SU545260A3 - Способ получени производных октагидроиндолохинолизина или их солей,или рацемата,или оптических антиподов - Google Patents
Способ получени производных октагидроиндолохинолизина или их солей,или рацемата,или оптических антиподовInfo
- Publication number
- SU545260A3 SU545260A3 SU2175647A SU2175647A SU545260A3 SU 545260 A3 SU545260 A3 SU 545260A3 SU 2175647 A SU2175647 A SU 2175647A SU 2175647 A SU2175647 A SU 2175647A SU 545260 A3 SU545260 A3 SU 545260A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- methanol
- ethyl
- hexahydro
- cyanoethyl
- mixture
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 13
- 150000003839 salts Chemical class 0.000 title claims description 8
- 230000003287 optical effect Effects 0.000 title claims description 5
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 78
- 239000000203 mixture Substances 0.000 claims description 15
- 239000003054 catalyst Substances 0.000 claims description 14
- 239000000047 product Substances 0.000 claims description 13
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 claims description 12
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 12
- 239000002253 acid Substances 0.000 claims description 12
- 229910052739 hydrogen Inorganic materials 0.000 claims description 12
- 239000001257 hydrogen Substances 0.000 claims description 12
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 claims description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 12
- -1 quinolizin-1-yl Chemical group 0.000 claims description 11
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 10
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 9
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 9
- 238000002360 preparation method Methods 0.000 claims description 9
- 239000011541 reaction mixture Substances 0.000 claims description 9
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 claims description 8
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 claims description 6
- 235000019253 formic acid Nutrition 0.000 claims description 6
- 238000005984 hydrogenation reaction Methods 0.000 claims description 6
- 238000002329 infrared spectrum Methods 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 239000000706 filtrate Substances 0.000 claims description 5
- 239000012442 inert solvent Substances 0.000 claims description 5
- 229910052987 metal hydride Inorganic materials 0.000 claims description 5
- 150000004681 metal hydrides Chemical class 0.000 claims description 5
- 229910052763 palladium Inorganic materials 0.000 claims description 5
- 239000012279 sodium borohydride Substances 0.000 claims description 5
- 229910000033 sodium borohydride Inorganic materials 0.000 claims description 5
- 238000010521 absorption reaction Methods 0.000 claims description 4
- 229910052786 argon Inorganic materials 0.000 claims description 4
- 239000012298 atmosphere Substances 0.000 claims description 4
- 239000000284 extract Substances 0.000 claims description 4
- 238000001914 filtration Methods 0.000 claims description 4
- 150000002431 hydrogen Chemical class 0.000 claims description 4
- 229910052751 metal Inorganic materials 0.000 claims description 4
- 239000002184 metal Substances 0.000 claims description 4
- 229910052759 nickel Inorganic materials 0.000 claims description 4
- 239000000725 suspension Substances 0.000 claims description 4
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 claims description 3
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 claims description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 claims description 3
- 230000002378 acidificating effect Effects 0.000 claims description 2
- 229910044991 metal oxide Inorganic materials 0.000 claims description 2
- 150000004706 metal oxides Chemical class 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 230000000707 stereoselective effect Effects 0.000 claims description 2
