SU571197A3 - Способ получени катионных азокрасителей - Google Patents
Способ получени катионных азокрасителейInfo
- Publication number
- SU571197A3 SU571197A3 SU7502133753A SU2133753A SU571197A3 SU 571197 A3 SU571197 A3 SU 571197A3 SU 7502133753 A SU7502133753 A SU 7502133753A SU 2133753 A SU2133753 A SU 2133753A SU 571197 A3 SU571197 A3 SU 571197A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- dye
- azodyes
- water
- preparing cation
- azo
- Prior art date
Links
- 239000000987 azo dye Substances 0.000 title description 7
- 238000000034 method Methods 0.000 title description 5
- 150000001768 cations Chemical class 0.000 title description 2
- 239000000975 dye Substances 0.000 description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- 239000000243 solution Substances 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- 125000002091 cationic group Chemical group 0.000 description 4
- 229920002239 polyacrylonitrile Polymers 0.000 description 4
- 239000004952 Polyamide Substances 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 229920002647 polyamide Polymers 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- LOCWBQIWHWIRGN-UHFFFAOYSA-N 2-chloro-4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1Cl LOCWBQIWHWIRGN-UHFFFAOYSA-N 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000004043 dyeing Methods 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 229920006149 polyester-amide block copolymer Polymers 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000006615 aromatic heterocyclic group Chemical group 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000013256 coordination polymer Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 235000002639 sodium chloride Nutrition 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid Chemical compound NS(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B44/00—Azo dyes containing onium groups
- C09B44/02—Azo dyes containing onium groups containing ammonium groups not directly attached to an azo group
- C09B44/04—Azo dyes containing onium groups containing ammonium groups not directly attached to an azo group from coupling components containing amino as the only directing group
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19732309528 DE2309528C3 (de) | 1973-02-26 | Kationische Monoazofarbstoffe, Verfahren zu deren Herstellung und ihre Verwendung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU571197A3 true SU571197A3 (ru) | 1977-08-30 |
Family
ID=5873128
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU7502133753A SU571197A3 (ru) | 1973-02-26 | 1975-05-12 | Способ получени катионных азокрасителей |
Country Status (18)
| Country | Link |
|---|---|
| US (2) | US4036826A (enExample) |
| JP (2) | JPS5744708B2 (enExample) |
| AR (1) | AR198554A1 (enExample) |
| AT (2) | AT325731B (enExample) |
| BE (1) | BE811520A (enExample) |
| BR (1) | BR7401367D0 (enExample) |
| CA (1) | CA1045123A (enExample) |
| CH (4) | CH599971A5 (enExample) |
| CS (1) | CS172880B2 (enExample) |
| DD (1) | DD113239A5 (enExample) |
| ES (2) | ES423618A1 (enExample) |
| FR (1) | FR2219204B1 (enExample) |
| GB (1) | GB1433664A (enExample) |
| IT (1) | IT1003589B (enExample) |
| NL (1) | NL7402601A (enExample) |
| RO (1) | RO69713A (enExample) |
| SE (1) | SE404610B (enExample) |
| SU (1) | SU571197A3 (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2631030A1 (de) * | 1976-07-09 | 1978-01-12 | Bayer Ag | Kationische farbstoffe |
| DE2811258C2 (de) * | 1978-03-15 | 1982-12-30 | Bayer Ag, 5090 Leverkusen | Kationische 1,3,4-Thiadiazol-Farbstoffe, Verfahren zu deren Herstellung sowie Verfahren zum Färben und Bedrucken natürlicher und synthetischer Materialien |
| EP0023386A1 (en) * | 1979-07-26 | 1981-02-04 | Imperial Chemical Industries Plc | Disperse monoazo dyes, their preparation and their application to synthetic textile materials |
