SU470957A3 - Способ получени производных 4-аминопирролин-3-она-2 или их солей - Google Patents
Способ получени производных 4-аминопирролин-3-она-2 или их солейInfo
- Publication number
- SU470957A3 SU470957A3 SU1763658A SU1763658A SU470957A3 SU 470957 A3 SU470957 A3 SU 470957A3 SU 1763658 A SU1763658 A SU 1763658A SU 1763658 A SU1763658 A SU 1763658A SU 470957 A3 SU470957 A3 SU 470957A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- calculated
- mol
- hydrochloride
- general formula
- derivatives
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 6
- 150000003839 salts Chemical class 0.000 title claims description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 33
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 12
- 150000001408 amides Chemical class 0.000 claims description 5
- 238000002955 isolation Methods 0.000 claims description 3
- 150000001412 amines Chemical class 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims 1
- 125000003118 aryl group Chemical group 0.000 claims 1
- 125000004432 carbon atom Chemical group C* 0.000 claims 1
- 229910052736 halogen Inorganic materials 0.000 claims 1
- 125000000623 heterocyclic group Chemical group 0.000 claims 1
- 229910052739 hydrogen Inorganic materials 0.000 claims 1
- 239000001257 hydrogen Substances 0.000 claims 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims 1
- 230000003993 interaction Effects 0.000 claims 1
- 239000003960 organic solvent Substances 0.000 claims 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 15
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 12
- 239000000243 solution Substances 0.000 description 12
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 8
- 238000010992 reflux Methods 0.000 description 7
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 238000001816 cooling Methods 0.000 description 3
- 235000011121 sodium hydroxide Nutrition 0.000 description 3
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- -1 RZTsousus and amides Chemical class 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- AKCRQHGQIJBRMN-UHFFFAOYSA-N 2-chloroaniline Chemical compound NC1=CC=CC=C1Cl AKCRQHGQIJBRMN-UHFFFAOYSA-N 0.000 description 1
- LTHNHFOGQMKPOV-UHFFFAOYSA-N 2-ethylhexan-1-amine Chemical compound CCCCC(CC)CN LTHNHFOGQMKPOV-UHFFFAOYSA-N 0.000 description 1
- JKJXONCYXKMLJK-UHFFFAOYSA-N 3-aminopyrrol-2-one Chemical compound N=C1C=CNC1=O JKJXONCYXKMLJK-UHFFFAOYSA-N 0.000 description 1
- RJTROOIXLNVHNB-UHFFFAOYSA-N 4-bromo-3-oxo-n-phenylbutanamide Chemical compound BrCC(=O)CC(=O)NC1=CC=CC=C1 RJTROOIXLNVHNB-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- MMCPOSDMTGQNKG-UHFFFAOYSA-N anilinium chloride Chemical compound Cl.NC1=CC=CC=C1 MMCPOSDMTGQNKG-UHFFFAOYSA-N 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000004570 mortar (masonry) Substances 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/34—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/36—Oxygen or sulfur atoms
- C07D207/38—2-Pyrrolones
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pyrrole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH439271A CH543504A (de) | 1971-03-25 | 1971-03-25 | Verfahren zur Herstellung 1-substituierter 4-Aminopyrrolin-3-one-(2) |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU470957A3 true SU470957A3 (ru) | 1975-05-15 |
Family
ID=4275258
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1763658A SU470957A3 (ru) | 1971-03-25 | 1972-03-22 | Способ получени производных 4-аминопирролин-3-она-2 или их солей |
Country Status (12)
| Country | Link |
|---|---|
| AT (1) | AT313891B (enExample) |
| BE (1) | BE781160A (enExample) |
| CA (1) | CA964661A (enExample) |
| CH (1) | CH543504A (enExample) |
| CS (1) | CS176186B2 (enExample) |
| DE (1) | DE2214488C3 (enExample) |
| FR (1) | FR2130704B1 (enExample) |
| GB (1) | GB1323020A (enExample) |
| IT (1) | IT988054B (enExample) |
