SU633473A3 - Способ получени производных пиперидина или их солей - Google Patents
Способ получени производных пиперидина или их солейInfo
- Publication number
- SU633473A3 SU633473A3 SU762415648A SU2415648A SU633473A3 SU 633473 A3 SU633473 A3 SU 633473A3 SU 762415648 A SU762415648 A SU 762415648A SU 2415648 A SU2415648 A SU 2415648A SU 633473 A3 SU633473 A3 SU 633473A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- piperidine
- salts
- piperidine derivatives
- salt
- general formula
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 3
- 150000003053 piperidines Chemical class 0.000 title claims description 3
- 150000003839 salts Chemical class 0.000 title claims 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 150000002431 hydrogen Chemical group 0.000 claims description 2
- HEMZNKOBGSXYFU-UHFFFAOYSA-N 2-(phenoxymethyl)pyridine Chemical class C=1C=CC=NC=1COC1=CC=CC=C1 HEMZNKOBGSXYFU-UHFFFAOYSA-N 0.000 claims 1
- 239000002253 acid Substances 0.000 claims 1
- 125000003545 alkoxy group Chemical group 0.000 claims 1
- 125000000217 alkyl group Chemical group 0.000 claims 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 claims 1
- 229910052736 halogen Inorganic materials 0.000 claims 1
- 150000002367 halogens Chemical group 0.000 claims 1
- 150000002391 heterocyclic compounds Chemical class 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- VYBZUXRVMWVTEB-UHFFFAOYSA-N 4-(phenoxymethyl)pyridine Chemical compound C=1C=NC=CC=1COC1=CC=CC=C1 VYBZUXRVMWVTEB-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- -1 4- (2-Bromphenoxymethyl) -piperidine 4- (2-Chlorphenoxymethyl) -piperidine 4- (3-Chlorophenoxymethyl) -piperidine 4- (4-Chlorphenoxymethyl) -piperidine 4- (2-Fluorophenoxymethyl) -piperidine Chemical compound 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 229910003446 platinum oxide Inorganic materials 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- ZDHKVKPZQKYREU-UHFFFAOYSA-N 4-(chloromethyl)pyridine;hydron;chloride Chemical compound Cl.ClCC1=CC=NC=C1 ZDHKVKPZQKYREU-UHFFFAOYSA-N 0.000 description 1
- SVJZXTDZALYYRB-UHFFFAOYSA-N 4-[(2-nitrophenoxy)methyl]piperidine Chemical compound [O-][N+](=O)C1=CC=CC=C1OCC1CCNCC1 SVJZXTDZALYYRB-UHFFFAOYSA-N 0.000 description 1
- OIRBFUKKCSYAKX-UHFFFAOYSA-N 4-[(4-methylphenoxy)methyl]piperidine Chemical compound C1=CC(C)=CC=C1OCC1CCNCC1 OIRBFUKKCSYAKX-UHFFFAOYSA-N 0.000 description 1
- YZCKVEUIGOORGS-OUBTZVSYSA-N Deuterium Chemical compound [2H] YZCKVEUIGOORGS-OUBTZVSYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical compound C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- PTMBWNZJOQBTBK-UHFFFAOYSA-N pyridin-4-ylmethanol Chemical compound OCC1=CC=NC=C1 PTMBWNZJOQBTBK-UHFFFAOYSA-N 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/08—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms
- C07D211/18—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D211/20—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms with hydrocarbon radicals, substituted by singly bound oxygen or sulphur atoms
- C07D211/22—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms with hydrocarbon radicals, substituted by singly bound oxygen or sulphur atoms by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/08—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms
- C07D211/18—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Hydrogenated Pyridines (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19752549999 DE2549999A1 (de) | 1975-11-07 | 1975-11-07 | Piperidin-derivate und verfahren zu ihrer herstellung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU633473A3 true SU633473A3 (ru) | 1978-11-15 |
Family
ID=5961166
