SU618038A3 - Способ получени производных фенилалканкарбоновых кислот,их солей, сложных эфиров или амидов - Google Patents
Способ получени производных фенилалканкарбоновых кислот,их солей, сложных эфиров или амидовInfo
- Publication number
- SU618038A3 SU618038A3 SU762346106A SU2346106A SU618038A3 SU 618038 A3 SU618038 A3 SU 618038A3 SU 762346106 A SU762346106 A SU 762346106A SU 2346106 A SU2346106 A SU 2346106A SU 618038 A3 SU618038 A3 SU 618038A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- acid
- square
- phenyl
- ethyl
- propionic acid
- Prior art date
Links
- 150000002148 esters Chemical class 0.000 title abstract description 12
- 150000003839 salts Chemical class 0.000 title abstract description 7
- 150000001408 amides Chemical class 0.000 title abstract description 5
- 238000000034 method Methods 0.000 title abstract description 5
- 239000002253 acid Substances 0.000 title description 28
- 125000003545 alkoxy group Chemical group 0.000 abstract description 5
- 125000000217 alkyl group Chemical group 0.000 abstract description 5
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 abstract description 4
- 238000002360 preparation method Methods 0.000 abstract description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract description 2
- 125000004432 carbon atom Chemical group C* 0.000 abstract 3
- 125000003710 aryl alkyl group Chemical group 0.000 abstract 2
- 125000003609 aryl vinyl group Chemical group 0.000 abstract 2
- 125000004104 aryloxy group Chemical group 0.000 abstract 2
- 229910052736 halogen Inorganic materials 0.000 abstract 2
- 125000000623 heterocyclic group Chemical group 0.000 abstract 2
- 125000003302 alkenyloxy group Chemical group 0.000 abstract 1
- 125000005083 alkoxyalkoxy group Chemical group 0.000 abstract 1
- 125000004414 alkyl thio group Chemical group 0.000 abstract 1
- 125000003118 aryl group Chemical group 0.000 abstract 1
- 125000005160 aryl oxy alkyl group Chemical group 0.000 abstract 1
- 125000005843 halogen group Chemical group 0.000 abstract 1
- 150000002367 halogens Chemical class 0.000 abstract 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 abstract 1
- 230000000055 hyoplipidemic effect Effects 0.000 abstract 1
- 230000002218 hypoglycaemic effect Effects 0.000 abstract 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 abstract 1
- 229920006395 saturated elastomer Polymers 0.000 abstract 1
- 125000001424 substituent group Chemical group 0.000 abstract 1
- 125000003107 substituted aryl group Chemical group 0.000 abstract 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 abstract 1
- -1 (6-Chlorchroman 2 carboxamido) - Chemical class 0.000 description 67
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 53
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 47
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 40
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 38
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 38
- 229940095574 propionic acid Drugs 0.000 description 37
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 30
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 30
- 125000004494 ethyl ester group Chemical group 0.000 description 26
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 21
- 239000000243 solution Substances 0.000 description 21
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 20
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 18
