SE441927B - Forfarande for framstellning av substituerade 6-aryl-4h-s-triazolo-/3,4-c/tieno/2,3-e/-1,4-diazepiner - Google Patents
Forfarande for framstellning av substituerade 6-aryl-4h-s-triazolo-/3,4-c/tieno/2,3-e/-1,4-diazepinerInfo
- Publication number
- SE441927B SE441927B SE8007021A SE8007021A SE441927B SE 441927 B SE441927 B SE 441927B SE 8007021 A SE8007021 A SE 8007021A SE 8007021 A SE8007021 A SE 8007021A SE 441927 B SE441927 B SE 441927B
- Authority
- SE
- Sweden
- Prior art keywords
- carbon atoms
- general formula
- process according
- triazolo
- hydrogen
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 17
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 claims description 12
- 125000004432 carbon atom Chemical group C* 0.000 claims description 11
- 150000001875 compounds Chemical class 0.000 claims description 9
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 claims description 8
- 239000002253 acid Substances 0.000 claims description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- 239000001257 hydrogen Substances 0.000 claims description 8
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 claims description 8
- -1 hydroxylamine compound Chemical class 0.000 claims description 7
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- 238000006243 chemical reaction Methods 0.000 claims description 5
- 239000003795 chemical substances by application Substances 0.000 claims description 5
- 239000012467 final product Substances 0.000 claims description 5
- 150000003839 salts Chemical class 0.000 claims description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 4
- 150000001204 N-oxides Chemical class 0.000 claims description 4
- 125000002947 alkylene group Chemical group 0.000 claims description 4
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 claims description 4
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 239000012024 dehydrating agents Substances 0.000 claims description 3
- 150000002431 hydrogen Chemical class 0.000 claims description 3
- 229910000474 mercury oxide Inorganic materials 0.000 claims description 3
- UKWHYYKOEPRTIC-UHFFFAOYSA-N mercury(ii) oxide Chemical compound [Hg]=O UKWHYYKOEPRTIC-UHFFFAOYSA-N 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 claims description 3
- 239000012286 potassium permanganate Substances 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- 239000011593 sulfur Substances 0.000 claims description 3
- UCZBMKTXCFBYEX-UHFFFAOYSA-N 1-propoxysulfanyloxypropane Chemical compound CCCOSOCCC UCZBMKTXCFBYEX-UHFFFAOYSA-N 0.000 claims description 2
- VDVUCLWJZJHFAV-UHFFFAOYSA-N 2,2,6,6-tetramethylpiperidin-4-ol Chemical compound CC1(C)CC(O)CC(C)(C)N1 VDVUCLWJZJHFAV-UHFFFAOYSA-N 0.000 claims description 2
- DVAZKUDTZUIOQK-UHFFFAOYSA-M 2-bromo-1-methylpyridin-1-ium;iodide Chemical compound [I-].C[N+]1=CC=CC=C1Br DVAZKUDTZUIOQK-UHFFFAOYSA-M 0.000 claims description 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 239000003638 chemical reducing agent Substances 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 125000005842 heteroatom Chemical group 0.000 claims description 2
- 229910052742 iron Inorganic materials 0.000 claims description 2
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- XRKQMIFKHDXFNQ-UHFFFAOYSA-N n-cyclohexyl-n-ethylcyclohexanamine Chemical compound C1CCCCC1N(CC)C1CCCCC1 XRKQMIFKHDXFNQ-UHFFFAOYSA-N 0.000 claims description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 2
- 239000007800 oxidant agent Substances 0.000 claims description 2
- 230000001590 oxidative effect Effects 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 229920006395 saturated elastomer Polymers 0.000 claims description 2
