SE461658B - Stabiliserad blekmedel- och tvaettmedelkomposition och dess anvaendning vid tvaettfoerfaranden - Google Patents
Stabiliserad blekmedel- och tvaettmedelkomposition och dess anvaendning vid tvaettfoerfarandenInfo
- Publication number
- SE461658B SE461658B SE8305765A SE8305765A SE461658B SE 461658 B SE461658 B SE 461658B SE 8305765 A SE8305765 A SE 8305765A SE 8305765 A SE8305765 A SE 8305765A SE 461658 B SE461658 B SE 461658B
- Authority
- SE
- Sweden
- Prior art keywords
- composition according
- weight
- composition
- taed
- sodium
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims description 103
- 239000007844 bleaching agent Substances 0.000 title claims description 25
- 238000000034 method Methods 0.000 title claims description 17
- -1 peroxy compound Chemical class 0.000 claims description 55
- 239000003599 detergent Substances 0.000 claims description 51
- 238000004061 bleaching Methods 0.000 claims description 32
- 125000004432 carbon atom Chemical group C* 0.000 claims description 30
- 125000000217 alkyl group Chemical group 0.000 claims description 24
- 229920000642 polymer Polymers 0.000 claims description 24
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical group OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 claims description 21
- 150000003839 salts Chemical class 0.000 claims description 21
- 239000004094 surface-active agent Substances 0.000 claims description 21
- 229910052783 alkali metal Inorganic materials 0.000 claims description 20
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 18
- 239000003352 sequestering agent Substances 0.000 claims description 16
- 239000002245 particle Substances 0.000 claims description 15
- 239000012190 activator Substances 0.000 claims description 14
- 229910052739 hydrogen Inorganic materials 0.000 claims description 14
- 235000019832 sodium triphosphate Nutrition 0.000 claims description 14
- 150000001340 alkali metals Chemical class 0.000 claims description 13
- 239000001257 hydrogen Substances 0.000 claims description 13
- 125000000129 anionic group Chemical group 0.000 claims description 12
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 9
- 125000002091 cationic group Chemical group 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 7
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 6
- 150000002431 hydrogen Chemical group 0.000 claims description 6
- 239000007864 aqueous solution Substances 0.000 claims description 5
- 238000009826 distribution Methods 0.000 claims description 5
- 239000000178 monomer Substances 0.000 claims description 5
- ATGAWOHQWWULNK-UHFFFAOYSA-I pentapotassium;[oxido(phosphonatooxy)phosphoryl] phosphate Chemical compound [K+].[K+].[K+].[K+].[K+].[O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O ATGAWOHQWWULNK-UHFFFAOYSA-I 0.000 claims description 5
- 150000001768 cations Chemical class 0.000 claims description 4
- 239000000945 filler Substances 0.000 claims description 4
- 239000008187 granular material Substances 0.000 claims description 4
- HWGNBUXHKFFFIH-UHFFFAOYSA-I pentasodium;[oxido(phosphonatooxy)phosphoryl] phosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O HWGNBUXHKFFFIH-UHFFFAOYSA-I 0.000 claims description 4
- 239000000463 material Substances 0.000 claims description 3
- FRPJTGXMTIIFIT-UHFFFAOYSA-N tetraacetylethylenediamine Chemical compound CC(=O)C(N)(C(C)=O)C(N)(C(C)=O)C(C)=O FRPJTGXMTIIFIT-UHFFFAOYSA-N 0.000 claims 11
- AZIQALWHRUQPHV-UHFFFAOYSA-N prop-2-eneperoxoic acid Chemical compound OOC(=O)C=C AZIQALWHRUQPHV-UHFFFAOYSA-N 0.000 claims 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 42
- 229910052708 sodium Inorganic materials 0.000 description 42
- 239000011734 sodium Substances 0.000 description 42
- 239000000243 solution Substances 0.000 description 30
- 150000004965 peroxy acids Chemical class 0.000 description 20
- BGRWYDHXPHLNKA-UHFFFAOYSA-N Tetraacetylethylenediamine Chemical compound CC(=O)N(C(C)=O)CCN(C(C)=O)C(C)=O BGRWYDHXPHLNKA-UHFFFAOYSA-N 0.000 description 18