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU762415648A SU633473A3 (ru) | 1975-11-07 | 1976-11-02 | Способ получени производных пиперидина или их солей |
| SU772534004A SU867298A3 (ru) | 1975-11-07 | 1977-10-21 | Способ получени производных пиперидина или их солей |
| SU772534003A SU662009A3 (ru) | 1975-11-07 | 1977-10-21 | Способ получени производных пиперидина или их солей |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU772534004A SU867298A3 (ru) | 1975-11-07 | 1977-10-21 | Способ получени производных пиперидина или их солей |
| SU772534003A SU662009A3 (ru) | 1975-11-07 | 1977-10-21 | Способ получени производных пиперидина или их солей |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US4243807A (enExample) |
| JP (1) | JPS6055509B2 (enExample) |
| AT (1) | AT352726B (enExample) |
| BE (1) | BE847973A (enExample) |
| CA (1) | CA1077942A (enExample) |
| CH (3) | CH624102A5 (enExample) |
| DD (1) | DD126942A5 (enExample) |
| DE (1) | DE2549999A1 (enExample) |
| DK (1) | DK494876A (enExample) |
| FI (1) | FI763148A7 (enExample) |
| FR (1) | FR2330678A1 (enExample) |
| GB (1) | GB1502050A (enExample) |
| HU (1) | HU171237B (enExample) |
| IE (1) | IE43866B1 (enExample) |
| IT (1) | IT1063618B (enExample) |
| LU (1) | LU76141A1 (enExample) |
| NL (1) | NL7612286A (enExample) |
| SE (1) | SE7612234L (enExample) |
| SU (3) | SU633473A3 (enExample) |
| ZA (1) | ZA766381B (enExample) |
Families Citing this family (38)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ZA848275B (en) * | 1983-12-28 | 1985-08-28 | Degussa | New piridine-2-ethers or pyridine-2-thioethers having a nitrogen-containing cycloaliphatic ring |
| US4556664A (en) * | 1984-03-13 | 1985-12-03 | Gunnar A. K. Aberg | Method and composition for the treatment of cardiac arrhythmias |
| IE66332B1 (en) * | 1986-11-03 | 1995-12-27 | Novo Nordisk As | Piperidine compounds and their preparation and use |
| US5231184A (en) * | 1987-11-23 | 1993-07-27 | Janssen Pharmaceutica N.V. | Pridazinamine derivatives |
| US4822778A (en) * | 1988-01-19 | 1989-04-18 | Gunnar Aberg | Membrane stabilizing phenoxy-piperidine compounds and pharmaceutical compositions employing such compounds |
| US5109002A (en) * | 1989-09-08 | 1992-04-28 | Du Pont Merck Pharmaceutical Company | Antipsychotic 1-cycloalkylpiperidines |
| NZ239846A (en) * | 1990-09-27 | 1994-11-25 | Merck & Co Inc | Sulphonamide derivatives and pharmaceutical compositions thereof |
| IL99537A (en) * | 1990-09-27 | 1995-11-27 | Merck & Co Inc | Fibrinogen receptor antagonists and pharmaceutical compositions containing them |
| US5264420A (en) * | 1990-09-27 | 1993-11-23 | Merck & Co., Inc. | Fibrinogen receptor antagonists |
| FR2667317B1 (fr) * | 1990-10-02 | 1992-12-04 | Synthelabo | Derives de 2-aminopyrimidine-4-carboxamide, leur preparation et leur application en therapeutique. |
| US5321034A (en) * | 1991-05-07 | 1994-06-14 | Merck & Co., Inc. | Fibrinogen receptor antagonists |
| FI934894L (fi) * | 1991-05-07 | 1993-11-05 | Merck & Co Inc | Fibrinogenreceptorantagonister |
| US5416099A (en) * | 1991-10-29 | 1995-05-16 | Merck & Co., Inc. | Fibrinogen receptor antagonists |
| US5272158A (en) * | 1991-10-29 | 1993-12-21 | Merck & Co., Inc. | Fibrinogen receptor antagonists |
| US5389631A (en) * | 1991-10-29 | 1995-02-14 | Merck & Co., Inc. | Fibrinogen receptor antagonists |
| CA2144763A1 (en) * | 1992-10-14 | 1994-04-28 | George D. Hartman | Fibrinogen receptor antagonists |
| US5358956A (en) * | 1992-10-14 | 1994-10-25 | Merck & Co., Inc. | Fibrinogen receptor antagonists |
| CA2150550A1 (en) * | 1992-12-01 | 1994-06-09 | Melissa S. Egbertson | Fibrinogen receptor antagonists |
| US5441952A (en) * | 1993-04-05 | 1995-08-15 | Merck & Co., Inc. | Fibrinogen receptor antagonists |