- BDZBKCUKTQZUTL-UHFFFAOYSA-N triethyl phosphite Chemical compound CCOP(OCC)OCC BDZBKCUKTQZUTL-UHFFFAOYSA-N 0.000 claims description 2
- GKZAMLSMSFBJRN-UHFFFAOYSA-M [I-].Cl[N+]1=CC=CC=C1 Chemical compound [I-].Cl[N+]1=CC=CC=C1 GKZAMLSMSFBJRN-UHFFFAOYSA-M 0.000 claims 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 claims 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims 1
- 125000004430 oxygen atom Chemical group O* 0.000 claims 1
- 239000005871 repellent Substances 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 27
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 12
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 8
- 238000002844 melting Methods 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 4
- 229910021529 ammonia Inorganic materials 0.000 description 4
- 239000012074 organic phase Substances 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- JZSPZFJNZKNYTR-UHFFFAOYSA-N C[S+]1C(N(C2)C(C(C(C=CC=C3)=C3Cl)N(C3)O)=NN2Br)=C3C=C1 Chemical compound C[S+]1C(N(C2)C(C(C(C=CC=C3)=C3Cl)N(C3)O)=NN2Br)=C3C=C1 JZSPZFJNZKNYTR-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000003776 cleavage reaction Methods 0.000 description 3
- 239000000470 constituent Substances 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 230000007017 scission Effects 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- UMSGKTJDUHERQW-UHFFFAOYSA-N Brotizolam Chemical compound C1=2C=C(Br)SC=2N2C(C)=NN=C2CN=C1C1=CC=CC=C1Cl UMSGKTJDUHERQW-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 101100298295 Drosophila melanogaster flfl gene Proteins 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 230000007613 environmental effect Effects 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- ZZODLYKNUUKPLE-MHJFOBGBSA-N (2S)-2-amino-1-(2-diphenoxyphosphorylpyrrolidin-1-yl)-2-(1,3-thiazolidin-4-yl)ethanone Chemical compound C1([C@H](N)C(=O)N2C(CCC2)P(=O)(OC=2C=CC=CC=2)OC=2C=CC=CC=2)CSCN1 ZZODLYKNUUKPLE-MHJFOBGBSA-N 0.000 description 1
- SGUVLZREKBPKCE-UHFFFAOYSA-N 1,5-diazabicyclo[4.3.0]-non-5-ene Chemical compound C1CCN=C2CCCN21 SGUVLZREKBPKCE-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- 125000002853 C1-C4 hydroxyalkyl group Chemical group 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 239000004133 Sodium thiosulphate Substances 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 230000002539 anti-aggressive effect Effects 0.000 description 1
- 230000001773 anti-convulsant effect Effects 0.000 description 1
- 239000001961 anticonvulsive agent Substances 0.000 description 1
- 229960003965 antiepileptics Drugs 0.000 description 1
- 239000002249 anxiolytic agent Substances 0.000 description 1
- 230000000949 anxiolytic effect Effects 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- HCAJEUSONLESMK-UHFFFAOYSA-N cyclohexylsulfamic acid Chemical compound OS(=O)(=O)NC1CCCCC1 HCAJEUSONLESMK-UHFFFAOYSA-N 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- SFJGCXYXEFWEBK-UHFFFAOYSA-N oxazepine Chemical group O1C=CC=CC=N1 SFJGCXYXEFWEBK-UHFFFAOYSA-N 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000012958 reprocessing Methods 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 239000000932 sedative agent Substances 0.000 description 1
- 230000001624 sedative effect Effects 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D495/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having sulfur atoms as the only ring hetero atoms
- C07D495/12—Heterocyclic compounds containing in the condensed system at least one hetero ring having sulfur atoms as the only ring hetero atoms in which the condensed system contains three hetero rings
- C07D495/14—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C04—CEMENTS; CONCRETE; ARTIFICIAL STONE; CERAMICS; REFRACTORIES