- 239000000203 mixture Substances 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 16
- 235000011121 sodium hydroxide Nutrition 0.000 description 12
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 10
- 235000019260 propionic acid Nutrition 0.000 description 10
- JVLUMHRASWENRU-UHFFFAOYSA-N 5-chloro-2-methoxybenzoyl chloride Chemical compound COC1=CC=C(Cl)C=C1C(Cl)=O JVLUMHRASWENRU-UHFFFAOYSA-N 0.000 description 9
- 150000001875 compounds Chemical class 0.000 description 9
- 239000000460 chlorine Substances 0.000 description 8
- 229910052801 chlorine Inorganic materials 0.000 description 8
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 8
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 7
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 7
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 7
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- 230000003993 interaction Effects 0.000 description 6
- 159000000000 sodium salts Chemical class 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 5
- 230000032050 esterification Effects 0.000 description 5
- 238000005886 esterification reaction Methods 0.000 description 5
- 239000012074 organic phase Substances 0.000 description 5
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 4
- 239000002655 kraft paper Substances 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- WBYWAXJHAXSJNI-VOTSOKGWSA-M .beta-Phenylacrylic acid Natural products [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 3
- XMIIGOLPHOKFCH-UHFFFAOYSA-N 3-phenylpropionic acid Chemical compound OC(=O)CCC1=CC=CC=C1 XMIIGOLPHOKFCH-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 235000001014 amino acid Nutrition 0.000 description 3
- 150000001735 carboxylic acids Chemical class 0.000 description 3
- 229930016911 cinnamic acid Natural products 0.000 description 3
- 235000013985 cinnamic acid Nutrition 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 150000004702 methyl esters Chemical class 0.000 description 3
- WBYWAXJHAXSJNI-UHFFFAOYSA-N methyl p-hydroxycinnamate Natural products OC(=O)C=CC1=CC=CC=C1 WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 description 3
- FBUKVWPVBMHYJY-UHFFFAOYSA-N nonanoic acid Chemical compound CCCCCCCCC(O)=O FBUKVWPVBMHYJY-UHFFFAOYSA-N 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 238000007127 saponification reaction Methods 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- JOLPMPPNHIACPD-ZZXKWVIFSA-N (e)-3-(4-aminophenyl)prop-2-enoic acid Chemical compound NC1=CC=C(\C=C\C(O)=O)C=C1 JOLPMPPNHIACPD-ZZXKWVIFSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- RKIDDEGICSMIJA-UHFFFAOYSA-N 4-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=C(Cl)C=C1 RKIDDEGICSMIJA-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- WBYWAXJHAXSJNI-SREVYHEPSA-N Cinnamic acid Chemical compound OC(=O)\C=C/C1=CC=CC=C1 WBYWAXJHAXSJNI-SREVYHEPSA-N 0.000 description 2
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 150000001413 amino acids Chemical class 0.000 description 2
- 229960004050 aminobenzoic acid Drugs 0.000 description 2
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- LBAQSKZHMLAFHH-UHFFFAOYSA-N ethoxyethane;hydron;chloride Chemical compound Cl.CCOCC LBAQSKZHMLAFHH-UHFFFAOYSA-N 0.000 description 2