- 150000001875 compounds Chemical class 0.000 description 18
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 16
- 238000005406 washing Methods 0.000 description 16
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 12
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 11
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 10
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 10
- 239000001301 oxygen Substances 0.000 description 10
- 229910052760 oxygen Inorganic materials 0.000 description 10
- 229910052700 potassium Inorganic materials 0.000 description 10
- 239000011591 potassium Substances 0.000 description 10
- 239000000047 product Substances 0.000 description 9
- UNXRWKVEANCORM-UHFFFAOYSA-I triphosphate(5-) Chemical compound [O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O UNXRWKVEANCORM-UHFFFAOYSA-I 0.000 description 9
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 8
- 239000000344 soap Substances 0.000 description 8
- 125000001273 sulfonato group Chemical class [O-]S(*)(=O)=O 0.000 description 8
- 239000002253 acid Substances 0.000 description 7
- 239000004744 fabric Substances 0.000 description 7
- 150000004760 silicates Chemical class 0.000 description 7
- 235000011152 sodium sulphate Nutrition 0.000 description 7
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 6
- 150000003863 ammonium salts Chemical class 0.000 description 6
- 239000003945 anionic surfactant Substances 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 150000002191 fatty alcohols Chemical class 0.000 description 6
- 229910052938 sodium sulfate Inorganic materials 0.000 description 6
- 239000003760 tallow Substances 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- 150000001298 alcohols Chemical class 0.000 description 5
- 239000007859 condensation product Substances 0.000 description 5
- 238000002474 experimental method Methods 0.000 description 5
- 230000002209 hydrophobic effect Effects 0.000 description 5
- 230000003287 optical effect Effects 0.000 description 5
- 239000002304 perfume Substances 0.000 description 5
- 125000000864 peroxy group Chemical group O(O*)* 0.000 description 5
- 238000007086 side reaction Methods 0.000 description 5
- 239000012418 sodium perborate tetrahydrate Substances 0.000 description 5
- IBDSNZLUHYKHQP-UHFFFAOYSA-N sodium;3-oxidodioxaborirane;tetrahydrate Chemical compound O.O.O.O.[Na+].[O-]B1OO1 IBDSNZLUHYKHQP-UHFFFAOYSA-N 0.000 description 5
- 239000010457 zeolite Substances 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 102000004190 Enzymes Human genes 0.000 description 4
- 108090000790 Enzymes Proteins 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 239000004115 Sodium Silicate Substances 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 235000014113 dietary fatty acids Nutrition 0.000 description 4
- 229940088598 enzyme Drugs 0.000 description 4
- 239000000194 fatty acid Substances 0.000 description 4
- 229930195729 fatty acid Natural products 0.000 description 4
- 125000001165 hydrophobic group Chemical group 0.000 description 4
- 239000004615 ingredient Substances 0.000 description 4
- 229910021645 metal ion Inorganic materials 0.000 description 4
- 238000002156 mixing Methods 0.000 description 4
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical compound OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 4
- 239000012188 paraffin wax Substances 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 150000003138 primary alcohols Chemical class 0.000 description 4
- 239000002002 slurry Substances 0.000 description 4
- 229960001922 sodium perborate Drugs 0.000 description 4
- 159000000000 sodium salts Chemical class 0.000 description 4
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 4
- 229910052911 sodium silicate Inorganic materials 0.000 description 4
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 description 4