| US5334596A (en) * | 1993-05-11 | 1994-08-02 | Merck & Co., Inc. | Fibrinogen receptor antagonists |
| US5397791A (en) * | 1993-08-09 | 1995-03-14 | Merck & Co., Inc. | Fibrinogen receptor antagonists |
| US5821241A (en) * | 1994-02-22 | 1998-10-13 | Merck & Co., Inc. | Fibrinogen receptor antagonists |
| US5719144A (en) * | 1995-02-22 | 1998-02-17 | Merck & Co., Inc. | Fibrinogen receptor antagonists |
| US5750147A (en) | 1995-06-07 | 1998-05-12 | Emisphere Technologies, Inc. | Method of solubilizing and encapsulating itraconazole |
| CN1125814C (zh) * | 1995-09-28 | 2003-10-29 | 科研制药株式会社 | 4-亚甲基哌啶的制备方法 |
| US5789421A (en) * | 1995-10-26 | 1998-08-04 | Merck & Co., Inc. | Fibrinogen receptor antagonist |
| US5780480A (en) * | 1996-02-28 | 1998-07-14 | Merck & Co., Inc. | Fibrinogen receptor antagonists |
| US5889023A (en) * | 1996-05-10 | 1999-03-30 | Merck & Co., Inc. | Fibrinogen receptor antagonist |
| US5981584A (en) * | 1997-02-06 | 1999-11-09 | Merck & Co., Inc. | Fibrinogen receptor antagonist prodrugs |
| ES2434250T3 (es) | 2008-07-24 | 2013-12-16 | Theravance, Inc. | Compuestos de 3-(fenoxifenilmetil)pirrolidina |
| PT2358675E (pt) | 2008-11-14 | 2012-12-12 | Theravance Inc | Compostos de 4-[2-(2-fluorofenoximetil)fenil]piperidina |
| WO2010120910A1 (en) * | 2009-04-15 | 2010-10-21 | Theravance, Inc. | 3-(phenoxypyrrolidin-3-yl-methyl)heteroaryl, 3-(phenylpyrrolidin-3-ylmethoxy)heteroaryl, and 3-(heteroarylpyrrolidin-3-ylmethoxy)heteroaryl compounds |
| US7994209B2 (en) * | 2009-07-13 | 2011-08-09 | Theravance, Inc. | 3-phenoxymethylpyrrolidine compounds |
| JP5714580B2 (ja) | 2009-07-21 | 2015-05-07 | セラヴァンス バイオファーマ アール&ディー アイピー, エルエルシー | 3−フェノキシメチルピロリジン化合物 |
| US8778949B2 (en) * | 2010-01-11 | 2014-07-15 | Theravance Biopharma R&D Ip, Llc | 1-(2-phenoxymethylphenyl)piperazine compounds |
| ES2543064T3 (es) * | 2010-03-22 | 2015-08-14 | Theravance Biopharma R&D Ip, Llc | Compuestos de 1-(2-fenoximetilheteroaril)piperidina y piperazina |
| ES2533434T3 (es) | 2010-10-11 | 2015-04-10 | Theravance Biopharma R&D Ip, Llc | Inhibidores de la captación de la serotonina |
| WO2012075239A1 (en) | 2010-12-03 | 2012-06-07 | Theravance, Inc. | Serotonin reuptake inhibitors |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1268951A (en) * | 1969-06-12 | 1972-03-29 | Pfizer Ltd | Phenoxy-amines |
| DE2245061A1 (de) * | 1972-09-14 | 1974-03-28 | Boehringer Mannheim Gmbh | Derivate des adenins |
| DE2401254A1 (de) * | 1974-01-11 | 1975-11-27 | Boehringer Mannheim Gmbh | Neue derivate von n hoch 6-substituierten adeninen |
| DE2550000A1 (de) * | 1975-11-07 | 1977-05-12 | Boehringer Mannheim Gmbh | Neue purin-derivate und verfahren zu ihrer herstellung |
-
1975
- 1975-11-07 DE DE19752549999 patent/DE2549999A1/de active Granted
-
1976
- 1976-10-25 ZA ZA766381A patent/ZA766381B/xx unknown
- 1976-10-28 CA CA264,608A patent/CA1077942A/en not_active Expired
- 1976-10-29 IE IE2394/76A patent/IE43866B1/en unknown
- 1976-11-01 US US05/737,518 patent/US4243807A/en not_active Expired - Lifetime
- 1976-11-01 HU HU76BO00001639A patent/HU171237B/hu not_active IP Right Cessation
- 1976-11-02 DK DK494876A patent/DK494876A/da not_active Application Discontinuation
- 1976-11-02 SU SU762415648A patent/SU633473A3/ru active
- 1976-11-03 CH CH1385576A patent/CH624102A5/de not_active IP Right Cessation
- 1976-11-03 SE SE7612234A patent/SE7612234L/xx not_active Application Discontinuation
- 1976-11-03 FI FI763148A patent/FI763148A7/fi not_active Application Discontinuation
- 1976-11-04 GB GB45916/76A patent/GB1502050A/en not_active Expired
- 1976-11-04 BE BE172068A patent/BE847973A/xx not_active IP Right Cessation
