SU525430A3 - Способ получени кристаллического моногидрата цефалексина кали или кристаллического моногидрата цефалексина натри - Google Patents
Способ получени кристаллического моногидрата цефалексина кали или кристаллического моногидрата цефалексина натриInfo
- Publication number
- SU525430A3 SU525430A3 SU1929889A SU1929889A SU525430A3 SU 525430 A3 SU525430 A3 SU 525430A3 SU 1929889 A SU1929889 A SU 1929889A SU 1929889 A SU1929889 A SU 1929889A SU 525430 A3 SU525430 A3 SU 525430A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- broad
- potassium
- monohydrate
- sodium
- cefalexin
- Prior art date
Links
- AVGYWQBCYZHHPN-CYJZLJNKSA-N cephalexin monohydrate Chemical compound O.C1([C@@H](N)C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)C)C(O)=O)=CC=CC=C1 AVGYWQBCYZHHPN-CYJZLJNKSA-N 0.000 title claims description 15
- 229940106164 cephalexin Drugs 0.000 title claims description 11
- 238000000034 method Methods 0.000 title claims description 8
- 150000004682 monohydrates Chemical class 0.000 title claims description 5
- LTUDISCZKZHRMJ-UHFFFAOYSA-N potassium;hydrate Chemical compound O.[K] LTUDISCZKZHRMJ-UHFFFAOYSA-N 0.000 title claims description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 claims description 40
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 21
- 239000011734 sodium Substances 0.000 claims description 12
- 229910052708 sodium Inorganic materials 0.000 claims description 11
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 9
- 239000011591 potassium Substances 0.000 claims description 8
- 229910052700 potassium Inorganic materials 0.000 claims description 8
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 claims description 6
- -1 potassium alkoxide Chemical class 0.000 claims description 6
- NZDYPHVJLWMLJI-CYJZLJNKSA-M cephalexin sodium Chemical compound [Na+].C1([C@@H](N)C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)C)C([O-])=O)=CC=CC=C1 NZDYPHVJLWMLJI-CYJZLJNKSA-M 0.000 claims description 5
- 239000003960 organic solvent Substances 0.000 claims description 5
- 239000000843 powder Substances 0.000 claims description 4
- 238000002441 X-ray diffraction Methods 0.000 claims description 3
- 238000004090 dissolution Methods 0.000 claims description 3
- 150000007524 organic acids Chemical class 0.000 claims description 3
- 235000005985 organic acids Nutrition 0.000 claims description 3
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 claims description 2
- 150000008282 halocarbons Chemical class 0.000 claims description 2
- 150000003512 tertiary amines Chemical class 0.000 claims description 2
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 claims 2
- 238000004821 distillation Methods 0.000 claims 1
- ZUFQCVZBBNZMKD-UHFFFAOYSA-M potassium 2-ethylhexanoate Chemical compound [K+].CCCCC(CC)C([O-])=O ZUFQCVZBBNZMKD-UHFFFAOYSA-M 0.000 claims 1
- RPACBEVZENYWOL-XFULWGLBSA-M sodium;(2r)-2-[6-(4-chlorophenoxy)hexyl]oxirane-2-carboxylate Chemical compound [Na+].C=1C=C(Cl)C=CC=1OCCCCCC[C@]1(C(=O)[O-])CO1 RPACBEVZENYWOL-XFULWGLBSA-M 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 24
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 8
- 239000000725 suspension Substances 0.000 description 8
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 6
- 239000013078 crystal Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- 230000004071 biological effect Effects 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 3
- 241001122767 Theaceae Species 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 239000008367 deionised water Substances 0.000 description 2
- 229910021641 deionized water Inorganic materials 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000012065 filter cake Substances 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 159000000001 potassium salts Chemical class 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000010802 sludge Substances 0.000 description 2