- GLVYLTSKTCWWJR-UHFFFAOYSA-N 2-carbonoperoxoylbenzoic acid Chemical compound OOC(=O)C1=CC=CC=C1C(O)=O GLVYLTSKTCWWJR-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 235000013162 Cocos nucifera Nutrition 0.000 description 3
- 244000060011 Cocos nucifera Species 0.000 description 3
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 3
- 229910019142 PO4 Inorganic materials 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 229910021536 Zeolite Inorganic materials 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 125000002947 alkylene group Chemical group 0.000 description 3
- 150000007942 carboxylates Chemical class 0.000 description 3
- 239000002738 chelating agent Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000000470 constituent Substances 0.000 description 3
- 239000008367 deionised water Substances 0.000 description 3
- 229910021641 deionized water Inorganic materials 0.000 description 3
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 3
- 229910001882 dioxygen Inorganic materials 0.000 description 3
- 150000004665 fatty acids Chemical class 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000002367 halogens Chemical class 0.000 description 3
- 230000002401 inhibitory effect Effects 0.000 description 3
- 239000002563 ionic surfactant Substances 0.000 description 3
- 150000002500 ions Chemical class 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 3
- 235000021317 phosphate Nutrition 0.000 description 3
- 159000000001 potassium salts Chemical class 0.000 description 3
- 238000001694 spray drying Methods 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 238000003860 storage Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 3
- DHCDFWKWKRSZHF-UHFFFAOYSA-L thiosulfate(2-) Chemical compound [O-]S([S-])(=O)=O DHCDFWKWKRSZHF-UHFFFAOYSA-L 0.000 description 3
- FEWFXBUNENSNBQ-UHFFFAOYSA-N 2-hydroxyacrylic acid Chemical compound OC(=C)C(O)=O FEWFXBUNENSNBQ-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- QPCDCPDFJACHGM-UHFFFAOYSA-N N,N-bis{2-[bis(carboxymethyl)amino]ethyl}glycine Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(=O)O)CCN(CC(O)=O)CC(O)=O QPCDCPDFJACHGM-UHFFFAOYSA-N 0.000 description 2
- 102000035195 Peptidases Human genes 0.000 description 2
- 108091005804 Peptidases Proteins 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000002671 adjuvant Substances 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 150000001342 alkaline earth metals Chemical class 0.000 description 2
- 150000001336 alkenes Chemical class 0.000 description 2
- 150000004996 alkyl benzenes Chemical class 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 239000002280 amphoteric surfactant Substances 0.000 description 2
- 150000001450 anions Chemical class 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- 239000003093 cationic surfactant Substances 0.000 description 2
- 239000007931 coated granule Substances 0.000 description 2
- 239000003240 coconut oil Substances 0.000 description 2
- 235000019864 coconut oil Nutrition 0.000 description 2
- 230000009918 complex formation Effects 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 229940090960 diethylenetriamine pentamethylene phosphonic acid Drugs 0.000 description 2
- 235000011180 diphosphates Nutrition 0.000 description 2
- DUYCTCQXNHFCSJ-UHFFFAOYSA-N dtpmp Chemical compound OP(=O)(O)CN(CP(O)(O)=O)CCN(CP(O)(=O)O)CCN(CP(O)(O)=O)CP(O)(O)=O DUYCTCQXNHFCSJ-UHFFFAOYSA-N 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 2
- KWIUHFFTVRNATP-UHFFFAOYSA-N glycine betaine Chemical compound C[N+](C)(C)CC([O-])=O KWIUHFFTVRNATP-UHFFFAOYSA-N 0.000 description 2
- 159000000003 magnesium salts Chemical class 0.000 description 2
- LMTSQIZQTFBYRL-UHFFFAOYSA-N n'-octadecylethane-1,2-diamine Chemical compound CCCCCCCCCCCCCCCCCCNCCN LMTSQIZQTFBYRL-UHFFFAOYSA-N 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 239000002736 nonionic surfactant Substances 0.000 description 2
- 229960003330 pentetic acid Drugs 0.000 description 2
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 2