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 claims 13
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims 12
- 239000000243 solution Substances 0.000 claims 12
- 239000013078 crystal Substances 0.000 claims 7
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 claims 6
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 claims 6
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 claims 6
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 claims 5
- 239000012153 distilled water Substances 0.000 claims 5
- DIQLGHMNRJRQPF-UHFFFAOYSA-N 4,5-dihydroquinolizin-5-ium perchlorate Chemical compound Cl(=O)(=O)(=O)O.C=1C=CCN2C=CC=CC12 DIQLGHMNRJRQPF-UHFFFAOYSA-N 0.000 claims 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims 4
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 claims 4
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 claims 4
- 238000003756 stirring Methods 0.000 claims 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims 3
- 238000001816 cooling Methods 0.000 claims 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 claims 3
- 235000019341 magnesium sulphate Nutrition 0.000 claims 3
- GDRVFDDBLLKWRI-UHFFFAOYSA-N 4H-quinolizine Chemical compound C1=CC=CN2CC=CC=C21 GDRVFDDBLLKWRI-UHFFFAOYSA-N 0.000 claims 2
- YZCKVEUIGOORGS-OUBTZVSYSA-N Deuterium Chemical compound [2H] YZCKVEUIGOORGS-OUBTZVSYSA-N 0.000 claims 2
- 239000012300 argon atmosphere Substances 0.000 claims 2
- 125000003118 aryl group Chemical group 0.000 claims 2
- 229910052805 deuterium Inorganic materials 0.000 claims 2
- 239000000155 melt Substances 0.000 claims 2
- 238000002844 melting Methods 0.000 claims 2
- 230000008018 melting Effects 0.000 claims 2
- 239000012074 organic phase Substances 0.000 claims 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 claims 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims 1
- 239000003929 acidic solution Substances 0.000 claims 1
- 229930013930 alkaloid Natural products 0.000 claims 1
- 239000012043 crude product Substances 0.000 claims 1
- 238000000354 decomposition reaction Methods 0.000 claims 1
- RXPRRQLKFXBCSJ-UHFFFAOYSA-N dl-Vincamin Natural products C1=CC=C2C(CCN3CCC4)=C5C3C4(CC)CC(O)(C(=O)OC)N5C2=C1 RXPRRQLKFXBCSJ-UHFFFAOYSA-N 0.000 claims 1
- 238000007429 general method Methods 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 claims 1
- 239000011261 inert gas Substances 0.000 claims 1
- 229910052976 metal sulfide Inorganic materials 0.000 claims 1
- 239000012071 phase Substances 0.000 claims 1
- 229910000027 potassium carbonate Inorganic materials 0.000 claims 1
- 238000001953 recrystallisation Methods 0.000 claims 1
- 239000007787 solid Substances 0.000 claims 1
- 238000006257 total synthesis reaction Methods 0.000 claims 1
- RXPRRQLKFXBCSJ-GIVPXCGWSA-N vincamine Chemical compound C1=CC=C2C(CCN3CCC4)=C5[C@@H]3[C@]4(CC)C[C@](O)(C(=O)OC)N5C2=C1 RXPRRQLKFXBCSJ-GIVPXCGWSA-N 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 description 14
- 150000007513 acids Chemical class 0.000 description 6
- 238000006722 reduction reaction Methods 0.000 description 6
- 239000003638 chemical reducing agent Substances 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- 239000002585 base Substances 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- 244000248349 Citrus limon Species 0.000 description 1
- 235000005979 Citrus limon Nutrition 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 239000012448 Lithium borohydride Substances 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical class CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- 229910052774 Proactinium Inorganic materials 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 229910002056 binary alloy Inorganic materials 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- DBVVQINTNHWWGH-UHFFFAOYSA-N indolo[3,2-a]quinolizine Chemical class C1=CC=CC2=C3C4=CC=CC=C4N=C3C=CN21 DBVVQINTNHWWGH-UHFFFAOYSA-N 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000002386 leaching Methods 0.000 description 1