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 238000006386 neutralization reaction Methods 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 238000001226 reprecipitation Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- GHPYJLCQYMAXGG-WCCKRBBISA-N (2R)-2-amino-3-(2-boronoethylsulfanyl)propanoic acid hydrochloride Chemical compound Cl.N[C@@H](CSCCB(O)O)C(O)=O GHPYJLCQYMAXGG-WCCKRBBISA-N 0.000 description 1
- KXKYMEWDPWQCQT-UHFFFAOYSA-N 1-[3-(2-aminoethyl)phenyl]ethanone Chemical compound CC(=O)C1=CC=CC(CCN)=C1 KXKYMEWDPWQCQT-UHFFFAOYSA-N 0.000 description 1
- WOMVICAMAQURRN-UHFFFAOYSA-N 2-(4-aminophenyl)propanoic acid Chemical compound OC(=O)C(C)C1=CC=C(N)C=C1 WOMVICAMAQURRN-UHFFFAOYSA-N 0.000 description 1
- IDZLDUPVMGWZLD-UHFFFAOYSA-N 2-methyl-2-phenylbutanoic acid Chemical compound CCC(C)(C(O)=O)C1=CC=CC=C1 IDZLDUPVMGWZLD-UHFFFAOYSA-N 0.000 description 1
- TWOLQIUHVMTAAE-UHFFFAOYSA-N 2-phenylsulfanylacetyl chloride Chemical compound ClC(=O)CSC1=CC=CC=C1 TWOLQIUHVMTAAE-UHFFFAOYSA-N 0.000 description 1
- UFOCOVKCWBLLTC-UHFFFAOYSA-N 3-[4-(2-acetamidoethyl)phenyl]prop-2-enoic acid Chemical compound CC(=O)NCCC1=CC=C(C=CC(O)=O)C=C1 UFOCOVKCWBLLTC-UHFFFAOYSA-N 0.000 description 1
- QALISGZCAUUYPI-UHFFFAOYSA-N 3-[4-(2-aminoethyl)phenyl]prop-2-enoic acid;hydrochloride Chemical compound Cl.NCCC1=CC=C(C=CC(O)=O)C=C1 QALISGZCAUUYPI-UHFFFAOYSA-N 0.000 description 1
- ZPNZCRSSEYJEMN-UHFFFAOYSA-N 3-[4-[(5-chloro-2-ethoxybenzoyl)amino]phenyl]prop-2-enoic acid Chemical compound CCOC1=CC=C(Cl)C=C1C(=O)NC1=CC=C(C=CC(O)=O)C=C1 ZPNZCRSSEYJEMN-UHFFFAOYSA-N 0.000 description 1
- NMJDWNDGFCTDNP-UHFFFAOYSA-N 3-chloro-2-methoxybenzoyl chloride Chemical compound COC1=C(Cl)C=CC=C1C(Cl)=O NMJDWNDGFCTDNP-UHFFFAOYSA-N 0.000 description 1
- YHOYYHYBFSYOSQ-UHFFFAOYSA-N 3-methylbenzoyl chloride Chemical compound CC1=CC=CC(C(Cl)=O)=C1 YHOYYHYBFSYOSQ-UHFFFAOYSA-N 0.000 description 1
- GFUFUJMSZWBPNH-UHFFFAOYSA-N 4-(2-acetamidoethyl)benzoic acid Chemical compound CC(=O)NCCC1=CC=C(C(O)=O)C=C1 GFUFUJMSZWBPNH-UHFFFAOYSA-N 0.000 description 1
- UFNZEQYWUUSELY-UHFFFAOYSA-N 4-(2-acetamidopropyl)benzoic acid Chemical compound CC(=O)NC(C)CC1=CC=C(C(O)=O)C=C1 UFNZEQYWUUSELY-UHFFFAOYSA-N 0.000 description 1
- MDUXCQKPDCOYJQ-UHFFFAOYSA-N 4-chloro-n-(2-chloroethyl)benzamide Chemical compound ClCCNC(=O)C1=CC=C(Cl)C=C1 MDUXCQKPDCOYJQ-UHFFFAOYSA-N 0.000 description 1
- CVICEEPAFUYBJG-UHFFFAOYSA-N 5-chloro-2,2-difluoro-1,3-benzodioxole Chemical group C1=C(Cl)C=C2OC(F)(F)OC2=C1 CVICEEPAFUYBJG-UHFFFAOYSA-N 0.000 description 1
- ZVSXKFNTWOIGJI-UHFFFAOYSA-N 7-phenyl heptanoic acid Chemical compound OC(=O)CCCCCCC1=CC=CC=C1 ZVSXKFNTWOIGJI-UHFFFAOYSA-N 0.000 description 1
- FBEHFRAORPEGFH-UHFFFAOYSA-N Allyxycarb Chemical compound CNC(=O)OC1=CC(C)=C(N(CC=C)CC=C)C(C)=C1 FBEHFRAORPEGFH-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 229940123208 Biguanide Drugs 0.000 description 1
- DQILADXEXOXXKK-UHFFFAOYSA-N Cl.C(C)OC(C(C)C1=CC=CC=C1)=O Chemical compound Cl.C(C)OC(C(C)C1=CC=CC=C1)=O DQILADXEXOXXKK-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- PRKQVKDSMLBJBJ-UHFFFAOYSA-N ammonium carbonate Chemical class N.N.OC(O)=O PRKQVKDSMLBJBJ-UHFFFAOYSA-N 0.000 description 1
- 239000001099 ammonium carbonate Substances 0.000 description 1