- 239000000049 pigment Substances 0.000 description 2
- 229920005646 polycarboxylate Polymers 0.000 description 2
- 235000011151 potassium sulphates Nutrition 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000002243 precursor Substances 0.000 description 2
- 229940024999 proteolytic enzymes for treatment of wounds and ulcers Drugs 0.000 description 2
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 230000000087 stabilizing effect Effects 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 150000008053 sultones Chemical class 0.000 description 2
- 239000008399 tap water Substances 0.000 description 2
- 235000020679 tap water Nutrition 0.000 description 2
- 238000010998 test method Methods 0.000 description 2
- 239000002888 zwitterionic surfactant Substances 0.000 description 2
- CIOXZGOUEYHNBF-UHFFFAOYSA-N (carboxymethoxy)succinic acid Chemical compound OC(=O)COC(C(O)=O)CC(O)=O CIOXZGOUEYHNBF-UHFFFAOYSA-N 0.000 description 1
- PSBDWGZCVUAZQS-UHFFFAOYSA-N (dimethylsulfonio)acetate Chemical compound C[S+](C)CC([O-])=O PSBDWGZCVUAZQS-UHFFFAOYSA-N 0.000 description 1
- SFRLSTJPMFGBDP-UHFFFAOYSA-N 1,2-diphosphonoethylphosphonic acid Chemical class OP(O)(=O)CC(P(O)(O)=O)P(O)(O)=O SFRLSTJPMFGBDP-UHFFFAOYSA-N 0.000 description 1
- JKTAIYGNOFSMCE-UHFFFAOYSA-N 2,3-di(nonyl)phenol Chemical compound CCCCCCCCCC1=CC=CC(O)=C1CCCCCCCCC JKTAIYGNOFSMCE-UHFFFAOYSA-N 0.000 description 1
- WZFUQSJFWNHZHM-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)CC(=O)N1CC2=C(CC1)NN=N2 WZFUQSJFWNHZHM-UHFFFAOYSA-N 0.000 description 1
- CYEJMVLDXAUOPN-UHFFFAOYSA-N 2-dodecylphenol Chemical compound CCCCCCCCCCCCC1=CC=CC=C1O CYEJMVLDXAUOPN-UHFFFAOYSA-N 0.000 description 1
- AEDQNOLIADXSBB-UHFFFAOYSA-N 3-(dodecylazaniumyl)propanoate Chemical compound CCCCCCCCCCCCNCCC(O)=O AEDQNOLIADXSBB-UHFFFAOYSA-N 0.000 description 1
- WBOQHFMXKCEWSQ-UHFFFAOYSA-N 4-hydroperoxy-4-oxobutanoic acid Chemical compound OOC(=O)CCC(O)=O WBOQHFMXKCEWSQ-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 101100037762 Caenorhabditis elegans rnh-2 gene Proteins 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- LZZYPRNAOMGNLH-UHFFFAOYSA-M Cetrimonium bromide Chemical compound [Br-].CCCCCCCCCCCCCCCC[N+](C)(C)C LZZYPRNAOMGNLH-UHFFFAOYSA-M 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical compound [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 description 1
- XZMCDFZZKTWFGF-UHFFFAOYSA-N Cyanamide Chemical class NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- 229940120146 EDTMP Drugs 0.000 description 1
- DBVJJBKOTRCVKF-UHFFFAOYSA-N Etidronic acid Chemical class OP(=O)(O)C(O)(C)P(O)(O)=O DBVJJBKOTRCVKF-UHFFFAOYSA-N 0.000 description 1
- 239000005639 Lauric acid Substances 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- IGFHQQFPSIBGKE-UHFFFAOYSA-N Nonylphenol Natural products CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 description 1
- 241000233805 Phoenix Species 0.000 description 1
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical class OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 239000004721 Polyphenylene oxide Chemical group 0.000 description 1
- 229920000388 Polyphosphate Polymers 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 239000004141 Sodium laurylsulphate Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical class OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 125000002015 acyclic group Chemical group 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 238000005054 agglomeration Methods 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- 229910052936 alkali metal sulfate Inorganic materials 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- APUPEJJSWDHEBO-UHFFFAOYSA-P ammonium molybdate Chemical compound [NH4+].[NH4+].[O-][Mo]([O-])(=O)=O APUPEJJSWDHEBO-UHFFFAOYSA-P 0.000 description 1
- 239000011609 ammonium molybdate Substances 0.000 description 1
- 229940010552 ammonium molybdate Drugs 0.000 description 1