- 1976-11-04 DD DD195610A patent/DD126942A5/xx unknown
- 1976-11-05 AT AT823776A patent/AT352726B/de not_active IP Right Cessation
- 1976-11-05 NL NL7612286A patent/NL7612286A/xx not_active Application Discontinuation
- 1976-11-05 LU LU76141A patent/LU76141A1/xx unknown
- 1976-11-05 JP JP51133139A patent/JPS6055509B2/ja not_active Expired
- 1976-11-05 FR FR7633389A patent/FR2330678A1/fr active Granted
- 1976-11-05 IT IT29083/76A patent/IT1063618B/it active
-
1977
- 1977-10-21 SU SU772534004A patent/SU867298A3/ru active
- 1977-10-21 SU SU772534003A patent/SU662009A3/ru active
-
1980
- 1980-10-03 CH CH742480A patent/CH627166A5/de not_active IP Right Cessation
- 1980-10-03 CH CH742380A patent/CH625788A5/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| CH625788A5 (enExample) | 1981-10-15 |
| FI763148A7 (enExample) | 1977-05-08 |
| IE43866L (en) | 1977-05-07 |
| CA1077942A (en) | 1980-05-20 |
| FR2330678A1 (fr) | 1977-06-03 |
| SU662009A3 (ru) | 1979-05-05 |
| NL7612286A (nl) | 1977-05-10 |
| US4243807A (en) | 1981-01-06 |
| DE2549999A1 (de) | 1977-05-12 |
| GB1502050A (en) | 1978-02-22 |
| SE7612234L (sv) | 1977-05-07 |
| JPS5259163A (en) | 1977-05-16 |
| SU867298A3 (ru) | 1981-09-23 |
| AT352726B (de) | 1979-10-10 |
| JPS6055509B2 (ja) | 1985-12-05 |
| ATA823776A (de) | 1979-03-15 |
| DD126942A5 (enExample) | 1977-08-24 |
| ZA766381B (en) | 1977-10-26 |
| LU76141A1 (enExample) | 1977-05-18 |
| CH627166A5 (enExample) | 1981-12-31 |
| BE847973A (fr) | 1977-05-04 |
| IE43866B1 (en) | 1981-06-17 |
| HU171237B (hu) | 1977-12-28 |
| FR2330678B1 (enExample) | 1980-11-07 |
| IT1063618B (it) | 1985-02-11 |
| DE2549999C2 (enExample) | 1989-01-26 |
| CH624102A5 (enExample) | 1981-07-15 |
| DK494876A (da) | 1977-05-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU633473A3 (ru) | Способ получени производных пиперидина или их солей | |
| SU575025A3 (ru) | Способ получени 4-арил-1,4-дигидропиридинов или их солей | |
| SU668599A3 (ru) | Способ получени пирролидин или пиперидинпроизводных бензамидов или их солей | |
| SU513620A3 (ru) | Способ получени сложных эфиров 1,4-дигидропиридинкарбоновой кислоты или их солей | |
| GB2126580A (en) | Heterocyclic oxyphenols | |
| NO764299L (enExample) | ||
| SU464997A3 (ru) | Способ получени -арил-4замещенных пиперидино-алканольных производных | |
| US2695290A (en) | Derivatives of indole and method for the production thereof | |
| US2355659A (en) | Piperidine derivatives and process for the manufacture of the same | |
| SU679136A3 (ru) | Способ получени производного пиперидина или его солей | |
| US4474783A (en) | Cyclopropylmethyl piperazines, the process for preparing the same and their use in therapeutics | |
| US2546159A (en) | Piperidyl ketones and process of | |
| US2771469A (en) | Quaternary ammonium salts of deltahydrocarbyoxyphenyl gamma-hydroxy amines | |
| NO130329B (enExample) | ||
| US2626948A (en) | 1-alkyl-2 or 4-[(n-alkyl-n-beta-dialkyl-aminoalkyl) aminophenethyl]-piperidines and salts thereof | |
| US3051710A (en) | Glycolic acid amide derivatives of piperazine and use thereof | |
| US2688618A (en) | Basic caffeine derivatives | |
| SU563915A3 (ru) | Способ получени 2-оксиметил3-фенил-4/3н/-хиназолинона или его соли | |
| US3128277A (en) | Lower alkyl-a | |
| US3733338A (en) | 1-oxo-isochromenes | |
| US2650231A (en) | Aminovalerolactones and method for their production | |
| US4029786A (en) | Morpholine derivatives for treating depression | |
| NO142103B (no) | Soppdrepende middel for anvendelse i og paa landbruksprodukter | |
| US3093651A (en) | Nu-alkyl-2-(2-[9-carbazolyl-ethyl])-piperidines | |
| US2576970A (en) | 3-(methylpyrrolidyl-1)propyl para(delta 2)-cyclohexenyloxybenzoates and salts thereof |