| LU (1) | LU65031A1 (enExample) |
| NL (1) | NL7201106A (enExample) |
| SU (1) | SU470957A3 (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH649282A5 (de) * | 1982-06-18 | 1985-05-15 | Lonza Ag | Verfahren zur herstellung von 4-(trialkylammonium)-acetoacetaryliden. |
| DE19944332A1 (de) * | 1999-09-16 | 2001-03-22 | Dresden Arzneimittel | Antikonvulsiv und anxiolytisch wirkende 4-Amino-1-aryl-1,5-dihydro-pyrrol-2-one und Verfahren zu deren Herstellung |
-
1971
- 1971-03-25 CH CH439271A patent/CH543504A/de not_active IP Right Cessation
- 1971-12-31 GB GB6096871A patent/GB1323020A/en not_active Expired
-
1972
- 1972-01-21 IT IT4784772A patent/IT988054B/it active
- 1972-01-27 NL NL7201106A patent/NL7201106A/xx not_active Application Discontinuation
- 1972-02-18 CS CS106072A patent/CS176186B2/cs unknown
- 1972-03-22 SU SU1763658A patent/SU470957A3/ru active
- 1972-03-23 LU LU65031D patent/LU65031A1/xx unknown
- 1972-03-23 BE BE781160A patent/BE781160A/xx unknown
- 1972-03-23 CA CA137,930A patent/CA964661A/en not_active Expired
- 1972-03-24 FR FR7210521A patent/FR2130704B1/fr not_active Expired
- 1972-03-24 AT AT258572A patent/AT313891B/de not_active IP Right Cessation
- 1972-03-24 DE DE19722214488 patent/DE2214488C3/de not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2130704A1 (enExample) | 1972-11-03 |
| LU65031A1 (enExample) | 1972-12-07 |
| IT988054B (it) | 1975-04-10 |
| GB1323020A (en) | 1973-07-11 |
| DE2214488B2 (de) | 1980-03-13 |
| FR2130704B1 (enExample) | 1977-04-01 |
| BE781160A (fr) | 1972-09-25 |
| NL7201106A (enExample) | 1972-09-27 |
| DE2214488C3 (de) | 1980-11-06 |
| CA964661A (en) | 1975-03-18 |
| CS176186B2 (enExample) | 1977-06-30 |
| AT313891B (de) | 1974-03-11 |
| DE2214488A1 (de) | 1972-10-05 |
| CH543504A (de) | 1973-10-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3632645A (en) | Substituted phenylacetyl derivatives of guanidine o-alkylisoureas s-alkylisothioureas and p-nitrobenzylisothiourea | |
| SU727142A3 (ru) | Способ получени замещенных 1-сульфонилбензимидазолов | |
| SU493966A3 (ru) | Способ получени производных 4-/2имидазолин-2-иламино/-2,1,3-бензотиадиазола | |
| NO151876B (no) | Fremgangsmaate og anordning for foring av dyr | |
| NO135258B (enExample) | ||
| NO762661L (enExample) | ||
| DK158977B (da) | Fremgangsmaade til fremstilling af substituerede guanidiner eller salte deraf | |
| SU453830A3 (ru) | Способ получения соответственно замещенного фенацетилгуанидина | |
| SU470957A3 (ru) | Способ получени производных 4-аминопирролин-3-она-2 или их солей | |
| NO120758B (enExample) | ||
| SU584775A3 (ru) | Способ получени производных бензотиазола или их солей | |
| NO147774B (no) | Innretning for automatisk kontroll og regulering av gjennomsnittsverdien av paatrykt spenning ved elektrolytisk farging av anodisert aluminium | |
| NO139920B (no) | Fremgangsmaate ved fremstilling av 2,5-disubstituerte benzamider | |
| US2729645A (en) | 1-[2-(dithiocarboxyamino)polymethylene] quaternary ammonium inner salts | |
| SU604497A3 (ru) | Способ получени тетрамизола или его солей | |
| SU505358A3 (ru) | Способ получени производных пиперазина | |
| SU489310A3 (ru) | Способ получени производного бифенилацетамида или его соли | |
| US2519530A (en) | Biotin aliphatic amides and method for their preparation | |
| SU492076A3 (ru) | Способ получени замещенных гуанидина | |
| US2433489A (en) | Production of amidines | |
| US2524802A (en) | Hydroxybenzenesulfonamidopyridazines and preparation of same | |
| SU426366A3 (ru) | Способ получения производных1-арил-2,3,4,5 тетрагидро-1 н-1,5-бензодиазепин-2-она | |
| US2532547A (en) | Z-aminoalkyl-glyoxaline derivatives | |
| SU591150A3 (ru) | Способ получени производных нитроимидазолилтриазолопиридазина или их солей | |
| US3378592A (en) | Process for the production of 3, 4-dihydroxybenzyloxyaminehydrobromide |