disorders | |
| TW201902894A (zh) | 用於治療寄生疾病之5,6-稠合-雙環化合物及組合物 | |
| TW202444351A (zh) | 聯芳基衍生物及相關用途 | |
| TWI781506B (zh) | 雜環亞碸亞胺化合物及其中間體、製備方法和應用 | |
| TW202442645A (zh) | 經取代的1H-吡唑并[4,3-c]喹啉、製備方法及其用途 | |
| CN114901646A (zh) | 苯并三嗪双氧化物及其药物组合物 | |
| HK40105522A (zh) | Parp1抑制剂及其用途 |