- MFRIHAYPQRLWNB-UHFFFAOYSA-N sodium tert-butoxide Chemical compound [Na+].CC(C)(C)[O-] MFRIHAYPQRLWNB-UHFFFAOYSA-N 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229940047526 cephalexin monohydrate Drugs 0.000 description 1
- 125000003636 chemical group Chemical group 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- LKHYFCSSVZVVNF-UHFFFAOYSA-N ethyl hexanoate;sodium Chemical compound [Na].CCCCCC(=O)OCC LKHYFCSSVZVVNF-UHFFFAOYSA-N 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 239000011229 interlayer Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- YGZIWEZFFBPCLN-UHFFFAOYSA-N n,3-bis(2-chloroethyl)-4-hydroperoxy-2-oxo-1,3,2$l^{5}-oxazaphosphinan-2-amine Chemical compound OOC1CCOP(=O)(NCCCl)N1CCCl YGZIWEZFFBPCLN-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- BYTCDABWEGFPLT-UHFFFAOYSA-L potassium;sodium;dihydroxide Chemical compound [OH-].[OH-].[Na+].[K+] BYTCDABWEGFPLT-UHFFFAOYSA-L 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
- C07D501/22—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids with radicals containing only hydrogen and carbon atoms, attached in position 3
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US00260885A US3822256A (en) | 1972-06-08 | 1972-06-08 | Crystalline monohydrates of sodium and potassium cephalexin |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU525430A3 true SU525430A3 (ru) | 1976-08-15 |
Family
ID=22991055
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1929889A SU525430A3 (ru) | 1972-06-08 | 1973-06-07 | Способ получени кристаллического моногидрата цефалексина кали или кристаллического моногидрата цефалексина натри |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US3822256A (enExample) |
| JP (1) | JPS604189B2 (enExample) |
| AR (1) | AR197510A1 (enExample) |
| AU (1) | AU472861B2 (enExample) |
| BE (1) | BE800635A (enExample) |
| CA (1) | CA1021322A (enExample) |
| CH (1) | CH581661A5 (enExample) |
| DD (1) | DD106183A5 (enExample) |
| DE (1) | DE2329452A1 (enExample) |
| ES (1) | ES415675A1 (enExample) |
| FI (1) | FI62311C (enExample) |
| FR (1) | FR2187303B1 (enExample) |
| GB (1) | GB1413066A (enExample) |
| HU (1) | HU165661B (enExample) |
| IE (1) | IE37771B1 (enExample) |
| IL (1) | IL42439A (enExample) |
| NL (1) | NL7307817A (enExample) |
| SE (1) | SE409207B (enExample) |
| SU (1) | SU525430A3 (enExample) |
| YU (1) | YU146173A (enExample) |
| ZA (1) | ZA733835B (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5623217A (en) * | 1979-07-31 | 1981-03-05 | Kawasaki Steel Corp | Pouring starting method of continuous casting |
| JPS60120886A (ja) * | 1983-12-02 | 1985-06-28 | Takeda Chem Ind Ltd | セフェムカルボン酸のナトリウム塩の結晶 |
| JPS63108988U (enExample) * | 1987-01-08 | 1988-07-13 | ||
| JPS63136198U (enExample) * | 1987-02-26 | 1988-09-07 | ||
| US5142042A (en) * | 1989-01-23 | 1992-08-25 | Purzer Pharmaceutical Co., Ltd. | Process for preparing well crystallized alkali metal salts of 3, 7-substituted 7-aminocephalosporanic acid derivatives |
| DE68922207T2 (de) * | 1989-02-06 | 1995-11-09 | Purzer Pharmaceutical Co | Verfahren zur Herstellung von Alkalimetall-Salze von 3,7-substituierten 7-Aminocephalosporansauerderivaten. |
| CN115043853A (zh) * | 2022-08-16 | 2022-09-13 | 齐鲁晟华制药有限公司 | 一种头孢氨苄钠的制备方法 |
-
1972
- 1972-06-08 US US00260885A patent/US3822256A/en not_active Expired - Lifetime
-
1973
- 1973-05-11 CA CA171,003A patent/CA1021322A/en not_active Expired
- 1973-06-04 YU YU01461/73A patent/YU146173A/xx unknown
- 1973-06-05 SE SE7307932A patent/SE409207B/xx unknown
- 1973-06-05 NL NL7307817A patent/NL7307817A/xx not_active Application Discontinuation
- 1973-06-05 IL IL42439A patent/IL42439A/xx unknown
- 1973-06-06 ZA ZA733835A patent/ZA733835B/xx unknown
- 1973-06-07 ES ES415675A patent/ES415675A1/es not_active Expired
- 1973-06-07 BE BE132034A patent/BE800635A/xx not_active IP Right Cessation
- 1973-06-07 IE IE923/73A patent/IE37771B1/xx unknown