- C04B—LIME, MAGNESIA; SLAG; CEMENTS; COMPOSITIONS THEREOF, e.g. MORTARS, CONCRETE OR LIKE BUILDING MATERIALS; ARTIFICIAL STONE; CERAMICS; REFRACTORIES; TREATMENT OF NATURAL STONE
- C04B35/00—Shaped ceramic products characterised by their composition; Ceramics compositions; Processing powders of inorganic compounds preparatory to the manufacturing of ceramic products
- C04B35/71—Ceramic products containing macroscopic reinforcing agents
- C04B35/78—Ceramic products containing macroscopic reinforcing agents containing non-metallic materials
- C04B35/80—Fibres, filaments, whiskers, platelets, or the like
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Ceramic Engineering (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Manufacturing & Machinery (AREA)
- Materials Engineering (AREA)
- Structural Engineering (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19792940737 DE2940737A1 (de) | 1979-10-08 | 1979-10-08 | Verfahren zur herstellung von substituierten 6-aryl- 4h-s-triazolo-(3,4-c)-thieno-(2,3-e)-1,4-diazepinen |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE8007021L SE8007021L (sv) | 1981-04-09 |
| SE441927B true SE441927B (sv) | 1985-11-18 |
Family
ID=6082971
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE8007021A SE441927B (sv) | 1979-10-08 | 1980-10-07 | Forfarande for framstellning av substituerade 6-aryl-4h-s-triazolo-/3,4-c/tieno/2,3-e/-1,4-diazepiner |
Country Status (18)
| Country | Link |
|---|---|
| JP (1) | JPS5661383A (enExample) |
| AT (1) | AT371820B (enExample) |
| CH (1) | CH645114A5 (enExample) |
| CS (1) | CS215141B2 (enExample) |
| DD (1) | DD153373A5 (enExample) |
| DE (1) | DE2940737A1 (enExample) |
| DK (1) | DK154505C (enExample) |
| ES (2) | ES495689A0 (enExample) |
| FI (1) | FI68837C (enExample) |
| GR (1) | GR70773B (enExample) |
| HU (1) | HU181744B (enExample) |
| LU (1) | LU82825A1 (enExample) |
| NO (1) | NO156652C (enExample) |
| PL (1) | PL125636B1 (enExample) |
| PT (1) | PT71884B (enExample) |
| SE (1) | SE441927B (enExample) |
| SU (1) | SU1056904A3 (enExample) |
| YU (1) | YU257180A (enExample) |
-
1979
- 1979-10-08 DE DE19792940737 patent/DE2940737A1/de active Granted
-
1980
- 1980-09-24 AT AT0475780A patent/AT371820B/de not_active IP Right Cessation
- 1980-10-03 SU SU802992903A patent/SU1056904A3/ru active
- 1980-10-03 GR GR63045A patent/GR70773B/el unknown
- 1980-10-06 FI FI803161A patent/FI68837C/fi not_active IP Right Cessation
- 1980-10-06 PL PL1980227128A patent/PL125636B1/pl unknown
- 1980-10-06 DD DD80224375A patent/DD153373A5/de unknown
- 1980-10-06 HU HU802432A patent/HU181744B/hu not_active IP Right Cessation
- 1980-10-06 CH CH745180A patent/CH645114A5/de not_active IP Right Cessation
- 1980-10-06 CS CS806739A patent/CS215141B2/cs unknown
- 1980-10-06 LU LU82825A patent/LU82825A1/de unknown
- 1980-10-07 SE SE8007021A patent/SE441927B/sv not_active IP Right Cessation
- 1980-10-07 JP JP13942480A patent/JPS5661383A/ja active Granted
- 1980-10-07 ES ES495689A patent/ES495689A0/es active Granted
- 1980-10-07 YU YU02571/80A patent/YU257180A/xx unknown
- 1980-10-07 PT PT71884A patent/PT71884B/pt not_active IP Right Cessation
- 1980-10-07 DK DK423280A patent/DK154505C/da not_active IP Right Cessation
- 1980-10-07 NO NO802987A patent/NO156652C/no unknown
-
1981
- 1981-07-01 ES ES503584A patent/ES503584A0/es active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| PT71884B (de) | 1982-06-15 |
| ES8205807A1 (es) | 1982-06-16 |
| ES8200892A1 (es) | 1981-11-16 |
| SU1056904A3 (ru) | 1983-11-23 |
| PT71884A (de) | 1980-11-01 |
| YU257180A (en) | 1983-02-28 |
| NO156652C (no) | 1987-10-28 |
| DE2940737C2 (enExample) | 1988-12-15 |
| GR70773B (enExample) | 1983-03-22 |
| FI803161L (fi) | 1981-04-09 |
| JPH0219118B2 (enExample) | 1990-04-27 |
| CH645114A5 (en) | 1984-09-14 |