- 235000018660 ammonium molybdate Nutrition 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 239000001166 ammonium sulphate Substances 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 238000010936 aqueous wash Methods 0.000 description 1
- RRDBXTBGGXLZHD-UHFFFAOYSA-N benzene-1,4-dicarboperoxoic acid Chemical compound OOC(=O)C1=CC=C(C(=O)OO)C=C1 RRDBXTBGGXLZHD-UHFFFAOYSA-N 0.000 description 1
- VBICKXHEKHSIBG-UHFFFAOYSA-N beta-monoglyceryl stearate Natural products CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO VBICKXHEKHSIBG-UHFFFAOYSA-N 0.000 description 1
- 229960003237 betaine Drugs 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 229910001431 copper ion Inorganic materials 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- GPLRAVKSCUXZTP-UHFFFAOYSA-N diglycerol Chemical compound OCC(O)COCC(O)CO GPLRAVKSCUXZTP-UHFFFAOYSA-N 0.000 description 1
- XPPKVPWEQAFLFU-UHFFFAOYSA-J diphosphate(4-) Chemical compound [O-]P([O-])(=O)OP([O-])([O-])=O XPPKVPWEQAFLFU-UHFFFAOYSA-J 0.000 description 1
- ZIHQYOJUGRUMKO-UHFFFAOYSA-N disodium trihydroxy-[hydroxy(dioxido)silyl]oxysilane Chemical compound [Na+].[Na+].O[Si](O)(O)O[Si](O)([O-])[O-] ZIHQYOJUGRUMKO-UHFFFAOYSA-N 0.000 description 1
- JHUXOSATQXGREM-UHFFFAOYSA-N dodecanediperoxoic acid Chemical compound OOC(=O)CCCCCCCCCCC(=O)OO JHUXOSATQXGREM-UHFFFAOYSA-N 0.000 description 1
- NFDRPXJGHKJRLJ-UHFFFAOYSA-N edtmp Chemical compound OP(O)(=O)CN(CP(O)(O)=O)CCN(CP(O)(O)=O)CP(O)(O)=O NFDRPXJGHKJRLJ-UHFFFAOYSA-N 0.000 description 1
- RXHDXDIEHWVFOC-UHFFFAOYSA-M ethyl-dimethyl-octadecylazanium;chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCCCC[N+](C)(C)CC RXHDXDIEHWVFOC-UHFFFAOYSA-M 0.000 description 1
- 239000003925 fat Substances 0.000 description 1
- 235000019197 fats Nutrition 0.000 description 1
- 239000004872 foam stabilizing agent Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- JPWNSMBCNUAXMJ-UHFFFAOYSA-N hexadecylhydrazine Chemical compound CCCCCCCCCCCCCCCCNN JPWNSMBCNUAXMJ-UHFFFAOYSA-N 0.000 description 1
- 229940005740 hexametaphosphate Drugs 0.000 description 1
- PMYUVOOOQDGQNW-UHFFFAOYSA-N hexasodium;trioxido(trioxidosilyloxy)silane Chemical compound [Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[O-][Si]([O-])([O-])O[Si]([O-])([O-])[O-] PMYUVOOOQDGQNW-UHFFFAOYSA-N 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 150000002460 imidazoles Chemical class 0.000 description 1
- 229910052806 inorganic carbonate Inorganic materials 0.000 description 1
- 150000002484 inorganic compounds Chemical class 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 150000004966 inorganic peroxy acids Chemical class 0.000 description 1
- 229940079865 intestinal antiinfectives imidazole derivative Drugs 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-N methyl sulfate Chemical class COS(O)(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-N 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 1
- MEFBJEMVZONFCJ-UHFFFAOYSA-N molybdate Chemical compound [O-][Mo]([O-])(=O)=O MEFBJEMVZONFCJ-UHFFFAOYSA-N 0.000 description 1
- QIBKKTQVKFEWCH-UHFFFAOYSA-N n'-tetradecylethane-1,2-diamine Chemical compound CCCCCCCCCCCCCCNCCN QIBKKTQVKFEWCH-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Chemical compound CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 125000006353 oxyethylene group Chemical group 0.000 description 1
- 125000005342 perphosphate group Chemical group 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 125000003703 phosphorus containing inorganic group Chemical group 0.000 description 1
- 229920000570 polyether Chemical group 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 239000001205 polyphosphate Substances 0.000 description 1
- 235000011176 polyphosphates Nutrition 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 235000013966 potassium salts of fatty acid Nutrition 0.000 description 1
- OTYBMLCTZGSZBG-UHFFFAOYSA-L potassium sulfate Chemical class [K+].[K+].[O-]S([O-])(=O)=O OTYBMLCTZGSZBG-UHFFFAOYSA-L 0.000 description 1
