SU458984A3 - Способ получени красителей полициклического р да - Google Patents
Способ получени красителей полициклического р даInfo
- Publication number
- SU458984A3 SU458984A3 SU1406615A SU1406615A SU458984A3 SU 458984 A3 SU458984 A3 SU 458984A3 SU 1406615 A SU1406615 A SU 1406615A SU 1406615 A SU1406615 A SU 1406615A SU 458984 A3 SU458984 A3 SU 458984A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- parts
- acid
- phenylthio
- added
- group
- Prior art date
Links
- 239000000975 dye Substances 0.000 title description 13
- 238000004519 manufacturing process Methods 0.000 title description 2
- 125000003367 polycyclic group Chemical group 0.000 title 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 15
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- 239000013078 crystal Substances 0.000 description 8
- -1 introgly Chemical group 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- WOZVHXUHUFLZGK-UHFFFAOYSA-N dimethyl terephthalate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C=C1 WOZVHXUHUFLZGK-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 5
- 125000003545 alkoxy group Chemical group 0.000 description 5
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 description 5
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- ADCOVFLJGNWWNZ-UHFFFAOYSA-N antimony trioxide Chemical compound O=[Sb]O[Sb]=O ADCOVFLJGNWWNZ-UHFFFAOYSA-N 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 230000007935 neutral effect Effects 0.000 description 4
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 125000005997 bromomethyl group Chemical group 0.000 description 3
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 3
- 239000003086 colorant Substances 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 239000000835 fiber Substances 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000002367 halogens Chemical class 0.000 description 3
- 229920000728 polyester Polymers 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- HOVRQUHNZHBKKJ-UHFFFAOYSA-N 4-(carbamoylamino)benzoic acid Chemical compound NC(=O)NC1=CC=C(C(O)=O)C=C1 HOVRQUHNZHBKKJ-UHFFFAOYSA-N 0.000 description 2
- ADCUEPOHPCPMCE-UHFFFAOYSA-N 4-cyanobenzoic acid Chemical compound OC(=O)C1=CC=C(C#N)C=C1 ADCUEPOHPCPMCE-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 229930040373 Paraformaldehyde Natural products 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 150000004056 anthraquinones Chemical class 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- MLIREBYILWEBDM-UHFFFAOYSA-N cyanoacetic acid Chemical compound OC(=O)CC#N MLIREBYILWEBDM-UHFFFAOYSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 238000004043 dyeing Methods 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- CGJMROBVSBIBKP-UHFFFAOYSA-N malonamic acid Chemical compound NC(=O)CC(O)=O CGJMROBVSBIBKP-UHFFFAOYSA-N 0.000 description 2
- 229940071125 manganese acetate Drugs 0.000 description 2
- UOGMEBQRZBEZQT-UHFFFAOYSA-L manganese(2+);diacetate Chemical compound [Mn+2].CC([O-])=O.CC([O-])=O UOGMEBQRZBEZQT-UHFFFAOYSA-L 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 239000003973 paint Substances 0.000 description 2
- 229920002866 paraformaldehyde Polymers 0.000 description 2
- 229920000570 polyether Polymers 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- XZZNDPSIHUTMOC-UHFFFAOYSA-N triphenyl phosphate Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)(=O)OC1=CC=CC=C1 XZZNDPSIHUTMOC-UHFFFAOYSA-N 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- RVNSAAIWCWTCTJ-ZPQYLTHOSA-N (2s,3s,4r)-2-(1,2-dihydroxyethyl)pyrrolidine-3,4-diol Chemical compound OCC(O)[C@@H]1NC[C@@H](O)[C@H]1O RVNSAAIWCWTCTJ-ZPQYLTHOSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- RWDCBLOFRYIIOL-UHFFFAOYSA-N 3-(carbamoylamino)benzoic acid Chemical compound NC(=O)NC1=CC=CC(C(O)=O)=C1 RWDCBLOFRYIIOL-UHFFFAOYSA-N 0.000 description 1
- BPTDJMQIQYRAPW-UHFFFAOYSA-N 3-[carbamoyl(hydroxymethyl)amino]benzoic acid Chemical compound C(O)N(C(=O)N)C=1C=C(C(=O)O)C=CC1 BPTDJMQIQYRAPW-UHFFFAOYSA-N 0.000 description 1
- JJYPMNFTHPTTDI-UHFFFAOYSA-N 3-methylaniline Chemical compound CC1=CC=CC(N)=C1 JJYPMNFTHPTTDI-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- HTUQWDUGEDFCGJ-UHFFFAOYSA-N 4-butyl-2,6-dimethylaniline Chemical compound CCCCC1=CC(C)=C(N)C(C)=C1 HTUQWDUGEDFCGJ-UHFFFAOYSA-N 0.000 description 1