- 229910052745 lead Inorganic materials 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/12—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains three hetero rings
- C07D471/14—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HURI545A HU169916B (enExample) | 1974-09-27 | 1974-09-27 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU545260A3 true SU545260A3 (ru) | 1977-01-30 |
Family
ID=11000956
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU2175647A SU545260A3 (ru) | 1974-09-27 | 1975-09-26 | Способ получени производных октагидроиндолохинолизина или их солей,или рацемата,или оптических антиподов |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US4057551A (enExample) |
| JP (1) | JPS5159898A (enExample) |
| AT (1) | AT345995B (enExample) |
| BE (1) | BE833897A (enExample) |
| BG (1) | BG31503A3 (enExample) |
| CA (1) | CA1067495A (enExample) |
| CH (1) | CH619952A5 (enExample) |
| CS (1) | CS226159B2 (enExample) |
| DD (1) | DD121942A5 (enExample) |
| DE (1) | DE2541484C3 (enExample) |
| DK (1) | DK139431B (enExample) |
| FR (1) | FR2285877A1 (enExample) |
| GB (1) | GB1519050A (enExample) |
| HU (1) | HU169916B (enExample) |
| IL (1) | IL48028A (enExample) |
| NL (1) | NL186383C (enExample) |
| PL (1) | PL100319B1 (enExample) |
| SE (1) | SE421208B (enExample) |
| SU (1) | SU545260A3 (enExample) |
| YU (1) | YU40972B (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU499923B2 (en) * | 1975-06-27 | 1979-05-03 | Richter Gedeon Vegyeszeti Gyar N | Indoloquinolizine derivatives & their production |
| HU174502B (hu) * | 1976-12-30 | 1980-01-28 | Richter Gedeon Vegyeszet | Sposob poluchenija novykh proizvodnykh oktagidro-indolo/2,3-a/-khinolizina |
| ZA786426B (en) * | 1977-11-25 | 1979-10-31 | Scras | New indulo(2,3-a)quinolizidines,preparation and therapeutic use |
| HU178700B (en) * | 1978-02-10 | 1982-06-28 | Richter Gedeon Vegyeszet | Process for preparing 1,1-disubstituted octahydro-indolo/2,3-a/-quinolizines |
| US4353911A (en) * | 1979-07-20 | 1982-10-12 | Andre Buzas | Indolo(2,3-a)quinolizidines, useful in increasing femoral and vertebral blood flow |
| US5218119A (en) * | 1989-06-21 | 1993-06-08 | Richter Gedeon Vegyeszeti Gyar Rt. | Process for preparing the octahydro-indolo[2,3-a] quinolizine diester derivatives |
| CN107417595B (zh) * | 2017-03-27 | 2020-07-24 | 四川大学 | 一种基于自由基串联反应的系列单萜吲哚生物碱骨架及天然产物的合成方法 |
| CN112601527B (zh) | 2018-03-31 | 2024-12-31 | 分子国际研究公司 | 用于有效预防和治疗的选择性抗癌剂 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3478051A (en) * | 1967-03-17 | 1969-11-11 | Sandoz Ag | Azecino- and azonino(5,4-b)indoles |
| US3536725A (en) * | 1967-11-22 | 1970-10-27 | Miles Lab | Cyanoethylated derivatives of 2,3,4,6,7,12-hexahydroindolo(2,3-alpha)-quinolizine |
| FR2108947B1 (enExample) * | 1970-10-22 | 1974-02-01 | Men Jean Le |
-
1974
- 1974-09-27 HU HURI545A patent/HU169916B/hu not_active IP Right Cessation
-
1975
- 1975-08-28 CA CA234,413A patent/CA1067495A/en not_active Expired
- 1975-09-02 IL IL48028A patent/IL48028A/xx unknown
- 1975-09-16 CH CH1207875A patent/CH619952A5/de not_active IP Right Cessation
- 1975-09-17 DE DE2541484A patent/DE2541484C3/de not_active Expired
- 1975-09-17 AT AT711375A patent/AT345995B/de not_active IP Right Cessation
- 1975-09-17 US US05/614,240 patent/US4057551A/en not_active Expired - Lifetime
- 1975-09-23 FR FR7529072A patent/FR2285877A1/fr active Granted
- 1975-09-23 CS CS756411A patent/CS226159B2/cs unknown
- 1975-09-24 NL NLAANVRAGE7511240,A patent/NL186383C/xx not_active IP Right Cessation
- 1975-09-25 DD DD188549A patent/DD121942A5/xx unknown
- 1975-09-25 SE SE7510785A patent/SE421208B/xx not_active IP Right Cessation
- 1975-09-25 YU YU2411/75A patent/YU40972B/xx unknown