| DE3030918A1 (de) * | 1980-08-16 | 1982-04-01 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von loesungen kationischer azofarbstoffe |
| JPS5761175U (enExample) * | 1980-09-30 | 1982-04-10 | ||
| JPS5761176U (enExample) * | 1980-09-30 | 1982-04-10 | ||
| JPS5761174U (enExample) * | 1980-09-30 | 1982-04-10 | ||
| DE3101140A1 (de) * | 1981-01-16 | 1982-09-02 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von loesungen kationischer azofarbstoffe |
| FR2706475B1 (fr) * | 1993-06-16 | 1997-08-29 | Sandoz Sa | Teinture dans la masse de polymères synthétiques. |
| DE69908923D1 (de) * | 1998-03-31 | 2003-07-24 | Avecia Ltd | 1,3,4-thiadiazolylazofarbstoffe-enthaltende tintenzusammensetzungen |
Family Cites Families (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2099525A (en) * | 1935-02-19 | 1937-11-16 | Gen Aniline Works Inc | Production of water-soluble azo dyestuffs |
| US2972508A (en) * | 1955-12-29 | 1961-02-21 | Bayer Ag | Dyeing of polymers of acrylonitrile |
| US2955108A (en) * | 1957-01-07 | 1960-10-04 | Univ Ohio State Res Found | Process for 1,1,1-trisubstituted hydrazinium chlorides |
| US3079377A (en) * | 1960-08-29 | 1963-02-26 | Du Pont | Azo dyes |
| CH425033A (de) * | 1961-05-26 | 1966-11-30 | Ciba Geigy | Verfahren zur Herstellung neuer basischer Azofarbstoffe |
| DE1223082B (de) * | 1962-10-03 | 1966-08-18 | Hoechst Ag | Verfahren zur Herstellung von organischen Farbstoffen |
| CH464392A (de) * | 1964-03-25 | 1968-10-31 | Sandoz Ag | Verfahren zur Herstellung von basischen Farbstoffen |
| FR1403396A (fr) * | 1964-07-28 | 1965-06-18 | Sandoz Sa | Colorants azoïques, leur fabrication et leurs applications |
| DE1644311A1 (de) * | 1965-09-24 | 1970-12-17 | Du Pont | Monoazofarbstoffe und Verfahren zur Herstellung derselben |
| CH468515A (de) * | 1965-12-02 | 1969-03-31 | Ciba Geigy | Verfahren zum Färben oder Bedrucken von Textilmaterial aus Polymerisaten oder Mischpolymerisaten aus Acrylnitril bzw. asymmetrischem Dicyanäthylen mit basischen Azofarbstoffen |
| DE1644279A1 (de) * | 1966-03-03 | 1971-07-15 | Inst Przemysllu Organicznego | Verfahren zur Herstellung von wasserloeslichen Azofarbstoffen |
| US3839426A (en) * | 1966-06-21 | 1974-10-01 | Sterling Drug Inc | Compounds and preparation thereof |
| CH488773A (de) * | 1966-06-24 | 1970-04-15 | Ciba Geigy | Verfahren zur Herstellung neuer basischer Farbstoffe |
| GB1162665A (en) * | 1966-09-27 | 1969-08-27 | Du Pont | Cationic and Basic Benzothiazolylazo Dyes, their preparation and use |
| DE1644175C3 (de) * | 1966-10-15 | 1975-10-09 | Bayer Ag, 5090 Leverkusen | Sulfonsäure- und carbonsäurefreie Azofarbstoffe, Verfahren zu deren Herstellung und ihre Verwendung |
| GB1154006A (en) * | 1966-10-28 | 1969-06-04 | Ici Ltd | New Water-Soluble Azo Dyestuffs |
| US3759893A (en) * | 1970-07-27 | 1973-09-18 | Du Pont | Biscationic monoazo dyes for acid modified nylons |
| US3812093A (en) * | 1972-08-29 | 1974-05-21 | Eastman Kodak Co | Cationic thiadiazolyl monoazo dyes |
-
1974
- 1974-02-19 DD DD176664A patent/DD113239A5/xx unknown
- 1974-02-20 RO RO7477753A patent/RO69713A/ro unknown
- 1974-02-22 CH CH1345176A patent/CH599971A5/xx not_active IP Right Cessation
- 1974-02-22 CH CH255374A patent/CH598403B5/xx not_active IP Right Cessation
- 1974-02-22 CA CA193,298A patent/CA1045123A/en not_active Expired
- 1974-02-22 BR BR1367/74A patent/BR7401367D0/pt unknown
- 1974-02-22 CH CH1001677A patent/CH606296A5/xx not_active IP Right Cessation
- 1974-02-22 JP JP49020655A patent/JPS5744708B2/ja not_active Expired
- 1974-02-22 CH CH255374D patent/CH255374A4/xx unknown
- 1974-02-22 AR AR252485A patent/AR198554A1/es active
- 1974-02-25 AT AT150874A patent/AT325731B/de not_active IP Right Cessation
- 1974-02-25 GB GB842274A patent/GB1433664A/en not_active Expired
- 1974-02-25 IT IT48716/74A patent/IT1003589B/it active
- 1974-02-25 AT AT881774*7A patent/AT328050B/de not_active IP Right Cessation
- 1974-02-25 ES ES423618A patent/ES423618A1/es not_active Expired