- 229910052939 potassium sulfate Inorganic materials 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 239000011347 resin Chemical class 0.000 description 1
- 229920005989 resin Chemical class 0.000 description 1
- 230000009919 sequestration Effects 0.000 description 1
- FQENQNTWSFEDLI-UHFFFAOYSA-J sodium diphosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])([O-])=O FQENQNTWSFEDLI-UHFFFAOYSA-J 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 235000013875 sodium salts of fatty acid Nutrition 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- SFVFIFLLYFPGHH-UHFFFAOYSA-M stearalkonium chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCCCC[N+](C)(C)CC1=CC=CC=C1 SFVFIFLLYFPGHH-UHFFFAOYSA-M 0.000 description 1
- 235000021286 stilbenes Nutrition 0.000 description 1
- 150000003900 succinic acid esters Chemical class 0.000 description 1
- 229940117986 sulfobetaine Drugs 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 235000019818 tetrasodium diphosphate Nutrition 0.000 description 1
- PJANXHGTPQOBST-VAWYXSNFSA-N trans-stilbene Chemical compound C=1C=CC=CC=1/C=C/C1=CC=CC=C1 PJANXHGTPQOBST-VAWYXSNFSA-N 0.000 description 1
- ILJSQTXMGCGYMG-UHFFFAOYSA-N triacetic acid Chemical compound CC(=O)CC(=O)CC(O)=O ILJSQTXMGCGYMG-UHFFFAOYSA-N 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
- 210000004885 white matter Anatomy 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/39—Organic or inorganic per-compounds
- C11D3/3902—Organic or inorganic per-compounds combined with specific additives
- C11D3/3937—Stabilising agents
- C11D3/394—Organic compounds
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/16—Organic compounds
- C11D3/37—Polymers
- C11D3/3746—Macromolecular compounds obtained by reactions only involving carbon-to-carbon unsaturated bonds
- C11D3/3757—(Co)polymerised carboxylic acids, -anhydrides, -esters in solid and liquid compositions
- C11D3/3761—(Co)polymerised carboxylic acids, -anhydrides, -esters in solid and liquid compositions in solid compositions
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/435,829 US4450089A (en) | 1982-10-21 | 1982-10-21 | Stabilized bleaching and laundering composition |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| SE8305765D0 SE8305765D0 (sv) | 1983-10-20 |
| SE8305765L SE8305765L (sv) | 1984-04-22 |
| SE461658B true SE461658B (sv) | 1990-03-12 |
Family
ID=23729993
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE8305765A SE461658B (sv) | 1982-10-21 | 1983-10-20 | Stabiliserad blekmedel- och tvaettmedelkomposition och dess anvaendning vid tvaettfoerfaranden |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US4450089A (OSRAM) |
| AU (1) | AU565445B2 (OSRAM) |
| BE (1) | BE898056A (OSRAM) |
| CA (1) | CA1217402A (OSRAM) |
| CH (1) | CH656144A5 (OSRAM) |
| DE (1) | DE3337719A1 (OSRAM) |
| DK (1) | DK159209C (OSRAM) |
| FR (1) | FR2534928B1 (OSRAM) |
| GB (1) | GB2129456B (OSRAM) |
| GR (1) | GR79411B (OSRAM) |
| HK (1) | HK28291A (OSRAM) |
| IT (1) | IT1169332B (OSRAM) |
| MX (1) | MX161291A (OSRAM) |
| NL (1) | NL8303639A (OSRAM) |
| NO (1) | NO162668C (OSRAM) |
| PT (1) | PT77511B (OSRAM) |
| SE (1) | SE461658B (OSRAM) |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4529534A (en) * | 1982-08-19 | 1985-07-16 | The Procter & Gamble Company | Peroxyacid bleach compositions |
| FR2545854B1 (fr) * | 1983-05-10 | 1985-07-26 | Ugine Kuhlmann | Procede de blanchiment des textiles en presence de particules de fer ou de metaux ferreux |
| DE3423452A1 (de) * | 1984-06-26 | 1986-01-02 | Sandoz-Patent-GmbH, 7850 Lörrach | Stabilisierende mischung zur peroxidbleiche zellulosehaltiger materialien |
| US5167854A (en) * | 1985-08-21 | 1992-12-01 | The Clorox Company | Encapsulated enzyme in dry bleach composition |
| US5093021A (en) * | 1985-08-21 | 1992-03-03 | The Clorox Company | Encapsulated enzyme in dry bleach composition |
| US5254287A (en) * | 1985-08-21 | 1993-10-19 | The Clorox Company | Encapsulated enzyme in dry bleach composition |