- 235000011162 ammonium carbonates Nutrition 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 150000004283 biguanides Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000005518 carboxamido group Chemical group 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- ITVPBBDAZKBMRP-UHFFFAOYSA-N chloro-dioxido-oxo-$l^{5}-phosphane;hydron Chemical compound OP(O)(Cl)=O ITVPBBDAZKBMRP-UHFFFAOYSA-N 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- JUHDXEXFNTZIGG-UHFFFAOYSA-N ethene 2-phenylpropanoic acid Chemical compound C1(=CC=CC=C1)C(C(=O)O)C.C=C JUHDXEXFNTZIGG-UHFFFAOYSA-N 0.000 description 1
- XKCZVOWGVYXSAQ-UHFFFAOYSA-N ethyl 2-[4-(2-aminoethyl)phenyl]propanoate;hydrochloride Chemical compound Cl.CCOC(=O)C(C)C1=CC=C(CCN)C=C1 XKCZVOWGVYXSAQ-UHFFFAOYSA-N 0.000 description 1
- RMKRTCAAFFCFSW-UHFFFAOYSA-N ethyl 2-amino-3-ethylbenzoate Chemical compound CCOC(=O)C1=CC=CC(CC)=C1N RMKRTCAAFFCFSW-UHFFFAOYSA-N 0.000 description 1
- 229960003750 ethyl chloride Drugs 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- LVIMBOHJGMDKEJ-UHFFFAOYSA-N heptanedioyl dichloride Chemical compound ClC(=O)CCCCCC(Cl)=O LVIMBOHJGMDKEJ-UHFFFAOYSA-N 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- QAXZWHGWYSJAEI-UHFFFAOYSA-N n,n-dimethylformamide;ethanol Chemical compound CCO.CN(C)C=O QAXZWHGWYSJAEI-UHFFFAOYSA-N 0.000 description 1
- GXVMVLSWIPHEMH-UHFFFAOYSA-N n-[1-(4-formylphenyl)propan-2-yl]acetamide Chemical compound CC(=O)NC(C)CC1=CC=C(C=O)C=C1 GXVMVLSWIPHEMH-UHFFFAOYSA-N 0.000 description 1
- MJJLKVBFIZUNJB-UHFFFAOYSA-N n-[1-[4-(hydroxymethyl)phenyl]propan-2-yl]acetamide Chemical compound CC(=O)NC(C)CC1=CC=C(CO)C=C1 MJJLKVBFIZUNJB-UHFFFAOYSA-N 0.000 description 1
- LIHXHJUXBPSFJK-UHFFFAOYSA-N n-[2-(4-formylphenyl)ethyl]acetamide Chemical compound CC(=O)NCCC1=CC=C(C=O)C=C1 LIHXHJUXBPSFJK-UHFFFAOYSA-N 0.000 description 1
- WRDNIPIOGHZYMD-UHFFFAOYSA-N n-[2-[4-(hydroxymethyl)phenyl]ethyl]acetamide Chemical compound CC(=O)NCCC1=CC=C(CO)C=C1 WRDNIPIOGHZYMD-UHFFFAOYSA-N 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- XTUSEBKMEQERQV-UHFFFAOYSA-N propan-2-ol;hydrate Chemical compound O.CC(C)O XTUSEBKMEQERQV-UHFFFAOYSA-N 0.000 description 1
- FZJCXIDLUFPGPP-UHFFFAOYSA-N propan-2-ol;toluene Chemical compound CC(C)O.CC1=CC=CC=C1 FZJCXIDLUFPGPP-UHFFFAOYSA-N 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- 210000004243 sweat Anatomy 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 229940005605 valeric acid Drugs 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/81—Amides; Imides
- C07D213/82—Amides; Imides in position 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/02—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings
- C07D241/10—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D241/14—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D241/24—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/79—Benzo [b] furans; Hydrogenated benzo [b] furans with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/58—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring other than with oxygen or sulphur atoms in position 2 or 4
- C07D311/66—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring other than with oxygen or sulphur atoms in position 2 or 4 with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/38—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2603/00—Systems containing at least three condensed rings
- C07C2603/02—Ortho- or ortho- and peri-condensed systems
- C07C2603/04—Ortho- or ortho- and peri-condensed systems containing three rings
- C07C2603/06—Ortho- or ortho- and peri-condensed systems containing three rings containing at least one ring with less than six ring members