- 1975-09-25 BG BG031072A patent/BG31503A3/xx unknown
- 1975-09-26 PL PL1975183605A patent/PL100319B1/pl unknown
- 1975-09-26 GB GB39507/75A patent/GB1519050A/en not_active Expired
- 1975-09-26 BE BE160441A patent/BE833897A/xx not_active IP Right Cessation
- 1975-09-26 SU SU2175647A patent/SU545260A3/ru active
- 1975-09-26 JP JP50117085A patent/JPS5159898A/ja active Pending
- 1975-09-26 DK DK433275AA patent/DK139431B/da not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5159898A (enExample) | 1976-05-25 |
| DE2541484C3 (de) | 1982-04-15 |
| YU241175A (en) | 1982-02-28 |
| DK139431B (da) | 1979-02-19 |
| CA1067495A (en) | 1979-12-04 |
| CH619952A5 (enExample) | 1980-10-31 |
| DK433275A (enExample) | 1976-03-28 |
| YU40972B (en) | 1986-10-31 |
| FR2285877A1 (fr) | 1976-04-23 |
| CS226159B2 (en) | 1984-03-19 |
| SE421208B (sv) | 1981-12-07 |
| US4057551A (en) | 1977-11-08 |
| DK139431C (enExample) | 1979-07-16 |
| AU8444575A (en) | 1977-03-10 |
| IL48028A (en) | 1978-07-31 |
| HU169916B (enExample) | 1977-02-28 |
| ATA711375A (de) | 1978-02-15 |
| DE2541484A1 (de) | 1976-04-15 |
| NL7511240A (nl) | 1976-03-30 |
| NL186383C (nl) | 1990-11-16 |
| FR2285877B1 (enExample) | 1979-09-14 |
| BE833897A (fr) | 1976-01-16 |
| GB1519050A (en) | 1978-07-26 |
| IL48028A0 (en) | 1975-11-25 |
| DD121942A5 (enExample) | 1976-09-05 |
| BG31503A3 (en) | 1982-01-15 |
| AT345995B (de) | 1978-10-10 |
| SE7510785L (sv) | 1976-03-29 |
| PL100319B1 (pl) | 1978-09-30 |
| DE2541484B2 (de) | 1981-06-04 |
| NL186383B (nl) | 1990-06-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH633536A5 (de) | Verfahren zur herstellung neuer tetracyclischer piperidin- oder pyrrolidinderivate. | |
| SU460626A3 (ru) | Способ получени винкамина или его производных | |
| SU545260A3 (ru) | Способ получени производных октагидроиндолохинолизина или их солей,или рацемата,или оптических антиподов | |
| US3830823A (en) | Process for the preparation of deethyleburnamonines | |
| SU481155A3 (ru) | Способ получени -(фурил-метил)морфинанов | |
| CN108314658A (zh) | 一种多取代噁唑衍生物的制备方法 | |
| US4316029A (en) | Synthesis of vincaminic acid derivatives | |
| US3983134A (en) | Ureylenethiophanes and their related compounds, and production thereof | |
| US4057550A (en) | Nitrogen-containing polycyclic compounds | |
| NZ202981A (en) | A process for the preparation of pyrazino(2,1-a)isoquinoline derivatives | |
| CA1071628A (en) | Indolo-quinolizines | |
| WO2024015861A1 (en) | Methods of preparation of heterocyclic compounds | |
| CZ294957B6 (cs) | Způsob přípravy substituované imidazopyridinové sloučeniny | |
| SU564813A3 (ru) | Способ получени производных индолохинолизина или их солей | |
| DE2813015C2 (de) | Verfahren zur Herstellung von Apovincaminsäureestern | |
| EP0977757B1 (en) | 9,10-diazatricyclo 4.2.1.1?2,5 ]decane and 9,10-diazatricyclo 3.3.1.1?2,6 ]decane derivatives having analgesic activity | |
| EP0050492B1 (en) | 1,1-disubstituted-hexahydro-indolo(2,3-a)quinolizine derivatives and their use in the enantioselective synthesis of optically active 14-oxo-e-homo-eburnane derivatives | |
| SU655317A3 (ru) | Способ получени винкана или его солей,или четвертичных солей | |
| SU665805A3 (ru) | Способ получени производных пиридо-(1,2-а) пиримидина или их оптически активных изомеров или их солей | |
| SU736872A3 (ru) | Способ получени производных эрголина | |
| US3018286A (en) | Methoxy-z-j | |
| SU532338A3 (ru) | Способ получени производных бензиламина | |
| IT9020715A1 (it) | Derivati diesteri di ottaidro-indolo/2, 3-a/chinolizina e loro sali nonche' procedimento per la loro preparazione | |
| Sanchez et al. | The synthesis of a series of 7‐amino‐1‐cyclopropyl‐8‐fluoro‐1, 4‐dihydro‐4‐oxo‐1, 6‐naphthyridine‐3‐carboxylic acids as potential antibacterial agents | |
| SU549086A3 (ru) | Способ получени производных индазола или их солей |