| US4863626A (en) * | 1985-08-21 | 1989-09-05 | The Clorox Company | Encapsulated enzyme in dry bleach composition |
| JPS62253697A (ja) * | 1986-04-02 | 1987-11-05 | 花王株式会社 | 漂白剤組成物 |
| US5112514A (en) * | 1986-11-06 | 1992-05-12 | The Clorox Company | Oxidant detergent containing stable bleach activator granules |
| US5002691A (en) * | 1986-11-06 | 1991-03-26 | The Clorox Company | Oxidant detergent containing stable bleach activator granules |
| US4963157A (en) * | 1987-04-17 | 1990-10-16 | Nippon Peroxide Co., Ltd. | Method for bleaching cellulosic fiber material with hydrogen peroxide |
| US4824592A (en) * | 1988-03-25 | 1989-04-25 | Lever Brothers Company | Suspending system for insoluble peroxy acid bleach |
| US4828747A (en) * | 1988-03-25 | 1989-05-09 | Lever Brothers Company | Suspending system for insoluble peroxy acid bleach |
| US5269962A (en) * | 1988-10-14 | 1993-12-14 | The Clorox Company | Oxidant composition containing stable bleach activator granules |
| US4988451A (en) * | 1989-06-14 | 1991-01-29 | Lever Brothers Company, Division Of Conopco, Inc. | Stabilization of particles containing quaternary ammonium bleach precursors |
| SE468014B (sv) * | 1991-08-16 | 1992-10-19 | Kommentus Ecogreen Ab | Foerfarande foer stabilisering av perkarbonat i pulverformiga tvaettmedel |
| CA2141586A1 (en) * | 1992-08-01 | 1994-02-17 | Anthony Dovey | Peroxyacid bleach precursor compositions |
| CA2141584C (en) * | 1992-12-22 | 2000-06-13 | Anthony Dovey | Coated peroxyacid bleach precursor compositions |
| US5968881A (en) * | 1995-02-02 | 1999-10-19 | The Procter & Gamble Company | Phosphate built automatic dishwashing compositions comprising catalysts |
| US5703034A (en) * | 1995-10-30 | 1997-12-30 | The Procter & Gamble Company | Bleach catalyst particles |
| US5699902A (en) * | 1996-04-03 | 1997-12-23 | Sperry; Laurence Burst | Foam in bag packaging system |
| US8034759B2 (en) * | 2008-10-31 | 2011-10-11 | Ecolab Usa Inc. | Enhanced stability peracid compositions |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3920570A (en) * | 1970-12-17 | 1975-11-18 | Solvay | Sequestration of metal ions by the use of poly-alpha-hydroxyacrylates |
| DE2136672B2 (de) * | 1971-07-22 | 1979-10-18 | Henkel Kgaa, 4000 Duesseldorf | Wasch- und Reinigungsmittel |
| DE2336108A1 (de) * | 1972-07-21 | 1974-01-31 | Interox | Oxydationsmittel mit komplexierenden eigenschaften und diese verbindungen enthaltende waschmittelzusammensetzungen |
| LU70411A1 (OSRAM) * | 1974-06-25 | 1976-04-13 | ||
| LU71985A1 (OSRAM) * | 1975-03-06 | 1977-01-28 | ||
| GB1573406A (en) * | 1975-12-18 | 1980-08-20 | Unilever Ltd | Bleaching detergent compositions |
| LU74434A1 (OSRAM) * | 1976-02-25 | 1977-09-12 | ||
| FR2424298A1 (fr) * | 1978-04-24 | 1979-11-23 | Solvay | Particules a base de polylactones derivees d'acides polyhydroxycarboxyliques et compositions pulverulentes contenant ces particules |
| FR2459203A1 (fr) * | 1979-06-21 | 1981-01-09 | Interox | Particules de composes peroxygenes stabilises, procede pour leur fabrication et composition en contenant |
| IE49996B1 (en) * | 1979-07-06 | 1986-01-22 | Unilever Ltd | Particulate bleach compositions |
-
1982
- 1982-10-21 US US06/435,829 patent/US4450089A/en not_active Expired - Fee Related
-
1983
- 1983-10-14 DK DK475983A patent/DK159209C/da not_active IP Right Cessation
- 1983-10-14 GR GR72707A patent/GR79411B/el unknown
- 1983-10-17 MX MX199133A patent/MX161291A/es unknown
- 1983-10-17 PT PT77511A patent/PT77511B/pt not_active IP Right Cessation
- 1983-10-18 DE DE19833337719 patent/DE3337719A1/de not_active Ceased
- 1983-10-18 GB GB08327831A patent/GB2129456B/en not_active Expired
- 1983-10-18 AU AU20266/83A patent/AU565445B2/en not_active Ceased
- 1983-10-20 IT IT49188/83A patent/IT1169332B/it active
- 1983-10-20 CA CA000439354A patent/CA1217402A/en not_active Expired
- 1983-10-20 NO NO833823A patent/NO162668C/no unknown