- C07C2603/10—Ortho- or ortho- and peri-condensed systems containing three rings containing at least one ring with less than six ring members containing five-membered rings
- C07C2603/12—Ortho- or ortho- and peri-condensed systems containing three rings containing at least one ring with less than six ring members containing five-membered rings only one five-membered ring
- C07C2603/18—Fluorenes; Hydrogenated fluorenes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
- Quinoline Compounds (AREA)
- Furan Compounds (AREA)
- Pyridine Compounds (AREA)
- Indole Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19752517229 DE2517229A1 (de) | 1975-04-18 | 1975-04-18 | Phenylalkylcarbonsaeure-derivate und verfahren zu ihrer herstellung |
| DE19762604560 DE2604560A1 (de) | 1976-02-06 | 1976-02-06 | Phenylalkancarbonsaeure-derivate und verfahren zu ihrer herstellung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU618038A3 true SU618038A3 (ru) | 1978-07-30 |
Family
ID=25768786
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU762346106A SU618038A3 (ru) | 1975-04-18 | 1976-04-16 | Способ получени производных фенилалканкарбоновых кислот,их солей, сложных эфиров или амидов |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US4113871A (OSRAM) |
| JP (1) | JPS51136646A (OSRAM) |
| AR (1) | AR213174A1 (OSRAM) |
| AT (1) | AT345795B (OSRAM) |
| AU (1) | AU497513B2 (OSRAM) |
| BG (1) | BG26518A3 (OSRAM) |
| CA (1) | CA1047513A (OSRAM) |
| DD (1) | DD124974A5 (OSRAM) |
| DK (1) | DK148576A (OSRAM) |
| ES (1) | ES446976A1 (OSRAM) |
| FI (1) | FI761004A7 (OSRAM) |
| FR (1) | FR2307528A1 (OSRAM) |
| GB (1) | GB1484848A (OSRAM) |
| HU (1) | HU177559B (OSRAM) |
| IE (1) | IE42712B1 (OSRAM) |
| IL (1) | IL49411A (OSRAM) |
| LU (1) | LU74786A1 (OSRAM) |
| NL (1) | NL7603947A (OSRAM) |
| PL (1) | PL101299B1 (OSRAM) |
| PT (1) | PT65019B (OSRAM) |
| RO (1) | RO73520A (OSRAM) |
| SE (1) | SE423231B (OSRAM) |
| SU (1) | SU618038A3 (OSRAM) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US7456217B2 (en) | 2000-08-31 | 2008-11-25 | Mitsubishi Tanabe Pharma Corporation | Inhibitors of alpha4 mediated cell adhesion |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2532420A1 (de) * | 1975-07-19 | 1977-02-03 | Boehringer Mannheim Gmbh | Phenylessigsaeure-derivate und verfahren zu ihrer herstellung |
| LU79008A1 (de) * | 1978-02-03 | 1979-09-06 | Byk Gulden Lomberg Chem Fab | W-(n-alkyl-n-benzoyl-amino)-phenylalkansaeuren,ihre verwendung und herstellung sowie sie enthaltende arzneimittel |
| IT1121577B (it) * | 1979-06-14 | 1986-04-02 | Wassermann Spa A | Procedimento per la produzione di carbossammido-etilbenzen-4-4solfonammidi |
| EP0025331B1 (en) * | 1979-09-06 | 1983-03-02 | Beecham Group Plc | Cinnamic acid derivatives, their preparation, and pharmaceutical compositions containing them |
| DE3000377A1 (de) * | 1980-01-07 | 1981-07-09 | Boehringer Mannheim Gmbh, 6800 Mannheim | Neue sulfonamide, verfahren zu deren herstellung sowie diese verbindungen enthaltende arzneimittel |
| US4413011A (en) * | 1981-02-26 | 1983-11-01 | Warner-Lambert Company | Substituted 2,2-dimethyl-5-phenoxypentanoic acid benzamides as anti-arteriosclerotic agents and method |
| PT77219B (fr) * | 1982-08-24 | 1986-02-04 | May & Baker Ltd | Procede de preparation des derives de la benzamide |