- 1974-02-25 SE SE7402479A patent/SE404610B/xx unknown
- 1974-02-25 BE BE141340A patent/BE811520A/xx not_active IP Right Cessation
- 1974-02-26 CS CS1405A patent/CS172880B2/cs unknown
- 1974-02-26 NL NL7402601A patent/NL7402601A/xx not_active Application Discontinuation
- 1974-02-26 FR FR7406500A patent/FR2219204B1/fr not_active Expired
- 1974-02-26 US US05/445,833 patent/US4036826A/en not_active Expired - Lifetime
- 1974-05-13 ES ES426282A patent/ES426282A1/es not_active Expired
-
1975
- 1975-05-12 SU SU7502133753A patent/SU571197A3/ru active
-
1976
- 1976-06-30 US US05/701,420 patent/US4233214A/en not_active Expired - Lifetime
- 1976-10-20 JP JP51125057A patent/JPS5277278A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS49118722A (enExample) | 1974-11-13 |
| FR2219204B1 (enExample) | 1978-02-10 |
| IT1003589B (it) | 1976-06-10 |
| SE404610B (sv) | 1978-10-16 |
| CH255374A4 (enExample) | 1977-05-31 |
| CS172880B2 (enExample) | 1977-01-28 |
| US4233214A (en) | 1980-11-11 |
| US4036826A (en) | 1977-07-19 |
| RO69713A (ro) | 1982-09-09 |
| DE2309528A1 (de) | 1974-10-17 |
| BR7401367D0 (pt) | 1974-11-05 |
| FR2219204A1 (enExample) | 1974-09-20 |
| CA1045123A (en) | 1978-12-26 |
| JPS5744708B2 (enExample) | 1982-09-22 |
| NL7402601A (enExample) | 1974-08-28 |
| CH606296A5 (enExample) | 1978-10-31 |
| DE2309528B2 (de) | 1975-12-18 |
| GB1433664A (en) | 1976-04-28 |
| AU6641474A (en) | 1975-09-11 |
| ATA150874A (de) | 1975-01-15 |
| AR198554A1 (es) | 1974-06-28 |
| CH598403B5 (enExample) | 1978-04-28 |
| JPS5347432B2 (enExample) | 1978-12-21 |
| DD113239A5 (enExample) | 1975-05-20 |
| ATA881774A (de) | 1975-05-15 |
| ES426282A1 (es) | 1976-09-01 |
| CH599971A5 (enExample) | 1978-06-15 |
| BE811520A (fr) | 1974-08-26 |
| AT328050B (de) | 1976-02-25 |
| ES423618A1 (es) | 1976-05-01 |
| JPS5277278A (en) | 1977-06-29 |
| AT325731B (de) | 1975-11-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU571197A3 (ru) | Способ получени катионных азокрасителей | |
| GB2179361A (en) | Basic-s-triazinyl azo dyes | |
| JP3100088B2 (ja) | カチオン性1,3,4−チアジアゾール染料 | |
| SU470971A3 (ru) | Способ получени бензтиазолового азокрасител | |
| US3933847A (en) | Method relating to manufacture of coumarin derivatives | |
| US4168264A (en) | 1,3,3-Trimethyl-2-methylene indoline cationic n-methyl azo dyes | |
| DE2531445C3 (de) | Sulfogruppenfreie wasserlösliche Azofarbstoffe und deren Verwendung zum Färben und/oder Bedrucken von synthetischen Textilfasern | |
| DE1719087B2 (de) | Basische Azofarbstoffe | |
| US4432899A (en) | Preparing concentrated azo dye solutions using nitrite salt as both coupling component and diazotizing agent | |
| DE2022624B2 (de) | Basischer Disazofarbstoff, Ver fahren zu dessen Herstellung und dessen Verwendung | |
| US3625937A (en) | Chromium mixed complex azo dyestuffs | |
| DE2033281A1 (en) | Water-soluble azo dyes - from diazotised heterocyclic amines and pyridone-(6) coupling components | |
| KR20120026544A (ko) | 비스아조 화합물 | |
| US4115380A (en) | Process for the preparation of dihydroxyphenylazophenylazophenyl dyestuffs | |
| US3635942A (en) | Basic ioninotriazole azoindole dyestuffs | |
| US4472308A (en) | Azo dyestuffs containing an amino or acylated amino naphthol monosulfonic acid radical and at least one reactive phosphoric or phosphonic acid group | |
| GB2057481A (en) | Organic compounds | |
| DE2804599C2 (de) | Azofarbstoffe, Verfahren zu deren Herstellung und deren Verwendung | |
| KR20030064892A (ko) | 종이를 염색하기 위한 디스아조 염료 및 이의 구리 착물 | |
| US4225491A (en) | Azo pyridone dyestuffs containing at least one reactive phosphoric or phosphonic acid group | |
| CN112646389B (zh) | 一种红色染料及其制备方法 | |
| US3701769A (en) | N-(p-aminophenyl) pyrrolidine containing monoazo dyes | |
| DE2824710A1 (de) | Wasserunloesliche monoazofarbstoffe | |
| JPH0156102B2 (enExample) | ||
| CH502413A (de) | Verfahren zur Herstellung von wasserlöslichen Azofarbstoffen |