- NIDKGLRXRBFGEN-UHFFFAOYSA-N 4-cyano-2-methylbenzoic acid Chemical compound CC1=CC(C#N)=CC=C1C(O)=O NIDKGLRXRBFGEN-UHFFFAOYSA-N 0.000 description 1
- 240000004507 Abelmoschus esculentus Species 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000001769 aryl amino group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000004181 carboxyalkyl group Chemical group 0.000 description 1
- 125000005026 carboxyaryl group Chemical group 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- HKYGSMOFSFOEIP-UHFFFAOYSA-N dichloro(dichloromethoxy)methane Chemical compound ClC(Cl)OC(Cl)Cl HKYGSMOFSFOEIP-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002148 esters Chemical group 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 231100001160 nonlethal Toxicity 0.000 description 1
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 description 1
- RZXMPPFPUUCRFN-UHFFFAOYSA-N p-toluidine Chemical compound CC1=CC=C(N)C=C1 RZXMPPFPUUCRFN-UHFFFAOYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical compound OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 238000011282 treatment Methods 0.000 description 1
- 125000004417 unsaturated alkyl group Chemical group 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
Landscapes
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP1507869A JPS4814167B1 (enExample) | 1969-02-27 | 1969-02-27 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU458984A3 true SU458984A3 (ru) | 1975-01-30 |
Family
ID=11878799
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1406615A SU458984A3 (ru) | 1969-02-27 | 1970-02-26 | Способ получени красителей полициклического р да |
Country Status (2)
| Country | Link |
|---|---|
| JP (1) | JPS4814167B1 (enExample) |
| SU (1) | SU458984A3 (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP2025123096A (ja) * | 2024-02-09 | 2025-08-22 | 太陽ホールディングス株式会社 | アントラキノン化合物、着色組成物及び硬化物 |
-
1969
- 1969-02-27 JP JP1507869A patent/JPS4814167B1/ja active Pending
-
1970
- 1970-02-26 SU SU1406615A patent/SU458984A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| JPS4814167B1 (enExample) | 1973-05-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1026456B (de) | Verfahren zur Herstellung von Kuepenfarbstoffen | |
| US2068353A (en) | Arylazodiamino-picolines | |
| DE1544460C3 (de) | Bis-(acetoacetyl)-arylendiamiddisazopigmente | |
| SU458984A3 (ru) | Способ получени красителей полициклического р да | |
| US3201402A (en) | Monocyclic carbocyclic aromatic amine | |
| US2096295A (en) | Dyestuffs capable of being chromed | |
| JPS5928589B2 (ja) | ペリノン染料並びにその製法 | |
| US3124581A (en) | Certificate of correction | |
| DE2210168A1 (de) | Chinophthalon-farbstoffe | |
| US2770625A (en) | Anthraquinone dyestuffs | |
| US3036077A (en) | Aminobenzanthrone dyestuffs | |
| CH516628A (de) | Farbstoffpräparate, welche wasserunlösliche Styrylfarbstoffe enthalten | |
| EP0000737B1 (de) | Monoazopigmente der Acetoacetylaminobenzimidazolonreihe, Verfahren zu deren Herstellung, und deren Verwendung zum Pigmentieren von hochmolekularem organischem Material | |
| US3082215A (en) | Lin-benzobisthiachromone pigments | |
| US2143830A (en) | Vat dyestuffs derived from 1,4,5,8-naphthalene-tetra-carboxylic acid and a process of preparing them | |
| CH506588A (de) | Verfahren zur Herstellung von in Wasser schwerlöslichen Anthrachinonfarbstoffen | |
| DE1794110A1 (de) | Wasserunloesliche Azofarbstoffe und Verfahren zu deren Herstellung | |
| US1714427A (en) | The-rhiite | |
| SU472956A1 (ru) | Способ получени азокрасител тиазолового р да | |
| US2115445A (en) | Production of compounds of the azabenzanthrone series | |
| DE974670C (de) | Verfahren zur Herstellung von Anthrachinonkuepenfarbstoffen | |
| DE867892C (de) | Verfahren zur Herstellung von Bisoxazol-Kuepenfarbstoffen | |
| AT204146B (de) | Verfahren zur Herstellung von kupplungsfähigen Phthalocyaninderivaten | |
| SU956465A1 (ru) | N-(3-сульфо-2-оксипропил)-анилины как промежуточные продукты дл получени азокрасителей и способ их получени | |
| DE1470289A1 (de) | 4,4-Di-[benzoxazolyl-(2)]-stilben Verbindungen und Verfahren zu ihrer Herstellung |