- 1973-06-07 HU HUBI471A patent/HU165661B/hu unknown
- 1973-06-07 AU AU56653/73A patent/AU472861B2/en not_active Expired
- 1973-06-07 FI FI1850/73A patent/FI62311C/fi active
- 1973-06-07 DD DD171409A patent/DD106183A5/xx unknown
- 1973-06-07 AR AR248443A patent/AR197510A1/es active
- 1973-06-07 JP JP48063440A patent/JPS604189B2/ja not_active Expired
- 1973-06-07 SU SU1929889A patent/SU525430A3/ru active
- 1973-06-07 FR FR7320815A patent/FR2187303B1/fr not_active Expired
- 1973-06-08 GB GB2745673A patent/GB1413066A/en not_active Expired
- 1973-06-08 DE DE2329452A patent/DE2329452A1/de not_active Ceased
- 1973-06-08 CH CH838673A patent/CH581661A5/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| DD106183A5 (enExample) | 1974-06-05 |
| DE2329452A1 (de) | 1974-01-03 |
| CH581661A5 (enExample) | 1976-11-15 |
| FI62311C (fi) | 1982-12-10 |
| FR2187303B1 (enExample) | 1977-09-09 |
| NL7307817A (enExample) | 1973-12-11 |
| ZA733835B (en) | 1974-04-24 |
| YU146173A (en) | 1982-02-28 |
| BE800635A (fr) | 1973-12-07 |
| IE37771B1 (en) | 1977-10-12 |
| JPS604189B2 (ja) | 1985-02-01 |
| AU5665373A (en) | 1974-12-12 |
| AU472861B2 (en) | 1976-06-10 |
| IL42439A (en) | 1975-12-31 |
| IL42439A0 (en) | 1973-08-29 |
| US3822256A (en) | 1974-07-02 |
| JPS4948815A (enExample) | 1974-05-11 |
| FR2187303A1 (enExample) | 1974-01-18 |
| HU165661B (enExample) | 1974-10-28 |
| IE37771L (en) | 1973-12-08 |
| GB1413066A (en) | 1975-11-05 |
| CA1021322A (en) | 1977-11-22 |
| FI62311B (fi) | 1982-08-31 |
| AR197510A1 (es) | 1974-04-15 |
| SE409207B (sv) | 1979-08-06 |
| ES415675A1 (es) | 1976-06-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU525430A3 (ru) | Способ получени кристаллического моногидрата цефалексина кали или кристаллического моногидрата цефалексина натри | |
| SU799666A3 (ru) | Способ получени гидратированной крис-ТАлличЕСКОй фОРМы НАТРиЕВОй СОли 3-АцЕТОКСи-МЕТил-7 2-(2-АМиНО-4-ТиАзОлил)-2-МЕТОКСи-иМиНОАцЕТАМидО цЕф-3-EM-4-КАРбОНОВОй КиС-лОТы,СиН-изОМЕРА | |
| EP0148094A2 (en) | Anti-tumor agent comprising an O-benzylidene-L-ascorbic acid or a salt thereof, and the production of the latter compound | |
| SU845789A3 (ru) | Способ получени -7- -(4-окси-6-метил-НиКОТиНАМидО)- -(4-ОКСифЕНил)АцЕТАМидО -3- (1-МЕТилТЕТРАзОл-5-ил)ТиОМЕТил-3-цЕфЕМ-4-КАРбО-НОВОй КиСлОТы | |
| CS195746B2 (en) | Process for preparing crystalline methanolate of natrium salt of cephamandole | |
| JP2780800B2 (ja) | セフタジジムジ塩酸塩ギ酸溶媒和物 | |
| US3647783A (en) | (2-substituted - 5 - oxo-cyclopent-1-enyl) esters of alpha-carboxyarylmethyl penicillins | |
| SU1516008A3 (ru) | Способ получени азетидин-3-карбоновой кислоты или ее солей | |
| SU574158A3 (ru) | Способ получени цефалексина или его солей | |
| US2838914A (en) | Isonicotinic acid hydrazide derivatives | |
| HU196822B (en) | Process for producing primicin salts | |
| US4168376A (en) | Process for crystalline sodium cefamandole | |
| RU2074171C1 (ru) | Способ получения трис-(2-оксиэтил)аммоний-о-крезоксиацетата | |
| CA1059518A (en) | Process for preparing 2-hydroxymethyl-3-hydroxy-6-(1-hydroxy-2-t-butylaminoethyl) pyridine | |
| HU176213B (en) | Process for preparing a new crystallic modification of the sodium salt of 7beta-cyanacetylamino-3-acetoxymethyl-cef-3-em-4-carboxylic acid | |
| SU545259A3 (ru) | Способ получени -замещенных циклосериновых соединений или их солей | |
| SU1664785A1 (ru) | Способ получени ацетата свинца | |
| SU980621A3 (ru) | Способ получени @ -формы гидрохлорида працозина | |
| SU348063A1 (ru) | Способ получени комплексной соли карбамида двухзамещенного фосфата меди | |
| RU2269532C1 (ru) | Способ получения тетра-(5-трет-бутилпиразино) порфиразина | |
| SU1456404A1 (ru) | Способ получени 2-нитрозо-1-нафтола | |
| SU740777A1 (ru) | Способ очистки пирослизевой кислоты | |
| SU384822A1 (enExample) | ||
| SU520351A1 (ru) | Способ плучени азометинов | |
| SU422737A1 (ru) | Способ получения производных фенилртути |