| ES495689A0 (es) | 1981-11-16 |
| LU82825A1 (de) | 1981-12-02 |
| FI68837C (fi) | 1985-11-11 |
| DD153373A5 (de) | 1982-01-06 |
| FI68837B (fi) | 1985-07-31 |
| JPS5661383A (en) | 1981-05-26 |
| NO156652B (no) | 1987-07-20 |
| PL227128A1 (enExample) | 1981-06-05 |
| DK423280A (da) | 1981-04-09 |
| AT371820B (de) | 1983-08-10 |
| SE8007021L (sv) | 1981-04-09 |
| NO802987L (no) | 1981-04-09 |
| DE2940737A1 (de) | 1981-04-16 |
| DK154505B (da) | 1988-11-21 |
| HU181744B (en) | 1983-11-28 |
| ES503584A0 (es) | 1982-06-16 |
| ATA475780A (de) | 1982-12-15 |
| DK154505C (da) | 1989-04-17 |
| PL125636B1 (en) | 1983-06-30 |
| CS215141B2 (en) | 1982-07-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE441927B (sv) | Forfarande for framstellning av substituerade 6-aryl-4h-s-triazolo-/3,4-c/tieno/2,3-e/-1,4-diazepiner | |
| FI71738C (fi) | Foerfarande foer framstaellning av 5,6,7, 7a-tetrahydro-4h-tien(3,2-c)pyridin-2-onderivat. | |
| NO140860B (no) | Analogifremgangsmaate for fremstilling av fysiologisk aktive triazolo-1,5-benzodiazepiner | |
| DE2254701C3 (de) | Verfahren zur Herstellung von in 2- und 5-Stellung substituierten Thiazolinen-(3) | |
| KR880007539A (ko) | 축합된 디아제피논, 이의 제조방법 및 이들 화합물을 함유하는 약제학적 조성물 | |
| US3812189A (en) | N-(2,2-diloweralkoxyalkyl)-2,2-dilower-alkoxyloweralkanamidines and their acid addition salts | |
| DE1620703B2 (de) | 11-basisch substituierte dibenzo eckige klammer auf b,f eckige klammer zu-eckige klammer auf 1,4 eckige klammer zu-thiazepine | |
| Moore et al. | Heterocyclic Studies. XII. The Base-Catalyzed Deuterium Exchange and Rearrangement of 2, 3-Dihydro-5-methyl-6-phenyl-4H-1, 2-diazepin-4-one to α-Aminopyridines1, 2 | |
| IT8223888A1 (it) | Derivati del 4-idrossi-2-metil-2h-1,2-benzotiazina-3-carbossamide1,1-biossido e procedimento per la loro preparazione | |
| US3293254A (en) | 2', 3', 4', 9'-tetrahydro-6'-alkoxy spiro | |
| EP0820454B1 (de) | Anellierte beta-carboline | |
| KR101079018B1 (ko) | 방향족 화합물의 단일-질화 | |
| DE1620703C3 (de) | 11-Basisch substituierte Dibenzo [b,f]-[l,4]thiazepine | |
| Barlow et al. | Epimeric forms of quaternary derivatives of atropine | |
| CH450426A (de) | Verfahren zur Herstellung 11-basisch substituierter Dibenz(b,f)(1,4)oxazepine | |
| Artemov et al. | Synthesis of 2, 7-naphthyridines by the recyclization of trimethylformyl-piperidone | |
| Aryuzina et al. | Synthesis of substituted imidazo [5, 1-b] benzimidazoles: II. 3, 4-dimethyl-and 1, 3, 4-trimethylimidazo [5, 1-b] benzimidazoles | |
| Grigor'eva et al. | Reaction of 1, 2-hydroxylaminooximes with 1, 2-diketones. Conversion of 2-acyl-1-hydroxy-3-imidazoline 3-oxides to pyrazine 1, 4-dioxides | |
| AT251588B (de) | Verfahren zur Herstellung von Chinazolin-Derivaten | |
| DE2856792A1 (de) | 1,2,3,4-tetrahydopydropyrido eckige klammer auf 4',3' zu 4,5 eckige klammer zu thiazolo eckige klammer auf 3,2-a eckige klammer zu benzimidazol-verbindungen | |
| DE2836085A1 (de) | Sulfamoylbenzolderivate und verfahren zu ihrer herstellung | |
| Bauman | Quaternary ammonium salts and betaines of thionocarbamic esters | |
| DE1470427B2 (de) | Substituierte 6-Piperazino-morphanthridine | |
| DE2531678A1 (de) | Neue thieno- eckige klammer auf 2,3-e eckige klammer zu -triazolo- eckige klammer auf 3,4-c eckige klammer zu -5,6-dihydro-1,4-diazepine und verfahren zu ihrer herstellung | |
| Levkovskaya et al. | Nitrogen and sulfur heterocycles. 45. Dual reactivity of 1, 2-dioxo-3a-alkyl-7-chloroimidazolidino [3, 2-f]-pyrido [2, 3-b]-1, 4-thiazines |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NAL | Patent in force |
Ref document number: 8007021-2 Format of ref document f/p: F |
|
| NUG | Patent has lapsed |
Ref document number: 8007021-2 Format of ref document f/p: F |