| IT1177966B (it) * | 1984-08-14 | 1987-09-03 | Medosan Ind Biochimi | Derivati amidici dell'acido 2-(p-aminobenzil)butirrico e relativi e-steri provvisti di attivita' ipolipidemizzante |
| US4689182A (en) * | 1985-12-20 | 1987-08-25 | Warner-Lambert Company | Benzoic acid and benzoic acid ester derivatives having anti-inflammatory and analgesic activity |
| CA2057324A1 (en) * | 1990-12-18 | 1992-06-19 | Lora Louise Fitch | Benzamide and sulfonamide hypoglycemic agents |
| US6358504B1 (en) | 1997-02-07 | 2002-03-19 | Emisphere Technologies, Inc. | Compounds and compositions for delivering active agents |
| US5741926A (en) * | 1997-02-12 | 1998-04-21 | Shaman Pharmaceuticals, Inc. | Aniline derivatives having antihyperglycemic activity |
| HUP0003881A3 (en) * | 1997-10-02 | 2001-04-28 | Sankyo Co | Amidocarboxylic acid derivatives |
| JP4618845B2 (ja) * | 1999-06-09 | 2011-01-26 | 杏林製薬株式会社 | ヒトペルオキシゾーム増殖薬活性化受容体(PPAR)αアゴニストとしての置換フェニルプロピオン酸誘導体 |
| AU2001258784A1 (en) * | 2000-05-22 | 2001-12-03 | Takeda Chemical Industries Ltd. | Tyrosine phosphatase inhibitors |
| CA2430846A1 (en) | 2000-12-05 | 2002-06-13 | Kyorin Pharmaceutical Co., Ltd. | Substituted carboxylic acid derivatives |
| NZ531153A (en) * | 2001-08-09 | 2005-10-28 | Ono Pharmaceutical Co | Carboxylic acid derivative compounds and drugs comprising these compounds as the active ingredient |
| TWI282784B (en) * | 2002-06-20 | 2007-06-21 | Astrazeneca Ab | Therapeutic agents |
| SE0201937D0 (sv) * | 2002-06-20 | 2002-06-20 | Astrazeneca Ab | Therapeutic agents |
| NZ552501A (en) * | 2004-08-11 | 2010-03-26 | Kyorin Seiyaku Kk | Novel cyclic aminobenzoic acid derivative |
| US8101774B2 (en) * | 2004-10-18 | 2012-01-24 | Japan Tobacco Inc. | Ester derivatives and medicinal use thereof |
-
1976
- 1976-03-31 DK DK148576A patent/DK148576A/da not_active IP Right Cessation
- 1976-04-08 CA CA249,831A patent/CA1047513A/en not_active Expired
- 1976-04-08 US US05/674,993 patent/US4113871A/en not_active Expired - Lifetime
- 1976-04-12 AR AR262851A patent/AR213174A1/es active
- 1976-04-13 IL IL49411A patent/IL49411A/xx unknown
- 1976-04-13 FI FI761004A patent/FI761004A7/fi not_active Application Discontinuation
- 1976-04-13 BG BG032888A patent/BG26518A3/xx unknown
- 1976-04-13 ES ES446976A patent/ES446976A1/es not_active Expired
- 1976-04-13 RO RO7685602A patent/RO73520A/ro unknown
- 1976-04-14 NL NL7603947A patent/NL7603947A/xx not_active Application Discontinuation
- 1976-04-14 SE SE7604381A patent/SE423231B/xx unknown
- 1976-04-15 DD DD192398A patent/DD124974A5/xx unknown
- 1976-04-15 IE IE822/76A patent/IE42712B1/en unknown
- 1976-04-15 FR FR7611222A patent/FR2307528A1/fr active Granted
- 1976-04-15 GB GB15550/76A patent/GB1484848A/en not_active Expired
- 1976-04-15 PT PT65019A patent/PT65019B/pt unknown
- 1976-04-16 HU HU76BO1612A patent/HU177559B/hu unknown
- 1976-04-16 SU SU762346106A patent/SU618038A3/ru active
- 1976-04-16 LU LU74786A patent/LU74786A1/xx unknown
- 1976-04-16 AT AT283676A patent/AT345795B/de not_active IP Right Cessation
- 1976-04-17 PL PL1976188879A patent/PL101299B1/pl unknown
- 1976-04-19 JP JP51044404A patent/JPS51136646A/ja active Pending
- 1976-04-20 AU AU13157/76A patent/AU497513B2/en not_active Expired
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US7456217B2 (en) | 2000-08-31 | 2008-11-25 | Mitsubishi Tanabe Pharma Corporation | Inhibitors of alpha4 mediated cell adhesion |