- 1983-10-20 SE SE8305765A patent/SE461658B/sv not_active IP Right Cessation
- 1983-10-20 FR FR8316720A patent/FR2534928B1/fr not_active Expired
- 1983-10-21 BE BE0/211753A patent/BE898056A/fr not_active IP Right Cessation
- 1983-10-21 CH CH5737/83A patent/CH656144A5/de not_active IP Right Cessation
- 1983-10-21 NL NL8303639A patent/NL8303639A/nl not_active Application Discontinuation
-
1991
- 1991-04-11 HK HK282/91A patent/HK28291A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CH656144A5 (de) | 1986-06-13 |
| GB2129456A (en) | 1984-05-16 |
| NO833823L (no) | 1984-04-24 |
| GB2129456B (en) | 1986-04-03 |
| CA1217402A (en) | 1987-02-03 |
| DE3337719A1 (de) | 1984-04-26 |
| DK159209C (da) | 1991-02-25 |
| GB8327831D0 (en) | 1983-11-16 |
| HK28291A (en) | 1991-04-19 |
| FR2534928B1 (fr) | 1986-11-14 |
| NO162668B (no) | 1989-10-23 |
| PT77511A (en) | 1983-11-01 |
| PT77511B (en) | 1986-03-25 |
| NO162668C (no) | 1990-01-31 |
| IT1169332B (it) | 1987-05-27 |
| SE8305765L (sv) | 1984-04-22 |
| FR2534928A1 (fr) | 1984-04-27 |
| MX161291A (es) | 1990-08-28 |
| DK475983D0 (da) | 1983-10-14 |
| GR79411B (OSRAM) | 1984-10-22 |
| AU2026683A (en) | 1984-05-03 |
| DK475983A (da) | 1984-04-22 |
| NL8303639A (nl) | 1984-05-16 |
| BE898056A (fr) | 1984-04-24 |
| US4450089A (en) | 1984-05-22 |
| IT8349188A0 (it) | 1983-10-20 |
| DK159209B (da) | 1990-09-17 |
| SE8305765D0 (sv) | 1983-10-20 |
| AU565445B2 (en) | 1987-09-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE461658B (sv) | Stabiliserad blekmedel- och tvaettmedelkomposition och dess anvaendning vid tvaettfoerfaranden | |
| US4086175A (en) | Activated bleaching process and compositions therefor | |
| JPS61111400A (ja) | 漂白剤組成物 | |
| US4378300A (en) | Peroxygen bleaching composition | |
| US4448705A (en) | Monoperoxyphthalic acid bleaching composition containing DTPMP | |
| JPH0317197A (ja) | 漂白活性化及び漂白組成物 | |
| CA1105658A (en) | Activated bleaching process and compositions therefor | |
| US4443352A (en) | Silicate-free bleaching and laundering composition | |
| US3850832A (en) | Washing, rinsing and cleansing agent compositions containing furan-maleic anhydride copolymer sequestering agents | |
| SE459500B (sv) | Partikelformig tvaettmedelskomposition vilken innehaaller en peroxisyrafoerening som blekmedel och en hydroxikarboxylpolymer som blekmedelsstabilisator och kompositionens anvaendning vid blekning | |
| US4110242A (en) | Compositions and method for activating oxygen utilizing N-acylated uracils and benzouracils | |
| US4430244A (en) | Silicate-free bleaching and laundering composition | |
| US3630921A (en) | Scouring agents with a bleaching and disinfecting action | |
| US4115309A (en) | Compositions and method for activating oxygen utilizing cyclic ester-anhydrides of α-hydroxycarboxylic acids | |
| CA1207956A (en) | Peroxyacid bleaching and laundering composition | |
| US4664837A (en) | Bleaching and laundering composition containing magnesium monoperoxyphthalate a chelating agent, a peroxygen compound and phthalic anhydride | |
| JPS5922999A (ja) | 漂白組成物 | |
| SE455792B (sv) | Blekande detergentkomposition innehallande monoperoxiftalsyra, ett chelaterande emne, en peroxiforening och en aktivator for nemnda peroxiforening samt anvendning av kompositionen vid tvettforfarande | |
| NO161444B (no) | Blekende vaskemiddelblanding. | |
| US4164394A (en) | Peroxygen bleaching and compositions therefor | |
| SE459973B (sv) | Blekmedel- och tvaettmedelskomposition och dess anvaendning vid tvaettfoerfarande | |
| CA1307991C (en) | Granulated magnesium monoperoxyphthalate coated with fatty acid | |
| SE460054B (sv) | Blekande tvaettmedelkomposition fri fraan vattenloesliga silikater och dess anvaendning vid blekning |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NAL | Patent in force |
Ref document number: 8305765-3 Format of ref document f/p: F |
|
| NUG | Patent has lapsed |
Ref document number: 8305765-3 Format of ref document f/p: F |