| US7671090B2 (en) | 2000-08-31 | 2010-03-02 | Mitsubishi Tanabe Pharma Corporation | Inhibitors of α4 mediated cell adhesion |
| US7872151B2 (en) | 2000-08-31 | 2011-01-18 | Mitsubishi Tanabe Pharma Corporation | Inhibitors of α4 mediated cell adhesion |
| US8501809B2 (en) | 2000-08-31 | 2013-08-06 | Mitsubishi Tanabe Pharma Corporation | Inhibitors of α4 mediated cell adhesion |
Also Published As
| Publication number | Publication date |
|---|---|
| ATA283676A (de) | 1978-02-15 |
| DD124974A5 (OSRAM) | 1977-03-23 |
| FI761004A7 (OSRAM) | 1976-10-19 |
| IE42712B1 (en) | 1980-10-08 |
| AR213174A1 (es) | 1978-12-29 |
| IE42712L (en) | 1976-10-18 |
| GB1484848A (en) | 1977-09-08 |
| NL7603947A (nl) | 1976-10-20 |
| LU74786A1 (OSRAM) | 1977-01-12 |
| PT65019A (de) | 1976-05-01 |
| US4113871A (en) | 1978-09-12 |
| PT65019B (de) | 1977-09-09 |
| BG26518A3 (bg) | 1979-04-12 |
| RO73520A (ro) | 1980-12-30 |
| ES446976A1 (es) | 1977-06-01 |
| HU177559B (en) | 1981-11-28 |
| FR2307528A1 (fr) | 1976-11-12 |
| IL49411A0 (en) | 1976-06-30 |
| SE7604381L (sv) | 1976-10-19 |
| DK148576A (da) | 1976-10-19 |
| AU497513B2 (en) | 1978-12-14 |
| CA1047513A (en) | 1979-01-30 |
| PL101299B1 (pl) | 1978-12-30 |
| IL49411A (en) | 1979-12-30 |
| JPS51136646A (en) | 1976-11-26 |
| FR2307528B1 (OSRAM) | 1981-11-13 |
| AT345795B (de) | 1978-10-10 |
| SE423231B (sv) | 1982-04-26 |
| AU1315776A (en) | 1977-10-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU618038A3 (ru) | Способ получени производных фенилалканкарбоновых кислот,их солей, сложных эфиров или амидов | |
| JP2003522750A5 (OSRAM) | ||
| WO2022169747A1 (en) | Method for preparing levetiracetam and intermediates thereof | |
| SU1279526A3 (ru) | Способ получени производных оксимов пировиноградной кислоты или ее амидов | |
| RS20050240A (sr) | Novi postupak za industrijsku sintezu stroncijum ranelata i njegovih hidrata | |
| SE452610B (sv) | Sett att spalta racemiska cis-1,2-cyklopropandikarboxylsyraderivat | |
| EP0179254A1 (en) | 4,5-Dihydro-4-oxo-2- [(2-trans-phenylcyclopropyl)amino]-3-furancarboxylic acids and derivatives thereof | |
| GB1586462A (en) | Phenonyalkanoic acids and derivatives thereof useful as herbicides | |
| JPH032134B2 (OSRAM) | ||
| CA2368493A1 (fr) | Inhibiteurs de lta4 hydrolase | |
| JPH0692385B2 (ja) | 新規なチオフェン誘導体 | |
| DK166271B (da) | Fremgangsmaade til optisk spaltning af racemiske blandinger af alfa-naphthyl-propionsyrer | |
| SU440824A1 (OSRAM) | ||
| BG65455B1 (bg) | МЕТОД ЗА ПОЛУЧАВАНЕ НА {2-[4-(алфа-ФЕНИЛ-р-ХЛОРОБЕНЗИЛ) ПИПЕРАЗИН-1-ИЛ]ЕТОКСИ}ОЦЕТНА КИСЕЛИНА И НОВИ МЕЖДИННИ СЪЕДИНЕНИЯ | |
| US3389170A (en) | 3-acylamino-2, 4, 6-triiodo-benzoic acids | |
| SU786883A3 (ru) | Способ получени ( -аминоалкокси)бибензилов или их солей | |
| SU718010A3 (ru) | Способ получени 3/ 4-(2-пиридил)-пиперазин-1-ил -1-(3,4,5-триметоксибензоилокси)-пропана или его солей | |
| SU470960A3 (ru) | Способ получени производных 3-амино-2-пиразолина | |
| US4559178A (en) | Resolution of 3-benzoylthio-2-methyl-propanoic acid with (+)-dehydroabietylamine | |
| US5734064A (en) | Process for the preparation of carboxylic acid succinimidyl esters | |
| NO134112B (OSRAM) | ||
| SU633476A3 (ru) | Способ получени производных 4-амино-транс-декагидрохинолина или их солей | |
| KR920003900B1 (ko) | 테트라-α-(1-나프틸메틸)-2-푸란 프로파논산의 제조방법 | |
| US3872112A (en) | Tetrahydrofurfuryl aminoesters | |
| CH616406A5 (en) | Process for the preparation of novel oxime derivatives |